Difference between revisions of "Team:NCTU Formosa/jquery"

(Created page with " /*! * jQuery JavaScript Library v3.4.1 * https://jquery.com/ * * Includes Sizzle.js * https://sizzlejs.com/ * * Copyright JS Foundation...")
 
(No difference)

Latest revision as of 10:21, 21 October 2019

   /*!
    * jQuery JavaScript Library v3.4.1
    * https://jquery.com/
    *
    * Includes Sizzle.js
    * https://sizzlejs.com/
    *
    * Copyright JS Foundation and other contributors
    * Released under the MIT license
    * https://jquery.org/license
    *
    * Date: 2019-05-01T21:04Z
    */
   (function (global, factory) {
       "use strict";
       if (typeof module === "object" && typeof module.exports === "object") {
           // For CommonJS and CommonJS-like environments where a proper `window`
           // is present, execute the factory and get jQuery.
           // For environments that do not have a `window` with a `document`
           // (such as Node.js), expose a factory as module.exports.
           // This accentuates the need for the creation of a real `window`.
           // e.g. var jQuery = require("jquery")(window);
           // See ticket #14549 for more info.
           module.exports = global.document ?
               factory(global, true) :
               function (w) {
                   if (!w.document) {
                       throw new Error("jQuery requires a window with a document");
                   }
                   return factory(w);
               };
       } else {
           factory(global);
       }
       // Pass this if window is not defined yet
   })(typeof window !== "undefined" ? window : this, function (window, noGlobal) {
       // Edge <= 12 - 13+, Firefox <=18 - 45+, IE 10 - 11, Safari 5.1 - 9+, iOS 6 - 9.1
       // throw exceptions when non-strict code (e.g., ASP.NET 4.5) accesses strict mode
       // arguments.callee.caller (trac-13335). But as of jQuery 3.0 (2016), strict mode should be common
       // enough that all such attempts are guarded in a try block.
       "use strict";
       var arr = [];
       var document = window.document;
       var getProto = Object.getPrototypeOf;
       var slice = arr.slice;
       var concat = arr.concat;
       var push = arr.push;
       var indexOf = arr.indexOf;
       var class2type = {};
       var toString = class2type.toString;
       var hasOwn = class2type.hasOwnProperty;
       var fnToString = hasOwn.toString;
       var ObjectFunctionString = fnToString.call(Object);
       var support = {};
       var isFunction = function isFunction(obj) {
           // Support: Chrome <=57, Firefox <=52
           // In some browsers, typeof returns "function" for HTML <object> elements
           // (i.e., `typeof document.createElement( "object" ) === "function"`).
           // We don't want to classify *any* DOM node as a function.
           return typeof obj === "function" && typeof obj.nodeType !== "number";
       };


       var isWindow = function isWindow(obj) {
           return obj != null && obj === obj.window;
       };



       var preservedScriptAttributes = {
           type: true,
           src: true,
           nonce: true,
           noModule: true
       };
       function DOMEval(code, node, doc) {
           doc = doc || document;
           var i, val,
               script = doc.createElement("script");
           script.text = code;
           if (node) {
               for (i in preservedScriptAttributes) {
                   // Support: Firefox 64+, Edge 18+
                   // Some browsers don't support the "nonce" property on scripts.
                   // On the other hand, just using `getAttribute` is not enough as
                   // the `nonce` attribute is reset to an empty string whenever it
                   // becomes browsing-context connected.
                   // See https://github.com/whatwg/html/issues/2369
                   // See https://html.spec.whatwg.org/#nonce-attributes
                   // The `node.getAttribute` check was added for the sake of
                   // `jQuery.globalEval` so that it can fake a nonce-containing node
                   // via an object.
                   val = node[i] || node.getAttribute && node.getAttribute(i);
                   if (val) {
                       script.setAttribute(i, val);
                   }
               }
           }
           doc.head.appendChild(script).parentNode.removeChild(script);
       }


       function toType(obj) {
           if (obj == null) {
               return obj + "";
           }
           // Support: Android <=2.3 only (functionish RegExp)
           return typeof obj === "object" || typeof obj === "function" ?
               class2type[toString.call(obj)] || "object" :
               typeof obj;
       }
       /* global Symbol */
       // Defining this global in .eslintrc.json would create a danger of using the global
       // unguarded in another place, it seems safer to define global only for this module


       var
           version = "3.4.1",
           // Define a local copy of jQuery
           jQuery = function (selector, context) {
               // The jQuery object is actually just the init constructor 'enhanced'
               // Need init if jQuery is called (just allow error to be thrown if not included)
               return new jQuery.fn.init(selector, context);
           },
           // Support: Android <=4.0 only
           // Make sure we trim BOM and NBSP
           rtrim = /^[\s\uFEFF\xA0]+|[\s\uFEFF\xA0]+$/g;
       jQuery.fn = jQuery.prototype = {
           // The current version of jQuery being used
           jquery: version,
           constructor: jQuery,
           // The default length of a jQuery object is 0
           length: 0,
           toArray: function () {
               return slice.call(this);
           },
           // Get the Nth element in the matched element set OR
           // Get the whole matched element set as a clean array
           get: function (num) {
               // Return all the elements in a clean array
               if (num == null) {
                   return slice.call(this);
               }
               // Return just the one element from the set
               return num < 0 ? this[num + this.length] : this[num];
           },
           // Take an array of elements and push it onto the stack
           // (returning the new matched element set)
           pushStack: function (elems) {
               // Build a new jQuery matched element set
               var ret = jQuery.merge(this.constructor(), elems);
               // Add the old object onto the stack (as a reference)
               ret.prevObject = this;
               // Return the newly-formed element set
               return ret;
           },
           // Execute a callback for every element in the matched set.
           each: function (callback) {
               return jQuery.each(this, callback);
           },
           map: function (callback) {
               return this.pushStack(jQuery.map(this, function (elem, i) {
                   return callback.call(elem, i, elem);
               }));
           },
           slice: function () {
               return this.pushStack(slice.apply(this, arguments));
           },
           first: function () {
               return this.eq(0);
           },
           last: function () {
               return this.eq(-1);
           },
           eq: function (i) {
               var len = this.length,
                   j = +i + (i < 0 ? len : 0);
               return this.pushStack(j >= 0 && j < len ? [this[j]] : []);
           },
           end: function () {
               return this.prevObject || this.constructor();
           },
           // For internal use only.
           // Behaves like an Array's method, not like a jQuery method.
           push: push,
           sort: arr.sort,
           splice: arr.splice
       };
       jQuery.extend = jQuery.fn.extend = function () {
           var options, name, src, copy, copyIsArray, clone,
               target = arguments[0] || {},
               i = 1,
               length = arguments.length,
               deep = false;
           // Handle a deep copy situation
           if (typeof target === "boolean") {
               deep = target;
               // Skip the boolean and the target
               target = arguments[i] || {};
               i++;
           }
           // Handle case when target is a string or something (possible in deep copy)
           if (typeof target !== "object" && !isFunction(target)) {
               target = {};
           }
           // Extend jQuery itself if only one argument is passed
           if (i === length) {
               target = this;
               i--;
           }
           for (; i < length; i++) {
               // Only deal with non-null/undefined values
               if ((options = arguments[i]) != null) {
                   // Extend the base object
                   for (name in options) {
                       copy = options[name];
                       // Prevent Object.prototype pollution
                       // Prevent never-ending loop
                       if (name === "__proto__" || target === copy) {
                           continue;
                       }
                       // Recurse if we're merging plain objects or arrays
                       if (deep && copy && (jQuery.isPlainObject(copy) ||
                               (copyIsArray = Array.isArray(copy)))) {
                           src = target[name];
                           // Ensure proper type for the source value
                           if (copyIsArray && !Array.isArray(src)) {
                               clone = [];
                           } else if (!copyIsArray && !jQuery.isPlainObject(src)) {
                               clone = {};
                           } else {
                               clone = src;
                           }
                           copyIsArray = false;
                           // Never move original objects, clone them
                           target[name] = jQuery.extend(deep, clone, copy);
                           // Don't bring in undefined values
                       } else if (copy !== undefined) {
                           target[name] = copy;
                       }
                   }
               }
           }
           // Return the modified object
           return target;
       };
       jQuery.extend({
           // Unique for each copy of jQuery on the page
           expando: "jQuery" + (version + Math.random()).replace(/\D/g, ""),
           // Assume jQuery is ready without the ready module
           isReady: true,
           error: function (msg) {
               throw new Error(msg);
           },
           noop: function () {},
           isPlainObject: function (obj) {
               var proto, Ctor;
               // Detect obvious negatives
               // Use toString instead of jQuery.type to catch host objects
               if (!obj || toString.call(obj) !== "[object Object]") {
                   return false;
               }
               proto = getProto(obj);
               // Objects with no prototype (e.g., `Object.create( null )`) are plain
               if (!proto) {
                   return true;
               }
               // Objects with prototype are plain iff they were constructed by a global Object function
               Ctor = hasOwn.call(proto, "constructor") && proto.constructor;
               return typeof Ctor === "function" && fnToString.call(Ctor) === ObjectFunctionString;
           },
           isEmptyObject: function (obj) {
               var name;
               for (name in obj) {
                   return false;
               }
               return true;
           },
           // Evaluates a script in a global context
           globalEval: function (code, options) {
               DOMEval(code, {
                   nonce: options && options.nonce
               });
           },
           each: function (obj, callback) {
               var length, i = 0;
               if (isArrayLike(obj)) {
                   length = obj.length;
                   for (; i < length; i++) {
                       if (callback.call(obj[i], i, obj[i]) === false) {
                           break;
                       }
                   }
               } else {
                   for (i in obj) {
                       if (callback.call(obj[i], i, obj[i]) === false) {
                           break;
                       }
                   }
               }
               return obj;
           },
           // Support: Android <=4.0 only
           trim: function (text) {
               return text == null ?
                   "" :
                   (text + "").replace(rtrim, "");
           },
           // results is for internal usage only
           makeArray: function (arr, results) {
               var ret = results || [];
               if (arr != null) {
                   if (isArrayLike(Object(arr))) {
                       jQuery.merge(ret,
                           typeof arr === "string" ? [arr] : arr
                       );
                   } else {
                       push.call(ret, arr);
                   }
               }
               return ret;
           },
           inArray: function (elem, arr, i) {
               return arr == null ? -1 : indexOf.call(arr, elem, i);
           },
           // Support: Android <=4.0 only, PhantomJS 1 only
           // push.apply(_, arraylike) throws on ancient WebKit
           merge: function (first, second) {
               var len = +second.length,
                   j = 0,
                   i = first.length;
               for (; j < len; j++) {
                   first[i++] = second[j];
               }
               first.length = i;
               return first;
           },
           grep: function (elems, callback, invert) {
               var callbackInverse,
                   matches = [],
                   i = 0,
                   length = elems.length,
                   callbackExpect = !invert;
               // Go through the array, only saving the items
               // that pass the validator function
               for (; i < length; i++) {
                   callbackInverse = !callback(elems[i], i);
                   if (callbackInverse !== callbackExpect) {
                       matches.push(elems[i]);
                   }
               }
               return matches;
           },
           // arg is for internal usage only
           map: function (elems, callback, arg) {
               var length, value,
                   i = 0,
                   ret = [];
               // Go through the array, translating each of the items to their new values
               if (isArrayLike(elems)) {
                   length = elems.length;
                   for (; i < length; i++) {
                       value = callback(elems[i], i, arg);
                       if (value != null) {
                           ret.push(value);
                       }
                   }
                   // Go through every key on the object,
               } else {
                   for (i in elems) {
                       value = callback(elems[i], i, arg);
                       if (value != null) {
                           ret.push(value);
                       }
                   }
               }
               // Flatten any nested arrays
               return concat.apply([], ret);
           },
           // A global GUID counter for objects
           guid: 1,
           // jQuery.support is not used in Core but other projects attach their
           // properties to it so it needs to exist.
           support: support
       });
       if (typeof Symbol === "function") {
           jQuery.fn[Symbol.iterator] = arr[Symbol.iterator];
       }
       // Populate the class2type map
       jQuery.each("Boolean Number String Function Array Date RegExp Object Error Symbol".split(" "),
           function (i, name) {
               class2type["[object " + name + "]"] = name.toLowerCase();
           });
       function isArrayLike(obj) {
           // Support: real iOS 8.2 only (not reproducible in simulator)
           // `in` check used to prevent JIT error (gh-2145)
           // hasOwn isn't used here due to false negatives
           // regarding Nodelist length in IE
           var length = !!obj && "length" in obj && obj.length,
               type = toType(obj);
           if (isFunction(obj) || isWindow(obj)) {
               return false;
           }
           return type === "array" || length === 0 ||
               typeof length === "number" && length > 0 && (length - 1) in obj;
       }
       var Sizzle =
           /*!
            * Sizzle CSS Selector Engine v2.3.4
            * https://sizzlejs.com/
            *
            * Copyright JS Foundation and other contributors
            * Released under the MIT license
            * https://js.foundation/
            *
            * Date: 2019-04-08
            */
           (function (window) {
               var i,
                   support,
                   Expr,
                   getText,
                   isXML,
                   tokenize,
                   compile,
                   select,
                   outermostContext,
                   sortInput,
                   hasDuplicate,
                   // Local document vars
                   setDocument,
                   document,
                   docElem,
                   documentIsHTML,
                   rbuggyQSA,
                   rbuggyMatches,
                   matches,
                   contains,
                   // Instance-specific data
                   expando = "sizzle" + 1 * new Date(),
                   preferredDoc = window.document,
                   dirruns = 0,
                   done = 0,
                   classCache = createCache(),
                   tokenCache = createCache(),
                   compilerCache = createCache(),
                   nonnativeSelectorCache = createCache(),
                   sortOrder = function (a, b) {
                       if (a === b) {
                           hasDuplicate = true;
                       }
                       return 0;
                   },
                   // Instance methods
                   hasOwn = ({}).hasOwnProperty,
                   arr = [],
                   pop = arr.pop,
                   push_native = arr.push,
                   push = arr.push,
                   slice = arr.slice,
                   // Use a stripped-down indexOf as it's faster than native
                   // https://jsperf.com/thor-indexof-vs-for/5
                   indexOf = function (list, elem) {
                       var i = 0,
                           len = list.length;
                       for (; i < len; i++) {
                           if (list[i] === elem) {
                               return i;
                           }
                       }
                       return -1;
                   },
                   booleans =
                   "checked|selected|async|autofocus|autoplay|controls|defer|disabled|hidden|ismap|loop|multiple|open|readonly|required|scoped",
                   // Regular expressions
                   // http://www.w3.org/TR/css3-selectors/#whitespace
                   whitespace = "[\\x20\\t\\r\\n\\f]",
                   // http://www.w3.org/TR/CSS21/syndata.html#value-def-identifier
                   identifier = "(?:\\\\.|[\\w-]|[^\0-\\xa0])+",
                   // Attribute selectors: http://www.w3.org/TR/selectors/#attribute-selectors
                   attributes = "\\[" + whitespace + "*(" + identifier + ")(?:" + whitespace +
                   // Operator (capture 2)
                   "*([*^$|!~]?=)" + whitespace +
                   // "Attribute values must be CSS identifiers [capture 5] or strings [capture 3 or capture 4]"
                   "*(?:'((?:\\\\.|[^\\\\'])*)'|\"((?:\\\\.|[^\\\\\"])*)\"|(" + identifier + "))|)" +
                   whitespace +
                   "*\\]",
                   pseudos = ":(" + identifier + ")(?:\\((" +
                   // To reduce the number of selectors needing tokenize in the preFilter, prefer arguments:
                   // 1. quoted (capture 3; capture 4 or capture 5)
                   "('((?:\\\\.|[^\\\\'])*)'|\"((?:\\\\.|[^\\\\\"])*)\")|" +
                   // 2. simple (capture 6)
                   "((?:\\\\.|[^\\\\()[\\]]|" + attributes + ")*)|" +
                   // 3. anything else (capture 2)
                   ".*" +
                   ")\\)|)",
                   // Leading and non-escaped trailing whitespace, capturing some non-whitespace characters preceding the latter
                   rwhitespace = new RegExp(whitespace + "+", "g"),
                   rtrim = new RegExp("^" + whitespace + "+|((?:^|[^\\\\])(?:\\\\.)*)" + whitespace + "+$",
                       "g"),
                   rcomma = new RegExp("^" + whitespace + "*," + whitespace + "*"),
                   rcombinators = new RegExp("^" + whitespace + "*([>+~]|" + whitespace + ")" + whitespace +
                       "*"),
                   rdescend = new RegExp(whitespace + "|>"),
                   rpseudo = new RegExp(pseudos),
                   ridentifier = new RegExp("^" + identifier + "$"),
                   matchExpr = {
                       "ID": new RegExp("^#(" + identifier + ")"),
                       "CLASS": new RegExp("^\\.(" + identifier + ")"),
                       "TAG": new RegExp("^(" + identifier + "|[*])"),
                       "ATTR": new RegExp("^" + attributes),
                       "PSEUDO": new RegExp("^" + pseudos),
                       "CHILD": new RegExp("^:(only|first|last|nth|nth-last)-(child|of-type)(?:\\(" +
                           whitespace +
                           "*(even|odd|(([+-]|)(\\d*)n|)" + whitespace + "*(?:([+-]|)" + whitespace +
                           "*(\\d+)|))" + whitespace + "*\\)|)", "i"),
                       "bool": new RegExp("^(?:" + booleans + ")$", "i"),
                       // For use in libraries implementing .is()
                       // We use this for POS matching in `select`
                       "needsContext": new RegExp("^" + whitespace +
                           "*[>+~]|:(even|odd|eq|gt|lt|nth|first|last)(?:\\(" +
                           whitespace + "*((?:-\\d)?\\d*)" + whitespace + "*\\)|)(?=[^-]|$)", "i")
                   },
                   rhtml = /HTML$/i,
                   rinputs = /^(?:input|select|textarea|button)$/i,
                   rheader = /^h\d$/i,
                   rnative = /^[^{]+\{\s*\[native \w/,
                   // Easily-parseable/retrievable ID or TAG or CLASS selectors
                   rquickExpr = /^(?:#([\w-]+)|(\w+)|\.([\w-]+))$/,
                   rsibling = /[+~]/,
                   // CSS escapes
                   // http://www.w3.org/TR/CSS21/syndata.html#escaped-characters
                   runescape = new RegExp("\\\\([\\da-f]{1,6}" + whitespace + "?|(" + whitespace + ")|.)",
                       "ig"),
                   funescape = function (_, escaped, escapedWhitespace) {
                       var high = "0x" + escaped - 0x10000;
                       // NaN means non-codepoint
                       // Support: Firefox<24
                       // Workaround erroneous numeric interpretation of +"0x"
                       return high !== high || escapedWhitespace ?
                           escaped :
                           high < 0 ?
                           // BMP codepoint
                           String.fromCharCode(high + 0x10000) :
                           // Supplemental Plane codepoint (surrogate pair)
                           String.fromCharCode(high >> 10 | 0xD800, high & 0x3FF | 0xDC00);
                   },
                   // CSS string/identifier serialization
                   // https://drafts.csswg.org/cssom/#common-serializing-idioms
                   rcssescape = /([\0-\x1f\x7f]|^-?\d)|^-$|[^\0-\x1f\x7f-\uFFFF\w-]/g,
                   fcssescape = function (ch, asCodePoint) {
                       if (asCodePoint) {
                           // U+0000 NULL becomes U+FFFD REPLACEMENT CHARACTER
                           if (ch === "\0") {
                               return "\uFFFD";
                           }
                           // Control characters and (dependent upon position) numbers get escaped as code points
                           return ch.slice(0, -1) + "\\" + ch.charCodeAt(ch.length - 1).toString(16) + " ";
                       }
                       // Other potentially-special ASCII characters get backslash-escaped
                       return "\\" + ch;
                   },
                   // Used for iframes
                   // See setDocument()
                   // Removing the function wrapper causes a "Permission Denied"
                   // error in IE
                   unloadHandler = function () {
                       setDocument();
                   },
                   inDisabledFieldset = addCombinator(
                       function (elem) {
                           return elem.disabled === true && elem.nodeName.toLowerCase() === "fieldset";
                       }, {
                           dir: "parentNode",
                           next: "legend"
                       }
                   );
               // Optimize for push.apply( _, NodeList )
               try {
                   push.apply(
                       (arr = slice.call(preferredDoc.childNodes)),
                       preferredDoc.childNodes
                   );
                   // Support: Android<4.0
                   // Detect silently failing push.apply
                   arr[preferredDoc.childNodes.length].nodeType;
               } catch (e) {
                   push = {
                       apply: arr.length ?
                           // Leverage slice if possible
                           function (target, els) {
                               push_native.apply(target, slice.call(els));
                           } :
                           // Support: IE<9
                           // Otherwise append directly
                           function (target, els) {
                               var j = target.length,
                                   i = 0;
                               // Can't trust NodeList.length
                               while ((target[j++] = els[i++])) {}
                               target.length = j - 1;
                           }
                   };
               }
               function Sizzle(selector, context, results, seed) {
                   var m, i, elem, nid, match, groups, newSelector,
                       newContext = context && context.ownerDocument,
                       // nodeType defaults to 9, since context defaults to document
                       nodeType = context ? context.nodeType : 9;
                   results = results || [];
                   // Return early from calls with invalid selector or context
                   if (typeof selector !== "string" || !selector ||
                       nodeType !== 1 && nodeType !== 9 && nodeType !== 11) {
                       return results;
                   }
                   // Try to shortcut find operations (as opposed to filters) in HTML documents
                   if (!seed) {
                       if ((context ? context.ownerDocument || context : preferredDoc) !== document) {
                           setDocument(context);
                       }
                       context = context || document;
                       if (documentIsHTML) {
                           // If the selector is sufficiently simple, try using a "get*By*" DOM method
                           // (excepting DocumentFragment context, where the methods don't exist)
                           if (nodeType !== 11 && (match = rquickExpr.exec(selector))) {
                               // ID selector
                               if ((m = match[1])) {
                                   // Document context
                                   if (nodeType === 9) {
                                       if ((elem = context.getElementById(m))) {
                                           // Support: IE, Opera, Webkit
                                           // TODO: identify versions
                                           // getElementById can match elements by name instead of ID
                                           if (elem.id === m) {
                                               results.push(elem);
                                               return results;
                                           }
                                       } else {
                                           return results;
                                       }
                                       // Element context
                                   } else {
                                       // Support: IE, Opera, Webkit
                                       // TODO: identify versions
                                       // getElementById can match elements by name instead of ID
                                       if (newContext && (elem = newContext.getElementById(m)) &&
                                           contains(context, elem) &&
                                           elem.id === m) {
                                           results.push(elem);
                                           return results;
                                       }
                                   }
                                   // Type selector
                               } else if (match[2]) {
                                   push.apply(results, context.getElementsByTagName(selector));
                                   return results;
                                   // Class selector
                               } else if ((m = match[3]) && support.getElementsByClassName &&
                                   context.getElementsByClassName) {
                                   push.apply(results, context.getElementsByClassName(m));
                                   return results;
                               }
                           }
                           // Take advantage of querySelectorAll
                           if (support.qsa &&
                               !nonnativeSelectorCache[selector + " "] &&
                               (!rbuggyQSA || !rbuggyQSA.test(selector)) &&
                               // Support: IE 8 only
                               // Exclude object elements
                               (nodeType !== 1 || context.nodeName.toLowerCase() !== "object")) {
                               newSelector = selector;
                               newContext = context;
                               // qSA considers elements outside a scoping root when evaluating child or
                               // descendant combinators, which is not what we want.
                               // In such cases, we work around the behavior by prefixing every selector in the
                               // list with an ID selector referencing the scope context.
                               // Thanks to Andrew Dupont for this technique.
                               if (nodeType === 1 && rdescend.test(selector)) {
                                   // Capture the context ID, setting it first if necessary
                                   if ((nid = context.getAttribute("id"))) {
                                       nid = nid.replace(rcssescape, fcssescape);
                                   } else {
                                       context.setAttribute("id", (nid = expando));
                                   }
                                   // Prefix every selector in the list
                                   groups = tokenize(selector);
                                   i = groups.length;
                                   while (i--) {
                                       groups[i] = "#" + nid + " " + toSelector(groups[i]);
                                   }
                                   newSelector = groups.join(",");
                                   // Expand context for sibling selectors
                                   newContext = rsibling.test(selector) && testContext(context.parentNode) ||
                                       context;
                               }
                               try {
                                   push.apply(results,
                                       newContext.querySelectorAll(newSelector)
                                   );
                                   return results;
                               } catch (qsaError) {
                                   nonnativeSelectorCache(selector, true);
                               } finally {
                                   if (nid === expando) {
                                       context.removeAttribute("id");
                                   }
                               }
                           }
                       }
                   }
                   // All others
                   return select(selector.replace(rtrim, "$1"), context, results, seed);
               }
               /**
                * Create key-value caches of limited size
                * @returns {function(string, object)} Returns the Object data after storing it on itself with
                *	property name the (space-suffixed) string and (if the cache is larger than Expr.cacheLength)
                *	deleting the oldest entry
                */
               function createCache() {
                   var keys = [];
                   function cache(key, value) {
                       // Use (key + " ") to avoid collision with native prototype properties (see Issue #157)
                       if (keys.push(key + " ") > Expr.cacheLength) {
                           // Only keep the most recent entries
                           delete cache[keys.shift()];
                       }
                       return (cache[key + " "] = value);
                   }
                   return cache;
               }
               /**
                * Mark a function for special use by Sizzle
                * @param {Function} fn The function to mark
                */
               function markFunction(fn) {
                   fn[expando] = true;
                   return fn;
               }
               /**
                * Support testing using an element
                * @param {Function} fn Passed the created element and returns a boolean result
                */
               function assert(fn) {
                   var el = document.createElement("fieldset");
                   try {
                       return !!fn(el);
                   } catch (e) {
                       return false;
                   } finally {
                       // Remove from its parent by default
                       if (el.parentNode) {
                           el.parentNode.removeChild(el);
                       }
                       // release memory in IE
                       el = null;
                   }
               }
               /**
                * Adds the same handler for all of the specified attrs
                * @param {String} attrs Pipe-separated list of attributes
                * @param {Function} handler The method that will be applied
                */
               function addHandle(attrs, handler) {
                   var arr = attrs.split("|"),
                       i = arr.length;
                   while (i--) {
                       Expr.attrHandle[arr[i]] = handler;
                   }
               }
               /**
                * Checks document order of two siblings
                * @param {Element} a
                * @param {Element} b
                * @returns {Number} Returns less than 0 if a precedes b, greater than 0 if a follows b
                */
               function siblingCheck(a, b) {
                   var cur = b && a,
                       diff = cur && a.nodeType === 1 && b.nodeType === 1 &&
                       a.sourceIndex - b.sourceIndex;
                   // Use IE sourceIndex if available on both nodes
                   if (diff) {
                       return diff;
                   }
                   // Check if b follows a
                   if (cur) {
                       while ((cur = cur.nextSibling)) {
                           if (cur === b) {
                               return -1;
                           }
                       }
                   }
                   return a ? 1 : -1;
               }
               /**
                * Returns a function to use in pseudos for input types
                * @param {String} type
                */
               function createInputPseudo(type) {
                   return function (elem) {
                       var name = elem.nodeName.toLowerCase();
                       return name === "input" && elem.type === type;
                   };
               }
               /**
                * Returns a function to use in pseudos for buttons
                * @param {String} type
                */
               function createButtonPseudo(type) {
                   return function (elem) {
                       var name = elem.nodeName.toLowerCase();
                       return (name === "input" || name === "button") && elem.type === type;
                   };
               }
               /**
                * Returns a function to use in pseudos for :enabled/:disabled
                * @param {Boolean} disabled true for :disabled; false for :enabled
                */
               function createDisabledPseudo(disabled) {
                   // Known :disabled false positives: fieldset[disabled] > legend:nth-of-type(n+2) :can-disable
                   return function (elem) {
                       // Only certain elements can match :enabled or :disabled
                       // https://html.spec.whatwg.org/multipage/scripting.html#selector-enabled
                       // https://html.spec.whatwg.org/multipage/scripting.html#selector-disabled
                       if ("form" in elem) {
                           // Check for inherited disabledness on relevant non-disabled elements:
                           // * listed form-associated elements in a disabled fieldset
                           //   https://html.spec.whatwg.org/multipage/forms.html#category-listed
                           //   https://html.spec.whatwg.org/multipage/forms.html#concept-fe-disabled
                           // * option elements in a disabled optgroup
                           //   https://html.spec.whatwg.org/multipage/forms.html#concept-option-disabled
                           // All such elements have a "form" property.
                           if (elem.parentNode && elem.disabled === false) {
                               // Option elements defer to a parent optgroup if present
                               if ("label" in elem) {
                                   if ("label" in elem.parentNode) {
                                       return elem.parentNode.disabled === disabled;
                                   } else {
                                       return elem.disabled === disabled;
                                   }
                               }
                               // Support: IE 6 - 11
                               // Use the isDisabled shortcut property to check for disabled fieldset ancestors
                               return elem.isDisabled === disabled ||
                                   // Where there is no isDisabled, check manually
                                   /* jshint -W018 */
                                   elem.isDisabled !== !disabled &&
                                   inDisabledFieldset(elem) === disabled;
                           }
                           return elem.disabled === disabled;
                           // Try to winnow out elements that can't be disabled before trusting the disabled property.
                           // Some victims get caught in our net (label, legend, menu, track), but it shouldn't
                           // even exist on them, let alone have a boolean value.
                       } else if ("label" in elem) {
                           return elem.disabled === disabled;
                       }
                       // Remaining elements are neither :enabled nor :disabled
                       return false;
                   };
               }
               /**
                * Returns a function to use in pseudos for positionals
                * @param {Function} fn
                */
               function createPositionalPseudo(fn) {
                   return markFunction(function (argument) {
                       argument = +argument;
                       return markFunction(function (seed, matches) {
                           var j,
                               matchIndexes = fn([], seed.length, argument),
                               i = matchIndexes.length;
                           // Match elements found at the specified indexes
                           while (i--) {
                               if (seed[(j = matchIndexes[i])]) {
                                   seed[j] = !(matches[j] = seed[j]);
                               }
                           }
                       });
                   });
               }
               /**
                * Checks a node for validity as a Sizzle context
                * @param {Element|Object=} context
                * @returns {Element|Object|Boolean} The input node if acceptable, otherwise a falsy value
                */
               function testContext(context) {
                   return context && typeof context.getElementsByTagName !== "undefined" && context;
               }
               // Expose support vars for convenience
               support = Sizzle.support = {};
               /**
                * Detects XML nodes
                * @param {Element|Object} elem An element or a document
                * @returns {Boolean} True iff elem is a non-HTML XML node
                */
               isXML = Sizzle.isXML = function (elem) {
                   var namespace = elem.namespaceURI,
                       docElem = (elem.ownerDocument || elem).documentElement;
                   // Support: IE <=8
                   // Assume HTML when documentElement doesn't yet exist, such as inside loading iframes
                   // https://bugs.jquery.com/ticket/4833
                   return !rhtml.test(namespace || docElem && docElem.nodeName || "HTML");
               };
               /**
                * Sets document-related variables once based on the current document
                * @param {Element|Object} [doc] An element or document object to use to set the document
                * @returns {Object} Returns the current document
                */
               setDocument = Sizzle.setDocument = function (node) {
                   var hasCompare, subWindow,
                       doc = node ? node.ownerDocument || node : preferredDoc;
                   // Return early if doc is invalid or already selected
                   if (doc === document || doc.nodeType !== 9 || !doc.documentElement) {
                       return document;
                   }
                   // Update global variables
                   document = doc;
                   docElem = document.documentElement;
                   documentIsHTML = !isXML(document);
                   // Support: IE 9-11, Edge
                   // Accessing iframe documents after unload throws "permission denied" errors (jQuery #13936)
                   if (preferredDoc !== document &&
                       (subWindow = document.defaultView) && subWindow.top !== subWindow) {
                       // Support: IE 11, Edge
                       if (subWindow.addEventListener) {
                           subWindow.addEventListener("unload", unloadHandler, false);
                           // Support: IE 9 - 10 only
                       } else if (subWindow.attachEvent) {
                           subWindow.attachEvent("onunload", unloadHandler);
                       }
                   }
                   /* Attributes
                   ---------------------------------------------------------------------- */
                   // Support: IE<8
                   // Verify that getAttribute really returns attributes and not properties
                   // (excepting IE8 booleans)
                   support.attributes = assert(function (el) {
                       el.className = "i";
                       return !el.getAttribute("className");
                   });
                   /* getElement(s)By*
                   ---------------------------------------------------------------------- */
                   // Check if getElementsByTagName("*") returns only elements
                   support.getElementsByTagName = assert(function (el) {
                       el.appendChild(document.createComment(""));
                       return !el.getElementsByTagName("*").length;
                   });
                   // Support: IE<9
                   support.getElementsByClassName = rnative.test(document.getElementsByClassName);
                   // Support: IE<10
                   // Check if getElementById returns elements by name
                   // The broken getElementById methods don't pick up programmatically-set names,
                   // so use a roundabout getElementsByName test
                   support.getById = assert(function (el) {
                       docElem.appendChild(el).id = expando;
                       return !document.getElementsByName || !document.getElementsByName(expando)
                           .length;
                   });
                   // ID filter and find
                   if (support.getById) {
                       Expr.filter["ID"] = function (id) {
                           var attrId = id.replace(runescape, funescape);
                           return function (elem) {
                               return elem.getAttribute("id") === attrId;
                           };
                       };
                       Expr.find["ID"] = function (id, context) {
                           if (typeof context.getElementById !== "undefined" && documentIsHTML) {
                               var elem = context.getElementById(id);
                               return elem ? [elem] : [];
                           }
                       };
                   } else {
                       Expr.filter["ID"] = function (id) {
                           var attrId = id.replace(runescape, funescape);
                           return function (elem) {
                               var node = typeof elem.getAttributeNode !== "undefined" &&
                                   elem.getAttributeNode("id");
                               return node && node.value === attrId;
                           };
                       };
                       // Support: IE 6 - 7 only
                       // getElementById is not reliable as a find shortcut
                       Expr.find["ID"] = function (id, context) {
                           if (typeof context.getElementById !== "undefined" && documentIsHTML) {
                               var node, i, elems,
                                   elem = context.getElementById(id);
                               if (elem) {
                                   // Verify the id attribute
                                   node = elem.getAttributeNode("id");
                                   if (node && node.value === id) {
                                       return [elem];
                                   }
                                   // Fall back on getElementsByName
                                   elems = context.getElementsByName(id);
                                   i = 0;
                                   while ((elem = elems[i++])) {
                                       node = elem.getAttributeNode("id");
                                       if (node && node.value === id) {
                                           return [elem];
                                       }
                                   }
                               }
                               return [];
                           }
                       };
                   }
                   // Tag
                   Expr.find["TAG"] = support.getElementsByTagName ?
                       function (tag, context) {
                           if (typeof context.getElementsByTagName !== "undefined") {
                               return context.getElementsByTagName(tag);
                               // DocumentFragment nodes don't have gEBTN
                           } else if (support.qsa) {
                               return context.querySelectorAll(tag);
                           }
                       } :
                       function (tag, context) {
                           var elem,
                               tmp = [],
                               i = 0,
                               // By happy coincidence, a (broken) gEBTN appears on DocumentFragment nodes too
                               results = context.getElementsByTagName(tag);
                           // Filter out possible comments
                           if (tag === "*") {
                               while ((elem = results[i++])) {
                                   if (elem.nodeType === 1) {
                                       tmp.push(elem);
                                   }
                               }
                               return tmp;
                           }
                           return results;
                       };
                   // Class
                   Expr.find["CLASS"] = support.getElementsByClassName && function (className, context) {
                       if (typeof context.getElementsByClassName !== "undefined" && documentIsHTML) {
                           return context.getElementsByClassName(className);
                       }
                   };
                   /* QSA/matchesSelector
                   ---------------------------------------------------------------------- */
                   // QSA and matchesSelector support
                   // matchesSelector(:active) reports false when true (IE9/Opera 11.5)
                   rbuggyMatches = [];
                   // qSa(:focus) reports false when true (Chrome 21)
                   // We allow this because of a bug in IE8/9 that throws an error
                   // whenever `document.activeElement` is accessed on an iframe
                   // So, we allow :focus to pass through QSA all the time to avoid the IE error
                   // See https://bugs.jquery.com/ticket/13378
                   rbuggyQSA = [];
                   if ((support.qsa = rnative.test(document.querySelectorAll))) {
                       // Build QSA regex
                       // Regex strategy adopted from Diego Perini
                       assert(function (el) {
                           // Select is set to empty string on purpose
                           // This is to test IE's treatment of not explicitly
                           // setting a boolean content attribute,
                           // since its presence should be enough
                           // https://bugs.jquery.com/ticket/12359
                           docElem.appendChild(el).innerHTML = "<a id='" + expando + "'></a>" +
                               "<select id='" + expando + "-\r\\' msallowcapture=>" +
                               "<option selected=></option></select>";
                           // Support: IE8, Opera 11-12.16
                           // Nothing should be selected when empty strings follow ^= or $= or *=
                           // The test attribute must be unknown in Opera but "safe" for WinRT
                           // https://msdn.microsoft.com/en-us/library/ie/hh465388.aspx#attribute_section
                           if (el.querySelectorAll("[msallowcapture^=]").length) {
                               rbuggyQSA.push("[*^$]=" + whitespace + "*(?:|\"\")");
                           }
                           // Support: IE8
                           // Boolean attributes and "value" are not treated correctly
                           if (!el.querySelectorAll("[selected]").length) {
                               rbuggyQSA.push("\\[" + whitespace + "*(?:value|" + booleans + ")");
                           }
                           // Support: Chrome<29, Android<4.4, Safari<7.0+, iOS<7.0+, PhantomJS<1.9.8+
                           if (!el.querySelectorAll("[id~=" + expando + "-]").length) {
                               rbuggyQSA.push("~=");
                           }
                           // Webkit/Opera - :checked should return selected option elements
                           // http://www.w3.org/TR/2011/REC-css3-selectors-20110929/#checked
                           // IE8 throws error here and will not see later tests
                           if (!el.querySelectorAll(":checked").length) {
                               rbuggyQSA.push(":checked");
                           }
                           // Support: Safari 8+, iOS 8+
                           // https://bugs.webkit.org/show_bug.cgi?id=136851
                           // In-page `selector#id sibling-combinator selector` fails
                           if (!el.querySelectorAll("a#" + expando + "+*").length) {
                               rbuggyQSA.push(".#.+[+~]");
                           }
                       });
                       assert(function (el) {
                           el.innerHTML = "<a href= disabled='disabled'></a>" +
                               "<select disabled='disabled'><option/></select>";
                           // Support: Windows 8 Native Apps
                           // The type and name attributes are restricted during .innerHTML assignment
                           var input = document.createElement("input");
                           input.setAttribute("type", "hidden");
                           el.appendChild(input).setAttribute("name", "D");
                           // Support: IE8
                           // Enforce case-sensitivity of name attribute
                           if (el.querySelectorAll("[name=d]").length) {
                               rbuggyQSA.push("name" + whitespace + "*[*^$|!~]?=");
                           }
                           // FF 3.5 - :enabled/:disabled and hidden elements (hidden elements are still enabled)
                           // IE8 throws error here and will not see later tests
                           if (el.querySelectorAll(":enabled").length !== 2) {
                               rbuggyQSA.push(":enabled", ":disabled");
                           }
                           // Support: IE9-11+
                           // IE's :disabled selector does not pick up the children of disabled fieldsets
                           docElem.appendChild(el).disabled = true;
                           if (el.querySelectorAll(":disabled").length !== 2) {
                               rbuggyQSA.push(":enabled", ":disabled");
                           }
                           // Opera 10-11 does not throw on post-comma invalid pseudos
                           el.querySelectorAll("*,:x");
                           rbuggyQSA.push(",.*:");
                       });
                   }
                   if ((support.matchesSelector = rnative.test((matches = docElem.matches ||
                           docElem.webkitMatchesSelector ||
                           docElem.mozMatchesSelector ||
                           docElem.oMatchesSelector ||
                           docElem.msMatchesSelector)))) {
                       assert(function (el) {
                           // Check to see if it's possible to do matchesSelector
                           // on a disconnected node (IE 9)
                           support.disconnectedMatch = matches.call(el, "*");
                           // This should fail with an exception
                           // Gecko does not error, returns false instead
                           matches.call(el, "[s!=]:x");
                           rbuggyMatches.push("!=", pseudos);
                       });
                   }
                   rbuggyQSA = rbuggyQSA.length && new RegExp(rbuggyQSA.join("|"));
                   rbuggyMatches = rbuggyMatches.length && new RegExp(rbuggyMatches.join("|"));
                   /* Contains
                   ---------------------------------------------------------------------- */
                   hasCompare = rnative.test(docElem.compareDocumentPosition);
                   // Element contains another
                   // Purposefully self-exclusive
                   // As in, an element does not contain itself
                   contains = hasCompare || rnative.test(docElem.contains) ?
                       function (a, b) {
                           var adown = a.nodeType === 9 ? a.documentElement : a,
                               bup = b && b.parentNode;
                           return a === bup || !!(bup && bup.nodeType === 1 && (
                               adown.contains ?
                               adown.contains(bup) :
                               a.compareDocumentPosition && a.compareDocumentPosition(bup) & 16
                           ));
                       } :
                       function (a, b) {
                           if (b) {
                               while ((b = b.parentNode)) {
                                   if (b === a) {
                                       return true;
                                   }
                               }
                           }
                           return false;
                       };
                   /* Sorting
                   ---------------------------------------------------------------------- */
                   // Document order sorting
                   sortOrder = hasCompare ?
                       function (a, b) {
                           // Flag for duplicate removal
                           if (a === b) {
                               hasDuplicate = true;
                               return 0;
                           }
                           // Sort on method existence if only one input has compareDocumentPosition
                           var compare = !a.compareDocumentPosition - !b.compareDocumentPosition;
                           if (compare) {
                               return compare;
                           }
                           // Calculate position if both inputs belong to the same document
                           compare = (a.ownerDocument || a) === (b.ownerDocument || b) ?
                               a.compareDocumentPosition(b) :
                               // Otherwise we know they are disconnected
                               1;
                           // Disconnected nodes
                           if (compare & 1 ||
                               (!support.sortDetached && b.compareDocumentPosition(a) === compare)) {
                               // Choose the first element that is related to our preferred document
                               if (a === document || a.ownerDocument === preferredDoc && contains(
                                       preferredDoc, a)) {
                                   return -1;
                               }
                               if (b === document || b.ownerDocument === preferredDoc && contains(
                                       preferredDoc, b)) {
                                   return 1;
                               }
                               // Maintain original order
                               return sortInput ?
                                   (indexOf(sortInput, a) - indexOf(sortInput, b)) :
                                   0;
                           }
                           return compare & 4 ? -1 : 1;
                       } :
                       function (a, b) {
                           // Exit early if the nodes are identical
                           if (a === b) {
                               hasDuplicate = true;
                               return 0;
                           }
                           var cur,
                               i = 0,
                               aup = a.parentNode,
                               bup = b.parentNode,
                               ap = [a],
                               bp = [b];
                           // Parentless nodes are either documents or disconnected
                           if (!aup || !bup) {
                               return a === document ? -1 :
                                   b === document ? 1 :
                                   aup ? -1 :
                                   bup ? 1 :
                                   sortInput ?
                                   (indexOf(sortInput, a) - indexOf(sortInput, b)) :
                                   0;
                               // If the nodes are siblings, we can do a quick check
                           } else if (aup === bup) {
                               return siblingCheck(a, b);
                           }
                           // Otherwise we need full lists of their ancestors for comparison
                           cur = a;
                           while ((cur = cur.parentNode)) {
                               ap.unshift(cur);
                           }
                           cur = b;
                           while ((cur = cur.parentNode)) {
                               bp.unshift(cur);
                           }
                           // Walk down the tree looking for a discrepancy
                           while (ap[i] === bp[i]) {
                               i++;
                           }
                           return i ?
                               // Do a sibling check if the nodes have a common ancestor
                               siblingCheck(ap[i], bp[i]) :
                               // Otherwise nodes in our document sort first
                               ap[i] === preferredDoc ? -1 :
                               bp[i] === preferredDoc ? 1 :
                               0;
                       };
                   return document;
               };
               Sizzle.matches = function (expr, elements) {
                   return Sizzle(expr, null, null, elements);
               };
               Sizzle.matchesSelector = function (elem, expr) {
                   // Set document vars if needed
                   if ((elem.ownerDocument || elem) !== document) {
                       setDocument(elem);
                   }
                   if (support.matchesSelector && documentIsHTML &&
                       !nonnativeSelectorCache[expr + " "] &&
                       (!rbuggyMatches || !rbuggyMatches.test(expr)) &&
                       (!rbuggyQSA || !rbuggyQSA.test(expr))) {
                       try {
                           var ret = matches.call(elem, expr);
                           // IE 9's matchesSelector returns false on disconnected nodes
                           if (ret || support.disconnectedMatch ||
                               // As well, disconnected nodes are said to be in a document
                               // fragment in IE 9
                               elem.document && elem.document.nodeType !== 11) {
                               return ret;
                           }
                       } catch (e) {
                           nonnativeSelectorCache(expr, true);
                       }
                   }
                   return Sizzle(expr, document, null, [elem]).length > 0;
               };
               Sizzle.contains = function (context, elem) {
                   // Set document vars if needed
                   if ((context.ownerDocument || context) !== document) {
                       setDocument(context);
                   }
                   return contains(context, elem);
               };
               Sizzle.attr = function (elem, name) {
                   // Set document vars if needed
                   if ((elem.ownerDocument || elem) !== document) {
                       setDocument(elem);
                   }
                   var fn = Expr.attrHandle[name.toLowerCase()],
                       // Don't get fooled by Object.prototype properties (jQuery #13807)
                       val = fn && hasOwn.call(Expr.attrHandle, name.toLowerCase()) ?
                       fn(elem, name, !documentIsHTML) :
                       undefined;
                   return val !== undefined ?
                       val :
                       support.attributes || !documentIsHTML ?
                       elem.getAttribute(name) :
                       (val = elem.getAttributeNode(name)) && val.specified ?
                       val.value :
                       null;
               };
               Sizzle.escape = function (sel) {
                   return (sel + "").replace(rcssescape, fcssescape);
               };
               Sizzle.error = function (msg) {
                   throw new Error("Syntax error, unrecognized expression: " + msg);
               };
               /**
                * Document sorting and removing duplicates
                * @param {ArrayLike} results
                */
               Sizzle.uniqueSort = function (results) {
                   var elem,
                       duplicates = [],
                       j = 0,
                       i = 0;
                   // Unless we *know* we can detect duplicates, assume their presence
                   hasDuplicate = !support.detectDuplicates;
                   sortInput = !support.sortStable && results.slice(0);
                   results.sort(sortOrder);
                   if (hasDuplicate) {
                       while ((elem = results[i++])) {
                           if (elem === results[i]) {
                               j = duplicates.push(i);
                           }
                       }
                       while (j--) {
                           results.splice(duplicates[j], 1);
                       }
                   }
                   // Clear input after sorting to release objects
                   // See https://github.com/jquery/sizzle/pull/225
                   sortInput = null;
                   return results;
               };
               /**
                * Utility function for retrieving the text value of an array of DOM nodes
                * @param {Array|Element} elem
                */
               getText = Sizzle.getText = function (elem) {
                   var node,
                       ret = "",
                       i = 0,
                       nodeType = elem.nodeType;
                   if (!nodeType) {
                       // If no nodeType, this is expected to be an array
                       while ((node = elem[i++])) {
                           // Do not traverse comment nodes
                           ret += getText(node);
                       }
                   } else if (nodeType === 1 || nodeType === 9 || nodeType === 11) {
                       // Use textContent for elements
                       // innerText usage removed for consistency of new lines (jQuery #11153)
                       if (typeof elem.textContent === "string") {
                           return elem.textContent;
                       } else {
                           // Traverse its children
                           for (elem = elem.firstChild; elem; elem = elem.nextSibling) {
                               ret += getText(elem);
                           }
                       }
                   } else if (nodeType === 3 || nodeType === 4) {
                       return elem.nodeValue;
                   }
                   // Do not include comment or processing instruction nodes
                   return ret;
               };
               Expr = Sizzle.selectors = {
                   // Can be adjusted by the user
                   cacheLength: 50,
                   createPseudo: markFunction,
                   match: matchExpr,
                   attrHandle: {},
                   find: {},
                   relative: {
                       ">": {
                           dir: "parentNode",
                           first: true
                       },
                       " ": {
                           dir: "parentNode"
                       },
                       "+": {
                           dir: "previousSibling",
                           first: true
                       },
                       "~": {
                           dir: "previousSibling"
                       }
                   },
                   preFilter: {
                       "ATTR": function (match) {
                           match[1] = match[1].replace(runescape, funescape);
                           // Move the given value to match[3] whether quoted or unquoted
                           match[3] = (match[3] || match[4] || match[5] || "").replace(runescape,
                               funescape);
                           if (match[2] === "~=") {
                               match[3] = " " + match[3] + " ";
                           }
                           return match.slice(0, 4);
                       },
                       "CHILD": function (match) {
                           /* matches from matchExpr["CHILD"]
                               1 type (only|nth|...)
                               2 what (child|of-type)
                               3 argument (even|odd|\d*|\d*n([+-]\d+)?|...)
                               4 xn-component of xn+y argument ([+-]?\d*n|)
                               5 sign of xn-component
                               6 x of xn-component
                               7 sign of y-component
                               8 y of y-component
                           */
                           match[1] = match[1].toLowerCase();
                           if (match[1].slice(0, 3) === "nth") {
                               // nth-* requires argument
                               if (!match[3]) {
                                   Sizzle.error(match[0]);
                               }
                               // numeric x and y parameters for Expr.filter.CHILD
                               // remember that false/true cast respectively to 0/1
                               match[4] = +(match[4] ? match[5] + (match[6] || 1) : 2 * (match[3] ===
                                   "even" || match[3] === "odd"));
                               match[5] = +((match[7] + match[8]) || match[3] === "odd");
                               // other types prohibit arguments
                           } else if (match[3]) {
                               Sizzle.error(match[0]);
                           }
                           return match;
                       },
                       "PSEUDO": function (match) {
                           var excess,
                               unquoted = !match[6] && match[2];
                           if (matchExpr["CHILD"].test(match[0])) {
                               return null;
                           }
                           // Accept quoted arguments as-is
                           if (match[3]) {
                               match[2] = match[4] || match[5] || "";
                               // Strip excess characters from unquoted arguments
                           } else if (unquoted && rpseudo.test(unquoted) &&
                               // Get excess from tokenize (recursively)
                               (excess = tokenize(unquoted, true)) &&
                               // advance to the next closing parenthesis
                               (excess = unquoted.indexOf(")", unquoted.length - excess) - unquoted
                                   .length)) {
                               // excess is a negative index
                               match[0] = match[0].slice(0, excess);
                               match[2] = unquoted.slice(0, excess);
                           }
                           // Return only captures needed by the pseudo filter method (type and argument)
                           return match.slice(0, 3);
                       }
                   },
                   filter: {
                       "TAG": function (nodeNameSelector) {
                           var nodeName = nodeNameSelector.replace(runescape, funescape).toLowerCase();
                           return nodeNameSelector === "*" ?
                               function () {
                                   return true;
                               } :
                               function (elem) {
                                   return elem.nodeName && elem.nodeName.toLowerCase() === nodeName;
                               };
                       },
                       "CLASS": function (className) {
                           var pattern = classCache[className + " "];
                           return pattern ||
                               (pattern = new RegExp("(^|" + whitespace + ")" + className + "(" +
                                   whitespace + "|$)")) &&
                               classCache(className, function (elem) {
                                   return pattern.test(typeof elem.className === "string" && elem
                                       .className || typeof elem.getAttribute !==
                                       "undefined" && elem.getAttribute("class") || "");
                               });
                       },
                       "ATTR": function (name, operator, check) {
                           return function (elem) {
                               var result = Sizzle.attr(elem, name);
                               if (result == null) {
                                   return operator === "!=";
                               }
                               if (!operator) {
                                   return true;
                               }
                               result += "";
                               return operator === "=" ? result === check :
                                   operator === "!=" ? result !== check :
                                   operator === "^=" ? check && result.indexOf(check) === 0 :
                                   operator === "*=" ? check && result.indexOf(check) > -1 :
                                   operator === "$=" ? check && result.slice(-check.length) ===
                                   check :
                                   operator === "~=" ? (" " + result.replace(rwhitespace, " ") +
                                       " ").indexOf(check) > -1 :
                                   operator === "|=" ? result === check || result.slice(0, check
                                       .length + 1) === check + "-" :
                                   false;
                           };
                       },
                       "CHILD": function (type, what, argument, first, last) {
                           var simple = type.slice(0, 3) !== "nth",
                               forward = type.slice(-4) !== "last",
                               ofType = what === "of-type";
                           return first === 1 && last === 0 ?
                               // Shortcut for :nth-*(n)
                               function (elem) {
                                   return !!elem.parentNode;
                               } :
                               function (elem, context, xml) {
                                   var cache, uniqueCache, outerCache, node, nodeIndex, start,
                                       dir = simple !== forward ? "nextSibling" : "previousSibling",
                                       parent = elem.parentNode,
                                       name = ofType && elem.nodeName.toLowerCase(),
                                       useCache = !xml && !ofType,
                                       diff = false;
                                   if (parent) {
                                       // :(first|last|only)-(child|of-type)
                                       if (simple) {
                                           while (dir) {
                                               node = elem;
                                               while ((node = node[dir])) {
                                                   if (ofType ?
                                                       node.nodeName.toLowerCase() === name :
                                                       node.nodeType === 1) {
                                                       return false;
                                                   }
                                               }
                                               // Reverse direction for :only-* (if we haven't yet done so)
                                               start = dir = type === "only" && !start &&
                                                   "nextSibling";
                                           }
                                           return true;
                                       }
                                       start = [forward ? parent.firstChild : parent.lastChild];
                                       // non-xml :nth-child(...) stores cache data on `parent`
                                       if (forward && useCache) {
                                           // Seek `elem` from a previously-cached index
                                           // ...in a gzip-friendly way
                                           node = parent;
                                           outerCache = node[expando] || (node[expando] = {});
                                           // Support: IE <9 only
                                           // Defend against cloned attroperties (jQuery gh-1709)
                                           uniqueCache = outerCache[node.uniqueID] ||
                                               (outerCache[node.uniqueID] = {});
                                           cache = uniqueCache[type] || [];
                                           nodeIndex = cache[0] === dirruns && cache[1];
                                           diff = nodeIndex && cache[2];
                                           node = nodeIndex && parent.childNodes[nodeIndex];
                                           while ((node = ++nodeIndex && node && node[dir] ||
                                                   // Fallback to seeking `elem` from the start
                                                   (diff = nodeIndex = 0) || start.pop())) {
                                               // When found, cache indexes on `parent` and break
                                               if (node.nodeType === 1 && ++diff && node === elem) {
                                                   uniqueCache[type] = [dirruns, nodeIndex, diff];
                                                   break;
                                               }
                                           }
                                       } else {
                                           // Use previously-cached element index if available
                                           if (useCache) {
                                               // ...in a gzip-friendly way
                                               node = elem;
                                               outerCache = node[expando] || (node[expando] = {});
                                               // Support: IE <9 only
                                               // Defend against cloned attroperties (jQuery gh-1709)
                                               uniqueCache = outerCache[node.uniqueID] ||
                                                   (outerCache[node.uniqueID] = {});
                                               cache = uniqueCache[type] || [];
                                               nodeIndex = cache[0] === dirruns && cache[1];
                                               diff = nodeIndex;
                                           }
                                           // xml :nth-child(...)
                                           // or :nth-last-child(...) or :nth(-last)?-of-type(...)
                                           if (diff === false) {
                                               // Use the same loop as above to seek `elem` from the start
                                               while ((node = ++nodeIndex && node && node[dir] ||
                                                       (diff = nodeIndex = 0) || start.pop())) {
                                                   if ((ofType ?
                                                           node.nodeName.toLowerCase() === name :
                                                           node.nodeType === 1) &&
                                                       ++diff) {
                                                       // Cache the index of each encountered element
                                                       if (useCache) {
                                                           outerCache = node[expando] || (node[
                                                               expando] = {});
                                                           // Support: IE <9 only
                                                           // Defend against cloned attroperties (jQuery gh-1709)
                                                           uniqueCache = outerCache[node.uniqueID] ||
                                                               (outerCache[node.uniqueID] = {});
                                                           uniqueCache[type] = [dirruns, diff];
                                                       }
                                                       if (node === elem) {
                                                           break;
                                                       }
                                                   }
                                               }
                                           }
                                       }
                                       // Incorporate the offset, then check against cycle size
                                       diff -= last;
                                       return diff === first || (diff % first === 0 && diff / first >=
                                           0);
                                   }
                               };
                       },
                       "PSEUDO": function (pseudo, argument) {
                           // pseudo-class names are case-insensitive
                           // http://www.w3.org/TR/selectors/#pseudo-classes
                           // Prioritize by case sensitivity in case custom pseudos are added with uppercase letters
                           // Remember that setFilters inherits from pseudos
                           var args,
                               fn = Expr.pseudos[pseudo] || Expr.setFilters[pseudo.toLowerCase()] ||
                               Sizzle.error("unsupported pseudo: " + pseudo);
                           // The user may use createPseudo to indicate that
                           // arguments are needed to create the filter function
                           // just as Sizzle does
                           if (fn[expando]) {
                               return fn(argument);
                           }
                           // But maintain support for old signatures
                           if (fn.length > 1) {
                               args = [pseudo, pseudo, "", argument];
                               return Expr.setFilters.hasOwnProperty(pseudo.toLowerCase()) ?
                                   markFunction(function (seed, matches) {
                                       var idx,
                                           matched = fn(seed, argument),
                                           i = matched.length;
                                       while (i--) {
                                           idx = indexOf(seed, matched[i]);
                                           seed[idx] = !(matches[idx] = matched[i]);
                                       }
                                   }) :
                                   function (elem) {
                                       return fn(elem, 0, args);
                                   };
                           }
                           return fn;
                       }
                   },
                   pseudos: {
                       // Potentially complex pseudos
                       "not": markFunction(function (selector) {
                           // Trim the selector passed to compile
                           // to avoid treating leading and trailing
                           // spaces as combinators
                           var input = [],
                               results = [],
                               matcher = compile(selector.replace(rtrim, "$1"));
                           return matcher[expando] ?
                               markFunction(function (seed, matches, context, xml) {
                                   var elem,
                                       unmatched = matcher(seed, null, xml, []),
                                       i = seed.length;
                                   // Match elements unmatched by `matcher`
                                   while (i--) {
                                       if ((elem = unmatched[i])) {
                                           seed[i] = !(matches[i] = elem);
                                       }
                                   }
                               }) :
                               function (elem, context, xml) {
                                   input[0] = elem;
                                   matcher(input, null, xml, results);
                                   // Don't keep the element (issue #299)
                                   input[0] = null;
                                   return !results.pop();
                               };
                       }),
                       "has": markFunction(function (selector) {
                           return function (elem) {
                               return Sizzle(selector, elem).length > 0;
                           };
                       }),
                       "contains": markFunction(function (text) {
                           text = text.replace(runescape, funescape);
                           return function (elem) {
                               return (elem.textContent || getText(elem)).indexOf(text) > -1;
                           };
                       }),
                       // "Whether an element is represented by a :lang() selector
                       // is based solely on the element's language value
                       // being equal to the identifier C,
                       // or beginning with the identifier C immediately followed by "-".
                       // The matching of C against the element's language value is performed case-insensitively.
                       // The identifier C does not have to be a valid language name."
                       // http://www.w3.org/TR/selectors/#lang-pseudo
                       "lang": markFunction(function (lang) {
                           // lang value must be a valid identifier
                           if (!ridentifier.test(lang || "")) {
                               Sizzle.error("unsupported lang: " + lang);
                           }
                           lang = lang.replace(runescape, funescape).toLowerCase();
                           return function (elem) {
                               var elemLang;
                               do {
                                   if ((elemLang = documentIsHTML ?
                                           elem.lang :
                                           elem.getAttribute("xml:lang") || elem.getAttribute(
                                               "lang"))) {
                                       elemLang = elemLang.toLowerCase();
                                       return elemLang === lang || elemLang.indexOf(lang +
                                           "-") === 0;
                                   }
                               } while ((elem = elem.parentNode) && elem.nodeType === 1);
                               return false;
                           };
                       }),
                       // Miscellaneous
                       "target": function (elem) {
                           var hash = window.location && window.location.hash;
                           return hash && hash.slice(1) === elem.id;
                       },
                       "root": function (elem) {
                           return elem === docElem;
                       },
                       "focus": function (elem) {
                           return elem === document.activeElement && (!document.hasFocus || document
                               .hasFocus()) && !!(elem.type || elem.href || ~elem.tabIndex);
                       },
                       // Boolean properties
                       "enabled": createDisabledPseudo(false),
                       "disabled": createDisabledPseudo(true),
                       "checked": function (elem) {
                           // In CSS3, :checked should return both checked and selected elements
                           // http://www.w3.org/TR/2011/REC-css3-selectors-20110929/#checked
                           var nodeName = elem.nodeName.toLowerCase();
                           return (nodeName === "input" && !!elem.checked) || (nodeName === "option" &&
                               !!elem.selected);
                       },
                       "selected": function (elem) {
                           // Accessing this property makes selected-by-default
                           // options in Safari work properly
                           if (elem.parentNode) {
                               elem.parentNode.selectedIndex;
                           }
                           return elem.selected === true;
                       },
                       // Contents
                       "empty": function (elem) {
                           // http://www.w3.org/TR/selectors/#empty-pseudo
                           // :empty is negated by element (1) or content nodes (text: 3; cdata: 4; entity ref: 5),
                           //   but not by others (comment: 8; processing instruction: 7; etc.)
                           // nodeType < 6 works because attributes (2) do not appear as children
                           for (elem = elem.firstChild; elem; elem = elem.nextSibling) {
                               if (elem.nodeType < 6) {
                                   return false;
                               }
                           }
                           return true;
                       },
                       "parent": function (elem) {
                           return !Expr.pseudos["empty"](elem);
                       },
                       // Element/input types
                       "header": function (elem) {
                           return rheader.test(elem.nodeName);
                       },
                       "input": function (elem) {
                           return rinputs.test(elem.nodeName);
                       },
                       "button": function (elem) {
                           var name = elem.nodeName.toLowerCase();
                           return name === "input" && elem.type === "button" || name === "button";
                       },
                       "text": function (elem) {
                           var attr;
                           return elem.nodeName.toLowerCase() === "input" &&
                               elem.type === "text" &&
                               // Support: IE<8
                               // New HTML5 attribute values (e.g., "search") appear with elem.type === "text"
                               ((attr = elem.getAttribute("type")) == null || attr.toLowerCase() ===
                                   "text");
                       },
                       // Position-in-collection
                       "first": createPositionalPseudo(function () {
                           return [0];
                       }),
                       "last": createPositionalPseudo(function (matchIndexes, length) {
                           return [length - 1];
                       }),
                       "eq": createPositionalPseudo(function (matchIndexes, length, argument) {
                           return [argument < 0 ? argument + length : argument];
                       }),
                       "even": createPositionalPseudo(function (matchIndexes, length) {
                           var i = 0;
                           for (; i < length; i += 2) {
                               matchIndexes.push(i);
                           }
                           return matchIndexes;
                       }),
                       "odd": createPositionalPseudo(function (matchIndexes, length) {
                           var i = 1;
                           for (; i < length; i += 2) {
                               matchIndexes.push(i);
                           }
                           return matchIndexes;
                       }),
                       "lt": createPositionalPseudo(function (matchIndexes, length, argument) {
                           var i = argument < 0 ?
                               argument + length :
                               argument > length ?
                               length :
                               argument;
                           for (; --i >= 0;) {
                               matchIndexes.push(i);
                           }
                           return matchIndexes;
                       }),
                       "gt": createPositionalPseudo(function (matchIndexes, length, argument) {
                           var i = argument < 0 ? argument + length : argument;
                           for (; ++i < length;) {
                               matchIndexes.push(i);
                           }
                           return matchIndexes;
                       })
                   }
               };
               Expr.pseudos["nth"] = Expr.pseudos["eq"];
               // Add button/input type pseudos
               for (i in {
                       radio: true,
                       checkbox: true,
                       file: true,
                       password: true,
                       image: true
                   }) {
                   Expr.pseudos[i] = createInputPseudo(i);
               }
               for (i in {
                       submit: true,
                       reset: true
                   }) {
                   Expr.pseudos[i] = createButtonPseudo(i);
               }
               // Easy API for creating new setFilters
               function setFilters() {}
               setFilters.prototype = Expr.filters = Expr.pseudos;
               Expr.setFilters = new setFilters();
               tokenize = Sizzle.tokenize = function (selector, parseOnly) {
                   var matched, match, tokens, type,
                       soFar, groups, preFilters,
                       cached = tokenCache[selector + " "];
                   if (cached) {
                       return parseOnly ? 0 : cached.slice(0);
                   }
                   soFar = selector;
                   groups = [];
                   preFilters = Expr.preFilter;
                   while (soFar) {
                       // Comma and first run
                       if (!matched || (match = rcomma.exec(soFar))) {
                           if (match) {
                               // Don't consume trailing commas as valid
                               soFar = soFar.slice(match[0].length) || soFar;
                           }
                           groups.push((tokens = []));
                       }
                       matched = false;
                       // Combinators
                       if ((match = rcombinators.exec(soFar))) {
                           matched = match.shift();
                           tokens.push({
                               value: matched,
                               // Cast descendant combinators to space
                               type: match[0].replace(rtrim, " ")
                           });
                           soFar = soFar.slice(matched.length);
                       }
                       // Filters
                       for (type in Expr.filter) {
                           if ((match = matchExpr[type].exec(soFar)) && (!preFilters[type] ||
                                   (match = preFilters[type](match)))) {
                               matched = match.shift();
                               tokens.push({
                                   value: matched,
                                   type: type,
                                   matches: match
                               });
                               soFar = soFar.slice(matched.length);
                           }
                       }
                       if (!matched) {
                           break;
                       }
                   }
                   // Return the length of the invalid excess
                   // if we're just parsing
                   // Otherwise, throw an error or return tokens
                   return parseOnly ?
                       soFar.length :
                       soFar ?
                       Sizzle.error(selector) :
                       // Cache the tokens
                       tokenCache(selector, groups).slice(0);
               };
               function toSelector(tokens) {
                   var i = 0,
                       len = tokens.length,
                       selector = "";
                   for (; i < len; i++) {
                       selector += tokens[i].value;
                   }
                   return selector;
               }
               function addCombinator(matcher, combinator, base) {
                   var dir = combinator.dir,
                       skip = combinator.next,
                       key = skip || dir,
                       checkNonElements = base && key === "parentNode",
                       doneName = done++;
                   return combinator.first ?
                       // Check against closest ancestor/preceding element
                       function (elem, context, xml) {
                           while ((elem = elem[dir])) {
                               if (elem.nodeType === 1 || checkNonElements) {
                                   return matcher(elem, context, xml);
                               }
                           }
                           return false;
                       } :
                       // Check against all ancestor/preceding elements
                       function (elem, context, xml) {
                           var oldCache, uniqueCache, outerCache,
                               newCache = [dirruns, doneName];
                           // We can't set arbitrary data on XML nodes, so they don't benefit from combinator caching
                           if (xml) {
                               while ((elem = elem[dir])) {
                                   if (elem.nodeType === 1 || checkNonElements) {
                                       if (matcher(elem, context, xml)) {
                                           return true;
                                       }
                                   }
                               }
                           } else {
                               while ((elem = elem[dir])) {
                                   if (elem.nodeType === 1 || checkNonElements) {
                                       outerCache = elem[expando] || (elem[expando] = {});
                                       // Support: IE <9 only
                                       // Defend against cloned attroperties (jQuery gh-1709)
                                       uniqueCache = outerCache[elem.uniqueID] || (outerCache[elem
                                           .uniqueID] = {});
                                       if (skip && skip === elem.nodeName.toLowerCase()) {
                                           elem = elem[dir] || elem;
                                       } else if ((oldCache = uniqueCache[key]) &&
                                           oldCache[0] === dirruns && oldCache[1] === doneName) {
                                           // Assign to newCache so results back-propagate to previous elements
                                           return (newCache[2] = oldCache[2]);
                                       } else {
                                           // Reuse newcache so results back-propagate to previous elements
                                           uniqueCache[key] = newCache;
                                           // A match means we're done; a fail means we have to keep checking
                                           if ((newCache[2] = matcher(elem, context, xml))) {
                                               return true;
                                           }
                                       }
                                   }
                               }
                           }
                           return false;
                       };
               }
               function elementMatcher(matchers) {
                   return matchers.length > 1 ?
                       function (elem, context, xml) {
                           var i = matchers.length;
                           while (i--) {
                               if (!matchers[i](elem, context, xml)) {
                                   return false;
                               }
                           }
                           return true;
                       } :
                       matchers[0];
               }
               function multipleContexts(selector, contexts, results) {
                   var i = 0,
                       len = contexts.length;
                   for (; i < len; i++) {
                       Sizzle(selector, contexts[i], results);
                   }
                   return results;
               }
               function condense(unmatched, map, filter, context, xml) {
                   var elem,
                       newUnmatched = [],
                       i = 0,
                       len = unmatched.length,
                       mapped = map != null;
                   for (; i < len; i++) {
                       if ((elem = unmatched[i])) {
                           if (!filter || filter(elem, context, xml)) {
                               newUnmatched.push(elem);
                               if (mapped) {
                                   map.push(i);
                               }
                           }
                       }
                   }
                   return newUnmatched;
               }
               function setMatcher(preFilter, selector, matcher, postFilter, postFinder, postSelector) {
                   if (postFilter && !postFilter[expando]) {
                       postFilter = setMatcher(postFilter);
                   }
                   if (postFinder && !postFinder[expando]) {
                       postFinder = setMatcher(postFinder, postSelector);
                   }
                   return markFunction(function (seed, results, context, xml) {
                       var temp, i, elem,
                           preMap = [],
                           postMap = [],
                           preexisting = results.length,
                           // Get initial elements from seed or context
                           elems = seed || multipleContexts(selector || "*", context.nodeType ? [
                               context
                           ] : context, []),
                           // Prefilter to get matcher input, preserving a map for seed-results synchronization
                           matcherIn = preFilter && (seed || !selector) ?
                           condense(elems, preMap, preFilter, context, xml) :
                           elems,
                           matcherOut = matcher ?
                           // If we have a postFinder, or filtered seed, or non-seed postFilter or preexisting results,
                           postFinder || (seed ? preFilter : preexisting || postFilter) ?
                           // ...intermediate processing is necessary
                           [] :
                           // ...otherwise use results directly
                           results :
                           matcherIn;
                       // Find primary matches
                       if (matcher) {
                           matcher(matcherIn, matcherOut, context, xml);
                       }
                       // Apply postFilter
                       if (postFilter) {
                           temp = condense(matcherOut, postMap);
                           postFilter(temp, [], context, xml);
                           // Un-match failing elements by moving them back to matcherIn
                           i = temp.length;
                           while (i--) {
                               if ((elem = temp[i])) {
                                   matcherOut[postMap[i]] = !(matcherIn[postMap[i]] = elem);
                               }
                           }
                       }
                       if (seed) {
                           if (postFinder || preFilter) {
                               if (postFinder) {
                                   // Get the final matcherOut by condensing this intermediate into postFinder contexts
                                   temp = [];
                                   i = matcherOut.length;
                                   while (i--) {
                                       if ((elem = matcherOut[i])) {
                                           // Restore matcherIn since elem is not yet a final match
                                           temp.push((matcherIn[i] = elem));
                                       }
                                   }
                                   postFinder(null, (matcherOut = []), temp, xml);
                               }
                               // Move matched elements from seed to results to keep them synchronized
                               i = matcherOut.length;
                               while (i--) {
                                   if ((elem = matcherOut[i]) &&
                                       (temp = postFinder ? indexOf(seed, elem) : preMap[i]) > -1) {
                                       seed[temp] = !(results[temp] = elem);
                                   }
                               }
                           }
                           // Add elements to results, through postFinder if defined
                       } else {
                           matcherOut = condense(
                               matcherOut === results ?
                               matcherOut.splice(preexisting, matcherOut.length) :
                               matcherOut
                           );
                           if (postFinder) {
                               postFinder(null, results, matcherOut, xml);
                           } else {
                               push.apply(results, matcherOut);
                           }
                       }
                   });
               }
               function matcherFromTokens(tokens) {
                   var checkContext, matcher, j,
                       len = tokens.length,
                       leadingRelative = Expr.relative[tokens[0].type],
                       implicitRelative = leadingRelative || Expr.relative[" "],
                       i = leadingRelative ? 1 : 0,
                       // The foundational matcher ensures that elements are reachable from top-level context(s)
                       matchContext = addCombinator(function (elem) {
                           return elem === checkContext;
                       }, implicitRelative, true),
                       matchAnyContext = addCombinator(function (elem) {
                           return indexOf(checkContext, elem) > -1;
                       }, implicitRelative, true),
                       matchers = [function (elem, context, xml) {
                           var ret = (!leadingRelative && (xml || context !== outermostContext)) || (
                               (checkContext = context).nodeType ?
                               matchContext(elem, context, xml) :
                               matchAnyContext(elem, context, xml));
                           // Avoid hanging onto element (issue #299)
                           checkContext = null;
                           return ret;
                       }];
                   for (; i < len; i++) {
                       if ((matcher = Expr.relative[tokens[i].type])) {
                           matchers = [addCombinator(elementMatcher(matchers), matcher)];
                       } else {
                           matcher = Expr.filter[tokens[i].type].apply(null, tokens[i].matches);
                           // Return special upon seeing a positional matcher
                           if (matcher[expando]) {
                               // Find the next relative operator (if any) for proper handling
                               j = ++i;
                               for (; j < len; j++) {
                                   if (Expr.relative[tokens[j].type]) {
                                       break;
                                   }
                               }
                               return setMatcher(
                                   i > 1 && elementMatcher(matchers),
                                   i > 1 && toSelector(
                                       // If the preceding token was a descendant combinator, insert an implicit any-element `*`
                                       tokens.slice(0, i - 1).concat({
                                           value: tokens[i - 2].type === " " ? "*" : ""
                                       })
                                   ).replace(rtrim, "$1"),
                                   matcher,
                                   i < j && matcherFromTokens(tokens.slice(i, j)),
                                   j < len && matcherFromTokens((tokens = tokens.slice(j))),
                                   j < len && toSelector(tokens)
                               );
                           }
                           matchers.push(matcher);
                       }
                   }
                   return elementMatcher(matchers);
               }
               function matcherFromGroupMatchers(elementMatchers, setMatchers) {
                   var bySet = setMatchers.length > 0,
                       byElement = elementMatchers.length > 0,
                       superMatcher = function (seed, context, xml, results, outermost) {
                           var elem, j, matcher,
                               matchedCount = 0,
                               i = "0",
                               unmatched = seed && [],
                               setMatched = [],
                               contextBackup = outermostContext,
                               // We must always have either seed elements or outermost context
                               elems = seed || byElement && Expr.find["TAG"]("*", outermost),
                               // Use integer dirruns iff this is the outermost matcher
                               dirrunsUnique = (dirruns += contextBackup == null ? 1 : Math.random() || 0.1),
                               len = elems.length;
                           if (outermost) {
                               outermostContext = context === document || context || outermost;
                           }
                           // Add elements passing elementMatchers directly to results
                           // Support: IE<9, Safari
                           // Tolerate NodeList properties (IE: "length"; Safari: <number>) matching elements by id
                           for (; i !== len && (elem = elems[i]) != null; i++) {
                               if (byElement && elem) {
                                   j = 0;
                                   if (!context && elem.ownerDocument !== document) {
                                       setDocument(elem);
                                       xml = !documentIsHTML;
                                   }
                                   while ((matcher = elementMatchers[j++])) {
                                       if (matcher(elem, context || document, xml)) {
                                           results.push(elem);
                                           break;
                                       }
                                   }
                                   if (outermost) {
                                       dirruns = dirrunsUnique;
                                   }
                               }
                               // Track unmatched elements for set filters
                               if (bySet) {
                                   // They will have gone through all possible matchers
                                   if ((elem = !matcher && elem)) {
                                       matchedCount--;
                                   }
                                   // Lengthen the array for every element, matched or not
                                   if (seed) {
                                       unmatched.push(elem);
                                   }
                               }
                           }
                           // `i` is now the count of elements visited above, and adding it to `matchedCount`
                           // makes the latter nonnegative.
                           matchedCount += i;
                           // Apply set filters to unmatched elements
                           // NOTE: This can be skipped if there are no unmatched elements (i.e., `matchedCount`
                           // equals `i`), unless we didn't visit _any_ elements in the above loop because we have
                           // no element matchers and no seed.
                           // Incrementing an initially-string "0" `i` allows `i` to remain a string only in that
                           // case, which will result in a "00" `matchedCount` that differs from `i` but is also
                           // numerically zero.
                           if (bySet && i !== matchedCount) {
                               j = 0;
                               while ((matcher = setMatchers[j++])) {
                                   matcher(unmatched, setMatched, context, xml);
                               }
                               if (seed) {
                                   // Reintegrate element matches to eliminate the need for sorting
                                   if (matchedCount > 0) {
                                       while (i--) {
                                           if (!(unmatched[i] || setMatched[i])) {
                                               setMatched[i] = pop.call(results);
                                           }
                                       }
                                   }
                                   // Discard index placeholder values to get only actual matches
                                   setMatched = condense(setMatched);
                               }
                               // Add matches to results
                               push.apply(results, setMatched);
                               // Seedless set matches succeeding multiple successful matchers stipulate sorting
                               if (outermost && !seed && setMatched.length > 0 &&
                                   (matchedCount + setMatchers.length) > 1) {
                                   Sizzle.uniqueSort(results);
                               }
                           }
                           // Override manipulation of globals by nested matchers
                           if (outermost) {
                               dirruns = dirrunsUnique;
                               outermostContext = contextBackup;
                           }
                           return unmatched;
                       };
                   return bySet ?
                       markFunction(superMatcher) :
                       superMatcher;
               }
               compile = Sizzle.compile = function (selector, match /* Internal Use Only */ ) {
                   var i,
                       setMatchers = [],
                       elementMatchers = [],
                       cached = compilerCache[selector + " "];
                   if (!cached) {
                       // Generate a function of recursive functions that can be used to check each element
                       if (!match) {
                           match = tokenize(selector);
                       }
                       i = match.length;
                       while (i--) {
                           cached = matcherFromTokens(match[i]);
                           if (cached[expando]) {
                               setMatchers.push(cached);
                           } else {
                               elementMatchers.push(cached);
                           }
                       }
                       // Cache the compiled function
                       cached = compilerCache(selector, matcherFromGroupMatchers(elementMatchers,
                           setMatchers));
                       // Save selector and tokenization
                       cached.selector = selector;
                   }
                   return cached;
               };
               /**
                * A low-level selection function that works with Sizzle's compiled
                *  selector functions
                * @param {String|Function} selector A selector or a pre-compiled
                *  selector function built with Sizzle.compile
                * @param {Element} context
                * @param {Array} [results]
                * @param {Array} [seed] A set of elements to match against
                */
               select = Sizzle.select = function (selector, context, results, seed) {
                   var i, tokens, token, type, find,
                       compiled = typeof selector === "function" && selector,
                       match = !seed && tokenize((selector = compiled.selector || selector));
                   results = results || [];
                   // Try to minimize operations if there is only one selector in the list and no seed
                   // (the latter of which guarantees us context)
                   if (match.length === 1) {
                       // Reduce context if the leading compound selector is an ID
                       tokens = match[0] = match[0].slice(0);
                       if (tokens.length > 2 && (token = tokens[0]).type === "ID" &&
                           context.nodeType === 9 && documentIsHTML && Expr.relative[tokens[1].type]) {
                           context = (Expr.find["ID"](token.matches[0].replace(runescape, funescape),
                               context) || [])[0];
                           if (!context) {
                               return results;
                               // Precompiled matchers will still verify ancestry, so step up a level
                           } else if (compiled) {
                               context = context.parentNode;
                           }
                           selector = selector.slice(tokens.shift().value.length);
                       }
                       // Fetch a seed set for right-to-left matching
                       i = matchExpr["needsContext"].test(selector) ? 0 : tokens.length;
                       while (i--) {
                           token = tokens[i];
                           // Abort if we hit a combinator
                           if (Expr.relative[(type = token.type)]) {
                               break;
                           }
                           if ((find = Expr.find[type])) {
                               // Search, expanding context for leading sibling combinators
                               if ((seed = find(
                                       token.matches[0].replace(runescape, funescape),
                                       rsibling.test(tokens[0].type) && testContext(context
                                           .parentNode) || context
                                   ))) {
                                   // If seed is empty or no tokens remain, we can return early
                                   tokens.splice(i, 1);
                                   selector = seed.length && toSelector(tokens);
                                   if (!selector) {
                                       push.apply(results, seed);
                                       return results;
                                   }
                                   break;
                               }
                           }
                       }
                   }
                   // Compile and execute a filtering function if one is not provided
                   // Provide `match` to avoid retokenization if we modified the selector above
                   (compiled || compile(selector, match))(
                       seed,
                       context,
                       !documentIsHTML,
                       results,
                       !context || rsibling.test(selector) && testContext(context.parentNode) || context
                   );
                   return results;
               };
               // One-time assignments
               // Sort stability
               support.sortStable = expando.split("").sort(sortOrder).join("") === expando;
               // Support: Chrome 14-35+
               // Always assume duplicates if they aren't passed to the comparison function
               support.detectDuplicates = !!hasDuplicate;
               // Initialize against the default document
               setDocument();
               // Support: Webkit<537.32 - Safari 6.0.3/Chrome 25 (fixed in Chrome 27)
               // Detached nodes confoundingly follow *each other*
               support.sortDetached = assert(function (el) {
                   // Should return 1, but returns 4 (following)
                   return el.compareDocumentPosition(document.createElement("fieldset")) & 1;
               });
               // Support: IE<8
               // Prevent attribute/property "interpolation"
               // https://msdn.microsoft.com/en-us/library/ms536429%28VS.85%29.aspx
               if (!assert(function (el) {
                       el.innerHTML = "<a href='#'></a>";
                       return el.firstChild.getAttribute("href") === "#";
                   })) {
                   addHandle("type|href|height|width", function (elem, name, isXML) {
                       if (!isXML) {
                           return elem.getAttribute(name, name.toLowerCase() === "type" ? 1 : 2);
                       }
                   });
               }
               // Support: IE<9
               // Use defaultValue in place of getAttribute("value")
               if (!support.attributes || !assert(function (el) {
                       el.innerHTML = "<input/>";
                       el.firstChild.setAttribute("value", "");
                       return el.firstChild.getAttribute("value") === "";
                   })) {
                   addHandle("value", function (elem, name, isXML) {
                       if (!isXML && elem.nodeName.toLowerCase() === "input") {
                           return elem.defaultValue;
                       }
                   });
               }
               // Support: IE<9
               // Use getAttributeNode to fetch booleans when getAttribute lies
               if (!assert(function (el) {
                       return el.getAttribute("disabled") == null;
                   })) {
                   addHandle(booleans, function (elem, name, isXML) {
                       var val;
                       if (!isXML) {
                           return elem[name] === true ? name.toLowerCase() :
                               (val = elem.getAttributeNode(name)) && val.specified ?
                               val.value :
                               null;
                       }
                   });
               }
               return Sizzle;
           })(window);


       jQuery.find = Sizzle;
       jQuery.expr = Sizzle.selectors;
       // Deprecated
       jQuery.expr[":"] = jQuery.expr.pseudos;
       jQuery.uniqueSort = jQuery.unique = Sizzle.uniqueSort;
       jQuery.text = Sizzle.getText;
       jQuery.isXMLDoc = Sizzle.isXML;
       jQuery.contains = Sizzle.contains;
       jQuery.escapeSelector = Sizzle.escape;



       var dir = function (elem, dir, until) {
           var matched = [],
               truncate = until !== undefined;
           while ((elem = elem[dir]) && elem.nodeType !== 9) {
               if (elem.nodeType === 1) {
                   if (truncate && jQuery(elem).is(until)) {
                       break;
                   }
                   matched.push(elem);
               }
           }
           return matched;
       };


       var siblings = function (n, elem) {
           var matched = [];
           for (; n; n = n.nextSibling) {
               if (n.nodeType === 1 && n !== elem) {
                   matched.push(n);
               }
           }
           return matched;
       };


       var rneedsContext = jQuery.expr.match.needsContext;


       function nodeName(elem, name) {
           return elem.nodeName && elem.nodeName.toLowerCase() === name.toLowerCase();
       };
       var rsingleTag = (/^<([a-z][^\/\0>:\x20\t\r\n\f]*)[\x20\t\r\n\f]*\/?>(?:<\/\1>|)$/i);


       // Implement the identical functionality for filter and not
       function winnow(elements, qualifier, not) {
           if (isFunction(qualifier)) {
               return jQuery.grep(elements, function (elem, i) {
                   return !!qualifier.call(elem, i, elem) !== not;
               });
           }
           // Single element
           if (qualifier.nodeType) {
               return jQuery.grep(elements, function (elem) {
                   return (elem === qualifier) !== not;
               });
           }
           // Arraylike of elements (jQuery, arguments, Array)
           if (typeof qualifier !== "string") {
               return jQuery.grep(elements, function (elem) {
                   return (indexOf.call(qualifier, elem) > -1) !== not;
               });
           }
           // Filtered directly for both simple and complex selectors
           return jQuery.filter(qualifier, elements, not);
       }
       jQuery.filter = function (expr, elems, not) {
           var elem = elems[0];
           if (not) {
               expr = ":not(" + expr + ")";
           }
           if (elems.length === 1 && elem.nodeType === 1) {
               return jQuery.find.matchesSelector(elem, expr) ? [elem] : [];
           }
           return jQuery.find.matches(expr, jQuery.grep(elems, function (elem) {
               return elem.nodeType === 1;
           }));
       };
       jQuery.fn.extend({
           find: function (selector) {
               var i, ret,
                   len = this.length,
                   self = this;
               if (typeof selector !== "string") {
                   return this.pushStack(jQuery(selector).filter(function () {
                       for (i = 0; i < len; i++) {
                           if (jQuery.contains(self[i], this)) {
                               return true;
                           }
                       }
                   }));
               }
               ret = this.pushStack([]);
               for (i = 0; i < len; i++) {
                   jQuery.find(selector, self[i], ret);
               }
               return len > 1 ? jQuery.uniqueSort(ret) : ret;
           },
           filter: function (selector) {
               return this.pushStack(winnow(this, selector || [], false));
           },
           not: function (selector) {
               return this.pushStack(winnow(this, selector || [], true));
           },
           is: function (selector) {
               return !!winnow(
                   this,
                   // If this is a positional/relative selector, check membership in the returned set
                   // so $("p:first").is("p:last") won't return true for a doc with two "p".
                   typeof selector === "string" && rneedsContext.test(selector) ?
                   jQuery(selector) :
                   selector || [],
                   false
               ).length;
           }
       });


       // Initialize a jQuery object


       // A central reference to the root jQuery(document)
       var rootjQuery,
           // A simple way to check for HTML strings
           // Prioritize #id over <tag> to avoid XSS via location.hash (#9521)
           // Strict HTML recognition (#11290: must start with <)
           // Shortcut simple #id case for speed
           rquickExpr = /^(?:\s*(<[\w\W]+>)[^>]*|#([\w-]+))$/,
           init = jQuery.fn.init = function (selector, context, root) {
               var match, elem;
               // HANDLE: $(""), $(null), $(undefined), $(false)
               if (!selector) {
                   return this;
               }
               // Method init() accepts an alternate rootjQuery
               // so migrate can support jQuery.sub (gh-2101)
               root = root || rootjQuery;
               // Handle HTML strings
               if (typeof selector === "string") {
                   if (selector[0] === "<" &&
                       selector[selector.length - 1] === ">" &&
                       selector.length >= 3) {
                       // Assume that strings that start and end with <> are HTML and skip the regex check
                       match = [null, selector, null];
                   } else {
                       match = rquickExpr.exec(selector);
                   }
                   // Match html or make sure no context is specified for #id
                   if (match && (match[1] || !context)) {
                       // HANDLE: $(html) -> $(array)
                       if (match[1]) {
                           context = context instanceof jQuery ? context[0] : context;
                           // Option to run scripts is true for back-compat
                           // Intentionally let the error be thrown if parseHTML is not present
                           jQuery.merge(this, jQuery.parseHTML(
                               match[1],
                               context && context.nodeType ? context.ownerDocument || context : document,
                               true
                           ));
                           // HANDLE: $(html, props)
                           if (rsingleTag.test(match[1]) && jQuery.isPlainObject(context)) {
                               for (match in context) {
                                   // Properties of context are called as methods if possible
                                   if (isFunction(this[match])) {
                                       this[match](context[match]);
                                       // ...and otherwise set as attributes
                                   } else {
                                       this.attr(match, context[match]);
                                   }
                               }
                           }
                           return this;
                           // HANDLE: $(#id)
                       } else {
                           elem = document.getElementById(match[2]);
                           if (elem) {
                               // Inject the element directly into the jQuery object
                               this[0] = elem;
                               this.length = 1;
                           }
                           return this;
                       }
                       // HANDLE: $(expr, $(...))
                   } else if (!context || context.jquery) {
                       return (context || root).find(selector);
                       // HANDLE: $(expr, context)
                       // (which is just equivalent to: $(context).find(expr)
                   } else {
                       return this.constructor(context).find(selector);
                   }
                   // HANDLE: $(DOMElement)
               } else if (selector.nodeType) {
                   this[0] = selector;
                   this.length = 1;
                   return this;
                   // HANDLE: $(function)
                   // Shortcut for document ready
               } else if (isFunction(selector)) {
                   return root.ready !== undefined ?
                       root.ready(selector) :
                       // Execute immediately if ready is not present
                       selector(jQuery);
               }
               return jQuery.makeArray(selector, this);
           };
       // Give the init function the jQuery prototype for later instantiation
       init.prototype = jQuery.fn;
       // Initialize central reference
       rootjQuery = jQuery(document);


       var rparentsprev = /^(?:parents|prev(?:Until|All))/,
           // Methods guaranteed to produce a unique set when starting from a unique set
           guaranteedUnique = {
               children: true,
               contents: true,
               next: true,
               prev: true
           };
       jQuery.fn.extend({
           has: function (target) {
               var targets = jQuery(target, this),
                   l = targets.length;
               return this.filter(function () {
                   var i = 0;
                   for (; i < l; i++) {
                       if (jQuery.contains(this, targets[i])) {
                           return true;
                       }
                   }
               });
           },
           closest: function (selectors, context) {
               var cur,
                   i = 0,
                   l = this.length,
                   matched = [],
                   targets = typeof selectors !== "string" && jQuery(selectors);
               // Positional selectors never match, since there's no _selection_ context
               if (!rneedsContext.test(selectors)) {
                   for (; i < l; i++) {
                       for (cur = this[i]; cur && cur !== context; cur = cur.parentNode) {
                           // Always skip document fragments
                           if (cur.nodeType < 11 && (targets ?
                                   targets.index(cur) > -1 :
                                   // Don't pass non-elements to Sizzle
                                   cur.nodeType === 1 &&
                                   jQuery.find.matchesSelector(cur, selectors))) {
                               matched.push(cur);
                               break;
                           }
                       }
                   }
               }
               return this.pushStack(matched.length > 1 ? jQuery.uniqueSort(matched) : matched);
           },
           // Determine the position of an element within the set
           index: function (elem) {
               // No argument, return index in parent
               if (!elem) {
                   return (this[0] && this[0].parentNode) ? this.first().prevAll().length : -1;
               }
               // Index in selector
               if (typeof elem === "string") {
                   return indexOf.call(jQuery(elem), this[0]);
               }
               // Locate the position of the desired element
               return indexOf.call(this,
                   // If it receives a jQuery object, the first element is used
                   elem.jquery ? elem[0] : elem
               );
           },
           add: function (selector, context) {
               return this.pushStack(
                   jQuery.uniqueSort(
                       jQuery.merge(this.get(), jQuery(selector, context))
                   )
               );
           },
           addBack: function (selector) {
               return this.add(selector == null ?
                   this.prevObject : this.prevObject.filter(selector)
               );
           }
       });
       function sibling(cur, dir) {
           while ((cur = cur[dir]) && cur.nodeType !== 1) {}
           return cur;
       }
       jQuery.each({
           parent: function (elem) {
               var parent = elem.parentNode;
               return parent && parent.nodeType !== 11 ? parent : null;
           },
           parents: function (elem) {
               return dir(elem, "parentNode");
           },
           parentsUntil: function (elem, i, until) {
               return dir(elem, "parentNode", until);
           },
           next: function (elem) {
               return sibling(elem, "nextSibling");
           },
           prev: function (elem) {
               return sibling(elem, "previousSibling");
           },
           nextAll: function (elem) {
               return dir(elem, "nextSibling");
           },
           prevAll: function (elem) {
               return dir(elem, "previousSibling");
           },
           nextUntil: function (elem, i, until) {
               return dir(elem, "nextSibling", until);
           },
           prevUntil: function (elem, i, until) {
               return dir(elem, "previousSibling", until);
           },
           siblings: function (elem) {
               return siblings((elem.parentNode || {}).firstChild, elem);
           },
           children: function (elem) {
               return siblings(elem.firstChild);
           },
           contents: function (elem) {
               if (typeof elem.contentDocument !== "undefined") {
                   return elem.contentDocument;
               }
               // Support: IE 9 - 11 only, iOS 7 only, Android Browser <=4.3 only
               // Treat the template element as a regular one in browsers that
               // don't support it.
               if (nodeName(elem, "template")) {
                   elem = elem.content || elem;
               }
               return jQuery.merge([], elem.childNodes);
           }
       }, function (name, fn) {
           jQuery.fn[name] = function (until, selector) {
               var matched = jQuery.map(this, fn, until);
               if (name.slice(-5) !== "Until") {
                   selector = until;
               }
               if (selector && typeof selector === "string") {
                   matched = jQuery.filter(selector, matched);
               }
               if (this.length > 1) {
                   // Remove duplicates
                   if (!guaranteedUnique[name]) {
                       jQuery.uniqueSort(matched);
                   }
                   // Reverse order for parents* and prev-derivatives
                   if (rparentsprev.test(name)) {
                       matched.reverse();
                   }
               }
               return this.pushStack(matched);
           };
       });
       var rnothtmlwhite = (/[^\x20\t\r\n\f]+/g);


       // Convert String-formatted options into Object-formatted ones
       function createOptions(options) {
           var object = {};
           jQuery.each(options.match(rnothtmlwhite) || [], function (_, flag) {
               object[flag] = true;
           });
           return object;
       }
       /*
        * Create a callback list using the following parameters:
        *
        *	options: an optional list of space-separated options that will change how
        *			the callback list behaves or a more traditional option object
        *
        * By default a callback list will act like an event callback list and can be
        * "fired" multiple times.
        *
        * Possible options:
        *
        *	once:			will ensure the callback list can only be fired once (like a Deferred)
        *
        *	memory:			will keep track of previous values and will call any callback added
        *					after the list has been fired right away with the latest "memorized"
        *					values (like a Deferred)
        *
        *	unique:			will ensure a callback can only be added once (no duplicate in the list)
        *
        *	stopOnFalse:	interrupt callings when a callback returns false
        *
        */
       jQuery.Callbacks = function (options) {
           // Convert options from String-formatted to Object-formatted if needed
           // (we check in cache first)
           options = typeof options === "string" ?
               createOptions(options) :
               jQuery.extend({}, options);
           var // Flag to know if list is currently firing
               firing,
               // Last fire value for non-forgettable lists
               memory,
               // Flag to know if list was already fired
               fired,
               // Flag to prevent firing
               locked,
               // Actual callback list
               list = [],
               // Queue of execution data for repeatable lists
               queue = [],
               // Index of currently firing callback (modified by add/remove as needed)
               firingIndex = -1,
               // Fire callbacks
               fire = function () {
                   // Enforce single-firing
                   locked = locked || options.once;
                   // Execute callbacks for all pending executions,
                   // respecting firingIndex overrides and runtime changes
                   fired = firing = true;
                   for (; queue.length; firingIndex = -1) {
                       memory = queue.shift();
                       while (++firingIndex < list.length) {
                           // Run callback and check for early termination
                           if (list[firingIndex].apply(memory[0], memory[1]) === false &&
                               options.stopOnFalse) {
                               // Jump to end and forget the data so .add doesn't re-fire
                               firingIndex = list.length;
                               memory = false;
                           }
                       }
                   }
                   // Forget the data if we're done with it
                   if (!options.memory) {
                       memory = false;
                   }
                   firing = false;
                   // Clean up if we're done firing for good
                   if (locked) {
                       // Keep an empty list if we have data for future add calls
                       if (memory) {
                           list = [];
                           // Otherwise, this object is spent
                       } else {
                           list = "";
                       }
                   }
               },
               // Actual Callbacks object
               self = {
                   // Add a callback or a collection of callbacks to the list
                   add: function () {
                       if (list) {
                           // If we have memory from a past run, we should fire after adding
                           if (memory && !firing) {
                               firingIndex = list.length - 1;
                               queue.push(memory);
                           }
                           (function add(args) {
                               jQuery.each(args, function (_, arg) {
                                   if (isFunction(arg)) {
                                       if (!options.unique || !self.has(arg)) {
                                           list.push(arg);
                                       }
                                   } else if (arg && arg.length && toType(arg) !== "string") {
                                       // Inspect recursively
                                       add(arg);
                                   }
                               });
                           })(arguments);
                           if (memory && !firing) {
                               fire();
                           }
                       }
                       return this;
                   },
                   // Remove a callback from the list
                   remove: function () {
                       jQuery.each(arguments, function (_, arg) {
                           var index;
                           while ((index = jQuery.inArray(arg, list, index)) > -1) {
                               list.splice(index, 1);
                               // Handle firing indexes
                               if (index <= firingIndex) {
                                   firingIndex--;
                               }
                           }
                       });
                       return this;
                   },
                   // Check if a given callback is in the list.
                   // If no argument is given, return whether or not list has callbacks attached.
                   has: function (fn) {
                       return fn ?
                           jQuery.inArray(fn, list) > -1 :
                           list.length > 0;
                   },
                   // Remove all callbacks from the list
                   empty: function () {
                       if (list) {
                           list = [];
                       }
                       return this;
                   },
                   // Disable .fire and .add
                   // Abort any current/pending executions
                   // Clear all callbacks and values
                   disable: function () {
                       locked = queue = [];
                       list = memory = "";
                       return this;
                   },
                   disabled: function () {
                       return !list;
                   },
                   // Disable .fire
                   // Also disable .add unless we have memory (since it would have no effect)
                   // Abort any pending executions
                   lock: function () {
                       locked = queue = [];
                       if (!memory && !firing) {
                           list = memory = "";
                       }
                       return this;
                   },
                   locked: function () {
                       return !!locked;
                   },
                   // Call all callbacks with the given context and arguments
                   fireWith: function (context, args) {
                       if (!locked) {
                           args = args || [];
                           args = [context, args.slice ? args.slice() : args];
                           queue.push(args);
                           if (!firing) {
                               fire();
                           }
                       }
                       return this;
                   },
                   // Call all the callbacks with the given arguments
                   fire: function () {
                       self.fireWith(this, arguments);
                       return this;
                   },
                   // To know if the callbacks have already been called at least once
                   fired: function () {
                       return !!fired;
                   }
               };
           return self;
       };


       function Identity(v) {
           return v;
       }
       function Thrower(ex) {
           throw ex;
       }
       function adoptValue(value, resolve, reject, noValue) {
           var method;
           try {
               // Check for promise aspect first to privilege synchronous behavior
               if (value && isFunction((method = value.promise))) {
                   method.call(value).done(resolve).fail(reject);
                   // Other thenables
               } else if (value && isFunction((method = value.then))) {
                   method.call(value, resolve, reject);
                   // Other non-thenables
               } else {
                   // Control `resolve` arguments by letting Array#slice cast boolean `noValue` to integer:
                   // * false: [ value ].slice( 0 ) => resolve( value )
                   // * true: [ value ].slice( 1 ) => resolve()
                   resolve.apply(undefined, [value].slice(noValue));
               }
               // For Promises/A+, convert exceptions into rejections
               // Since jQuery.when doesn't unwrap thenables, we can skip the extra checks appearing in
               // Deferred#then to conditionally suppress rejection.
           } catch (value) {
               // Support: Android 4.0 only
               // Strict mode functions invoked without .call/.apply get global-object context
               reject.apply(undefined, [value]);
           }
       }
       jQuery.extend({
           Deferred: function (func) {
               var tuples = [
                       // action, add listener, callbacks,
                       // ... .then handlers, argument index, [final state]
                       ["notify", "progress", jQuery.Callbacks("memory"),
                           jQuery.Callbacks("memory"), 2
                       ],
                       ["resolve", "done", jQuery.Callbacks("once memory"),
                           jQuery.Callbacks("once memory"), 0, "resolved"
                       ],
                       ["reject", "fail", jQuery.Callbacks("once memory"),
                           jQuery.Callbacks("once memory"), 1, "rejected"
                       ]
                   ],
                   state = "pending",
                   promise = {
                       state: function () {
                           return state;
                       },
                       always: function () {
                           deferred.done(arguments).fail(arguments);
                           return this;
                       },
                       "catch": function (fn) {
                           return promise.then(null, fn);
                       },
                       // Keep pipe for back-compat
                       pipe: function ( /* fnDone, fnFail, fnProgress */ ) {
                           var fns = arguments;
                           return jQuery.Deferred(function (newDefer) {
                               jQuery.each(tuples, function (i, tuple) {
                                   // Map tuples (progress, done, fail) to arguments (done, fail, progress)
                                   var fn = isFunction(fns[tuple[4]]) && fns[tuple[
                                       4]];
                                   // deferred.progress(function() { bind to newDefer or newDefer.notify })
                                   // deferred.done(function() { bind to newDefer or newDefer.resolve })
                                   // deferred.fail(function() { bind to newDefer or newDefer.reject })
                                   deferred[tuple[1]](function () {
                                       var returned = fn && fn.apply(this,
                                           arguments);
                                       if (returned && isFunction(returned
                                               .promise)) {
                                           returned.promise()
                                               .progress(newDefer.notify)
                                               .done(newDefer.resolve)
                                               .fail(newDefer.reject);
                                       } else {
                                           newDefer[tuple[0] + "With"](
                                               this,
                                               fn ? [returned] :
                                               arguments
                                           );
                                       }
                                   });
                               });
                               fns = null;
                           }).promise();
                       },
                       then: function (onFulfilled, onRejected, onProgress) {
                           var maxDepth = 0;
                           function resolve(depth, deferred, handler, special) {
                               return function () {
                                   var that = this,
                                       args = arguments,
                                       mightThrow = function () {
                                           var returned, then;
                                           // Support: Promises/A+ section 2.3.3.3.3
                                           // https://promisesaplus.com/#point-59
                                           // Ignore double-resolution attempts
                                           if (depth < maxDepth) {
                                               return;
                                           }
                                           returned = handler.apply(that, args);
                                           // Support: Promises/A+ section 2.3.1
                                           // https://promisesaplus.com/#point-48
                                           if (returned === deferred.promise()) {
                                               throw new TypeError("Thenable self-resolution");
                                           }
                                           // Support: Promises/A+ sections 2.3.3.1, 3.5
                                           // https://promisesaplus.com/#point-54
                                           // https://promisesaplus.com/#point-75
                                           // Retrieve `then` only once
                                           then = returned &&
                                               // Support: Promises/A+ section 2.3.4
                                               // https://promisesaplus.com/#point-64
                                               // Only check objects and functions for thenability
                                               (typeof returned === "object" ||
                                                   typeof returned === "function") &&
                                               returned.then;
                                           // Handle a returned thenable
                                           if (isFunction(then)) {
                                               // Special processors (notify) just wait for resolution
                                               if (special) {
                                                   then.call(
                                                       returned,
                                                       resolve(maxDepth, deferred,
                                                           Identity, special),
                                                       resolve(maxDepth, deferred, Thrower,
                                                           special)
                                                   );
                                                   // Normal processors (resolve) also hook into progress
                                               } else {
                                                   // ...and disregard older resolution values
                                                   maxDepth++;
                                                   then.call(
                                                       returned,
                                                       resolve(maxDepth, deferred,
                                                           Identity, special),
                                                       resolve(maxDepth, deferred, Thrower,
                                                           special),
                                                       resolve(maxDepth, deferred,
                                                           Identity,
                                                           deferred.notifyWith)
                                                   );
                                               }
                                               // Handle all other returned values
                                           } else {
                                               // Only substitute handlers pass on context
                                               // and multiple values (non-spec behavior)
                                               if (handler !== Identity) {
                                                   that = undefined;
                                                   args = [returned];
                                               }
                                               // Process the value(s)
                                               // Default process is resolve
                                               (special || deferred.resolveWith)(that, args);
                                           }
                                       },
                                       // Only normal processors (resolve) catch and reject exceptions
                                       process = special ?
                                       mightThrow :
                                       function () {
                                           try {
                                               mightThrow();
                                           } catch (e) {
                                               if (jQuery.Deferred.exceptionHook) {
                                                   jQuery.Deferred.exceptionHook(e,
                                                       process.stackTrace);
                                               }
                                               // Support: Promises/A+ section 2.3.3.3.4.1
                                               // https://promisesaplus.com/#point-61
                                               // Ignore post-resolution exceptions
                                               if (depth + 1 >= maxDepth) {
                                                   // Only substitute handlers pass on context
                                                   // and multiple values (non-spec behavior)
                                                   if (handler !== Thrower) {
                                                       that = undefined;
                                                       args = [e];
                                                   }
                                                   deferred.rejectWith(that, args);
                                               }
                                           }
                                       };
                                   // Support: Promises/A+ section 2.3.3.3.1
                                   // https://promisesaplus.com/#point-57
                                   // Re-resolve promises immediately to dodge false rejection from
                                   // subsequent errors
                                   if (depth) {
                                       process();
                                   } else {
                                       // Call an optional hook to record the stack, in case of exception
                                       // since it's otherwise lost when execution goes async
                                       if (jQuery.Deferred.getStackHook) {
                                           process.stackTrace = jQuery.Deferred.getStackHook();
                                       }
                                       window.setTimeout(process);
                                   }
                               };
                           }
                           return jQuery.Deferred(function (newDefer) {
                               // progress_handlers.add( ... )
                               tuples[0][3].add(
                                   resolve(
                                       0,
                                       newDefer,
                                       isFunction(onProgress) ?
                                       onProgress :
                                       Identity,
                                       newDefer.notifyWith
                                   )
                               );
                               // fulfilled_handlers.add( ... )
                               tuples[1][3].add(
                                   resolve(
                                       0,
                                       newDefer,
                                       isFunction(onFulfilled) ?
                                       onFulfilled :
                                       Identity
                                   )
                               );
                               // rejected_handlers.add( ... )
                               tuples[2][3].add(
                                   resolve(
                                       0,
                                       newDefer,
                                       isFunction(onRejected) ?
                                       onRejected :
                                       Thrower
                                   )
                               );
                           }).promise();
                       },
                       // Get a promise for this deferred
                       // If obj is provided, the promise aspect is added to the object
                       promise: function (obj) {
                           return obj != null ? jQuery.extend(obj, promise) : promise;
                       }
                   },
                   deferred = {};
               // Add list-specific methods
               jQuery.each(tuples, function (i, tuple) {
                   var list = tuple[2],
                       stateString = tuple[5];
                   // promise.progress = list.add
                   // promise.done = list.add
                   // promise.fail = list.add
                   promise[tuple[1]] = list.add;
                   // Handle state
                   if (stateString) {
                       list.add(
                           function () {
                               // state = "resolved" (i.e., fulfilled)
                               // state = "rejected"
                               state = stateString;
                           },
                           // rejected_callbacks.disable
                           // fulfilled_callbacks.disable
                           tuples[3 - i][2].disable,
                           // rejected_handlers.disable
                           // fulfilled_handlers.disable
                           tuples[3 - i][3].disable,
                           // progress_callbacks.lock
                           tuples[0][2].lock,
                           // progress_handlers.lock
                           tuples[0][3].lock
                       );
                   }
                   // progress_handlers.fire
                   // fulfilled_handlers.fire
                   // rejected_handlers.fire
                   list.add(tuple[3].fire);
                   // deferred.notify = function() { deferred.notifyWith(...) }
                   // deferred.resolve = function() { deferred.resolveWith(...) }
                   // deferred.reject = function() { deferred.rejectWith(...) }
                   deferred[tuple[0]] = function () {
                       deferred[tuple[0] + "With"](this === deferred ? undefined : this,
                           arguments);
                       return this;
                   };
                   // deferred.notifyWith = list.fireWith
                   // deferred.resolveWith = list.fireWith
                   // deferred.rejectWith = list.fireWith
                   deferred[tuple[0] + "With"] = list.fireWith;
               });
               // Make the deferred a promise
               promise.promise(deferred);
               // Call given func if any
               if (func) {
                   func.call(deferred, deferred);
               }
               // All done!
               return deferred;
           },
           // Deferred helper
           when: function (singleValue) {
               var
                   // count of uncompleted subordinates
                   remaining = arguments.length,
                   // count of unprocessed arguments
                   i = remaining,
                   // subordinate fulfillment data
                   resolveContexts = Array(i),
                   resolveValues = slice.call(arguments),
                   // the master Deferred
                   master = jQuery.Deferred(),
                   // subordinate callback factory
                   updateFunc = function (i) {
                       return function (value) {
                           resolveContexts[i] = this;
                           resolveValues[i] = arguments.length > 1 ? slice.call(arguments) : value;
                           if (!(--remaining)) {
                               master.resolveWith(resolveContexts, resolveValues);
                           }
                       };
                   };
               // Single- and empty arguments are adopted like Promise.resolve
               if (remaining <= 1) {
                   adoptValue(singleValue, master.done(updateFunc(i)).resolve, master.reject,
                       !remaining);
                   // Use .then() to unwrap secondary thenables (cf. gh-3000)
                   if (master.state() === "pending" ||
                       isFunction(resolveValues[i] && resolveValues[i].then)) {
                       return master.then();
                   }
               }
               // Multiple arguments are aggregated like Promise.all array elements
               while (i--) {
                   adoptValue(resolveValues[i], updateFunc(i), master.reject);
               }
               return master.promise();
           }
       });


       // These usually indicate a programmer mistake during development,
       // warn about them ASAP rather than swallowing them by default.
       var rerrorNames = /^(Eval|Internal|Range|Reference|Syntax|Type|URI)Error$/;
       jQuery.Deferred.exceptionHook = function (error, stack) {
           // Support: IE 8 - 9 only
           // Console exists when dev tools are open, which can happen at any time
           if (window.console && window.console.warn && error && rerrorNames.test(error.name)) {
               window.console.warn("jQuery.Deferred exception: " + error.message, error.stack, stack);
           }
       };



       jQuery.readyException = function (error) {
           window.setTimeout(function () {
               throw error;
           });
       };



       // The deferred used on DOM ready
       var readyList = jQuery.Deferred();
       jQuery.fn.ready = function (fn) {
           readyList
               .then(fn)
               // Wrap jQuery.readyException in a function so that the lookup
               // happens at the time of error handling instead of callback
               // registration.
               .catch(function (error) {
                   jQuery.readyException(error);
               });
           return this;
       };
       jQuery.extend({
           // Is the DOM ready to be used? Set to true once it occurs.
           isReady: false,
           // A counter to track how many items to wait for before
           // the ready event fires. See #6781
           readyWait: 1,
           // Handle when the DOM is ready
           ready: function (wait) {
               // Abort if there are pending holds or we're already ready
               if (wait === true ? --jQuery.readyWait : jQuery.isReady) {
                   return;
               }
               // Remember that the DOM is ready
               jQuery.isReady = true;
               // If a normal DOM Ready event fired, decrement, and wait if need be
               if (wait !== true && --jQuery.readyWait > 0) {
                   return;
               }
               // If there are functions bound, to execute
               readyList.resolveWith(document, [jQuery]);
           }
       });
       jQuery.ready.then = readyList.then;
       // The ready event handler and self cleanup method
       function completed() {
           document.removeEventListener("DOMContentLoaded", completed);
           window.removeEventListener("load", completed);
           jQuery.ready();
       }
       // Catch cases where $(document).ready() is called
       // after the browser event has already occurred.
       // Support: IE <=9 - 10 only
       // Older IE sometimes signals "interactive" too soon
       if (document.readyState === "complete" ||
           (document.readyState !== "loading" && !document.documentElement.doScroll)) {
           // Handle it asynchronously to allow scripts the opportunity to delay ready
           window.setTimeout(jQuery.ready);
       } else {
           // Use the handy event callback
           document.addEventListener("DOMContentLoaded", completed);
           // A fallback to window.onload, that will always work
           window.addEventListener("load", completed);
       }



       // Multifunctional method to get and set values of a collection
       // The value/s can optionally be executed if it's a function
       var access = function (elems, fn, key, value, chainable, emptyGet, raw) {
           var i = 0,
               len = elems.length,
               bulk = key == null;
           // Sets many values
           if (toType(key) === "object") {
               chainable = true;
               for (i in key) {
                   access(elems, fn, i, key[i], true, emptyGet, raw);
               }
               // Sets one value
           } else if (value !== undefined) {
               chainable = true;
               if (!isFunction(value)) {
                   raw = true;
               }
               if (bulk) {
                   // Bulk operations run against the entire set
                   if (raw) {
                       fn.call(elems, value);
                       fn = null;
                       // ...except when executing function values
                   } else {
                       bulk = fn;
                       fn = function (elem, key, value) {
                           return bulk.call(jQuery(elem), value);
                       };
                   }
               }
               if (fn) {
                   for (; i < len; i++) {
                       fn(
                           elems[i], key, raw ?
                           value :
                           value.call(elems[i], i, fn(elems[i], key))
                       );
                   }
               }
           }
           if (chainable) {
               return elems;
           }
           // Gets
           if (bulk) {
               return fn.call(elems);
           }
           return len ? fn(elems[0], key) : emptyGet;
       };


       // Matches dashed string for camelizing
       var rmsPrefix = /^-ms-/,
           rdashAlpha = /-([a-z])/g;
       // Used by camelCase as callback to replace()
       function fcamelCase(all, letter) {
           return letter.toUpperCase();
       }
       // Convert dashed to camelCase; used by the css and data modules
       // Support: IE <=9 - 11, Edge 12 - 15
       // Microsoft forgot to hump their vendor prefix (#9572)
       function camelCase(string) {
           return string.replace(rmsPrefix, "ms-").replace(rdashAlpha, fcamelCase);
       }
       var acceptData = function (owner) {
           // Accepts only:
           //  - Node
           //    - Node.ELEMENT_NODE
           //    - Node.DOCUMENT_NODE
           //  - Object
           //    - Any
           return owner.nodeType === 1 || owner.nodeType === 9 || !(+owner.nodeType);
       };



       function Data() {
           this.expando = jQuery.expando + Data.uid++;
       }
       Data.uid = 1;
       Data.prototype = {
           cache: function (owner) {
               // Check if the owner object already has a cache
               var value = owner[this.expando];
               // If not, create one
               if (!value) {
                   value = {};
                   // We can accept data for non-element nodes in modern browsers,
                   // but we should not, see #8335.
                   // Always return an empty object.
                   if (acceptData(owner)) {
                       // If it is a node unlikely to be stringify-ed or looped over
                       // use plain assignment
                       if (owner.nodeType) {
                           owner[this.expando] = value;
                           // Otherwise secure it in a non-enumerable property
                           // configurable must be true to allow the property to be
                           // deleted when data is removed
                       } else {
                           Object.defineProperty(owner, this.expando, {
                               value: value,
                               configurable: true
                           });
                       }
                   }
               }
               return value;
           },
           set: function (owner, data, value) {
               var prop,
                   cache = this.cache(owner);
               // Handle: [ owner, key, value ] args
               // Always use camelCase key (gh-2257)
               if (typeof data === "string") {
                   cache[camelCase(data)] = value;
                   // Handle: [ owner, { properties } ] args
               } else {
                   // Copy the properties one-by-one to the cache object
                   for (prop in data) {
                       cache[camelCase(prop)] = data[prop];
                   }
               }
               return cache;
           },
           get: function (owner, key) {
               return key === undefined ?
                   this.cache(owner) :
                   // Always use camelCase key (gh-2257)
                   owner[this.expando] && owner[this.expando][camelCase(key)];
           },
           access: function (owner, key, value) {
               // In cases where either:
               //
               //   1. No key was specified
               //   2. A string key was specified, but no value provided
               //
               // Take the "read" path and allow the get method to determine
               // which value to return, respectively either:
               //
               //   1. The entire cache object
               //   2. The data stored at the key
               //
               if (key === undefined ||
                   ((key && typeof key === "string") && value === undefined)) {
                   return this.get(owner, key);
               }
               // When the key is not a string, or both a key and value
               // are specified, set or extend (existing objects) with either:
               //
               //   1. An object of properties
               //   2. A key and value
               //
               this.set(owner, key, value);
               // Since the "set" path can have two possible entry points
               // return the expected data based on which path was taken[*]
               return value !== undefined ? value : key;
           },
           remove: function (owner, key) {
               var i,
                   cache = owner[this.expando];
               if (cache === undefined) {
                   return;
               }
               if (key !== undefined) {
                   // Support array or space separated string of keys
                   if (Array.isArray(key)) {
                       // If key is an array of keys...
                       // We always set camelCase keys, so remove that.
                       key = key.map(camelCase);
                   } else {
                       key = camelCase(key);
                       // If a key with the spaces exists, use it.
                       // Otherwise, create an array by matching non-whitespace
                       key = key in cache ? [key] :
                           (key.match(rnothtmlwhite) || []);
                   }
                   i = key.length;
                   while (i--) {
                       delete cache[key[i]];
                   }
               }
               // Remove the expando if there's no more data
               if (key === undefined || jQuery.isEmptyObject(cache)) {
                   // Support: Chrome <=35 - 45
                   // Webkit & Blink performance suffers when deleting properties
                   // from DOM nodes, so set to undefined instead
                   // https://bugs.chromium.org/p/chromium/issues/detail?id=378607 (bug restricted)
                   if (owner.nodeType) {
                       owner[this.expando] = undefined;
                   } else {
                       delete owner[this.expando];
                   }
               }
           },
           hasData: function (owner) {
               var cache = owner[this.expando];
               return cache !== undefined && !jQuery.isEmptyObject(cache);
           }
       };
       var dataPriv = new Data();
       var dataUser = new Data();


       //	Implementation Summary
       //
       //	1. Enforce API surface and semantic compatibility with 1.9.x branch
       //	2. Improve the module's maintainability by reducing the storage
       //		paths to a single mechanism.
       //	3. Use the same single mechanism to support "private" and "user" data.
       //	4. _Never_ expose "private" data to user code (TODO: Drop _data, _removeData)
       //	5. Avoid exposing implementation details on user objects (eg. expando properties)
       //	6. Provide a clear path for implementation upgrade to WeakMap in 2014
       var rbrace = /^(?:\{[\w\W]*\}|\[[\w\W]*\])$/,
           rmultiDash = /[A-Z]/g;
       function getData(data) {
           if (data === "true") {
               return true;
           }
           if (data === "false") {
               return false;
           }
           if (data === "null") {
               return null;
           }
           // Only convert to a number if it doesn't change the string
           if (data === +data + "") {
               return +data;
           }
           if (rbrace.test(data)) {
               return JSON.parse(data);
           }
           return data;
       }
       function dataAttr(elem, key, data) {
           var name;
           // If nothing was found internally, try to fetch any
           // data from the HTML5 data-* attribute
           if (data === undefined && elem.nodeType === 1) {
               name = "data-" + key.replace(rmultiDash, "-$&").toLowerCase();
               data = elem.getAttribute(name);
               if (typeof data === "string") {
                   try {
                       data = getData(data);
                   } catch (e) {}
                   // Make sure we set the data so it isn't changed later
                   dataUser.set(elem, key, data);
               } else {
                   data = undefined;
               }
           }
           return data;
       }
       jQuery.extend({
           hasData: function (elem) {
               return dataUser.hasData(elem) || dataPriv.hasData(elem);
           },
           data: function (elem, name, data) {
               return dataUser.access(elem, name, data);
           },
           removeData: function (elem, name) {
               dataUser.remove(elem, name);
           },
           // TODO: Now that all calls to _data and _removeData have been replaced
           // with direct calls to dataPriv methods, these can be deprecated.
           _data: function (elem, name, data) {
               return dataPriv.access(elem, name, data);
           },
           _removeData: function (elem, name) {
               dataPriv.remove(elem, name);
           }
       });
       jQuery.fn.extend({
           data: function (key, value) {
               var i, name, data,
                   elem = this[0],
                   attrs = elem && elem.attributes;
               // Gets all values
               if (key === undefined) {
                   if (this.length) {
                       data = dataUser.get(elem);
                       if (elem.nodeType === 1 && !dataPriv.get(elem, "hasDataAttrs")) {
                           i = attrs.length;
                           while (i--) {
                               // Support: IE 11 only
                               // The attrs elements can be null (#14894)
                               if (attrs[i]) {
                                   name = attrs[i].name;
                                   if (name.indexOf("data-") === 0) {
                                       name = camelCase(name.slice(5));
                                       dataAttr(elem, name, data[name]);
                                   }
                               }
                           }
                           dataPriv.set(elem, "hasDataAttrs", true);
                       }
                   }
                   return data;
               }
               // Sets multiple values
               if (typeof key === "object") {
                   return this.each(function () {
                       dataUser.set(this, key);
                   });
               }
               return access(this, function (value) {
                   var data;
                   // The calling jQuery object (element matches) is not empty
                   // (and therefore has an element appears at this[ 0 ]) and the
                   // `value` parameter was not undefined. An empty jQuery object
                   // will result in `undefined` for elem = this[ 0 ] which will
                   // throw an exception if an attempt to read a data cache is made.
                   if (elem && value === undefined) {
                       // Attempt to get data from the cache
                       // The key will always be camelCased in Data
                       data = dataUser.get(elem, key);
                       if (data !== undefined) {
                           return data;
                       }
                       // Attempt to "discover" the data in
                       // HTML5 custom data-* attrs
                       data = dataAttr(elem, key);
                       if (data !== undefined) {
                           return data;
                       }
                       // We tried really hard, but the data doesn't exist.
                       return;
                   }
                   // Set the data...
                   this.each(function () {
                       // We always store the camelCased key
                       dataUser.set(this, key, value);
                   });
               }, null, value, arguments.length > 1, null, true);
           },
           removeData: function (key) {
               return this.each(function () {
                   dataUser.remove(this, key);
               });
           }
       });


       jQuery.extend({
           queue: function (elem, type, data) {
               var queue;
               if (elem) {
                   type = (type || "fx") + "queue";
                   queue = dataPriv.get(elem, type);
                   // Speed up dequeue by getting out quickly if this is just a lookup
                   if (data) {
                       if (!queue || Array.isArray(data)) {
                           queue = dataPriv.access(elem, type, jQuery.makeArray(data));
                       } else {
                           queue.push(data);
                       }
                   }
                   return queue || [];
               }
           },
           dequeue: function (elem, type) {
               type = type || "fx";
               var queue = jQuery.queue(elem, type),
                   startLength = queue.length,
                   fn = queue.shift(),
                   hooks = jQuery._queueHooks(elem, type),
                   next = function () {
                       jQuery.dequeue(elem, type);
                   };
               // If the fx queue is dequeued, always remove the progress sentinel
               if (fn === "inprogress") {
                   fn = queue.shift();
                   startLength--;
               }
               if (fn) {
                   // Add a progress sentinel to prevent the fx queue from being
                   // automatically dequeued
                   if (type === "fx") {
                       queue.unshift("inprogress");
                   }
                   // Clear up the last queue stop function
                   delete hooks.stop;
                   fn.call(elem, next, hooks);
               }
               if (!startLength && hooks) {
                   hooks.empty.fire();
               }
           },
           // Not public - generate a queueHooks object, or return the current one
           _queueHooks: function (elem, type) {
               var key = type + "queueHooks";
               return dataPriv.get(elem, key) || dataPriv.access(elem, key, {
                   empty: jQuery.Callbacks("once memory").add(function () {
                       dataPriv.remove(elem, [type + "queue", key]);
                   })
               });
           }
       });
       jQuery.fn.extend({
           queue: function (type, data) {
               var setter = 2;
               if (typeof type !== "string") {
                   data = type;
                   type = "fx";
                   setter--;
               }
               if (arguments.length < setter) {
                   return jQuery.queue(this[0], type);
               }
               return data === undefined ?
                   this :
                   this.each(function () {
                       var queue = jQuery.queue(this, type, data);
                       // Ensure a hooks for this queue
                       jQuery._queueHooks(this, type);
                       if (type === "fx" && queue[0] !== "inprogress") {
                           jQuery.dequeue(this, type);
                       }
                   });
           },
           dequeue: function (type) {
               return this.each(function () {
                   jQuery.dequeue(this, type);
               });
           },
           clearQueue: function (type) {
               return this.queue(type || "fx", []);
           },
           // Get a promise resolved when queues of a certain type
           // are emptied (fx is the type by default)
           promise: function (type, obj) {
               var tmp,
                   count = 1,
                   defer = jQuery.Deferred(),
                   elements = this,
                   i = this.length,
                   resolve = function () {
                       if (!(--count)) {
                           defer.resolveWith(elements, [elements]);
                       }
                   };
               if (typeof type !== "string") {
                   obj = type;
                   type = undefined;
               }
               type = type || "fx";
               while (i--) {
                   tmp = dataPriv.get(elements[i], type + "queueHooks");
                   if (tmp && tmp.empty) {
                       count++;
                       tmp.empty.add(resolve);
                   }
               }
               resolve();
               return defer.promise(obj);
           }
       });
       var pnum = (/[+-]?(?:\d*\.|)\d+(?:[eE][+-]?\d+|)/).source;
       var rcssNum = new RegExp("^(?:([+-])=|)(" + pnum + ")([a-z%]*)$", "i");


       var cssExpand = ["Top", "Right", "Bottom", "Left"];
       var documentElement = document.documentElement;


       var isAttached = function (elem) {
               return jQuery.contains(elem.ownerDocument, elem);
           },
           composed = {
               composed: true
           };
       // Support: IE 9 - 11+, Edge 12 - 18+, iOS 10.0 - 10.2 only
       // Check attachment across shadow DOM boundaries when possible (gh-3504)
       // Support: iOS 10.0-10.2 only
       // Early iOS 10 versions support `attachShadow` but not `getRootNode`,
       // leading to errors. We need to check for `getRootNode`.
       if (documentElement.getRootNode) {
           isAttached = function (elem) {
               return jQuery.contains(elem.ownerDocument, elem) ||
                   elem.getRootNode(composed) === elem.ownerDocument;
           };
       }
       var isHiddenWithinTree = function (elem, el) {
           // isHiddenWithinTree might be called from jQuery#filter function;
           // in that case, element will be second argument
           elem = el || elem;
           // Inline style trumps all
           return elem.style.display === "none" ||
               elem.style.display === "" &&
               // Otherwise, check computed style
               // Support: Firefox <=43 - 45
               // Disconnected elements can have computed display: none, so first confirm that elem is
               // in the document.
               isAttached(elem) &&
               jQuery.css(elem, "display") === "none";
       };
       var swap = function (elem, options, callback, args) {
           var ret, name,
               old = {};
           // Remember the old values, and insert the new ones
           for (name in options) {
               old[name] = elem.style[name];
               elem.style[name] = options[name];
           }
           ret = callback.apply(elem, args || []);
           // Revert the old values
           for (name in options) {
               elem.style[name] = old[name];
           }
           return ret;
       };



       function adjustCSS(elem, prop, valueParts, tween) {
           var adjusted, scale,
               maxIterations = 20,
               currentValue = tween ?
               function () {
                   return tween.cur();
               } :
               function () {
                   return jQuery.css(elem, prop, "");
               },
               initial = currentValue(),
               unit = valueParts && valueParts[3] || (jQuery.cssNumber[prop] ? "" : "px"),
               // Starting value computation is required for potential unit mismatches
               initialInUnit = elem.nodeType &&
               (jQuery.cssNumber[prop] || unit !== "px" && +initial) &&
               rcssNum.exec(jQuery.css(elem, prop));
           if (initialInUnit && initialInUnit[3] !== unit) {
               // Support: Firefox <=54
               // Halve the iteration target value to prevent interference from CSS upper bounds (gh-2144)
               initial = initial / 2;
               // Trust units reported by jQuery.css
               unit = unit || initialInUnit[3];
               // Iteratively approximate from a nonzero starting point
               initialInUnit = +initial || 1;
               while (maxIterations--) {
                   // Evaluate and update our best guess (doubling guesses that zero out).
                   // Finish if the scale equals or crosses 1 (making the old*new product non-positive).
                   jQuery.style(elem, prop, initialInUnit + unit);
                   if ((1 - scale) * (1 - (scale = currentValue() / initial || 0.5)) <= 0) {
                       maxIterations = 0;
                   }
                   initialInUnit = initialInUnit / scale;
               }
               initialInUnit = initialInUnit * 2;
               jQuery.style(elem, prop, initialInUnit + unit);
               // Make sure we update the tween properties later on
               valueParts = valueParts || [];
           }
           if (valueParts) {
               initialInUnit = +initialInUnit || +initial || 0;
               // Apply relative offset (+=/-=) if specified
               adjusted = valueParts[1] ?
                   initialInUnit + (valueParts[1] + 1) * valueParts[2] :
                   +valueParts[2];
               if (tween) {
                   tween.unit = unit;
                   tween.start = initialInUnit;
                   tween.end = adjusted;
               }
           }
           return adjusted;
       }


       var defaultDisplayMap = {};
       function getDefaultDisplay(elem) {
           var temp,
               doc = elem.ownerDocument,
               nodeName = elem.nodeName,
               display = defaultDisplayMap[nodeName];
           if (display) {
               return display;
           }
           temp = doc.body.appendChild(doc.createElement(nodeName));
           display = jQuery.css(temp, "display");
           temp.parentNode.removeChild(temp);
           if (display === "none") {
               display = "block";
           }
           defaultDisplayMap[nodeName] = display;
           return display;
       }
       function showHide(elements, show) {
           var display, elem,
               values = [],
               index = 0,
               length = elements.length;
           // Determine new display value for elements that need to change
           for (; index < length; index++) {
               elem = elements[index];
               if (!elem.style) {
                   continue;
               }
               display = elem.style.display;
               if (show) {
                   // Since we force visibility upon cascade-hidden elements, an immediate (and slow)
                   // check is required in this first loop unless we have a nonempty display value (either
                   // inline or about-to-be-restored)
                   if (display === "none") {
                       values[index] = dataPriv.get(elem, "display") || null;
                       if (!values[index]) {
                           elem.style.display = "";
                       }
                   }
                   if (elem.style.display === "" && isHiddenWithinTree(elem)) {
                       values[index] = getDefaultDisplay(elem);
                   }
               } else {
                   if (display !== "none") {
                       values[index] = "none";
                       // Remember what we're overwriting
                       dataPriv.set(elem, "display", display);
                   }
               }
           }
           // Set the display of the elements in a second loop to avoid constant reflow
           for (index = 0; index < length; index++) {
               if (values[index] != null) {
                   elements[index].style.display = values[index];
               }
           }
           return elements;
       }
       jQuery.fn.extend({
           show: function () {
               return showHide(this, true);
           },
           hide: function () {
               return showHide(this);
           },
           toggle: function (state) {
               if (typeof state === "boolean") {
                   return state ? this.show() : this.hide();
               }
               return this.each(function () {
                   if (isHiddenWithinTree(this)) {
                       jQuery(this).show();
                   } else {
                       jQuery(this).hide();
                   }
               });
           }
       });
       var rcheckableType = (/^(?:checkbox|radio)$/i);
       var rtagName = (/<([a-z][^\/\0>\x20\t\r\n\f]*)/i);
       var rscriptType = (/^$|^module$|\/(?:java|ecma)script/i);


       // We have to close these tags to support XHTML (#13200)
       var wrapMap = {
           // Support: IE <=9 only
           option: [1, "<select multiple='multiple'>", "</select>"],
           // XHTML parsers do not magically insert elements in the
           // same way that tag soup parsers do. So we cannot shorten
           // this by omitting <tbody> or other required elements.
thead: [1, "", "
"], col: [2, "<colgroup>", "</colgroup>
"], tr: [2, "<tbody>", "</tbody>
"], td: [3, "<tbody>", "</tbody>
"],
           _default: [0, "", ""]
       };
       // Support: IE <=9 only
       wrapMap.optgroup = wrapMap.option;
       wrapMap.tbody = wrapMap.tfoot = wrapMap.colgroup = wrapMap.caption = wrapMap.thead;
       wrapMap.th = wrapMap.td;


       function getAll(context, tag) {
           // Support: IE <=9 - 11 only
           // Use typeof to avoid zero-argument method invocation on host objects (#15151)
           var ret;
           if (typeof context.getElementsByTagName !== "undefined") {
               ret = context.getElementsByTagName(tag || "*");
           } else if (typeof context.querySelectorAll !== "undefined") {
               ret = context.querySelectorAll(tag || "*");
           } else {
               ret = [];
           }
           if (tag === undefined || tag && nodeName(context, tag)) {
               return jQuery.merge([context], ret);
           }
           return ret;
       }


       // Mark scripts as having already been evaluated
       function setGlobalEval(elems, refElements) {
           var i = 0,
               l = elems.length;
           for (; i < l; i++) {
               dataPriv.set(
                   elems[i],
                   "globalEval",
                   !refElements || dataPriv.get(refElements[i], "globalEval")
               );
           }
       }


       var rhtml = /<|&#?\w+;/;
       function buildFragment(elems, context, scripts, selection, ignored) {
           var elem, tmp, tag, wrap, attached, j,
               fragment = context.createDocumentFragment(),
               nodes = [],
               i = 0,
               l = elems.length;
           for (; i < l; i++) {
               elem = elems[i];
               if (elem || elem === 0) {
                   // Add nodes directly
                   if (toType(elem) === "object") {
                       // Support: Android <=4.0 only, PhantomJS 1 only
                       // push.apply(_, arraylike) throws on ancient WebKit
                       jQuery.merge(nodes, elem.nodeType ? [elem] : elem);
                       // Convert non-html into a text node
                   } else if (!rhtml.test(elem)) {
                       nodes.push(context.createTextNode(elem));
                       // Convert html into DOM nodes
                   } else {
                       tmp = tmp || fragment.appendChild(context.createElement("div"));
                       // Deserialize a standard representation
                       tag = (rtagName.exec(elem) || ["", ""])[1].toLowerCase();
                       wrap = wrapMap[tag] || wrapMap._default;
                       tmp.innerHTML = wrap[1] + jQuery.htmlPrefilter(elem) + wrap[2];
                       // Descend through wrappers to the right content
                       j = wrap[0];
                       while (j--) {
                           tmp = tmp.lastChild;
                       }
                       // Support: Android <=4.0 only, PhantomJS 1 only
                       // push.apply(_, arraylike) throws on ancient WebKit
                       jQuery.merge(nodes, tmp.childNodes);
                       // Remember the top-level container
                       tmp = fragment.firstChild;
                       // Ensure the created nodes are orphaned (#12392)
                       tmp.textContent = "";
                   }
               }
           }
           // Remove wrapper from fragment
           fragment.textContent = "";
           i = 0;
           while ((elem = nodes[i++])) {
               // Skip elements already in the context collection (trac-4087)
               if (selection && jQuery.inArray(elem, selection) > -1) {
                   if (ignored) {
                       ignored.push(elem);
                   }
                   continue;
               }
               attached = isAttached(elem);
               // Append to fragment
               tmp = getAll(fragment.appendChild(elem), "script");
               // Preserve script evaluation history
               if (attached) {
                   setGlobalEval(tmp);
               }
               // Capture executables
               if (scripts) {
                   j = 0;
                   while ((elem = tmp[j++])) {
                       if (rscriptType.test(elem.type || "")) {
                           scripts.push(elem);
                       }
                   }
               }
           }
           return fragment;
       }


       (function () {
           var fragment = document.createDocumentFragment(),
               div = fragment.appendChild(document.createElement("div")),
               input = document.createElement("input");
           // Support: Android 4.0 - 4.3 only
           // Check state lost if the name is set (#11217)
           // Support: Windows Web Apps (WWA)
           // `name` and `type` must use .setAttribute for WWA (#14901)
           input.setAttribute("type", "radio");
           input.setAttribute("checked", "checked");
           input.setAttribute("name", "t");
           div.appendChild(input);
           // Support: Android <=4.1 only
           // Older WebKit doesn't clone checked state correctly in fragments
           support.checkClone = div.cloneNode(true).cloneNode(true).lastChild.checked;
           // Support: IE <=11 only
           // Make sure textarea (and checkbox) defaultValue is properly cloned
           div.innerHTML = "<textarea>x</textarea>";
           support.noCloneChecked = !!div.cloneNode(true).lastChild.defaultValue;
       })();


       var
           rkeyEvent = /^key/,
           rmouseEvent = /^(?:mouse|pointer|contextmenu|drag|drop)|click/,
           rtypenamespace = /^([^.]*)(?:\.(.+)|)/;
       function returnTrue() {
           return true;
       }
       function returnFalse() {
           return false;
       }
       // Support: IE <=9 - 11+
       // focus() and blur() are asynchronous, except when they are no-op.
       // So expect focus to be synchronous when the element is already active,
       // and blur to be synchronous when the element is not already active.
       // (focus and blur are always synchronous in other supported browsers,
       // this just defines when we can count on it).
       function expectSync(elem, type) {
           return (elem === safeActiveElement()) === (type === "focus");
       }
       // Support: IE <=9 only
       // Accessing document.activeElement can throw unexpectedly
       // https://bugs.jquery.com/ticket/13393
       function safeActiveElement() {
           try {
               return document.activeElement;
           } catch (err) {}
       }
       function on(elem, types, selector, data, fn, one) {
           var origFn, type;
           // Types can be a map of types/handlers
           if (typeof types === "object") {
               // ( types-Object, selector, data )
               if (typeof selector !== "string") {
                   // ( types-Object, data )
                   data = data || selector;
                   selector = undefined;
               }
               for (type in types) {
                   on(elem, type, selector, data, types[type], one);
               }
               return elem;
           }
           if (data == null && fn == null) {
               // ( types, fn )
               fn = selector;
               data = selector = undefined;
           } else if (fn == null) {
               if (typeof selector === "string") {
                   // ( types, selector, fn )
                   fn = data;
                   data = undefined;
               } else {
                   // ( types, data, fn )
                   fn = data;
                   data = selector;
                   selector = undefined;
               }
           }
           if (fn === false) {
               fn = returnFalse;
           } else if (!fn) {
               return elem;
           }
           if (one === 1) {
               origFn = fn;
               fn = function (event) {
                   // Can use an empty set, since event contains the info
                   jQuery().off(event);
                   return origFn.apply(this, arguments);
               };
               // Use same guid so caller can remove using origFn
               fn.guid = origFn.guid || (origFn.guid = jQuery.guid++);
           }
           return elem.each(function () {
               jQuery.event.add(this, types, fn, data, selector);
           });
       }
       /*
        * Helper functions for managing events -- not part of the public interface.
        * Props to Dean Edwards' addEvent library for many of the ideas.
        */
       jQuery.event = {
           global: {},
           add: function (elem, types, handler, data, selector) {
               var handleObjIn, eventHandle, tmp,
                   events, t, handleObj,
                   special, handlers, type, namespaces, origType,
                   elemData = dataPriv.get(elem);
               // Don't attach events to noData or text/comment nodes (but allow plain objects)
               if (!elemData) {
                   return;
               }
               // Caller can pass in an object of custom data in lieu of the handler
               if (handler.handler) {
                   handleObjIn = handler;
                   handler = handleObjIn.handler;
                   selector = handleObjIn.selector;
               }
               // Ensure that invalid selectors throw exceptions at attach time
               // Evaluate against documentElement in case elem is a non-element node (e.g., document)
               if (selector) {
                   jQuery.find.matchesSelector(documentElement, selector);
               }
               // Make sure that the handler has a unique ID, used to find/remove it later
               if (!handler.guid) {
                   handler.guid = jQuery.guid++;
               }
               // Init the element's event structure and main handler, if this is the first
               if (!(events = elemData.events)) {
                   events = elemData.events = {};
               }
               if (!(eventHandle = elemData.handle)) {
                   eventHandle = elemData.handle = function (e) {
                       // Discard the second event of a jQuery.event.trigger() and
                       // when an event is called after a page has unloaded
                       return typeof jQuery !== "undefined" && jQuery.event.triggered !== e.type ?
                           jQuery.event.dispatch.apply(elem, arguments) : undefined;
                   };
               }
               // Handle multiple events separated by a space
               types = (types || "").match(rnothtmlwhite) || [""];
               t = types.length;
               while (t--) {
                   tmp = rtypenamespace.exec(types[t]) || [];
                   type = origType = tmp[1];
                   namespaces = (tmp[2] || "").split(".").sort();
                   // There *must* be a type, no attaching namespace-only handlers
                   if (!type) {
                       continue;
                   }
                   // If event changes its type, use the special event handlers for the changed type
                   special = jQuery.event.special[type] || {};
                   // If selector defined, determine special event api type, otherwise given type
                   type = (selector ? special.delegateType : special.bindType) || type;
                   // Update special based on newly reset type
                   special = jQuery.event.special[type] || {};
                   // handleObj is passed to all event handlers
                   handleObj = jQuery.extend({
                       type: type,
                       origType: origType,
                       data: data,
                       handler: handler,
                       guid: handler.guid,
                       selector: selector,
                       needsContext: selector && jQuery.expr.match.needsContext.test(selector),
                       namespace: namespaces.join(".")
                   }, handleObjIn);
                   // Init the event handler queue if we're the first
                   if (!(handlers = events[type])) {
                       handlers = events[type] = [];
                       handlers.delegateCount = 0;
                       // Only use addEventListener if the special events handler returns false
                       if (!special.setup ||
                           special.setup.call(elem, data, namespaces, eventHandle) === false) {
                           if (elem.addEventListener) {
                               elem.addEventListener(type, eventHandle);
                           }
                       }
                   }
                   if (special.add) {
                       special.add.call(elem, handleObj);
                       if (!handleObj.handler.guid) {
                           handleObj.handler.guid = handler.guid;
                       }
                   }
                   // Add to the element's handler list, delegates in front
                   if (selector) {
                       handlers.splice(handlers.delegateCount++, 0, handleObj);
                   } else {
                       handlers.push(handleObj);
                   }
                   // Keep track of which events have ever been used, for event optimization
                   jQuery.event.global[type] = true;
               }
           },
           // Detach an event or set of events from an element
           remove: function (elem, types, handler, selector, mappedTypes) {
               var j, origCount, tmp,
                   events, t, handleObj,
                   special, handlers, type, namespaces, origType,
                   elemData = dataPriv.hasData(elem) && dataPriv.get(elem);
               if (!elemData || !(events = elemData.events)) {
                   return;
               }
               // Once for each type.namespace in types; type may be omitted
               types = (types || "").match(rnothtmlwhite) || [""];
               t = types.length;
               while (t--) {
                   tmp = rtypenamespace.exec(types[t]) || [];
                   type = origType = tmp[1];
                   namespaces = (tmp[2] || "").split(".").sort();
                   // Unbind all events (on this namespace, if provided) for the element
                   if (!type) {
                       for (type in events) {
                           jQuery.event.remove(elem, type + types[t], handler, selector, true);
                       }
                       continue;
                   }
                   special = jQuery.event.special[type] || {};
                   type = (selector ? special.delegateType : special.bindType) || type;
                   handlers = events[type] || [];
                   tmp = tmp[2] &&
                       new RegExp("(^|\\.)" + namespaces.join("\\.(?:.*\\.|)") + "(\\.|$)");
                   // Remove matching events
                   origCount = j = handlers.length;
                   while (j--) {
                       handleObj = handlers[j];
                       if ((mappedTypes || origType === handleObj.origType) &&
                           (!handler || handler.guid === handleObj.guid) &&
                           (!tmp || tmp.test(handleObj.namespace)) &&
                           (!selector || selector === handleObj.selector ||
                               selector === "**" && handleObj.selector)) {
                           handlers.splice(j, 1);
                           if (handleObj.selector) {
                               handlers.delegateCount--;
                           }
                           if (special.remove) {
                               special.remove.call(elem, handleObj);
                           }
                       }
                   }
                   // Remove generic event handler if we removed something and no more handlers exist
                   // (avoids potential for endless recursion during removal of special event handlers)
                   if (origCount && !handlers.length) {
                       if (!special.teardown ||
                           special.teardown.call(elem, namespaces, elemData.handle) === false) {
                           jQuery.removeEvent(elem, type, elemData.handle);
                       }
                       delete events[type];
                   }
               }
               // Remove data and the expando if it's no longer used
               if (jQuery.isEmptyObject(events)) {
                   dataPriv.remove(elem, "handle events");
               }
           },
           dispatch: function (nativeEvent) {
               // Make a writable jQuery.Event from the native event object
               var event = jQuery.event.fix(nativeEvent);
               var i, j, ret, matched, handleObj, handlerQueue,
                   args = new Array(arguments.length),
                   handlers = (dataPriv.get(this, "events") || {})[event.type] || [],
                   special = jQuery.event.special[event.type] || {};
               // Use the fix-ed jQuery.Event rather than the (read-only) native event
               args[0] = event;
               for (i = 1; i < arguments.length; i++) {
                   args[i] = arguments[i];
               }
               event.delegateTarget = this;
               // Call the preDispatch hook for the mapped type, and let it bail if desired
               if (special.preDispatch && special.preDispatch.call(this, event) === false) {
                   return;
               }
               // Determine handlers
               handlerQueue = jQuery.event.handlers.call(this, event, handlers);
               // Run delegates first; they may want to stop propagation beneath us
               i = 0;
               while ((matched = handlerQueue[i++]) && !event.isPropagationStopped()) {
                   event.currentTarget = matched.elem;
                   j = 0;
                   while ((handleObj = matched.handlers[j++]) &&
                       !event.isImmediatePropagationStopped()) {
                       // If the event is namespaced, then each handler is only invoked if it is
                       // specially universal or its namespaces are a superset of the event's.
                       if (!event.rnamespace || handleObj.namespace === false ||
                           event.rnamespace.test(handleObj.namespace)) {
                           event.handleObj = handleObj;
                           event.data = handleObj.data;
                           ret = ((jQuery.event.special[handleObj.origType] || {}).handle ||
                               handleObj.handler).apply(matched.elem, args);
                           if (ret !== undefined) {
                               if ((event.result = ret) === false) {
                                   event.preventDefault();
                                   event.stopPropagation();
                               }
                           }
                       }
                   }
               }
               // Call the postDispatch hook for the mapped type
               if (special.postDispatch) {
                   special.postDispatch.call(this, event);
               }
               return event.result;
           },
           handlers: function (event, handlers) {
               var i, handleObj, sel, matchedHandlers, matchedSelectors,
                   handlerQueue = [],
                   delegateCount = handlers.delegateCount,
                   cur = event.target;
               // Find delegate handlers
               if (delegateCount &&
                   // Support: IE <=9
                   // Black-hole SVG <use> instance trees (trac-13180)
                   cur.nodeType &&
                   // Support: Firefox <=42
                   // Suppress spec-violating clicks indicating a non-primary pointer button (trac-3861)
                   // https://www.w3.org/TR/DOM-Level-3-Events/#event-type-click
                   // Support: IE 11 only
                   // ...but not arrow key "clicks" of radio inputs, which can have `button` -1 (gh-2343)
                   !(event.type === "click" && event.button >= 1)) {
                   for (; cur !== this; cur = cur.parentNode || this) {
                       // Don't check non-elements (#13208)
                       // Don't process clicks on disabled elements (#6911, #8165, #11382, #11764)
                       if (cur.nodeType === 1 && !(event.type === "click" && cur.disabled === true)) {
                           matchedHandlers = [];
                           matchedSelectors = {};
                           for (i = 0; i < delegateCount; i++) {
                               handleObj = handlers[i];
                               // Don't conflict with Object.prototype properties (#13203)
                               sel = handleObj.selector + " ";
                               if (matchedSelectors[sel] === undefined) {
                                   matchedSelectors[sel] = handleObj.needsContext ?
                                       jQuery(sel, this).index(cur) > -1 :
                                       jQuery.find(sel, this, null, [cur]).length;
                               }
                               if (matchedSelectors[sel]) {
                                   matchedHandlers.push(handleObj);
                               }
                           }
                           if (matchedHandlers.length) {
                               handlerQueue.push({
                                   elem: cur,
                                   handlers: matchedHandlers
                               });
                           }
                       }
                   }
               }
               // Add the remaining (directly-bound) handlers
               cur = this;
               if (delegateCount < handlers.length) {
                   handlerQueue.push({
                       elem: cur,
                       handlers: handlers.slice(delegateCount)
                   });
               }
               return handlerQueue;
           },
           addProp: function (name, hook) {
               Object.defineProperty(jQuery.Event.prototype, name, {
                   enumerable: true,
                   configurable: true,
                   get: isFunction(hook) ?
                       function () {
                           if (this.originalEvent) {
                               return hook(this.originalEvent);
                           }
                       } : function () {
                           if (this.originalEvent) {
                               return this.originalEvent[name];
                           }
                       },
                   set: function (value) {
                       Object.defineProperty(this, name, {
                           enumerable: true,
                           configurable: true,
                           writable: true,
                           value: value
                       });
                   }
               });
           },
           fix: function (originalEvent) {
               return originalEvent[jQuery.expando] ?
                   originalEvent :
                   new jQuery.Event(originalEvent);
           },
           special: {
               load: {
                   // Prevent triggered image.load events from bubbling to window.load
                   noBubble: true
               },
               click: {
                   // Utilize native event to ensure correct state for checkable inputs
                   setup: function (data) {
                       // For mutual compressibility with _default, replace `this` access with a local var.
                       // `|| data` is dead code meant only to preserve the variable through minification.
                       var el = this || data;
                       // Claim the first handler
                       if (rcheckableType.test(el.type) &&
                           el.click && nodeName(el, "input")) {
                           // dataPriv.set( el, "click", ... )
                           leverageNative(el, "click", returnTrue);
                       }
                       // Return false to allow normal processing in the caller
                       return false;
                   },
                   trigger: function (data) {
                       // For mutual compressibility with _default, replace `this` access with a local var.
                       // `|| data` is dead code meant only to preserve the variable through minification.
                       var el = this || data;
                       // Force setup before triggering a click
                       if (rcheckableType.test(el.type) &&
                           el.click && nodeName(el, "input")) {
                           leverageNative(el, "click");
                       }
                       // Return non-false to allow normal event-path propagation
                       return true;
                   },
                   // For cross-browser consistency, suppress native .click() on links
                   // Also prevent it if we're currently inside a leveraged native-event stack
                   _default: function (event) {
                       var target = event.target;
                       return rcheckableType.test(target.type) &&
                           target.click && nodeName(target, "input") &&
                           dataPriv.get(target, "click") ||
                           nodeName(target, "a");
                   }
               },
               beforeunload: {
                   postDispatch: function (event) {
                       // Support: Firefox 20+
                       // Firefox doesn't alert if the returnValue field is not set.
                       if (event.result !== undefined && event.originalEvent) {
                           event.originalEvent.returnValue = event.result;
                       }
                   }
               }
           }
       };
       // Ensure the presence of an event listener that handles manually-triggered
       // synthetic events by interrupting progress until reinvoked in response to
       // *native* events that it fires directly, ensuring that state changes have
       // already occurred before other listeners are invoked.
       function leverageNative(el, type, expectSync) {
           // Missing expectSync indicates a trigger call, which must force setup through jQuery.event.add
           if (!expectSync) {
               if (dataPriv.get(el, type) === undefined) {
                   jQuery.event.add(el, type, returnTrue);
               }
               return;
           }
           // Register the controller as a special universal handler for all event namespaces
           dataPriv.set(el, type, false);
           jQuery.event.add(el, type, {
               namespace: false,
               handler: function (event) {
                   var notAsync, result,
                       saved = dataPriv.get(this, type);
                   if ((event.isTrigger & 1) && this[type]) {
                       // Interrupt processing of the outer synthetic .trigger()ed event
                       // Saved data should be false in such cases, but might be a leftover capture object
                       // from an async native handler (gh-4350)
                       if (!saved.length) {
                           // Store arguments for use when handling the inner native event
                           // There will always be at least one argument (an event object), so this array
                           // will not be confused with a leftover capture object.
                           saved = slice.call(arguments);
                           dataPriv.set(this, type, saved);
                           // Trigger the native event and capture its result
                           // Support: IE <=9 - 11+
                           // focus() and blur() are asynchronous
                           notAsync = expectSync(this, type);
                           this[type]();
                           result = dataPriv.get(this, type);
                           if (saved !== result || notAsync) {
                               dataPriv.set(this, type, false);
                           } else {
                               result = {};
                           }
                           if (saved !== result) {
                               // Cancel the outer synthetic event
                               event.stopImmediatePropagation();
                               event.preventDefault();
                               return result.value;
                           }
                           // If this is an inner synthetic event for an event with a bubbling surrogate
                           // (focus or blur), assume that the surrogate already propagated from triggering the
                           // native event and prevent that from happening again here.
                           // This technically gets the ordering wrong w.r.t. to `.trigger()` (in which the
                           // bubbling surrogate propagates *after* the non-bubbling base), but that seems
                           // less bad than duplication.
                       } else if ((jQuery.event.special[type] || {}).delegateType) {
                           event.stopPropagation();
                       }
                       // If this is a native event triggered above, everything is now in order
                       // Fire an inner synthetic event with the original arguments
                   } else if (saved.length) {
                       // ...and capture the result
                       dataPriv.set(this, type, {
                           value: jQuery.event.trigger(
                               // Support: IE <=9 - 11+
                               // Extend with the prototype to reset the above stopImmediatePropagation()
                               jQuery.extend(saved[0], jQuery.Event.prototype),
                               saved.slice(1),
                               this
                           )
                       });
                       // Abort handling of the native event
                       event.stopImmediatePropagation();
                   }
               }
           });
       }
       jQuery.removeEvent = function (elem, type, handle) {
           // This "if" is needed for plain objects
           if (elem.removeEventListener) {
               elem.removeEventListener(type, handle);
           }
       };
       jQuery.Event = function (src, props) {
           // Allow instantiation without the 'new' keyword
           if (!(this instanceof jQuery.Event)) {
               return new jQuery.Event(src, props);
           }
           // Event object
           if (src && src.type) {
               this.originalEvent = src;
               this.type = src.type;
               // Events bubbling up the document may have been marked as prevented
               // by a handler lower down the tree; reflect the correct value.
               this.isDefaultPrevented = src.defaultPrevented ||
                   src.defaultPrevented === undefined &&
                   // Support: Android <=2.3 only
                   src.returnValue === false ?
                   returnTrue :
                   returnFalse;
               // Create target properties
               // Support: Safari <=6 - 7 only
               // Target should not be a text node (#504, #13143)
               this.target = (src.target && src.target.nodeType === 3) ?
                   src.target.parentNode :
                   src.target;
               this.currentTarget = src.currentTarget;
               this.relatedTarget = src.relatedTarget;
               // Event type
           } else {
               this.type = src;
           }
           // Put explicitly provided properties onto the event object
           if (props) {
               jQuery.extend(this, props);
           }
           // Create a timestamp if incoming event doesn't have one
           this.timeStamp = src && src.timeStamp || Date.now();
           // Mark it as fixed
           this[jQuery.expando] = true;
       };
       // jQuery.Event is based on DOM3 Events as specified by the ECMAScript Language Binding
       // https://www.w3.org/TR/2003/WD-DOM-Level-3-Events-20030331/ecma-script-binding.html
       jQuery.Event.prototype = {
           constructor: jQuery.Event,
           isDefaultPrevented: returnFalse,
           isPropagationStopped: returnFalse,
           isImmediatePropagationStopped: returnFalse,
           isSimulated: false,
           preventDefault: function () {
               var e = this.originalEvent;
               this.isDefaultPrevented = returnTrue;
               if (e && !this.isSimulated) {
                   e.preventDefault();
               }
           },
           stopPropagation: function () {
               var e = this.originalEvent;
               this.isPropagationStopped = returnTrue;
               if (e && !this.isSimulated) {
                   e.stopPropagation();
               }
           },
           stopImmediatePropagation: function () {
               var e = this.originalEvent;
               this.isImmediatePropagationStopped = returnTrue;
               if (e && !this.isSimulated) {
                   e.stopImmediatePropagation();
               }
               this.stopPropagation();
           }
       };
       // Includes all common event props including KeyEvent and MouseEvent specific props
       jQuery.each({
           altKey: true,
           bubbles: true,
           cancelable: true,
           changedTouches: true,
           ctrlKey: true,
           detail: true,
           eventPhase: true,
           metaKey: true,
           pageX: true,
           pageY: true,
           shiftKey: true,
           view: true,
           "char": true,
           code: true,
           charCode: true,
           key: true,
           keyCode: true,
           button: true,
           buttons: true,
           clientX: true,
           clientY: true,
           offsetX: true,
           offsetY: true,
           pointerId: true,
           pointerType: true,
           screenX: true,
           screenY: true,
           targetTouches: true,
           toElement: true,
           touches: true,
           which: function (event) {
               var button = event.button;
               // Add which for key events
               if (event.which == null && rkeyEvent.test(event.type)) {
                   return event.charCode != null ? event.charCode : event.keyCode;
               }
               // Add which for click: 1 === left; 2 === middle; 3 === right
               if (!event.which && button !== undefined && rmouseEvent.test(event.type)) {
                   if (button & 1) {
                       return 1;
                   }
                   if (button & 2) {
                       return 3;
                   }
                   if (button & 4) {
                       return 2;
                   }
                   return 0;
               }
               return event.which;
           }
       }, jQuery.event.addProp);
       jQuery.each({
           focus: "focusin",
           blur: "focusout"
       }, function (type, delegateType) {
           jQuery.event.special[type] = {
               // Utilize native event if possible so blur/focus sequence is correct
               setup: function () {
                   // Claim the first handler
                   // dataPriv.set( this, "focus", ... )
                   // dataPriv.set( this, "blur", ... )
                   leverageNative(this, type, expectSync);
                   // Return false to allow normal processing in the caller
                   return false;
               },
               trigger: function () {
                   // Force setup before trigger
                   leverageNative(this, type);
                   // Return non-false to allow normal event-path propagation
                   return true;
               },
               delegateType: delegateType
           };
       });
       // Create mouseenter/leave events using mouseover/out and event-time checks
       // so that event delegation works in jQuery.
       // Do the same for pointerenter/pointerleave and pointerover/pointerout
       //
       // Support: Safari 7 only
       // Safari sends mouseenter too often; see:
       // https://bugs.chromium.org/p/chromium/issues/detail?id=470258
       // for the description of the bug (it existed in older Chrome versions as well).
       jQuery.each({
           mouseenter: "mouseover",
           mouseleave: "mouseout",
           pointerenter: "pointerover",
           pointerleave: "pointerout"
       }, function (orig, fix) {
           jQuery.event.special[orig] = {
               delegateType: fix,
               bindType: fix,
               handle: function (event) {
                   var ret,
                       target = this,
                       related = event.relatedTarget,
                       handleObj = event.handleObj;
                   // For mouseenter/leave call the handler if related is outside the target.
                   // NB: No relatedTarget if the mouse left/entered the browser window
                   if (!related || (related !== target && !jQuery.contains(target, related))) {
                       event.type = handleObj.origType;
                       ret = handleObj.handler.apply(this, arguments);
                       event.type = fix;
                   }
                   return ret;
               }
           };
       });
       jQuery.fn.extend({
           on: function (types, selector, data, fn) {
               return on(this, types, selector, data, fn);
           },
           one: function (types, selector, data, fn) {
               return on(this, types, selector, data, fn, 1);
           },
           off: function (types, selector, fn) {
               var handleObj, type;
               if (types && types.preventDefault && types.handleObj) {
                   // ( event )  dispatched jQuery.Event
                   handleObj = types.handleObj;
                   jQuery(types.delegateTarget).off(
                       handleObj.namespace ?
                       handleObj.origType + "." + handleObj.namespace :
                       handleObj.origType,
                       handleObj.selector,
                       handleObj.handler
                   );
                   return this;
               }
               if (typeof types === "object") {
                   // ( types-object [, selector] )
                   for (type in types) {
                       this.off(type, selector, types[type]);
                   }
                   return this;
               }
               if (selector === false || typeof selector === "function") {
                   // ( types [, fn] )
                   fn = selector;
                   selector = undefined;
               }
               if (fn === false) {
                   fn = returnFalse;
               }
               return this.each(function () {
                   jQuery.event.remove(this, types, fn, selector);
               });
           }
       });


       var
           /* eslint-disable max-len */
           // See https://github.com/eslint/eslint/issues/3229
           rxhtmlTag =
           /<(?!area|br|col|embed|hr|img|input|link|meta|param)(([a-z][^\/\0>\x20\t\r\n\f]*)[^>]*)\/>/gi,
           /* eslint-enable */
           // Support: IE <=10 - 11, Edge 12 - 13 only
           // In IE/Edge using regex groups here causes severe slowdowns.
           // See https://connect.microsoft.com/IE/feedback/details/1736512/
           rnoInnerhtml = /<script|<style|<link/i,
           // checked="checked" or checked
           rchecked = /checked\s*(?:[^=]|=\s*.checked.)/i,
           rcleanScript = /^\s*<!(?:\[CDATA\[|--)|(?:\]\]|--)>\s*$/g;
       // Prefer a tbody over its parent table for containing new rows
       function manipulationTarget(elem, content) {
           if (nodeName(elem, "table") &&
               nodeName(content.nodeType !== 11 ? content : content.firstChild, "tr")) {
               return jQuery(elem).children("tbody")[0] || elem;
           }
           return elem;
       }
       // Replace/restore the type attribute of script elements for safe DOM manipulation
       function disableScript(elem) {
           elem.type = (elem.getAttribute("type") !== null) + "/" + elem.type;
           return elem;
       }
       function restoreScript(elem) {
           if ((elem.type || "").slice(0, 5) === "true/") {
               elem.type = elem.type.slice(5);
           } else {
               elem.removeAttribute("type");
           }
           return elem;
       }
       function cloneCopyEvent(src, dest) {
           var i, l, type, pdataOld, pdataCur, udataOld, udataCur, events;
           if (dest.nodeType !== 1) {
               return;
           }
           // 1. Copy private data: events, handlers, etc.
           if (dataPriv.hasData(src)) {
               pdataOld = dataPriv.access(src);
               pdataCur = dataPriv.set(dest, pdataOld);
               events = pdataOld.events;
               if (events) {
                   delete pdataCur.handle;
                   pdataCur.events = {};
                   for (type in events) {
                       for (i = 0, l = events[type].length; i < l; i++) {
                           jQuery.event.add(dest, type, events[type][i]);
                       }
                   }
               }
           }
           // 2. Copy user data
           if (dataUser.hasData(src)) {
               udataOld = dataUser.access(src);
               udataCur = jQuery.extend({}, udataOld);
               dataUser.set(dest, udataCur);
           }
       }
       // Fix IE bugs, see support tests
       function fixInput(src, dest) {
           var nodeName = dest.nodeName.toLowerCase();
           // Fails to persist the checked state of a cloned checkbox or radio button.
           if (nodeName === "input" && rcheckableType.test(src.type)) {
               dest.checked = src.checked;
               // Fails to return the selected option to the default selected state when cloning options
           } else if (nodeName === "input" || nodeName === "textarea") {
               dest.defaultValue = src.defaultValue;
           }
       }
       function domManip(collection, args, callback, ignored) {
           // Flatten any nested arrays
           args = concat.apply([], args);
           var fragment, first, scripts, hasScripts, node, doc,
               i = 0,
               l = collection.length,
               iNoClone = l - 1,
               value = args[0],
               valueIsFunction = isFunction(value);
           // We can't cloneNode fragments that contain checked, in WebKit
           if (valueIsFunction ||
               (l > 1 && typeof value === "string" &&
                   !support.checkClone && rchecked.test(value))) {
               return collection.each(function (index) {
                   var self = collection.eq(index);
                   if (valueIsFunction) {
                       args[0] = value.call(this, index, self.html());
                   }
                   domManip(self, args, callback, ignored);
               });
           }
           if (l) {
               fragment = buildFragment(args, collection[0].ownerDocument, false, collection, ignored);
               first = fragment.firstChild;
               if (fragment.childNodes.length === 1) {
                   fragment = first;
               }
               // Require either new content or an interest in ignored elements to invoke the callback
               if (first || ignored) {
                   scripts = jQuery.map(getAll(fragment, "script"), disableScript);
                   hasScripts = scripts.length;
                   // Use the original fragment for the last item
                   // instead of the first because it can end up
                   // being emptied incorrectly in certain situations (#8070).
                   for (; i < l; i++) {
                       node = fragment;
                       if (i !== iNoClone) {
                           node = jQuery.clone(node, true, true);
                           // Keep references to cloned scripts for later restoration
                           if (hasScripts) {
                               // Support: Android <=4.0 only, PhantomJS 1 only
                               // push.apply(_, arraylike) throws on ancient WebKit
                               jQuery.merge(scripts, getAll(node, "script"));
                           }
                       }
                       callback.call(collection[i], node, i);
                   }
                   if (hasScripts) {
                       doc = scripts[scripts.length - 1].ownerDocument;
                       // Reenable scripts
                       jQuery.map(scripts, restoreScript);
                       // Evaluate executable scripts on first document insertion
                       for (i = 0; i < hasScripts; i++) {
                           node = scripts[i];
                           if (rscriptType.test(node.type || "") &&
                               !dataPriv.access(node, "globalEval") &&
                               jQuery.contains(doc, node)) {
                               if (node.src && (node.type || "").toLowerCase() !== "module") {
                                   // Optional AJAX dependency, but won't run scripts if not present
                                   if (jQuery._evalUrl && !node.noModule) {
                                       jQuery._evalUrl(node.src, {
                                           nonce: node.nonce || node.getAttribute("nonce")
                                       });
                                   }
                               } else {
                                   DOMEval(node.textContent.replace(rcleanScript, ""), node, doc);
                               }
                           }
                       }
                   }
               }
           }
           return collection;
       }
       function remove(elem, selector, keepData) {
           var node,
               nodes = selector ? jQuery.filter(selector, elem) : elem,
               i = 0;
           for (;
               (node = nodes[i]) != null; i++) {
               if (!keepData && node.nodeType === 1) {
                   jQuery.cleanData(getAll(node));
               }
               if (node.parentNode) {
                   if (keepData && isAttached(node)) {
                       setGlobalEval(getAll(node, "script"));
                   }
                   node.parentNode.removeChild(node);
               }
           }
           return elem;
       }
       jQuery.extend({
           htmlPrefilter: function (html) {
               return html.replace(rxhtmlTag, "<$1></$2>");
           },
           clone: function (elem, dataAndEvents, deepDataAndEvents) {
               var i, l, srcElements, destElements,
                   clone = elem.cloneNode(true),
                   inPage = isAttached(elem);
               // Fix IE cloning issues
               if (!support.noCloneChecked && (elem.nodeType === 1 || elem.nodeType === 11) &&
                   !jQuery.isXMLDoc(elem)) {
                   // We eschew Sizzle here for performance reasons: https://jsperf.com/getall-vs-sizzle/2
                   destElements = getAll(clone);
                   srcElements = getAll(elem);
                   for (i = 0, l = srcElements.length; i < l; i++) {
                       fixInput(srcElements[i], destElements[i]);
                   }
               }
               // Copy the events from the original to the clone
               if (dataAndEvents) {
                   if (deepDataAndEvents) {
                       srcElements = srcElements || getAll(elem);
                       destElements = destElements || getAll(clone);
                       for (i = 0, l = srcElements.length; i < l; i++) {
                           cloneCopyEvent(srcElements[i], destElements[i]);
                       }
                   } else {
                       cloneCopyEvent(elem, clone);
                   }
               }
               // Preserve script evaluation history
               destElements = getAll(clone, "script");
               if (destElements.length > 0) {
                   setGlobalEval(destElements, !inPage && getAll(elem, "script"));
               }
               // Return the cloned set
               return clone;
           },
           cleanData: function (elems) {
               var data, elem, type,
                   special = jQuery.event.special,
                   i = 0;
               for (;
                   (elem = elems[i]) !== undefined; i++) {
                   if (acceptData(elem)) {
                       if ((data = elem[dataPriv.expando])) {
                           if (data.events) {
                               for (type in data.events) {
                                   if (special[type]) {
                                       jQuery.event.remove(elem, type);
                                       // This is a shortcut to avoid jQuery.event.remove's overhead
                                   } else {
                                       jQuery.removeEvent(elem, type, data.handle);
                                   }
                               }
                           }
                           // Support: Chrome <=35 - 45+
                           // Assign undefined instead of using delete, see Data#remove
                           elem[dataPriv.expando] = undefined;
                       }
                       if (elem[dataUser.expando]) {
                           // Support: Chrome <=35 - 45+
                           // Assign undefined instead of using delete, see Data#remove
                           elem[dataUser.expando] = undefined;
                       }
                   }
               }
           }
       });
       jQuery.fn.extend({
           detach: function (selector) {
               return remove(this, selector, true);
           },
           remove: function (selector) {
               return remove(this, selector);
           },
           text: function (value) {
               return access(this, function (value) {
                   return value === undefined ?
                       jQuery.text(this) :
                       this.empty().each(function () {
                           if (this.nodeType === 1 || this.nodeType === 11 || this
                               .nodeType === 9) {
                               this.textContent = value;
                           }
                       });
               }, null, value, arguments.length);
           },
           append: function () {
               return domManip(this, arguments, function (elem) {
                   if (this.nodeType === 1 || this.nodeType === 11 || this.nodeType === 9) {
                       var target = manipulationTarget(this, elem);
                       target.appendChild(elem);
                   }
               });
           },
           prepend: function () {
               return domManip(this, arguments, function (elem) {
                   if (this.nodeType === 1 || this.nodeType === 11 || this.nodeType === 9) {
                       var target = manipulationTarget(this, elem);
                       target.insertBefore(elem, target.firstChild);
                   }
               });
           },
           before: function () {
               return domManip(this, arguments, function (elem) {
                   if (this.parentNode) {
                       this.parentNode.insertBefore(elem, this);
                   }
               });
           },
           after: function () {
               return domManip(this, arguments, function (elem) {
                   if (this.parentNode) {
                       this.parentNode.insertBefore(elem, this.nextSibling);
                   }
               });
           },
           empty: function () {
               var elem,
                   i = 0;
               for (;
                   (elem = this[i]) != null; i++) {
                   if (elem.nodeType === 1) {
                       // Prevent memory leaks
                       jQuery.cleanData(getAll(elem, false));
                       // Remove any remaining nodes
                       elem.textContent = "";
                   }
               }
               return this;
           },
           clone: function (dataAndEvents, deepDataAndEvents) {
               dataAndEvents = dataAndEvents == null ? false : dataAndEvents;
               deepDataAndEvents = deepDataAndEvents == null ? dataAndEvents : deepDataAndEvents;
               return this.map(function () {
                   return jQuery.clone(this, dataAndEvents, deepDataAndEvents);
               });
           },
           html: function (value) {
               return access(this, function (value) {
                   var elem = this[0] || {},
                       i = 0,
                       l = this.length;
                   if (value === undefined && elem.nodeType === 1) {
                       return elem.innerHTML;
                   }
                   // See if we can take a shortcut and just use innerHTML
                   if (typeof value === "string" && !rnoInnerhtml.test(value) &&
                       !wrapMap[(rtagName.exec(value) || ["", ""])[1].toLowerCase()]) {
                       value = jQuery.htmlPrefilter(value);
                       try {
                           for (; i < l; i++) {
                               elem = this[i] || {};
                               // Remove element nodes and prevent memory leaks
                               if (elem.nodeType === 1) {
                                   jQuery.cleanData(getAll(elem, false));
                                   elem.innerHTML = value;
                               }
                           }
                           elem = 0;
                           // If using innerHTML throws an exception, use the fallback method
                       } catch (e) {}
                   }
                   if (elem) {
                       this.empty().append(value);
                   }
               }, null, value, arguments.length);
           },
           replaceWith: function () {
               var ignored = [];
               // Make the changes, replacing each non-ignored context element with the new content
               return domManip(this, arguments, function (elem) {
                   var parent = this.parentNode;
                   if (jQuery.inArray(this, ignored) < 0) {
                       jQuery.cleanData(getAll(this));
                       if (parent) {
                           parent.replaceChild(elem, this);
                       }
                   }
                   // Force callback invocation
               }, ignored);
           }
       });
       jQuery.each({
           appendTo: "append",
           prependTo: "prepend",
           insertBefore: "before",
           insertAfter: "after",
           replaceAll: "replaceWith"
       }, function (name, original) {
           jQuery.fn[name] = function (selector) {
               var elems,
                   ret = [],
                   insert = jQuery(selector),
                   last = insert.length - 1,
                   i = 0;
               for (; i <= last; i++) {
                   elems = i === last ? this : this.clone(true);
                   jQuery(insert[i])[original](elems);
                   // Support: Android <=4.0 only, PhantomJS 1 only
                   // .get() because push.apply(_, arraylike) throws on ancient WebKit
                   push.apply(ret, elems.get());
               }
               return this.pushStack(ret);
           };
       });
       var rnumnonpx = new RegExp("^(" + pnum + ")(?!px)[a-z%]+$", "i");
       var getStyles = function (elem) {
           // Support: IE <=11 only, Firefox <=30 (#15098, #14150)
           // IE throws on elements created in popups
           // FF meanwhile throws on frame elements through "defaultView.getComputedStyle"
           var view = elem.ownerDocument.defaultView;
           if (!view || !view.opener) {
               view = window;
           }
           return view.getComputedStyle(elem);
       };
       var rboxStyle = new RegExp(cssExpand.join("|"), "i");


       (function () {
           // Executing both pixelPosition & boxSizingReliable tests require only one layout
           // so they're executed at the same time to save the second computation.
           function computeStyleTests() {
               // This is a singleton, we need to execute it only once
               if (!div) {
                   return;
               }
               container.style.cssText = "position:absolute;left:-11111px;width:60px;" +
                   "margin-top:1px;padding:0;border:0";
               div.style.cssText =
                   "position:relative;display:block;box-sizing:border-box;overflow:scroll;" +
                   "margin:auto;border:1px;padding:1px;" +
                   "width:60%;top:1%";
               documentElement.appendChild(container).appendChild(div);
               var divStyle = window.getComputedStyle(div);
               pixelPositionVal = divStyle.top !== "1%";
               // Support: Android 4.0 - 4.3 only, Firefox <=3 - 44
               reliableMarginLeftVal = roundPixelMeasures(divStyle.marginLeft) === 12;
               // Support: Android 4.0 - 4.3 only, Safari <=9.1 - 10.1, iOS <=7.0 - 9.3
               // Some styles come back with percentage values, even though they shouldn't
               div.style.right = "60%";
               pixelBoxStylesVal = roundPixelMeasures(divStyle.right) === 36;
               // Support: IE 9 - 11 only
               // Detect misreporting of content dimensions for box-sizing:border-box elements
               boxSizingReliableVal = roundPixelMeasures(divStyle.width) === 36;
               // Support: IE 9 only
               // Detect overflow:scroll screwiness (gh-3699)
               // Support: Chrome <=64
               // Don't get tricked when zoom affects offsetWidth (gh-4029)
               div.style.position = "absolute";
               scrollboxSizeVal = roundPixelMeasures(div.offsetWidth / 3) === 12;
               documentElement.removeChild(container);
               // Nullify the div so it wouldn't be stored in the memory and
               // it will also be a sign that checks already performed
               div = null;
           }
           function roundPixelMeasures(measure) {
               return Math.round(parseFloat(measure));
           }
           var pixelPositionVal, boxSizingReliableVal, scrollboxSizeVal, pixelBoxStylesVal,
               reliableMarginLeftVal,
               container = document.createElement("div"),
               div = document.createElement("div");
           // Finish early in limited (non-browser) environments
           if (!div.style) {
               return;
           }
           // Support: IE <=9 - 11 only
           // Style of cloned element affects source element cloned (#8908)
           div.style.backgroundClip = "content-box";
           div.cloneNode(true).style.backgroundClip = "";
           support.clearCloneStyle = div.style.backgroundClip === "content-box";
           jQuery.extend(support, {
               boxSizingReliable: function () {
                   computeStyleTests();
                   return boxSizingReliableVal;
               },
               pixelBoxStyles: function () {
                   computeStyleTests();
                   return pixelBoxStylesVal;
               },
               pixelPosition: function () {
                   computeStyleTests();
                   return pixelPositionVal;
               },
               reliableMarginLeft: function () {
                   computeStyleTests();
                   return reliableMarginLeftVal;
               },
               scrollboxSize: function () {
                   computeStyleTests();
                   return scrollboxSizeVal;
               }
           });
       })();


       function curCSS(elem, name, computed) {
           var width, minWidth, maxWidth, ret,
               // Support: Firefox 51+
               // Retrieving style before computed somehow
               // fixes an issue with getting wrong values
               // on detached elements
               style = elem.style;
           computed = computed || getStyles(elem);
           // getPropertyValue is needed for:
           //   .css('filter') (IE 9 only, #12537)
           //   .css('--customProperty) (#3144)
           if (computed) {
               ret = computed.getPropertyValue(name) || computed[name];
               if (ret === "" && !isAttached(elem)) {
                   ret = jQuery.style(elem, name);
               }
               // A tribute to the "awesome hack by Dean Edwards"
               // Android Browser returns percentage for some values,
               // but width seems to be reliably pixels.
               // This is against the CSSOM draft spec:
               // https://drafts.csswg.org/cssom/#resolved-values
               if (!support.pixelBoxStyles() && rnumnonpx.test(ret) && rboxStyle.test(name)) {
                   // Remember the original values
                   width = style.width;
                   minWidth = style.minWidth;
                   maxWidth = style.maxWidth;
                   // Put in the new values to get a computed value out
                   style.minWidth = style.maxWidth = style.width = ret;
                   ret = computed.width;
                   // Revert the changed values
                   style.width = width;
                   style.minWidth = minWidth;
                   style.maxWidth = maxWidth;
               }
           }
           return ret !== undefined ?
               // Support: IE <=9 - 11 only
               // IE returns zIndex value as an integer.
               ret + "" :
               ret;
       }


       function addGetHookIf(conditionFn, hookFn) {
           // Define the hook, we'll check on the first run if it's really needed.
           return {
               get: function () {
                   if (conditionFn()) {
                       // Hook not needed (or it's not possible to use it due
                       // to missing dependency), remove it.
                       delete this.get;
                       return;
                   }
                   // Hook needed; redefine it so that the support test is not executed again.
                   return (this.get = hookFn).apply(this, arguments);
               }
           };
       }


       var cssPrefixes = ["Webkit", "Moz", "ms"],
           emptyStyle = document.createElement("div").style,
           vendorProps = {};
       // Return a vendor-prefixed property or undefined
       function vendorPropName(name) {
           // Check for vendor prefixed names
           var capName = name[0].toUpperCase() + name.slice(1),
               i = cssPrefixes.length;
           while (i--) {
               name = cssPrefixes[i] + capName;
               if (name in emptyStyle) {
                   return name;
               }
           }
       }
       // Return a potentially-mapped jQuery.cssProps or vendor prefixed property
       function finalPropName(name) {
           var final = jQuery.cssProps[name] || vendorProps[name];
           if (final) {
               return final;
           }
           if (name in emptyStyle) {
               return name;
           }
           return vendorProps[name] = vendorPropName(name) || name;
       }


       var
           // Swappable if display is none or starts with table
           // except "table", "table-cell", or "table-caption"
           // See here for display values: https://developer.mozilla.org/en-US/docs/CSS/display
           rdisplayswap = /^(none|table(?!-c[ea]).+)/,
           rcustomProp = /^--/,
           cssShow = {
               position: "absolute",
               visibility: "hidden",
               display: "block"
           },
           cssNormalTransform = {
               letterSpacing: "0",
               fontWeight: "400"
           };
       function setPositiveNumber(elem, value, subtract) {
           // Any relative (+/-) values have already been
           // normalized at this point
           var matches = rcssNum.exec(value);
           return matches ?
               // Guard against undefined "subtract", e.g., when used as in cssHooks
               Math.max(0, matches[2] - (subtract || 0)) + (matches[3] || "px") :
               value;
       }
       function boxModelAdjustment(elem, dimension, box, isBorderBox, styles, computedVal) {
           var i = dimension === "width" ? 1 : 0,
               extra = 0,
               delta = 0;
           // Adjustment may not be necessary
           if (box === (isBorderBox ? "border" : "content")) {
               return 0;
           }
           for (; i < 4; i += 2) {
               // Both box models exclude margin
               if (box === "margin") {
                   delta += jQuery.css(elem, box + cssExpand[i], true, styles);
               }
               // If we get here with a content-box, we're seeking "padding" or "border" or "margin"
               if (!isBorderBox) {
                   // Add padding
                   delta += jQuery.css(elem, "padding" + cssExpand[i], true, styles);
                   // For "border" or "margin", add border
                   if (box !== "padding") {
                       delta += jQuery.css(elem, "border" + cssExpand[i] + "Width", true, styles);
                       // But still keep track of it otherwise
                   } else {
                       extra += jQuery.css(elem, "border" + cssExpand[i] + "Width", true, styles);
                   }
                   // If we get here with a border-box (content + padding + border), we're seeking "content" or
                   // "padding" or "margin"
               } else {
                   // For "content", subtract padding
                   if (box === "content") {
                       delta -= jQuery.css(elem, "padding" + cssExpand[i], true, styles);
                   }
                   // For "content" or "padding", subtract border
                   if (box !== "margin") {
                       delta -= jQuery.css(elem, "border" + cssExpand[i] + "Width", true, styles);
                   }
               }
           }
           // Account for positive content-box scroll gutter when requested by providing computedVal
           if (!isBorderBox && computedVal >= 0) {
               // offsetWidth/offsetHeight is a rounded sum of content, padding, scroll gutter, and border
               // Assuming integer scroll gutter, subtract the rest and round down
               delta += Math.max(0, Math.ceil(
                   elem["offset" + dimension[0].toUpperCase() + dimension.slice(1)] -
                   computedVal -
                   delta -
                   extra -
                   0.5
                   // If offsetWidth/offsetHeight is unknown, then we can't determine content-box scroll gutter
                   // Use an explicit zero to avoid NaN (gh-3964)
               )) || 0;
           }
           return delta;
       }
       function getWidthOrHeight(elem, dimension, extra) {
           // Start with computed style
           var styles = getStyles(elem),
               // To avoid forcing a reflow, only fetch boxSizing if we need it (gh-4322).
               // Fake content-box until we know it's needed to know the true value.
               boxSizingNeeded = !support.boxSizingReliable() || extra,
               isBorderBox = boxSizingNeeded &&
               jQuery.css(elem, "boxSizing", false, styles) === "border-box",
               valueIsBorderBox = isBorderBox,
               val = curCSS(elem, dimension, styles),
               offsetProp = "offset" + dimension[0].toUpperCase() + dimension.slice(1);
           // Support: Firefox <=54
           // Return a confounding non-pixel value or feign ignorance, as appropriate.
           if (rnumnonpx.test(val)) {
               if (!extra) {
                   return val;
               }
               val = "auto";
           }


           // Fall back to offsetWidth/offsetHeight when value is "auto"
           // This happens for inline elements with no explicit setting (gh-3571)
           // Support: Android <=4.1 - 4.3 only
           // Also use offsetWidth/offsetHeight for misreported inline dimensions (gh-3602)
           // Support: IE 9-11 only
           // Also use offsetWidth/offsetHeight for when box sizing is unreliable
           // We use getClientRects() to check for hidden/disconnected.
           // In those cases, the computed value can be trusted to be border-box
           if ((!support.boxSizingReliable() && isBorderBox ||
                   val === "auto" ||
                   !parseFloat(val) && jQuery.css(elem, "display", false, styles) === "inline") &&
               elem.getClientRects().length) {
               isBorderBox = jQuery.css(elem, "boxSizing", false, styles) === "border-box";
               // Where available, offsetWidth/offsetHeight approximate border box dimensions.
               // Where not available (e.g., SVG), assume unreliable box-sizing and interpret the
               // retrieved value as a content box dimension.
               valueIsBorderBox = offsetProp in elem;
               if (valueIsBorderBox) {
                   val = elem[offsetProp];
               }
           }
           // Normalize "" and auto
           val = parseFloat(val) || 0;
           // Adjust for the element's box model
           return (val +
               boxModelAdjustment(
                   elem,
                   dimension,
                   extra || (isBorderBox ? "border" : "content"),
                   valueIsBorderBox,
                   styles,
                   // Provide the current computed size to request scroll gutter calculation (gh-3589)
                   val
               )
           ) + "px";
       }
       jQuery.extend({
           // Add in style property hooks for overriding the default
           // behavior of getting and setting a style property
           cssHooks: {
               opacity: {
                   get: function (elem, computed) {
                       if (computed) {
                           // We should always get a number back from opacity
                           var ret = curCSS(elem, "opacity");
                           return ret === "" ? "1" : ret;
                       }
                   }
               }
           },
           // Don't automatically add "px" to these possibly-unitless properties
           cssNumber: {
               "animationIterationCount": true,
               "columnCount": true,
               "fillOpacity": true,
               "flexGrow": true,
               "flexShrink": true,
               "fontWeight": true,
               "gridArea": true,
               "gridColumn": true,
               "gridColumnEnd": true,
               "gridColumnStart": true,
               "gridRow": true,
               "gridRowEnd": true,
               "gridRowStart": true,
               "lineHeight": true,
               "opacity": true,
               "order": true,
               "orphans": true,
               "widows": true,
               "zIndex": true,
               "zoom": true
           },
           // Add in properties whose names you wish to fix before
           // setting or getting the value
           cssProps: {},
           // Get and set the style property on a DOM Node
           style: function (elem, name, value, extra) {
               // Don't set styles on text and comment nodes
               if (!elem || elem.nodeType === 3 || elem.nodeType === 8 || !elem.style) {
                   return;
               }
               // Make sure that we're working with the right name
               var ret, type, hooks,
                   origName = camelCase(name),
                   isCustomProp = rcustomProp.test(name),
                   style = elem.style;
               // Make sure that we're working with the right name. We don't
               // want to query the value if it is a CSS custom property
               // since they are user-defined.
               if (!isCustomProp) {
                   name = finalPropName(origName);
               }
               // Gets hook for the prefixed version, then unprefixed version
               hooks = jQuery.cssHooks[name] || jQuery.cssHooks[origName];
               // Check if we're setting a value
               if (value !== undefined) {
                   type = typeof value;
                   // Convert "+=" or "-=" to relative numbers (#7345)
                   if (type === "string" && (ret = rcssNum.exec(value)) && ret[1]) {
                       value = adjustCSS(elem, name, ret);
                       // Fixes bug #9237
                       type = "number";
                   }
                   // Make sure that null and NaN values aren't set (#7116)
                   if (value == null || value !== value) {
                       return;
                   }
                   // If a number was passed in, add the unit (except for certain CSS properties)
                   // The isCustomProp check can be removed in jQuery 4.0 when we only auto-append
                   // "px" to a few hardcoded values.
                   if (type === "number" && !isCustomProp) {
                       value += ret && ret[3] || (jQuery.cssNumber[origName] ? "" : "px");
                   }
                   // background-* props affect original clone's values
                   if (!support.clearCloneStyle && value === "" && name.indexOf("background") === 0) {
                       style[name] = "inherit";
                   }
                   // If a hook was provided, use that value, otherwise just set the specified value
                   if (!hooks || !("set" in hooks) ||
                       (value = hooks.set(elem, value, extra)) !== undefined) {
                       if (isCustomProp) {
                           style.setProperty(name, value);
                       } else {
                           style[name] = value;
                       }
                   }
               } else {
                   // If a hook was provided get the non-computed value from there
                   if (hooks && "get" in hooks &&
                       (ret = hooks.get(elem, false, extra)) !== undefined) {
                       return ret;
                   }
                   // Otherwise just get the value from the style object
                   return style[name];
               }
           },
           css: function (elem, name, extra, styles) {
               var val, num, hooks,
                   origName = camelCase(name),
                   isCustomProp = rcustomProp.test(name);
               // Make sure that we're working with the right name. We don't
               // want to modify the value if it is a CSS custom property
               // since they are user-defined.
               if (!isCustomProp) {
                   name = finalPropName(origName);
               }
               // Try prefixed name followed by the unprefixed name
               hooks = jQuery.cssHooks[name] || jQuery.cssHooks[origName];
               // If a hook was provided get the computed value from there
               if (hooks && "get" in hooks) {
                   val = hooks.get(elem, true, extra);
               }
               // Otherwise, if a way to get the computed value exists, use that
               if (val === undefined) {
                   val = curCSS(elem, name, styles);
               }
               // Convert "normal" to computed value
               if (val === "normal" && name in cssNormalTransform) {
                   val = cssNormalTransform[name];
               }
               // Make numeric if forced or a qualifier was provided and val looks numeric
               if (extra === "" || extra) {
                   num = parseFloat(val);
                   return extra === true || isFinite(num) ? num || 0 : val;
               }
               return val;
           }
       });
       jQuery.each(["height", "width"], function (i, dimension) {
           jQuery.cssHooks[dimension] = {
               get: function (elem, computed, extra) {
                   if (computed) {
                       // Certain elements can have dimension info if we invisibly show them
                       // but it must have a current display style that would benefit
                       return rdisplayswap.test(jQuery.css(elem, "display")) &&
                           // Support: Safari 8+
                           // Table columns in Safari have non-zero offsetWidth & zero
                           // getBoundingClientRect().width unless display is changed.
                           // Support: IE <=11 only
                           // Running getBoundingClientRect on a disconnected node
                           // in IE throws an error.
                           (!elem.getClientRects().length || !elem.getBoundingClientRect().width) ?
                           swap(elem, cssShow, function () {
                               return getWidthOrHeight(elem, dimension, extra);
                           }) :
                           getWidthOrHeight(elem, dimension, extra);
                   }
               },
               set: function (elem, value, extra) {
                   var matches,
                       styles = getStyles(elem),
                       // Only read styles.position if the test has a chance to fail
                       // to avoid forcing a reflow.
                       scrollboxSizeBuggy = !support.scrollboxSize() &&
                       styles.position === "absolute",
                       // To avoid forcing a reflow, only fetch boxSizing if we need it (gh-3991)
                       boxSizingNeeded = scrollboxSizeBuggy || extra,
                       isBorderBox = boxSizingNeeded &&
                       jQuery.css(elem, "boxSizing", false, styles) === "border-box",
                       subtract = extra ?
                       boxModelAdjustment(
                           elem,
                           dimension,
                           extra,
                           isBorderBox,
                           styles
                       ) :
                       0;
                   // Account for unreliable border-box dimensions by comparing offset* to computed and
                   // faking a content-box to get border and padding (gh-3699)
                   if (isBorderBox && scrollboxSizeBuggy) {
                       subtract -= Math.ceil(
                           elem["offset" + dimension[0].toUpperCase() + dimension.slice(1)] -
                           parseFloat(styles[dimension]) -
                           boxModelAdjustment(elem, dimension, "border", false, styles) -
                           0.5
                       );
                   }
                   // Convert to pixels if value adjustment is needed
                   if (subtract && (matches = rcssNum.exec(value)) &&
                       (matches[3] || "px") !== "px") {
                       elem.style[dimension] = value;
                       value = jQuery.css(elem, dimension);
                   }
                   return setPositiveNumber(elem, value, subtract);
               }
           };
       });
       jQuery.cssHooks.marginLeft = addGetHookIf(support.reliableMarginLeft,
           function (elem, computed) {
               if (computed) {
                   return (parseFloat(curCSS(elem, "marginLeft")) ||
                       elem.getBoundingClientRect().left -
                       swap(elem, {
                           marginLeft: 0
                       }, function () {
                           return elem.getBoundingClientRect().left;
                       })
                   ) + "px";
               }
           }
       );
       // These hooks are used by animate to expand properties
       jQuery.each({
           margin: "",
           padding: "",
           border: "Width"
       }, function (prefix, suffix) {
           jQuery.cssHooks[prefix + suffix] = {
               expand: function (value) {
                   var i = 0,
                       expanded = {},
                       // Assumes a single number if not a string
                       parts = typeof value === "string" ? value.split(" ") : [value];
                   for (; i < 4; i++) {
                       expanded[prefix + cssExpand[i] + suffix] =
                           parts[i] || parts[i - 2] || parts[0];
                   }
                   return expanded;
               }
           };
           if (prefix !== "margin") {
               jQuery.cssHooks[prefix + suffix].set = setPositiveNumber;
           }
       });
       jQuery.fn.extend({
           css: function (name, value) {
               return access(this, function (elem, name, value) {
                   var styles, len,
                       map = {},
                       i = 0;
                   if (Array.isArray(name)) {
                       styles = getStyles(elem);
                       len = name.length;
                       for (; i < len; i++) {
                           map[name[i]] = jQuery.css(elem, name[i], false, styles);
                       }
                       return map;
                   }
                   return value !== undefined ?
                       jQuery.style(elem, name, value) :
                       jQuery.css(elem, name);
               }, name, value, arguments.length > 1);
           }
       });


       function Tween(elem, options, prop, end, easing) {
           return new Tween.prototype.init(elem, options, prop, end, easing);
       }
       jQuery.Tween = Tween;
       Tween.prototype = {
           constructor: Tween,
           init: function (elem, options, prop, end, easing, unit) {
               this.elem = elem;
               this.prop = prop;
               this.easing = easing || jQuery.easing._default;
               this.options = options;
               this.start = this.now = this.cur();
               this.end = end;
               this.unit = unit || (jQuery.cssNumber[prop] ? "" : "px");
           },
           cur: function () {
               var hooks = Tween.propHooks[this.prop];
               return hooks && hooks.get ?
                   hooks.get(this) :
                   Tween.propHooks._default.get(this);
           },
           run: function (percent) {
               var eased,
                   hooks = Tween.propHooks[this.prop];
               if (this.options.duration) {
                   this.pos = eased = jQuery.easing[this.easing](
                       percent, this.options.duration * percent, 0, 1, this.options.duration
                   );
               } else {
                   this.pos = eased = percent;
               }
               this.now = (this.end - this.start) * eased + this.start;
               if (this.options.step) {
                   this.options.step.call(this.elem, this.now, this);
               }
               if (hooks && hooks.set) {
                   hooks.set(this);
               } else {
                   Tween.propHooks._default.set(this);
               }
               return this;
           }
       };
       Tween.prototype.init.prototype = Tween.prototype;
       Tween.propHooks = {
           _default: {
               get: function (tween) {
                   var result;
                   // Use a property on the element directly when it is not a DOM element,
                   // or when there is no matching style property that exists.
                   if (tween.elem.nodeType !== 1 ||
                       tween.elem[tween.prop] != null && tween.elem.style[tween.prop] == null) {
                       return tween.elem[tween.prop];
                   }
                   // Passing an empty string as a 3rd parameter to .css will automatically
                   // attempt a parseFloat and fallback to a string if the parse fails.
                   // Simple values such as "10px" are parsed to Float;
                   // complex values such as "rotate(1rad)" are returned as-is.
                   result = jQuery.css(tween.elem, tween.prop, "");
                   // Empty strings, null, undefined and "auto" are converted to 0.
                   return !result || result === "auto" ? 0 : result;
               },
               set: function (tween) {
                   // Use step hook for back compat.
                   // Use cssHook if its there.
                   // Use .style if available and use plain properties where available.
                   if (jQuery.fx.step[tween.prop]) {
                       jQuery.fx.step[tween.prop](tween);
                   } else if (tween.elem.nodeType === 1 && (
                           jQuery.cssHooks[tween.prop] ||
                           tween.elem.style[finalPropName(tween.prop)] != null)) {
                       jQuery.style(tween.elem, tween.prop, tween.now + tween.unit);
                   } else {
                       tween.elem[tween.prop] = tween.now;
                   }
               }
           }
       };
       // Support: IE <=9 only
       // Panic based approach to setting things on disconnected nodes
       Tween.propHooks.scrollTop = Tween.propHooks.scrollLeft = {
           set: function (tween) {
               if (tween.elem.nodeType && tween.elem.parentNode) {
                   tween.elem[tween.prop] = tween.now;
               }
           }
       };
       jQuery.easing = {
           linear: function (p) {
               return p;
           },
           swing: function (p) {
               return 0.5 - Math.cos(p * Math.PI) / 2;
           },
           _default: "swing"
       };
       jQuery.fx = Tween.prototype.init;
       // Back compat <1.8 extension point
       jQuery.fx.step = {};



       var
           fxNow, inProgress,
           rfxtypes = /^(?:toggle|show|hide)$/,
           rrun = /queueHooks$/;
       function schedule() {
           if (inProgress) {
               if (document.hidden === false && window.requestAnimationFrame) {
                   window.requestAnimationFrame(schedule);
               } else {
                   window.setTimeout(schedule, jQuery.fx.interval);
               }
               jQuery.fx.tick();
           }
       }
       // Animations created synchronously will run synchronously
       function createFxNow() {
           window.setTimeout(function () {
               fxNow = undefined;
           });
           return (fxNow = Date.now());
       }
       // Generate parameters to create a standard animation
       function genFx(type, includeWidth) {
           var which,
               i = 0,
               attrs = {
                   height: type
               };
           // If we include width, step value is 1 to do all cssExpand values,
           // otherwise step value is 2 to skip over Left and Right
           includeWidth = includeWidth ? 1 : 0;
           for (; i < 4; i += 2 - includeWidth) {
               which = cssExpand[i];
               attrs["margin" + which] = attrs["padding" + which] = type;
           }
           if (includeWidth) {
               attrs.opacity = attrs.width = type;
           }
           return attrs;
       }
       function createTween(value, prop, animation) {
           var tween,
               collection = (Animation.tweeners[prop] || []).concat(Animation.tweeners["*"]),
               index = 0,
               length = collection.length;
           for (; index < length; index++) {
               if ((tween = collection[index].call(animation, prop, value))) {
                   // We're done with this property
                   return tween;
               }
           }
       }
       function defaultPrefilter(elem, props, opts) {
           var prop, value, toggle, hooks, oldfire, propTween, restoreDisplay, display,
               isBox = "width" in props || "height" in props,
               anim = this,
               orig = {},
               style = elem.style,
               hidden = elem.nodeType && isHiddenWithinTree(elem),
               dataShow = dataPriv.get(elem, "fxshow");
           // Queue-skipping animations hijack the fx hooks
           if (!opts.queue) {
               hooks = jQuery._queueHooks(elem, "fx");
               if (hooks.unqueued == null) {
                   hooks.unqueued = 0;
                   oldfire = hooks.empty.fire;
                   hooks.empty.fire = function () {
                       if (!hooks.unqueued) {
                           oldfire();
                       }
                   };
               }
               hooks.unqueued++;
               anim.always(function () {
                   // Ensure the complete handler is called before this completes
                   anim.always(function () {
                       hooks.unqueued--;
                       if (!jQuery.queue(elem, "fx").length) {
                           hooks.empty.fire();
                       }
                   });
               });
           }
           // Detect show/hide animations
           for (prop in props) {
               value = props[prop];
               if (rfxtypes.test(value)) {
                   delete props[prop];
                   toggle = toggle || value === "toggle";
                   if (value === (hidden ? "hide" : "show")) {
                       // Pretend to be hidden if this is a "show" and
                       // there is still data from a stopped show/hide
                       if (value === "show" && dataShow && dataShow[prop] !== undefined) {
                           hidden = true;
                           // Ignore all other no-op show/hide data
                       } else {
                           continue;
                       }
                   }
                   orig[prop] = dataShow && dataShow[prop] || jQuery.style(elem, prop);
               }
           }
           // Bail out if this is a no-op like .hide().hide()
           propTween = !jQuery.isEmptyObject(props);
           if (!propTween && jQuery.isEmptyObject(orig)) {
               return;
           }
           // Restrict "overflow" and "display" styles during box animations
           if (isBox && elem.nodeType === 1) {
               // Support: IE <=9 - 11, Edge 12 - 15
               // Record all 3 overflow attributes because IE does not infer the shorthand
               // from identically-valued overflowX and overflowY and Edge just mirrors
               // the overflowX value there.
               opts.overflow = [style.overflow, style.overflowX, style.overflowY];
               // Identify a display type, preferring old show/hide data over the CSS cascade
               restoreDisplay = dataShow && dataShow.display;
               if (restoreDisplay == null) {
                   restoreDisplay = dataPriv.get(elem, "display");
               }
               display = jQuery.css(elem, "display");
               if (display === "none") {
                   if (restoreDisplay) {
                       display = restoreDisplay;
                   } else {
                       // Get nonempty value(s) by temporarily forcing visibility
                       showHide([elem], true);
                       restoreDisplay = elem.style.display || restoreDisplay;
                       display = jQuery.css(elem, "display");
                       showHide([elem]);
                   }
               }
               // Animate inline elements as inline-block
               if (display === "inline" || display === "inline-block" && restoreDisplay != null) {
                   if (jQuery.css(elem, "float") === "none") {
                       // Restore the original display value at the end of pure show/hide animations
                       if (!propTween) {
                           anim.done(function () {
                               style.display = restoreDisplay;
                           });
                           if (restoreDisplay == null) {
                               display = style.display;
                               restoreDisplay = display === "none" ? "" : display;
                           }
                       }
                       style.display = "inline-block";
                   }
               }
           }
           if (opts.overflow) {
               style.overflow = "hidden";
               anim.always(function () {
                   style.overflow = opts.overflow[0];
                   style.overflowX = opts.overflow[1];
                   style.overflowY = opts.overflow[2];
               });
           }
           // Implement show/hide animations
           propTween = false;
           for (prop in orig) {
               // General show/hide setup for this element animation
               if (!propTween) {
                   if (dataShow) {
                       if ("hidden" in dataShow) {
                           hidden = dataShow.hidden;
                       }
                   } else {
                       dataShow = dataPriv.access(elem, "fxshow", {
                           display: restoreDisplay
                       });
                   }
                   // Store hidden/visible for toggle so `.stop().toggle()` "reverses"
                   if (toggle) {
                       dataShow.hidden = !hidden;
                   }
                   // Show elements before animating them
                   if (hidden) {
                       showHide([elem], true);
                   }
                   /* eslint-disable no-loop-func */
                   anim.done(function () {
                       /* eslint-enable no-loop-func */
                       // The final step of a "hide" animation is actually hiding the element
                       if (!hidden) {
                           showHide([elem]);
                       }
                       dataPriv.remove(elem, "fxshow");
                       for (prop in orig) {
                           jQuery.style(elem, prop, orig[prop]);
                       }
                   });
               }
               // Per-property setup
               propTween = createTween(hidden ? dataShow[prop] : 0, prop, anim);
               if (!(prop in dataShow)) {
                   dataShow[prop] = propTween.start;
                   if (hidden) {
                       propTween.end = propTween.start;
                       propTween.start = 0;
                   }
               }
           }
       }
       function propFilter(props, specialEasing) {
           var index, name, easing, value, hooks;
           // camelCase, specialEasing and expand cssHook pass
           for (index in props) {
               name = camelCase(index);
               easing = specialEasing[name];
               value = props[index];
               if (Array.isArray(value)) {
                   easing = value[1];
                   value = props[index] = value[0];
               }
               if (index !== name) {
                   props[name] = value;
                   delete props[index];
               }
               hooks = jQuery.cssHooks[name];
               if (hooks && "expand" in hooks) {
                   value = hooks.expand(value);
                   delete props[name];
                   // Not quite $.extend, this won't overwrite existing keys.
                   // Reusing 'index' because we have the correct "name"
                   for (index in value) {
                       if (!(index in props)) {
                           props[index] = value[index];
                           specialEasing[index] = easing;
                       }
                   }
               } else {
                   specialEasing[name] = easing;
               }
           }
       }
       function Animation(elem, properties, options) {
           var result,
               stopped,
               index = 0,
               length = Animation.prefilters.length,
               deferred = jQuery.Deferred().always(function () {
                   // Don't match elem in the :animated selector
                   delete tick.elem;
               }),
               tick = function () {
                   if (stopped) {
                       return false;
                   }
                   var currentTime = fxNow || createFxNow(),
                       remaining = Math.max(0, animation.startTime + animation.duration - currentTime),
                       // Support: Android 2.3 only
                       // Archaic crash bug won't allow us to use `1 - ( 0.5 || 0 )` (#12497)
                       temp = remaining / animation.duration || 0,
                       percent = 1 - temp,
                       index = 0,
                       length = animation.tweens.length;
                   for (; index < length; index++) {
                       animation.tweens[index].run(percent);
                   }
                   deferred.notifyWith(elem, [animation, percent, remaining]);
                   // If there's more to do, yield
                   if (percent < 1 && length) {
                       return remaining;
                   }
                   // If this was an empty animation, synthesize a final progress notification
                   if (!length) {
                       deferred.notifyWith(elem, [animation, 1, 0]);
                   }
                   // Resolve the animation and report its conclusion
                   deferred.resolveWith(elem, [animation]);
                   return false;
               },
               animation = deferred.promise({
                   elem: elem,
                   props: jQuery.extend({}, properties),
                   opts: jQuery.extend(true, {
                       specialEasing: {},
                       easing: jQuery.easing._default
                   }, options),
                   originalProperties: properties,
                   originalOptions: options,
                   startTime: fxNow || createFxNow(),
                   duration: options.duration,
                   tweens: [],
                   createTween: function (prop, end) {
                       var tween = jQuery.Tween(elem, animation.opts, prop, end,
                           animation.opts.specialEasing[prop] || animation.opts.easing);
                       animation.tweens.push(tween);
                       return tween;
                   },
                   stop: function (gotoEnd) {
                       var index = 0,
                           // If we are going to the end, we want to run all the tweens
                           // otherwise we skip this part
                           length = gotoEnd ? animation.tweens.length : 0;
                       if (stopped) {
                           return this;
                       }
                       stopped = true;
                       for (; index < length; index++) {
                           animation.tweens[index].run(1);
                       }
                       // Resolve when we played the last frame; otherwise, reject
                       if (gotoEnd) {
                           deferred.notifyWith(elem, [animation, 1, 0]);
                           deferred.resolveWith(elem, [animation, gotoEnd]);
                       } else {
                           deferred.rejectWith(elem, [animation, gotoEnd]);
                       }
                       return this;
                   }
               }),
               props = animation.props;
           propFilter(props, animation.opts.specialEasing);
           for (; index < length; index++) {
               result = Animation.prefilters[index].call(animation, elem, props, animation.opts);
               if (result) {
                   if (isFunction(result.stop)) {
                       jQuery._queueHooks(animation.elem, animation.opts.queue).stop =
                           result.stop.bind(result);
                   }
                   return result;
               }
           }
           jQuery.map(props, createTween, animation);
           if (isFunction(animation.opts.start)) {
               animation.opts.start.call(elem, animation);
           }
           // Attach callbacks from options
           animation
               .progress(animation.opts.progress)
               .done(animation.opts.done, animation.opts.complete)
               .fail(animation.opts.fail)
               .always(animation.opts.always);
           jQuery.fx.timer(
               jQuery.extend(tick, {
                   elem: elem,
                   anim: animation,
                   queue: animation.opts.queue
               })
           );
           return animation;
       }
       jQuery.Animation = jQuery.extend(Animation, {
           tweeners: {
               "*": [function (prop, value) {
                   var tween = this.createTween(prop, value);
                   adjustCSS(tween.elem, prop, rcssNum.exec(value), tween);
                   return tween;
               }]
           },
           tweener: function (props, callback) {
               if (isFunction(props)) {
                   callback = props;
                   props = ["*"];
               } else {
                   props = props.match(rnothtmlwhite);
               }
               var prop,
                   index = 0,
                   length = props.length;
               for (; index < length; index++) {
                   prop = props[index];
                   Animation.tweeners[prop] = Animation.tweeners[prop] || [];
                   Animation.tweeners[prop].unshift(callback);
               }
           },
           prefilters: [defaultPrefilter],
           prefilter: function (callback, prepend) {
               if (prepend) {
                   Animation.prefilters.unshift(callback);
               } else {
                   Animation.prefilters.push(callback);
               }
           }
       });
       jQuery.speed = function (speed, easing, fn) {
           var opt = speed && typeof speed === "object" ? jQuery.extend({}, speed) : {
               complete: fn || !fn && easing ||
                   isFunction(speed) && speed,
               duration: speed,
               easing: fn && easing || easing && !isFunction(easing) && easing
           };
           // Go to the end state if fx are off
           if (jQuery.fx.off) {
               opt.duration = 0;
           } else {
               if (typeof opt.duration !== "number") {
                   if (opt.duration in jQuery.fx.speeds) {
                       opt.duration = jQuery.fx.speeds[opt.duration];
                   } else {
                       opt.duration = jQuery.fx.speeds._default;
                   }
               }
           }
           // Normalize opt.queue - true/undefined/null -> "fx"
           if (opt.queue == null || opt.queue === true) {
               opt.queue = "fx";
           }
           // Queueing
           opt.old = opt.complete;
           opt.complete = function () {
               if (isFunction(opt.old)) {
                   opt.old.call(this);
               }
               if (opt.queue) {
                   jQuery.dequeue(this, opt.queue);
               }
           };
           return opt;
       };
       jQuery.fn.extend({
           fadeTo: function (speed, to, easing, callback) {
               // Show any hidden elements after setting opacity to 0
               return this.filter(isHiddenWithinTree).css("opacity", 0).show()
                   // Animate to the value specified
                   .end().animate({
                       opacity: to
                   }, speed, easing, callback);
           },
           animate: function (prop, speed, easing, callback) {
               var empty = jQuery.isEmptyObject(prop),
                   optall = jQuery.speed(speed, easing, callback),
                   doAnimation = function () {
                       // Operate on a copy of prop so per-property easing won't be lost
                       var anim = Animation(this, jQuery.extend({}, prop), optall);
                       // Empty animations, or finishing resolves immediately
                       if (empty || dataPriv.get(this, "finish")) {
                           anim.stop(true);
                       }
                   };
               doAnimation.finish = doAnimation;
               return empty || optall.queue === false ?
                   this.each(doAnimation) :
                   this.queue(optall.queue, doAnimation);
           },
           stop: function (type, clearQueue, gotoEnd) {
               var stopQueue = function (hooks) {
                   var stop = hooks.stop;
                   delete hooks.stop;
                   stop(gotoEnd);
               };
               if (typeof type !== "string") {
                   gotoEnd = clearQueue;
                   clearQueue = type;
                   type = undefined;
               }
               if (clearQueue && type !== false) {
                   this.queue(type || "fx", []);
               }
               return this.each(function () {
                   var dequeue = true,
                       index = type != null && type + "queueHooks",
                       timers = jQuery.timers,
                       data = dataPriv.get(this);
                   if (index) {
                       if (data[index] && data[index].stop) {
                           stopQueue(data[index]);
                       }
                   } else {
                       for (index in data) {
                           if (data[index] && data[index].stop && rrun.test(index)) {
                               stopQueue(data[index]);
                           }
                       }
                   }
                   for (index = timers.length; index--;) {
                       if (timers[index].elem === this &&
                           (type == null || timers[index].queue === type)) {
                           timers[index].anim.stop(gotoEnd);
                           dequeue = false;
                           timers.splice(index, 1);
                       }
                   }
                   // Start the next in the queue if the last step wasn't forced.
                   // Timers currently will call their complete callbacks, which
                   // will dequeue but only if they were gotoEnd.
                   if (dequeue || !gotoEnd) {
                       jQuery.dequeue(this, type);
                   }
               });
           },
           finish: function (type) {
               if (type !== false) {
                   type = type || "fx";
               }
               return this.each(function () {
                   var index,
                       data = dataPriv.get(this),
                       queue = data[type + "queue"],
                       hooks = data[type + "queueHooks"],
                       timers = jQuery.timers,
                       length = queue ? queue.length : 0;
                   // Enable finishing flag on private data
                   data.finish = true;
                   // Empty the queue first
                   jQuery.queue(this, type, []);
                   if (hooks && hooks.stop) {
                       hooks.stop.call(this, true);
                   }
                   // Look for any active animations, and finish them
                   for (index = timers.length; index--;) {
                       if (timers[index].elem === this && timers[index].queue === type) {
                           timers[index].anim.stop(true);
                           timers.splice(index, 1);
                       }
                   }
                   // Look for any animations in the old queue and finish them
                   for (index = 0; index < length; index++) {
                       if (queue[index] && queue[index].finish) {
                           queue[index].finish.call(this);
                       }
                   }
                   // Turn off finishing flag
                   delete data.finish;
               });
           }
       });
       jQuery.each(["toggle", "show", "hide"], function (i, name) {
           var cssFn = jQuery.fn[name];
           jQuery.fn[name] = function (speed, easing, callback) {
               return speed == null || typeof speed === "boolean" ?
                   cssFn.apply(this, arguments) :
                   this.animate(genFx(name, true), speed, easing, callback);
           };
       });
       // Generate shortcuts for custom animations
       jQuery.each({
           slideDown: genFx("show"),
           slideUp: genFx("hide"),
           slideToggle: genFx("toggle"),
           fadeIn: {
               opacity: "show"
           },
           fadeOut: {
               opacity: "hide"
           },
           fadeToggle: {
               opacity: "toggle"
           }
       }, function (name, props) {
           jQuery.fn[name] = function (speed, easing, callback) {
               return this.animate(props, speed, easing, callback);
           };
       });
       jQuery.timers = [];
       jQuery.fx.tick = function () {
           var timer,
               i = 0,
               timers = jQuery.timers;
           fxNow = Date.now();
           for (; i < timers.length; i++) {
               timer = timers[i];
               // Run the timer and safely remove it when done (allowing for external removal)
               if (!timer() && timers[i] === timer) {
                   timers.splice(i--, 1);
               }
           }
           if (!timers.length) {
               jQuery.fx.stop();
           }
           fxNow = undefined;
       };
       jQuery.fx.timer = function (timer) {
           jQuery.timers.push(timer);
           jQuery.fx.start();
       };
       jQuery.fx.interval = 13;
       jQuery.fx.start = function () {
           if (inProgress) {
               return;
           }
           inProgress = true;
           schedule();
       };
       jQuery.fx.stop = function () {
           inProgress = null;
       };
       jQuery.fx.speeds = {
           slow: 600,
           fast: 200,
           // Default speed
           _default: 400
       };


       // Based off of the plugin by Clint Helfers, with permission.
       // https://web.archive.org/web/20100324014747/http://blindsignals.com/index.php/2009/07/jquery-delay/
       jQuery.fn.delay = function (time, type) {
           time = jQuery.fx ? jQuery.fx.speeds[time] || time : time;
           type = type || "fx";
           return this.queue(type, function (next, hooks) {
               var timeout = window.setTimeout(next, time);
               hooks.stop = function () {
                   window.clearTimeout(timeout);
               };
           });
       };


       (function () {
           var input = document.createElement("input"),
               select = document.createElement("select"),
               opt = select.appendChild(document.createElement("option"));
           input.type = "checkbox";
           // Support: Android <=4.3 only
           // Default value for a checkbox should be "on"
           support.checkOn = input.value !== "";
           // Support: IE <=11 only
           // Must access selectedIndex to make default options select
           support.optSelected = opt.selected;
           // Support: IE <=11 only
           // An input loses its value after becoming a radio
           input = document.createElement("input");
           input.value = "t";
           input.type = "radio";
           support.radioValue = input.value === "t";
       })();


       var boolHook,
           attrHandle = jQuery.expr.attrHandle;
       jQuery.fn.extend({
           attr: function (name, value) {
               return access(this, jQuery.attr, name, value, arguments.length > 1);
           },
           removeAttr: function (name) {
               return this.each(function () {
                   jQuery.removeAttr(this, name);
               });
           }
       });
       jQuery.extend({
           attr: function (elem, name, value) {
               var ret, hooks,
                   nType = elem.nodeType;
               // Don't get/set attributes on text, comment and attribute nodes
               if (nType === 3 || nType === 8 || nType === 2) {
                   return;
               }
               // Fallback to prop when attributes are not supported
               if (typeof elem.getAttribute === "undefined") {
                   return jQuery.prop(elem, name, value);
               }
               // Attribute hooks are determined by the lowercase version
               // Grab necessary hook if one is defined
               if (nType !== 1 || !jQuery.isXMLDoc(elem)) {
                   hooks = jQuery.attrHooks[name.toLowerCase()] ||
                       (jQuery.expr.match.bool.test(name) ? boolHook : undefined);
               }
               if (value !== undefined) {
                   if (value === null) {
                       jQuery.removeAttr(elem, name);
                       return;
                   }
                   if (hooks && "set" in hooks &&
                       (ret = hooks.set(elem, value, name)) !== undefined) {
                       return ret;
                   }
                   elem.setAttribute(name, value + "");
                   return value;
               }
               if (hooks && "get" in hooks && (ret = hooks.get(elem, name)) !== null) {
                   return ret;
               }
               ret = jQuery.find.attr(elem, name);
               // Non-existent attributes return null, we normalize to undefined
               return ret == null ? undefined : ret;
           },
           attrHooks: {
               type: {
                   set: function (elem, value) {
                       if (!support.radioValue && value === "radio" &&
                           nodeName(elem, "input")) {
                           var val = elem.value;
                           elem.setAttribute("type", value);
                           if (val) {
                               elem.value = val;
                           }
                           return value;
                       }
                   }
               }
           },
           removeAttr: function (elem, value) {
               var name,
                   i = 0,
                   // Attribute names can contain non-HTML whitespace characters
                   // https://html.spec.whatwg.org/multipage/syntax.html#attributes-2
                   attrNames = value && value.match(rnothtmlwhite);
               if (attrNames && elem.nodeType === 1) {
                   while ((name = attrNames[i++])) {
                       elem.removeAttribute(name);
                   }
               }
           }
       });
       // Hooks for boolean attributes
       boolHook = {
           set: function (elem, value, name) {
               if (value === false) {
                   // Remove boolean attributes when set to false
                   jQuery.removeAttr(elem, name);
               } else {
                   elem.setAttribute(name, name);
               }
               return name;
           }
       };
       jQuery.each(jQuery.expr.match.bool.source.match(/\w+/g), function (i, name) {
           var getter = attrHandle[name] || jQuery.find.attr;
           attrHandle[name] = function (elem, name, isXML) {
               var ret, handle,
                   lowercaseName = name.toLowerCase();
               if (!isXML) {
                   // Avoid an infinite loop by temporarily removing this function from the getter
                   handle = attrHandle[lowercaseName];
                   attrHandle[lowercaseName] = ret;
                   ret = getter(elem, name, isXML) != null ?
                       lowercaseName :
                       null;
                   attrHandle[lowercaseName] = handle;
               }
               return ret;
           };
       });



       var rfocusable = /^(?:input|select|textarea|button)$/i,
           rclickable = /^(?:a|area)$/i;
       jQuery.fn.extend({
           prop: function (name, value) {
               return access(this, jQuery.prop, name, value, arguments.length > 1);
           },
           removeProp: function (name) {
               return this.each(function () {
                   delete this[jQuery.propFix[name] || name];
               });
           }
       });
       jQuery.extend({
           prop: function (elem, name, value) {
               var ret, hooks,
                   nType = elem.nodeType;
               // Don't get/set properties on text, comment and attribute nodes
               if (nType === 3 || nType === 8 || nType === 2) {
                   return;
               }
               if (nType !== 1 || !jQuery.isXMLDoc(elem)) {
                   // Fix name and attach hooks
                   name = jQuery.propFix[name] || name;
                   hooks = jQuery.propHooks[name];
               }
               if (value !== undefined) {
                   if (hooks && "set" in hooks &&
                       (ret = hooks.set(elem, value, name)) !== undefined) {
                       return ret;
                   }
                   return (elem[name] = value);
               }
               if (hooks && "get" in hooks && (ret = hooks.get(elem, name)) !== null) {
                   return ret;
               }
               return elem[name];
           },
           propHooks: {
               tabIndex: {
                   get: function (elem) {
                       // Support: IE <=9 - 11 only
                       // elem.tabIndex doesn't always return the
                       // correct value when it hasn't been explicitly set
                       // https://web.archive.org/web/20141116233347/http://fluidproject.org/blog/2008/01/09/getting-setting-and-removing-tabindex-values-with-javascript/
                       // Use proper attribute retrieval(#12072)
                       var tabindex = jQuery.find.attr(elem, "tabindex");
                       if (tabindex) {
                           return parseInt(tabindex, 10);
                       }
                       if (
                           rfocusable.test(elem.nodeName) ||
                           rclickable.test(elem.nodeName) &&
                           elem.href
                       ) {
                           return 0;
                       }
                       return -1;
                   }
               }
           },
           propFix: {
               "for": "htmlFor",
               "class": "className"
           }
       });
       // Support: IE <=11 only
       // Accessing the selectedIndex property
       // forces the browser to respect setting selected
       // on the option
       // The getter ensures a default option is selected
       // when in an optgroup
       // eslint rule "no-unused-expressions" is disabled for this code
       // since it considers such accessions noop
       if (!support.optSelected) {
           jQuery.propHooks.selected = {
               get: function (elem) {
                   /* eslint no-unused-expressions: "off" */
                   var parent = elem.parentNode;
                   if (parent && parent.parentNode) {
                       parent.parentNode.selectedIndex;
                   }
                   return null;
               },
               set: function (elem) {
                   /* eslint no-unused-expressions: "off" */
                   var parent = elem.parentNode;
                   if (parent) {
                       parent.selectedIndex;
                       if (parent.parentNode) {
                           parent.parentNode.selectedIndex;
                       }
                   }
               }
           };
       }
       jQuery.each([
           "tabIndex",
           "readOnly",
           "maxLength",
           "cellSpacing",
           "cellPadding",
           "rowSpan",
           "colSpan",
           "useMap",
           "frameBorder",
           "contentEditable"
       ], function () {
           jQuery.propFix[this.toLowerCase()] = this;
       });



       // Strip and collapse whitespace according to HTML spec
       // https://infra.spec.whatwg.org/#strip-and-collapse-ascii-whitespace
       function stripAndCollapse(value) {
           var tokens = value.match(rnothtmlwhite) || [];
           return tokens.join(" ");
       }


       function getClass(elem) {
           return elem.getAttribute && elem.getAttribute("class") || "";
       }
       function classesToArray(value) {
           if (Array.isArray(value)) {
               return value;
           }
           if (typeof value === "string") {
               return value.match(rnothtmlwhite) || [];
           }
           return [];
       }
       jQuery.fn.extend({
           addClass: function (value) {
               var classes, elem, cur, curValue, clazz, j, finalValue,
                   i = 0;
               if (isFunction(value)) {
                   return this.each(function (j) {
                       jQuery(this).addClass(value.call(this, j, getClass(this)));
                   });
               }
               classes = classesToArray(value);
               if (classes.length) {
                   while ((elem = this[i++])) {
                       curValue = getClass(elem);
                       cur = elem.nodeType === 1 && (" " + stripAndCollapse(curValue) + " ");
                       if (cur) {
                           j = 0;
                           while ((clazz = classes[j++])) {
                               if (cur.indexOf(" " + clazz + " ") < 0) {
                                   cur += clazz + " ";
                               }
                           }
                           // Only assign if different to avoid unneeded rendering.
                           finalValue = stripAndCollapse(cur);
                           if (curValue !== finalValue) {
                               elem.setAttribute("class", finalValue);
                           }
                       }
                   }
               }
               return this;
           },
           removeClass: function (value) {
               var classes, elem, cur, curValue, clazz, j, finalValue,
                   i = 0;
               if (isFunction(value)) {
                   return this.each(function (j) {
                       jQuery(this).removeClass(value.call(this, j, getClass(this)));
                   });
               }
               if (!arguments.length) {
                   return this.attr("class", "");
               }
               classes = classesToArray(value);
               if (classes.length) {
                   while ((elem = this[i++])) {
                       curValue = getClass(elem);
                       // This expression is here for better compressibility (see addClass)
                       cur = elem.nodeType === 1 && (" " + stripAndCollapse(curValue) + " ");
                       if (cur) {
                           j = 0;
                           while ((clazz = classes[j++])) {
                               // Remove *all* instances
                               while (cur.indexOf(" " + clazz + " ") > -1) {
                                   cur = cur.replace(" " + clazz + " ", " ");
                               }
                           }
                           // Only assign if different to avoid unneeded rendering.
                           finalValue = stripAndCollapse(cur);
                           if (curValue !== finalValue) {
                               elem.setAttribute("class", finalValue);
                           }
                       }
                   }
               }
               return this;
           },
           toggleClass: function (value, stateVal) {
               var type = typeof value,
                   isValidValue = type === "string" || Array.isArray(value);
               if (typeof stateVal === "boolean" && isValidValue) {
                   return stateVal ? this.addClass(value) : this.removeClass(value);
               }
               if (isFunction(value)) {
                   return this.each(function (i) {
                       jQuery(this).toggleClass(
                           value.call(this, i, getClass(this), stateVal),
                           stateVal
                       );
                   });
               }
               return this.each(function () {
                   var className, i, self, classNames;
                   if (isValidValue) {
                       // Toggle individual class names
                       i = 0;
                       self = jQuery(this);
                       classNames = classesToArray(value);
                       while ((className = classNames[i++])) {
                           // Check each className given, space separated list
                           if (self.hasClass(className)) {
                               self.removeClass(className);
                           } else {
                               self.addClass(className);
                           }
                       }
                       // Toggle whole class name
                   } else if (value === undefined || type === "boolean") {
                       className = getClass(this);
                       if (className) {
                           // Store className if set
                           dataPriv.set(this, "__className__", className);
                       }
                       // If the element has a class name or if we're passed `false`,
                       // then remove the whole classname (if there was one, the above saved it).
                       // Otherwise bring back whatever was previously saved (if anything),
                       // falling back to the empty string if nothing was stored.
                       if (this.setAttribute) {
                           this.setAttribute("class",
                               className || value === false ?
                               "" :
                               dataPriv.get(this, "__className__") || ""
                           );
                       }
                   }
               });
           },
           hasClass: function (selector) {
               var className, elem,
                   i = 0;
               className = " " + selector + " ";
               while ((elem = this[i++])) {
                   if (elem.nodeType === 1 &&
                       (" " + stripAndCollapse(getClass(elem)) + " ").indexOf(className) > -1) {
                       return true;
                   }
               }
               return false;
           }
       });



       var rreturn = /\r/g;
       jQuery.fn.extend({
           val: function (value) {
               var hooks, ret, valueIsFunction,
                   elem = this[0];
               if (!arguments.length) {
                   if (elem) {
                       hooks = jQuery.valHooks[elem.type] ||
                           jQuery.valHooks[elem.nodeName.toLowerCase()];
                       if (hooks &&
                           "get" in hooks &&
                           (ret = hooks.get(elem, "value")) !== undefined
                       ) {
                           return ret;
                       }
                       ret = elem.value;
                       // Handle most common string cases
                       if (typeof ret === "string") {
                           return ret.replace(rreturn, "");
                       }
                       // Handle cases where value is null/undef or number
                       return ret == null ? "" : ret;
                   }
                   return;
               }
               valueIsFunction = isFunction(value);
               return this.each(function (i) {
                   var val;
                   if (this.nodeType !== 1) {
                       return;
                   }
                   if (valueIsFunction) {
                       val = value.call(this, i, jQuery(this).val());
                   } else {
                       val = value;
                   }
                   // Treat null/undefined as ""; convert numbers to string
                   if (val == null) {
                       val = "";
                   } else if (typeof val === "number") {
                       val += "";
                   } else if (Array.isArray(val)) {
                       val = jQuery.map(val, function (value) {
                           return value == null ? "" : value + "";
                       });
                   }
                   hooks = jQuery.valHooks[this.type] || jQuery.valHooks[this.nodeName
                       .toLowerCase()];
                   // If set returns undefined, fall back to normal setting
                   if (!hooks || !("set" in hooks) || hooks.set(this, val, "value") ===
                       undefined) {
                       this.value = val;
                   }
               });
           }
       });
       jQuery.extend({
           valHooks: {
               option: {
                   get: function (elem) {
                       var val = jQuery.find.attr(elem, "value");
                       return val != null ?
                           val :
                           // Support: IE <=10 - 11 only
                           // option.text throws exceptions (#14686, #14858)
                           // Strip and collapse whitespace
                           // https://html.spec.whatwg.org/#strip-and-collapse-whitespace
                           stripAndCollapse(jQuery.text(elem));
                   }
               },
               select: {
                   get: function (elem) {
                       var value, option, i,
                           options = elem.options,
                           index = elem.selectedIndex,
                           one = elem.type === "select-one",
                           values = one ? null : [],
                           max = one ? index + 1 : options.length;
                       if (index < 0) {
                           i = max;
                       } else {
                           i = one ? index : 0;
                       }
                       // Loop through all the selected options
                       for (; i < max; i++) {
                           option = options[i];
                           // Support: IE <=9 only
                           // IE8-9 doesn't update selected after form reset (#2551)
                           if ((option.selected || i === index) &&
                               // Don't return options that are disabled or in a disabled optgroup
                               !option.disabled &&
                               (!option.parentNode.disabled ||
                                   !nodeName(option.parentNode, "optgroup"))) {
                               // Get the specific value for the option
                               value = jQuery(option).val();
                               // We don't need an array for one selects
                               if (one) {
                                   return value;
                               }
                               // Multi-Selects return an array
                               values.push(value);
                           }
                       }
                       return values;
                   },
                   set: function (elem, value) {
                       var optionSet, option,
                           options = elem.options,
                           values = jQuery.makeArray(value),
                           i = options.length;
                       while (i--) {
                           option = options[i];
                           /* eslint-disable no-cond-assign */
                           if (option.selected =
                               jQuery.inArray(jQuery.valHooks.option.get(option), values) > -1
                           ) {
                               optionSet = true;
                           }
                           /* eslint-enable no-cond-assign */
                       }
                       // Force browsers to behave consistently when non-matching value is set
                       if (!optionSet) {
                           elem.selectedIndex = -1;
                       }
                       return values;
                   }
               }
           }
       });
       // Radios and checkboxes getter/setter
       jQuery.each(["radio", "checkbox"], function () {
           jQuery.valHooks[this] = {
               set: function (elem, value) {
                   if (Array.isArray(value)) {
                       return (elem.checked = jQuery.inArray(jQuery(elem).val(), value) > -1);
                   }
               }
           };
           if (!support.checkOn) {
               jQuery.valHooks[this].get = function (elem) {
                   return elem.getAttribute("value") === null ? "on" : elem.value;
               };
           }
       });



       // Return jQuery for attributes-only inclusion


       support.focusin = "onfocusin" in window;


       var rfocusMorph = /^(?:focusinfocus|focusoutblur)$/,
           stopPropagationCallback = function (e) {
               e.stopPropagation();
           };
       jQuery.extend(jQuery.event, {
           trigger: function (event, data, elem, onlyHandlers) {
               var i, cur, tmp, bubbleType, ontype, handle, special, lastElement,
                   eventPath = [elem || document],
                   type = hasOwn.call(event, "type") ? event.type : event,
                   namespaces = hasOwn.call(event, "namespace") ? event.namespace.split(".") : [];
               cur = lastElement = tmp = elem = elem || document;
               // Don't do events on text and comment nodes
               if (elem.nodeType === 3 || elem.nodeType === 8) {
                   return;
               }
               // focus/blur morphs to focusin/out; ensure we're not firing them right now
               if (rfocusMorph.test(type + jQuery.event.triggered)) {
                   return;
               }
               if (type.indexOf(".") > -1) {
                   // Namespaced trigger; create a regexp to match event type in handle()
                   namespaces = type.split(".");
                   type = namespaces.shift();
                   namespaces.sort();
               }
               ontype = type.indexOf(":") < 0 && "on" + type;
               // Caller can pass in a jQuery.Event object, Object, or just an event type string
               event = event[jQuery.expando] ?
                   event :
                   new jQuery.Event(type, typeof event === "object" && event);
               // Trigger bitmask: & 1 for native handlers; & 2 for jQuery (always true)
               event.isTrigger = onlyHandlers ? 2 : 3;
               event.namespace = namespaces.join(".");
               event.rnamespace = event.namespace ?
                   new RegExp("(^|\\.)" + namespaces.join("\\.(?:.*\\.|)") + "(\\.|$)") :
                   null;
               // Clean up the event in case it is being reused
               event.result = undefined;
               if (!event.target) {
                   event.target = elem;
               }
               // Clone any incoming data and prepend the event, creating the handler arg list
               data = data == null ? [event] :
                   jQuery.makeArray(data, [event]);
               // Allow special events to draw outside the lines
               special = jQuery.event.special[type] || {};
               if (!onlyHandlers && special.trigger && special.trigger.apply(elem, data) === false) {
                   return;
               }
               // Determine event propagation path in advance, per W3C events spec (#9951)
               // Bubble up to document, then to window; watch for a global ownerDocument var (#9724)
               if (!onlyHandlers && !special.noBubble && !isWindow(elem)) {
                   bubbleType = special.delegateType || type;
                   if (!rfocusMorph.test(bubbleType + type)) {
                       cur = cur.parentNode;
                   }
                   for (; cur; cur = cur.parentNode) {
                       eventPath.push(cur);
                       tmp = cur;
                   }
                   // Only add window if we got to document (e.g., not plain obj or detached DOM)
                   if (tmp === (elem.ownerDocument || document)) {
                       eventPath.push(tmp.defaultView || tmp.parentWindow || window);
                   }
               }
               // Fire handlers on the event path
               i = 0;
               while ((cur = eventPath[i++]) && !event.isPropagationStopped()) {
                   lastElement = cur;
                   event.type = i > 1 ?
                       bubbleType :
                       special.bindType || type;
                   // jQuery handler
                   handle = (dataPriv.get(cur, "events") || {})[event.type] &&
                       dataPriv.get(cur, "handle");
                   if (handle) {
                       handle.apply(cur, data);
                   }
                   // Native handler
                   handle = ontype && cur[ontype];
                   if (handle && handle.apply && acceptData(cur)) {
                       event.result = handle.apply(cur, data);
                       if (event.result === false) {
                           event.preventDefault();
                       }
                   }
               }
               event.type = type;
               // If nobody prevented the default action, do it now
               if (!onlyHandlers && !event.isDefaultPrevented()) {
                   if ((!special._default ||
                           special._default.apply(eventPath.pop(), data) === false) &&
                       acceptData(elem)) {
                       // Call a native DOM method on the target with the same name as the event.
                       // Don't do default actions on window, that's where global variables be (#6170)
                       if (ontype && isFunction(elem[type]) && !isWindow(elem)) {
                           // Don't re-trigger an onFOO event when we call its FOO() method
                           tmp = elem[ontype];
                           if (tmp) {
                               elem[ontype] = null;
                           }
                           // Prevent re-triggering of the same event, since we already bubbled it above
                           jQuery.event.triggered = type;
                           if (event.isPropagationStopped()) {
                               lastElement.addEventListener(type, stopPropagationCallback);
                           }
                           elem[type]();
                           if (event.isPropagationStopped()) {
                               lastElement.removeEventListener(type, stopPropagationCallback);
                           }
                           jQuery.event.triggered = undefined;
                           if (tmp) {
                               elem[ontype] = tmp;
                           }
                       }
                   }
               }
               return event.result;
           },
           // Piggyback on a donor event to simulate a different one
           // Used only for `focus(in | out)` events
           simulate: function (type, elem, event) {
               var e = jQuery.extend(
                   new jQuery.Event(),
                   event, {
                       type: type,
                       isSimulated: true
                   }
               );
               jQuery.event.trigger(e, null, elem);
           }
       });
       jQuery.fn.extend({
           trigger: function (type, data) {
               return this.each(function () {
                   jQuery.event.trigger(type, data, this);
               });
           },
           triggerHandler: function (type, data) {
               var elem = this[0];
               if (elem) {
                   return jQuery.event.trigger(type, data, elem, true);
               }
           }
       });


       // Support: Firefox <=44
       // Firefox doesn't have focus(in | out) events
       // Related ticket - https://bugzilla.mozilla.org/show_bug.cgi?id=687787
       //
       // Support: Chrome <=48 - 49, Safari <=9.0 - 9.1
       // focus(in | out) events fire after focus & blur events,
       // which is spec violation - http://www.w3.org/TR/DOM-Level-3-Events/#events-focusevent-event-order
       // Related ticket - https://bugs.chromium.org/p/chromium/issues/detail?id=449857
       if (!support.focusin) {
           jQuery.each({
               focus: "focusin",
               blur: "focusout"
           }, function (orig, fix) {
               // Attach a single capturing handler on the document while someone wants focusin/focusout
               var handler = function (event) {
                   jQuery.event.simulate(fix, event.target, jQuery.event.fix(event));
               };
               jQuery.event.special[fix] = {
                   setup: function () {
                       var doc = this.ownerDocument || this,
                           attaches = dataPriv.access(doc, fix);
                       if (!attaches) {
                           doc.addEventListener(orig, handler, true);
                       }
                       dataPriv.access(doc, fix, (attaches || 0) + 1);
                   },
                   teardown: function () {
                       var doc = this.ownerDocument || this,
                           attaches = dataPriv.access(doc, fix) - 1;
                       if (!attaches) {
                           doc.removeEventListener(orig, handler, true);
                           dataPriv.remove(doc, fix);
                       } else {
                           dataPriv.access(doc, fix, attaches);
                       }
                   }
               };
           });
       }
       var location = window.location;
       var nonce = Date.now();
       var rquery = (/\?/);


       // Cross-browser xml parsing
       jQuery.parseXML = function (data) {
           var xml;
           if (!data || typeof data !== "string") {
               return null;
           }
           // Support: IE 9 - 11 only
           // IE throws on parseFromString with invalid input.
           try {
               xml = (new window.DOMParser()).parseFromString(data, "text/xml");
           } catch (e) {
               xml = undefined;
           }
           if (!xml || xml.getElementsByTagName("parsererror").length) {
               jQuery.error("Invalid XML: " + data);
           }
           return xml;
       };


       var
           rbracket = /\[\]$/,
           rCRLF = /\r?\n/g,
           rsubmitterTypes = /^(?:submit|button|image|reset|file)$/i,
           rsubmittable = /^(?:input|select|textarea|keygen)/i;
       function buildParams(prefix, obj, traditional, add) {
           var name;
           if (Array.isArray(obj)) {
               // Serialize array item.
               jQuery.each(obj, function (i, v) {
                   if (traditional || rbracket.test(prefix)) {
                       // Treat each array item as a scalar.
                       add(prefix, v);
                   } else {
                       // Item is non-scalar (array or object), encode its numeric index.
                       buildParams(
                           prefix + "[" + (typeof v === "object" && v != null ? i : "") + "]",
                           v,
                           traditional,
                           add
                       );
                   }
               });
           } else if (!traditional && toType(obj) === "object") {
               // Serialize object item.
               for (name in obj) {
                   buildParams(prefix + "[" + name + "]", obj[name], traditional, add);
               }
           } else {
               // Serialize scalar item.
               add(prefix, obj);
           }
       }
       // Serialize an array of form elements or a set of
       // key/values into a query string
       jQuery.param = function (a, traditional) {
           var prefix,
               s = [],
               add = function (key, valueOrFunction) {
                   // If value is a function, invoke it and use its return value
                   var value = isFunction(valueOrFunction) ?
                       valueOrFunction() :
                       valueOrFunction;
                   s[s.length] = encodeURIComponent(key) + "=" +
                       encodeURIComponent(value == null ? "" : value);
               };
           if (a == null) {
               return "";
           }
           // If an array was passed in, assume that it is an array of form elements.
           if (Array.isArray(a) || (a.jquery && !jQuery.isPlainObject(a))) {
               // Serialize the form elements
               jQuery.each(a, function () {
                   add(this.name, this.value);
               });
           } else {
               // If traditional, encode the "old" way (the way 1.3.2 or older
               // did it), otherwise encode params recursively.
               for (prefix in a) {
                   buildParams(prefix, a[prefix], traditional, add);
               }
           }
           // Return the resulting serialization
           return s.join("&");
       };
       jQuery.fn.extend({
           serialize: function () {
               return jQuery.param(this.serializeArray());
           },
           serializeArray: function () {
               return this.map(function () {
                       // Can add propHook for "elements" to filter or add form elements
                       var elements = jQuery.prop(this, "elements");
                       return elements ? jQuery.makeArray(elements) : this;
                   })
                   .filter(function () {
                       var type = this.type;
                       // Use .is( ":disabled" ) so that fieldset[disabled] works
                       return this.name && !jQuery(this).is(":disabled") &&
                           rsubmittable.test(this.nodeName) && !rsubmitterTypes.test(type) &&
                           (this.checked || !rcheckableType.test(type));
                   })
                   .map(function (i, elem) {
                       var val = jQuery(this).val();
                       if (val == null) {
                           return null;
                       }
                       if (Array.isArray(val)) {
                           return jQuery.map(val, function (val) {
                               return {
                                   name: elem.name,
                                   value: val.replace(rCRLF, "\r\n")
                               };
                           });
                       }
                       return {
                           name: elem.name,
                           value: val.replace(rCRLF, "\r\n")
                       };
                   }).get();
           }
       });


       var
           r20 = /%20/g,
           rhash = /#.*$/,
           rantiCache = /([?&])_=[^&]*/,
           rheaders = /^(.*?):[ \t]*([^\r\n]*)$/mg,
           // #7653, #8125, #8152: local protocol detection
           rlocalProtocol = /^(?:about|app|app-storage|.+-extension|file|res|widget):$/,
           rnoContent = /^(?:GET|HEAD)$/,
           rprotocol = /^\/\//,
           /* Prefilters
            * 1) They are useful to introduce custom dataTypes (see ajax/jsonp.js for an example)
            * 2) These are called:
            *    - BEFORE asking for a transport
            *    - AFTER param serialization (s.data is a string if s.processData is true)
            * 3) key is the dataType
            * 4) the catchall symbol "*" can be used
            * 5) execution will start with transport dataType and THEN continue down to "*" if needed
            */
           prefilters = {},
           /* Transports bindings
            * 1) key is the dataType
            * 2) the catchall symbol "*" can be used
            * 3) selection will start with transport dataType and THEN go to "*" if needed
            */
           transports = {},
           // Avoid comment-prolog char sequence (#10098); must appease lint and evade compression
           allTypes = "*/".concat("*"),
           // Anchor tag for parsing the document origin
           originAnchor = document.createElement("a");
       originAnchor.href = location.href;
       // Base "constructor" for jQuery.ajaxPrefilter and jQuery.ajaxTransport
       function addToPrefiltersOrTransports(structure) {
           // dataTypeExpression is optional and defaults to "*"
           return function (dataTypeExpression, func) {
               if (typeof dataTypeExpression !== "string") {
                   func = dataTypeExpression;
                   dataTypeExpression = "*";
               }
               var dataType,
                   i = 0,
                   dataTypes = dataTypeExpression.toLowerCase().match(rnothtmlwhite) || [];
               if (isFunction(func)) {
                   // For each dataType in the dataTypeExpression
                   while ((dataType = dataTypes[i++])) {
                       // Prepend if requested
                       if (dataType[0] === "+") {
                           dataType = dataType.slice(1) || "*";
                           (structure[dataType] = structure[dataType] || []).unshift(func);
                           // Otherwise append
                       } else {
                           (structure[dataType] = structure[dataType] || []).push(func);
                       }
                   }
               }
           };
       }
       // Base inspection function for prefilters and transports
       function inspectPrefiltersOrTransports(structure, options, originalOptions, jqXHR) {
           var inspected = {},
               seekingTransport = (structure === transports);
           function inspect(dataType) {
               var selected;
               inspected[dataType] = true;
               jQuery.each(structure[dataType] || [], function (_, prefilterOrFactory) {
                   var dataTypeOrTransport = prefilterOrFactory(options, originalOptions, jqXHR);
                   if (typeof dataTypeOrTransport === "string" &&
                       !seekingTransport && !inspected[dataTypeOrTransport]) {
                       options.dataTypes.unshift(dataTypeOrTransport);
                       inspect(dataTypeOrTransport);
                       return false;
                   } else if (seekingTransport) {
                       return !(selected = dataTypeOrTransport);
                   }
               });
               return selected;
           }
           return inspect(options.dataTypes[0]) || !inspected["*"] && inspect("*");
       }
       // A special extend for ajax options
       // that takes "flat" options (not to be deep extended)
       // Fixes #9887
       function ajaxExtend(target, src) {
           var key, deep,
               flatOptions = jQuery.ajaxSettings.flatOptions || {};
           for (key in src) {
               if (src[key] !== undefined) {
                   (flatOptions[key] ? target : (deep || (deep = {})))[key] = src[key];
               }
           }
           if (deep) {
               jQuery.extend(true, target, deep);
           }
           return target;
       }
       /* Handles responses to an ajax request:
        * - finds the right dataType (mediates between content-type and expected dataType)
        * - returns the corresponding response
        */
       function ajaxHandleResponses(s, jqXHR, responses) {
           var ct, type, finalDataType, firstDataType,
               contents = s.contents,
               dataTypes = s.dataTypes;
           // Remove auto dataType and get content-type in the process
           while (dataTypes[0] === "*") {
               dataTypes.shift();
               if (ct === undefined) {
                   ct = s.mimeType || jqXHR.getResponseHeader("Content-Type");
               }
           }
           // Check if we're dealing with a known content-type
           if (ct) {
               for (type in contents) {
                   if (contents[type] && contents[type].test(ct)) {
                       dataTypes.unshift(type);
                       break;
                   }
               }
           }
           // Check to see if we have a response for the expected dataType
           if (dataTypes[0] in responses) {
               finalDataType = dataTypes[0];
           } else {
               // Try convertible dataTypes
               for (type in responses) {
                   if (!dataTypes[0] || s.converters[type + " " + dataTypes[0]]) {
                       finalDataType = type;
                       break;
                   }
                   if (!firstDataType) {
                       firstDataType = type;
                   }
               }
               // Or just use first one
               finalDataType = finalDataType || firstDataType;
           }
           // If we found a dataType
           // We add the dataType to the list if needed
           // and return the corresponding response
           if (finalDataType) {
               if (finalDataType !== dataTypes[0]) {
                   dataTypes.unshift(finalDataType);
               }
               return responses[finalDataType];
           }
       }
       /* Chain conversions given the request and the original response
        * Also sets the responseXXX fields on the jqXHR instance
        */
       function ajaxConvert(s, response, jqXHR, isSuccess) {
           var conv2, current, conv, tmp, prev,
               converters = {},
               // Work with a copy of dataTypes in case we need to modify it for conversion
               dataTypes = s.dataTypes.slice();
           // Create converters map with lowercased keys
           if (dataTypes[1]) {
               for (conv in s.converters) {
                   converters[conv.toLowerCase()] = s.converters[conv];
               }
           }
           current = dataTypes.shift();
           // Convert to each sequential dataType
           while (current) {
               if (s.responseFields[current]) {
                   jqXHR[s.responseFields[current]] = response;
               }
               // Apply the dataFilter if provided
               if (!prev && isSuccess && s.dataFilter) {
                   response = s.dataFilter(response, s.dataType);
               }
               prev = current;
               current = dataTypes.shift();
               if (current) {
                   // There's only work to do if current dataType is non-auto
                   if (current === "*") {
                       current = prev;
                       // Convert response if prev dataType is non-auto and differs from current
                   } else if (prev !== "*" && prev !== current) {
                       // Seek a direct converter
                       conv = converters[prev + " " + current] || converters["* " + current];
                       // If none found, seek a pair
                       if (!conv) {
                           for (conv2 in converters) {
                               // If conv2 outputs current
                               tmp = conv2.split(" ");
                               if (tmp[1] === current) {
                                   // If prev can be converted to accepted input
                                   conv = converters[prev + " " + tmp[0]] ||
                                       converters["* " + tmp[0]];
                                   if (conv) {
                                       // Condense equivalence converters
                                       if (conv === true) {
                                           conv = converters[conv2];
                                           // Otherwise, insert the intermediate dataType
                                       } else if (converters[conv2] !== true) {
                                           current = tmp[0];
                                           dataTypes.unshift(tmp[1]);
                                       }
                                       break;
                                   }
                               }
                           }
                       }
                       // Apply converter (if not an equivalence)
                       if (conv !== true) {
                           // Unless errors are allowed to bubble, catch and return them
                           if (conv && s.throws) {
                               response = conv(response);
                           } else {
                               try {
                                   response = conv(response);
                               } catch (e) {
                                   return {
                                       state: "parsererror",
                                       error: conv ? e : "No conversion from " + prev + " to " + current
                                   };
                               }
                           }
                       }
                   }
               }
           }
           return {
               state: "success",
               data: response
           };
       }
       jQuery.extend({
           // Counter for holding the number of active queries
           active: 0,
           // Last-Modified header cache for next request
           lastModified: {},
           etag: {},
           ajaxSettings: {
               url: location.href,
               type: "GET",
               isLocal: rlocalProtocol.test(location.protocol),
               global: true,
               processData: true,
               async: true,
               contentType: "application/x-www-form-urlencoded; charset=UTF-8",
               /*
               timeout: 0,
               data: null,
               dataType: null,
               username: null,
               password: null,
               cache: null,
               throws: false,
               traditional: false,
               headers: {},
               */
               accepts: {
                   "*": allTypes,
                   text: "text/plain",
                   html: "text/html",
                   xml: "application/xml, text/xml",
                   json: "application/json, text/javascript"
               },
               contents: {
                   xml: /\bxml\b/,
                   html: /\bhtml/,
                   json: /\bjson\b/
               },
               responseFields: {
                   xml: "responseXML",
                   text: "responseText",
                   json: "responseJSON"
               },
               // Data converters
               // Keys separate source (or catchall "*") and destination types with a single space
               converters: {
                   // Convert anything to text
                   "* text": String,
                   // Text to html (true = no transformation)
                   "text html": true,
                   // Evaluate text as a json expression
                   "text json": JSON.parse,
                   // Parse text as xml
                   "text xml": jQuery.parseXML
               },
               // For options that shouldn't be deep extended:
               // you can add your own custom options here if
               // and when you create one that shouldn't be
               // deep extended (see ajaxExtend)
               flatOptions: {
                   url: true,
                   context: true
               }
           },
           // Creates a full fledged settings object into target
           // with both ajaxSettings and settings fields.
           // If target is omitted, writes into ajaxSettings.
           ajaxSetup: function (target, settings) {
               return settings ?
                   // Building a settings object
                   ajaxExtend(ajaxExtend(target, jQuery.ajaxSettings), settings) :
                   // Extending ajaxSettings
                   ajaxExtend(jQuery.ajaxSettings, target);
           },
           ajaxPrefilter: addToPrefiltersOrTransports(prefilters),
           ajaxTransport: addToPrefiltersOrTransports(transports),
           // Main method
           ajax: function (url, options) {
               // If url is an object, simulate pre-1.5 signature
               if (typeof url === "object") {
                   options = url;
                   url = undefined;
               }
               // Force options to be an object
               options = options || {};
               var transport,
                   // URL without anti-cache param
                   cacheURL,
                   // Response headers
                   responseHeadersString,
                   responseHeaders,
                   // timeout handle
                   timeoutTimer,
                   // Url cleanup var
                   urlAnchor,
                   // Request state (becomes false upon send and true upon completion)
                   completed,
                   // To know if global events are to be dispatched
                   fireGlobals,
                   // Loop variable
                   i,
                   // uncached part of the url
                   uncached,
                   // Create the final options object
                   s = jQuery.ajaxSetup({}, options),
                   // Callbacks context
                   callbackContext = s.context || s,
                   // Context for global events is callbackContext if it is a DOM node or jQuery collection
                   globalEventContext = s.context &&
                   (callbackContext.nodeType || callbackContext.jquery) ?
                   jQuery(callbackContext) :
                   jQuery.event,
                   // Deferreds
                   deferred = jQuery.Deferred(),
                   completeDeferred = jQuery.Callbacks("once memory"),
                   // Status-dependent callbacks
                   statusCode = s.statusCode || {},
                   // Headers (they are sent all at once)
                   requestHeaders = {},
                   requestHeadersNames = {},
                   // Default abort message
                   strAbort = "canceled",
                   // Fake xhr
                   jqXHR = {
                       readyState: 0,
                       // Builds headers hashtable if needed
                       getResponseHeader: function (key) {
                           var match;
                           if (completed) {
                               if (!responseHeaders) {
                                   responseHeaders = {};
                                   while ((match = rheaders.exec(responseHeadersString))) {
                                       responseHeaders[match[1].toLowerCase() + " "] =
                                           (responseHeaders[match[1].toLowerCase() + " "] || [])
                                           .concat(match[2]);
                                   }
                               }
                               match = responseHeaders[key.toLowerCase() + " "];
                           }
                           return match == null ? null : match.join(", ");
                       },
                       // Raw string
                       getAllResponseHeaders: function () {
                           return completed ? responseHeadersString : null;
                       },
                       // Caches the header
                       setRequestHeader: function (name, value) {
                           if (completed == null) {
                               name = requestHeadersNames[name.toLowerCase()] =
                                   requestHeadersNames[name.toLowerCase()] || name;
                               requestHeaders[name] = value;
                           }
                           return this;
                       },
                       // Overrides response content-type header
                       overrideMimeType: function (type) {
                           if (completed == null) {
                               s.mimeType = type;
                           }
                           return this;
                       },
                       // Status-dependent callbacks
                       statusCode: function (map) {
                           var code;
                           if (map) {
                               if (completed) {
                                   // Execute the appropriate callbacks
                                   jqXHR.always(map[jqXHR.status]);
                               } else {
                                   // Lazy-add the new callbacks in a way that preserves old ones
                                   for (code in map) {
                                       statusCode[code] = [statusCode[code], map[code]];
                                   }
                               }
                           }
                           return this;
                       },
                       // Cancel the request
                       abort: function (statusText) {
                           var finalText = statusText || strAbort;
                           if (transport) {
                               transport.abort(finalText);
                           }
                           done(0, finalText);
                           return this;
                       }
                   };
               // Attach deferreds
               deferred.promise(jqXHR);
               // Add protocol if not provided (prefilters might expect it)
               // Handle falsy url in the settings object (#10093: consistency with old signature)
               // We also use the url parameter if available
               s.url = ((url || s.url || location.href) + "")
                   .replace(rprotocol, location.protocol + "//");
               // Alias method option to type as per ticket #12004
               s.type = options.method || options.type || s.method || s.type;
               // Extract dataTypes list
               s.dataTypes = (s.dataType || "*").toLowerCase().match(rnothtmlwhite) || [""];
               // A cross-domain request is in order when the origin doesn't match the current origin.
               if (s.crossDomain == null) {
                   urlAnchor = document.createElement("a");
                   // Support: IE <=8 - 11, Edge 12 - 15
                   // IE throws exception on accessing the href property if url is malformed,
                   // e.g. http://example.com:80x/
                   try {
                       urlAnchor.href = s.url;
                       // Support: IE <=8 - 11 only
                       // Anchor's host property isn't correctly set when s.url is relative
                       urlAnchor.href = urlAnchor.href;
                       s.crossDomain = originAnchor.protocol + "//" + originAnchor.host !==
                           urlAnchor.protocol + "//" + urlAnchor.host;
                   } catch (e) {
                       // If there is an error parsing the URL, assume it is crossDomain,
                       // it can be rejected by the transport if it is invalid
                       s.crossDomain = true;
                   }
               }
               // Convert data if not already a string
               if (s.data && s.processData && typeof s.data !== "string") {
                   s.data = jQuery.param(s.data, s.traditional);
               }
               // Apply prefilters
               inspectPrefiltersOrTransports(prefilters, s, options, jqXHR);
               // If request was aborted inside a prefilter, stop there
               if (completed) {
                   return jqXHR;
               }
               // We can fire global events as of now if asked to
               // Don't fire events if jQuery.event is undefined in an AMD-usage scenario (#15118)
               fireGlobals = jQuery.event && s.global;
               // Watch for a new set of requests
               if (fireGlobals && jQuery.active++ === 0) {
                   jQuery.event.trigger("ajaxStart");
               }
               // Uppercase the type
               s.type = s.type.toUpperCase();
               // Determine if request has content
               s.hasContent = !rnoContent.test(s.type);
               // Save the URL in case we're toying with the If-Modified-Since
               // and/or If-None-Match header later on
               // Remove hash to simplify url manipulation
               cacheURL = s.url.replace(rhash, "");
               // More options handling for requests with no content
               if (!s.hasContent) {
                   // Remember the hash so we can put it back
                   uncached = s.url.slice(cacheURL.length);
                   // If data is available and should be processed, append data to url
                   if (s.data && (s.processData || typeof s.data === "string")) {
                       cacheURL += (rquery.test(cacheURL) ? "&" : "?") + s.data;
                       // #9682: remove data so that it's not used in an eventual retry
                       delete s.data;
                   }
                   // Add or update anti-cache param if needed
                   if (s.cache === false) {
                       cacheURL = cacheURL.replace(rantiCache, "$1");
                       uncached = (rquery.test(cacheURL) ? "&" : "?") + "_=" + (nonce++) + uncached;
                   }
                   // Put hash and anti-cache on the URL that will be requested (gh-1732)
                   s.url = cacheURL + uncached;
                   // Change '%20' to '+' if this is encoded form body content (gh-2658)
               } else if (s.data && s.processData &&
                   (s.contentType || "").indexOf("application/x-www-form-urlencoded") === 0) {
                   s.data = s.data.replace(r20, "+");
               }
               // Set the If-Modified-Since and/or If-None-Match header, if in ifModified mode.
               if (s.ifModified) {
                   if (jQuery.lastModified[cacheURL]) {
                       jqXHR.setRequestHeader("If-Modified-Since", jQuery.lastModified[cacheURL]);
                   }
                   if (jQuery.etag[cacheURL]) {
                       jqXHR.setRequestHeader("If-None-Match", jQuery.etag[cacheURL]);
                   }
               }
               // Set the correct header, if data is being sent
               if (s.data && s.hasContent && s.contentType !== false || options.contentType) {
                   jqXHR.setRequestHeader("Content-Type", s.contentType);
               }
               // Set the Accepts header for the server, depending on the dataType
               jqXHR.setRequestHeader(
                   "Accept",
                   s.dataTypes[0] && s.accepts[s.dataTypes[0]] ?
                   s.accepts[s.dataTypes[0]] +
                   (s.dataTypes[0] !== "*" ? ", " + allTypes + "; q=0.01" : "") :
                   s.accepts["*"]
               );
               // Check for headers option
               for (i in s.headers) {
                   jqXHR.setRequestHeader(i, s.headers[i]);
               }
               // Allow custom headers/mimetypes and early abort
               if (s.beforeSend &&
                   (s.beforeSend.call(callbackContext, jqXHR, s) === false || completed)) {
                   // Abort if not done already and return
                   return jqXHR.abort();
               }
               // Aborting is no longer a cancellation
               strAbort = "abort";
               // Install callbacks on deferreds
               completeDeferred.add(s.complete);
               jqXHR.done(s.success);
               jqXHR.fail(s.error);
               // Get transport
               transport = inspectPrefiltersOrTransports(transports, s, options, jqXHR);
               // If no transport, we auto-abort
               if (!transport) {
                   done(-1, "No Transport");
               } else {
                   jqXHR.readyState = 1;
                   // Send global event
                   if (fireGlobals) {
                       globalEventContext.trigger("ajaxSend", [jqXHR, s]);
                   }
                   // If request was aborted inside ajaxSend, stop there
                   if (completed) {
                       return jqXHR;
                   }
                   // Timeout
                   if (s.async && s.timeout > 0) {
                       timeoutTimer = window.setTimeout(function () {
                           jqXHR.abort("timeout");
                       }, s.timeout);
                   }
                   try {
                       completed = false;
                       transport.send(requestHeaders, done);
                   } catch (e) {
                       // Rethrow post-completion exceptions
                       if (completed) {
                           throw e;
                       }
                       // Propagate others as results
                       done(-1, e);
                   }
               }
               // Callback for when everything is done
               function done(status, nativeStatusText, responses, headers) {
                   var isSuccess, success, error, response, modified,
                       statusText = nativeStatusText;
                   // Ignore repeat invocations
                   if (completed) {
                       return;
                   }
                   completed = true;
                   // Clear timeout if it exists
                   if (timeoutTimer) {
                       window.clearTimeout(timeoutTimer);
                   }
                   // Dereference transport for early garbage collection
                   // (no matter how long the jqXHR object will be used)
                   transport = undefined;
                   // Cache response headers
                   responseHeadersString = headers || "";
                   // Set readyState
                   jqXHR.readyState = status > 0 ? 4 : 0;
                   // Determine if successful
                   isSuccess = status >= 200 && status < 300 || status === 304;
                   // Get response data
                   if (responses) {
                       response = ajaxHandleResponses(s, jqXHR, responses);
                   }
                   // Convert no matter what (that way responseXXX fields are always set)
                   response = ajaxConvert(s, response, jqXHR, isSuccess);
                   // If successful, handle type chaining
                   if (isSuccess) {
                       // Set the If-Modified-Since and/or If-None-Match header, if in ifModified mode.
                       if (s.ifModified) {
                           modified = jqXHR.getResponseHeader("Last-Modified");
                           if (modified) {
                               jQuery.lastModified[cacheURL] = modified;
                           }
                           modified = jqXHR.getResponseHeader("etag");
                           if (modified) {
                               jQuery.etag[cacheURL] = modified;
                           }
                       }
                       // if no content
                       if (status === 204 || s.type === "HEAD") {
                           statusText = "nocontent";
                           // if not modified
                       } else if (status === 304) {
                           statusText = "notmodified";
                           // If we have data, let's convert it
                       } else {
                           statusText = response.state;
                           success = response.data;
                           error = response.error;
                           isSuccess = !error;
                       }
                   } else {
                       // Extract error from statusText and normalize for non-aborts
                       error = statusText;
                       if (status || !statusText) {
                           statusText = "error";
                           if (status < 0) {
                               status = 0;
                           }
                       }
                   }
                   // Set data for the fake xhr object
                   jqXHR.status = status;
                   jqXHR.statusText = (nativeStatusText || statusText) + "";
                   // Success/Error
                   if (isSuccess) {
                       deferred.resolveWith(callbackContext, [success, statusText, jqXHR]);
                   } else {
                       deferred.rejectWith(callbackContext, [jqXHR, statusText, error]);
                   }
                   // Status-dependent callbacks
                   jqXHR.statusCode(statusCode);
                   statusCode = undefined;
                   if (fireGlobals) {
                       globalEventContext.trigger(isSuccess ? "ajaxSuccess" : "ajaxError",
                           [jqXHR, s, isSuccess ? success : error]);
                   }
                   // Complete
                   completeDeferred.fireWith(callbackContext, [jqXHR, statusText]);
                   if (fireGlobals) {
                       globalEventContext.trigger("ajaxComplete", [jqXHR, s]);
                       // Handle the global AJAX counter
                       if (!(--jQuery.active)) {
                           jQuery.event.trigger("ajaxStop");
                       }
                   }
               }
               return jqXHR;
           },
           getJSON: function (url, data, callback) {
               return jQuery.get(url, data, callback, "json");
           },
           getScript: function (url, callback) {
               return jQuery.get(url, undefined, callback, "script");
           }
       });
       jQuery.each(["get", "post"], function (i, method) {
           jQuery[method] = function (url, data, callback, type) {
               // Shift arguments if data argument was omitted
               if (isFunction(data)) {
                   type = type || callback;
                   callback = data;
                   data = undefined;
               }
               // The url can be an options object (which then must have .url)
               return jQuery.ajax(jQuery.extend({
                   url: url,
                   type: method,
                   dataType: type,
                   data: data,
                   success: callback
               }, jQuery.isPlainObject(url) && url));
           };
       });


       jQuery._evalUrl = function (url, options) {
           return jQuery.ajax({
               url: url,
               // Make this explicit, since user can override this through ajaxSetup (#11264)
               type: "GET",
               dataType: "script",
               cache: true,
               async: false,
               global: false,
               // Only evaluate the response if it is successful (gh-4126)
               // dataFilter is not invoked for failure responses, so using it instead
               // of the default converter is kludgy but it works.
               converters: {
                   "text script": function () {}
               },
               dataFilter: function (response) {
                   jQuery.globalEval(response, options);
               }
           });
       };


       jQuery.fn.extend({
           wrapAll: function (html) {
               var wrap;
               if (this[0]) {
                   if (isFunction(html)) {
                       html = html.call(this[0]);
                   }
                   // The elements to wrap the target around
                   wrap = jQuery(html, this[0].ownerDocument).eq(0).clone(true);
                   if (this[0].parentNode) {
                       wrap.insertBefore(this[0]);
                   }
                   wrap.map(function () {
                       var elem = this;
                       while (elem.firstElementChild) {
                           elem = elem.firstElementChild;
                       }
                       return elem;
                   }).append(this);
               }
               return this;
           },
           wrapInner: function (html) {
               if (isFunction(html)) {
                   return this.each(function (i) {
                       jQuery(this).wrapInner(html.call(this, i));
                   });
               }
               return this.each(function () {
                   var self = jQuery(this),
                       contents = self.contents();
                   if (contents.length) {
                       contents.wrapAll(html);
                   } else {
                       self.append(html);
                   }
               });
           },
           wrap: function (html) {
               var htmlIsFunction = isFunction(html);
               return this.each(function (i) {
                   jQuery(this).wrapAll(htmlIsFunction ? html.call(this, i) : html);
               });
           },
           unwrap: function (selector) {
               this.parent(selector).not("body").each(function () {
                   jQuery(this).replaceWith(this.childNodes);
               });
               return this;
           }
       });


       jQuery.expr.pseudos.hidden = function (elem) {
           return !jQuery.expr.pseudos.visible(elem);
       };
       jQuery.expr.pseudos.visible = function (elem) {
           return !!(elem.offsetWidth || elem.offsetHeight || elem.getClientRects().length);
       };



       jQuery.ajaxSettings.xhr = function () {
           try {
               return new window.XMLHttpRequest();
           } catch (e) {}
       };
       var xhrSuccessStatus = {
               // File protocol always yields status code 0, assume 200
               0: 200,
               // Support: IE <=9 only
               // #1450: sometimes IE returns 1223 when it should be 204
               1223: 204
           },
           xhrSupported = jQuery.ajaxSettings.xhr();
       support.cors = !!xhrSupported && ("withCredentials" in xhrSupported);
       support.ajax = xhrSupported = !!xhrSupported;
       jQuery.ajaxTransport(function (options) {
           var callback, errorCallback;
           // Cross domain only allowed if supported through XMLHttpRequest
           if (support.cors || xhrSupported && !options.crossDomain) {
               return {
                   send: function (headers, complete) {
                       var i,
                           xhr = options.xhr();
                       xhr.open(
                           options.type,
                           options.url,
                           options.async,
                           options.username,
                           options.password
                       );
                       // Apply custom fields if provided
                       if (options.xhrFields) {
                           for (i in options.xhrFields) {
                               xhr[i] = options.xhrFields[i];
                           }
                       }
                       // Override mime type if needed
                       if (options.mimeType && xhr.overrideMimeType) {
                           xhr.overrideMimeType(options.mimeType);
                       }
                       // X-Requested-With header
                       // For cross-domain requests, seeing as conditions for a preflight are
                       // akin to a jigsaw puzzle, we simply never set it to be sure.
                       // (it can always be set on a per-request basis or even using ajaxSetup)
                       // For same-domain requests, won't change header if already provided.
                       if (!options.crossDomain && !headers["X-Requested-With"]) {
                           headers["X-Requested-With"] = "XMLHttpRequest";
                       }
                       // Set headers
                       for (i in headers) {
                           xhr.setRequestHeader(i, headers[i]);
                       }
                       // Callback
                       callback = function (type) {
                           return function () {
                               if (callback) {
                                   callback = errorCallback = xhr.onload =
                                       xhr.onerror = xhr.onabort = xhr.ontimeout =
                                       xhr.onreadystatechange = null;
                                   if (type === "abort") {
                                       xhr.abort();
                                   } else if (type === "error") {
                                       // Support: IE <=9 only
                                       // On a manual native abort, IE9 throws
                                       // errors on any property access that is not readyState
                                       if (typeof xhr.status !== "number") {
                                           complete(0, "error");
                                       } else {
                                           complete(
                                               // File: protocol always yields status 0; see #8605, #14207
                                               xhr.status,
                                               xhr.statusText
                                           );
                                       }
                                   } else {
                                       complete(
                                           xhrSuccessStatus[xhr.status] || xhr.status,
                                           xhr.statusText,
                                           // Support: IE <=9 only
                                           // IE9 has no XHR2 but throws on binary (trac-11426)
                                           // For XHR2 non-text, let the caller handle it (gh-2498)
                                           (xhr.responseType || "text") !== "text" ||
                                           typeof xhr.responseText !== "string" ? {
                                               binary: xhr.response
                                           } : {
                                               text: xhr.responseText
                                           },
                                           xhr.getAllResponseHeaders()
                                       );
                                   }
                               }
                           };
                       };
                       // Listen to events
                       xhr.onload = callback();
                       errorCallback = xhr.onerror = xhr.ontimeout = callback("error");
                       // Support: IE 9 only
                       // Use onreadystatechange to replace onabort
                       // to handle uncaught aborts
                       if (xhr.onabort !== undefined) {
                           xhr.onabort = errorCallback;
                       } else {
                           xhr.onreadystatechange = function () {
                               // Check readyState before timeout as it changes
                               if (xhr.readyState === 4) {
                                   // Allow onerror to be called first,
                                   // but that will not handle a native abort
                                   // Also, save errorCallback to a variable
                                   // as xhr.onerror cannot be accessed
                                   window.setTimeout(function () {
                                       if (callback) {
                                           errorCallback();
                                       }
                                   });
                               }
                           };
                       }
                       // Create the abort callback
                       callback = callback("abort");
                       try {
                           // Do send the request (this may raise an exception)
                           xhr.send(options.hasContent && options.data || null);
                       } catch (e) {
                           // #14683: Only rethrow if this hasn't been notified as an error yet
                           if (callback) {
                               throw e;
                           }
                       }
                   },
                   abort: function () {
                       if (callback) {
                           callback();
                       }
                   }
               };
           }
       });



       // Prevent auto-execution of scripts when no explicit dataType was provided (See gh-2432)
       jQuery.ajaxPrefilter(function (s) {
           if (s.crossDomain) {
               s.contents.script = false;
           }
       });
       // Install script dataType
       jQuery.ajaxSetup({
           accepts: {
               script: "text/javascript, application/javascript, " +
                   "application/ecmascript, application/x-ecmascript"
           },
           contents: {
               script: /\b(?:java|ecma)script\b/
           },
           converters: {
               "text script": function (text) {
                   jQuery.globalEval(text);
                   return text;
               }
           }
       });
       // Handle cache's special case and crossDomain
       jQuery.ajaxPrefilter("script", function (s) {
           if (s.cache === undefined) {
               s.cache = false;
           }
           if (s.crossDomain) {
               s.type = "GET";
           }
       });
       // Bind script tag hack transport
       jQuery.ajaxTransport("script", function (s) {
           // This transport only deals with cross domain or forced-by-attrs requests
           if (s.crossDomain || s.scriptAttrs) {
               var script, callback;
               return {
                   send: function (_, complete) {
                       script = jQuery("<script>")
                           .attr(s.scriptAttrs || {})
                           .prop({
                               charset: s.scriptCharset,
                               src: s.url
                           })
                           .on("load error", callback = function (evt) {
                               script.remove();
                               callback = null;
                               if (evt) {
                                   complete(evt.type === "error" ? 404 : 200, evt.type);
                               }
                           });
                       // Use native DOM manipulation to avoid our domManip AJAX trickery
                       document.head.appendChild(script[0]);
                   },
                   abort: function () {
                       if (callback) {
                           callback();
                       }
                   }
               };
           }
       });



       var oldCallbacks = [],
           rjsonp = /(=)\?(?=&|$)|\?\?/;
       // Default jsonp settings
       jQuery.ajaxSetup({
           jsonp: "callback",
           jsonpCallback: function () {
               var callback = oldCallbacks.pop() || (jQuery.expando + "_" + (nonce++));
               this[callback] = true;
               return callback;
           }
       });
       // Detect, normalize options and install callbacks for jsonp requests
       jQuery.ajaxPrefilter("json jsonp", function (s, originalSettings, jqXHR) {
           var callbackName, overwritten, responseContainer,
               jsonProp = s.jsonp !== false && (rjsonp.test(s.url) ?
                   "url" :
                   typeof s.data === "string" &&
                   (s.contentType || "")
                   .indexOf("application/x-www-form-urlencoded") === 0 &&
                   rjsonp.test(s.data) && "data"
               );
           // Handle iff the expected data type is "jsonp" or we have a parameter to set
           if (jsonProp || s.dataTypes[0] === "jsonp") {
               // Get callback name, remembering preexisting value associated with it
               callbackName = s.jsonpCallback = isFunction(s.jsonpCallback) ?
                   s.jsonpCallback() :
                   s.jsonpCallback;
               // Insert callback into url or form data
               if (jsonProp) {
                   s[jsonProp] = s[jsonProp].replace(rjsonp, "$1" + callbackName);
               } else if (s.jsonp !== false) {
                   s.url += (rquery.test(s.url) ? "&" : "?") + s.jsonp + "=" + callbackName;
               }
               // Use data converter to retrieve json after script execution
               s.converters["script json"] = function () {
                   if (!responseContainer) {
                       jQuery.error(callbackName + " was not called");
                   }
                   return responseContainer[0];
               };
               // Force json dataType
               s.dataTypes[0] = "json";
               // Install callback
               overwritten = window[callbackName];
               window[callbackName] = function () {
                   responseContainer = arguments;
               };
               // Clean-up function (fires after converters)
               jqXHR.always(function () {
                   // If previous value didn't exist - remove it
                   if (overwritten === undefined) {
                       jQuery(window).removeProp(callbackName);
                       // Otherwise restore preexisting value
                   } else {
                       window[callbackName] = overwritten;
                   }
                   // Save back as free
                   if (s[callbackName]) {
                       // Make sure that re-using the options doesn't screw things around
                       s.jsonpCallback = originalSettings.jsonpCallback;
                       // Save the callback name for future use
                       oldCallbacks.push(callbackName);
                   }
                   // Call if it was a function and we have a response
                   if (responseContainer && isFunction(overwritten)) {
                       overwritten(responseContainer[0]);
                   }
                   responseContainer = overwritten = undefined;
               });
               // Delegate to script
               return "script";
           }
       });



       // Support: Safari 8 only
       // In Safari 8 documents created via document.implementation.createHTMLDocument
       // collapse sibling forms: the second one becomes a child of the first one.
       // Because of that, this security measure has to be disabled in Safari 8.
       // https://bugs.webkit.org/show_bug.cgi?id=137337
       support.createHTMLDocument = (function () {
           var body = document.implementation.createHTMLDocument("").body;
           body.innerHTML = "<form></form><form></form>";
           return body.childNodes.length === 2;
       })();


       // Argument "data" should be string of html
       // context (optional): If specified, the fragment will be created in this context,
       // defaults to document
       // keepScripts (optional): If true, will include scripts passed in the html string
       jQuery.parseHTML = function (data, context, keepScripts) {
           if (typeof data !== "string") {
               return [];
           }
           if (typeof context === "boolean") {
               keepScripts = context;
               context = false;
           }
           var base, parsed, scripts;
           if (!context) {
               // Stop scripts or inline event handlers from being executed immediately
               // by using document.implementation
               if (support.createHTMLDocument) {
                   context = document.implementation.createHTMLDocument("");
                   // Set the base href for the created document
                   // so any parsed elements with URLs
                   // are based on the document's URL (gh-2965)
                   base = context.createElement("base");
                   base.href = document.location.href;
                   context.head.appendChild(base);
               } else {
                   context = document;
               }
           }
           parsed = rsingleTag.exec(data);
           scripts = !keepScripts && [];
           // Single tag
           if (parsed) {
               return [context.createElement(parsed[1])];
           }
           parsed = buildFragment([data], context, scripts);
           if (scripts && scripts.length) {
               jQuery(scripts).remove();
           }
           return jQuery.merge([], parsed.childNodes);
       };


       /**
        * Load a url into a page
        */
       jQuery.fn.load = function (url, params, callback) {
           var selector, type, response,
               self = this,
               off = url.indexOf(" ");
           if (off > -1) {
               selector = stripAndCollapse(url.slice(off));
               url = url.slice(0, off);
           }
           // If it's a function
           if (isFunction(params)) {
               // We assume that it's the callback
               callback = params;
               params = undefined;
               // Otherwise, build a param string
           } else if (params && typeof params === "object") {
               type = "POST";
           }
           // If we have elements to modify, make the request
           if (self.length > 0) {
               jQuery.ajax({
                   url: url,
                   // If "type" variable is undefined, then "GET" method will be used.
                   // Make value of this field explicit since
                   // user can override it through ajaxSetup method
                   type: type || "GET",
                   dataType: "html",
                   data: params
               }).done(function (responseText) {
                   // Save response for use in complete callback
                   response = arguments;
                   self.html(selector ?
                       // If a selector was specified, locate the right elements in a dummy div
                       // Exclude scripts to avoid IE 'Permission Denied' errors
jQuery("
").append(jQuery.parseHTML(responseText)).find(selector) :
                       // Otherwise use the full result
                       responseText);
                   // If the request succeeds, this function gets "data", "status", "jqXHR"
                   // but they are ignored because response was set above.
                   // If it fails, this function gets "jqXHR", "status", "error"
               }).always(callback && function (jqXHR, status) {
                   self.each(function () {
                       callback.apply(this, response || [jqXHR.responseText, status, jqXHR]);
                   });
               });
           }
           return this;
       };



       // Attach a bunch of functions for handling common AJAX events
       jQuery.each([
           "ajaxStart",
           "ajaxStop",
           "ajaxComplete",
           "ajaxError",
           "ajaxSuccess",
           "ajaxSend"
       ], function (i, type) {
           jQuery.fn[type] = function (fn) {
               return this.on(type, fn);
           };
       });



       jQuery.expr.pseudos.animated = function (elem) {
           return jQuery.grep(jQuery.timers, function (fn) {
               return elem === fn.elem;
           }).length;
       };



       jQuery.offset = {
           setOffset: function (elem, options, i) {
               var curPosition, curLeft, curCSSTop, curTop, curOffset, curCSSLeft, calculatePosition,
                   position = jQuery.css(elem, "position"),
                   curElem = jQuery(elem),
                   props = {};
               // Set position first, in-case top/left are set even on static elem
               if (position === "static") {
                   elem.style.position = "relative";
               }
               curOffset = curElem.offset();
               curCSSTop = jQuery.css(elem, "top");
               curCSSLeft = jQuery.css(elem, "left");
               calculatePosition = (position === "absolute" || position === "fixed") &&
                   (curCSSTop + curCSSLeft).indexOf("auto") > -1;
               // Need to be able to calculate position if either
               // top or left is auto and position is either absolute or fixed
               if (calculatePosition) {
                   curPosition = curElem.position();
                   curTop = curPosition.top;
                   curLeft = curPosition.left;
               } else {
                   curTop = parseFloat(curCSSTop) || 0;
                   curLeft = parseFloat(curCSSLeft) || 0;
               }
               if (isFunction(options)) {
                   // Use jQuery.extend here to allow modification of coordinates argument (gh-1848)
                   options = options.call(elem, i, jQuery.extend({}, curOffset));
               }
               if (options.top != null) {
                   props.top = (options.top - curOffset.top) + curTop;
               }
               if (options.left != null) {
                   props.left = (options.left - curOffset.left) + curLeft;
               }
               if ("using" in options) {
                   options.using.call(elem, props);
               } else {
                   curElem.css(props);
               }
           }
       };
       jQuery.fn.extend({
           // offset() relates an element's border box to the document origin
           offset: function (options) {
               // Preserve chaining for setter
               if (arguments.length) {
                   return options === undefined ?
                       this :
                       this.each(function (i) {
                           jQuery.offset.setOffset(this, options, i);
                       });
               }
               var rect, win,
                   elem = this[0];
               if (!elem) {
                   return;
               }
               // Return zeros for disconnected and hidden (display: none) elements (gh-2310)
               // Support: IE <=11 only
               // Running getBoundingClientRect on a
               // disconnected node in IE throws an error
               if (!elem.getClientRects().length) {
                   return {
                       top: 0,
                       left: 0
                   };
               }
               // Get document-relative position by adding viewport scroll to viewport-relative gBCR
               rect = elem.getBoundingClientRect();
               win = elem.ownerDocument.defaultView;
               return {
                   top: rect.top + win.pageYOffset,
                   left: rect.left + win.pageXOffset
               };
           },
           // position() relates an element's margin box to its offset parent's padding box
           // This corresponds to the behavior of CSS absolute positioning
           position: function () {
               if (!this[0]) {
                   return;
               }
               var offsetParent, offset, doc,
                   elem = this[0],
                   parentOffset = {
                       top: 0,
                       left: 0
                   };
               // position:fixed elements are offset from the viewport, which itself always has zero offset
               if (jQuery.css(elem, "position") === "fixed") {
                   // Assume position:fixed implies availability of getBoundingClientRect
                   offset = elem.getBoundingClientRect();
               } else {
                   offset = this.offset();
                   // Account for the *real* offset parent, which can be the document or its root element
                   // when a statically positioned element is identified
                   doc = elem.ownerDocument;
                   offsetParent = elem.offsetParent || doc.documentElement;
                   while (offsetParent &&
                       (offsetParent === doc.body || offsetParent === doc.documentElement) &&
                       jQuery.css(offsetParent, "position") === "static") {
                       offsetParent = offsetParent.parentNode;
                   }
                   if (offsetParent && offsetParent !== elem && offsetParent.nodeType === 1) {
                       // Incorporate borders into its offset, since they are outside its content origin
                       parentOffset = jQuery(offsetParent).offset();
                       parentOffset.top += jQuery.css(offsetParent, "borderTopWidth", true);
                       parentOffset.left += jQuery.css(offsetParent, "borderLeftWidth", true);
                   }
               }
               // Subtract parent offsets and element margins
               return {
                   top: offset.top - parentOffset.top - jQuery.css(elem, "marginTop", true),
                   left: offset.left - parentOffset.left - jQuery.css(elem, "marginLeft", true)
               };
           },
           // This method will return documentElement in the following cases:
           // 1) For the element inside the iframe without offsetParent, this method will return
           //    documentElement of the parent window
           // 2) For the hidden or detached element
           // 3) For body or html element, i.e. in case of the html node - it will return itself
           //
           // but those exceptions were never presented as a real life use-cases
           // and might be considered as more preferable results.
           //
           // This logic, however, is not guaranteed and can change at any point in the future
           offsetParent: function () {
               return this.map(function () {
                   var offsetParent = this.offsetParent;
                   while (offsetParent && jQuery.css(offsetParent, "position") === "static") {
                       offsetParent = offsetParent.offsetParent;
                   }
                   return offsetParent || documentElement;
               });
           }
       });
       // Create scrollLeft and scrollTop methods
       jQuery.each({
           scrollLeft: "pageXOffset",
           scrollTop: "pageYOffset"
       }, function (method, prop) {
           var top = "pageYOffset" === prop;
           jQuery.fn[method] = function (val) {
               return access(this, function (elem, method, val) {
                   // Coalesce documents and windows
                   var win;
                   if (isWindow(elem)) {
                       win = elem;
                   } else if (elem.nodeType === 9) {
                       win = elem.defaultView;
                   }
                   if (val === undefined) {
                       return win ? win[prop] : elem[method];
                   }
                   if (win) {
                       win.scrollTo(
                           !top ? val : win.pageXOffset,
                           top ? val : win.pageYOffset
                       );
                   } else {
                       elem[method] = val;
                   }
               }, method, val, arguments.length);
           };
       });
       // Support: Safari <=7 - 9.1, Chrome <=37 - 49
       // Add the top/left cssHooks using jQuery.fn.position
       // Webkit bug: https://bugs.webkit.org/show_bug.cgi?id=29084
       // Blink bug: https://bugs.chromium.org/p/chromium/issues/detail?id=589347
       // getComputedStyle returns percent when specified for top/left/bottom/right;
       // rather than make the css module depend on the offset module, just check for it here
       jQuery.each(["top", "left"], function (i, prop) {
           jQuery.cssHooks[prop] = addGetHookIf(support.pixelPosition,
               function (elem, computed) {
                   if (computed) {
                       computed = curCSS(elem, prop);
                       // If curCSS returns percentage, fallback to offset
                       return rnumnonpx.test(computed) ?
                           jQuery(elem).position()[prop] + "px" :
                           computed;
                   }
               }
           );
       });


       // Create innerHeight, innerWidth, height, width, outerHeight and outerWidth methods
       jQuery.each({
           Height: "height",
           Width: "width"
       }, function (name, type) {
           jQuery.each({
                   padding: "inner" + name,
                   content: type,
                   "": "outer" + name
               },
               function (defaultExtra, funcName) {
                   // Margin is only for outerHeight, outerWidth
                   jQuery.fn[funcName] = function (margin, value) {
                       var chainable = arguments.length && (defaultExtra || typeof margin !==
                               "boolean"),
                           extra = defaultExtra || (margin === true || value === true ? "margin" :
                               "border");
                       return access(this, function (elem, type, value) {
                           var doc;
                           if (isWindow(elem)) {
                               // $( window ).outerWidth/Height return w/h including scrollbars (gh-1729)
                               return funcName.indexOf("outer") === 0 ?
                                   elem["inner" + name] :
                                   elem.document.documentElement["client" + name];
                           }
                           // Get document width or height
                           if (elem.nodeType === 9) {
                               doc = elem.documentElement;
                               // Either scroll[Width/Height] or offset[Width/Height] or client[Width/Height],
                               // whichever is greatest
                               return Math.max(
                                   elem.body["scroll" + name], doc["scroll" + name],
                                   elem.body["offset" + name], doc["offset" + name],
                                   doc["client" + name]
                               );
                           }
                           return value === undefined ?
                               // Get width or height on the element, requesting but not forcing parseFloat
                               jQuery.css(elem, type, extra) :
                               // Set width or height on the element
                               jQuery.style(elem, type, value, extra);
                       }, type, chainable ? margin : undefined, chainable);
                   };
               });
       });


       jQuery.each(("blur focus focusin focusout resize scroll click dblclick " +
               "mousedown mouseup mousemove mouseover mouseout mouseenter mouseleave " +
               "change select submit keydown keypress keyup contextmenu").split(" "),
           function (i, name) {
               // Handle event binding
               jQuery.fn[name] = function (data, fn) {
                   return arguments.length > 0 ?
                       this.on(name, null, data, fn) :
                       this.trigger(name);
               };
           });
       jQuery.fn.extend({
           hover: function (fnOver, fnOut) {
               return this.mouseenter(fnOver).mouseleave(fnOut || fnOver);
           }
       });



       jQuery.fn.extend({
           bind: function (types, data, fn) {
               return this.on(types, null, data, fn);
           },
           unbind: function (types, fn) {
               return this.off(types, null, fn);
           },
           delegate: function (selector, types, data, fn) {
               return this.on(types, selector, data, fn);
           },
           undelegate: function (selector, types, fn) {
               // ( namespace ) or ( selector, types [, fn] )
               return arguments.length === 1 ?
                   this.off(selector, "**") :
                   this.off(types, selector || "**", fn);
           }
       });
       // Bind a function to a context, optionally partially applying any
       // arguments.
       // jQuery.proxy is deprecated to promote standards (specifically Function#bind)
       // However, it is not slated for removal any time soon
       jQuery.proxy = function (fn, context) {
           var tmp, args, proxy;
           if (typeof context === "string") {
               tmp = fn[context];
               context = fn;
               fn = tmp;
           }
           // Quick check to determine if target is callable, in the spec
           // this throws a TypeError, but we will just return undefined.
           if (!isFunction(fn)) {
               return undefined;
           }
           // Simulated bind
           args = slice.call(arguments, 2);
           proxy = function () {
               return fn.apply(context || this, args.concat(slice.call(arguments)));
           };
           // Set the guid of unique handler to the same of original handler, so it can be removed
           proxy.guid = fn.guid = fn.guid || jQuery.guid++;
           return proxy;
       };
       jQuery.holdReady = function (hold) {
           if (hold) {
               jQuery.readyWait++;
           } else {
               jQuery.ready(true);
           }
       };
       jQuery.isArray = Array.isArray;
       jQuery.parseJSON = JSON.parse;
       jQuery.nodeName = nodeName;
       jQuery.isFunction = isFunction;
       jQuery.isWindow = isWindow;
       jQuery.camelCase = camelCase;
       jQuery.type = toType;
       jQuery.now = Date.now;
       jQuery.isNumeric = function (obj) {
           // As of jQuery 3.0, isNumeric is limited to
           // strings and numbers (primitives or objects)
           // that can be coerced to finite numbers (gh-2662)
           var type = jQuery.type(obj);
           return (type === "number" || type === "string") &&
               // parseFloat NaNs numeric-cast false positives ("")
               // ...but misinterprets leading-number strings, particularly hex literals ("0x...")
               // subtraction forces infinities to NaN
               !isNaN(obj - parseFloat(obj));
       };



       // Register as a named AMD module, since jQuery can be concatenated with other
       // files that may use define, but not via a proper concatenation script that
       // understands anonymous AMD modules. A named AMD is safest and most robust
       // way to register. Lowercase jquery is used because AMD module names are
       // derived from file names, and jQuery is normally delivered in a lowercase
       // file name. Do this after creating the global so that if an AMD module wants
       // to call noConflict to hide this version of jQuery, it will work.
       // Note that for maximum portability, libraries that are not jQuery should
       // declare themselves as anonymous modules, and avoid setting a global if an
       // AMD loader is present. jQuery is a special case. For more information, see
       // https://github.com/jrburke/requirejs/wiki/Updating-existing-libraries#wiki-anon
       if (typeof define === "function" && define.amd) {
           define("jquery", [], function () {
               return jQuery;
           });
       }



       var
           // Map over jQuery in case of overwrite
           _jQuery = window.jQuery,
           // Map over the $ in case of overwrite
           _$ = window.$;
       jQuery.noConflict = function (deep) {
           if (window.$ === jQuery) {
               window.$ = _$;
           }
           if (deep && window.jQuery === jQuery) {
               window.jQuery = _jQuery;
           }
           return jQuery;
       };
       // Expose jQuery and $ identifiers, even in AMD
       // (#7102#comment:10, https://github.com/jquery/jquery/pull/557)
       // and CommonJS for browser emulators (#13566)
       if (!noGlobal) {
           window.jQuery = window.$ = jQuery;
       }



       return jQuery;
   });
   /*! jQuery UI - v1.12.1 - 2016-09-14
    * http://jqueryui.com
    * Includes: widget.js, position.js, data.js, disable-selection.js, effect.js, effects/effect-blind.js, effects/effect-bounce.js, effects/effect-clip.js, effects/effect-drop.js, effects/effect-explode.js, effects/effect-fade.js, effects/effect-fold.js, effects/effect-highlight.js, effects/effect-puff.js, effects/effect-pulsate.js, effects/effect-scale.js, effects/effect-shake.js, effects/effect-size.js, effects/effect-slide.js, effects/effect-transfer.js, focusable.js, form-reset-mixin.js, jquery-1-7.js, keycode.js, labels.js, scroll-parent.js, tabbable.js, unique-id.js, widgets/accordion.js, widgets/autocomplete.js, widgets/button.js, widgets/checkboxradio.js, widgets/controlgroup.js, widgets/datepicker.js, widgets/dialog.js, widgets/draggable.js, widgets/droppable.js, widgets/menu.js, widgets/mouse.js, widgets/progressbar.js, widgets/resizable.js, widgets/selectable.js, widgets/selectmenu.js, widgets/slider.js, widgets/sortable.js, widgets/spinner.js, widgets/tabs.js, widgets/tooltip.js
    * Copyright jQuery Foundation and other contributors; Licensed MIT */
   (function (factory) {
       if (typeof define === "function" && define.amd) {
           // AMD. Register as an anonymous module.
           define(["jquery"], factory);
       } else {
           // Browser globals
           factory(jQuery);
       }
   }(function ($) {
       $.ui = $.ui || {};
       var version = $.ui.version = "1.12.1";


       /*!
        * jQuery UI Widget 1.12.1
        * http://jqueryui.com
        *
        * Copyright jQuery Foundation and other contributors
        * Released under the MIT license.
        * http://jquery.org/license
        */
       //>>label: Widget
       //>>group: Core
       //>>description: Provides a factory for creating stateful widgets with a common API.
       //>>docs: http://api.jqueryui.com/jQuery.widget/
       //>>demos: http://jqueryui.com/widget/


       var widgetUuid = 0;
       var widgetSlice = Array.prototype.slice;
       $.cleanData = (function (orig) {
           return function (elems) {
               var events, elem, i;
               for (i = 0;
                   (elem = elems[i]) != null; i++) {
                   try {
                       // Only trigger remove when necessary to save time
                       events = $._data(elem, "events");
                       if (events && events.remove) {
                           $(elem).triggerHandler("remove");
                       }
                       // Http://bugs.jquery.com/ticket/8235
                   } catch (e) {}
               }
               orig(elems);
           };
       })($.cleanData);
       $.widget = function (name, base, prototype) {
           var existingConstructor, constructor, basePrototype;
           // ProxiedPrototype allows the provided prototype to remain unmodified
           // so that it can be used as a mixin for multiple widgets (#8876)
           var proxiedPrototype = {};
           var namespace = name.split(".")[0];
           name = name.split(".")[1];
           var fullName = namespace + "-" + name;
           if (!prototype) {
               prototype = base;
               base = $.Widget;
           }
           if ($.isArray(prototype)) {
               prototype = $.extend.apply(null, [{}].concat(prototype));
           }
           // Create selector for plugin
           $.expr[":"][fullName.toLowerCase()] = function (elem) {
               return !!$.data(elem, fullName);
           };
           $[namespace] = $[namespace] || {};
           existingConstructor = $[namespace][name];
           constructor = $[namespace][name] = function (options, element) {
               // Allow instantiation without "new" keyword
               if (!this._createWidget) {
                   return new constructor(options, element);
               }
               // Allow instantiation without initializing for simple inheritance
               // must use "new" keyword (the code above always passes args)
               if (arguments.length) {
                   this._createWidget(options, element);
               }
           };
           // Extend with the existing constructor to carry over any static properties
           $.extend(constructor, existingConstructor, {
               version: prototype.version,
               // Copy the object used to create the prototype in case we need to
               // redefine the widget later
               _proto: $.extend({}, prototype),
               // Track widgets that inherit from this widget in case this widget is
               // redefined after a widget inherits from it
               _childConstructors: []
           });
           basePrototype = new base();
           // We need to make the options hash a property directly on the new instance
           // otherwise we'll modify the options hash on the prototype that we're
           // inheriting from
           basePrototype.options = $.widget.extend({}, basePrototype.options);
           $.each(prototype, function (prop, value) {
               if (!$.isFunction(value)) {
                   proxiedPrototype[prop] = value;
                   return;
               }
               proxiedPrototype[prop] = (function () {
                   function _super() {
                       return base.prototype[prop].apply(this, arguments);
                   }
                   function _superApply(args) {
                       return base.prototype[prop].apply(this, args);
                   }
                   return function () {
                       var __super = this._super;
                       var __superApply = this._superApply;
                       var returnValue;
                       this._super = _super;
                       this._superApply = _superApply;
                       returnValue = value.apply(this, arguments);
                       this._super = __super;
                       this._superApply = __superApply;
                       return returnValue;
                   };
               })();
           });
           constructor.prototype = $.widget.extend(basePrototype, {
               // TODO: remove support for widgetEventPrefix
               // always use the name + a colon as the prefix, e.g., draggable:start
               // don't prefix for widgets that aren't DOM-based
               widgetEventPrefix: existingConstructor ? (basePrototype.widgetEventPrefix || name) :
                   name
           }, proxiedPrototype, {
               constructor: constructor,
               namespace: namespace,
               widgetName: name,
               widgetFullName: fullName
           });
           // If this widget is being redefined then we need to find all widgets that
           // are inheriting from it and redefine all of them so that they inherit from
           // the new version of this widget. We're essentially trying to replace one
           // level in the prototype chain.
           if (existingConstructor) {
               $.each(existingConstructor._childConstructors, function (i, child) {
                   var childPrototype = child.prototype;
                   // Redefine the child widget using the same prototype that was
                   // originally used, but inherit from the new version of the base
                   $.widget(childPrototype.namespace + "." + childPrototype.widgetName,
                       constructor,
                       child._proto);
               });
               // Remove the list of existing child constructors from the old constructor
               // so the old child constructors can be garbage collected
               delete existingConstructor._childConstructors;
           } else {
               base._childConstructors.push(constructor);
           }
           $.widget.bridge(name, constructor);
           return constructor;
       };
       $.widget.extend = function (target) {
           var input = widgetSlice.call(arguments, 1);
           var inputIndex = 0;
           var inputLength = input.length;
           var key;
           var value;
           for (; inputIndex < inputLength; inputIndex++) {
               for (key in input[inputIndex]) {
                   value = input[inputIndex][key];
                   if (input[inputIndex].hasOwnProperty(key) && value !== undefined) {
                       // Clone objects
                       if ($.isPlainObject(value)) {
                           target[key] = $.isPlainObject(target[key]) ?
                               $.widget.extend({}, target[key], value) :
                               // Don't extend strings, arrays, etc. with objects
                               $.widget.extend({}, value);
                           // Copy everything else by reference
                       } else {
                           target[key] = value;
                       }
                   }
               }
           }
           return target;
       };
       $.widget.bridge = function (name, object) {
           var fullName = object.prototype.widgetFullName || name;
           $.fn[name] = function (options) {
               var isMethodCall = typeof options === "string";
               var args = widgetSlice.call(arguments, 1);
               var returnValue = this;
               if (isMethodCall) {
                   // If this is an empty collection, we need to have the instance method
                   // return undefined instead of the jQuery instance
                   if (!this.length && options === "instance") {
                       returnValue = undefined;
                   } else {
                       this.each(function () {
                           var methodValue;
                           var instance = $.data(this, fullName);
                           if (options === "instance") {
                               returnValue = instance;
                               return false;
                           }
                           if (!instance) {
                               return $.error("cannot call methods on " + name +
                                   " prior to initialization; " +
                                   "attempted to call method '" + options + "'");
                           }
                           if (!$.isFunction(instance[options]) || options.charAt(0) === "_") {
                               return $.error("no such method '" + options + "' for " + name +
                                   " widget instance");
                           }
                           methodValue = instance[options].apply(instance, args);
                           if (methodValue !== instance && methodValue !== undefined) {
                               returnValue = methodValue && methodValue.jquery ?
                                   returnValue.pushStack(methodValue.get()) :
                                   methodValue;
                               return false;
                           }
                       });
                   }
               } else {
                   // Allow multiple hashes to be passed on init
                   if (args.length) {
                       options = $.widget.extend.apply(null, [options].concat(args));
                   }
                   this.each(function () {
                       var instance = $.data(this, fullName);
                       if (instance) {
                           instance.option(options || {});
                           if (instance._init) {
                               instance._init();
                           }
                       } else {
                           $.data(this, fullName, new object(options, this));
                       }
                   });
               }
               return returnValue;
           };
       };
       $.Widget = function ( /* options, element */ ) {};
       $.Widget._childConstructors = [];
       $.Widget.prototype = {
           widgetName: "widget",
           widgetEventPrefix: "",
defaultElement: "
",
           options: {
               classes: {},
               disabled: false,
               // Callbacks
               create: null
           },
           _createWidget: function (options, element) {
               element = $(element || this.defaultElement || this)[0];
               this.element = $(element);
               this.uuid = widgetUuid++;
               this.eventNamespace = "." + this.widgetName + this.uuid;
               this.bindings = $();
               this.hoverable = $();
               this.focusable = $();
               this.classesElementLookup = {};
               if (element !== this) {
                   $.data(element, this.widgetFullName, this);
                   this._on(true, this.element, {
                       remove: function (event) {
                           if (event.target === element) {
                               this.destroy();
                           }
                       }
                   });
                   this.document = $(element.style ?
                       // Element within the document
                       element.ownerDocument :
                       // Element is window or document
                       element.document || element);
                   this.window = $(this.document[0].defaultView || this.document[0].parentWindow);
               }
               this.options = $.widget.extend({},
                   this.options,
                   this._getCreateOptions(),
                   options);
               this._create();
               if (this.options.disabled) {
                   this._setOptionDisabled(this.options.disabled);
               }
               this._trigger("create", null, this._getCreateEventData());
               this._init();
           },
           _getCreateOptions: function () {
               return {};
           },
           _getCreateEventData: $.noop,
           _create: $.noop,
           _init: $.noop,
           destroy: function () {
               var that = this;
               this._destroy();
               $.each(this.classesElementLookup, function (key, value) {
                   that._removeClass(value, key);
               });
               // We can probably remove the unbind calls in 2.0
               // all event bindings should go through this._on()
               this.element
                   .off(this.eventNamespace)
                   .removeData(this.widgetFullName);
               this.widget()
                   .off(this.eventNamespace)
                   .removeAttr("aria-disabled");
               // Clean up events and states
               this.bindings.off(this.eventNamespace);
           },
           _destroy: $.noop,
           widget: function () {
               return this.element;
           },
           option: function (key, value) {
               var options = key;
               var parts;
               var curOption;
               var i;
               if (arguments.length === 0) {
                   // Don't return a reference to the internal hash
                   return $.widget.extend({}, this.options);
               }
               if (typeof key === "string") {
                   // Handle nested keys, e.g., "foo.bar" => { foo: { bar: ___ } }
                   options = {};
                   parts = key.split(".");
                   key = parts.shift();
                   if (parts.length) {
                       curOption = options[key] = $.widget.extend({}, this.options[key]);
                       for (i = 0; i < parts.length - 1; i++) {
                           curOption[parts[i]] = curOption[parts[i]] || {};
                           curOption = curOption[parts[i]];
                       }
                       key = parts.pop();
                       if (arguments.length === 1) {
                           return curOption[key] === undefined ? null : curOption[key];
                       }
                       curOption[key] = value;
                   } else {
                       if (arguments.length === 1) {
                           return this.options[key] === undefined ? null : this.options[key];
                       }
                       options[key] = value;
                   }
               }
               this._setOptions(options);
               return this;
           },
           _setOptions: function (options) {
               var key;
               for (key in options) {
                   this._setOption(key, options[key]);
               }
               return this;
           },
           _setOption: function (key, value) {
               if (key === "classes") {
                   this._setOptionClasses(value);
               }
               this.options[key] = value;
               if (key === "disabled") {
                   this._setOptionDisabled(value);
               }
               return this;
           },
           _setOptionClasses: function (value) {
               var classKey, elements, currentElements;
               for (classKey in value) {
                   currentElements = this.classesElementLookup[classKey];
                   if (value[classKey] === this.options.classes[classKey] ||
                       !currentElements ||
                       !currentElements.length) {
                       continue;
                   }
                   // We are doing this to create a new jQuery object because the _removeClass() call
                   // on the next line is going to destroy the reference to the current elements being
                   // tracked. We need to save a copy of this collection so that we can add the new classes
                   // below.
                   elements = $(currentElements.get());
                   this._removeClass(currentElements, classKey);
                   // We don't use _addClass() here, because that uses this.options.classes
                   // for generating the string of classes. We want to use the value passed in from
                   // _setOption(), this is the new value of the classes option which was passed to
                   // _setOption(). We pass this value directly to _classes().
                   elements.addClass(this._classes({
                       element: elements,
                       keys: classKey,
                       classes: value,
                       add: true
                   }));
               }
           },
           _setOptionDisabled: function (value) {
               this._toggleClass(this.widget(), this.widgetFullName + "-disabled", null, !!value);
               // If the widget is becoming disabled, then nothing is interactive
               if (value) {
                   this._removeClass(this.hoverable, null, "ui-state-hover");
                   this._removeClass(this.focusable, null, "ui-state-focus");
               }
           },
           enable: function () {
               return this._setOptions({
                   disabled: false
               });
           },
           disable: function () {
               return this._setOptions({
                   disabled: true
               });
           },
           _classes: function (options) {
               var full = [];
               var that = this;
               options = $.extend({
                   element: this.element,
                   classes: this.options.classes || {}
               }, options);
               function processClassString(classes, checkOption) {
                   var current, i;
                   for (i = 0; i < classes.length; i++) {
                       current = that.classesElementLookup[classes[i]] || $();
                       if (options.add) {
                           current = $($.unique(current.get().concat(options.element.get())));
                       } else {
                           current = $(current.not(options.element).get());
                       }
                       that.classesElementLookup[classes[i]] = current;
                       full.push(classes[i]);
                       if (checkOption && options.classes[classes[i]]) {
                           full.push(options.classes[classes[i]]);
                       }
                   }
               }
               this._on(options.element, {
                   "remove": "_untrackClassesElement"
               });
               if (options.keys) {
                   processClassString(options.keys.match(/\S+/g) || [], true);
               }
               if (options.extra) {
                   processClassString(options.extra.match(/\S+/g) || []);
               }
               return full.join(" ");
           },
           _untrackClassesElement: function (event) {
               var that = this;
               $.each(that.classesElementLookup, function (key, value) {
                   if ($.inArray(event.target, value) !== -1) {
                       that.classesElementLookup[key] = $(value.not(event.target).get());
                   }
               });
           },
           _removeClass: function (element, keys, extra) {
               return this._toggleClass(element, keys, extra, false);
           },
           _addClass: function (element, keys, extra) {
               return this._toggleClass(element, keys, extra, true);
           },
           _toggleClass: function (element, keys, extra, add) {
               add = (typeof add === "boolean") ? add : extra;
               var shift = (typeof element === "string" || element === null),
                   options = {
                       extra: shift ? keys : extra,
                       keys: shift ? element : keys,
                       element: shift ? this.element : element,
                       add: add
                   };
               options.element.toggleClass(this._classes(options), add);
               return this;
           },
           _on: function (suppressDisabledCheck, element, handlers) {
               var delegateElement;
               var instance = this;
               // No suppressDisabledCheck flag, shuffle arguments
               if (typeof suppressDisabledCheck !== "boolean") {
                   handlers = element;
                   element = suppressDisabledCheck;
                   suppressDisabledCheck = false;
               }
               // No element argument, shuffle and use this.element
               if (!handlers) {
                   handlers = element;
                   element = this.element;
                   delegateElement = this.widget();
               } else {
                   element = delegateElement = $(element);
                   this.bindings = this.bindings.add(element);
               }
               $.each(handlers, function (event, handler) {
                   function handlerProxy() {
                       // Allow widgets to customize the disabled handling
                       // - disabled as an array instead of boolean
                       // - disabled class as method for disabling individual parts
                       if (!suppressDisabledCheck &&
                           (instance.options.disabled === true ||
                               $(this).hasClass("ui-state-disabled"))) {
                           return;
                       }
                       return (typeof handler === "string" ? instance[handler] : handler)
                           .apply(instance, arguments);
                   }
                   // Copy the guid so direct unbinding works
                   if (typeof handler !== "string") {
                       handlerProxy.guid = handler.guid =
                           handler.guid || handlerProxy.guid || $.guid++;
                   }
                   var match = event.match(/^([\w:-]*)\s*(.*)$/);
                   var eventName = match[1] + instance.eventNamespace;
                   var selector = match[2];
                   if (selector) {
                       delegateElement.on(eventName, selector, handlerProxy);
                   } else {
                       element.on(eventName, handlerProxy);
                   }
               });
           },
           _off: function (element, eventName) {
               eventName = (eventName || "").split(" ").join(this.eventNamespace + " ") +
                   this.eventNamespace;
               element.off(eventName).off(eventName);
               // Clear the stack to avoid memory leaks (#10056)
               this.bindings = $(this.bindings.not(element).get());
               this.focusable = $(this.focusable.not(element).get());
               this.hoverable = $(this.hoverable.not(element).get());
           },
           _delay: function (handler, delay) {
               function handlerProxy() {
                   return (typeof handler === "string" ? instance[handler] : handler)
                       .apply(instance, arguments);
               }
               var instance = this;
               return setTimeout(handlerProxy, delay || 0);
           },
           _hoverable: function (element) {
               this.hoverable = this.hoverable.add(element);
               this._on(element, {
                   mouseenter: function (event) {
                       this._addClass($(event.currentTarget), null, "ui-state-hover");
                   },
                   mouseleave: function (event) {
                       this._removeClass($(event.currentTarget), null, "ui-state-hover");
                   }
               });
           },
           _focusable: function (element) {
               this.focusable = this.focusable.add(element);
               this._on(element, {
                   focusin: function (event) {
                       this._addClass($(event.currentTarget), null, "ui-state-focus");
                   },
                   focusout: function (event) {
                       this._removeClass($(event.currentTarget), null, "ui-state-focus");
                   }
               });
           },
           _trigger: function (type, event, data) {
               var prop, orig;
               var callback = this.options[type];
               data = data || {};
               event = $.Event(event);
               event.type = (type === this.widgetEventPrefix ?
                   type :
                   this.widgetEventPrefix + type).toLowerCase();
               // The original event may come from any element
               // so we need to reset the target on the new event
               event.target = this.element[0];
               // Copy original event properties over to the new event
               orig = event.originalEvent;
               if (orig) {
                   for (prop in orig) {
                       if (!(prop in event)) {
                           event[prop] = orig[prop];
                       }
                   }
               }
               this.element.trigger(event, data);
               return !($.isFunction(callback) &&
                   callback.apply(this.element[0], [event].concat(data)) === false ||
                   event.isDefaultPrevented());
           }
       };
       $.each({
           show: "fadeIn",
           hide: "fadeOut"
       }, function (method, defaultEffect) {
           $.Widget.prototype["_" + method] = function (element, options, callback) {
               if (typeof options === "string") {
                   options = {
                       effect: options
                   };
               }
               var hasOptions;
               var effectName = !options ?
                   method :
                   options === true || typeof options === "number" ?
                   defaultEffect :
                   options.effect || defaultEffect;
               options = options || {};
               if (typeof options === "number") {
                   options = {
                       duration: options
                   };
               }
               hasOptions = !$.isEmptyObject(options);
               options.complete = callback;
               if (options.delay) {
                   element.delay(options.delay);
               }
               if (hasOptions && $.effects && $.effects.effect[effectName]) {
                   element[method](options);
               } else if (effectName !== method && element[effectName]) {
                   element[effectName](options.duration, options.easing, callback);
               } else {
                   element.queue(function (next) {
                       $(this)[method]();
                       if (callback) {
                           callback.call(element[0]);
                       }
                       next();
                   });
               }
           };
       });
       var widget = $.widget;


       /*!
        * jQuery UI Position 1.12.1
        * http://jqueryui.com
        *
        * Copyright jQuery Foundation and other contributors
        * Released under the MIT license.
        * http://jquery.org/license
        *
        * http://api.jqueryui.com/position/
        */
       //>>label: Position
       //>>group: Core
       //>>description: Positions elements relative to other elements.
       //>>docs: http://api.jqueryui.com/position/
       //>>demos: http://jqueryui.com/position/


       (function () {
           var cachedScrollbarWidth,
               max = Math.max,
               abs = Math.abs,
               rhorizontal = /left|center|right/,
               rvertical = /top|center|bottom/,
               roffset = /[\+\-]\d+(\.[\d]+)?%?/,
               rposition = /^\w+/,
               rpercent = /%$/,
               _position = $.fn.position;
           function getOffsets(offsets, width, height) {
               return [
                   parseFloat(offsets[0]) * (rpercent.test(offsets[0]) ? width / 100 : 1),
                   parseFloat(offsets[1]) * (rpercent.test(offsets[1]) ? height / 100 : 1)
               ];
           }
           function parseCss(element, property) {
               return parseInt($.css(element, property), 10) || 0;
           }
           function getDimensions(elem) {
               var raw = elem[0];
               if (raw.nodeType === 9) {
                   return {
                       width: elem.width(),
                       height: elem.height(),
                       offset: {
                           top: 0,
                           left: 0
                       }
                   };
               }
               if ($.isWindow(raw)) {
                   return {
                       width: elem.width(),
                       height: elem.height(),
                       offset: {
                           top: elem.scrollTop(),
                           left: elem.scrollLeft()
                       }
                   };
               }
               if (raw.preventDefault) {
                   return {
                       width: 0,
                       height: 0,
                       offset: {
                           top: raw.pageY,
                           left: raw.pageX
                       }
                   };
               }
               return {
                   width: elem.outerWidth(),
                   height: elem.outerHeight(),
                   offset: elem.offset()
               };
           }
           $.position = {
               scrollbarWidth: function () {
                   if (cachedScrollbarWidth !== undefined) {
                       return cachedScrollbarWidth;
                   }
                   var w1, w2,
div = $("
" + "
"),
                       innerDiv = div.children()[0];
                   $("body").append(div);
                   w1 = innerDiv.offsetWidth;
                   div.css("overflow", "scroll");
                   w2 = innerDiv.offsetWidth;
                   if (w1 === w2) {
                       w2 = div[0].clientWidth;
                   }
                   div.remove();
                   return (cachedScrollbarWidth = w1 - w2);
               },
               getScrollInfo: function (within) {
                   var overflowX = within.isWindow || within.isDocument ? "" :
                       within.element.css("overflow-x"),
                       overflowY = within.isWindow || within.isDocument ? "" :
                       within.element.css("overflow-y"),
                       hasOverflowX = overflowX === "scroll" ||
                       (overflowX === "auto" && within.width < within.element[0].scrollWidth),
                       hasOverflowY = overflowY === "scroll" ||
                       (overflowY === "auto" && within.height < within.element[0].scrollHeight);
                   return {
                       width: hasOverflowY ? $.position.scrollbarWidth() : 0,
                       height: hasOverflowX ? $.position.scrollbarWidth() : 0
                   };
               },
               getWithinInfo: function (element) {
                   var withinElement = $(element || window),
                       isWindow = $.isWindow(withinElement[0]),
                       isDocument = !!withinElement[0] && withinElement[0].nodeType === 9,
                       hasOffset = !isWindow && !isDocument;
                   return {
                       element: withinElement,
                       isWindow: isWindow,
                       isDocument: isDocument,
                       offset: hasOffset ? $(element).offset() : {
                           left: 0,
                           top: 0
                       },
                       scrollLeft: withinElement.scrollLeft(),
                       scrollTop: withinElement.scrollTop(),
                       width: withinElement.outerWidth(),
                       height: withinElement.outerHeight()
                   };
               }
           };
           $.fn.position = function (options) {
               if (!options || !options.of) {
                   return _position.apply(this, arguments);
               }
               // Make a copy, we don't want to modify arguments
               options = $.extend({}, options);
               var atOffset, targetWidth, targetHeight, targetOffset, basePosition, dimensions,
                   target = $(options.of),
                   within = $.position.getWithinInfo(options.within),
                   scrollInfo = $.position.getScrollInfo(within),
                   collision = (options.collision || "flip").split(" "),
                   offsets = {};
               dimensions = getDimensions(target);
               if (target[0].preventDefault) {
                   // Force left top to allow flipping
                   options.at = "left top";
               }
               targetWidth = dimensions.width;
               targetHeight = dimensions.height;
               targetOffset = dimensions.offset;
               // Clone to reuse original targetOffset later
               basePosition = $.extend({}, targetOffset);
               // Force my and at to have valid horizontal and vertical positions
               // if a value is missing or invalid, it will be converted to center
               $.each(["my", "at"], function () {
                   var pos = (options[this] || "").split(" "),
                       horizontalOffset,
                       verticalOffset;
                   if (pos.length === 1) {
                       pos = rhorizontal.test(pos[0]) ?
                           pos.concat(["center"]) :
                           rvertical.test(pos[0]) ? ["center"].concat(pos) : ["center",
                               "center"
                           ];
                   }
                   pos[0] = rhorizontal.test(pos[0]) ? pos[0] : "center";
                   pos[1] = rvertical.test(pos[1]) ? pos[1] : "center";
                   // Calculate offsets
                   horizontalOffset = roffset.exec(pos[0]);
                   verticalOffset = roffset.exec(pos[1]);
                   offsets[this] = [
                       horizontalOffset ? horizontalOffset[0] : 0,
                       verticalOffset ? verticalOffset[0] : 0
                   ];
                   // Reduce to just the positions without the offsets
                   options[this] = [
                       rposition.exec(pos[0])[0],
                       rposition.exec(pos[1])[0]
                   ];
               });
               // Normalize collision option
               if (collision.length === 1) {
                   collision[1] = collision[0];
               }
               if (options.at[0] === "right") {
                   basePosition.left += targetWidth;
               } else if (options.at[0] === "center") {
                   basePosition.left += targetWidth / 2;
               }
               if (options.at[1] === "bottom") {
                   basePosition.top += targetHeight;
               } else if (options.at[1] === "center") {
                   basePosition.top += targetHeight / 2;
               }
               atOffset = getOffsets(offsets.at, targetWidth, targetHeight);
               basePosition.left += atOffset[0];
               basePosition.top += atOffset[1];
               return this.each(function () {
                   var collisionPosition, using,
                       elem = $(this),
                       elemWidth = elem.outerWidth(),
                       elemHeight = elem.outerHeight(),
                       marginLeft = parseCss(this, "marginLeft"),
                       marginTop = parseCss(this, "marginTop"),
                       collisionWidth = elemWidth + marginLeft + parseCss(this,
                           "marginRight") +
                       scrollInfo.width,
                       collisionHeight = elemHeight + marginTop + parseCss(this,
                           "marginBottom") +
                       scrollInfo.height,
                       position = $.extend({}, basePosition),
                       myOffset = getOffsets(offsets.my, elem.outerWidth(), elem
                           .outerHeight());
                   if (options.my[0] === "right") {
                       position.left -= elemWidth;
                   } else if (options.my[0] === "center") {
                       position.left -= elemWidth / 2;
                   }
                   if (options.my[1] === "bottom") {
                       position.top -= elemHeight;
                   } else if (options.my[1] === "center") {
                       position.top -= elemHeight / 2;
                   }
                   position.left += myOffset[0];
                   position.top += myOffset[1];
                   collisionPosition = {
                       marginLeft: marginLeft,
                       marginTop: marginTop
                   };
                   $.each(["left", "top"], function (i, dir) {
                       if ($.ui.position[collision[i]]) {
                           $.ui.position[collision[i]][dir](position, {
                               targetWidth: targetWidth,
                               targetHeight: targetHeight,
                               elemWidth: elemWidth,
                               elemHeight: elemHeight,
                               collisionPosition: collisionPosition,
                               collisionWidth: collisionWidth,
                               collisionHeight: collisionHeight,
                               offset: [atOffset[0] + myOffset[0], atOffset[
                                   1] + myOffset[1]],
                               my: options.my,
                               at: options.at,
                               within: within,
                               elem: elem
                           });
                       }
                   });
                   if (options.using) {
                       // Adds feedback as second argument to using callback, if present
                       using = function (props) {
                           var left = targetOffset.left - position.left,
                               right = left + targetWidth - elemWidth,
                               top = targetOffset.top - position.top,
                               bottom = top + targetHeight - elemHeight,
                               feedback = {
                                   target: {
                                       element: target,
                                       left: targetOffset.left,
                                       top: targetOffset.top,
                                       width: targetWidth,
                                       height: targetHeight
                                   },
                                   element: {
                                       element: elem,
                                       left: position.left,
                                       top: position.top,
                                       width: elemWidth,
                                       height: elemHeight
                                   },
                                   horizontal: right < 0 ? "left" : left > 0 ? "right" :
                                       "center",
                                   vertical: bottom < 0 ? "top" : top > 0 ? "bottom" :
                                       "middle"
                               };
                           if (targetWidth < elemWidth && abs(left + right) <
                               targetWidth) {
                               feedback.horizontal = "center";
                           }
                           if (targetHeight < elemHeight && abs(top + bottom) <
                               targetHeight) {
                               feedback.vertical = "middle";
                           }
                           if (max(abs(left), abs(right)) > max(abs(top), abs(bottom))) {
                               feedback.important = "horizontal";
                           } else {
                               feedback.important = "vertical";
                           }
                           options.using.call(this, props, feedback);
                       };
                   }
                   elem.offset($.extend(position, {
                       using: using
                   }));
               });
           };
           $.ui.position = {
               fit: {
                   left: function (position, data) {
                       var within = data.within,
                           withinOffset = within.isWindow ? within.scrollLeft : within.offset.left,
                           outerWidth = within.width,
                           collisionPosLeft = position.left - data.collisionPosition.marginLeft,
                           overLeft = withinOffset - collisionPosLeft,
                           overRight = collisionPosLeft + data.collisionWidth - outerWidth -
                           withinOffset,
                           newOverRight;
                       // Element is wider than within
                       if (data.collisionWidth > outerWidth) {
                           // Element is initially over the left side of within
                           if (overLeft > 0 && overRight <= 0) {
                               newOverRight = position.left + overLeft + data.collisionWidth -
                                   outerWidth -
                                   withinOffset;
                               position.left += overLeft - newOverRight;
                               // Element is initially over right side of within
                           } else if (overRight > 0 && overLeft <= 0) {
                               position.left = withinOffset;
                               // Element is initially over both left and right sides of within
                           } else {
                               if (overLeft > overRight) {
                                   position.left = withinOffset + outerWidth - data.collisionWidth;
                               } else {
                                   position.left = withinOffset;
                               }
                           }
                           // Too far left -> align with left edge
                       } else if (overLeft > 0) {
                           position.left += overLeft;
                           // Too far right -> align with right edge
                       } else if (overRight > 0) {
                           position.left -= overRight;
                           // Adjust based on position and margin
                       } else {
                           position.left = max(position.left - collisionPosLeft, position.left);
                       }
                   },
                   top: function (position, data) {
                       var within = data.within,
                           withinOffset = within.isWindow ? within.scrollTop : within.offset.top,
                           outerHeight = data.within.height,
                           collisionPosTop = position.top - data.collisionPosition.marginTop,
                           overTop = withinOffset - collisionPosTop,
                           overBottom = collisionPosTop + data.collisionHeight - outerHeight -
                           withinOffset,
                           newOverBottom;
                       // Element is taller than within
                       if (data.collisionHeight > outerHeight) {
                           // Element is initially over the top of within
                           if (overTop > 0 && overBottom <= 0) {
                               newOverBottom = position.top + overTop + data.collisionHeight -
                                   outerHeight -
                                   withinOffset;
                               position.top += overTop - newOverBottom;
                               // Element is initially over bottom of within
                           } else if (overBottom > 0 && overTop <= 0) {
                               position.top = withinOffset;
                               // Element is initially over both top and bottom of within
                           } else {
                               if (overTop > overBottom) {
                                   position.top = withinOffset + outerHeight - data
                                       .collisionHeight;
                               } else {
                                   position.top = withinOffset;
                               }
                           }
                           // Too far up -> align with top
                       } else if (overTop > 0) {
                           position.top += overTop;
                           // Too far down -> align with bottom edge
                       } else if (overBottom > 0) {
                           position.top -= overBottom;
                           // Adjust based on position and margin
                       } else {
                           position.top = max(position.top - collisionPosTop, position.top);
                       }
                   }
               },
               flip: {
                   left: function (position, data) {
                       var within = data.within,
                           withinOffset = within.offset.left + within.scrollLeft,
                           outerWidth = within.width,
                           offsetLeft = within.isWindow ? within.scrollLeft : within.offset.left,
                           collisionPosLeft = position.left - data.collisionPosition.marginLeft,
                           overLeft = collisionPosLeft - offsetLeft,
                           overRight = collisionPosLeft + data.collisionWidth - outerWidth -
                           offsetLeft,
                           myOffset = data.my[0] === "left" ?
                           -data.elemWidth :
                           data.my[0] === "right" ?
                           data.elemWidth :
                           0,
                           atOffset = data.at[0] === "left" ?
                           data.targetWidth :
                           data.at[0] === "right" ?
                           -data.targetWidth :
                           0,
                           offset = -2 * data.offset[0],
                           newOverRight,
                           newOverLeft;
                       if (overLeft < 0) {
                           newOverRight = position.left + myOffset + atOffset + offset + data
                               .collisionWidth -
                               outerWidth - withinOffset;
                           if (newOverRight < 0 || newOverRight < abs(overLeft)) {
                               position.left += myOffset + atOffset + offset;
                           }
                       } else if (overRight > 0) {
                           newOverLeft = position.left - data.collisionPosition.marginLeft +
                               myOffset +
                               atOffset + offset - offsetLeft;
                           if (newOverLeft > 0 || abs(newOverLeft) < overRight) {
                               position.left += myOffset + atOffset + offset;
                           }
                       }
                   },
                   top: function (position, data) {
                       var within = data.within,
                           withinOffset = within.offset.top + within.scrollTop,
                           outerHeight = within.height,
                           offsetTop = within.isWindow ? within.scrollTop : within.offset.top,
                           collisionPosTop = position.top - data.collisionPosition.marginTop,
                           overTop = collisionPosTop - offsetTop,
                           overBottom = collisionPosTop + data.collisionHeight - outerHeight -
                           offsetTop,
                           top = data.my[1] === "top",
                           myOffset = top ?
                           -data.elemHeight :
                           data.my[1] === "bottom" ?
                           data.elemHeight :
                           0,
                           atOffset = data.at[1] === "top" ?
                           data.targetHeight :
                           data.at[1] === "bottom" ?
                           -data.targetHeight :
                           0,
                           offset = -2 * data.offset[1],
                           newOverTop,
                           newOverBottom;
                       if (overTop < 0) {
                           newOverBottom = position.top + myOffset + atOffset + offset + data
                               .collisionHeight -
                               outerHeight - withinOffset;
                           if (newOverBottom < 0 || newOverBottom < abs(overTop)) {
                               position.top += myOffset + atOffset + offset;
                           }
                       } else if (overBottom > 0) {
                           newOverTop = position.top - data.collisionPosition.marginTop +
                               myOffset + atOffset +
                               offset - offsetTop;
                           if (newOverTop > 0 || abs(newOverTop) < overBottom) {
                               position.top += myOffset + atOffset + offset;
                           }
                       }
                   }
               },
               flipfit: {
                   left: function () {
                       $.ui.position.flip.left.apply(this, arguments);
                       $.ui.position.fit.left.apply(this, arguments);
                   },
                   top: function () {
                       $.ui.position.flip.top.apply(this, arguments);
                       $.ui.position.fit.top.apply(this, arguments);
                   }
               }
           };
       })();
       var position = $.ui.position;


       /*!
        * jQuery UI :data 1.12.1
        * http://jqueryui.com
        *
        * Copyright jQuery Foundation and other contributors
        * Released under the MIT license.
        * http://jquery.org/license
        */
       //>>label: :data Selector
       //>>group: Core
       //>>description: Selects elements which have data stored under the specified key.
       //>>docs: http://api.jqueryui.com/data-selector/


       var data = $.extend($.expr[":"], {
           data: $.expr.createPseudo ?
               $.expr.createPseudo(function (dataName) {
                   return function (elem) {
                       return !!$.data(elem, dataName);
                   };
               }) :
               // Support: jQuery <1.8
               function (elem, i, match) {
                   return !!$.data(elem, match[3]);
               }
       });
       /*!
        * jQuery UI Disable Selection 1.12.1
        * http://jqueryui.com
        *
        * Copyright jQuery Foundation and other contributors
        * Released under the MIT license.
        * http://jquery.org/license
        */
       //>>label: disableSelection
       //>>group: Core
       //>>description: Disable selection of text content within the set of matched elements.
       //>>docs: http://api.jqueryui.com/disableSelection/
       // This file is deprecated


       var disableSelection = $.fn.extend({
           disableSelection: (function () {
               var eventType = "onselectstart" in document.createElement("div") ?
                   "selectstart" :
                   "mousedown";
               return function () {
                   return this.on(eventType + ".ui-disableSelection", function (event) {
                       event.preventDefault();
                   });
               };
           })(),
           enableSelection: function () {
               return this.off(".ui-disableSelection");
           }
       });


       /*!
        * jQuery UI Effects 1.12.1
        * http://jqueryui.com
        *
        * Copyright jQuery Foundation and other contributors
        * Released under the MIT license.
        * http://jquery.org/license
        */
       //>>label: Effects Core
       //>>group: Effects
       // jscs:disable maximumLineLength
       //>>description: Extends the internal jQuery effects. Includes morphing and easing. Required by all other effects.
       // jscs:enable maximumLineLength
       //>>docs: http://api.jqueryui.com/category/effects-core/
       //>>demos: http://jqueryui.com/effect/


       var dataSpace = "ui-effects-",
           dataSpaceStyle = "ui-effects-style",
           dataSpaceAnimated = "ui-effects-animated",
           // Create a local jQuery because jQuery Color relies on it and the
           // global may not exist with AMD and a custom build (#10199)
           jQuery = $;
       $.effects = {
           effect: {}
       };
       /*!
        * jQuery Color Animations v2.1.2
        * https://github.com/jquery/jquery-color
        *
        * Copyright 2014 jQuery Foundation and other contributors
        * Released under the MIT license.
        * http://jquery.org/license
        *
        * Date: Wed Jan 16 08:47:09 2013 -0600
        */
       (function (jQuery, undefined) {
           var stepHooks = "backgroundColor borderBottomColor borderLeftColor borderRightColor " +
               "borderTopColor color columnRuleColor outlineColor textDecorationColor textEmphasisColor",
               // Plusequals test for += 100 -= 100
               rplusequals = /^([\-+])=\s*(\d+\.?\d*)/,
               // A set of RE's that can match strings and generate color tuples.
               stringParsers = [{
                   re: /rgba?\(\s*(\d{1,3})\s*,\s*(\d{1,3})\s*,\s*(\d{1,3})\s*(?:,\s*(\d?(?:\.\d+)?)\s*)?\)/,
                   parse: function (execResult) {
                       return [
                           execResult[1],
                           execResult[2],
                           execResult[3],
                           execResult[4]
                       ];
                   }
               }, {
                   re: /rgba?\(\s*(\d+(?:\.\d+)?)\%\s*,\s*(\d+(?:\.\d+)?)\%\s*,\s*(\d+(?:\.\d+)?)\%\s*(?:,\s*(\d?(?:\.\d+)?)\s*)?\)/,
                   parse: function (execResult) {
                       return [
                           execResult[1] * 2.55,
                           execResult[2] * 2.55,
                           execResult[3] * 2.55,
                           execResult[4]
                       ];
                   }
               }, {
                   // This regex ignores A-F because it's compared against an already lowercased string
                   re: /#([a-f0-9]{2})([a-f0-9]{2})([a-f0-9]{2})/,
                   parse: function (execResult) {
                       return [
                           parseInt(execResult[1], 16),
                           parseInt(execResult[2], 16),
                           parseInt(execResult[3], 16)
                       ];
                   }
               }, {
                   // This regex ignores A-F because it's compared against an already lowercased string
                   re: /#([a-f0-9])([a-f0-9])([a-f0-9])/,
                   parse: function (execResult) {
                       return [
                           parseInt(execResult[1] + execResult[1], 16),
                           parseInt(execResult[2] + execResult[2], 16),
                           parseInt(execResult[3] + execResult[3], 16)
                       ];
                   }
               }, {
                   re: /hsla?\(\s*(\d+(?:\.\d+)?)\s*,\s*(\d+(?:\.\d+)?)\%\s*,\s*(\d+(?:\.\d+)?)\%\s*(?:,\s*(\d?(?:\.\d+)?)\s*)?\)/,
                   space: "hsla",
                   parse: function (execResult) {
                       return [
                           execResult[1],
                           execResult[2] / 100,
                           execResult[3] / 100,
                           execResult[4]
                       ];
                   }
               }],
               // JQuery.Color( )
               color = jQuery.Color = function (color, green, blue, alpha) {
                   return new jQuery.Color.fn.parse(color, green, blue, alpha);
               },
               spaces = {
                   rgba: {
                       props: {
                           red: {
                               idx: 0,
                               type: "byte"
                           },
                           green: {
                               idx: 1,
                               type: "byte"
                           },
                           blue: {
                               idx: 2,
                               type: "byte"
                           }
                       }
                   },
                   hsla: {
                       props: {
                           hue: {
                               idx: 0,
                               type: "degrees"
                           },
                           saturation: {
                               idx: 1,
                               type: "percent"
                           },
                           lightness: {
                               idx: 2,
                               type: "percent"
                           }
                       }
                   }
               },
               propTypes = {
                   "byte": {
                       floor: true,
                       max: 255
                   },
                   "percent": {
                       max: 1
                   },
                   "degrees": {
                       mod: 360,
                       floor: true
                   }
               },
               support = color.support = {},
               // Element for support tests
supportElem = jQuery("

")[0], // Colors = jQuery.Color.names colors, // Local aliases of functions called often each = jQuery.each; // Determine rgba support immediately supportElem.style.cssText = "background-color:rgba(1,1,1,.5)"; support.rgba = supportElem.style.backgroundColor.indexOf("rgba") > -1; // Define cache name and alpha properties // for rgba and hsla spaces each(spaces, function (spaceName, space) { space.cache = "_" + spaceName; space.props.alpha = { idx: 3, type: "percent", def: 1 }; }); function clamp(value, prop, allowEmpty) { var type = propTypes[prop.type] || {}; if (value == null) { return (allowEmpty || !prop.def) ? null : prop.def; } // ~~ is an short way of doing floor for positive numbers value = type.floor ? ~~value : parseFloat(value); // IE will pass in empty strings as value for alpha, // which will hit this case if (isNaN(value)) { return prop.def; } if (type.mod) { // We add mod before modding to make sure that negatives values // get converted properly: -10 -> 350 return (value + type.mod) % type.mod; } // For now all property types without mod have min and max return 0 > value ? 0 : type.max < value ? type.max : value; } function stringParse(string) { var inst = color(), rgba = inst._rgba = []; string = string.toLowerCase(); each(stringParsers, function (i, parser) { var parsed, match = parser.re.exec(string), values = match && parser.parse(match), spaceName = parser.space || "rgba"; if (values) { parsed = inst[spaceName](values); // If this was an rgba parse the assignment might happen twice // oh well.... inst[spaces[spaceName].cache] = parsed[spaces[spaceName].cache]; rgba = inst._rgba = parsed._rgba; // Exit each( stringParsers ) here because we matched return false; } }); // Found a stringParser that handled it if (rgba.length) { // If this came from a parsed string, force "transparent" when alpha is 0 // chrome, (and maybe others) return "transparent" as rgba(0,0,0,0) if (rgba.join() === "0,0,0,0") { jQuery.extend(rgba, colors.transparent); } return inst; } // Named colors return colors[string]; } color.fn = jQuery.extend(color.prototype, { parse: function (red, green, blue, alpha) { if (red === undefined) { this._rgba = [null, null, null, null]; return this; } if (red.jquery || red.nodeType) { red = jQuery(red).css(green); green = undefined; } var inst = this, type = jQuery.type(red), rgba = this._rgba = []; // More than 1 argument specified - assume ( red, green, blue, alpha ) if (green !== undefined) { red = [red, green, blue, alpha]; type = "array"; } if (type === "string") { return this.parse(stringParse(red) || colors._default); } if (type === "array") { each(spaces.rgba.props, function (key, prop) { rgba[prop.idx] = clamp(red[prop.idx], prop); }); return this; } if (type === "object") { if (red instanceof color) { each(spaces, function (spaceName, space) { if (red[space.cache]) { inst[space.cache] = red[space.cache].slice(); } }); } else { each(spaces, function (spaceName, space) { var cache = space.cache; each(space.props, function (key, prop) { // If the cache doesn't exist, and we know how to convert if (!inst[cache] && space.to) { // If the value was null, we don't need to copy it // if the key was alpha, we don't need to copy it either if (key === "alpha" || red[key] == null) { return; } inst[cache] = space.to(inst._rgba); } // This is the only case where we allow nulls for ALL properties. // call clamp with alwaysAllowEmpty inst[cache][prop.idx] = clamp(red[key], prop, true); }); // Everything defined but alpha? if (inst[cache] && jQuery.inArray(null, inst[cache].slice(0, 3)) < 0) { // Use the default of 1 inst[cache][3] = 1; if (space.from) { inst._rgba = space.from(inst[cache]); } } }); } return this; } }, is: function (compare) { var is = color(compare), same = true, inst = this; each(spaces, function (_, space) { var localCache, isCache = is[space.cache]; if (isCache) { localCache = inst[space.cache] || space.to && space.to(inst ._rgba) || []; each(space.props, function (_, prop) { if (isCache[prop.idx] != null) { same = (isCache[prop.idx] === localCache[ prop.idx]); return same; } }); } return same; }); return same; }, _space: function () { var used = [], inst = this; each(spaces, function (spaceName, space) { if (inst[space.cache]) { used.push(spaceName); } }); return used.pop(); }, transition: function (other, distance) { var end = color(other), spaceName = end._space(), space = spaces[spaceName], startColor = this.alpha() === 0 ? color("transparent") : this, start = startColor[space.cache] || space.to(startColor._rgba), result = start.slice(); end = end[space.cache]; each(space.props, function (key, prop) { var index = prop.idx, startValue = start[index], endValue = end[index], type = propTypes[prop.type] || {}; // If null, don't override start value if (endValue === null) { return; } // If null - use end if (startValue === null) { result[index] = endValue; } else { if (type.mod) { if (endValue - startValue > type.mod / 2) { startValue += type.mod; } else if (startValue - endValue > type.mod / 2) { startValue -= type.mod; } } result[index] = clamp((endValue - startValue) * distance + startValue, prop); } }); return this[spaceName](result); }, blend: function (opaque) { // If we are already opaque - return ourself if (this._rgba[3] === 1) { return this; } var rgb = this._rgba.slice(), a = rgb.pop(), blend = color(opaque)._rgba; return color(jQuery.map(rgb, function (v, i) { return (1 - a) * blend[i] + a * v; })); }, toRgbaString: function () { var prefix = "rgba(", rgba = jQuery.map(this._rgba, function (v, i) { return v == null ? (i > 2 ? 1 : 0) : v; }); if (rgba[3] === 1) { rgba.pop(); prefix = "rgb("; } return prefix + rgba.join() + ")"; }, toHslaString: function () { var prefix = "hsla(", hsla = jQuery.map(this.hsla(), function (v, i) { if (v == null) { v = i > 2 ? 1 : 0; } // Catch 1 and 2 if (i && i < 3) { v = Math.round(v * 100) + "%"; } return v; }); if (hsla[3] === 1) { hsla.pop(); prefix = "hsl("; } return prefix + hsla.join() + ")"; }, toHexString: function (includeAlpha) { var rgba = this._rgba.slice(), alpha = rgba.pop(); if (includeAlpha) { rgba.push(~~(alpha * 255)); } return "#" + jQuery.map(rgba, function (v) { // Default to 0 when nulls exist v = (v || 0).toString(16); return v.length === 1 ? "0" + v : v; }).join(""); }, toString: function () { return this._rgba[3] === 0 ? "transparent" : this.toRgbaString(); } }); color.fn.parse.prototype = color.fn; // Hsla conversions adapted from: // https://code.google.com/p/maashaack/source/browse/packages/graphics/trunk/src/graphics/colors/HUE2RGB.as?r=5021 function hue2rgb(p, q, h) { h = (h + 1) % 1; if (h * 6 < 1) { return p + (q - p) * h * 6; } if (h * 2 < 1) { return q; } if (h * 3 < 2) { return p + (q - p) * ((2 / 3) - h) * 6; } return p; } spaces.hsla.to = function (rgba) { if (rgba[0] == null || rgba[1] == null || rgba[2] == null) { return [null, null, null, rgba[3]]; } var r = rgba[0] / 255, g = rgba[1] / 255, b = rgba[2] / 255, a = rgba[3], max = Math.max(r, g, b), min = Math.min(r, g, b), diff = max - min, add = max + min, l = add * 0.5, h, s; if (min === max) { h = 0; } else if (r === max) { h = (60 * (g - b) / diff) + 360; } else if (g === max) { h = (60 * (b - r) / diff) + 120; } else { h = (60 * (r - g) / diff) + 240; } // Chroma (diff) == 0 means greyscale which, by definition, saturation = 0% // otherwise, saturation is based on the ratio of chroma (diff) to lightness (add) if (diff === 0) { s = 0; } else if (l <= 0.5) { s = diff / add; } else { s = diff / (2 - add); } return [Math.round(h) % 360, s, l, a == null ? 1 : a]; }; spaces.hsla.from = function (hsla) { if (hsla[0] == null || hsla[1] == null || hsla[2] == null) { return [null, null, null, hsla[3]]; } var h = hsla[0] / 360, s = hsla[1], l = hsla[2], a = hsla[3], q = l <= 0.5 ? l * (1 + s) : l + s - l * s, p = 2 * l - q; return [ Math.round(hue2rgb(p, q, h + (1 / 3)) * 255), Math.round(hue2rgb(p, q, h) * 255), Math.round(hue2rgb(p, q, h - (1 / 3)) * 255), a ]; }; each(spaces, function (spaceName, space) { var props = space.props, cache = space.cache, to = space.to, from = space.from; // Makes rgba() and hsla() color.fn[spaceName] = function (value) { // Generate a cache for this space if it doesn't exist if (to && !this[cache]) { this[cache] = to(this._rgba); } if (value === undefined) { return this[cache].slice(); } var ret, type = jQuery.type(value), arr = (type === "array" || type === "object") ? value : arguments, local = this[cache].slice(); each(props, function (key, prop) { var val = arr[type === "object" ? key : prop.idx]; if (val == null) { val = local[prop.idx]; } local[prop.idx] = clamp(val, prop); }); if (from) { ret = color(from(local)); ret[cache] = local; return ret; } else { return color(local); } }; // Makes red() green() blue() alpha() hue() saturation() lightness() each(props, function (key, prop) { // Alpha is included in more than one space if (color.fn[key]) { return; } color.fn[key] = function (value) { var vtype = jQuery.type(value), fn = (key === "alpha" ? (this._hsla ? "hsla" : "rgba") : spaceName), local = this[fn](), cur = local[prop.idx], match; if (vtype === "undefined") { return cur; } if (vtype === "function") { value = value.call(this, cur); vtype = jQuery.type(value); } if (value == null && prop.empty) { return this; } if (vtype === "string") { match = rplusequals.exec(value); if (match) { value = cur + parseFloat(match[2]) * (match[1] === "+" ? 1 : -1); } } local[prop.idx] = value; return this[fn](local); }; }); }); // Add cssHook and .fx.step function for each named hook. // accept a space separated string of properties color.hook = function (hook) { var hooks = hook.split(" "); each(hooks, function (i, hook) { jQuery.cssHooks[hook] = { set: function (elem, value) { var parsed, curElem, backgroundColor = ""; if (value !== "transparent" && (jQuery.type(value) !== "string" || (parsed = stringParse(value)))) { value = color(parsed || value); if (!support.rgba && value._rgba[3] !== 1) { curElem = hook === "backgroundColor" ? elem .parentNode : elem; while ( (backgroundColor === "" || backgroundColor === "transparent") && curElem && curElem.style ) { try { backgroundColor = jQuery.css(curElem, "backgroundColor"); curElem = curElem.parentNode; } catch (e) {} } value = value.blend(backgroundColor && backgroundColor !== "transparent" ? backgroundColor : "_default"); } value = value.toRgbaString(); } try { elem.style[hook] = value; } catch (e) { // Wrapped to prevent IE from throwing errors on "invalid" values like // 'auto' or 'inherit' } } }; jQuery.fx.step[hook] = function (fx) { if (!fx.colorInit) { fx.start = color(fx.elem, hook); fx.end = color(fx.end); fx.colorInit = true; } jQuery.cssHooks[hook].set(fx.elem, fx.start.transition(fx.end, fx .pos)); }; }); }; color.hook(stepHooks); jQuery.cssHooks.borderColor = { expand: function (value) { var expanded = {}; each(["Top", "Right", "Bottom", "Left"], function (i, part) { expanded["border" + part + "Color"] = value; }); return expanded; } }; // Basic color names only. // Usage of any of the other color names requires adding yourself or including // jquery.color.svg-names.js. colors = jQuery.Color.names = { // 4.1. Basic color keywords aqua: "#00ffff", black: "#000000", blue: "#0000ff", fuchsia: "#ff00ff", gray: "#808080", green: "#008000", lime: "#00ff00", maroon: "#800000", navy: "#000080", olive: "#808000", purple: "#800080", red: "#ff0000", silver: "#c0c0c0", teal: "#008080", white: "#ffffff", yellow: "#ffff00", // 4.2.3. "transparent" color keyword transparent: [null, null, null, 0], _default: "#ffffff" }; })(jQuery); /******************************************************************************/ /****************************** CLASS ANIMATIONS ******************************/ /******************************************************************************/ (function () { var classAnimationActions = ["add", "remove", "toggle"], shorthandStyles = { border: 1, borderBottom: 1, borderColor: 1, borderLeft: 1, borderRight: 1, borderTop: 1, borderWidth: 1, margin: 1, padding: 1 }; $.each( ["borderLeftStyle", "borderRightStyle", "borderBottomStyle", "borderTopStyle"], function (_, prop) { $.fx.step[prop] = function (fx) { if (fx.end !== "none" && !fx.setAttr || fx.pos === 1 && !fx.setAttr) { jQuery.style(fx.elem, prop, fx.end); fx.setAttr = true; } }; } ); function getElementStyles(elem) { var key, len, style = elem.ownerDocument.defaultView ? elem.ownerDocument.defaultView.getComputedStyle(elem, null) : elem.currentStyle, styles = {}; if (style && style.length && style[0] && style[style[0]]) { len = style.length; while (len--) { key = style[len]; if (typeof style[key] === "string") { styles[$.camelCase(key)] = style[key]; } } // Support: Opera, IE <9 } else { for (key in style) { if (typeof style[key] === "string") { styles[key] = style[key]; } } } return styles; } function styleDifference(oldStyle, newStyle) { var diff = {}, name, value; for (name in newStyle) { value = newStyle[name]; if (oldStyle[name] !== value) { if (!shorthandStyles[name]) { if ($.fx.step[name] || !isNaN(parseFloat(value))) { diff[name] = value; } } } } return diff; } // Support: jQuery <1.8 if (!$.fn.addBack) { $.fn.addBack = function (selector) { return this.add(selector == null ? this.prevObject : this.prevObject.filter(selector) ); }; } $.effects.animateClass = function (value, duration, easing, callback) { var o = $.speed(duration, easing, callback); return this.queue(function () { var animated = $(this), baseClass = animated.attr("class") || "", applyClassChange, allAnimations = o.children ? animated.find("*").addBack() : animated; // Map the animated objects to store the original styles. allAnimations = allAnimations.map(function () { var el = $(this); return { el: el, start: getElementStyles(this) }; }); // Apply class change applyClassChange = function () { $.each(classAnimationActions, function (i, action) { if (value[action]) { animated[action + "Class"](value[action]); } }); }; applyClassChange(); // Map all animated objects again - calculate new styles and diff allAnimations = allAnimations.map(function () { this.end = getElementStyles(this.el[0]); this.diff = styleDifference(this.start, this.end); return this; }); // Apply original class animated.attr("class", baseClass); // Map all animated objects again - this time collecting a promise allAnimations = allAnimations.map(function () { var styleInfo = this, dfd = $.Deferred(), opts = $.extend({}, o, { queue: false, complete: function () { dfd.resolve(styleInfo); } }); this.el.animate(this.diff, opts); return dfd.promise(); }); // Once all animations have completed: $.when.apply($, allAnimations.get()).done(function () { // Set the final class applyClassChange(); // For each animated element, // clear all css properties that were animated $.each(arguments, function () { var el = this.el; $.each(this.diff, function (key) { el.css(key, ""); }); }); // This is guarnteed to be there if you use jQuery.speed() // it also handles dequeuing the next anim... o.complete.call(animated[0]); }); }); }; $.fn.extend({ addClass: (function (orig) { return function (classNames, speed, easing, callback) { return speed ? $.effects.animateClass.call(this, { add: classNames }, speed, easing, callback) : orig.apply(this, arguments); }; })($.fn.addClass), removeClass: (function (orig) { return function (classNames, speed, easing, callback) { return arguments.length > 1 ? $.effects.animateClass.call(this, { remove: classNames }, speed, easing, callback) : orig.apply(this, arguments); }; })($.fn.removeClass), toggleClass: (function (orig) { return function (classNames, force, speed, easing, callback) { if (typeof force === "boolean" || force === undefined) { if (!speed) { // Without speed parameter return orig.apply(this, arguments); } else { return $.effects.animateClass.call(this, (force ? { add: classNames } : { remove: classNames }), speed, easing, callback); } } else { // Without force parameter return $.effects.animateClass.call(this, { toggle: classNames }, force, speed, easing); } }; })($.fn.toggleClass), switchClass: function (remove, add, speed, easing, callback) { return $.effects.animateClass.call(this, { add: add, remove: remove }, speed, easing, callback); } }); })(); /******************************************************************************/ /*********************************** EFFECTS **********************************/ /******************************************************************************/ (function () { if ($.expr && $.expr.filters && $.expr.filters.animated) { $.expr.filters.animated = (function (orig) { return function (elem) { return !!$(elem).data(dataSpaceAnimated) || orig(elem); }; })($.expr.filters.animated); } if ($.uiBackCompat !== false) { $.extend($.effects, { // Saves a set of properties in a data storage save: function (element, set) { var i = 0, length = set.length; for (; i < length; i++) { if (set[i] !== null) { element.data(dataSpace + set[i], element[0].style[set[i]]); } } }, // Restores a set of previously saved properties from a data storage restore: function (element, set) { var val, i = 0, length = set.length; for (; i < length; i++) { if (set[i] !== null) { val = element.data(dataSpace + set[i]); element.css(set[i], val); } } }, setMode: function (el, mode) { if (mode === "toggle") { mode = el.is(":hidden") ? "show" : "hide"; } return mode; }, // Wraps the element around a wrapper that copies position properties createWrapper: function (element) { // If the element is already wrapped, return it if (element.parent().is(".ui-effects-wrapper")) { return element.parent(); } // Wrap the element var props = { width: element.outerWidth(true), height: element.outerHeight(true), "float": element.css("float") }, wrapper = $("

")
                           .addClass("ui-effects-wrapper")
                           .css({
                               fontSize: "100%",
                               background: "transparent",
                               border: "none",
                               margin: 0,
                               padding: 0
                           }),
                           // Store the size in case width/height are defined in % - Fixes #5245
                           size = {
                               width: element.width(),
                               height: element.height()
                           },
                           active = document.activeElement;
                       // Support: Firefox
                       // Firefox incorrectly exposes anonymous content
                       // https://bugzilla.mozilla.org/show_bug.cgi?id=561664
                       try {
                           active.id;
                       } catch (e) {
                           active = document.body;
                       }
                       element.wrap(wrapper);
                       // Fixes #7595 - Elements lose focus when wrapped.
                       if (element[0] === active || $.contains(element[0], active)) {
                           $(active).trigger("focus");
                       }
                       // Hotfix for jQuery 1.4 since some change in wrap() seems to actually
                       // lose the reference to the wrapped element
                       wrapper = element.parent();
                       // Transfer positioning properties to the wrapper
                       if (element.css("position") === "static") {
                           wrapper.css({
                               position: "relative"
                           });
                           element.css({
                               position: "relative"
                           });
                       } else {
                           $.extend(props, {
                               position: element.css("position"),
                               zIndex: element.css("z-index")
                           });
                           $.each(["top", "left", "bottom", "right"], function (i, pos) {
                               props[pos] = element.css(pos);
                               if (isNaN(parseInt(props[pos], 10))) {
                                   props[pos] = "auto";
                               }
                           });
                           element.css({
                               position: "relative",
                               top: 0,
                               left: 0,
                               right: "auto",
                               bottom: "auto"
                           });
                       }
                       element.css(size);
                       return wrapper.css(props).show();
                   },
                   removeWrapper: function (element) {
                       var active = document.activeElement;
                       if (element.parent().is(".ui-effects-wrapper")) {
                           element.parent().replaceWith(element);
                           // Fixes #7595 - Elements lose focus when wrapped.
                           if (element[0] === active || $.contains(element[0], active)) {
                               $(active).trigger("focus");
                           }
                       }
                       return element;
                   }
               });
           }
           $.extend($.effects, {
               version: "1.12.1",
               define: function (name, mode, effect) {
                   if (!effect) {
                       effect = mode;
                       mode = "effect";
                   }
                   $.effects.effect[name] = effect;
                   $.effects.effect[name].mode = mode;
                   return effect;
               },
               scaledDimensions: function (element, percent, direction) {
                   if (percent === 0) {
                       return {
                           height: 0,
                           width: 0,
                           outerHeight: 0,
                           outerWidth: 0
                       };
                   }
                   var x = direction !== "horizontal" ? ((percent || 100) / 100) : 1,
                       y = direction !== "vertical" ? ((percent || 100) / 100) : 1;
                   return {
                       height: element.height() * y,
                       width: element.width() * x,
                       outerHeight: element.outerHeight() * y,
                       outerWidth: element.outerWidth() * x
                   };
               },
               clipToBox: function (animation) {
                   return {
                       width: animation.clip.right - animation.clip.left,
                       height: animation.clip.bottom - animation.clip.top,
                       left: animation.clip.left,
                       top: animation.clip.top
                   };
               },
               // Injects recently queued functions to be first in line (after "inprogress")
               unshift: function (element, queueLength, count) {
                   var queue = element.queue();
                   if (queueLength > 1) {
                       queue.splice.apply(queue,
                           [1, 0].concat(queue.splice(queueLength, count)));
                   }
                   element.dequeue();
               },
               saveStyle: function (element) {
                   element.data(dataSpaceStyle, element[0].style.cssText);
               },
               restoreStyle: function (element) {
                   element[0].style.cssText = element.data(dataSpaceStyle) || "";
                   element.removeData(dataSpaceStyle);
               },
               mode: function (element, mode) {
                   var hidden = element.is(":hidden");
                   if (mode === "toggle") {
                       mode = hidden ? "show" : "hide";
                   }
                   if (hidden ? mode === "hide" : mode === "show") {
                       mode = "none";
                   }
                   return mode;
               },
               // Translates a [top,left] array into a baseline value
               getBaseline: function (origin, original) {
                   var y, x;
                   switch (origin[0]) {
                       case "top":
                           y = 0;
                           break;
                       case "middle":
                           y = 0.5;
                           break;
                       case "bottom":
                           y = 1;
                           break;
                       default:
                           y = origin[0] / original.height;
                   }
                   switch (origin[1]) {
                       case "left":
                           x = 0;
                           break;
                       case "center":
                           x = 0.5;
                           break;
                       case "right":
                           x = 1;
                           break;
                       default:
                           x = origin[1] / original.width;
                   }
                   return {
                       x: x,
                       y: y
                   };
               },
               // Creates a placeholder element so that the original element can be made absolute
               createPlaceholder: function (element) {
                   var placeholder,
                       cssPosition = element.css("position"),
                       position = element.position();
                   // Lock in margins first to account for form elements, which
                   // will change margin if you explicitly set height
                   // see: http://jsfiddle.net/JZSMt/3/ https://bugs.webkit.org/show_bug.cgi?id=107380
                   // Support: Safari
                   element.css({
                           marginTop: element.css("marginTop"),
                           marginBottom: element.css("marginBottom"),
                           marginLeft: element.css("marginLeft"),
                           marginRight: element.css("marginRight")
                       })
                       .outerWidth(element.outerWidth())
                       .outerHeight(element.outerHeight());
                   if (/^(static|relative)/.test(cssPosition)) {
                       cssPosition = "absolute";
                       placeholder = $("<" + element[0].nodeName + ">").insertAfter(element)
                           .css({
                               // Convert inline to inline block to account for inline elements
                               // that turn to inline block based on content (like img)
                               display: /^(inline|ruby)/.test(element.css("display")) ?
                                   "inline-block" : "block",
                               visibility: "hidden",
                               // Margins need to be set to account for margin collapse
                               marginTop: element.css("marginTop"),
                               marginBottom: element.css("marginBottom"),
                               marginLeft: element.css("marginLeft"),
                               marginRight: element.css("marginRight"),
                               "float": element.css("float")
                           })
                           .outerWidth(element.outerWidth())
                           .outerHeight(element.outerHeight())
                           .addClass("ui-effects-placeholder");
                       element.data(dataSpace + "placeholder", placeholder);
                   }
                   element.css({
                       position: cssPosition,
                       left: position.left,
                       top: position.top
                   });
                   return placeholder;
               },
               removePlaceholder: function (element) {
                   var dataKey = dataSpace + "placeholder",
                       placeholder = element.data(dataKey);
                   if (placeholder) {
                       placeholder.remove();
                       element.removeData(dataKey);
                   }
               },
               // Removes a placeholder if it exists and restores
               // properties that were modified during placeholder creation
               cleanUp: function (element) {
                   $.effects.restoreStyle(element);
                   $.effects.removePlaceholder(element);
               },
               setTransition: function (element, list, factor, value) {
                   value = value || {};
                   $.each(list, function (i, x) {
                       var unit = element.cssUnit(x);
                       if (unit[0] > 0) {
                           value[x] = unit[0] * factor + unit[1];
                       }
                   });
                   return value;
               }
           });
           // Return an effect options object for the given parameters:
           function _normalizeArguments(effect, options, speed, callback) {
               // Allow passing all options as the first parameter
               if ($.isPlainObject(effect)) {
                   options = effect;
                   effect = effect.effect;
               }
               // Convert to an object
               effect = {
                   effect: effect
               };
               // Catch (effect, null, ...)
               if (options == null) {
                   options = {};
               }
               // Catch (effect, callback)
               if ($.isFunction(options)) {
                   callback = options;
                   speed = null;
                   options = {};
               }
               // Catch (effect, speed, ?)
               if (typeof options === "number" || $.fx.speeds[options]) {
                   callback = speed;
                   speed = options;
                   options = {};
               }
               // Catch (effect, options, callback)
               if ($.isFunction(speed)) {
                   callback = speed;
                   speed = null;
               }
               // Add options to effect
               if (options) {
                   $.extend(effect, options);
               }
               speed = speed || options.duration;
               effect.duration = $.fx.off ? 0 :
                   typeof speed === "number" ? speed :
                   speed in $.fx.speeds ? $.fx.speeds[speed] :
                   $.fx.speeds._default;
               effect.complete = callback || options.complete;
               return effect;
           }
           function standardAnimationOption(option) {
               // Valid standard speeds (nothing, number, named speed)
               if (!option || typeof option === "number" || $.fx.speeds[option]) {
                   return true;
               }
               // Invalid strings - treat as "normal" speed
               if (typeof option === "string" && !$.effects.effect[option]) {
                   return true;
               }
               // Complete callback
               if ($.isFunction(option)) {
                   return true;
               }
               // Options hash (but not naming an effect)
               if (typeof option === "object" && !option.effect) {
                   return true;
               }
               // Didn't match any standard API
               return false;
           }
           $.fn.extend({
               effect: function ( /* effect, options, speed, callback */ ) {
                   var args = _normalizeArguments.apply(this, arguments),
                       effectMethod = $.effects.effect[args.effect],
                       defaultMode = effectMethod.mode,
                       queue = args.queue,
                       queueName = queue || "fx",
                       complete = args.complete,
                       mode = args.mode,
                       modes = [],
                       prefilter = function (next) {
                           var el = $(this),
                               normalizedMode = $.effects.mode(el, mode) || defaultMode;
                           // Sentinel for duck-punching the :animated psuedo-selector
                           el.data(dataSpaceAnimated, true);
                           // Save effect mode for later use,
                           // we can't just call $.effects.mode again later,
                           // as the .show() below destroys the initial state
                           modes.push(normalizedMode);
                           // See $.uiBackCompat inside of run() for removal of defaultMode in 1.13
                           if (defaultMode && (normalizedMode === "show" ||
                                   (normalizedMode === defaultMode && normalizedMode ===
                                       "hide"))) {
                               el.show();
                           }
                           if (!defaultMode || normalizedMode !== "none") {
                               $.effects.saveStyle(el);
                           }
                           if ($.isFunction(next)) {
                               next();
                           }
                       };
                   if ($.fx.off || !effectMethod) {
                       // Delegate to the original method (e.g., .show()) if possible
                       if (mode) {
                           return this[mode](args.duration, complete);
                       } else {
                           return this.each(function () {
                               if (complete) {
                                   complete.call(this);
                               }
                           });
                       }
                   }
                   function run(next) {
                       var elem = $(this);
                       function cleanup() {
                           elem.removeData(dataSpaceAnimated);
                           $.effects.cleanUp(elem);
                           if (args.mode === "hide") {
                               elem.hide();
                           }
                           done();
                       }
                       function done() {
                           if ($.isFunction(complete)) {
                               complete.call(elem[0]);
                           }
                           if ($.isFunction(next)) {
                               next();
                           }
                       }
                       // Override mode option on a per element basis,
                       // as toggle can be either show or hide depending on element state
                       args.mode = modes.shift();
                       if ($.uiBackCompat !== false && !defaultMode) {
                           if (elem.is(":hidden") ? mode === "hide" : mode === "show") {
                               // Call the core method to track "olddisplay" properly
                               elem[mode]();
                               done();
                           } else {
                               effectMethod.call(elem[0], args, done);
                           }
                       } else {
                           if (args.mode === "none") {
                               // Call the core method to track "olddisplay" properly
                               elem[mode]();
                               done();
                           } else {
                               effectMethod.call(elem[0], args, cleanup);
                           }
                       }
                   }
                   // Run prefilter on all elements first to ensure that
                   // any showing or hiding happens before placeholder creation,
                   // which ensures that any layout changes are correctly captured.
                   return queue === false ?
                       this.each(prefilter).each(run) :
                       this.queue(queueName, prefilter).queue(queueName, run);
               },
               show: (function (orig) {
                   return function (option) {
                       if (standardAnimationOption(option)) {
                           return orig.apply(this, arguments);
                       } else {
                           var args = _normalizeArguments.apply(this, arguments);
                           args.mode = "show";
                           return this.effect.call(this, args);
                       }
                   };
               })($.fn.show),
               hide: (function (orig) {
                   return function (option) {
                       if (standardAnimationOption(option)) {
                           return orig.apply(this, arguments);
                       } else {
                           var args = _normalizeArguments.apply(this, arguments);
                           args.mode = "hide";
                           return this.effect.call(this, args);
                       }
                   };
               })($.fn.hide),
               toggle: (function (orig) {
                   return function (option) {
                       if (standardAnimationOption(option) || typeof option ===
                           "boolean") {
                           return orig.apply(this, arguments);
                       } else {
                           var args = _normalizeArguments.apply(this, arguments);
                           args.mode = "toggle";
                           return this.effect.call(this, args);
                       }
                   };
               })($.fn.toggle),
               cssUnit: function (key) {
                   var style = this.css(key),
                       val = [];
                   $.each(["em", "px", "%", "pt"], function (i, unit) {
                       if (style.indexOf(unit) > 0) {
                           val = [parseFloat(style), unit];
                       }
                   });
                   return val;
               },
               cssClip: function (clipObj) {
                   if (clipObj) {
                       return this.css("clip", "rect(" + clipObj.top + "px " + clipObj.right +
                           "px " +
                           clipObj.bottom + "px " + clipObj.left + "px)");
                   }
                   return parseClip(this.css("clip"), this);
               },
               transfer: function (options, done) {
                   var element = $(this),
                       target = $(options.to),
                       targetFixed = target.css("position") === "fixed",
                       body = $("body"),
                       fixTop = targetFixed ? body.scrollTop() : 0,
                       fixLeft = targetFixed ? body.scrollLeft() : 0,
                       endPosition = target.offset(),
                       animation = {
                           top: endPosition.top - fixTop,
                           left: endPosition.left - fixLeft,
                           height: target.innerHeight(),
                           width: target.innerWidth()
                       },
                       startPosition = element.offset(),
transfer = $("
")
                       .appendTo("body")
                       .addClass(options.className)
                       .css({
                           top: startPosition.top - fixTop,
                           left: startPosition.left - fixLeft,
                           height: element.innerHeight(),
                           width: element.innerWidth(),
                           position: targetFixed ? "fixed" : "absolute"
                       })
                       .animate(animation, options.duration, options.easing, function () {
                           transfer.remove();
                           if ($.isFunction(done)) {
                               done();
                           }
                       });
               }
           });
           function parseClip(str, element) {
               var outerWidth = element.outerWidth(),
                   outerHeight = element.outerHeight(),
                   clipRegex =
                   /^rect\((-?\d*\.?\d*px|-?\d+%|auto),?\s*(-?\d*\.?\d*px|-?\d+%|auto),?\s*(-?\d*\.?\d*px|-?\d+%|auto),?\s*(-?\d*\.?\d*px|-?\d+%|auto)\)$/,
                   values = clipRegex.exec(str) || ["", 0, outerWidth, outerHeight, 0];
               return {
                   top: parseFloat(values[1]) || 0,
                   right: values[2] === "auto" ? outerWidth : parseFloat(values[2]),
                   bottom: values[3] === "auto" ? outerHeight : parseFloat(values[3]),
                   left: parseFloat(values[4]) || 0
               };
           }
           $.fx.step.clip = function (fx) {
               if (!fx.clipInit) {
                   fx.start = $(fx.elem).cssClip();
                   if (typeof fx.end === "string") {
                       fx.end = parseClip(fx.end, fx.elem);
                   }
                   fx.clipInit = true;
               }
               $(fx.elem).cssClip({
                   top: fx.pos * (fx.end.top - fx.start.top) + fx.start.top,
                   right: fx.pos * (fx.end.right - fx.start.right) + fx.start.right,
                   bottom: fx.pos * (fx.end.bottom - fx.start.bottom) + fx.start.bottom,
                   left: fx.pos * (fx.end.left - fx.start.left) + fx.start.left
               });
           };
       })();
       /******************************************************************************/
       /*********************************** EASING ***********************************/
       /******************************************************************************/
       (function () {
           // Based on easing equations from Robert Penner (http://www.robertpenner.com/easing)
           var baseEasings = {};
           $.each(["Quad", "Cubic", "Quart", "Quint", "Expo"], function (i, name) {
               baseEasings[name] = function (p) {
                   return Math.pow(p, i + 2);
               };
           });
           $.extend(baseEasings, {
               Sine: function (p) {
                   return 1 - Math.cos(p * Math.PI / 2);
               },
               Circ: function (p) {
                   return 1 - Math.sqrt(1 - p * p);
               },
               Elastic: function (p) {
                   return p === 0 || p === 1 ? p :
                       -Math.pow(2, 8 * (p - 1)) * Math.sin(((p - 1) * 80 - 7.5) * Math.PI /
                           15);
               },
               Back: function (p) {
                   return p * p * (3 * p - 2);
               },
               Bounce: function (p) {
                   var pow2,
                       bounce = 4;
                   while (p < ((pow2 = Math.pow(2, --bounce)) - 1) / 11) {}
                   return 1 / Math.pow(4, 3 - bounce) - 7.5625 * Math.pow((pow2 * 3 - 2) / 22 -
                       p, 2);
               }
           });
           $.each(baseEasings, function (name, easeIn) {
               $.easing["easeIn" + name] = easeIn;
               $.easing["easeOut" + name] = function (p) {
                   return 1 - easeIn(1 - p);
               };
               $.easing["easeInOut" + name] = function (p) {
                   return p < 0.5 ?
                       easeIn(p * 2) / 2 :
                       1 - easeIn(p * -2 + 2) / 2;
               };
           });
       })();
       var effect = $.effects;


       /*!
        * jQuery UI Effects Blind 1.12.1
        * http://jqueryui.com
        *
        * Copyright jQuery Foundation and other contributors
        * Released under the MIT license.
        * http://jquery.org/license
        */
       //>>label: Blind Effect
       //>>group: Effects
       //>>description: Blinds the element.
       //>>docs: http://api.jqueryui.com/blind-effect/
       //>>demos: http://jqueryui.com/effect/


       var effectsEffectBlind = $.effects.define("blind", "hide", function (options, done) {
           var map = {
                   up: ["bottom", "top"],
                   vertical: ["bottom", "top"],
                   down: ["top", "bottom"],
                   left: ["right", "left"],
                   horizontal: ["right", "left"],
                   right: ["left", "right"]
               },
               element = $(this),
               direction = options.direction || "up",
               start = element.cssClip(),
               animate = {
                   clip: $.extend({}, start)
               },
               placeholder = $.effects.createPlaceholder(element);
           animate.clip[map[direction][0]] = animate.clip[map[direction][1]];
           if (options.mode === "show") {
               element.cssClip(animate.clip);
               if (placeholder) {
                   placeholder.css($.effects.clipToBox(animate));
               }
               animate.clip = start;
           }
           if (placeholder) {
               placeholder.animate($.effects.clipToBox(animate), options.duration, options.easing);
           }
           element.animate(animate, {
               queue: false,
               duration: options.duration,
               easing: options.easing,
               complete: done
           });
       });


       /*!
        * jQuery UI Effects Bounce 1.12.1
        * http://jqueryui.com
        *
        * Copyright jQuery Foundation and other contributors
        * Released under the MIT license.
        * http://jquery.org/license
        */
       //>>label: Bounce Effect
       //>>group: Effects
       //>>description: Bounces an element horizontally or vertically n times.
       //>>docs: http://api.jqueryui.com/bounce-effect/
       //>>demos: http://jqueryui.com/effect/


       var effectsEffectBounce = $.effects.define("bounce", function (options, done) {
           var upAnim, downAnim, refValue,
               element = $(this),
               // Defaults:
               mode = options.mode,
               hide = mode === "hide",
               show = mode === "show",
               direction = options.direction || "up",
               distance = options.distance,
               times = options.times || 5,
               // Number of internal animations
               anims = times * 2 + (show || hide ? 1 : 0),
               speed = options.duration / anims,
               easing = options.easing,
               // Utility:
               ref = (direction === "up" || direction === "down") ? "top" : "left",
               motion = (direction === "up" || direction === "left"),
               i = 0,
               queuelen = element.queue().length;
           $.effects.createPlaceholder(element);
           refValue = element.css(ref);
           // Default distance for the BIGGEST bounce is the outer Distance / 3
           if (!distance) {
               distance = element[ref === "top" ? "outerHeight" : "outerWidth"]() / 3;
           }
           if (show) {
               downAnim = {
                   opacity: 1
               };
               downAnim[ref] = refValue;
               // If we are showing, force opacity 0 and set the initial position
               // then do the "first" animation
               element
                   .css("opacity", 0)
                   .css(ref, motion ? -distance * 2 : distance * 2)
                   .animate(downAnim, speed, easing);
           }
           // Start at the smallest distance if we are hiding
           if (hide) {
               distance = distance / Math.pow(2, times - 1);
           }
           downAnim = {};
           downAnim[ref] = refValue;
           // Bounces up/down/left/right then back to 0 -- times * 2 animations happen here
           for (; i < times; i++) {
               upAnim = {};
               upAnim[ref] = (motion ? "-=" : "+=") + distance;
               element
                   .animate(upAnim, speed, easing)
                   .animate(downAnim, speed, easing);
               distance = hide ? distance * 2 : distance / 2;
           }
           // Last Bounce when Hiding
           if (hide) {
               upAnim = {
                   opacity: 0
               };
               upAnim[ref] = (motion ? "-=" : "+=") + distance;
               element.animate(upAnim, speed, easing);
           }
           element.queue(done);
           $.effects.unshift(element, queuelen, anims + 1);
       });


       /*!
        * jQuery UI Effects Clip 1.12.1
        * http://jqueryui.com
        *
        * Copyright jQuery Foundation and other contributors
        * Released under the MIT license.
        * http://jquery.org/license
        */
       //>>label: Clip Effect
       //>>group: Effects
       //>>description: Clips the element on and off like an old TV.
       //>>docs: http://api.jqueryui.com/clip-effect/
       //>>demos: http://jqueryui.com/effect/


       var effectsEffectClip = $.effects.define("clip", "hide", function (options, done) {
           var start,
               animate = {},
               element = $(this),
               direction = options.direction || "vertical",
               both = direction === "both",
               horizontal = both || direction === "horizontal",
               vertical = both || direction === "vertical";
           start = element.cssClip();
           animate.clip = {
               top: vertical ? (start.bottom - start.top) / 2 : start.top,
               right: horizontal ? (start.right - start.left) / 2 : start.right,
               bottom: vertical ? (start.bottom - start.top) / 2 : start.bottom,
               left: horizontal ? (start.right - start.left) / 2 : start.left
           };
           $.effects.createPlaceholder(element);
           if (options.mode === "show") {
               element.cssClip(animate.clip);
               animate.clip = start;
           }
           element.animate(animate, {
               queue: false,
               duration: options.duration,
               easing: options.easing,
               complete: done
           });
       });


       /*!
        * jQuery UI Effects Drop 1.12.1
        * http://jqueryui.com
        *
        * Copyright jQuery Foundation and other contributors
        * Released under the MIT license.
        * http://jquery.org/license
        */
       //>>label: Drop Effect
       //>>group: Effects
       //>>description: Moves an element in one direction and hides it at the same time.
       //>>docs: http://api.jqueryui.com/drop-effect/
       //>>demos: http://jqueryui.com/effect/


       var effectsEffectDrop = $.effects.define("drop", "hide", function (options, done) {
           var distance,
               element = $(this),
               mode = options.mode,
               show = mode === "show",
               direction = options.direction || "left",
               ref = (direction === "up" || direction === "down") ? "top" : "left",
               motion = (direction === "up" || direction === "left") ? "-=" : "+=",
               oppositeMotion = (motion === "+=") ? "-=" : "+=",
               animation = {
                   opacity: 0
               };
           $.effects.createPlaceholder(element);
           distance = options.distance ||
               element[ref === "top" ? "outerHeight" : "outerWidth"](true) / 2;
           animation[ref] = motion + distance;
           if (show) {
               element.css(animation);
               animation[ref] = oppositeMotion + distance;
               animation.opacity = 1;
           }
           // Animate
           element.animate(animation, {
               queue: false,
               duration: options.duration,
               easing: options.easing,
               complete: done
           });
       });


       /*!
        * jQuery UI Effects Explode 1.12.1
        * http://jqueryui.com
        *
        * Copyright jQuery Foundation and other contributors
        * Released under the MIT license.
        * http://jquery.org/license
        */
       //>>label: Explode Effect
       //>>group: Effects
       // jscs:disable maximumLineLength
       //>>description: Explodes an element in all directions into n pieces. Implodes an element to its original wholeness.
       // jscs:enable maximumLineLength
       //>>docs: http://api.jqueryui.com/explode-effect/
       //>>demos: http://jqueryui.com/effect/


       var effectsEffectExplode = $.effects.define("explode", "hide", function (options, done) {
           var i, j, left, top, mx, my,
               rows = options.pieces ? Math.round(Math.sqrt(options.pieces)) : 3,
               cells = rows,
               element = $(this),
               mode = options.mode,
               show = mode === "show",
               // Show and then visibility:hidden the element before calculating offset
               offset = element.show().css("visibility", "hidden").offset(),
               // Width and height of a piece
               width = Math.ceil(element.outerWidth() / cells),
               height = Math.ceil(element.outerHeight() / rows),
               pieces = [];
           // Children animate complete:
           function childComplete() {
               pieces.push(this);
               if (pieces.length === rows * cells) {
                   animComplete();
               }
           }
           // Clone the element for each row and cell.
           for (i = 0; i < rows; i++) { // ===>
               top = offset.top + i * height;
               my = i - (rows - 1) / 2;
               for (j = 0; j < cells; j++) { // |||
                   left = offset.left + j * width;
                   mx = j - (cells - 1) / 2;
                   // Create a clone of the now hidden main element that will be absolute positioned
                   // within a wrapper div off the -left and -top equal to size of our pieces
                   element
                       .clone()
                       .appendTo("body")
.wrap("
")
                       .css({
                           position: "absolute",
                           visibility: "visible",
                           left: -j * width,
                           top: -i * height
                       })
                       // Select the wrapper - make it overflow: hidden and absolute positioned based on
                       // where the original was located +left and +top equal to the size of pieces
                       .parent()
                       .addClass("ui-effects-explode")
                       .css({
                           position: "absolute",
                           overflow: "hidden",
                           width: width,
                           height: height,
                           left: left + (show ? mx * width : 0),
                           top: top + (show ? my * height : 0),
                           opacity: show ? 0 : 1
                       })
                       .animate({
                           left: left + (show ? 0 : mx * width),
                           top: top + (show ? 0 : my * height),
                           opacity: show ? 1 : 0
                       }, options.duration || 500, options.easing, childComplete);
               }
           }
           function animComplete() {
               element.css({
                   visibility: "visible"
               });
               $(pieces).remove();
               done();
           }
       });


       /*!
        * jQuery UI Effects Fade 1.12.1
        * http://jqueryui.com
        *
        * Copyright jQuery Foundation and other contributors
        * Released under the MIT license.
        * http://jquery.org/license
        */
       //>>label: Fade Effect
       //>>group: Effects
       //>>description: Fades the element.
       //>>docs: http://api.jqueryui.com/fade-effect/
       //>>demos: http://jqueryui.com/effect/


       var effectsEffectFade = $.effects.define("fade", "toggle", function (options, done) {
           var show = options.mode === "show";
           $(this)
               .css("opacity", show ? 0 : 1)
               .animate({
                   opacity: show ? 1 : 0
               }, {
                   queue: false,
                   duration: options.duration,
                   easing: options.easing,
                   complete: done
               });
       });


       /*!
        * jQuery UI Effects Fold 1.12.1
        * http://jqueryui.com
        *
        * Copyright jQuery Foundation and other contributors
        * Released under the MIT license.
        * http://jquery.org/license
        */
       //>>label: Fold Effect
       //>>group: Effects
       //>>description: Folds an element first horizontally and then vertically.
       //>>docs: http://api.jqueryui.com/fold-effect/
       //>>demos: http://jqueryui.com/effect/


       var effectsEffectFold = $.effects.define("fold", "hide", function (options, done) {
           // Create element
           var element = $(this),
               mode = options.mode,
               show = mode === "show",
               hide = mode === "hide",
               size = options.size || 15,
               percent = /([0-9]+)%/.exec(size),
               horizFirst = !!options.horizFirst,
               ref = horizFirst ? ["right", "bottom"] : ["bottom", "right"],
               duration = options.duration / 2,
               placeholder = $.effects.createPlaceholder(element),
               start = element.cssClip(),
               animation1 = {
                   clip: $.extend({}, start)
               },
               animation2 = {
                   clip: $.extend({}, start)
               },
               distance = [start[ref[0]], start[ref[1]]],
               queuelen = element.queue().length;
           if (percent) {
               size = parseInt(percent[1], 10) / 100 * distance[hide ? 0 : 1];
           }
           animation1.clip[ref[0]] = size;
           animation2.clip[ref[0]] = size;
           animation2.clip[ref[1]] = 0;
           if (show) {
               element.cssClip(animation2.clip);
               if (placeholder) {
                   placeholder.css($.effects.clipToBox(animation2));
               }
               animation2.clip = start;
           }
           // Animate
           element
               .queue(function (next) {
                   if (placeholder) {
                       placeholder
                           .animate($.effects.clipToBox(animation1), duration, options.easing)
                           .animate($.effects.clipToBox(animation2), duration, options.easing);
                   }
                   next();
               })
               .animate(animation1, duration, options.easing)
               .animate(animation2, duration, options.easing)
               .queue(done);
           $.effects.unshift(element, queuelen, 4);
       });


       /*!
        * jQuery UI Effects Highlight 1.12.1
        * http://jqueryui.com
        *
        * Copyright jQuery Foundation and other contributors
        * Released under the MIT license.
        * http://jquery.org/license
        */
       //>>label: Highlight Effect
       //>>group: Effects
       //>>description: Highlights the background of an element in a defined color for a custom duration.
       //>>docs: http://api.jqueryui.com/highlight-effect/
       //>>demos: http://jqueryui.com/effect/


       var effectsEffectHighlight = $.effects.define("highlight", "show", function (options, done) {
           var element = $(this),
               animation = {
                   backgroundColor: element.css("backgroundColor")
               };
           if (options.mode === "hide") {
               animation.opacity = 0;
           }
           $.effects.saveStyle(element);
           element
               .css({
                   backgroundImage: "none",
                   backgroundColor: options.color || "#ffff99"
               })
               .animate(animation, {
                   queue: false,
                   duration: options.duration,
                   easing: options.easing,
                   complete: done
               });
       });


       /*!
        * jQuery UI Effects Size 1.12.1
        * http://jqueryui.com
        *
        * Copyright jQuery Foundation and other contributors
        * Released under the MIT license.
        * http://jquery.org/license
        */
       //>>label: Size Effect
       //>>group: Effects
       //>>description: Resize an element to a specified width and height.
       //>>docs: http://api.jqueryui.com/size-effect/
       //>>demos: http://jqueryui.com/effect/


       var effectsEffectSize = $.effects.define("size", function (options, done) {
           // Create element
           var baseline, factor, temp,
               element = $(this),
               // Copy for children
               cProps = ["fontSize"],
               vProps = ["borderTopWidth", "borderBottomWidth", "paddingTop", "paddingBottom"],
               hProps = ["borderLeftWidth", "borderRightWidth", "paddingLeft", "paddingRight"],
               // Set options
               mode = options.mode,
               restore = mode !== "effect",
               scale = options.scale || "both",
               origin = options.origin || ["middle", "center"],
               position = element.css("position"),
               pos = element.position(),
               original = $.effects.scaledDimensions(element),
               from = options.from || original,
               to = options.to || $.effects.scaledDimensions(element, 0);
           $.effects.createPlaceholder(element);
           if (mode === "show") {
               temp = from;
               from = to;
               to = temp;
           }
           // Set scaling factor
           factor = {
               from: {
                   y: from.height / original.height,
                   x: from.width / original.width
               },
               to: {
                   y: to.height / original.height,
                   x: to.width / original.width
               }
           };
           // Scale the css box
           if (scale === "box" || scale === "both") {
               // Vertical props scaling
               if (factor.from.y !== factor.to.y) {
                   from = $.effects.setTransition(element, vProps, factor.from.y, from);
                   to = $.effects.setTransition(element, vProps, factor.to.y, to);
               }
               // Horizontal props scaling
               if (factor.from.x !== factor.to.x) {
                   from = $.effects.setTransition(element, hProps, factor.from.x, from);
                   to = $.effects.setTransition(element, hProps, factor.to.x, to);
               }
           }
           // Scale the content
           if (scale === "content" || scale === "both") {
               // Vertical props scaling
               if (factor.from.y !== factor.to.y) {
                   from = $.effects.setTransition(element, cProps, factor.from.y, from);
                   to = $.effects.setTransition(element, cProps, factor.to.y, to);
               }
           }
           // Adjust the position properties based on the provided origin points
           if (origin) {
               baseline = $.effects.getBaseline(origin, original);
               from.top = (original.outerHeight - from.outerHeight) * baseline.y + pos.top;
               from.left = (original.outerWidth - from.outerWidth) * baseline.x + pos.left;
               to.top = (original.outerHeight - to.outerHeight) * baseline.y + pos.top;
               to.left = (original.outerWidth - to.outerWidth) * baseline.x + pos.left;
           }
           element.css(from);
           // Animate the children if desired
           if (scale === "content" || scale === "both") {
               vProps = vProps.concat(["marginTop", "marginBottom"]).concat(cProps);
               hProps = hProps.concat(["marginLeft", "marginRight"]);
               // Only animate children with width attributes specified
               // TODO: is this right? should we include anything with css width specified as well
               element.find("*[width]").each(function () {
                   var child = $(this),
                       childOriginal = $.effects.scaledDimensions(child),
                       childFrom = {
                           height: childOriginal.height * factor.from.y,
                           width: childOriginal.width * factor.from.x,
                           outerHeight: childOriginal.outerHeight * factor.from.y,
                           outerWidth: childOriginal.outerWidth * factor.from.x
                       },
                       childTo = {
                           height: childOriginal.height * factor.to.y,
                           width: childOriginal.width * factor.to.x,
                           outerHeight: childOriginal.height * factor.to.y,
                           outerWidth: childOriginal.width * factor.to.x
                       };
                   // Vertical props scaling
                   if (factor.from.y !== factor.to.y) {
                       childFrom = $.effects.setTransition(child, vProps, factor.from.y,
                           childFrom);
                       childTo = $.effects.setTransition(child, vProps, factor.to.y, childTo);
                   }
                   // Horizontal props scaling
                   if (factor.from.x !== factor.to.x) {
                       childFrom = $.effects.setTransition(child, hProps, factor.from.x,
                           childFrom);
                       childTo = $.effects.setTransition(child, hProps, factor.to.x, childTo);
                   }
                   if (restore) {
                       $.effects.saveStyle(child);
                   }
                   // Animate children
                   child.css(childFrom);
                   child.animate(childTo, options.duration, options.easing, function () {
                       // Restore children
                       if (restore) {
                           $.effects.restoreStyle(child);
                       }
                   });
               });
           }
           // Animate
           element.animate(to, {
               queue: false,
               duration: options.duration,
               easing: options.easing,
               complete: function () {
                   var offset = element.offset();
                   if (to.opacity === 0) {
                       element.css("opacity", from.opacity);
                   }
                   if (!restore) {
                       element
                           .css("position", position === "static" ? "relative" : position)
                           .offset(offset);
                       // Need to save style here so that automatic style restoration
                       // doesn't restore to the original styles from before the animation.
                       $.effects.saveStyle(element);
                   }
                   done();
               }
           });
       });


       /*!
        * jQuery UI Effects Scale 1.12.1
        * http://jqueryui.com
        *
        * Copyright jQuery Foundation and other contributors
        * Released under the MIT license.
        * http://jquery.org/license
        */
       //>>label: Scale Effect
       //>>group: Effects
       //>>description: Grows or shrinks an element and its content.
       //>>docs: http://api.jqueryui.com/scale-effect/
       //>>demos: http://jqueryui.com/effect/


       var effectsEffectScale = $.effects.define("scale", function (options, done) {
           // Create element
           var el = $(this),
               mode = options.mode,
               percent = parseInt(options.percent, 10) ||
               (parseInt(options.percent, 10) === 0 ? 0 : (mode !== "effect" ? 0 : 100)),
               newOptions = $.extend(true, {
                   from: $.effects.scaledDimensions(el),
                   to: $.effects.scaledDimensions(el, percent, options.direction || "both"),
                   origin: options.origin || ["middle", "center"]
               }, options);
           // Fade option to support puff
           if (options.fade) {
               newOptions.from.opacity = 1;
               newOptions.to.opacity = 0;
           }
           $.effects.effect.size.call(this, newOptions, done);
       });


       /*!
        * jQuery UI Effects Puff 1.12.1
        * http://jqueryui.com
        *
        * Copyright jQuery Foundation and other contributors
        * Released under the MIT license.
        * http://jquery.org/license
        */
       //>>label: Puff Effect
       //>>group: Effects
       //>>description: Creates a puff effect by scaling the element up and hiding it at the same time.
       //>>docs: http://api.jqueryui.com/puff-effect/
       //>>demos: http://jqueryui.com/effect/


       var effectsEffectPuff = $.effects.define("puff", "hide", function (options, done) {
           var newOptions = $.extend(true, {}, options, {
               fade: true,
               percent: parseInt(options.percent, 10) || 150
           });
           $.effects.effect.scale.call(this, newOptions, done);
       });


       /*!
        * jQuery UI Effects Pulsate 1.12.1
        * http://jqueryui.com
        *
        * Copyright jQuery Foundation and other contributors
        * Released under the MIT license.
        * http://jquery.org/license
        */
       //>>label: Pulsate Effect
       //>>group: Effects
       //>>description: Pulsates an element n times by changing the opacity to zero and back.
       //>>docs: http://api.jqueryui.com/pulsate-effect/
       //>>demos: http://jqueryui.com/effect/


       var effectsEffectPulsate = $.effects.define("pulsate", "show", function (options, done) {
           var element = $(this),
               mode = options.mode,
               show = mode === "show",
               hide = mode === "hide",
               showhide = show || hide,
               // Showing or hiding leaves off the "last" animation
               anims = ((options.times || 5) * 2) + (showhide ? 1 : 0),
               duration = options.duration / anims,
               animateTo = 0,
               i = 1,
               queuelen = element.queue().length;
           if (show || !element.is(":visible")) {
               element.css("opacity", 0).show();
               animateTo = 1;
           }
           // Anims - 1 opacity "toggles"
           for (; i < anims; i++) {
               element.animate({
                   opacity: animateTo
               }, duration, options.easing);
               animateTo = 1 - animateTo;
           }
           element.animate({
               opacity: animateTo
           }, duration, options.easing);
           element.queue(done);
           $.effects.unshift(element, queuelen, anims + 1);
       });


       /*!
        * jQuery UI Effects Shake 1.12.1
        * http://jqueryui.com
        *
        * Copyright jQuery Foundation and other contributors
        * Released under the MIT license.
        * http://jquery.org/license
        */
       //>>label: Shake Effect
       //>>group: Effects
       //>>description: Shakes an element horizontally or vertically n times.
       //>>docs: http://api.jqueryui.com/shake-effect/
       //>>demos: http://jqueryui.com/effect/


       var effectsEffectShake = $.effects.define("shake", function (options, done) {
           var i = 1,
               element = $(this),
               direction = options.direction || "left",
               distance = options.distance || 20,
               times = options.times || 3,
               anims = times * 2 + 1,
               speed = Math.round(options.duration / anims),
               ref = (direction === "up" || direction === "down") ? "top" : "left",
               positiveMotion = (direction === "up" || direction === "left"),
               animation = {},
               animation1 = {},
               animation2 = {},
               queuelen = element.queue().length;
           $.effects.createPlaceholder(element);
           // Animation
           animation[ref] = (positiveMotion ? "-=" : "+=") + distance;
           animation1[ref] = (positiveMotion ? "+=" : "-=") + distance * 2;
           animation2[ref] = (positiveMotion ? "-=" : "+=") + distance * 2;
           // Animate
           element.animate(animation, speed, options.easing);
           // Shakes
           for (; i < times; i++) {
               element
                   .animate(animation1, speed, options.easing)
                   .animate(animation2, speed, options.easing);
           }
           element
               .animate(animation1, speed, options.easing)
               .animate(animation, speed / 2, options.easing)
               .queue(done);
           $.effects.unshift(element, queuelen, anims + 1);
       });


       /*!
        * jQuery UI Effects Slide 1.12.1
        * http://jqueryui.com
        *
        * Copyright jQuery Foundation and other contributors
        * Released under the MIT license.
        * http://jquery.org/license
        */
       //>>label: Slide Effect
       //>>group: Effects
       //>>description: Slides an element in and out of the viewport.
       //>>docs: http://api.jqueryui.com/slide-effect/
       //>>demos: http://jqueryui.com/effect/


       var effectsEffectSlide = $.effects.define("slide", "show", function (options, done) {
           var startClip, startRef,
               element = $(this),
               map = {
                   up: ["bottom", "top"],
                   down: ["top", "bottom"],
                   left: ["right", "left"],
                   right: ["left", "right"]
               },
               mode = options.mode,
               direction = options.direction || "left",
               ref = (direction === "up" || direction === "down") ? "top" : "left",
               positiveMotion = (direction === "up" || direction === "left"),
               distance = options.distance ||
               element[ref === "top" ? "outerHeight" : "outerWidth"](true),
               animation = {};
           $.effects.createPlaceholder(element);
           startClip = element.cssClip();
           startRef = element.position()[ref];
           // Define hide animation
           animation[ref] = (positiveMotion ? -1 : 1) * distance + startRef;
           animation.clip = element.cssClip();
           animation.clip[map[direction][1]] = animation.clip[map[direction][0]];
           // Reverse the animation if we're showing
           if (mode === "show") {
               element.cssClip(animation.clip);
               element.css(ref, animation[ref]);
               animation.clip = startClip;
               animation[ref] = startRef;
           }
           // Actually animate
           element.animate(animation, {
               queue: false,
               duration: options.duration,
               easing: options.easing,
               complete: done
           });
       });


       /*!
        * jQuery UI Effects Transfer 1.12.1
        * http://jqueryui.com
        *
        * Copyright jQuery Foundation and other contributors
        * Released under the MIT license.
        * http://jquery.org/license
        */
       //>>label: Transfer Effect
       //>>group: Effects
       //>>description: Displays a transfer effect from one element to another.
       //>>docs: http://api.jqueryui.com/transfer-effect/
       //>>demos: http://jqueryui.com/effect/


       var effect;
       if ($.uiBackCompat !== false) {
           effect = $.effects.define("transfer", function (options, done) {
               $(this).transfer(options, done);
           });
       }
       var effectsEffectTransfer = effect;


       /*!
        * jQuery UI Focusable 1.12.1
        * http://jqueryui.com
        *
        * Copyright jQuery Foundation and other contributors
        * Released under the MIT license.
        * http://jquery.org/license
        */
       //>>label: :focusable Selector
       //>>group: Core
       //>>description: Selects elements which can be focused.
       //>>docs: http://api.jqueryui.com/focusable-selector/


       // Selectors
       $.ui.focusable = function (element, hasTabindex) {
           var map, mapName, img, focusableIfVisible, fieldset,
               nodeName = element.nodeName.toLowerCase();
           if ("area" === nodeName) {
               map = element.parentNode;
               mapName = map.name;
               if (!element.href || !mapName || map.nodeName.toLowerCase() !== "map") {
                   return false;
               }
               img = $("img[usemap='#" + mapName + "']");
               return img.length > 0 && img.is(":visible");
           }
           if (/^(input|select|textarea|button|object)$/.test(nodeName)) {
               focusableIfVisible = !element.disabled;
               if (focusableIfVisible) {
                   // Form controls within a disabled fieldset are disabled.
                   // However, controls within the fieldset's legend do not get disabled.
                   // Since controls generally aren't placed inside legends, we skip
                   // this portion of the check.
                   fieldset = $(element).closest("fieldset")[0];
                   if (fieldset) {
                       focusableIfVisible = !fieldset.disabled;
                   }
               }
           } else if ("a" === nodeName) {
               focusableIfVisible = element.href || hasTabindex;
           } else {
               focusableIfVisible = hasTabindex;
           }
           return focusableIfVisible && $(element).is(":visible") && visible($(element));
       };
       // Support: IE 8 only
       // IE 8 doesn't resolve inherit to visible/hidden for computed values
       function visible(element) {
           var visibility = element.css("visibility");
           while (visibility === "inherit") {
               element = element.parent();
               visibility = element.css("visibility");
           }
           return visibility !== "hidden";
       }
       $.extend($.expr[":"], {
           focusable: function (element) {
               return $.ui.focusable(element, $.attr(element, "tabindex") != null);
           }
       });
       var focusable = $.ui.focusable;



       // Support: IE8 Only
       // IE8 does not support the form attribute and when it is supplied. It overwrites the form prop
       // with a string, so we need to find the proper form.
       var form = $.fn.form = function () {
           return typeof this[0].form === "string" ? this.closest("form") : $(this[0].form);
       };


       /*!
        * jQuery UI Form Reset Mixin 1.12.1
        * http://jqueryui.com
        *
        * Copyright jQuery Foundation and other contributors
        * Released under the MIT license.
        * http://jquery.org/license
        */
       //>>label: Form Reset Mixin
       //>>group: Core
       //>>description: Refresh input widgets when their form is reset
       //>>docs: http://api.jqueryui.com/form-reset-mixin/


       var formResetMixin = $.ui.formResetMixin = {
           _formResetHandler: function () {
               var form = $(this);
               // Wait for the form reset to actually happen before refreshing
               setTimeout(function () {
                   var instances = form.data("ui-form-reset-instances");
                   $.each(instances, function () {
                       this.refresh();
                   });
               });
           },
           _bindFormResetHandler: function () {
               this.form = this.element.form();
               if (!this.form.length) {
                   return;
               }
               var instances = this.form.data("ui-form-reset-instances") || [];
               if (!instances.length) {
                   // We don't use _on() here because we use a single event handler per form
                   this.form.on("reset.ui-form-reset", this._formResetHandler);
               }
               instances.push(this);
               this.form.data("ui-form-reset-instances", instances);
           },
           _unbindFormResetHandler: function () {
               if (!this.form.length) {
                   return;
               }
               var instances = this.form.data("ui-form-reset-instances");
               instances.splice($.inArray(this, instances), 1);
               if (instances.length) {
                   this.form.data("ui-form-reset-instances", instances);
               } else {
                   this.form
                       .removeData("ui-form-reset-instances")
                       .off("reset.ui-form-reset");
               }
           }
       };


       /*!
        * jQuery UI Support for jQuery core 1.7.x 1.12.1
        * http://jqueryui.com
        *
        * Copyright jQuery Foundation and other contributors
        * Released under the MIT license.
        * http://jquery.org/license
        *
        */
       //>>label: jQuery 1.7 Support
       //>>group: Core
       //>>description: Support version 1.7.x of jQuery core


       // Support: jQuery 1.7 only
       // Not a great way to check versions, but since we only support 1.7+ and only
       // need to detect <1.8, this is a simple check that should suffice. Checking
       // for "1.7." would be a bit safer, but the version string is 1.7, not 1.7.0
       // and we'll never reach 1.70.0 (if we do, we certainly won't be supporting
       // 1.7 anymore). See #11197 for why we're not using feature detection.
       if ($.fn.jquery.substring(0, 3) === "1.7") {
           // Setters for .innerWidth(), .innerHeight(), .outerWidth(), .outerHeight()
           // Unlike jQuery Core 1.8+, these only support numeric values to set the
           // dimensions in pixels
           $.each(["Width", "Height"], function (i, name) {
               var side = name === "Width" ? ["Left", "Right"] : ["Top", "Bottom"],
                   type = name.toLowerCase(),
                   orig = {
                       innerWidth: $.fn.innerWidth,
                       innerHeight: $.fn.innerHeight,
                       outerWidth: $.fn.outerWidth,
                       outerHeight: $.fn.outerHeight
                   };
               function reduce(elem, size, border, margin) {
                   $.each(side, function () {
                       size -= parseFloat($.css(elem, "padding" + this)) || 0;
                       if (border) {
                           size -= parseFloat($.css(elem, "border" + this + "Width")) || 0;
                       }
                       if (margin) {
                           size -= parseFloat($.css(elem, "margin" + this)) || 0;
                       }
                   });
                   return size;
               }
               $.fn["inner" + name] = function (size) {
                   if (size === undefined) {
                       return orig["inner" + name].call(this);
                   }
                   return this.each(function () {
                       $(this).css(type, reduce(this, size) + "px");
                   });
               };
               $.fn["outer" + name] = function (size, margin) {
                   if (typeof size !== "number") {
                       return orig["outer" + name].call(this, size);
                   }
                   return this.each(function () {
                       $(this).css(type, reduce(this, size, true, margin) + "px");
                   });
               };
           });
           $.fn.addBack = function (selector) {
               return this.add(selector == null ?
                   this.prevObject : this.prevObject.filter(selector)
               );
           };
       }
       ;
       /*!
        * jQuery UI Keycode 1.12.1
        * http://jqueryui.com
        *
        * Copyright jQuery Foundation and other contributors
        * Released under the MIT license.
        * http://jquery.org/license
        */
       //>>label: Keycode
       //>>group: Core
       //>>description: Provide keycodes as keynames
       //>>docs: http://api.jqueryui.com/jQuery.ui.keyCode/


       var keycode = $.ui.keyCode = {
           BACKSPACE: 8,
           COMMA: 188,
           DELETE: 46,
           DOWN: 40,
           END: 35,
           ENTER: 13,
           ESCAPE: 27,
           HOME: 36,
           LEFT: 37,
           PAGE_DOWN: 34,
           PAGE_UP: 33,
           PERIOD: 190,
           RIGHT: 39,
           SPACE: 32,
           TAB: 9,
           UP: 38
       };



       // Internal use only
       var escapeSelector = $.ui.escapeSelector = (function () {
           var selectorEscape = /([!"#$%&'()*+,./:;<=>?@[\]^`{|}~])/g;
           return function (selector) {
               return selector.replace(selectorEscape, "\\$1");
           };
       })();


       /*!
        * jQuery UI Labels 1.12.1
        * http://jqueryui.com
        *
        * Copyright jQuery Foundation and other contributors
        * Released under the MIT license.
        * http://jquery.org/license
        */
       //>>label: labels
       //>>group: Core
       //>>description: Find all the labels associated with a given input
       //>>docs: http://api.jqueryui.com/labels/


       var labels = $.fn.labels = function () {
           var ancestor, selector, id, labels, ancestors;
           // Check control.labels first
           if (this[0].labels && this[0].labels.length) {
               return this.pushStack(this[0].labels);
           }
           // Support: IE <= 11, FF <= 37, Android <= 2.3 only
           // Above browsers do not support control.labels. Everything below is to support them
           // as well as document fragments. control.labels does not work on document fragments
           labels = this.eq(0).parents("label");
           // Look for the label based on the id
           id = this.attr("id");
           if (id) {
               // We don't search against the document in case the element
               // is disconnected from the DOM
               ancestor = this.eq(0).parents().last();
               // Get a full set of top level ancestors
               ancestors = ancestor.add(ancestor.length ? ancestor.siblings() : this.siblings());
               // Create a selector for the label based on the id
               selector = "label[for='" + $.ui.escapeSelector(id) + "']";
               labels = labels.add(ancestors.find(selector).addBack(selector));
           }
           // Return whatever we have found for labels
           return this.pushStack(labels);
       };


       /*!
        * jQuery UI Scroll Parent 1.12.1
        * http://jqueryui.com
        *
        * Copyright jQuery Foundation and other contributors
        * Released under the MIT license.
        * http://jquery.org/license
        */
       //>>label: scrollParent
       //>>group: Core
       //>>description: Get the closest ancestor element that is scrollable.
       //>>docs: http://api.jqueryui.com/scrollParent/


       var scrollParent = $.fn.scrollParent = function (includeHidden) {
           var position = this.css("position"),
               excludeStaticParent = position === "absolute",
               overflowRegex = includeHidden ? /(auto|scroll|hidden)/ : /(auto|scroll)/,
               scrollParent = this.parents().filter(function () {
                   var parent = $(this);
                   if (excludeStaticParent && parent.css("position") === "static") {
                       return false;
                   }
                   return overflowRegex.test(parent.css("overflow") + parent.css("overflow-y") +
                       parent.css("overflow-x"));
               }).eq(0);
           return position === "fixed" || !scrollParent.length ?
               $(this[0].ownerDocument || document) :
               scrollParent;
       };


       /*!
        * jQuery UI Tabbable 1.12.1
        * http://jqueryui.com
        *
        * Copyright jQuery Foundation and other contributors
        * Released under the MIT license.
        * http://jquery.org/license
        */
       //>>label: :tabbable Selector
       //>>group: Core
       //>>description: Selects elements which can be tabbed to.
       //>>docs: http://api.jqueryui.com/tabbable-selector/


       var tabbable = $.extend($.expr[":"], {
           tabbable: function (element) {
               var tabIndex = $.attr(element, "tabindex"),
                   hasTabindex = tabIndex != null;
               return (!hasTabindex || tabIndex >= 0) && $.ui.focusable(element, hasTabindex);
           }
       });


       /*!
        * jQuery UI Unique ID 1.12.1
        * http://jqueryui.com
        *
        * Copyright jQuery Foundation and other contributors
        * Released under the MIT license.
        * http://jquery.org/license
        */
       //>>label: uniqueId
       //>>group: Core
       //>>description: Functions to generate and remove uniqueId's
       //>>docs: http://api.jqueryui.com/uniqueId/


       var uniqueId = $.fn.extend({
           uniqueId: (function () {
               var uuid = 0;
               return function () {
                   return this.each(function () {
                       if (!this.id) {
                           this.id = "ui-id-" + (++uuid);
                       }
                   });
               };
           })(),
           removeUniqueId: function () {
               return this.each(function () {
                   if (/^ui-id-\d+$/.test(this.id)) {
                       $(this).removeAttr("id");
                   }
               });
           }
       });


       /*!
        * jQuery UI Accordion 1.12.1
        * http://jqueryui.com
        *
        * Copyright jQuery Foundation and other contributors
        * Released under the MIT license.
        * http://jquery.org/license
        */
       //>>label: Accordion
       //>>group: Widgets
       // jscs:disable maximumLineLength
       //>>description: Displays collapsible content panels for presenting information in a limited amount of space.
       // jscs:enable maximumLineLength
       //>>docs: http://api.jqueryui.com/accordion/
       //>>demos: http://jqueryui.com/accordion/
       //>>css.structure: ../../themes/base/core.css
       //>>css.structure: ../../themes/base/accordion.css
       //>>css.theme: ../../themes/base/theme.css


       var widgetsAccordion = $.widget("ui.accordion", {
           version: "1.12.1",
           options: {
               active: 0,
               animate: {},
               classes: {
                   "ui-accordion-header": "ui-corner-top",
                   "ui-accordion-header-collapsed": "ui-corner-all",
                   "ui-accordion-content": "ui-corner-bottom"
               },
               collapsible: false,
               event: "click",
               header: "> li > :first-child, > :not(li):even",
               heightStyle: "auto",
               icons: {
                   activeHeader: "ui-icon-triangle-1-s",
                   header: "ui-icon-triangle-1-e"
               },
               // Callbacks
               activate: null,
               beforeActivate: null
           },
           hideProps: {
               borderTopWidth: "hide",
               borderBottomWidth: "hide",
               paddingTop: "hide",
               paddingBottom: "hide",
               height: "hide"
           },
           showProps: {
               borderTopWidth: "show",
               borderBottomWidth: "show",
               paddingTop: "show",
               paddingBottom: "show",
               height: "show"
           },
           _create: function () {
               var options = this.options;
               this.prevShow = this.prevHide = $();
               this._addClass("ui-accordion", "ui-widget ui-helper-reset");
               this.element.attr("role", "tablist");
               // Don't allow collapsible: false and active: false / null
               if (!options.collapsible && (options.active === false || options.active == null)) {
                   options.active = 0;
               }
               this._processPanels();
               // handle negative values
               if (options.active < 0) {
                   options.active += this.headers.length;
               }
               this._refresh();
           },
           _getCreateEventData: function () {
               return {
                   header: this.active,
                   panel: !this.active.length ? $() : this.active.next()
               };
           },
           _createIcons: function () {
               var icon, children,
                   icons = this.options.icons;
               if (icons) {
                   icon = $("");
                   this._addClass(icon, "ui-accordion-header-icon", "ui-icon " + icons.header);
                   icon.prependTo(this.headers);
                   children = this.active.children(".ui-accordion-header-icon");
                   this._removeClass(children, icons.header)
                       ._addClass(children, null, icons.activeHeader)
                       ._addClass(this.headers, "ui-accordion-icons");
               }
           },
           _destroyIcons: function () {
               this._removeClass(this.headers, "ui-accordion-icons");
               this.headers.children(".ui-accordion-header-icon").remove();
           },
           _destroy: function () {
               var contents;
               // Clean up main element
               this.element.removeAttr("role");
               // Clean up headers
               this.headers
                   .removeAttr("role aria-expanded aria-selected aria-controls tabIndex")
                   .removeUniqueId();
               this._destroyIcons();
               // Clean up content panels
               contents = this.headers.next()
                   .css("display", "")
                   .removeAttr("role aria-hidden aria-labelledby")
                   .removeUniqueId();
               if (this.options.heightStyle !== "content") {
                   contents.css("height", "");
               }
           },
           _setOption: function (key, value) {
               if (key === "active") {
                   // _activate() will handle invalid values and update this.options
                   this._activate(value);
                   return;
               }
               if (key === "event") {
                   if (this.options.event) {
                       this._off(this.headers, this.options.event);
                   }
                   this._setupEvents(value);
               }
               this._super(key, value);
               // Setting collapsible: false while collapsed; open first panel
               if (key === "collapsible" && !value && this.options.active === false) {
                   this._activate(0);
               }
               if (key === "icons") {
                   this._destroyIcons();
                   if (value) {
                       this._createIcons();
                   }
               }
           },
           _setOptionDisabled: function (value) {
               this._super(value);
               this.element.attr("aria-disabled", value);
               // Support: IE8 Only
               // #5332 / #6059 - opacity doesn't cascade to positioned elements in IE
               // so we need to add the disabled class to the headers and panels
               this._toggleClass(null, "ui-state-disabled", !!value);
               this._toggleClass(this.headers.add(this.headers.next()), null, "ui-state-disabled",
                   !!value);
           },
           _keydown: function (event) {
               if (event.altKey || event.ctrlKey) {
                   return;
               }
               var keyCode = $.ui.keyCode,
                   length = this.headers.length,
                   currentIndex = this.headers.index(event.target),
                   toFocus = false;
               switch (event.keyCode) {
                   case keyCode.RIGHT:
                   case keyCode.DOWN:
                       toFocus = this.headers[(currentIndex + 1) % length];
                       break;
                   case keyCode.LEFT:
                   case keyCode.UP:
                       toFocus = this.headers[(currentIndex - 1 + length) % length];
                       break;
                   case keyCode.SPACE:
                   case keyCode.ENTER:
                       this._eventHandler(event);
                       break;
                   case keyCode.HOME:
                       toFocus = this.headers[0];
                       break;
                   case keyCode.END:
                       toFocus = this.headers[length - 1];
                       break;
               }
               if (toFocus) {
                   $(event.target).attr("tabIndex", -1);
                   $(toFocus).attr("tabIndex", 0);
                   $(toFocus).trigger("focus");
                   event.preventDefault();
               }
           },
           _panelKeyDown: function (event) {
               if (event.keyCode === $.ui.keyCode.UP && event.ctrlKey) {
                   $(event.currentTarget).prev().trigger("focus");
               }
           },
           refresh: function () {
               var options = this.options;
               this._processPanels();
               // Was collapsed or no panel
               if ((options.active === false && options.collapsible === true) ||
                   !this.headers.length) {
                   options.active = false;
                   this.active = $();
                   // active false only when collapsible is true
               } else if (options.active === false) {
                   this._activate(0);
                   // was active, but active panel is gone
               } else if (this.active.length && !$.contains(this.element[0], this.active[0])) {
                   // all remaining panel are disabled
                   if (this.headers.length === this.headers.find(".ui-state-disabled").length) {
                       options.active = false;
                       this.active = $();
                       // activate previous panel
                   } else {
                       this._activate(Math.max(0, options.active - 1));
                   }
                   // was active, active panel still exists
               } else {
                   // make sure active index is correct
                   options.active = this.headers.index(this.active);
               }
               this._destroyIcons();
               this._refresh();
           },
           _processPanels: function () {
               var prevHeaders = this.headers,
                   prevPanels = this.panels;
               this.headers = this.element.find(this.options.header);
               this._addClass(this.headers, "ui-accordion-header ui-accordion-header-collapsed",
                   "ui-state-default");
               this.panels = this.headers.next().filter(":not(.ui-accordion-content-active)")
                   .hide();
               this._addClass(this.panels, "ui-accordion-content",
                   "ui-helper-reset ui-widget-content");
               // Avoid memory leaks (#10056)
               if (prevPanels) {
                   this._off(prevHeaders.not(this.headers));
                   this._off(prevPanels.not(this.panels));
               }
           },
           _refresh: function () {
               var maxHeight,
                   options = this.options,
                   heightStyle = options.heightStyle,
                   parent = this.element.parent();
               this.active = this._findActive(options.active);
               this._addClass(this.active, "ui-accordion-header-active", "ui-state-active")
                   ._removeClass(this.active, "ui-accordion-header-collapsed");
               this._addClass(this.active.next(), "ui-accordion-content-active");
               this.active.next().show();
               this.headers
                   .attr("role", "tab")
                   .each(function () {
                       var header = $(this),
                           headerId = header.uniqueId().attr("id"),
                           panel = header.next(),
                           panelId = panel.uniqueId().attr("id");
                       header.attr("aria-controls", panelId);
                       panel.attr("aria-labelledby", headerId);
                   })
                   .next()
                   .attr("role", "tabpanel");
               this.headers
                   .not(this.active)
                   .attr({
                       "aria-selected": "false",
                       "aria-expanded": "false",
                       tabIndex: -1
                   })
                   .next()
                   .attr({
                       "aria-hidden": "true"
                   })
                   .hide();
               // Make sure at least one header is in the tab order
               if (!this.active.length) {
                   this.headers.eq(0).attr("tabIndex", 0);
               } else {
                   this.active.attr({
                           "aria-selected": "true",
                           "aria-expanded": "true",
                           tabIndex: 0
                       })
                       .next()
                       .attr({
                           "aria-hidden": "false"
                       });
               }
               this._createIcons();
               this._setupEvents(options.event);
               if (heightStyle === "fill") {
                   maxHeight = parent.height();
                   this.element.siblings(":visible").each(function () {
                       var elem = $(this),
                           position = elem.css("position");
                       if (position === "absolute" || position === "fixed") {
                           return;
                       }
                       maxHeight -= elem.outerHeight(true);
                   });
                   this.headers.each(function () {
                       maxHeight -= $(this).outerHeight(true);
                   });
                   this.headers.next()
                       .each(function () {
                           $(this).height(Math.max(0, maxHeight -
                               $(this).innerHeight() + $(this).height()));
                       })
                       .css("overflow", "auto");
               } else if (heightStyle === "auto") {
                   maxHeight = 0;
                   this.headers.next()
                       .each(function () {
                           var isVisible = $(this).is(":visible");
                           if (!isVisible) {
                               $(this).show();
                           }
                           maxHeight = Math.max(maxHeight, $(this).css("height", "").height());
                           if (!isVisible) {
                               $(this).hide();
                           }
                       })
                       .height(maxHeight);
               }
           },
           _activate: function (index) {
               var active = this._findActive(index)[0];
               // Trying to activate the already active panel
               if (active === this.active[0]) {
                   return;
               }
               // Trying to collapse, simulate a click on the currently active header
               active = active || this.active[0];
               this._eventHandler({
                   target: active,
                   currentTarget: active,
                   preventDefault: $.noop
               });
           },
           _findActive: function (selector) {
               return typeof selector === "number" ? this.headers.eq(selector) : $();
           },
           _setupEvents: function (event) {
               var events = {
                   keydown: "_keydown"
               };
               if (event) {
                   $.each(event.split(" "), function (index, eventName) {
                       events[eventName] = "_eventHandler";
                   });
               }
               this._off(this.headers.add(this.headers.next()));
               this._on(this.headers, events);
               this._on(this.headers.next(), {
                   keydown: "_panelKeyDown"
               });
               this._hoverable(this.headers);
               this._focusable(this.headers);
           },
           _eventHandler: function (event) {
               var activeChildren, clickedChildren,
                   options = this.options,
                   active = this.active,
                   clicked = $(event.currentTarget),
                   clickedIsActive = clicked[0] === active[0],
                   collapsing = clickedIsActive && options.collapsible,
                   toShow = collapsing ? $() : clicked.next(),
                   toHide = active.next(),
                   eventData = {
                       oldHeader: active,
                       oldPanel: toHide,
                       newHeader: collapsing ? $() : clicked,
                       newPanel: toShow
                   };
               event.preventDefault();
               if (
                   // click on active header, but not collapsible
                   (clickedIsActive && !options.collapsible) ||
                   // allow canceling activation
                   (this._trigger("beforeActivate", event, eventData) === false)) {
                   return;
               }
               options.active = collapsing ? false : this.headers.index(clicked);
               // When the call to ._toggle() comes after the class changes
               // it causes a very odd bug in IE 8 (see #6720)
               this.active = clickedIsActive ? $() : clicked;
               this._toggle(eventData);
               // Switch classes
               // corner classes on the previously active header stay after the animation
               this._removeClass(active, "ui-accordion-header-active", "ui-state-active");
               if (options.icons) {
                   activeChildren = active.children(".ui-accordion-header-icon");
                   this._removeClass(activeChildren, null, options.icons.activeHeader)
                       ._addClass(activeChildren, null, options.icons.header);
               }
               if (!clickedIsActive) {
                   this._removeClass(clicked, "ui-accordion-header-collapsed")
                       ._addClass(clicked, "ui-accordion-header-active", "ui-state-active");
                   if (options.icons) {
                       clickedChildren = clicked.children(".ui-accordion-header-icon");
                       this._removeClass(clickedChildren, null, options.icons.header)
                           ._addClass(clickedChildren, null, options.icons.activeHeader);
                   }
                   this._addClass(clicked.next(), "ui-accordion-content-active");
               }
           },
           _toggle: function (data) {
               var toShow = data.newPanel,
                   toHide = this.prevShow.length ? this.prevShow : data.oldPanel;
               // Handle activating a panel during the animation for another activation
               this.prevShow.add(this.prevHide).stop(true, true);
               this.prevShow = toShow;
               this.prevHide = toHide;
               if (this.options.animate) {
                   this._animate(toShow, toHide, data);
               } else {
                   toHide.hide();
                   toShow.show();
                   this._toggleComplete(data);
               }
               toHide.attr({
                   "aria-hidden": "true"
               });
               toHide.prev().attr({
                   "aria-selected": "false",
                   "aria-expanded": "false"
               });
               // if we're switching panels, remove the old header from the tab order
               // if we're opening from collapsed state, remove the previous header from the tab order
               // if we're collapsing, then keep the collapsing header in the tab order
               if (toShow.length && toHide.length) {
                   toHide.prev().attr({
                       "tabIndex": -1,
                       "aria-expanded": "false"
                   });
               } else if (toShow.length) {
                   this.headers.filter(function () {
                           return parseInt($(this).attr("tabIndex"), 10) === 0;
                       })
                       .attr("tabIndex", -1);
               }
               toShow
                   .attr("aria-hidden", "false")
                   .prev()
                   .attr({
                       "aria-selected": "true",
                       "aria-expanded": "true",
                       tabIndex: 0
                   });
           },
           _animate: function (toShow, toHide, data) {
               var total, easing, duration,
                   that = this,
                   adjust = 0,
                   boxSizing = toShow.css("box-sizing"),
                   down = toShow.length &&
                   (!toHide.length || (toShow.index() < toHide.index())),
                   animate = this.options.animate || {},
                   options = down && animate.down || animate,
                   complete = function () {
                       that._toggleComplete(data);
                   };
               if (typeof options === "number") {
                   duration = options;
               }
               if (typeof options === "string") {
                   easing = options;
               }
               // fall back from options to animation in case of partial down settings
               easing = easing || options.easing || animate.easing;
               duration = duration || options.duration || animate.duration;
               if (!toHide.length) {
                   return toShow.animate(this.showProps, duration, easing, complete);
               }
               if (!toShow.length) {
                   return toHide.animate(this.hideProps, duration, easing, complete);
               }
               total = toShow.show().outerHeight();
               toHide.animate(this.hideProps, {
                   duration: duration,
                   easing: easing,
                   step: function (now, fx) {
                       fx.now = Math.round(now);
                   }
               });
               toShow
                   .hide()
                   .animate(this.showProps, {
                       duration: duration,
                       easing: easing,
                       complete: complete,
                       step: function (now, fx) {
                           fx.now = Math.round(now);
                           if (fx.prop !== "height") {
                               if (boxSizing === "content-box") {
                                   adjust += fx.now;
                               }
                           } else if (that.options.heightStyle !== "content") {
                               fx.now = Math.round(total - toHide.outerHeight() - adjust);
                               adjust = 0;
                           }
                       }
                   });
           },
           _toggleComplete: function (data) {
               var toHide = data.oldPanel,
                   prev = toHide.prev();
               this._removeClass(toHide, "ui-accordion-content-active");
               this._removeClass(prev, "ui-accordion-header-active")
                   ._addClass(prev, "ui-accordion-header-collapsed");
               // Work around for rendering bug in IE (#5421)
               if (toHide.length) {
                   toHide.parent()[0].className = toHide.parent()[0].className;
               }
               this._trigger("activate", null, data);
           }
       });


       var safeActiveElement = $.ui.safeActiveElement = function (document) {
           var activeElement;
           // Support: IE 9 only
           // IE9 throws an "Unspecified error" accessing document.activeElement from an <iframe>
           try {
               activeElement = document.activeElement;
           } catch (error) {
               activeElement = document.body;
           }
           // Support: IE 9 - 11 only
           // IE may return null instead of an element
           // Interestingly, this only seems to occur when NOT in an iframe
           if (!activeElement) {
               activeElement = document.body;
           }
           // Support: IE 11 only
           // IE11 returns a seemingly empty object in some cases when accessing
           // document.activeElement from an <iframe>
           if (!activeElement.nodeName) {
               activeElement = document.body;
           }
           return activeElement;
       };


       /*!
        * jQuery UI Menu 1.12.1
        * http://jqueryui.com
        *
        * Copyright jQuery Foundation and other contributors
        * Released under the MIT license.
        * http://jquery.org/license
        */
       //>>label: Menu
       //>>group: Widgets
       //>>description: Creates nestable menus.
       //>>docs: http://api.jqueryui.com/menu/
       //>>demos: http://jqueryui.com/menu/
       //>>css.structure: ../../themes/base/core.css
       //>>css.structure: ../../themes/base/menu.css
       //>>css.theme: ../../themes/base/theme.css


       var widgetsMenu = $.widget("ui.menu", {
           version: "1.12.1",
defaultElement: "
    ", delay: 300, options: { icons: { submenu: "ui-icon-caret-1-e" }, items: "> *", menus: "ul", position: { my: "left top", at: "right top" }, role: "menu", // Callbacks blur: null, focus: null, select: null }, _create: function () { this.activeMenu = this.element; // Flag used to prevent firing of the click handler // as the event bubbles up through nested menus this.mouseHandled = false; this.element .uniqueId() .attr({ role: this.options.role, tabIndex: 0 }); this._addClass("ui-menu", "ui-widget ui-widget-content"); this._on({ // Prevent focus from sticking to links inside menu after clicking // them (focus should always stay on UL during navigation). "mousedown .ui-menu-item": function (event) { event.preventDefault(); }, "click .ui-menu-item": function (event) { var target = $(event.target); var active = $($.ui.safeActiveElement(this.document[0])); if (!this.mouseHandled && target.not(".ui-state-disabled") .length) { this.select(event); // Only set the mouseHandled flag if the event will bubble, see #9469. if (!event.isPropagationStopped()) { this.mouseHandled = true; } // Open submenu on click if (target.has(".ui-menu").length) { this.expand(event); } else if (!this.element.is(":focus") && active.closest(".ui-menu").length) { // Redirect focus to the menu this.element.trigger("focus", [true]); // If the active item is on the top level, let it stay active. // Otherwise, blur the active item since it is no longer visible. if (this.active && this.active.parents(".ui-menu") .length === 1) { clearTimeout(this.timer); } } } }, "mouseenter .ui-menu-item": function (event) { // Ignore mouse events while typeahead is active, see #10458. // Prevents focusing the wrong item when typeahead causes a scroll while the mouse // is over an item in the menu if (this.previousFilter) { return; } var actualTarget = $(event.target).closest(".ui-menu-item"), target = $(event.currentTarget); // Ignore bubbled events on parent items, see #11641 if (actualTarget[0] !== target[0]) { return; } // Remove ui-state-active class from siblings of the newly focused menu item // to avoid a jump caused by adjacent elements both having a class with a border this._removeClass(target.siblings().children( ".ui-state-active"), null, "ui-state-active"); this.focus(event, target); }, mouseleave: "collapseAll", "mouseleave .ui-menu": "collapseAll", focus: function (event, keepActiveItem) { // If there's already an active item, keep it active // If not, activate the first item var item = this.active || this.element.find(this.options.items) .eq(0); if (!keepActiveItem) { this.focus(event, item); } }, blur: function (event) { this._delay(function () { var notContained = !$.contains( this.element[0], $.ui.safeActiveElement(this.document[0]) ); if (notContained) { this.collapseAll(event); } }); }, keydown: "_keydown" }); this.refresh(); // Clicks outside of a menu collapse any open menus this._on(this.document, { click: function (event) { if (this._closeOnDocumentClick(event)) { this.collapseAll(event); } // Reset the mouseHandled flag this.mouseHandled = false; } }); }, _destroy: function () { var items = this.element.find(".ui-menu-item") .removeAttr("role aria-disabled"), submenus = items.children(".ui-menu-item-wrapper") .removeUniqueId() .removeAttr("tabIndex role aria-haspopup"); // Destroy (sub)menus this.element .removeAttr("aria-activedescendant") .find(".ui-menu").addBack() .removeAttr("role aria-labelledby aria-expanded aria-hidden aria-disabled " + "tabIndex") .removeUniqueId() .show(); submenus.children().each(function () { var elem = $(this); if (elem.data("ui-menu-submenu-caret")) { elem.remove(); } }); }, _keydown: function (event) { var match, prev, character, skip, preventDefault = true; switch (event.keyCode) { case $.ui.keyCode.PAGE_UP: this.previousPage(event); break; case $.ui.keyCode.PAGE_DOWN: this.nextPage(event); break; case $.ui.keyCode.HOME: this._move("first", "first", event); break; case $.ui.keyCode.END: this._move("last", "last", event); break; case $.ui.keyCode.UP: this.previous(event); break; case $.ui.keyCode.DOWN: this.next(event); break; case $.ui.keyCode.LEFT: this.collapse(event); break; case $.ui.keyCode.RIGHT: if (this.active && !this.active.is(".ui-state-disabled")) { this.expand(event); } break; case $.ui.keyCode.ENTER: case $.ui.keyCode.SPACE: this._activate(event); break; case $.ui.keyCode.ESCAPE: this.collapse(event); break; default: preventDefault = false; prev = this.previousFilter || ""; skip = false; // Support number pad values character = event.keyCode >= 96 && event.keyCode <= 105 ? (event.keyCode - 96).toString() : String.fromCharCode(event.keyCode); clearTimeout(this.filterTimer); if (character === prev) { skip = true; } else { character = prev + character; } match = this._filterMenuItems(character); match = skip && match.index(this.active.next()) !== -1 ? this.active.nextAll(".ui-menu-item") : match; // If no matches on the current filter, reset to the last character pressed // to move down the menu to the first item that starts with that character if (!match.length) { character = String.fromCharCode(event.keyCode); match = this._filterMenuItems(character); } if (match.length) { this.focus(event, match); this.previousFilter = character; this.filterTimer = this._delay(function () { delete this.previousFilter; }, 1000); } else { delete this.previousFilter; } } if (preventDefault) { event.preventDefault(); } }, _activate: function (event) { if (this.active && !this.active.is(".ui-state-disabled")) { if (this.active.children("[aria-haspopup='true']").length) { this.expand(event); } else { this.select(event); } } }, refresh: function () { var menus, items, newSubmenus, newItems, newWrappers, that = this, icon = this.options.icons.submenu, submenus = this.element.find(this.options.menus); this._toggleClass("ui-menu-icons", null, !!this.element.find(".ui-icon").length); // Initialize nested menus newSubmenus = submenus.filter(":not(.ui-menu)") .hide() .attr({ role: this.options.role, "aria-hidden": "true", "aria-expanded": "false" }) .each(function () { var menu = $(this), item = menu.prev(), submenuCaret = $("").data("ui-menu-submenu-caret", true); that._addClass(submenuCaret, "ui-menu-icon", "ui-icon " + icon); item .attr("aria-haspopup", "true") .prepend(submenuCaret); menu.attr("aria-labelledby", item.attr("id")); }); this._addClass(newSubmenus, "ui-menu", "ui-widget ui-widget-content ui-front"); menus = submenus.add(this.element); items = menus.find(this.options.items); // Initialize menu-items containing spaces and/or dashes only as dividers items.not(".ui-menu-item").each(function () { var item = $(this); if (that._isDivider(item)) { that._addClass(item, "ui-menu-divider", "ui-widget-content"); } }); // Don't refresh list items that are already adapted newItems = items.not(".ui-menu-item, .ui-menu-divider"); newWrappers = newItems.children() .not(".ui-menu") .uniqueId() .attr({ tabIndex: -1, role: this._itemRole() }); this._addClass(newItems, "ui-menu-item") ._addClass(newWrappers, "ui-menu-item-wrapper"); // Add aria-disabled attribute to any disabled menu item items.filter(".ui-state-disabled").attr("aria-disabled", "true"); // If the active item has been removed, blur the menu if (this.active && !$.contains(this.element[0], this.active[0])) { this.blur(); } }, _itemRole: function () { return { menu: "menuitem", listbox: "option" } [this.options.role]; }, _setOption: function (key, value) { if (key === "icons") { var icons = this.element.find(".ui-menu-icon"); this._removeClass(icons, null, this.options.icons.submenu) ._addClass(icons, null, value.submenu); } this._super(key, value); }, _setOptionDisabled: function (value) { this._super(value); this.element.attr("aria-disabled", String(value)); this._toggleClass(null, "ui-state-disabled", !!value); }, focus: function (event, item) { var nested, focused, activeParent; this.blur(event, event && event.type === "focus"); this._scrollIntoView(item); this.active = item.first(); focused = this.active.children(".ui-menu-item-wrapper"); this._addClass(focused, null, "ui-state-active"); // Only update aria-activedescendant if there's a role // otherwise we assume focus is managed elsewhere if (this.options.role) { this.element.attr("aria-activedescendant", focused.attr("id")); } // Highlight active parent menu item, if any activeParent = this.active .parent() .closest(".ui-menu-item") .children(".ui-menu-item-wrapper"); this._addClass(activeParent, null, "ui-state-active"); if (event && event.type === "keydown") { this._close(); } else { this.timer = this._delay(function () { this._close(); }, this.delay); } nested = item.children(".ui-menu"); if (nested.length && event && (/^mouse/.test(event.type))) { this._startOpening(nested); } this.activeMenu = item.parent(); this._trigger("focus", event, { item: item }); }, _scrollIntoView: function (item) { var borderTop, paddingTop, offset, scroll, elementHeight, itemHeight; if (this._hasScroll()) { borderTop = parseFloat($.css(this.activeMenu[0], "borderTopWidth")) || 0; paddingTop = parseFloat($.css(this.activeMenu[0], "paddingTop")) || 0; offset = item.offset().top - this.activeMenu.offset().top - borderTop - paddingTop; scroll = this.activeMenu.scrollTop(); elementHeight = this.activeMenu.height(); itemHeight = item.outerHeight(); if (offset < 0) { this.activeMenu.scrollTop(scroll + offset); } else if (offset + itemHeight > elementHeight) { this.activeMenu.scrollTop(scroll + offset - elementHeight + itemHeight); } } }, blur: function (event, fromFocus) { if (!fromFocus) { clearTimeout(this.timer); } if (!this.active) { return; } this._removeClass(this.active.children(".ui-menu-item-wrapper"), null, "ui-state-active"); this._trigger("blur", event, { item: this.active }); this.active = null; }, _startOpening: function (submenu) { clearTimeout(this.timer); // Don't open if already open fixes a Firefox bug that caused a .5 pixel // shift in the submenu position when mousing over the caret icon if (submenu.attr("aria-hidden") !== "true") { return; } this.timer = this._delay(function () { this._close(); this._open(submenu); }, this.delay); }, _open: function (submenu) { var position = $.extend({ of: this.active }, this.options.position); clearTimeout(this.timer); this.element.find(".ui-menu").not(submenu.parents(".ui-menu")) .hide() .attr("aria-hidden", "true"); submenu .show() .removeAttr("aria-hidden") .attr("aria-expanded", "true") .position(position); }, collapseAll: function (event, all) { clearTimeout(this.timer); this.timer = this._delay(function () { // If we were passed an event, look for the submenu that contains the event var currentMenu = all ? this.element : $(event && event.target).closest(this.element.find(".ui-menu")); // If we found no valid submenu ancestor, use the main menu to close all // sub menus anyway if (!currentMenu.length) { currentMenu = this.element; } this._close(currentMenu); this.blur(event); // Work around active item staying active after menu is blurred this._removeClass(currentMenu.find(".ui-state-active"), null, "ui-state-active"); this.activeMenu = currentMenu; }, this.delay); }, // With no arguments, closes the currently active menu - if nothing is active // it closes all menus. If passed an argument, it will search for menus BELOW _close: function (startMenu) { if (!startMenu) { startMenu = this.active ? this.active.parent() : this.element; } startMenu.find(".ui-menu") .hide() .attr("aria-hidden", "true") .attr("aria-expanded", "false"); }, _closeOnDocumentClick: function (event) { return !$(event.target).closest(".ui-menu").length; }, _isDivider: function (item) { // Match hyphen, em dash, en dash return !/[^\-\u2014\u2013\s]/.test(item.text()); }, collapse: function (event) { var newItem = this.active && this.active.parent().closest(".ui-menu-item", this.element); if (newItem && newItem.length) { this._close(); this.focus(event, newItem); } }, expand: function (event) { var newItem = this.active && this.active .children(".ui-menu ") .find(this.options.items) .first(); if (newItem && newItem.length) { this._open(newItem.parent()); // Delay so Firefox will not hide activedescendant change in expanding submenu from AT this._delay(function () { this.focus(event, newItem); }); } }, next: function (event) { this._move("next", "first", event); }, previous: function (event) { this._move("prev", "last", event); }, isFirstItem: function () { return this.active && !this.active.prevAll(".ui-menu-item").length; }, isLastItem: function () { return this.active && !this.active.nextAll(".ui-menu-item").length; }, _move: function (direction, filter, event) { var next; if (this.active) { if (direction === "first" || direction === "last") { next = this.active[direction === "first" ? "prevAll" : "nextAll"]( ".ui-menu-item") .eq(-1); } else { next = this.active[direction + "All"](".ui-menu-item") .eq(0); } } if (!next || !next.length || !this.active) { next = this.activeMenu.find(this.options.items)[filter](); } this.focus(event, next); }, nextPage: function (event) { var item, base, height; if (!this.active) { this.next(event); return; } if (this.isLastItem()) { return; } if (this._hasScroll()) { base = this.active.offset().top; height = this.element.height(); this.active.nextAll(".ui-menu-item").each(function () { item = $(this); return item.offset().top - base - height < 0; }); this.focus(event, item); } else { this.focus(event, this.activeMenu.find(this.options.items)[!this.active ? "first" : "last"]()); } }, previousPage: function (event) { var item, base, height; if (!this.active) { this.next(event); return; } if (this.isFirstItem()) { return; } if (this._hasScroll()) { base = this.active.offset().top; height = this.element.height(); this.active.prevAll(".ui-menu-item").each(function () { item = $(this); return item.offset().top - base + height > 0; }); this.focus(event, item); } else { this.focus(event, this.activeMenu.find(this.options.items).first()); } }, _hasScroll: function () { return this.element.outerHeight() < this.element.prop("scrollHeight"); }, select: function (event) { // TODO: It should never be possible to not have an active item at this // point, but the tests don't trigger mouseenter before click. this.active = this.active || $(event.target).closest(".ui-menu-item"); var ui = { item: this.active }; if (!this.active.has(".ui-menu").length) { this.collapseAll(event, true); } this._trigger("select", event, ui); }, _filterMenuItems: function (character) { var escapedCharacter = character.replace(/[\-\[\]{}()*+?.,\\\^$|#\s]/g, "\\$&"), regex = new RegExp("^" + escapedCharacter, "i"); return this.activeMenu .find(this.options.items) // Only match on items, not dividers or other content (#10571) .filter(".ui-menu-item") .filter(function () { return regex.test( $.trim($(this).children(".ui-menu-item-wrapper").text())); }); } }); /*! * jQuery UI Autocomplete 1.12.1 * http://jqueryui.com * * Copyright jQuery Foundation and other contributors * Released under the MIT license. * http://jquery.org/license */ //>>label: Autocomplete //>>group: Widgets //>>description: Lists suggested words as the user is typing. //>>docs: http://api.jqueryui.com/autocomplete/ //>>demos: http://jqueryui.com/autocomplete/ //>>css.structure: ../../themes/base/core.css //>>css.structure: ../../themes/base/autocomplete.css //>>css.theme: ../../themes/base/theme.css $.widget("ui.autocomplete", { version: "1.12.1", defaultElement: "<input>", options: { appendTo: null, autoFocus: false, delay: 300, minLength: 1, position: { my: "left top", at: "left bottom", collision: "none" }, source: null, // Callbacks change: null, close: null, focus: null, open: null, response: null, search: null, select: null }, requestIndex: 0, pending: 0, _create: function () { // Some browsers only repeat keydown events, not keypress events, // so we use the suppressKeyPress flag to determine if we've already // handled the keydown event. #7269 // Unfortunately the code for & in keypress is the same as the up arrow, // so we use the suppressKeyPressRepeat flag to avoid handling keypress // events when we know the keydown event was used to modify the // search term. #7799 var suppressKeyPress, suppressKeyPressRepeat, suppressInput, nodeName = this.element[0].nodeName.toLowerCase(), isTextarea = nodeName === "textarea", isInput = nodeName === "input"; // Textareas are always multi-line // Inputs are always single-line, even if inside a contentEditable element // IE also treats inputs as contentEditable // All other element types are determined by whether or not they're contentEditable this.isMultiLine = isTextarea || !isInput && this._isContentEditable(this.element); this.valueMethod = this.element[isTextarea || isInput ? "val" : "text"]; this.isNewMenu = true; this._addClass("ui-autocomplete-input"); this.element.attr("autocomplete", "off"); this._on(this.element, { keydown: function (event) { if (this.element.prop("readOnly")) { suppressKeyPress = true; suppressInput = true; suppressKeyPressRepeat = true; return; } suppressKeyPress = false; suppressInput = false; suppressKeyPressRepeat = false; var keyCode = $.ui.keyCode; switch (event.keyCode) { case keyCode.PAGE_UP: suppressKeyPress = true; this._move("previousPage", event); break; case keyCode.PAGE_DOWN: suppressKeyPress = true; this._move("nextPage", event); break; case keyCode.UP: suppressKeyPress = true; this._keyEvent("previous", event); break; case keyCode.DOWN: suppressKeyPress = true; this._keyEvent("next", event); break; case keyCode.ENTER: // when menu is open and has focus if (this.menu.active) { // #6055 - Opera still allows the keypress to occur // which causes forms to submit suppressKeyPress = true; event.preventDefault(); this.menu.select(event); } break; case keyCode.TAB: if (this.menu.active) { this.menu.select(event); } break; case keyCode.ESCAPE: if (this.menu.element.is(":visible")) { if (!this.isMultiLine) { this._value(this.term); } this.close(event); // Different browsers have different default behavior for escape // Single press can mean undo or clear // Double press in IE means clear the whole form event.preventDefault(); } break; default: suppressKeyPressRepeat = true; // search timeout should be triggered before the input value is changed this._searchTimeout(event); break; } }, keypress: function (event) { if (suppressKeyPress) { suppressKeyPress = false; if (!this.isMultiLine || this.menu.element.is(":visible")) { event.preventDefault(); } return; } if (suppressKeyPressRepeat) { return; } // Replicate some key handlers to allow them to repeat in Firefox and Opera var keyCode = $.ui.keyCode; switch (event.keyCode) { case keyCode.PAGE_UP: this._move("previousPage", event); break; case keyCode.PAGE_DOWN: this._move("nextPage", event); break; case keyCode.UP: this._keyEvent("previous", event); break; case keyCode.DOWN: this._keyEvent("next", event); break; } }, input: function (event) { if (suppressInput) { suppressInput = false; event.preventDefault(); return; } this._searchTimeout(event); }, focus: function () { this.selectedItem = null; this.previous = this._value(); }, blur: function (event) { if (this.cancelBlur) { delete this.cancelBlur; return; } clearTimeout(this.searching); this.close(event); this._change(event); } }); this._initSource(); this.menu = $("
      ") .appendTo(this._appendTo()) .menu({ // disable ARIA support, the live region takes care of that role: null }) .hide() .menu("instance"); this._addClass(this.menu.element, "ui-autocomplete", "ui-front"); this._on(this.menu.element, { mousedown: function (event) { // prevent moving focus out of the text field event.preventDefault(); // IE doesn't prevent moving focus even with event.preventDefault() // so we set a flag to know when we should ignore the blur event this.cancelBlur = true; this._delay(function () { delete this.cancelBlur; // Support: IE 8 only // Right clicking a menu item or selecting text from the menu items will // result in focus moving out of the input. However, we've already received // and ignored the blur event because of the cancelBlur flag set above. So // we restore focus to ensure that the menu closes properly based on the user's // next actions. if (this.element[0] !== $.ui.safeActiveElement(this .document[0])) { this.element.trigger("focus"); } }); }, menufocus: function (event, ui) { var label, item; // support: Firefox // Prevent accidental activation of menu items in Firefox (#7024 #9118) if (this.isNewMenu) { this.isNewMenu = false; if (event.originalEvent && /^mouse/.test(event.originalEvent .type)) { this.menu.blur(); this.document.one("mousemove", function () { $(event.target).trigger(event .originalEvent); }); return; } } item = ui.item.data("ui-autocomplete-item"); if (false !== this._trigger("focus", event, { item: item })) { // use value to match what will end up in the input, if it was a key event if (event.originalEvent && /^key/.test(event.originalEvent .type)) { this._value(item.value); } } // Announce the value in the liveRegion label = ui.item.attr("aria-label") || item.value; if (label && $.trim(label).length) { this.liveRegion.children().hide(); $("
      ").text(label).appendTo(this.liveRegion);
                             }
                         },
                         menuselect: function (event, ui) {
                             var item = ui.item.data("ui-autocomplete-item"),
                                 previous = this.previous;
      
                             // Only trigger when focus was lost (click on menu)
                             if (this.element[0] !== $.ui.safeActiveElement(this.document[
                                     0])) {
                                 this.element.trigger("focus");
                                 this.previous = previous;
      
                                 // #6109 - IE triggers two focus events and the second
                                 // is asynchronous, so we need to reset the previous
                                 // term synchronously and asynchronously :-(
                                 this._delay(function () {
                                     this.previous = previous;
                                     this.selectedItem = item;
                                 });
                             }
      
                             if (false !== this._trigger("select", event, {
                                     item: item
                                 })) {
                                 this._value(item.value);
                             }
      
                             // reset the term after the select event
                             // this allows custom select handling to work properly
                             this.term = this._value();
      
                             this.close(event);
                             this.selectedItem = item;
                         }
                     });
      
      this.liveRegion = $("
      ", {
                             role: "status",
                             "aria-live": "assertive",
                             "aria-relevant": "additions"
                         })
                         .appendTo(this.document[0].body);
      
                     this._addClass(this.liveRegion, null, "ui-helper-hidden-accessible");
      
                     // Turning off autocomplete prevents the browser from remembering the
                     // value when navigating through history, so we re-enable autocomplete
                     // if the page is unloaded before the widget is destroyed. #7790
                     this._on(this.window, {
                         beforeunload: function () {
                             this.element.removeAttr("autocomplete");
                         }
                     });
                 },
      
                 _destroy: function () {
                     clearTimeout(this.searching);
                     this.element.removeAttr("autocomplete");
                     this.menu.element.remove();
                     this.liveRegion.remove();
                 },
      
                 _setOption: function (key, value) {
                     this._super(key, value);
                     if (key === "source") {
                         this._initSource();
                     }
                     if (key === "appendTo") {
                         this.menu.element.appendTo(this._appendTo());
                     }
                     if (key === "disabled" && value && this.xhr) {
                         this.xhr.abort();
                     }
                 },
      
                 _isEventTargetInWidget: function (event) {
                     var menuElement = this.menu.element[0];
      
                     return event.target === this.element[0] ||
                         event.target === menuElement ||
                         $.contains(menuElement, event.target);
                 },
      
                 _closeOnClickOutside: function (event) {
                     if (!this._isEventTargetInWidget(event)) {
                         this.close();
                     }
                 },
      
                 _appendTo: function () {
                     var element = this.options.appendTo;
      
                     if (element) {
                         element = element.jquery || element.nodeType ?
                             $(element) :
                             this.document.find(element).eq(0);
                     }
      
                     if (!element || !element[0]) {
                         element = this.element.closest(".ui-front, dialog");
                     }
      
                     if (!element.length) {
                         element = this.document[0].body;
                     }
      
                     return element;
                 },
      
                 _initSource: function () {
                     var array, url,
                         that = this;
                     if ($.isArray(this.options.source)) {
                         array = this.options.source;
                         this.source = function (request, response) {
                             response($.ui.autocomplete.filter(array, request.term));
                         };
                     } else if (typeof this.options.source === "string") {
                         url = this.options.source;
                         this.source = function (request, response) {
                             if (that.xhr) {
                                 that.xhr.abort();
                             }
                             that.xhr = $.ajax({
                                 url: url,
                                 data: request,
                                 dataType: "json",
                                 success: function (data) {
                                     response(data);
                                 },
                                 error: function () {
                                     response([]);
                                 }
                             });
                         };
                     } else {
                         this.source = this.options.source;
                     }
                 },
      
                 _searchTimeout: function (event) {
                     clearTimeout(this.searching);
                     this.searching = this._delay(function () {
      
                         // Search if the value has changed, or if the user retypes the same value (see #7434)
                         var equalValues = this.term === this._value(),
                             menuVisible = this.menu.element.is(":visible"),
                             modifierKey = event.altKey || event.ctrlKey || event.metaKey ||
                             event.shiftKey;
      
                         if (!equalValues || (equalValues && !menuVisible && !modifierKey)) {
                             this.selectedItem = null;
                             this.search(null, event);
                         }
                     }, this.options.delay);
                 },
      
                 search: function (value, event) {
                     value = value != null ? value : this._value();
      
                     // Always save the actual value, not the one passed as an argument
                     this.term = this._value();
      
                     if (value.length < this.options.minLength) {
                         return this.close(event);
                     }
      
                     if (this._trigger("search", event) === false) {
                         return;
                     }
      
                     return this._search(value);
                 },
      
                 _search: function (value) {
                     this.pending++;
                     this._addClass("ui-autocomplete-loading");
                     this.cancelSearch = false;
      
                     this.source({
                         term: value
                     }, this._response());
                 },
      
                 _response: function () {
                     var index = ++this.requestIndex;
      
                     return $.proxy(function (content) {
                         if (index === this.requestIndex) {
                             this.__response(content);
                         }
      
                         this.pending--;
                         if (!this.pending) {
                             this._removeClass("ui-autocomplete-loading");
                         }
                     }, this);
                 },
      
                 __response: function (content) {
                     if (content) {
                         content = this._normalize(content);
                     }
                     this._trigger("response", null, {
                         content: content
                     });
                     if (!this.options.disabled && content && content.length && !this.cancelSearch) {
                         this._suggest(content);
                         this._trigger("open");
                     } else {
      
                         // use ._close() instead of .close() so we don't cancel future searches
                         this._close();
                     }
                 },
      
                 close: function (event) {
                     this.cancelSearch = true;
                     this._close(event);
                 },
      
                 _close: function (event) {
      
                     // Remove the handler that closes the menu on outside clicks
                     this._off(this.document, "mousedown");
      
                     if (this.menu.element.is(":visible")) {
                         this.menu.element.hide();
                         this.menu.blur();
                         this.isNewMenu = true;
                         this._trigger("close", event);
                     }
                 },
      
                 _change: function (event) {
                     if (this.previous !== this._value()) {
                         this._trigger("change", event, {
                             item: this.selectedItem
                         });
                     }
                 },
      
                 _normalize: function (items) {
      
                     // assume all items have the right format when the first item is complete
                     if (items.length && items[0].label && items[0].value) {
                         return items;
                     }
                     return $.map(items, function (item) {
                         if (typeof item === "string") {
                             return {
                                 label: item,
                                 value: item
                             };
                         }
                         return $.extend({}, item, {
                             label: item.label || item.value,
                             value: item.value || item.label
                         });
                     });
                 },
      
                 _suggest: function (items) {
                     var ul = this.menu.element.empty();
                     this._renderMenu(ul, items);
                     this.isNewMenu = true;
                     this.menu.refresh();
      
                     // Size and position menu
                     ul.show();
                     this._resizeMenu();
                     ul.position($.extend({
                         of: this.element
                     }, this.options.position));
      
                     if (this.options.autoFocus) {
                         this.menu.next();
                     }
      
                     // Listen for interactions outside of the widget (#6642)
                     this._on(this.document, {
                         mousedown: "_closeOnClickOutside"
                     });
                 },
      
                 _resizeMenu: function () {
                     var ul = this.menu.element;
                     ul.outerWidth(Math.max(
      
                         // Firefox wraps long text (possibly a rounding bug)
                         // so we add 1px to avoid the wrapping (#7513)
                         ul.width("").outerWidth() + 1,
                         this.element.outerWidth()
                     ));
                 },
      
                 _renderMenu: function (ul, items) {
                     var that = this;
                     $.each(items, function (index, item) {
                         that._renderItemData(ul, item);
                     });
                 },
      
                 _renderItemData: function (ul, item) {
                     return this._renderItem(ul, item).data("ui-autocomplete-item", item);
                 },
      
                 _renderItem: function (ul, item) {
      
      return $("
    • ") .append($("
      ").text(item.label))
                         .appendTo(ul);
                 },
      
                 _move: function (direction, event) {
                     if (!this.menu.element.is(":visible")) {
                         this.search(null, event);
                         return;
                     }
                     if (this.menu.isFirstItem() && /^previous/.test(direction) ||
                         this.menu.isLastItem() && /^next/.test(direction)) {
      
                         if (!this.isMultiLine) {
                             this._value(this.term);
                         }
      
                         this.menu.blur();
                         return;
                     }
                     this.menu[direction](event);
                 },
      
                 widget: function () {
                     return this.menu.element;
                 },
      
                 _value: function () {
                     return this.valueMethod.apply(this.element, arguments);
                 },
      
                 _keyEvent: function (keyEvent, event) {
                     if (!this.isMultiLine || this.menu.element.is(":visible")) {
                         this._move(keyEvent, event);
      
                         // Prevents moving cursor to beginning/end of the text field in some browsers
                         event.preventDefault();
                     }
                 },
      
                 // Support: Chrome <=50
                 // We should be able to just use this.element.prop( "isContentEditable" )
                 // but hidden elements always report false in Chrome.
                 // https://code.google.com/p/chromium/issues/detail?id=313082
                 _isContentEditable: function (element) {
                     if (!element.length) {
                         return false;
                     }
      
                     var editable = element.prop("contentEditable");
      
                     if (editable === "inherit") {
                         return this._isContentEditable(element.parent());
                     }
      
                     return editable === "true";
                 }
             });
      
             $.extend($.ui.autocomplete, {
                 escapeRegex: function (value) {
                     return value.replace(/[\-\[\]{}()*+?.,\\\^$|#\s]/g, "\\$&");
                 },
                 filter: function (array, term) {
                     var matcher = new RegExp($.ui.autocomplete.escapeRegex(term), "i");
                     return $.grep(array, function (value) {
                         return matcher.test(value.label || value.value || value);
                     });
                 }
             });
      
             // Live region extension, adding a `messages` option
             // NOTE: This is an experimental API. We are still investigating
             // a full solution for string manipulation and internationalization.
             $.widget("ui.autocomplete", $.ui.autocomplete, {
                 options: {
                     messages: {
                         noResults: "No search results.",
                         results: function (amount) {
                             return amount + (amount > 1 ? " results are" : " result is") +
                                 " available, use up and down arrow keys to navigate.";
                         }
                     }
                 },
      
                 __response: function (content) {
                     var message;
                     this._superApply(arguments);
                     if (this.options.disabled || this.cancelSearch) {
                         return;
                     }
                     if (content && content.length) {
                         message = this.options.messages.results(content.length);
                     } else {
                         message = this.options.messages.noResults;
                     }
                     this.liveRegion.children().hide();
      
      $("
      ").text(message).appendTo(this.liveRegion);
                 }
             });
      
             var widgetsAutocomplete = $.ui.autocomplete;
      


             /*!
              * jQuery UI Controlgroup 1.12.1
              * http://jqueryui.com
              *
              * Copyright jQuery Foundation and other contributors
              * Released under the MIT license.
              * http://jquery.org/license
              */
      
             //>>label: Controlgroup
             //>>group: Widgets
             //>>description: Visually groups form control widgets
             //>>docs: http://api.jqueryui.com/controlgroup/
             //>>demos: http://jqueryui.com/controlgroup/
             //>>css.structure: ../../themes/base/core.css
             //>>css.structure: ../../themes/base/controlgroup.css
             //>>css.theme: ../../themes/base/theme.css
      


             var controlgroupCornerRegex = /ui-corner-([a-z]){2,6}/g;
      
             var widgetsControlgroup = $.widget("ui.controlgroup", {
                 version: "1.12.1",
      
      defaultElement: "
      ",
                 options: {
                     direction: "horizontal",
                     disabled: null,
                     onlyVisible: true,
                     items: {
                         "button": "input[type=button], input[type=submit], input[type=reset], button, a",
                         "controlgroupLabel": ".ui-controlgroup-label",
                         "checkboxradio": "input[type='checkbox'], input[type='radio']",
                         "selectmenu": "select",
                         "spinner": ".ui-spinner-input"
                     }
                 },
      
                 _create: function () {
                     this._enhance();
                 },
      
                 // To support the enhanced option in jQuery Mobile, we isolate DOM manipulation
                 _enhance: function () {
                     this.element.attr("role", "toolbar");
                     this.refresh();
                 },
      
                 _destroy: function () {
                     this._callChildMethod("destroy");
                     this.childWidgets.removeData("ui-controlgroup-data");
                     this.element.removeAttr("role");
                     if (this.options.items.controlgroupLabel) {
                         this.element
                             .find(this.options.items.controlgroupLabel)
                             .find(".ui-controlgroup-label-contents")
                             .contents().unwrap();
                     }
                 },
      
                 _initWidgets: function () {
                     var that = this,
                         childWidgets = [];
      
                     // First we iterate over each of the items options
                     $.each(this.options.items, function (widget, selector) {
                         var labels;
                         var options = {};
      
                         // Make sure the widget has a selector set
                         if (!selector) {
                             return;
                         }
      
                         if (widget === "controlgroupLabel") {
                             labels = that.element.find(selector);
                             labels.each(function () {
                                 var element = $(this);
      
                                 if (element.children(".ui-controlgroup-label-contents")
                                     .length) {
                                     return;
                                 }
                                 element.contents()
                                     .wrapAll(
                                         ""
                                     );
                             });
                             that._addClass(labels, null,
                                 "ui-widget ui-widget-content ui-state-default");
                             childWidgets = childWidgets.concat(labels.get());
                             return;
                         }
      
                         // Make sure the widget actually exists
                         if (!$.fn[widget]) {
                             return;
                         }
      
                         // We assume everything is in the middle to start because we can't determine
                         // first / last elements until all enhancments are done.
                         if (that["_" + widget + "Options"]) {
                             options = that["_" + widget + "Options"]("middle");
                         } else {
                             options = {
                                 classes: {}
                             };
                         }
      
                         // Find instances of this widget inside controlgroup and init them
                         that.element
                             .find(selector)
                             .each(function () {
                                 var element = $(this);
                                 var instance = element[widget]("instance");
      
                                 // We need to clone the default options for this type of widget to avoid
                                 // polluting the variable options which has a wider scope than a single widget.
                                 var instanceOptions = $.widget.extend({}, options);
      
                                 // If the button is the child of a spinner ignore it
                                 // TODO: Find a more generic solution
                                 if (widget === "button" && element.parent(".ui-spinner")
                                     .length) {
                                     return;
                                 }
      
                                 // Create the widget if it doesn't exist
                                 if (!instance) {
                                     instance = element[widget]()[widget]("instance");
                                 }
                                 if (instance) {
                                     instanceOptions.classes =
                                         that._resolveClassesValues(instanceOptions.classes,
                                             instance);
                                 }
                                 element[widget](instanceOptions);
      
                                 // Store an instance of the controlgroup to be able to reference
                                 // from the outermost element for changing options and refresh
                                 var widgetElement = element[widget]("widget");
                                 $.data(widgetElement[0], "ui-controlgroup-data",
                                     instance ? instance : element[widget]("instance"));
      
                                 childWidgets.push(widgetElement[0]);
                             });
                     });
      
                     this.childWidgets = $($.unique(childWidgets));
                     this._addClass(this.childWidgets, "ui-controlgroup-item");
                 },
      
                 _callChildMethod: function (method) {
                     this.childWidgets.each(function () {
                         var element = $(this),
                             data = element.data("ui-controlgroup-data");
                         if (data && data[method]) {
                             data[method]();
                         }
                     });
                 },
      
                 _updateCornerClass: function (element, position) {
                     var remove =
                         "ui-corner-top ui-corner-bottom ui-corner-left ui-corner-right ui-corner-all";
                     var add = this._buildSimpleOptions(position, "label").classes.label;
      
                     this._removeClass(element, null, remove);
                     this._addClass(element, null, add);
                 },
      
                 _buildSimpleOptions: function (position, key) {
                     var direction = this.options.direction === "vertical";
                     var result = {
                         classes: {}
                     };
                     result.classes[key] = {
                         "middle": "",
                         "first": "ui-corner-" + (direction ? "top" : "left"),
                         "last": "ui-corner-" + (direction ? "bottom" : "right"),
                         "only": "ui-corner-all"
                     } [position];
      
                     return result;
                 },
      
                 _spinnerOptions: function (position) {
                     var options = this._buildSimpleOptions(position, "ui-spinner");
      
                     options.classes["ui-spinner-up"] = "";
                     options.classes["ui-spinner-down"] = "";
      
                     return options;
                 },
      
                 _buttonOptions: function (position) {
                     return this._buildSimpleOptions(position, "ui-button");
                 },
      
                 _checkboxradioOptions: function (position) {
                     return this._buildSimpleOptions(position, "ui-checkboxradio-label");
                 },
      
                 _selectmenuOptions: function (position) {
                     var direction = this.options.direction === "vertical";
                     return {
                         width: direction ? "auto" : false,
                         classes: {
                             middle: {
                                 "ui-selectmenu-button-open": "",
                                 "ui-selectmenu-button-closed": ""
                             },
                             first: {
                                 "ui-selectmenu-button-open": "ui-corner-" + (direction ? "top" : "tl"),
                                 "ui-selectmenu-button-closed": "ui-corner-" + (direction ? "top" :
                                     "left")
                             },
                             last: {
                                 "ui-selectmenu-button-open": direction ? "" : "ui-corner-tr",
                                 "ui-selectmenu-button-closed": "ui-corner-" + (direction ? "bottom" :
                                     "right")
                             },
                             only: {
                                 "ui-selectmenu-button-open": "ui-corner-top",
                                 "ui-selectmenu-button-closed": "ui-corner-all"
                             }
      
                         } [position]
                     };
                 },
      
                 _resolveClassesValues: function (classes, instance) {
                     var result = {};
                     $.each(classes, function (key) {
                         var current = instance.options.classes[key] || "";
                         current = $.trim(current.replace(controlgroupCornerRegex, ""));
                         result[key] = (current + " " + classes[key]).replace(/\s+/g, " ");
                     });
                     return result;
                 },
      
                 _setOption: function (key, value) {
                     if (key === "direction") {
                         this._removeClass("ui-controlgroup-" + this.options.direction);
                     }
      
                     this._super(key, value);
                     if (key === "disabled") {
                         this._callChildMethod(value ? "disable" : "enable");
                         return;
                     }
      
                     this.refresh();
                 },
      
                 refresh: function () {
                     var children,
                         that = this;
      
                     this._addClass("ui-controlgroup ui-controlgroup-" + this.options.direction);
      
                     if (this.options.direction === "horizontal") {
                         this._addClass(null, "ui-helper-clearfix");
                     }
                     this._initWidgets();
      
                     children = this.childWidgets;
      
                     // We filter here because we need to track all childWidgets not just the visible ones
                     if (this.options.onlyVisible) {
                         children = children.filter(":visible");
                     }
      
                     if (children.length) {
      
                         // We do this last because we need to make sure all enhancment is done
                         // before determining first and last
                         $.each(["first", "last"], function (index, value) {
                             var instance = children[value]().data("ui-controlgroup-data");
      
                             if (instance && that["_" + instance.widgetName + "Options"]) {
                                 var options = that["_" + instance.widgetName + "Options"](
                                     children.length === 1 ? "only" : value
                                 );
                                 options.classes = that._resolveClassesValues(options.classes,
                                     instance);
                                 instance.element[instance.widgetName](options);
                             } else {
                                 that._updateCornerClass(children[value](), value);
                             }
                         });
      
                         // Finally call the refresh method on each of the child widgets.
                         this._callChildMethod("refresh");
                     }
                 }
             });
      
             /*!
              * jQuery UI Checkboxradio 1.12.1
              * http://jqueryui.com
              *
              * Copyright jQuery Foundation and other contributors
              * Released under the MIT license.
              * http://jquery.org/license
              */
      
             //>>label: Checkboxradio
             //>>group: Widgets
             //>>description: Enhances a form with multiple themeable checkboxes or radio buttons.
             //>>docs: http://api.jqueryui.com/checkboxradio/
             //>>demos: http://jqueryui.com/checkboxradio/
             //>>css.structure: ../../themes/base/core.css
             //>>css.structure: ../../themes/base/button.css
             //>>css.structure: ../../themes/base/checkboxradio.css
             //>>css.theme: ../../themes/base/theme.css
      


             $.widget("ui.checkboxradio", [$.ui.formResetMixin, {
                 version: "1.12.1",
                 options: {
                     disabled: null,
                     label: null,
                     icon: true,
                     classes: {
                         "ui-checkboxradio-label": "ui-corner-all",
                         "ui-checkboxradio-icon": "ui-corner-all"
                     }
                 },
      
                 _getCreateOptions: function () {
                     var disabled, labels;
                     var that = this;
                     var options = this._super() || {};
      
                     // We read the type here, because it makes more sense to throw a element type error first,
                     // rather then the error for lack of a label. Often if its the wrong type, it
                     // won't have a label (e.g. calling on a div, btn, etc)
                     this._readType();
      
                     labels = this.element.labels();
      
                     // If there are multiple labels, use the last one
                     this.label = $(labels[labels.length - 1]);
                     if (!this.label.length) {
                         $.error("No label found for checkboxradio widget");
                     }
      
                     this.originalLabel = "";
      
                     // We need to get the label text but this may also need to make sure it does not contain the
                     // input itself.
                     this.label.contents().not(this.element[0]).each(function () {
      
                         // The label contents could be text, html, or a mix. We concat each element to get a
                         // string representation of the label, without the input as part of it.
                         that.originalLabel += this.nodeType === 3 ? $(this).text() : this
                             .outerHTML;
                     });
      
                     // Set the label option if we found label text
                     if (this.originalLabel) {
                         options.label = this.originalLabel;
                     }
      
                     disabled = this.element[0].disabled;
                     if (disabled != null) {
                         options.disabled = disabled;
                     }
                     return options;
                 },
      
                 _create: function () {
                     var checked = this.element[0].checked;
      
                     this._bindFormResetHandler();
      
                     if (this.options.disabled == null) {
                         this.options.disabled = this.element[0].disabled;
                     }
      
                     this._setOption("disabled", this.options.disabled);
                     this._addClass("ui-checkboxradio", "ui-helper-hidden-accessible");
                     this._addClass(this.label, "ui-checkboxradio-label", "ui-button ui-widget");
      
                     if (this.type === "radio") {
                         this._addClass(this.label, "ui-checkboxradio-radio-label");
                     }
      
                     if (this.options.label && this.options.label !== this.originalLabel) {
                         this._updateLabel();
                     } else if (this.originalLabel) {
                         this.options.label = this.originalLabel;
                     }
      
                     this._enhance();
      
                     if (checked) {
                         this._addClass(this.label, "ui-checkboxradio-checked", "ui-state-active");
                         if (this.icon) {
                             this._addClass(this.icon, null, "ui-state-hover");
                         }
                     }
      
                     this._on({
                         change: "_toggleClasses",
                         focus: function () {
                             this._addClass(this.label, null,
                                 "ui-state-focus ui-visual-focus");
                         },
                         blur: function () {
                             this._removeClass(this.label, null,
                                 "ui-state-focus ui-visual-focus");
                         }
                     });
                 },
      
                 _readType: function () {
                     var nodeName = this.element[0].nodeName.toLowerCase();
                     this.type = this.element[0].type;
                     if (nodeName !== "input" || !/radio|checkbox/.test(this.type)) {
                         $.error("Can't create checkboxradio on element.nodeName=" + nodeName +
                             " and element.type=" + this.type);
                     }
                 },
      
                 // Support jQuery Mobile enhanced option
                 _enhance: function () {
                     this._updateIcon(this.element[0].checked);
                 },
      
                 widget: function () {
                     return this.label;
                 },
      
                 _getRadioGroup: function () {
                     var group;
                     var name = this.element[0].name;
                     var nameSelector = "input[name='" + $.ui.escapeSelector(name) + "']";
      
                     if (!name) {
                         return $([]);
                     }
      
                     if (this.form.length) {
                         group = $(this.form[0].elements).filter(nameSelector);
                     } else {
      
                         // Not inside a form, check all inputs that also are not inside a form
                         group = $(nameSelector).filter(function () {
                             return $(this).form().length === 0;
                         });
                     }
      
                     return group.not(this.element);
                 },
      
                 _toggleClasses: function () {
                     var checked = this.element[0].checked;
                     this._toggleClass(this.label, "ui-checkboxradio-checked", "ui-state-active",
                         checked);
      
                     if (this.options.icon && this.type === "checkbox") {
                         this._toggleClass(this.icon, null, "ui-icon-check ui-state-checked",
                                 checked)
                             ._toggleClass(this.icon, null, "ui-icon-blank", !checked);
                     }
      
                     if (this.type === "radio") {
                         this._getRadioGroup()
                             .each(function () {
                                 var instance = $(this).checkboxradio("instance");
      
                                 if (instance) {
                                     instance._removeClass(instance.label,
                                         "ui-checkboxradio-checked", "ui-state-active");
                                 }
                             });
                     }
                 },
      
                 _destroy: function () {
                     this._unbindFormResetHandler();
      
                     if (this.icon) {
                         this.icon.remove();
                         this.iconSpace.remove();
                     }
                 },
      
                 _setOption: function (key, value) {
      
                     // We don't allow the value to be set to nothing
                     if (key === "label" && !value) {
                         return;
                     }
      
                     this._super(key, value);
      
                     if (key === "disabled") {
                         this._toggleClass(this.label, null, "ui-state-disabled", value);
                         this.element[0].disabled = value;
      
                         // Don't refresh when setting disabled
                         return;
                     }
                     this.refresh();
                 },
      
                 _updateIcon: function (checked) {
                     var toAdd = "ui-icon ui-icon-background ";
      
                     if (this.options.icon) {
                         if (!this.icon) {
                             this.icon = $("");
                             this.iconSpace = $(" ");
                             this._addClass(this.iconSpace, "ui-checkboxradio-icon-space");
                         }
      
                         if (this.type === "checkbox") {
                             toAdd += checked ? "ui-icon-check ui-state-checked" : "ui-icon-blank";
                             this._removeClass(this.icon, null, checked ? "ui-icon-blank" :
                                 "ui-icon-check");
                         } else {
                             toAdd += "ui-icon-blank";
                         }
                         this._addClass(this.icon, "ui-checkboxradio-icon", toAdd);
                         if (!checked) {
                             this._removeClass(this.icon, null, "ui-icon-check ui-state-checked");
                         }
                         this.icon.prependTo(this.label).after(this.iconSpace);
                     } else if (this.icon !== undefined) {
                         this.icon.remove();
                         this.iconSpace.remove();
                         delete this.icon;
                     }
                 },
      
                 _updateLabel: function () {
      
                     // Remove the contents of the label ( minus the icon, icon space, and input )
                     var contents = this.label.contents().not(this.element[0]);
                     if (this.icon) {
                         contents = contents.not(this.icon[0]);
                     }
                     if (this.iconSpace) {
                         contents = contents.not(this.iconSpace[0]);
                     }
                     contents.remove();
      
                     this.label.append(this.options.label);
                 },
      
                 refresh: function () {
                     var checked = this.element[0].checked,
                         isDisabled = this.element[0].disabled;
      
                     this._updateIcon(checked);
                     this._toggleClass(this.label, "ui-checkboxradio-checked", "ui-state-active",
                         checked);
                     if (this.options.label !== null) {
                         this._updateLabel();
                     }
      
                     if (isDisabled !== this.options.disabled) {
                         this._setOptions({
                             "disabled": isDisabled
                         });
                     }
                 }
      
             }]);
      
             var widgetsCheckboxradio = $.ui.checkboxradio;
      


             /*!
              * jQuery UI Button 1.12.1
              * http://jqueryui.com
              *
              * Copyright jQuery Foundation and other contributors
              * Released under the MIT license.
              * http://jquery.org/license
              */
      
             //>>label: Button
             //>>group: Widgets
             //>>description: Enhances a form with themeable buttons.
             //>>docs: http://api.jqueryui.com/button/
             //>>demos: http://jqueryui.com/button/
             //>>css.structure: ../../themes/base/core.css
             //>>css.structure: ../../themes/base/button.css
             //>>css.theme: ../../themes/base/theme.css
      


             $.widget("ui.button", {
                 version: "1.12.1",
                 defaultElement: "<button>",
                 options: {
                     classes: {
                         "ui-button": "ui-corner-all"
                     },
                     disabled: null,
                     icon: null,
                     iconPosition: "beginning",
                     label: null,
                     showLabel: true
                 },
      
                 _getCreateOptions: function () {
                     var disabled,
      
                         // This is to support cases like in jQuery Mobile where the base widget does have
                         // an implementation of _getCreateOptions
                         options = this._super() || {};
      
                     this.isInput = this.element.is("input");
      
                     disabled = this.element[0].disabled;
                     if (disabled != null) {
                         options.disabled = disabled;
                     }
      
                     this.originalLabel = this.isInput ? this.element.val() : this.element.html();
                     if (this.originalLabel) {
                         options.label = this.originalLabel;
                     }
      
                     return options;
                 },
      
                 _create: function () {
                     if (!this.option.showLabel & !this.options.icon) {
                         this.options.showLabel = true;
                     }
      
                     // We have to check the option again here even though we did in _getCreateOptions,
                     // because null may have been passed on init which would override what was set in
                     // _getCreateOptions
                     if (this.options.disabled == null) {
                         this.options.disabled = this.element[0].disabled || false;
                     }
      
                     this.hasTitle = !!this.element.attr("title");
      
                     // Check to see if the label needs to be set or if its already correct
                     if (this.options.label && this.options.label !== this.originalLabel) {
                         if (this.isInput) {
                             this.element.val(this.options.label);
                         } else {
                             this.element.html(this.options.label);
                         }
                     }
                     this._addClass("ui-button", "ui-widget");
                     this._setOption("disabled", this.options.disabled);
                     this._enhance();
      
                     if (this.element.is("a")) {
                         this._on({
                             "keyup": function (event) {
                                 if (event.keyCode === $.ui.keyCode.SPACE) {
                                     event.preventDefault();
      
                                     // Support: PhantomJS <= 1.9, IE 8 Only
                                     // If a native click is available use it so we actually cause navigation
                                     // otherwise just trigger a click event
                                     if (this.element[0].click) {
                                         this.element[0].click();
                                     } else {
                                         this.element.trigger("click");
                                     }
                                 }
                             }
                         });
                     }
                 },
      
                 _enhance: function () {
                     if (!this.element.is("button")) {
                         this.element.attr("role", "button");
                     }
      
                     if (this.options.icon) {
                         this._updateIcon("icon", this.options.icon);
                         this._updateTooltip();
                     }
                 },
      
                 _updateTooltip: function () {
                     this.title = this.element.attr("title");
      
                     if (!this.options.showLabel && !this.title) {
                         this.element.attr("title", this.options.label);
                     }
                 },
      
                 _updateIcon: function (option, value) {
                     var icon = option !== "iconPosition",
                         position = icon ? this.options.iconPosition : value,
                         displayBlock = position === "top" || position === "bottom";
      
                     // Create icon
                     if (!this.icon) {
                         this.icon = $("");
      
                         this._addClass(this.icon, "ui-button-icon", "ui-icon");
      
                         if (!this.options.showLabel) {
                             this._addClass("ui-button-icon-only");
                         }
                     } else if (icon) {
      
                         // If we are updating the icon remove the old icon class
                         this._removeClass(this.icon, null, this.options.icon);
                     }
      
                     // If we are updating the icon add the new icon class
                     if (icon) {
                         this._addClass(this.icon, null, value);
                     }
      
                     this._attachIcon(position);
      
                     // If the icon is on top or bottom we need to add the ui-widget-icon-block class and remove
                     // the iconSpace if there is one.
                     if (displayBlock) {
                         this._addClass(this.icon, null, "ui-widget-icon-block");
                         if (this.iconSpace) {
                             this.iconSpace.remove();
                         }
                     } else {
      
                         // Position is beginning or end so remove the ui-widget-icon-block class and add the
                         // space if it does not exist
                         if (!this.iconSpace) {
                             this.iconSpace = $(" ");
                             this._addClass(this.iconSpace, "ui-button-icon-space");
                         }
                         this._removeClass(this.icon, null, "ui-wiget-icon-block");
                         this._attachIconSpace(position);
                     }
                 },
      
                 _destroy: function () {
                     this.element.removeAttr("role");
      
                     if (this.icon) {
                         this.icon.remove();
                     }
                     if (this.iconSpace) {
                         this.iconSpace.remove();
                     }
                     if (!this.hasTitle) {
                         this.element.removeAttr("title");
                     }
                 },
      
                 _attachIconSpace: function (iconPosition) {
                     this.icon[/^(?:end|bottom)/.test(iconPosition) ? "before" : "after"](this
                         .iconSpace);
                 },
      
                 _attachIcon: function (iconPosition) {
                     this.element[/^(?:end|bottom)/.test(iconPosition) ? "append" : "prepend"](this
                         .icon);
                 },
      
                 _setOptions: function (options) {
                     var newShowLabel = options.showLabel === undefined ?
                         this.options.showLabel :
                         options.showLabel,
                         newIcon = options.icon === undefined ? this.options.icon : options.icon;
      
                     if (!newShowLabel && !newIcon) {
                         options.showLabel = true;
                     }
                     this._super(options);
                 },
      
                 _setOption: function (key, value) {
                     if (key === "icon") {
                         if (value) {
                             this._updateIcon(key, value);
                         } else if (this.icon) {
                             this.icon.remove();
                             if (this.iconSpace) {
                                 this.iconSpace.remove();
                             }
                         }
                     }
      
                     if (key === "iconPosition") {
                         this._updateIcon(key, value);
                     }
      
                     // Make sure we can't end up with a button that has neither text nor icon
                     if (key === "showLabel") {
                         this._toggleClass("ui-button-icon-only", null, !value);
                         this._updateTooltip();
                     }
      
                     if (key === "label") {
                         if (this.isInput) {
                             this.element.val(value);
                         } else {
      
                             // If there is an icon, append it, else nothing then append the value
                             // this avoids removal of the icon when setting label text
                             this.element.html(value);
                             if (this.icon) {
                                 this._attachIcon(this.options.iconPosition);
                                 this._attachIconSpace(this.options.iconPosition);
                             }
                         }
                     }
      
                     this._super(key, value);
      
                     if (key === "disabled") {
                         this._toggleClass(null, "ui-state-disabled", value);
                         this.element[0].disabled = value;
                         if (value) {
                             this.element.blur();
                         }
                     }
                 },
      
                 refresh: function () {
      
                     // Make sure to only check disabled if its an element that supports this otherwise
                     // check for the disabled class to determine state
                     var isDisabled = this.element.is("input, button") ?
                         this.element[0].disabled : this.element.hasClass("ui-button-disabled");
      
                     if (isDisabled !== this.options.disabled) {
                         this._setOptions({
                             disabled: isDisabled
                         });
                     }
      
                     this._updateTooltip();
                 }
             });
      
             // DEPRECATED
             if ($.uiBackCompat !== false) {
      
                 // Text and Icons options
                 $.widget("ui.button", $.ui.button, {
                     options: {
                         text: true,
                         icons: {
                             primary: null,
                             secondary: null
                         }
                     },
      
                     _create: function () {
                         if (this.options.showLabel && !this.options.text) {
                             this.options.showLabel = this.options.text;
                         }
                         if (!this.options.showLabel && this.options.text) {
                             this.options.text = this.options.showLabel;
                         }
                         if (!this.options.icon && (this.options.icons.primary ||
                                 this.options.icons.secondary)) {
                             if (this.options.icons.primary) {
                                 this.options.icon = this.options.icons.primary;
                             } else {
                                 this.options.icon = this.options.icons.secondary;
                                 this.options.iconPosition = "end";
                             }
                         } else if (this.options.icon) {
                             this.options.icons.primary = this.options.icon;
                         }
                         this._super();
                     },
      
                     _setOption: function (key, value) {
                         if (key === "text") {
                             this._super("showLabel", value);
                             return;
                         }
                         if (key === "showLabel") {
                             this.options.text = value;
                         }
                         if (key === "icon") {
                             this.options.icons.primary = value;
                         }
                         if (key === "icons") {
                             if (value.primary) {
                                 this._super("icon", value.primary);
                                 this._super("iconPosition", "beginning");
                             } else if (value.secondary) {
                                 this._super("icon", value.secondary);
                                 this._super("iconPosition", "end");
                             }
                         }
                         this._superApply(arguments);
                     }
                 });
      
                 $.fn.button = (function (orig) {
                     return function () {
                         if (!this.length || (this.length && this[0].tagName !== "INPUT") ||
                             (this.length && this[0].tagName === "INPUT" && (
                                 this.attr("type") !== "checkbox" && this.attr("type") !== "radio"
                             ))) {
                             return orig.apply(this, arguments);
                         }
                         if (!$.ui.checkboxradio) {
                             $.error("Checkboxradio widget missing");
                         }
                         if (arguments.length === 0) {
                             return this.checkboxradio({
                                 "icon": false
                             });
                         }
                         return this.checkboxradio.apply(this, arguments);
                     };
                 })($.fn.button);
      
                 $.fn.buttonset = function () {
                     if (!$.ui.controlgroup) {
                         $.error("Controlgroup widget missing");
                     }
                     if (arguments[0] === "option" && arguments[1] === "items" && arguments[2]) {
                         return this.controlgroup.apply(this,
                             [arguments[0], "items.button", arguments[2]]);
                     }
                     if (arguments[0] === "option" && arguments[1] === "items") {
                         return this.controlgroup.apply(this, [arguments[0], "items.button"]);
                     }
                     if (typeof arguments[0] === "object" && arguments[0].items) {
                         arguments[0].items = {
                             button: arguments[0].items
                         };
                     }
                     return this.controlgroup.apply(this, arguments);
                 };
             }
      
             var widgetsButton = $.ui.button;
      


             // jscs:disable maximumLineLength
             /* jscs:disable requireCamelCaseOrUpperCaseIdentifiers */
             /*!
              * jQuery UI Datepicker 1.12.1
              * http://jqueryui.com
              *
              * Copyright jQuery Foundation and other contributors
              * Released under the MIT license.
              * http://jquery.org/license
              */
      
             //>>label: Datepicker
             //>>group: Widgets
             //>>description: Displays a calendar from an input or inline for selecting dates.
             //>>docs: http://api.jqueryui.com/datepicker/
             //>>demos: http://jqueryui.com/datepicker/
             //>>css.structure: ../../themes/base/core.css
             //>>css.structure: ../../themes/base/datepicker.css
             //>>css.theme: ../../themes/base/theme.css
      


             $.extend($.ui, {
                 datepicker: {
                     version: "1.12.1"
                 }
             });
      
             var datepicker_instActive;
      
             function datepicker_getZindex(elem) {
                 var position, value;
                 while (elem.length && elem[0] !== document) {
      
                     // Ignore z-index if position is set to a value where z-index is ignored by the browser
                     // This makes behavior of this function consistent across browsers
                     // WebKit always returns auto if the element is positioned
                     position = elem.css("position");
                     if (position === "absolute" || position === "relative" || position === "fixed") {
      
                         // IE returns 0 when zIndex is not specified
                         // other browsers return a string
                         // we ignore the case of nested elements with an explicit value of 0
      
      //
                         value = parseInt(elem.css("zIndex"), 10);
                         if (!isNaN(value) && value !== 0) {
                             return value;
                         }
                     }
                     elem = elem.parent();
                 }
      
                 return 0;
             }
             /* Date picker manager.
                Use the singleton instance of this class, $.datepicker, to interact with the date picker.
                Settings for (groups of) date pickers are maintained in an instance object,
                allowing multiple different settings on the same page. */
      
             function Datepicker() {
                 this._curInst = null; // The current instance in use
                 this._keyEvent = false; // If the last event was a key event
                 this._disabledInputs = []; // List of date picker inputs that have been disabled
                 this._datepickerShowing = false; // True if the popup picker is showing , false if not
                 this._inDialog = false; // True if showing within a "dialog", false if not
                 this._mainDivId = "ui-datepicker-div"; // The ID of the main datepicker division
                 this._inlineClass = "ui-datepicker-inline"; // The name of the inline marker class
                 this._appendClass = "ui-datepicker-append"; // The name of the append marker class
                 this._triggerClass = "ui-datepicker-trigger"; // The name of the trigger marker class
                 this._dialogClass = "ui-datepicker-dialog"; // The name of the dialog marker class
                 this._disableClass = "ui-datepicker-disabled"; // The name of the disabled covering marker class
                 this._unselectableClass =
                     "ui-datepicker-unselectable"; // The name of the unselectable cell marker class
                 this._currentClass = "ui-datepicker-current-day"; // The name of the current day marker class
                 this._dayOverClass = "ui-datepicker-days-cell-over"; // The name of the day hover marker class
                 this.regional = []; // Available regional settings, indexed by language code
                 this.regional[""] = { // Default regional settings
                     closeText: "Done", // Display text for close link
                     prevText: "Prev", // Display text for previous month link
                     nextText: "Next", // Display text for next month link
                     currentText: "Today", // Display text for current month link
                     monthNames: ["January", "February", "March", "April", "May", "June",
                         "July", "August", "September", "October", "November", "December"
                     ], // Names of months for drop-down and formatting
                     monthNamesShort: ["Jan", "Feb", "Mar", "Apr", "May", "Jun", "Jul", "Aug", "Sep", "Oct",
                         "Nov", "Dec"
                     ], // For formatting
                     dayNames: ["Sunday", "Monday", "Tuesday", "Wednesday", "Thursday", "Friday",
                         "Saturday"
                     ], // For formatting
                     dayNamesShort: ["Sun", "Mon", "Tue", "Wed", "Thu", "Fri", "Sat"], // For formatting
                     dayNamesMin: ["Su", "Mo", "Tu", "We", "Th", "Fr",
                         "Sa"
                     ], // Column headings for days starting at Sunday
                     weekHeader: "Wk", // Column header for week of the year
                     dateFormat: "mm/dd/yy", // See format options on parseDate
                     firstDay: 0, // The first day of the week, Sun = 0, Mon = 1, ...
                     isRTL: false, // True if right-to-left language, false if left-to-right
                     showMonthAfterYear: false, // True if the year select precedes month, false for month then year
                     yearSuffix: "" // Additional text to append to the year in the month headers
                 };
                 this._defaults = { // Global defaults for all the date picker instances
                     showOn: "focus", // "focus" for popup on focus,
                     // "button" for trigger button, or "both" for either
                     showAnim: "fadeIn", // Name of jQuery animation for popup
                     showOptions: {}, // Options for enhanced animations
                     defaultDate: null, // Used when field is blank: actual date,
                     // +/-number for offset from today, null for today
                     appendText: "", // Display text following the input box, e.g. showing the format
                     buttonText: "...", // Text for trigger button
                     buttonImage: "", // URL for trigger button image
                     buttonImageOnly: false, // True if the image appears alone, false if it appears on a button
                     hideIfNoPrevNext: false, // True to hide next/previous month links
                     // if not applicable, false to just disable them
                     navigationAsDateFormat: false, // True if date formatting applied to prev/today/next links
                     gotoCurrent: false, // True if today link goes back to current selection instead
                     changeMonth: false, // True if month can be selected directly, false if only prev/next
                     changeYear: false, // True if year can be selected directly, false if only prev/next
                     yearRange: "c-10:c+10", // Range of years to display in drop-down,
                     // either relative to today's year (-nn:+nn), relative to currently displayed year
                     // (c-nn:c+nn), absolute (nnnn:nnnn), or a combination of the above (nnnn:-n)
                     showOtherMonths: false, // True to show dates in other months, false to leave blank
                     selectOtherMonths: false, // True to allow selection of dates in other months, false for unselectable
                     showWeek: false, // True to show week of the year, false to not show it
                     calculateWeek: this.iso8601Week, // How to calculate the week of the year,
                     // takes a Date and returns the number of the week for it
                     shortYearCutoff: "+10", // Short year values < this are in the current century,
                     // > this are in the previous century,
                     // string value starting with "+" for current year + value
                     minDate: null, // The earliest selectable date, or null for no limit
                     maxDate: null, // The latest selectable date, or null for no limit
                     duration: "fast", // Duration of display/closure
                     beforeShowDay: null, // Function that takes a date and returns an array with
                     // [0] = true if selectable, false if not, [1] = custom CSS class name(s) or "",
                     // [2] = cell title (optional), e.g. $.datepicker.noWeekends
                     beforeShow: null, // Function that takes an input field and
                     // returns a set of custom settings for the date picker
                     onSelect: null, // Define a callback function when a date is selected
                     onChangeMonthYear: null, // Define a callback function when the month or year is changed
                     onClose: null, // Define a callback function when the datepicker is closed
                     numberOfMonths: 1, // Number of months to show at a time
                     showCurrentAtPos: 0, // The position in multipe months at which to show the current month (starting at 0)
                     stepMonths: 1, // Number of months to step back/forward
                     stepBigMonths: 12, // Number of months to step back/forward for the big links
                     altField: "", // Selector for an alternate field to store selected dates into
                     altFormat: "", // The date format to use for the alternate field
                     constrainInput: true, // The input is constrained by the current date format
                     showButtonPanel: false, // True to show button panel, false to not show it
                     autoSize: false, // True to size the input for the date format, false to leave as is
                     disabled: false // The initial disabled state
                 };
                 $.extend(this._defaults, this.regional[""]);
                 this.regional.en = $.extend(true, {}, this.regional[""]);
                 this.regional["en-US"] = $.extend(true, {}, this.regional.en);
      
      this.dpDiv = datepicker_bindHover($("
      "
                 ));
             }
      
             $.extend(Datepicker.prototype, {
                 /* Class name added to elements to indicate already configured with a date picker. */
                 markerClassName: "hasDatepicker",
      
                 //Keep track of the maximum number of rows displayed (see #7043)
                 maxRows: 4,
      
                 // TODO rename to "widget" when switching to widget factory
                 _widgetDatepicker: function () {
                     return this.dpDiv;
                 },
      
                 /* Override the default settings for all instances of the date picker.
                  * @param  settings  object - the new settings to use as defaults (anonymous object)
                  * @return the manager object
                  */
                 setDefaults: function (settings) {
                     datepicker_extendRemove(this._defaults, settings || {});
                     return this;
                 },
      
                 /* Attach the date picker to a jQuery selection.
                  * @param  target	element - the target input field or division or span
                  * @param  settings  object - the new settings to use for this date picker instance (anonymous)
                  */
                 _attachDatepicker: function (target, settings) {
                     var nodeName, inline, inst;
                     nodeName = target.nodeName.toLowerCase();
                     inline = (nodeName === "div" || nodeName === "span");
                     if (!target.id) {
                         this.uuid += 1;
                         target.id = "dp" + this.uuid;
                     }
                     inst = this._newInst($(target), inline);
                     inst.settings = $.extend({}, settings || {});
                     if (nodeName === "input") {
                         this._connectDatepicker(target, inst);
                     } else if (inline) {
                         this._inlineDatepicker(target, inst);
                     }
                 },
      
                 /* Create a new instance object. */
                 _newInst: function (target, inline) {
                     var id = target[0].id.replace(/([^A-Za-z0-9_\-])/g,
                         "\\\\$1"); // escape jQuery meta chars
                     return {
                         id: id,
                         input: target, // associated target
                         selectedDay: 0,
                         selectedMonth: 0,
                         selectedYear: 0, // current selection
                         drawMonth: 0,
                         drawYear: 0, // month being drawn
                         inline: inline, // is datepicker inline or not
                         dpDiv: (!inline ? this.dpDiv : // presentation div
      
      datepicker_bindHover($("
      "
                             )))
                     };
                 },
      
                 /* Attach the date picker to an input field. */
                 _connectDatepicker: function (target, inst) {
                     var input = $(target);
                     inst.append = $([]);
                     inst.trigger = $([]);
                     if (input.hasClass(this.markerClassName)) {
                         return;
                     }
                     this._attachments(input, inst);
                     input.addClass(this.markerClassName).on("keydown", this._doKeyDown).
                     on("keypress", this._doKeyPress).on("keyup", this._doKeyUp);
                     this._autoSize(inst);
                     $.data(target, "datepicker", inst);
      
                     //If disabled option is true, disable the datepicker once it has been attached to the input (see ticket #5665)
                     if (inst.settings.disabled) {
                         this._disableDatepicker(target);
                     }
                 },
      
                 /* Make attachments based on settings. */
                 _attachments: function (input, inst) {
                     var showOn, buttonText, buttonImage,
                         appendText = this._get(inst, "appendText"),
                         isRTL = this._get(inst, "isRTL");
      
                     if (inst.append) {
                         inst.append.remove();
                     }
                     if (appendText) {
                         inst.append = $("" + appendText +
                             "");
                         input[isRTL ? "before" : "after"](inst.append);
                     }
      
                     input.off("focus", this._showDatepicker);
      
                     if (inst.trigger) {
                         inst.trigger.remove();
                     }
      
                     showOn = this._get(inst, "showOn");
                     if (showOn === "focus" || showOn ===
                         "both") { // pop-up date picker when in the marked field
                         input.on("focus", this._showDatepicker);
                     }
                     if (showOn === "button" || showOn ===
                         "both") { // pop-up date picker when button clicked
                         buttonText = this._get(inst, "buttonText");
                         buttonImage = this._get(inst, "buttonImage");
                         inst.trigger = $(this._get(inst, "buttonImageOnly") ?
                             $("<img/>").addClass(this._triggerClass).attr({
                                 src: buttonImage,
                                 alt: buttonText,
                                 title: buttonText
                             }) :
                             $("<button type='button'></button>").addClass(this._triggerClass).html(!
                                 buttonImage ? buttonText : $("<img/>").attr({
                                     src: buttonImage,
                                     alt: buttonText,
                                     title: buttonText
                                 })));
                         input[isRTL ? "before" : "after"](inst.trigger);
                         inst.trigger.on("click", function () {
                             if ($.datepicker._datepickerShowing && $.datepicker._lastInput ===
                                 input[0]) {
                                 $.datepicker._hideDatepicker();
                             } else if ($.datepicker._datepickerShowing && $.datepicker
                                 ._lastInput !== input[0]) {
                                 $.datepicker._hideDatepicker();
                                 $.datepicker._showDatepicker(input[0]);
                             } else {
                                 $.datepicker._showDatepicker(input[0]);
                             }
                             return false;
                         });
                     }
                 },
      
                 /* Apply the maximum length for the date format. */
                 _autoSize: function (inst) {
                     if (this._get(inst, "autoSize") && !inst.inline) {
                         var findMax, max, maxI, i,
                             date = new Date(2009, 12 - 1, 20), // Ensure double digits
                             dateFormat = this._get(inst, "dateFormat");
      
                         if (dateFormat.match(/[DM]/)) {
                             findMax = function (names) {
                                 max = 0;
                                 maxI = 0;
                                 for (i = 0; i < names.length; i++) {
                                     if (names[i].length > max) {
                                         max = names[i].length;
                                         maxI = i;
                                     }
                                 }
                                 return maxI;
                             };
                             date.setMonth(findMax(this._get(inst, (dateFormat.match(/MM/) ?
                                 "monthNames" : "monthNamesShort"))));
                             date.setDate(findMax(this._get(inst, (dateFormat.match(/DD/) ?
                                 "dayNames" : "dayNamesShort"))) + 20 - date.getDay());
                         }
                         inst.input.attr("size", this._formatDate(inst, date).length);
                     }
                 },
      
                 /* Attach an inline date picker to a div. */
                 _inlineDatepicker: function (target, inst) {
                     var divSpan = $(target);
                     if (divSpan.hasClass(this.markerClassName)) {
                         return;
                     }
                     divSpan.addClass(this.markerClassName).append(inst.dpDiv);
                     $.data(target, "datepicker", inst);
                     this._setDate(inst, this._getDefaultDate(inst), true);
                     this._updateDatepicker(inst);
                     this._updateAlternate(inst);
      
                     //If disabled option is true, disable the datepicker before showing it (see ticket #5665)
                     if (inst.settings.disabled) {
                         this._disableDatepicker(target);
                     }
      
                     // Set display:block in place of inst.dpDiv.show() which won't work on disconnected elements
                     // http://bugs.jqueryui.com/ticket/7552 - A Datepicker created on a detached div has zero height
                     inst.dpDiv.css("display", "block");
                 },
      
                 /* Pop-up the date picker in a "dialog" box.
                  * @param  input element - ignored
                  * @param  date	string or Date - the initial date to display
                  * @param  onSelect  function - the function to call when a date is selected
                  * @param  settings  object - update the dialog date picker instance's settings (anonymous object)
                  * @param  pos int[2] - coordinates for the dialog's position within the screen or
                  *					event - with x/y coordinates or
                  *					leave empty for default (screen centre)
                  * @return the manager object
                  */
                 _dialogDatepicker: function (input, date, onSelect, settings, pos) {
                     var id, browserWidth, browserHeight, scrollX, scrollY,
                         inst = this._dialogInst; // internal instance
      
                     if (!inst) {
                         this.uuid += 1;
                         id = "dp" + this.uuid;
                         this._dialogInput = $("<input type='text' id='" + id +
                             "' style='position: absolute; top: -100px; width: 0px;'/>");
                         this._dialogInput.on("keydown", this._doKeyDown);
                         $("body").append(this._dialogInput);
                         inst = this._dialogInst = this._newInst(this._dialogInput, false);
                         inst.settings = {};
                         $.data(this._dialogInput[0], "datepicker", inst);
                     }
                     datepicker_extendRemove(inst.settings, settings || {});
                     date = (date && date.constructor === Date ? this._formatDate(inst, date) : date);
                     this._dialogInput.val(date);
      
                     this._pos = (pos ? (pos.length ? pos : [pos.pageX, pos.pageY]) : null);
                     if (!this._pos) {
                         browserWidth = document.documentElement.clientWidth;
                         browserHeight = document.documentElement.clientHeight;
                         scrollX = document.documentElement.scrollLeft || document.body.scrollLeft;
                         scrollY = document.documentElement.scrollTop || document.body.scrollTop;
                         this._pos = // should use actual width/height below
                             [(browserWidth / 2) - 100 + scrollX, (browserHeight / 2) - 150 + scrollY];
                     }
      
                     // Move input on screen for focus, but hidden behind dialog
                     this._dialogInput.css("left", (this._pos[0] + 20) + "px").css("top", this._pos[1] +
                         "px");
                     inst.settings.onSelect = onSelect;
                     this._inDialog = true;
                     this.dpDiv.addClass(this._dialogClass);
                     this._showDatepicker(this._dialogInput[0]);
                     if ($.blockUI) {
                         $.blockUI(this.dpDiv);
                     }
                     $.data(this._dialogInput[0], "datepicker", inst);
                     return this;
                 },
      
                 /* Detach a datepicker from its control.
                  * @param  target	element - the target input field or division or span
                  */
                 _destroyDatepicker: function (target) {
                     var nodeName,
                         $target = $(target),
                         inst = $.data(target, "datepicker");
      
                     if (!$target.hasClass(this.markerClassName)) {
                         return;
                     }
      
                     nodeName = target.nodeName.toLowerCase();
                     $.removeData(target, "datepicker");
                     if (nodeName === "input") {
                         inst.append.remove();
                         inst.trigger.remove();
                         $target.removeClass(this.markerClassName).
                         off("focus", this._showDatepicker).
                         off("keydown", this._doKeyDown).
                         off("keypress", this._doKeyPress).
                         off("keyup", this._doKeyUp);
                     } else if (nodeName === "div" || nodeName === "span") {
                         $target.removeClass(this.markerClassName).empty();
                     }
      
                     if (datepicker_instActive === inst) {
                         datepicker_instActive = null;
                     }
                 },
      
                 /* Enable the date picker to a jQuery selection.
                  * @param  target	element - the target input field or division or span
                  */
                 _enableDatepicker: function (target) {
                     var nodeName, inline,
                         $target = $(target),
                         inst = $.data(target, "datepicker");
      
                     if (!$target.hasClass(this.markerClassName)) {
                         return;
                     }
      
                     nodeName = target.nodeName.toLowerCase();
                     if (nodeName === "input") {
                         target.disabled = false;
                         inst.trigger.filter("button").
                         each(function () {
                             this.disabled = false;
                         }).end().
                         filter("img").css({
                             opacity: "1.0",
                             cursor: ""
                         });
                     } else if (nodeName === "div" || nodeName === "span") {
                         inline = $target.children("." + this._inlineClass);
                         inline.children().removeClass("ui-state-disabled");
                         inline.find("select.ui-datepicker-month, select.ui-datepicker-year").
                         prop("disabled", false);
                     }
                     this._disabledInputs = $.map(this._disabledInputs,
                         function (value) {
                             return (value === target ? null : value);
                         }); // delete entry
                 },
      
                 /* Disable the date picker to a jQuery selection.
                  * @param  target	element - the target input field or division or span
                  */
                 _disableDatepicker: function (target) {
                     var nodeName, inline,
                         $target = $(target),
                         inst = $.data(target, "datepicker");
      
                     if (!$target.hasClass(this.markerClassName)) {
                         return;
                     }
      
                     nodeName = target.nodeName.toLowerCase();
                     if (nodeName === "input") {
                         target.disabled = true;
                         inst.trigger.filter("button").
                         each(function () {
                             this.disabled = true;
                         }).end().
                         filter("img").css({
                             opacity: "0.5",
                             cursor: "default"
                         });
                     } else if (nodeName === "div" || nodeName === "span") {
                         inline = $target.children("." + this._inlineClass);
                         inline.children().addClass("ui-state-disabled");
                         inline.find("select.ui-datepicker-month, select.ui-datepicker-year").
                         prop("disabled", true);
                     }
                     this._disabledInputs = $.map(this._disabledInputs,
                         function (value) {
                             return (value === target ? null : value);
                         }); // delete entry
                     this._disabledInputs[this._disabledInputs.length] = target;
                 },
      
                 /* Is the first field in a jQuery collection disabled as a datepicker?
                  * @param  target	element - the target input field or division or span
                  * @return boolean - true if disabled, false if enabled
                  */
                 _isDisabledDatepicker: function (target) {
                     if (!target) {
                         return false;
                     }
                     for (var i = 0; i < this._disabledInputs.length; i++) {
                         if (this._disabledInputs[i] === target) {
                             return true;
                         }
                     }
                     return false;
                 },
      
                 /* Retrieve the instance data for the target control.
                  * @param  target  element - the target input field or division or span
                  * @return  object - the associated instance data
                  * @throws  error if a jQuery problem getting data
                  */
                 _getInst: function (target) {
                     try {
                         return $.data(target, "datepicker");
                     } catch (err) {
                         throw "Missing instance data for this datepicker";
                     }
                 },
      
                 /* Update or retrieve the settings for a date picker attached to an input field or division.
                  * @param  target  element - the target input field or division or span
                  * @param  name	object - the new settings to update or
                  *				string - the name of the setting to change or retrieve,
                  *				when retrieving also "all" for all instance settings or
                  *				"defaults" for all global defaults
                  * @param  value   any - the new value for the setting
                  *				(omit if above is an object or to retrieve a value)
                  */
                 _optionDatepicker: function (target, name, value) {
                     var settings, date, minDate, maxDate,
                         inst = this._getInst(target);
      
                     if (arguments.length === 2 && typeof name === "string") {
                         return (name === "defaults" ? $.extend({}, $.datepicker._defaults) :
                             (inst ? (name === "all" ? $.extend({}, inst.settings) :
                                 this._get(inst, name)) : null));
                     }
      
                     settings = name || {};
                     if (typeof name === "string") {
                         settings = {};
                         settings[name] = value;
                     }
      
                     if (inst) {
                         if (this._curInst === inst) {
                             this._hideDatepicker();
                         }
      
                         date = this._getDateDatepicker(target, true);
                         minDate = this._getMinMaxDate(inst, "min");
                         maxDate = this._getMinMaxDate(inst, "max");
                         datepicker_extendRemove(inst.settings, settings);
      
                         // reformat the old minDate/maxDate values if dateFormat changes and a new minDate/maxDate isn't provided
                         if (minDate !== null && settings.dateFormat !== undefined && settings
                             .minDate === undefined) {
                             inst.settings.minDate = this._formatDate(inst, minDate);
                         }
                         if (maxDate !== null && settings.dateFormat !== undefined && settings
                             .maxDate === undefined) {
                             inst.settings.maxDate = this._formatDate(inst, maxDate);
                         }
                         if ("disabled" in settings) {
                             if (settings.disabled) {
                                 this._disableDatepicker(target);
                             } else {
                                 this._enableDatepicker(target);
                             }
                         }
                         this._attachments($(target), inst);
                         this._autoSize(inst);
                         this._setDate(inst, date);
                         this._updateAlternate(inst);
                         this._updateDatepicker(inst);
                     }
                 },
      
                 // Change method deprecated
                 _changeDatepicker: function (target, name, value) {
                     this._optionDatepicker(target, name, value);
                 },
      
                 /* Redraw the date picker attached to an input field or division.
                  * @param  target  element - the target input field or division or span
                  */
                 _refreshDatepicker: function (target) {
                     var inst = this._getInst(target);
                     if (inst) {
                         this._updateDatepicker(inst);
                     }
                 },
      
                 /* Set the dates for a jQuery selection.
                  * @param  target element - the target input field or division or span
                  * @param  date	Date - the new date
                  */
                 _setDateDatepicker: function (target, date) {
                     var inst = this._getInst(target);
                     if (inst) {
                         this._setDate(inst, date);
                         this._updateDatepicker(inst);
                         this._updateAlternate(inst);
                     }
                 },
      
                 /* Get the date(s) for the first entry in a jQuery selection.
                  * @param  target element - the target input field or division or span
                  * @param  noDefault boolean - true if no default date is to be used
                  * @return Date - the current date
                  */
                 _getDateDatepicker: function (target, noDefault) {
                     var inst = this._getInst(target);
                     if (inst && !inst.inline) {
                         this._setDateFromField(inst, noDefault);
                     }
                     return (inst ? this._getDate(inst) : null);
                 },
      
                 /* Handle keystrokes. */
                 _doKeyDown: function (event) {
                     var onSelect, dateStr, sel,
                         inst = $.datepicker._getInst(event.target),
                         handled = true,
                         isRTL = inst.dpDiv.is(".ui-datepicker-rtl");
      
                     inst._keyEvent = true;
                     if ($.datepicker._datepickerShowing) {
                         switch (event.keyCode) {
                             case 9:
                                 $.datepicker._hideDatepicker();
                                 handled = false;
                                 break; // hide on tab out
                             case 13:
                                 sel = $("td." + $.datepicker._dayOverClass + ":not(." +
                                     $.datepicker._currentClass + ")", inst.dpDiv);
                                 if (sel[0]) {
                                     $.datepicker._selectDay(event.target, inst.selectedMonth, inst
                                         .selectedYear, sel[0]);
                                 }
      
                                 onSelect = $.datepicker._get(inst, "onSelect");
                                 if (onSelect) {
                                     dateStr = $.datepicker._formatDate(inst);
      
                                     // Trigger custom callback
                                     onSelect.apply((inst.input ? inst.input[0] : null), [dateStr,
                                         inst
                                     ]);
                                 } else {
                                     $.datepicker._hideDatepicker();
                                 }
      
                                 return false; // don't submit the form
                             case 27:
                                 $.datepicker._hideDatepicker();
                                 break; // hide on escape
                             case 33:
                                 $.datepicker._adjustDate(event.target, (event.ctrlKey ?
                                     -$.datepicker._get(inst, "stepBigMonths") :
                                     -$.datepicker._get(inst, "stepMonths")), "M");
                                 break; // previous month/year on page up/+ ctrl
                             case 34:
                                 $.datepicker._adjustDate(event.target, (event.ctrlKey ?
                                     +$.datepicker._get(inst, "stepBigMonths") :
                                     +$.datepicker._get(inst, "stepMonths")), "M");
                                 break; // next month/year on page down/+ ctrl
                             case 35:
                                 if (event.ctrlKey || event.metaKey) {
                                     $.datepicker._clearDate(event.target);
                                 }
                                 handled = event.ctrlKey || event.metaKey;
                                 break; // clear on ctrl or command +end
                             case 36:
                                 if (event.ctrlKey || event.metaKey) {
                                     $.datepicker._gotoToday(event.target);
                                 }
                                 handled = event.ctrlKey || event.metaKey;
                                 break; // current on ctrl or command +home
                             case 37:
                                 if (event.ctrlKey || event.metaKey) {
                                     $.datepicker._adjustDate(event.target, (isRTL ? +1 : -1), "D");
                                 }
                                 handled = event.ctrlKey || event.metaKey;
      
                                 // -1 day on ctrl or command +left
                                 if (event.originalEvent.altKey) {
                                     $.datepicker._adjustDate(event.target, (event.ctrlKey ?
                                         -$.datepicker._get(inst, "stepBigMonths") :
                                         -$.datepicker._get(inst, "stepMonths")), "M");
                                 }
      
                                 // next month/year on alt +left on Mac
                                 break;
                             case 38:
                                 if (event.ctrlKey || event.metaKey) {
                                     $.datepicker._adjustDate(event.target, -7, "D");
                                 }
                                 handled = event.ctrlKey || event.metaKey;
                                 break; // -1 week on ctrl or command +up
                             case 39:
                                 if (event.ctrlKey || event.metaKey) {
                                     $.datepicker._adjustDate(event.target, (isRTL ? -1 : +1), "D");
                                 }
                                 handled = event.ctrlKey || event.metaKey;
      
                                 // +1 day on ctrl or command +right
                                 if (event.originalEvent.altKey) {
                                     $.datepicker._adjustDate(event.target, (event.ctrlKey ?
                                         +$.datepicker._get(inst, "stepBigMonths") :
                                         +$.datepicker._get(inst, "stepMonths")), "M");
                                 }
      
                                 // next month/year on alt +right
                                 break;
                             case 40:
                                 if (event.ctrlKey || event.metaKey) {
                                     $.datepicker._adjustDate(event.target, +7, "D");
                                 }
                                 handled = event.ctrlKey || event.metaKey;
                                 break; // +1 week on ctrl or command +down
                             default:
                                 handled = false;
                         }
                     } else if (event.keyCode === 36 && event
                         .ctrlKey) { // display the date picker on ctrl+home
                         $.datepicker._showDatepicker(this);
                     } else {
                         handled = false;
                     }
      
                     if (handled) {
                         event.preventDefault();
                         event.stopPropagation();
                     }
                 },
      
                 /* Filter entered characters - based on date format. */
                 _doKeyPress: function (event) {
                     var chars, chr,
                         inst = $.datepicker._getInst(event.target);
      
                     if ($.datepicker._get(inst, "constrainInput")) {
                         chars = $.datepicker._possibleChars($.datepicker._get(inst, "dateFormat"));
                         chr = String.fromCharCode(event.charCode == null ? event.keyCode : event
                             .charCode);
                         return event.ctrlKey || event.metaKey || (chr < " " || !chars || chars.indexOf(
                             chr) > -1);
                     }
                 },
      
                 /* Synchronise manual entry and field/alternate field. */
                 _doKeyUp: function (event) {
                     var date,
                         inst = $.datepicker._getInst(event.target);
      
                     if (inst.input.val() !== inst.lastVal) {
                         try {
                             date = $.datepicker.parseDate($.datepicker._get(inst, "dateFormat"),
                                 (inst.input ? inst.input.val() : null),
                                 $.datepicker._getFormatConfig(inst));
      
                             if (date) { // only if valid
                                 $.datepicker._setDateFromField(inst);
                                 $.datepicker._updateAlternate(inst);
                                 $.datepicker._updateDatepicker(inst);
                             }
                         } catch (err) {}
                     }
                     return true;
                 },
      
                 /* Pop-up the date picker for a given input field.
                  * If false returned from beforeShow event handler do not show.
                  * @param  input  element - the input field attached to the date picker or
                  *					event - if triggered by focus
                  */
                 _showDatepicker: function (input) {
                     input = input.target || input;
                     if (input.nodeName.toLowerCase() !== "input") { // find from button/image trigger
                         input = $("input", input.parentNode)[0];
                     }
      
                     if ($.datepicker._isDisabledDatepicker(input) || $.datepicker._lastInput ===
                         input) { // already here
                         return;
                     }
      
                     var inst, beforeShow, beforeShowSettings, isFixed,
                         offset, showAnim, duration;
      
                     inst = $.datepicker._getInst(input);
                     if ($.datepicker._curInst && $.datepicker._curInst !== inst) {
                         $.datepicker._curInst.dpDiv.stop(true, true);
                         if (inst && $.datepicker._datepickerShowing) {
                             $.datepicker._hideDatepicker($.datepicker._curInst.input[0]);
                         }
                     }
      
                     beforeShow = $.datepicker._get(inst, "beforeShow");
                     beforeShowSettings = beforeShow ? beforeShow.apply(input, [input, inst]) : {};
                     if (beforeShowSettings === false) {
                         return;
                     }
                     datepicker_extendRemove(inst.settings, beforeShowSettings);
      
                     inst.lastVal = null;
                     $.datepicker._lastInput = input;
                     $.datepicker._setDateFromField(inst);
      
                     if ($.datepicker._inDialog) { // hide cursor
                         input.value = "";
                     }
                     if (!$.datepicker._pos) { // position below input
                         $.datepicker._pos = $.datepicker._findPos(input);
                         $.datepicker._pos[1] += input.offsetHeight; // add the height
                     }
      
                     isFixed = false;
                     $(input).parents().each(function () {
                         isFixed |= $(this).css("position") === "fixed";
                         return !isFixed;
                     });
      
                     offset = {
                         left: $.datepicker._pos[0],
                         top: $.datepicker._pos[1]
                     };
                     $.datepicker._pos = null;
      
                     //to avoid flashes on Firefox
                     inst.dpDiv.empty();
      
                     // determine sizing offscreen
                     inst.dpDiv.css({
                         position: "absolute",
                         display: "block",
                         top: "-1000px"
                     });
                     $.datepicker._updateDatepicker(inst);
      
                     // fix width for dynamic number of date pickers
                     // and adjust position before showing
                     offset = $.datepicker._checkOffset(inst, offset, isFixed);
                     inst.dpDiv.css({
                         position: ($.datepicker._inDialog && $.blockUI ?
                             "static" : (isFixed ? "fixed" : "absolute")),
                         display: "none",
                         left: offset.left + "px",
                         top: offset.top + "px"
                     });
      
                     if (!inst.inline) {
                         showAnim = $.datepicker._get(inst, "showAnim");
                         duration = $.datepicker._get(inst, "duration");
                         inst.dpDiv.css("z-index", datepicker_getZindex($(input)) + 1);
                         $.datepicker._datepickerShowing = true;
      
                         if ($.effects && $.effects.effect[showAnim]) {
                             inst.dpDiv.show(showAnim, $.datepicker._get(inst, "showOptions"), duration);
                         } else {
                             inst.dpDiv[showAnim || "show"](showAnim ? duration : null);
                         }
      
                         if ($.datepicker._shouldFocusInput(inst)) {
                             inst.input.trigger("focus");
                         }
      
                         $.datepicker._curInst = inst;
                     }
                 },
      
                 /* Generate the date picker content. */
                 _updateDatepicker: function (inst) {
                     this.maxRows = 4; //Reset the max number of rows being displayed (see #7043)
                     datepicker_instActive = inst; // for delegate hover events
                     inst.dpDiv.empty().append(this._generateHTML(inst));
                     this._attachHandlers(inst);
      
                     var origyearshtml,
                         numMonths = this._getNumberOfMonths(inst),
                         cols = numMonths[1],
                         width = 17,
                         activeCell = inst.dpDiv.find("." + this._dayOverClass + " a");
      
                     if (activeCell.length > 0) {
                         datepicker_handleMouseover.apply(activeCell.get(0));
                     }
      
                     inst.dpDiv.removeClass(
                         "ui-datepicker-multi-2 ui-datepicker-multi-3 ui-datepicker-multi-4").width(
                         "");
                     if (cols > 1) {
                         inst.dpDiv.addClass("ui-datepicker-multi-" + cols).css("width", (width * cols) +
                             "em");
                     }
                     inst.dpDiv[(numMonths[0] !== 1 || numMonths[1] !== 1 ? "add" : "remove") +
                         "Class"]("ui-datepicker-multi");
                     inst.dpDiv[(this._get(inst, "isRTL") ? "add" : "remove") +
                         "Class"]("ui-datepicker-rtl");
      
                     if (inst === $.datepicker._curInst && $.datepicker._datepickerShowing && $
                         .datepicker._shouldFocusInput(inst)) {
                         inst.input.trigger("focus");
                     }
      
                     // Deffered render of the years select (to avoid flashes on Firefox)
                     if (inst.yearshtml) {
                         origyearshtml = inst.yearshtml;
                         setTimeout(function () {
      
                             //assure that inst.yearshtml didn't change.
                             if (origyearshtml === inst.yearshtml && inst.yearshtml) {
                                 inst.dpDiv.find("select.ui-datepicker-year:first").replaceWith(
                                     inst.yearshtml);
                             }
                             origyearshtml = inst.yearshtml = null;
                         }, 0);
                     }
                 },
      
                 // #6694 - don't focus the input if it's already focused
                 // this breaks the change event in IE
                 // Support: IE and jQuery <1.9
                 _shouldFocusInput: function (inst) {
                     return inst.input && inst.input.is(":visible") && !inst.input.is(":disabled") && !
                         inst.input.is(":focus");
                 },
      
                 /* Check positioning to remain on screen. */
                 _checkOffset: function (inst, offset, isFixed) {
                     var dpWidth = inst.dpDiv.outerWidth(),
                         dpHeight = inst.dpDiv.outerHeight(),
                         inputWidth = inst.input ? inst.input.outerWidth() : 0,
                         inputHeight = inst.input ? inst.input.outerHeight() : 0,
                         viewWidth = document.documentElement.clientWidth + (isFixed ? 0 : $(document)
                             .scrollLeft()),
                         viewHeight = document.documentElement.clientHeight + (isFixed ? 0 : $(document)
                             .scrollTop());
      
                     offset.left -= (this._get(inst, "isRTL") ? (dpWidth - inputWidth) : 0);
                     offset.left -= (isFixed && offset.left === inst.input.offset().left) ? $(document)
                         .scrollLeft() : 0;
                     offset.top -= (isFixed && offset.top === (inst.input.offset().top + inputHeight)) ?
                         $(document).scrollTop() : 0;
      
                     // Now check if datepicker is showing outside window viewport - move to a better place if so.
                     offset.left -= Math.min(offset.left, (offset.left + dpWidth > viewWidth &&
                             viewWidth > dpWidth) ?
                         Math.abs(offset.left + dpWidth - viewWidth) : 0);
                     offset.top -= Math.min(offset.top, (offset.top + dpHeight > viewHeight &&
                             viewHeight > dpHeight) ?
                         Math.abs(dpHeight + inputHeight) : 0);
      
                     return offset;
                 },
      
                 /* Find an object's position on the screen. */
                 _findPos: function (obj) {
                     var position,
                         inst = this._getInst(obj),
                         isRTL = this._get(inst, "isRTL");
      
                     while (obj && (obj.type === "hidden" || obj.nodeType !== 1 || $.expr.filters.hidden(
                             obj))) {
                         obj = obj[isRTL ? "previousSibling" : "nextSibling"];
                     }
      
                     position = $(obj).offset();
                     return [position.left, position.top];
                 },
      
                 /* Hide the date picker from view.
                  * @param  input  element - the input field attached to the date picker
                  */
                 _hideDatepicker: function (input) {
                     var showAnim, duration, postProcess, onClose,
                         inst = this._curInst;
      
                     if (!inst || (input && inst !== $.data(input, "datepicker"))) {
                         return;
                     }
      
                     if (this._datepickerShowing) {
                         showAnim = this._get(inst, "showAnim");
                         duration = this._get(inst, "duration");
                         postProcess = function () {
                             $.datepicker._tidyDialog(inst);
                         };
      
                         // DEPRECATED: after BC for 1.8.x $.effects[ showAnim ] is not needed
                         if ($.effects && ($.effects.effect[showAnim] || $.effects[showAnim])) {
                             inst.dpDiv.hide(showAnim, $.datepicker._get(inst, "showOptions"), duration,
                                 postProcess);
                         } else {
                             inst.dpDiv[(showAnim === "slideDown" ? "slideUp" :
                                 (showAnim === "fadeIn" ? "fadeOut" : "hide"))]((showAnim ?
                                 duration : null), postProcess);
                         }
      
                         if (!showAnim) {
                             postProcess();
                         }
                         this._datepickerShowing = false;
      
                         onClose = this._get(inst, "onClose");
                         if (onClose) {
                             onClose.apply((inst.input ? inst.input[0] : null), [(inst.input ? inst.input
                                 .val() : ""), inst]);
                         }
      
                         this._lastInput = null;
                         if (this._inDialog) {
                             this._dialogInput.css({
                                 position: "absolute",
                                 left: "0",
                                 top: "-100px"
                             });
                             if ($.blockUI) {
                                 $.unblockUI();
                                 $("body").append(this.dpDiv);
                             }
                         }
                         this._inDialog = false;
                     }
                 },
      
                 /* Tidy up after a dialog display. */
                 _tidyDialog: function (inst) {
                     inst.dpDiv.removeClass(this._dialogClass).off(".ui-datepicker-calendar");
                 },
      
                 /* Close date picker if clicked elsewhere. */
                 _checkExternalClick: function (event) {
                     if (!$.datepicker._curInst) {
                         return;
                     }
      
                     var $target = $(event.target),
                         inst = $.datepicker._getInst($target[0]);
      
                     if ((($target[0].id !== $.datepicker._mainDivId &&
                             $target.parents("#" + $.datepicker._mainDivId).length === 0 &&
                             !$target.hasClass($.datepicker.markerClassName) &&
                             !$target.closest("." + $.datepicker._triggerClass).length &&
                             $.datepicker._datepickerShowing && !($.datepicker._inDialog && $
                                 .blockUI))) ||
                         ($target.hasClass($.datepicker.markerClassName) && $.datepicker._curInst !==
                             inst)) {
                         $.datepicker._hideDatepicker();
                     }
                 },
      
                 /* Adjust one of the date sub-fields. */
                 _adjustDate: function (id, offset, period) {
                     var target = $(id),
                         inst = this._getInst(target[0]);
      
                     if (this._isDisabledDatepicker(target[0])) {
                         return;
                     }
                     this._adjustInstDate(inst, offset +
                         (period === "M" ? this._get(inst, "showCurrentAtPos") :
                             0), // undo positioning
                         period);
                     this._updateDatepicker(inst);
                 },
      
                 /* Action for current link. */
                 _gotoToday: function (id) {
                     var date,
                         target = $(id),
                         inst = this._getInst(target[0]);
      
                     if (this._get(inst, "gotoCurrent") && inst.currentDay) {
                         inst.selectedDay = inst.currentDay;
                         inst.drawMonth = inst.selectedMonth = inst.currentMonth;
                         inst.drawYear = inst.selectedYear = inst.currentYear;
                     } else {
                         date = new Date();
                         inst.selectedDay = date.getDate();
                         inst.drawMonth = inst.selectedMonth = date.getMonth();
                         inst.drawYear = inst.selectedYear = date.getFullYear();
                     }
                     this._notifyChange(inst);
                     this._adjustDate(target);
                 },
      
                 /* Action for selecting a new month/year. */
                 _selectMonthYear: function (id, select, period) {
                     var target = $(id),
                         inst = this._getInst(target[0]);
      
                     inst["selected" + (period === "M" ? "Month" : "Year")] =
                         inst["draw" + (period === "M" ? "Month" : "Year")] =
                         parseInt(select.options[select.selectedIndex].value, 10);
      
                     this._notifyChange(inst);
                     this._adjustDate(target);
                 },
      
                 /* Action for selecting a day. */
                 _selectDay: function (id, month, year, td) {
                     var inst,
                         target = $(id);
      
                     if ($(td).hasClass(this._unselectableClass) || this._isDisabledDatepicker(target[
                             0])) {
                         return;
                     }
      
                     inst = this._getInst(target[0]);
                     inst.selectedDay = inst.currentDay = $("a", td).html();
                     inst.selectedMonth = inst.currentMonth = month;
                     inst.selectedYear = inst.currentYear = year;
                     this._selectDate(id, this._formatDate(inst,
                         inst.currentDay, inst.currentMonth, inst.currentYear));
                 },
      
                 /* Erase the input field and hide the date picker. */
                 _clearDate: function (id) {
                     var target = $(id);
                     this._selectDate(target, "");
                 },
      
                 /* Update the input field with the selected date. */
                 _selectDate: function (id, dateStr) {
                     var onSelect,
                         target = $(id),
                         inst = this._getInst(target[0]);
      
                     dateStr = (dateStr != null ? dateStr : this._formatDate(inst));
                     if (inst.input) {
                         inst.input.val(dateStr);
                     }
                     this._updateAlternate(inst);
      
                     onSelect = this._get(inst, "onSelect");
                     if (onSelect) {
                         onSelect.apply((inst.input ? inst.input[0] : null), [dateStr,
                             inst
                         ]); // trigger custom callback
                     } else if (inst.input) {
                         inst.input.trigger("change"); // fire the change event
                     }
      
                     if (inst.inline) {
                         this._updateDatepicker(inst);
                     } else {
                         this._hideDatepicker();
                         this._lastInput = inst.input[0];
                         if (typeof (inst.input[0]) !== "object") {
                             inst.input.trigger("focus"); // restore focus
                         }
                         this._lastInput = null;
                     }
                 },
      
                 /* Update any alternate field to synchronise with the main field. */
                 _updateAlternate: function (inst) {
                     var altFormat, date, dateStr,
                         altField = this._get(inst, "altField");
      
                     if (altField) { // update alternate field too
                         altFormat = this._get(inst, "altFormat") || this._get(inst, "dateFormat");
                         date = this._getDate(inst);
                         dateStr = this.formatDate(altFormat, date, this._getFormatConfig(inst));
                         $(altField).val(dateStr);
                     }
                 },
      
                 /* Set as beforeShowDay function to prevent selection of weekends.
                  * @param  date  Date - the date to customise
                  * @return [boolean, string] - is this date selectable?, what is its CSS class?
                  */
                 noWeekends: function (date) {
                     var day = date.getDay();
                     return [(day > 0 && day < 6), ""];
                 },
      
                 /* Set as calculateWeek to determine the week of the year based on the ISO 8601 definition.
                  * @param  date  Date - the date to get the week for
                  * @return  number - the number of the week within the year that contains this date
                  */
                 iso8601Week: function (date) {
                     var time,
                         checkDate = new Date(date.getTime());
      
                     // Find Thursday of this week starting on Monday
                     checkDate.setDate(checkDate.getDate() + 4 - (checkDate.getDay() || 7));
      
                     time = checkDate.getTime();
                     checkDate.setMonth(0); // Compare with Jan 1
                     checkDate.setDate(1);
                     return Math.floor(Math.round((time - checkDate) / 86400000) / 7) + 1;
                 },
      
                 /* Parse a string value into a date object.
                  * See formatDate below for the possible formats.
                  *
                  * @param  format string - the expected format of the date
                  * @param  value string - the date in the above format
                  * @param  settings Object - attributes include:
                  *					shortYearCutoff  number - the cutoff year for determining the century (optional)
                  *					dayNamesShort	string[7] - abbreviated names of the days from Sunday (optional)
                  *					dayNames		string[7] - names of the days from Sunday (optional)
                  *					monthNamesShort string[12] - abbreviated names of the months (optional)
                  *					monthNames		string[12] - names of the months (optional)
                  * @return  Date - the extracted date value or null if value is blank
                  */
                 parseDate: function (format, value, settings) {
                     if (format == null || value == null) {
                         throw "Invalid arguments";
                     }
      
                     value = (typeof value === "object" ? value.toString() : value + "");
                     if (value === "") {
                         return null;
                     }
      
                     var iFormat, dim, extra,
                         iValue = 0,
                         shortYearCutoffTemp = (settings ? settings.shortYearCutoff : null) || this
                         ._defaults.shortYearCutoff,
                         shortYearCutoff = (typeof shortYearCutoffTemp !== "string" ?
                             shortYearCutoffTemp :
                             new Date().getFullYear() % 100 + parseInt(shortYearCutoffTemp, 10)),
                         dayNamesShort = (settings ? settings.dayNamesShort : null) || this._defaults
                         .dayNamesShort,
                         dayNames = (settings ? settings.dayNames : null) || this._defaults.dayNames,
                         monthNamesShort = (settings ? settings.monthNamesShort : null) || this._defaults
                         .monthNamesShort,
                         monthNames = (settings ? settings.monthNames : null) || this._defaults
                         .monthNames,
                         year = -1,
                         month = -1,
                         day = -1,
                         doy = -1,
                         literal = false,
                         date,
      
                         // Check whether a format character is doubled
                         lookAhead = function (match) {
                             var matches = (iFormat + 1 < format.length && format.charAt(iFormat + 1) ===
                                 match);
                             if (matches) {
                                 iFormat++;
                             }
                             return matches;
                         },
      
                         // Extract a number from the string value
                         getNumber = function (match) {
                             var isDoubled = lookAhead(match),
                                 size = (match === "@" ? 14 : (match === "!" ? 20 :
                                     (match === "y" && isDoubled ? 4 : (match === "o" ? 3 : 2)))),
                                 minSize = (match === "y" ? size : 1),
                                 digits = new RegExp("^\\d{" + minSize + "," + size + "}"),
                                 num = value.substring(iValue).match(digits);
                             if (!num) {
                                 throw "Missing number at position " + iValue;
                             }
                             iValue += num[0].length;
                             return parseInt(num[0], 10);
                         },
      
                         // Extract a name from the string value and convert to an index
                         getName = function (match, shortNames, longNames) {
                             var index = -1,
                                 names = $.map(lookAhead(match) ? longNames : shortNames, function (v,
                                     k) {
                                     return [
                                         [k, v]
                                     ];
                                 }).sort(function (a, b) {
                                     return -(a[1].length - b[1].length);
                                 });
      
                             $.each(names, function (i, pair) {
                                 var name = pair[1];
                                 if (value.substr(iValue, name.length).toLowerCase() === name
                                     .toLowerCase()) {
                                     index = pair[0];
                                     iValue += name.length;
                                     return false;
                                 }
                             });
                             if (index !== -1) {
                                 return index + 1;
                             } else {
                                 throw "Unknown name at position " + iValue;
                             }
                         },
      
                         // Confirm that a literal character matches the string value
                         checkLiteral = function () {
                             if (value.charAt(iValue) !== format.charAt(iFormat)) {
                                 throw "Unexpected literal at position " + iValue;
                             }
                             iValue++;
                         };
      
                     for (iFormat = 0; iFormat < format.length; iFormat++) {
                         if (literal) {
                             if (format.charAt(iFormat) === "'" && !lookAhead("'")) {
                                 literal = false;
                             } else {
                                 checkLiteral();
                             }
                         } else {
                             switch (format.charAt(iFormat)) {
                                 case "d":
                                     day = getNumber("d");
                                     break;
                                 case "D":
                                     getName("D", dayNamesShort, dayNames);
                                     break;
                                 case "o":
                                     doy = getNumber("o");
                                     break;
                                 case "m":
                                     month = getNumber("m");
                                     break;
                                 case "M":
                                     month = getName("M", monthNamesShort, monthNames);
                                     break;
                                 case "y":
                                     year = getNumber("y");
                                     break;
                                 case "@":
                                     date = new Date(getNumber("@"));
                                     year = date.getFullYear();
                                     month = date.getMonth() + 1;
                                     day = date.getDate();
                                     break;
                                 case "!":
                                     date = new Date((getNumber("!") - this._ticksTo1970) / 10000);
                                     year = date.getFullYear();
                                     month = date.getMonth() + 1;
                                     day = date.getDate();
                                     break;
                                 case "'":
                                     if (lookAhead("'")) {
                                         checkLiteral();
                                     } else {
                                         literal = true;
                                     }
                                     break;
                                 default:
                                     checkLiteral();
                             }
                         }
                     }
      
                     if (iValue < value.length) {
                         extra = value.substr(iValue);
                         if (!/^\s+/.test(extra)) {
                             throw "Extra/unparsed characters found in date: " + extra;
                         }
                     }
      
                     if (year === -1) {
                         year = new Date().getFullYear();
                     } else if (year < 100) {
                         year += new Date().getFullYear() - new Date().getFullYear() % 100 +
                             (year <= shortYearCutoff ? 0 : -100);
                     }
      
                     if (doy > -1) {
                         month = 1;
                         day = doy;
                         do {
                             dim = this._getDaysInMonth(year, month - 1);
                             if (day <= dim) {
                                 break;
                             }
                             month++;
                             day -= dim;
                         } while (true);
                     }
      
                     date = this._daylightSavingAdjust(new Date(year, month - 1, day));
                     if (date.getFullYear() !== year || date.getMonth() + 1 !== month || date
                         .getDate() !== day) {
                         throw "Invalid date"; // E.g. 31/02/00
                     }
                     return date;
                 },
      
                 /* Standard date formats. */
                 ATOM: "yy-mm-dd", // RFC 3339 (ISO 8601)
                 COOKIE: "D, dd M yy",
                 ISO_8601: "yy-mm-dd",
                 RFC_822: "D, d M y",
                 RFC_850: "DD, dd-M-y",
                 RFC_1036: "D, d M y",
                 RFC_1123: "D, d M yy",
                 RFC_2822: "D, d M yy",
                 RSS: "D, d M y", // RFC 822
                 TICKS: "!",
                 TIMESTAMP: "@",
                 W3C: "yy-mm-dd", // ISO 8601
      
                 _ticksTo1970: (((1970 - 1) * 365 + Math.floor(1970 / 4) - Math.floor(1970 / 100) +
                     Math.floor(1970 / 400)) * 24 * 60 * 60 * 10000000),
      
                 /* Format a date object into a string value.
                  * The format can be combinations of the following:
                  * d  - day of month (no leading zero)
                  * dd - day of month (two digit)
                  * o  - day of year (no leading zeros)
                  * oo - day of year (three digit)
                  * D  - day name short
                  * DD - day name long
                  * m  - month of year (no leading zero)
                  * mm - month of year (two digit)
                  * M  - month name short
                  * MM - month name long
                  * y  - year (two digit)
                  * yy - year (four digit)
                  * @ - Unix timestamp (ms since 01/01/1970)
                  * ! - Windows ticks (100ns since 01/01/0001)
                  * "..." - literal text
                  *  - single quote
                  *
                  * @param  format string - the desired format of the date
                  * @param  date Date - the date value to format
                  * @param  settings Object - attributes include:
                  *					dayNamesShort	string[7] - abbreviated names of the days from Sunday (optional)
                  *					dayNames		string[7] - names of the days from Sunday (optional)
                  *					monthNamesShort string[12] - abbreviated names of the months (optional)
                  *					monthNames		string[12] - names of the months (optional)
                  * @return  string - the date in the above format
                  */
                 formatDate: function (format, date, settings) {
                     if (!date) {
                         return "";
                     }
      
                     var iFormat,
                         dayNamesShort = (settings ? settings.dayNamesShort : null) || this._defaults
                         .dayNamesShort,
                         dayNames = (settings ? settings.dayNames : null) || this._defaults.dayNames,
                         monthNamesShort = (settings ? settings.monthNamesShort : null) || this._defaults
                         .monthNamesShort,
                         monthNames = (settings ? settings.monthNames : null) || this._defaults
                         .monthNames,
      
                         // Check whether a format character is doubled
                         lookAhead = function (match) {
                             var matches = (iFormat + 1 < format.length && format.charAt(iFormat + 1) ===
                                 match);
                             if (matches) {
                                 iFormat++;
                             }
                             return matches;
                         },
      
                         // Format a number, with leading zero if necessary
                         formatNumber = function (match, value, len) {
                             var num = "" + value;
                             if (lookAhead(match)) {
                                 while (num.length < len) {
                                     num = "0" + num;
                                 }
                             }
                             return num;
                         },
      
                         // Format a name, short or long as requested
                         formatName = function (match, value, shortNames, longNames) {
                             return (lookAhead(match) ? longNames[value] : shortNames[value]);
                         },
                         output = "",
                         literal = false;
      
                     if (date) {
                         for (iFormat = 0; iFormat < format.length; iFormat++) {
                             if (literal) {
                                 if (format.charAt(iFormat) === "'" && !lookAhead("'")) {
                                     literal = false;
                                 } else {
                                     output += format.charAt(iFormat);
                                 }
                             } else {
                                 switch (format.charAt(iFormat)) {
                                     case "d":
                                         output += formatNumber("d", date.getDate(), 2);
                                         break;
                                     case "D":
                                         output += formatName("D", date.getDay(), dayNamesShort,
                                             dayNames);
                                         break;
                                     case "o":
                                         output += formatNumber("o",
                                             Math.round((new Date(date.getFullYear(), date
                                                         .getMonth(), date.getDate()).getTime() -
                                                     new Date(date.getFullYear(), 0, 0).getTime()) /
                                                 86400000), 3);
                                         break;
                                     case "m":
                                         output += formatNumber("m", date.getMonth() + 1, 2);
                                         break;
                                     case "M":
                                         output += formatName("M", date.getMonth(), monthNamesShort,
                                             monthNames);
                                         break;
                                     case "y":
                                         output += (lookAhead("y") ? date.getFullYear() :
                                             (date.getFullYear() % 100 < 10 ? "0" : "") + date
                                             .getFullYear() % 100);
                                         break;
                                     case "@":
                                         output += date.getTime();
                                         break;
                                     case "!":
                                         output += date.getTime() * 10000 + this._ticksTo1970;
                                         break;
                                     case "'":
                                         if (lookAhead("'")) {
                                             output += "'";
                                         } else {
                                             literal = true;
                                         }
                                         break;
                                     default:
                                         output += format.charAt(iFormat);
                                 }
                             }
                         }
                     }
                     return output;
                 },
      
                 /* Extract all possible characters from the date format. */
                 _possibleChars: function (format) {
                     var iFormat,
                         chars = "",
                         literal = false,
      
                         // Check whether a format character is doubled
                         lookAhead = function (match) {
                             var matches = (iFormat + 1 < format.length && format.charAt(iFormat + 1) ===
                                 match);
                             if (matches) {
                                 iFormat++;
                             }
                             return matches;
                         };
      
                     for (iFormat = 0; iFormat < format.length; iFormat++) {
                         if (literal) {
                             if (format.charAt(iFormat) === "'" && !lookAhead("'")) {
                                 literal = false;
                             } else {
                                 chars += format.charAt(iFormat);
                             }
                         } else {
                             switch (format.charAt(iFormat)) {
                                 case "d":
                                 case "m":
                                 case "y":
                                 case "@":
                                     chars += "0123456789";
                                     break;
                                 case "D":
                                 case "M":
                                     return null; // Accept anything
                                 case "'":
                                     if (lookAhead("'")) {
                                         chars += "'";
                                     } else {
                                         literal = true;
                                     }
                                     break;
                                 default:
                                     chars += format.charAt(iFormat);
                             }
                         }
                     }
                     return chars;
                 },
      
                 /* Get a setting value, defaulting if necessary. */
                 _get: function (inst, name) {
                     return inst.settings[name] !== undefined ?
                         inst.settings[name] : this._defaults[name];
                 },
      
                 /* Parse existing date and initialise date picker. */
                 _setDateFromField: function (inst, noDefault) {
                     if (inst.input.val() === inst.lastVal) {
                         return;
                     }
      
                     var dateFormat = this._get(inst, "dateFormat"),
                         dates = inst.lastVal = inst.input ? inst.input.val() : null,
                         defaultDate = this._getDefaultDate(inst),
                         date = defaultDate,
                         settings = this._getFormatConfig(inst);
      
                     try {
                         date = this.parseDate(dateFormat, dates, settings) || defaultDate;
                     } catch (event) {
                         dates = (noDefault ? "" : dates);
                     }
                     inst.selectedDay = date.getDate();
                     inst.drawMonth = inst.selectedMonth = date.getMonth();
                     inst.drawYear = inst.selectedYear = date.getFullYear();
                     inst.currentDay = (dates ? date.getDate() : 0);
                     inst.currentMonth = (dates ? date.getMonth() : 0);
                     inst.currentYear = (dates ? date.getFullYear() : 0);
                     this._adjustInstDate(inst);
                 },
      
                 /* Retrieve the default date shown on opening. */
                 _getDefaultDate: function (inst) {
                     return this._restrictMinMax(inst,
                         this._determineDate(inst, this._get(inst, "defaultDate"), new Date()));
                 },
      
                 /* A date may be specified as an exact value or a relative one. */
                 _determineDate: function (inst, date, defaultDate) {
                     var offsetNumeric = function (offset) {
                             var date = new Date();
                             date.setDate(date.getDate() + offset);
                             return date;
                         },
                         offsetString = function (offset) {
                             try {
                                 return $.datepicker.parseDate($.datepicker._get(inst, "dateFormat"),
                                     offset, $.datepicker._getFormatConfig(inst));
                             } catch (e) {
      
                                 // Ignore
                             }
      
                             var date = (offset.toLowerCase().match(/^c/) ?
                                     $.datepicker._getDate(inst) : null) || new Date(),
                                 year = date.getFullYear(),
                                 month = date.getMonth(),
                                 day = date.getDate(),
                                 pattern = /([+\-]?[0-9]+)\s*(d|D|w|W|m|M|y|Y)?/g,
                                 matches = pattern.exec(offset);
      
                             while (matches) {
                                 switch (matches[2] || "d") {
                                     case "d":
                                     case "D":
                                         day += parseInt(matches[1], 10);
                                         break;
                                     case "w":
                                     case "W":
                                         day += parseInt(matches[1], 10) * 7;
                                         break;
                                     case "m":
                                     case "M":
                                         month += parseInt(matches[1], 10);
                                         day = Math.min(day, $.datepicker._getDaysInMonth(year, month));
                                         break;
                                     case "y":
                                     case "Y":
                                         year += parseInt(matches[1], 10);
                                         day = Math.min(day, $.datepicker._getDaysInMonth(year, month));
                                         break;
                                 }
                                 matches = pattern.exec(offset);
                             }
                             return new Date(year, month, day);
                         },
                         newDate = (date == null || date === "" ? defaultDate : (typeof date ===
                             "string" ? offsetString(date) :
                             (typeof date === "number" ? (isNaN(date) ? defaultDate : offsetNumeric(
                                 date)) : new Date(date.getTime()))));
      
                     newDate = (newDate && newDate.toString() === "Invalid Date" ? defaultDate :
                         newDate);
                     if (newDate) {
                         newDate.setHours(0);
                         newDate.setMinutes(0);
                         newDate.setSeconds(0);
                         newDate.setMilliseconds(0);
                     }
                     return this._daylightSavingAdjust(newDate);
                 },
      
                 /* Handle switch to/from daylight saving.
                  * Hours may be non-zero on daylight saving cut-over:
                  * > 12 when midnight changeover, but then cannot generate
                  * midnight datetime, so jump to 1AM, otherwise reset.
                  * @param  date  (Date) the date to check
                  * @return  (Date) the corrected date
                  */
                 _daylightSavingAdjust: function (date) {
                     if (!date) {
                         return null;
                     }
                     date.setHours(date.getHours() > 12 ? date.getHours() + 2 : 0);
                     return date;
                 },
      
                 /* Set the date(s) directly. */
                 _setDate: function (inst, date, noChange) {
                     var clear = !date,
                         origMonth = inst.selectedMonth,
                         origYear = inst.selectedYear,
                         newDate = this._restrictMinMax(inst, this._determineDate(inst, date,
                             new Date()));
      
                     inst.selectedDay = inst.currentDay = newDate.getDate();
                     inst.drawMonth = inst.selectedMonth = inst.currentMonth = newDate.getMonth();
                     inst.drawYear = inst.selectedYear = inst.currentYear = newDate.getFullYear();
                     if ((origMonth !== inst.selectedMonth || origYear !== inst.selectedYear) && !
                         noChange) {
                         this._notifyChange(inst);
                     }
                     this._adjustInstDate(inst);
                     if (inst.input) {
                         inst.input.val(clear ? "" : this._formatDate(inst));
                     }
                 },
      
                 /* Retrieve the date(s) directly. */
                 _getDate: function (inst) {
                     var startDate = (!inst.currentYear || (inst.input && inst.input.val() === "") ?
                         null :
                         this._daylightSavingAdjust(new Date(
                             inst.currentYear, inst.currentMonth, inst.currentDay)));
                     return startDate;
                 },
      
                 /* Attach the onxxx handlers.  These are declared statically so
                  * they work with static code transformers like Caja.
                  */
                 _attachHandlers: function (inst) {
                     var stepMonths = this._get(inst, "stepMonths"),
                         id = "#" + inst.id.replace(/\\\\/g, "\\");
                     inst.dpDiv.find("[data-handler]").map(function () {
                         var handler = {
                             prev: function () {
                                 $.datepicker._adjustDate(id, -stepMonths, "M");
                             },
                             next: function () {
                                 $.datepicker._adjustDate(id, +stepMonths, "M");
                             },
                             hide: function () {
                                 $.datepicker._hideDatepicker();
                             },
                             today: function () {
                                 $.datepicker._gotoToday(id);
                             },
                             selectDay: function () {
                                 $.datepicker._selectDay(id, +this.getAttribute(
                                     "data-month"), +this.getAttribute(
                                     "data-year"), this);
                                 return false;
                             },
                             selectMonth: function () {
                                 $.datepicker._selectMonthYear(id, this, "M");
                                 return false;
                             },
                             selectYear: function () {
                                 $.datepicker._selectMonthYear(id, this, "Y");
                                 return false;
                             }
                         };
                         $(this).on(this.getAttribute("data-event"), handler[this.getAttribute(
                             "data-handler")]);
                     });
                 },
      
                 /* Generate the HTML for the current state of the date picker. */
                 _generateHTML: function (inst) {
                     var maxDraw, prevText, prev, nextText, next, currentText, gotoDate,
                         controls, buttonPanel, firstDay, showWeek, dayNames, dayNamesMin,
                         monthNames, monthNamesShort, beforeShowDay, showOtherMonths,
                         selectOtherMonths, defaultDate, html, dow, row, group, col, selectedDate,
                         cornerClass, calender, thead, day, daysInMonth, leadDays, curRows, numRows,
                         printDate, dRow, tbody, daySettings, otherMonth, unselectable,
                         tempDate = new Date(),
                         today = this._daylightSavingAdjust(
                             new Date(tempDate.getFullYear(), tempDate.getMonth(), tempDate.getDate())
                         ), // clear time
                         isRTL = this._get(inst, "isRTL"),
                         showButtonPanel = this._get(inst, "showButtonPanel"),
                         hideIfNoPrevNext = this._get(inst, "hideIfNoPrevNext"),
                         navigationAsDateFormat = this._get(inst, "navigationAsDateFormat"),
                         numMonths = this._getNumberOfMonths(inst),
                         showCurrentAtPos = this._get(inst, "showCurrentAtPos"),
                         stepMonths = this._get(inst, "stepMonths"),
                         isMultiMonth = (numMonths[0] !== 1 || numMonths[1] !== 1),
                         currentDate = this._daylightSavingAdjust((!inst.currentDay ? new Date(9999, 9,
                                 9) :
                             new Date(inst.currentYear, inst.currentMonth, inst.currentDay))),
                         minDate = this._getMinMaxDate(inst, "min"),
                         maxDate = this._getMinMaxDate(inst, "max"),
                         drawMonth = inst.drawMonth - showCurrentAtPos,
                         drawYear = inst.drawYear;
      
                     if (drawMonth < 0) {
                         drawMonth += 12;
                         drawYear--;
                     }
                     if (maxDate) {
                         maxDraw = this._daylightSavingAdjust(new Date(maxDate.getFullYear(),
                             maxDate.getMonth() - (numMonths[0] * numMonths[1]) + 1, maxDate
                             .getDate()));
                         maxDraw = (minDate && maxDraw < minDate ? minDate : maxDraw);
                         while (this._daylightSavingAdjust(new Date(drawYear, drawMonth, 1)) > maxDraw) {
                             drawMonth--;
                             if (drawMonth < 0) {
                                 drawMonth = 11;
                                 drawYear--;
                             }
                         }
                     }
                     inst.drawMonth = drawMonth;
                     inst.drawYear = drawYear;
      
                     prevText = this._get(inst, "prevText");
                     prevText = (!navigationAsDateFormat ? prevText : this.formatDate(prevText,
                         this._daylightSavingAdjust(new Date(drawYear, drawMonth - stepMonths,
                             1)),
                         this._getFormatConfig(inst)));
      
                     prev = (this._canAdjustMonth(inst, -1, drawYear, drawMonth) ?
                         "<a class='ui-datepicker-prev ui-corner-all' data-handler='prev' data-event='click'" +
                         " title='" + prevText + "'>" + prevText + "</a>" :
                         (hideIfNoPrevNext ? "" :
                             "<a class='ui-datepicker-prev ui-corner-all ui-state-disabled' title='" +
                             prevText + "'>" + prevText + "</a>"));
      
                     nextText = this._get(inst, "nextText");
                     nextText = (!navigationAsDateFormat ? nextText : this.formatDate(nextText,
                         this._daylightSavingAdjust(new Date(drawYear, drawMonth + stepMonths,
                             1)),
                         this._getFormatConfig(inst)));
      
                     next = (this._canAdjustMonth(inst, +1, drawYear, drawMonth) ?
                         "<a class='ui-datepicker-next ui-corner-all' data-handler='next' data-event='click'" +
                         " title='" + nextText + "'>" + nextText + "</a>" :
                         (hideIfNoPrevNext ? "" :
                             "<a class='ui-datepicker-next ui-corner-all ui-state-disabled' title='" +
                             nextText + "'>" + nextText + "</a>"));
      
                     currentText = this._get(inst, "currentText");
                     gotoDate = (this._get(inst, "gotoCurrent") && inst.currentDay ? currentDate :
                         today);
                     currentText = (!navigationAsDateFormat ? currentText :
                         this.formatDate(currentText, gotoDate, this._getFormatConfig(inst)));
      
                     controls = (!inst.inline ?
                         "<button type='button' class='ui-datepicker-close ui-state-default ui-priority-primary ui-corner-all' data-handler='hide' data-event='click'>" +
                         this._get(inst, "closeText") + "</button>" : "");
      
                     buttonPanel = (showButtonPanel) ?
      
      "
      " + (isRTL ? controls :
                             "") +
                         (this._isInRange(inst, gotoDate) ?
                             "<button type='button' class='ui-datepicker-current ui-state-default ui-priority-secondary ui-corner-all' data-handler='today' data-event='click'" +
      
      ">" + currentText + "</button>" : "") + (isRTL ? "" : controls) + "
      " :
                         "";
      
                     firstDay = parseInt(this._get(inst, "firstDay"), 10);
                     firstDay = (isNaN(firstDay) ? 0 : firstDay);
      
                     showWeek = this._get(inst, "showWeek");
                     dayNames = this._get(inst, "dayNames");
                     dayNamesMin = this._get(inst, "dayNamesMin");
                     monthNames = this._get(inst, "monthNames");
                     monthNamesShort = this._get(inst, "monthNamesShort");
                     beforeShowDay = this._get(inst, "beforeShowDay");
                     showOtherMonths = this._get(inst, "showOtherMonths");
                     selectOtherMonths = this._get(inst, "selectOtherMonths");
                     defaultDate = this._getDefaultDate(inst);
                     html = "";
      
                     for (row = 0; row < numMonths[0]; row++) {
                         group = "";
                         this.maxRows = 4;
                         for (col = 0; col < numMonths[1]; col++) {
                             selectedDate = this._daylightSavingAdjust(new Date(drawYear, drawMonth, inst
                                 .selectedDay));
                             cornerClass = " ui-corner-all";
                             calender = "";
                             if (isMultiMonth) {
      
      calender += "
      1) {
                                     switch (col) {
                                         case 0:
                                             calender += " ui-datepicker-group-first";
                                             cornerClass = " ui-corner-" + (isRTL ? "right" : "left");
                                             break;
                                         case numMonths[1] - 1:
                                             calender += " ui-datepicker-group-last";
                                             cornerClass = " ui-corner-" + (isRTL ? "left" : "right");
                                             break;
                                         default:
                                             calender += " ui-datepicker-group-middle";
                                             cornerClass = "";
                                             break;
                                     }
                                 }
                                 calender += "'>";
                             }
                             calender +=
      
      "
      " +
                                 (/all|left/.test(cornerClass) && row === 0 ? (isRTL ? next : prev) :
                                     "") +
                                 (/all|right/.test(cornerClass) && row === 0 ? (isRTL ? prev : next) :
                                     "") +
                                 this._generateMonthYearHeader(inst, drawMonth, drawYear, minDate,
                                     maxDate,
                                     row > 0 || col > 0, monthNames, monthNamesShort) +
                                 // draw month headers
      
      "
      <thead>" + ""; thead = (showWeek ? "" : ""); for (dow = 0; dow < 7; dow++) { // days of the week day = (dow + firstDay) % 7; thead += ""; } calender += thead + "</thead><tbody>"; daysInMonth = this._getDaysInMonth(drawYear, drawMonth); if (drawYear === inst.selectedYear && drawMonth === inst.selectedMonth) { inst.selectedDay = Math.min(inst.selectedDay, daysInMonth); } leadDays = (this._getFirstDayOfMonth(drawYear, drawMonth) - firstDay + 7) % 7; curRows = Math.ceil((leadDays + daysInMonth) / 7); // calculate the number of rows to generate numRows = (isMultiMonth ? this.maxRows > curRows ? this.maxRows : curRows : curRows ); //If multiple months, use the higher number of rows (see #7043) this.maxRows = numRows; printDate = this._daylightSavingAdjust(new Date(drawYear, drawMonth, 1 - leadDays)); for (dRow = 0; dRow < numRows; dRow++) { // create date picker rows calender += ""; tbody = (!showWeek ? "" : ""); for (dow = 0; dow < 7; dow++) { // create date picker days daySettings = (beforeShowDay ? beforeShowDay.apply((inst.input ? inst.input[0] : null), [ printDate ]) : [true, ""]); otherMonth = (printDate.getMonth() !== drawMonth); unselectable = (otherMonth && !selectOtherMonths) || !daySettings[ 0] || (minDate && printDate < minDate) || (maxDate && printDate > maxDate); tbody += ""; // display selectable date printDate.setDate(printDate.getDate() + 1); printDate = this._daylightSavingAdjust(printDate); } calender += tbody + ""; } drawMonth++; if (drawMonth > 11) { drawMonth = 0; drawYear++; } calender += "</tbody>
      " + this._get(inst, "weekHeader") + "= 5 ?
                                         " class='ui-datepicker-week-end'" : "") + ">" +
                                     "" + dayNamesMin[day] +
      
      "
      " + this._get(inst, "calculateWeek")(printDate) + "= 5 ? " ui-datepicker-week-end" :
                                             "") + // highlight weekends
                                         (otherMonth ? " ui-datepicker-other-month" : "") +
                                         // highlight days from other months
                                         ((printDate.getTime() === selectedDate.getTime() &&
                                                 drawMonth === inst.selectedMonth && inst._keyEvent) ||
                                             // user pressed key
                                             (defaultDate.getTime() === printDate.getTime() &&
                                                 defaultDate.getTime() === selectedDate.getTime()) ?
      
                                             // or defaultDate is current printedDate and defaultDate is selectedDate
                                             " " + this._dayOverClass : "") + // highlight selected day
                                         (unselectable ? " " + this._unselectableClass +
                                             " ui-state-disabled" : "") + // highlight unselectable days
                                         (otherMonth && !showOtherMonths ? "" : " " + daySettings[1] +
                                             // highlight custom dates
                                             (printDate.getTime() === currentDate.getTime() ? " " + this
                                                 ._currentClass : "") + // highlight selected day
                                             (printDate.getTime() === today.getTime() ?
                                                 " ui-datepicker-today" : "")) + "'" +
                                         // highlight today (if different)
                                         ((!otherMonth || showOtherMonths) && daySettings[2] ?
                                             " title='" + daySettings[2].replace(/'/g, "'") + "'" :
                                             "") + // cell title
                                         (unselectable ? "" :
                                             " data-handler='selectDay' data-event='click' data-month='" +
                                             printDate.getMonth() + "' data-year='" + printDate
                                             .getFullYear() + "'") + ">" + // actions
                                         (otherMonth && !showOtherMonths ? " " :
                                             // display for other months
                                             (unselectable ? "" +
                                                 printDate.getDate() + "" :
                                                 "<a class='ui-state-default" +
                                                 (printDate.getTime() === today.getTime() ?
                                                     " ui-state-highlight" : "") +
                                                 (printDate.getTime() === currentDate.getTime() ?
                                                     " ui-state-active" : "") + // highlight selected day
                                                 (otherMonth ? " ui-priority-secondary" : "") +
                                                 // distinguish dates from other months
                                                 "' href='#'>" + printDate.getDate() + "</a>")) +
      
      "
      " + (isMultiMonth ? "
      " +
                                 ((numMonths[0] > 0 && col === numMonths[1] - 1) ?
      
      "
      " : "") : "");
                             group += calender;
                         }
                         html += group;
                     }
                     html += buttonPanel;
                     inst._keyEvent = false;
                     return html;
                 },
      
                 /* Generate the month and year header. */
                 _generateMonthYearHeader: function (inst, drawMonth, drawYear, minDate, maxDate,
                     secondary, monthNames, monthNamesShort) {
      
                     var inMinYear, inMaxYear, month, years, thisYear, determineYear, year, endYear,
                         changeMonth = this._get(inst, "changeMonth"),
                         changeYear = this._get(inst, "changeYear"),
                         showMonthAfterYear = this._get(inst, "showMonthAfterYear"),
      
      html = "
      ",
                         monthHtml = "";
      
                     // Month selection
                     if (secondary || !changeMonth) {
                         monthHtml += "" + monthNames[drawMonth] +
                             "";
                     } else {
                         inMinYear = (minDate && minDate.getFullYear() === drawYear);
                         inMaxYear = (maxDate && maxDate.getFullYear() === drawYear);
                         monthHtml +=
                             "<select class='ui-datepicker-month' data-handler='selectMonth' data-event='change'>";
                         for (month = 0; month < 12; month++) {
                             if ((!inMinYear || month >= minDate.getMonth()) && (!inMaxYear || month <=
                                     maxDate.getMonth())) {
                                 monthHtml += "<option value='" + month + "'" +
                                     (month === drawMonth ? " selected='selected'" : "") +
                                     ">" + monthNamesShort[month] + "</option>";
                             }
                         }
                         monthHtml += "</select>";
                     }
      
                     if (!showMonthAfterYear) {
                         html += monthHtml + (secondary || !(changeMonth && changeYear) ? " " : "");
                     }
      
                     // Year selection
                     if (!inst.yearshtml) {
                         inst.yearshtml = "";
                         if (secondary || !changeYear) {
                             html += "" + drawYear + "";
                         } else {
      
                             // determine range of years to display
                             years = this._get(inst, "yearRange").split(":");
                             thisYear = new Date().getFullYear();
                             determineYear = function (value) {
                                 var year = (value.match(/c[+\-].*/) ? drawYear + parseInt(value
                                         .substring(1), 10) :
                                     (value.match(/[+\-].*/) ? thisYear + parseInt(value, 10) :
                                         parseInt(value, 10)));
                                 return (isNaN(year) ? thisYear : year);
                             };
                             year = determineYear(years[0]);
                             endYear = Math.max(year, determineYear(years[1] || ""));
                             year = (minDate ? Math.max(year, minDate.getFullYear()) : year);
                             endYear = (maxDate ? Math.min(endYear, maxDate.getFullYear()) : endYear);
                             inst.yearshtml +=
                                 "<select class='ui-datepicker-year' data-handler='selectYear' data-event='change'>";
                             for (; year <= endYear; year++) {
                                 inst.yearshtml += "<option value='" + year + "'" +
                                     (year === drawYear ? " selected='selected'" : "") +
                                     ">" + year + "</option>";
                             }
                             inst.yearshtml += "</select>";
      
                             html += inst.yearshtml;
                             inst.yearshtml = null;
                         }
                     }
      
                     html += this._get(inst, "yearSuffix");
                     if (showMonthAfterYear) {
                         html += (secondary || !(changeMonth && changeYear) ? " " : "") + monthHtml;
                     }
      
      html += "
      "; // Close datepicker_header
                     return html;
                 },
      
                 /* Adjust one of the date sub-fields. */
                 _adjustInstDate: function (inst, offset, period) {
                     var year = inst.selectedYear + (period === "Y" ? offset : 0),
                         month = inst.selectedMonth + (period === "M" ? offset : 0),
                         day = Math.min(inst.selectedDay, this._getDaysInMonth(year, month)) + (
                             period === "D" ? offset : 0),
                         date = this._restrictMinMax(inst, this._daylightSavingAdjust(new Date(year,
                             month, day)));
      
                     inst.selectedDay = date.getDate();
                     inst.drawMonth = inst.selectedMonth = date.getMonth();
                     inst.drawYear = inst.selectedYear = date.getFullYear();
                     if (period === "M" || period === "Y") {
                         this._notifyChange(inst);
                     }
                 },
      
                 /* Ensure a date is within any min/max bounds. */
                 _restrictMinMax: function (inst, date) {
                     var minDate = this._getMinMaxDate(inst, "min"),
                         maxDate = this._getMinMaxDate(inst, "max"),
                         newDate = (minDate && date < minDate ? minDate : date);
                     return (maxDate && newDate > maxDate ? maxDate : newDate);
                 },
      
                 /* Notify change of month/year. */
                 _notifyChange: function (inst) {
                     var onChange = this._get(inst, "onChangeMonthYear");
                     if (onChange) {
                         onChange.apply((inst.input ? inst.input[0] : null),
                             [inst.selectedYear, inst.selectedMonth + 1, inst]);
                     }
                 },
      
                 /* Determine the number of months to show. */
                 _getNumberOfMonths: function (inst) {
                     var numMonths = this._get(inst, "numberOfMonths");
                     return (numMonths == null ? [1, 1] : (typeof numMonths === "number" ? [1,
                         numMonths
                     ] : numMonths));
                 },
      
                 /* Determine the current maximum date - ensure no time components are set. */
                 _getMinMaxDate: function (inst, minMax) {
                     return this._determineDate(inst, this._get(inst, minMax + "Date"), null);
                 },
      
                 /* Find the number of days in a given month. */
                 _getDaysInMonth: function (year, month) {
                     return 32 - this._daylightSavingAdjust(new Date(year, month, 32)).getDate();
                 },
      
                 /* Find the day of the week of the first of a month. */
                 _getFirstDayOfMonth: function (year, month) {
                     return new Date(year, month, 1).getDay();
                 },
      
                 /* Determines if we should allow a "next/prev" month display change. */
                 _canAdjustMonth: function (inst, offset, curYear, curMonth) {
                     var numMonths = this._getNumberOfMonths(inst),
                         date = this._daylightSavingAdjust(new Date(curYear,
                             curMonth + (offset < 0 ? offset : numMonths[0] * numMonths[1]), 1));
      
                     if (offset < 0) {
                         date.setDate(this._getDaysInMonth(date.getFullYear(), date.getMonth()));
                     }
                     return this._isInRange(inst, date);
                 },
      
                 /* Is the given date in the accepted range? */
                 _isInRange: function (inst, date) {
                     var yearSplit, currentYear,
                         minDate = this._getMinMaxDate(inst, "min"),
                         maxDate = this._getMinMaxDate(inst, "max"),
                         minYear = null,
                         maxYear = null,
                         years = this._get(inst, "yearRange");
                     if (years) {
                         yearSplit = years.split(":");
                         currentYear = new Date().getFullYear();
                         minYear = parseInt(yearSplit[0], 10);
                         maxYear = parseInt(yearSplit[1], 10);
                         if (yearSplit[0].match(/[+\-].*/)) {
                             minYear += currentYear;
                         }
                         if (yearSplit[1].match(/[+\-].*/)) {
                             maxYear += currentYear;
                         }
                     }
      
                     return ((!minDate || date.getTime() >= minDate.getTime()) &&
                         (!maxDate || date.getTime() <= maxDate.getTime()) &&
                         (!minYear || date.getFullYear() >= minYear) &&
                         (!maxYear || date.getFullYear() <= maxYear));
                 },
      
                 /* Provide the configuration settings for formatting/parsing. */
                 _getFormatConfig: function (inst) {
                     var shortYearCutoff = this._get(inst, "shortYearCutoff");
                     shortYearCutoff = (typeof shortYearCutoff !== "string" ? shortYearCutoff :
                         new Date().getFullYear() % 100 + parseInt(shortYearCutoff, 10));
                     return {
                         shortYearCutoff: shortYearCutoff,
                         dayNamesShort: this._get(inst, "dayNamesShort"),
                         dayNames: this._get(inst, "dayNames"),
                         monthNamesShort: this._get(inst, "monthNamesShort"),
                         monthNames: this._get(inst, "monthNames")
                     };
                 },
      
                 /* Format the given date for display. */
                 _formatDate: function (inst, day, month, year) {
                     if (!day) {
                         inst.currentDay = inst.selectedDay;
                         inst.currentMonth = inst.selectedMonth;
                         inst.currentYear = inst.selectedYear;
                     }
                     var date = (day ? (typeof day === "object" ? day :
                             this._daylightSavingAdjust(new Date(year, month, day))) :
                         this._daylightSavingAdjust(new Date(inst.currentYear, inst.currentMonth,
                             inst.currentDay)));
                     return this.formatDate(this._get(inst, "dateFormat"), date, this._getFormatConfig(
                         inst));
                 }
             });
      
             /*
              * Bind hover events for datepicker elements.
              * Done via delegate so the binding only occurs once in the lifetime of the parent div.
              * Global datepicker_instActive, set by _updateDatepicker allows the handlers to find their way back to the active picker.
              */
             function datepicker_bindHover(dpDiv) {
                 var selector = "button, .ui-datepicker-prev, .ui-datepicker-next, .ui-datepicker-calendar td a";
                 return dpDiv.on("mouseout", selector, function () {
                         $(this).removeClass("ui-state-hover");
                         if (this.className.indexOf("ui-datepicker-prev") !== -1) {
                             $(this).removeClass("ui-datepicker-prev-hover");
                         }
                         if (this.className.indexOf("ui-datepicker-next") !== -1) {
                             $(this).removeClass("ui-datepicker-next-hover");
                         }
                     })
                     .on("mouseover", selector, datepicker_handleMouseover);
             }
      
             function datepicker_handleMouseover() {
                 if (!$.datepicker._isDisabledDatepicker(datepicker_instActive.inline ? datepicker_instActive.dpDiv
                         .parent()[0] : datepicker_instActive.input[0])) {
                     $(this).parents(".ui-datepicker-calendar").find("a").removeClass("ui-state-hover");
                     $(this).addClass("ui-state-hover");
                     if (this.className.indexOf("ui-datepicker-prev") !== -1) {
                         $(this).addClass("ui-datepicker-prev-hover");
                     }
                     if (this.className.indexOf("ui-datepicker-next") !== -1) {
                         $(this).addClass("ui-datepicker-next-hover");
                     }
                 }
             }
      
             /* jQuery extend now ignores nulls! */
             function datepicker_extendRemove(target, props) {
                 $.extend(target, props);
                 for (var name in props) {
                     if (props[name] == null) {
                         target[name] = props[name];
                     }
                 }
                 return target;
             }
      
             /* Invoke the datepicker functionality.
                @param  options  string - a command, optionally followed by additional parameters or
             					Object - settings for attaching new datepicker functionality
                @return  jQuery object */
             $.fn.datepicker = function (options) {
      
                 /* Verify an empty collection wasn't passed - Fixes #6976 */
                 if (!this.length) {
                     return this;
                 }
      
                 /* Initialise the date picker. */
                 if (!$.datepicker.initialized) {
                     $(document).on("mousedown", $.datepicker._checkExternalClick);
                     $.datepicker.initialized = true;
                 }
      
                 /* Append datepicker main container to body if not exist. */
                 if ($("#" + $.datepicker._mainDivId).length === 0) {
                     $("body").append($.datepicker.dpDiv);
                 }
      
                 var otherArgs = Array.prototype.slice.call(arguments, 1);
                 if (typeof options === "string" && (options === "isDisabled" || options === "getDate" ||
                         options === "widget")) {
                     return $.datepicker["_" + options + "Datepicker"].
                     apply($.datepicker, [this[0]].concat(otherArgs));
                 }
                 if (options === "option" && arguments.length === 2 && typeof arguments[1] === "string") {
                     return $.datepicker["_" + options + "Datepicker"].
                     apply($.datepicker, [this[0]].concat(otherArgs));
                 }
                 return this.each(function () {
                     typeof options === "string" ?
                         $.datepicker["_" + options + "Datepicker"].
                     apply($.datepicker, [this].concat(otherArgs)):
                         $.datepicker._attachDatepicker(this, options);
                 });
             };
      
             $.datepicker = new Datepicker(); // singleton instance
             $.datepicker.initialized = false;
             $.datepicker.uuid = new Date().getTime();
             $.datepicker.version = "1.12.1";
      
             var widgetsDatepicker = $.datepicker;
      



             // This file is deprecated
             var ie = $.ui.ie = !!/msie [\w.]+/.exec(navigator.userAgent.toLowerCase());
      
             /*!
              * jQuery UI Mouse 1.12.1
              * http://jqueryui.com
              *
              * Copyright jQuery Foundation and other contributors
              * Released under the MIT license.
              * http://jquery.org/license
              */
      
             //>>label: Mouse
             //>>group: Widgets
             //>>description: Abstracts mouse-based interactions to assist in creating certain widgets.
             //>>docs: http://api.jqueryui.com/mouse/
      


             var mouseHandled = false;
             $(document).on("mouseup", function () {
                 mouseHandled = false;
             });
      
             var widgetsMouse = $.widget("ui.mouse", {
                 version: "1.12.1",
                 options: {
                     cancel: "input, textarea, button, select, option",
                     distance: 1,
                     delay: 0
                 },
                 _mouseInit: function () {
                     var that = this;
      
                     this.element
                         .on("mousedown." + this.widgetName, function (event) {
                             return that._mouseDown(event);
                         })
                         .on("click." + this.widgetName, function (event) {
                             if (true === $.data(event.target, that.widgetName +
                                     ".preventClickEvent")) {
                                 $.removeData(event.target, that.widgetName + ".preventClickEvent");
                                 event.stopImmediatePropagation();
                                 return false;
                             }
                         });
      
                     this.started = false;
                 },
      
                 // TODO: make sure destroying one instance of mouse doesn't mess with
                 // other instances of mouse
                 _mouseDestroy: function () {
                     this.element.off("." + this.widgetName);
                     if (this._mouseMoveDelegate) {
                         this.document
                             .off("mousemove." + this.widgetName, this._mouseMoveDelegate)
                             .off("mouseup." + this.widgetName, this._mouseUpDelegate);
                     }
                 },
      
                 _mouseDown: function (event) {
      
                     // don't let more than one widget handle mouseStart
                     if (mouseHandled) {
                         return;
                     }
      
                     this._mouseMoved = false;
      
                     // We may have missed mouseup (out of window)
                     (this._mouseStarted && this._mouseUp(event));
      
                     this._mouseDownEvent = event;
      
                     var that = this,
                         btnIsLeft = (event.which === 1),
      
                         // event.target.nodeName works around a bug in IE 8 with
                         // disabled inputs (#7620)
                         elIsCancel = (typeof this.options.cancel === "string" && event.target.nodeName ?
                             $(event.target).closest(this.options.cancel).length : false);
                     if (!btnIsLeft || elIsCancel || !this._mouseCapture(event)) {
                         return true;
                     }
      
                     this.mouseDelayMet = !this.options.delay;
                     if (!this.mouseDelayMet) {
                         this._mouseDelayTimer = setTimeout(function () {
                             that.mouseDelayMet = true;
                         }, this.options.delay);
                     }
      
                     if (this._mouseDistanceMet(event) && this._mouseDelayMet(event)) {
                         this._mouseStarted = (this._mouseStart(event) !== false);
                         if (!this._mouseStarted) {
                             event.preventDefault();
                             return true;
                         }
                     }
      
                     // Click event may never have fired (Gecko & Opera)
                     if (true === $.data(event.target, this.widgetName + ".preventClickEvent")) {
                         $.removeData(event.target, this.widgetName + ".preventClickEvent");
                     }
      
                     // These delegates are required to keep context
                     this._mouseMoveDelegate = function (event) {
                         return that._mouseMove(event);
                     };
                     this._mouseUpDelegate = function (event) {
                         return that._mouseUp(event);
                     };
      
                     this.document
                         .on("mousemove." + this.widgetName, this._mouseMoveDelegate)
                         .on("mouseup." + this.widgetName, this._mouseUpDelegate);
      
                     event.preventDefault();
      
                     mouseHandled = true;
                     return true;
                 },
      
                 _mouseMove: function (event) {
      
                     // Only check for mouseups outside the document if you've moved inside the document
                     // at least once. This prevents the firing of mouseup in the case of IE<9, which will
                     // fire a mousemove event if content is placed under the cursor. See #7778
                     // Support: IE <9
                     if (this._mouseMoved) {
      
                         // IE mouseup check - mouseup happened when mouse was out of window
                         if ($.ui.ie && (!document.documentMode || document.documentMode < 9) &&
                             !event.button) {
                             return this._mouseUp(event);
      
                             // Iframe mouseup check - mouseup occurred in another document
                         } else if (!event.which) {
      
                             // Support: Safari <=8 - 9
                             // Safari sets which to 0 if you press any of the following keys
                             // during a drag (#14461)
                             if (event.originalEvent.altKey || event.originalEvent.ctrlKey ||
                                 event.originalEvent.metaKey || event.originalEvent.shiftKey) {
                                 this.ignoreMissingWhich = true;
                             } else if (!this.ignoreMissingWhich) {
                                 return this._mouseUp(event);
                             }
                         }
                     }
      
                     if (event.which || event.button) {
                         this._mouseMoved = true;
                     }
      
                     if (this._mouseStarted) {
                         this._mouseDrag(event);
                         return event.preventDefault();
                     }
      
                     if (this._mouseDistanceMet(event) && this._mouseDelayMet(event)) {
                         this._mouseStarted =
                             (this._mouseStart(this._mouseDownEvent, event) !== false);
                         (this._mouseStarted ? this._mouseDrag(event) : this._mouseUp(event));
                     }
      
                     return !this._mouseStarted;
                 },
      
                 _mouseUp: function (event) {
                     this.document
                         .off("mousemove." + this.widgetName, this._mouseMoveDelegate)
                         .off("mouseup." + this.widgetName, this._mouseUpDelegate);
      
                     if (this._mouseStarted) {
                         this._mouseStarted = false;
      
                         if (event.target === this._mouseDownEvent.target) {
                             $.data(event.target, this.widgetName + ".preventClickEvent", true);
                         }
      
                         this._mouseStop(event);
                     }
      
                     if (this._mouseDelayTimer) {
                         clearTimeout(this._mouseDelayTimer);
                         delete this._mouseDelayTimer;
                     }
      
                     this.ignoreMissingWhich = false;
                     mouseHandled = false;
                     event.preventDefault();
                 },
      
                 _mouseDistanceMet: function (event) {
                     return (Math.max(
                         Math.abs(this._mouseDownEvent.pageX - event.pageX),
                         Math.abs(this._mouseDownEvent.pageY - event.pageY)
                     ) >= this.options.distance);
                 },
      
                 _mouseDelayMet: function ( /* event */ ) {
                     return this.mouseDelayMet;
                 },
      
                 // These are placeholder methods, to be overriden by extending plugin
                 _mouseStart: function ( /* event */ ) {},
                 _mouseDrag: function ( /* event */ ) {},
                 _mouseStop: function ( /* event */ ) {},
                 _mouseCapture: function ( /* event */ ) {
                     return true;
                 }
             });
      



             // $.ui.plugin is deprecated. Use $.widget() extensions instead.
             var plugin = $.ui.plugin = {
                 add: function (module, option, set) {
                     var i,
                         proto = $.ui[module].prototype;
                     for (i in set) {
                         proto.plugins[i] = proto.plugins[i] || [];
                         proto.plugins[i].push([option, set[i]]);
                     }
                 },
                 call: function (instance, name, args, allowDisconnected) {
                     var i,
                         set = instance.plugins[name];
      
                     if (!set) {
                         return;
                     }
      
                     if (!allowDisconnected && (!instance.element[0].parentNode ||
                             instance.element[0].parentNode.nodeType === 11)) {
                         return;
                     }
      
                     for (i = 0; i < set.length; i++) {
                         if (instance.options[set[i][0]]) {
                             set[i][1].apply(instance.element, args);
                         }
                     }
                 }
             };
      


             var safeBlur = $.ui.safeBlur = function (element) {
      
                 // Support: IE9 - 10 only
                 // If the <body> is blurred, IE will switch windows, see #9420
                 if (element && element.nodeName.toLowerCase() !== "body") {
                     $(element).trigger("blur");
                 }
             };
      


             /*!
              * jQuery UI Draggable 1.12.1
              * http://jqueryui.com
              *
              * Copyright jQuery Foundation and other contributors
              * Released under the MIT license.
              * http://jquery.org/license
              */
      
             //>>label: Draggable
             //>>group: Interactions
             //>>description: Enables dragging functionality for any element.
             //>>docs: http://api.jqueryui.com/draggable/
             //>>demos: http://jqueryui.com/draggable/
             //>>css.structure: ../../themes/base/draggable.css
      


             $.widget("ui.draggable", $.ui.mouse, {
                 version: "1.12.1",
                 widgetEventPrefix: "drag",
                 options: {
                     addClasses: true,
                     appendTo: "parent",
                     axis: false,
                     connectToSortable: false,
                     containment: false,
                     cursor: "auto",
                     cursorAt: false,
                     grid: false,
                     handle: false,
                     helper: "original",
                     iframeFix: false,
                     opacity: false,
                     refreshPositions: false,
                     revert: false,
                     revertDuration: 500,
                     scope: "default",
                     scroll: true,
                     scrollSensitivity: 20,
                     scrollSpeed: 20,
                     snap: false,
                     snapMode: "both",
                     snapTolerance: 20,
                     stack: false,
                     zIndex: false,
      
                     // Callbacks
                     drag: null,
                     start: null,
                     stop: null
                 },
                 _create: function () {
      
                     if (this.options.helper === "original") {
                         this._setPositionRelative();
                     }
                     if (this.options.addClasses) {
                         this._addClass("ui-draggable");
                     }
                     this._setHandleClassName();
      
                     this._mouseInit();
                 },
      
                 _setOption: function (key, value) {
                     this._super(key, value);
                     if (key === "handle") {
                         this._removeHandleClassName();
                         this._setHandleClassName();
                     }
                 },
      
                 _destroy: function () {
                     if ((this.helper || this.element).is(".ui-draggable-dragging")) {
                         this.destroyOnClear = true;
                         return;
                     }
                     this._removeHandleClassName();
                     this._mouseDestroy();
                 },
      
                 _mouseCapture: function (event) {
                     var o = this.options;
      
                     // Among others, prevent a drag on a resizable-handle
                     if (this.helper || o.disabled ||
                         $(event.target).closest(".ui-resizable-handle").length > 0) {
                         return false;
                     }
      
                     //Quit if we're not on a valid handle
                     this.handle = this._getHandle(event);
                     if (!this.handle) {
                         return false;
                     }
      
                     this._blurActiveElement(event);
      
                     this._blockFrames(o.iframeFix === true ? "iframe" : o.iframeFix);
      
                     return true;
      
                 },
      
                 _blockFrames: function (selector) {
                     this.iframeBlocks = this.document.find(selector).map(function () {
                         var iframe = $(this);
      
      return $("
      ")
                             .css("position", "absolute")
                             .appendTo(iframe.parent())
                             .outerWidth(iframe.outerWidth())
                             .outerHeight(iframe.outerHeight())
                             .offset(iframe.offset())[0];
                     });
                 },
      
                 _unblockFrames: function () {
                     if (this.iframeBlocks) {
                         this.iframeBlocks.remove();
                         delete this.iframeBlocks;
                     }
                 },
      
                 _blurActiveElement: function (event) {
                     var activeElement = $.ui.safeActiveElement(this.document[0]),
                         target = $(event.target);
      
                     // Don't blur if the event occurred on an element that is within
                     // the currently focused element
                     // See #10527, #12472
                     if (target.closest(activeElement).length) {
                         return;
                     }
      
                     // Blur any element that currently has focus, see #4261
                     $.ui.safeBlur(activeElement);
                 },
      
                 _mouseStart: function (event) {
      
                     var o = this.options;
      
                     //Create and append the visible helper
                     this.helper = this._createHelper(event);
      
                     this._addClass(this.helper, "ui-draggable-dragging");
      
                     //Cache the helper size
                     this._cacheHelperProportions();
      
                     //If ddmanager is used for droppables, set the global draggable
                     if ($.ui.ddmanager) {
                         $.ui.ddmanager.current = this;
                     }
      
                     /*
                      * - Position generation -
                      * This block generates everything position related - it's the core of draggables.
                      */
      
                     //Cache the margins of the original element
                     this._cacheMargins();
      
                     //Store the helper's css position
                     this.cssPosition = this.helper.css("position");
                     this.scrollParent = this.helper.scrollParent(true);
                     this.offsetParent = this.helper.offsetParent();
                     this.hasFixedAncestor = this.helper.parents().filter(function () {
                         return $(this).css("position") === "fixed";
                     }).length > 0;
      
                     //The element's absolute position on the page minus margins
                     this.positionAbs = this.element.offset();
                     this._refreshOffsets(event);
      
                     //Generate the original position
                     this.originalPosition = this.position = this._generatePosition(event, false);
                     this.originalPageX = event.pageX;
                     this.originalPageY = event.pageY;
      
                     //Adjust the mouse offset relative to the helper if "cursorAt" is supplied
                     (o.cursorAt && this._adjustOffsetFromHelper(o.cursorAt));
      
                     //Set a containment if given in the options
                     this._setContainment();
      
                     //Trigger event + callbacks
                     if (this._trigger("start", event) === false) {
                         this._clear();
                         return false;
                     }
      
                     //Recache the helper size
                     this._cacheHelperProportions();
      
                     //Prepare the droppable offsets
                     if ($.ui.ddmanager && !o.dropBehaviour) {
                         $.ui.ddmanager.prepareOffsets(this, event);
                     }
      
                     // Execute the drag once - this causes the helper not to be visible before getting its
                     // correct position
                     this._mouseDrag(event, true);
      
                     // If the ddmanager is used for droppables, inform the manager that dragging has started
                     // (see #5003)
                     if ($.ui.ddmanager) {
                         $.ui.ddmanager.dragStart(this, event);
                     }
      
                     return true;
                 },
      
                 _refreshOffsets: function (event) {
                     this.offset = {
                         top: this.positionAbs.top - this.margins.top,
                         left: this.positionAbs.left - this.margins.left,
                         scroll: false,
                         parent: this._getParentOffset(),
                         relative: this._getRelativeOffset()
                     };
      
                     this.offset.click = {
                         left: event.pageX - this.offset.left,
                         top: event.pageY - this.offset.top
                     };
                 },
      
                 _mouseDrag: function (event, noPropagation) {
      
                     // reset any necessary cached properties (see #5009)
                     if (this.hasFixedAncestor) {
                         this.offset.parent = this._getParentOffset();
                     }
      
                     //Compute the helpers position
                     this.position = this._generatePosition(event, true);
                     this.positionAbs = this._convertPositionTo("absolute");
      
                     //Call plugins and callbacks and use the resulting position if something is returned
                     if (!noPropagation) {
                         var ui = this._uiHash();
                         if (this._trigger("drag", event, ui) === false) {
                             this._mouseUp(new $.Event("mouseup", event));
                             return false;
                         }
                         this.position = ui.position;
                     }
      
                     this.helper[0].style.left = this.position.left + "px";
                     this.helper[0].style.top = this.position.top + "px";
      
                     if ($.ui.ddmanager) {
                         $.ui.ddmanager.drag(this, event);
                     }
      
                     return false;
                 },
      
                 _mouseStop: function (event) {
      
                     //If we are using droppables, inform the manager about the drop
                     var that = this,
                         dropped = false;
                     if ($.ui.ddmanager && !this.options.dropBehaviour) {
                         dropped = $.ui.ddmanager.drop(this, event);
                     }
      
                     //if a drop comes from outside (a sortable)
                     if (this.dropped) {
                         dropped = this.dropped;
                         this.dropped = false;
                     }
      
                     if ((this.options.revert === "invalid" && !dropped) ||
                         (this.options.revert === "valid" && dropped) ||
                         this.options.revert === true || ($.isFunction(this.options.revert) &&
                             this.options.revert.call(this.element, dropped))
                     ) {
                         $(this.helper).animate(
                             this.originalPosition,
                             parseInt(this.options.revertDuration, 10),
                             function () {
                                 if (that._trigger("stop", event) !== false) {
                                     that._clear();
                                 }
                             }
                         );
                     } else {
                         if (this._trigger("stop", event) !== false) {
                             this._clear();
                         }
                     }
      
                     return false;
                 },
      
                 _mouseUp: function (event) {
                     this._unblockFrames();
      
                     // If the ddmanager is used for droppables, inform the manager that dragging has stopped
                     // (see #5003)
                     if ($.ui.ddmanager) {
                         $.ui.ddmanager.dragStop(this, event);
                     }
      
                     // Only need to focus if the event occurred on the draggable itself, see #10527
                     if (this.handleElement.is(event.target)) {
      
                         // The interaction is over; whether or not the click resulted in a drag,
                         // focus the element
                         this.element.trigger("focus");
                     }
      
                     return $.ui.mouse.prototype._mouseUp.call(this, event);
                 },
      
                 cancel: function () {
      
                     if (this.helper.is(".ui-draggable-dragging")) {
                         this._mouseUp(new $.Event("mouseup", {
                             target: this.element[0]
                         }));
                     } else {
                         this._clear();
                     }
      
                     return this;
      
                 },
      
                 _getHandle: function (event) {
                     return this.options.handle ?
                         !!$(event.target).closest(this.element.find(this.options.handle)).length :
                         true;
                 },
      
                 _setHandleClassName: function () {
                     this.handleElement = this.options.handle ?
                         this.element.find(this.options.handle) : this.element;
                     this._addClass(this.handleElement, "ui-draggable-handle");
                 },
      
                 _removeHandleClassName: function () {
                     this._removeClass(this.handleElement, "ui-draggable-handle");
                 },
      
                 _createHelper: function (event) {
      
                     var o = this.options,
                         helperIsFunction = $.isFunction(o.helper),
                         helper = helperIsFunction ?
                         $(o.helper.apply(this.element[0], [event])) :
                         (o.helper === "clone" ?
                             this.element.clone().removeAttr("id") :
                             this.element);
      
                     if (!helper.parents("body").length) {
                         helper.appendTo((o.appendTo === "parent" ?
                             this.element[0].parentNode :
                             o.appendTo));
                     }
      
                     // Http://bugs.jqueryui.com/ticket/9446
                     // a helper function can return the original element
                     // which wouldn't have been set to relative in _create
                     if (helperIsFunction && helper[0] === this.element[0]) {
                         this._setPositionRelative();
                     }
      
                     if (helper[0] !== this.element[0] &&
                         !(/(fixed|absolute)/).test(helper.css("position"))) {
                         helper.css("position", "absolute");
                     }
      
                     return helper;
      
                 },
      
                 _setPositionRelative: function () {
                     if (!(/^(?:r|a|f)/).test(this.element.css("position"))) {
                         this.element[0].style.position = "relative";
                     }
                 },
      
                 _adjustOffsetFromHelper: function (obj) {
                     if (typeof obj === "string") {
                         obj = obj.split(" ");
                     }
                     if ($.isArray(obj)) {
                         obj = {
                             left: +obj[0],
                             top: +obj[1] || 0
                         };
                     }
                     if ("left" in obj) {
                         this.offset.click.left = obj.left + this.margins.left;
                     }
                     if ("right" in obj) {
                         this.offset.click.left = this.helperProportions.width - obj.right + this.margins
                             .left;
                     }
                     if ("top" in obj) {
                         this.offset.click.top = obj.top + this.margins.top;
                     }
                     if ("bottom" in obj) {
                         this.offset.click.top = this.helperProportions.height - obj.bottom + this
                             .margins.top;
                     }
                 },
      
                 _isRootNode: function (element) {
                     return (/(html|body)/i).test(element.tagName) || element === this.document[0];
                 },
      
                 _getParentOffset: function () {
      
                     //Get the offsetParent and cache its position
                     var po = this.offsetParent.offset(),
                         document = this.document[0];
      
                     // This is a special case where we need to modify a offset calculated on start, since the
                     // following happened:
                     // 1. The position of the helper is absolute, so it's position is calculated based on the
                     // next positioned parent
                     // 2. The actual offset parent is a child of the scroll parent, and the scroll parent isn't
                     // the document, which means that the scroll is included in the initial calculation of the
                     // offset of the parent, and never recalculated upon drag
                     if (this.cssPosition === "absolute" && this.scrollParent[0] !== document &&
                         $.contains(this.scrollParent[0], this.offsetParent[0])) {
                         po.left += this.scrollParent.scrollLeft();
                         po.top += this.scrollParent.scrollTop();
                     }
      
                     if (this._isRootNode(this.offsetParent[0])) {
                         po = {
                             top: 0,
                             left: 0
                         };
                     }
      
                     return {
                         top: po.top + (parseInt(this.offsetParent.css("borderTopWidth"), 10) || 0),
                         left: po.left + (parseInt(this.offsetParent.css("borderLeftWidth"), 10) || 0)
                     };
      
                 },
      
                 _getRelativeOffset: function () {
                     if (this.cssPosition !== "relative") {
                         return {
                             top: 0,
                             left: 0
                         };
                     }
      
                     var p = this.element.position(),
                         scrollIsRootNode = this._isRootNode(this.scrollParent[0]);
      
                     return {
                         top: p.top - (parseInt(this.helper.css("top"), 10) || 0) +
                             (!scrollIsRootNode ? this.scrollParent.scrollTop() : 0),
                         left: p.left - (parseInt(this.helper.css("left"), 10) || 0) +
                             (!scrollIsRootNode ? this.scrollParent.scrollLeft() : 0)
                     };
      
                 },
      
                 _cacheMargins: function () {
                     this.margins = {
                         left: (parseInt(this.element.css("marginLeft"), 10) || 0),
                         top: (parseInt(this.element.css("marginTop"), 10) || 0),
                         right: (parseInt(this.element.css("marginRight"), 10) || 0),
                         bottom: (parseInt(this.element.css("marginBottom"), 10) || 0)
                     };
                 },
      
                 _cacheHelperProportions: function () {
                     this.helperProportions = {
                         width: this.helper.outerWidth(),
                         height: this.helper.outerHeight()
                     };
                 },
      
                 _setContainment: function () {
      
                     var isUserScrollable, c, ce,
                         o = this.options,
                         document = this.document[0];
      
                     this.relativeContainer = null;
      
                     if (!o.containment) {
                         this.containment = null;
                         return;
                     }
      
                     if (o.containment === "window") {
                         this.containment = [
                             $(window).scrollLeft() - this.offset.relative.left - this.offset.parent
                             .left,
                             $(window).scrollTop() - this.offset.relative.top - this.offset.parent
                             .top,
                             $(window).scrollLeft() + $(window).width() -
                             this.helperProportions.width - this.margins.left,
                             $(window).scrollTop() +
                             ($(window).height() || document.body.parentNode.scrollHeight) -
                             this.helperProportions.height - this.margins.top
                         ];
                         return;
                     }
      
                     if (o.containment === "document") {
                         this.containment = [
                             0,
                             0,
                             $(document).width() - this.helperProportions.width - this.margins.left,
                             ($(document).height() || document.body.parentNode.scrollHeight) -
                             this.helperProportions.height - this.margins.top
                         ];
                         return;
                     }
      
                     if (o.containment.constructor === Array) {
                         this.containment = o.containment;
                         return;
                     }
      
                     if (o.containment === "parent") {
                         o.containment = this.helper[0].parentNode;
                     }
      
                     c = $(o.containment);
                     ce = c[0];
      
                     if (!ce) {
                         return;
                     }
      
                     isUserScrollable = /(scroll|auto)/.test(c.css("overflow"));
      
                     this.containment = [
                         (parseInt(c.css("borderLeftWidth"), 10) || 0) +
                         (parseInt(c.css("paddingLeft"), 10) || 0),
                         (parseInt(c.css("borderTopWidth"), 10) || 0) +
                         (parseInt(c.css("paddingTop"), 10) || 0),
                         (isUserScrollable ? Math.max(ce.scrollWidth, ce.offsetWidth) : ce
                             .offsetWidth) -
                         (parseInt(c.css("borderRightWidth"), 10) || 0) -
                         (parseInt(c.css("paddingRight"), 10) || 0) -
                         this.helperProportions.width -
                         this.margins.left -
                         this.margins.right,
                         (isUserScrollable ? Math.max(ce.scrollHeight, ce.offsetHeight) : ce
                             .offsetHeight) -
                         (parseInt(c.css("borderBottomWidth"), 10) || 0) -
                         (parseInt(c.css("paddingBottom"), 10) || 0) -
                         this.helperProportions.height -
                         this.margins.top -
                         this.margins.bottom
                     ];
                     this.relativeContainer = c;
                 },
      
                 _convertPositionTo: function (d, pos) {
      
                     if (!pos) {
                         pos = this.position;
                     }
      
                     var mod = d === "absolute" ? 1 : -1,
                         scrollIsRootNode = this._isRootNode(this.scrollParent[0]);
      
                     return {
                         top: (
      
                             // The absolute mouse position
                             pos.top +
      
                             // Only for relative positioned nodes: Relative offset from element to offset parent
                             this.offset.relative.top * mod +
      
                             // The offsetParent's offset without borders (offset + border)
                             this.offset.parent.top * mod -
                             ((this.cssPosition === "fixed" ?
                                 -this.offset.scroll.top :
                                 (scrollIsRootNode ? 0 : this.offset.scroll.top)) * mod)
                         ),
                         left: (
      
                             // The absolute mouse position
                             pos.left +
      
                             // Only for relative positioned nodes: Relative offset from element to offset parent
                             this.offset.relative.left * mod +
      
                             // The offsetParent's offset without borders (offset + border)
                             this.offset.parent.left * mod -
                             ((this.cssPosition === "fixed" ?
                                 -this.offset.scroll.left :
                                 (scrollIsRootNode ? 0 : this.offset.scroll.left)) * mod)
                         )
                     };
      
                 },
      
                 _generatePosition: function (event, constrainPosition) {
      
                     var containment, co, top, left,
                         o = this.options,
                         scrollIsRootNode = this._isRootNode(this.scrollParent[0]),
                         pageX = event.pageX,
                         pageY = event.pageY;
      
                     // Cache the scroll
                     if (!scrollIsRootNode || !this.offset.scroll) {
                         this.offset.scroll = {
                             top: this.scrollParent.scrollTop(),
                             left: this.scrollParent.scrollLeft()
                         };
                     }
      
                     /*
                      * - Position constraining -
                      * Constrain the position to a mix of grid, containment.
                      */
      
                     // If we are not dragging yet, we won't check for options
                     if (constrainPosition) {
                         if (this.containment) {
                             if (this.relativeContainer) {
                                 co = this.relativeContainer.offset();
                                 containment = [
                                     this.containment[0] + co.left,
                                     this.containment[1] + co.top,
                                     this.containment[2] + co.left,
                                     this.containment[3] + co.top
                                 ];
                             } else {
                                 containment = this.containment;
                             }
      
                             if (event.pageX - this.offset.click.left < containment[0]) {
                                 pageX = containment[0] + this.offset.click.left;
                             }
                             if (event.pageY - this.offset.click.top < containment[1]) {
                                 pageY = containment[1] + this.offset.click.top;
                             }
                             if (event.pageX - this.offset.click.left > containment[2]) {
                                 pageX = containment[2] + this.offset.click.left;
                             }
                             if (event.pageY - this.offset.click.top > containment[3]) {
                                 pageY = containment[3] + this.offset.click.top;
                             }
                         }
      
                         if (o.grid) {
      
                             //Check for grid elements set to 0 to prevent divide by 0 error causing invalid
                             // argument errors in IE (see ticket #6950)
                             top = o.grid[1] ? this.originalPageY + Math.round((pageY -
                                 this.originalPageY) / o.grid[1]) * o.grid[1] : this.originalPageY;
                             pageY = containment ? ((top - this.offset.click.top >= containment[1] ||
                                     top - this.offset.click.top > containment[3]) ?
                                 top :
                                 ((top - this.offset.click.top >= containment[1]) ?
                                     top - o.grid[1] : top + o.grid[1])) : top;
      
                             left = o.grid[0] ? this.originalPageX +
                                 Math.round((pageX - this.originalPageX) / o.grid[0]) * o.grid[0] :
                                 this.originalPageX;
                             pageX = containment ? ((left - this.offset.click.left >= containment[0] ||
                                     left - this.offset.click.left > containment[2]) ?
                                 left :
                                 ((left - this.offset.click.left >= containment[0]) ?
                                     left - o.grid[0] : left + o.grid[0])) : left;
                         }
      
                         if (o.axis === "y") {
                             pageX = this.originalPageX;
                         }
      
                         if (o.axis === "x") {
                             pageY = this.originalPageY;
                         }
                     }
      
                     return {
                         top: (
      
                             // The absolute mouse position
                             pageY -
      
                             // Click offset (relative to the element)
                             this.offset.click.top -
      
                             // Only for relative positioned nodes: Relative offset from element to offset parent
                             this.offset.relative.top -
      
                             // The offsetParent's offset without borders (offset + border)
                             this.offset.parent.top +
                             (this.cssPosition === "fixed" ?
                                 -this.offset.scroll.top :
                                 (scrollIsRootNode ? 0 : this.offset.scroll.top))
                         ),
                         left: (
      
                             // The absolute mouse position
                             pageX -
      
                             // Click offset (relative to the element)
                             this.offset.click.left -
      
                             // Only for relative positioned nodes: Relative offset from element to offset parent
                             this.offset.relative.left -
      
                             // The offsetParent's offset without borders (offset + border)
                             this.offset.parent.left +
                             (this.cssPosition === "fixed" ?
                                 -this.offset.scroll.left :
                                 (scrollIsRootNode ? 0 : this.offset.scroll.left))
                         )
                     };
      
                 },
      
                 _clear: function () {
                     this._removeClass(this.helper, "ui-draggable-dragging");
                     if (this.helper[0] !== this.element[0] && !this.cancelHelperRemoval) {
                         this.helper.remove();
                     }
                     this.helper = null;
                     this.cancelHelperRemoval = false;
                     if (this.destroyOnClear) {
                         this.destroy();
                     }
                 },
      
                 // From now on bulk stuff - mainly helpers
      
                 _trigger: function (type, event, ui) {
                     ui = ui || this._uiHash();
                     $.ui.plugin.call(this, type, [event, ui, this], true);
      
                     // Absolute position and offset (see #6884 ) have to be recalculated after plugins
                     if (/^(drag|start|stop)/.test(type)) {
                         this.positionAbs = this._convertPositionTo("absolute");
                         ui.offset = this.positionAbs;
                     }
                     return $.Widget.prototype._trigger.call(this, type, event, ui);
                 },
      
                 plugins: {},
      
                 _uiHash: function () {
                     return {
                         helper: this.helper,
                         position: this.position,
                         originalPosition: this.originalPosition,
                         offset: this.positionAbs
                     };
                 }
      
             });
      
             $.ui.plugin.add("draggable", "connectToSortable", {
                 start: function (event, ui, draggable) {
                     var uiSortable = $.extend({}, ui, {
                         item: draggable.element
                     });
      
                     draggable.sortables = [];
                     $(draggable.options.connectToSortable).each(function () {
                         var sortable = $(this).sortable("instance");
      
                         if (sortable && !sortable.options.disabled) {
                             draggable.sortables.push(sortable);
      
                             // RefreshPositions is called at drag start to refresh the containerCache
                             // which is used in drag. This ensures it's initialized and synchronized
                             // with any changes that might have happened on the page since initialization.
                             sortable.refreshPositions();
                             sortable._trigger("activate", event, uiSortable);
                         }
                     });
                 },
                 stop: function (event, ui, draggable) {
                     var uiSortable = $.extend({}, ui, {
                         item: draggable.element
                     });
      
                     draggable.cancelHelperRemoval = false;
      
                     $.each(draggable.sortables, function () {
                         var sortable = this;
      
                         if (sortable.isOver) {
                             sortable.isOver = 0;
      
                             // Allow this sortable to handle removing the helper
                             draggable.cancelHelperRemoval = true;
                             sortable.cancelHelperRemoval = false;
      
                             // Use _storedCSS To restore properties in the sortable,
                             // as this also handles revert (#9675) since the draggable
                             // may have modified them in unexpected ways (#8809)
                             sortable._storedCSS = {
                                 position: sortable.placeholder.css("position"),
                                 top: sortable.placeholder.css("top"),
                                 left: sortable.placeholder.css("left")
                             };
      
                             sortable._mouseStop(event);
      
                             // Once drag has ended, the sortable should return to using
                             // its original helper, not the shared helper from draggable
                             sortable.options.helper = sortable.options._helper;
                         } else {
      
                             // Prevent this Sortable from removing the helper.
                             // However, don't set the draggable to remove the helper
                             // either as another connected Sortable may yet handle the removal.
                             sortable.cancelHelperRemoval = true;
      
                             sortable._trigger("deactivate", event, uiSortable);
                         }
                     });
                 },
                 drag: function (event, ui, draggable) {
                     $.each(draggable.sortables, function () {
                         var innermostIntersecting = false,
                             sortable = this;
      
                         // Copy over variables that sortable's _intersectsWith uses
                         sortable.positionAbs = draggable.positionAbs;
                         sortable.helperProportions = draggable.helperProportions;
                         sortable.offset.click = draggable.offset.click;
      
                         if (sortable._intersectsWith(sortable.containerCache)) {
                             innermostIntersecting = true;
      
                             $.each(draggable.sortables, function () {
      
                                 // Copy over variables that sortable's _intersectsWith uses
                                 this.positionAbs = draggable.positionAbs;
                                 this.helperProportions = draggable.helperProportions;
                                 this.offset.click = draggable.offset.click;
      
                                 if (this !== sortable &&
                                     this._intersectsWith(this.containerCache) &&
                                     $.contains(sortable.element[0], this.element[0])) {
                                     innermostIntersecting = false;
                                 }
      
                                 return innermostIntersecting;
                             });
                         }
      
                         if (innermostIntersecting) {
      
                             // If it intersects, we use a little isOver variable and set it once,
                             // so that the move-in stuff gets fired only once.
                             if (!sortable.isOver) {
                                 sortable.isOver = 1;
      
                                 // Store draggable's parent in case we need to reappend to it later.
                                 draggable._parent = ui.helper.parent();
      
                                 sortable.currentItem = ui.helper
                                     .appendTo(sortable.element)
                                     .data("ui-sortable-item", true);
      
                                 // Store helper option to later restore it
                                 sortable.options._helper = sortable.options.helper;
      
                                 sortable.options.helper = function () {
                                     return ui.helper[0];
                                 };
      
                                 // Fire the start events of the sortable with our passed browser event,
                                 // and our own helper (so it doesn't create a new one)
                                 event.target = sortable.currentItem[0];
                                 sortable._mouseCapture(event, true);
                                 sortable._mouseStart(event, true, true);
      
                                 // Because the browser event is way off the new appended portlet,
                                 // modify necessary variables to reflect the changes
                                 sortable.offset.click.top = draggable.offset.click.top;
                                 sortable.offset.click.left = draggable.offset.click.left;
                                 sortable.offset.parent.left -= draggable.offset.parent.left -
                                     sortable.offset.parent.left;
                                 sortable.offset.parent.top -= draggable.offset.parent.top -
                                     sortable.offset.parent.top;
      
                                 draggable._trigger("toSortable", event);
      
                                 // Inform draggable that the helper is in a valid drop zone,
                                 // used solely in the revert option to handle "valid/invalid".
                                 draggable.dropped = sortable.element;
      
                                 // Need to refreshPositions of all sortables in the case that
                                 // adding to one sortable changes the location of the other sortables (#9675)
                                 $.each(draggable.sortables, function () {
                                     this.refreshPositions();
                                 });
      
                                 // Hack so receive/update callbacks work (mostly)
                                 draggable.currentItem = draggable.element;
                                 sortable.fromOutside = draggable;
                             }
      
                             if (sortable.currentItem) {
                                 sortable._mouseDrag(event);
      
                                 // Copy the sortable's position because the draggable's can potentially reflect
                                 // a relative position, while sortable is always absolute, which the dragged
                                 // element has now become. (#8809)
                                 ui.position = sortable.position;
                             }
                         } else {
      
                             // If it doesn't intersect with the sortable, and it intersected before,
                             // we fake the drag stop of the sortable, but make sure it doesn't remove
                             // the helper by using cancelHelperRemoval.
                             if (sortable.isOver) {
      
                                 sortable.isOver = 0;
                                 sortable.cancelHelperRemoval = true;
      
                                 // Calling sortable's mouseStop would trigger a revert,
                                 // so revert must be temporarily false until after mouseStop is called.
                                 sortable.options._revert = sortable.options.revert;
                                 sortable.options.revert = false;
      
                                 sortable._trigger("out", event, sortable._uiHash(sortable));
                                 sortable._mouseStop(event, true);
      
                                 // Restore sortable behaviors that were modfied
                                 // when the draggable entered the sortable area (#9481)
                                 sortable.options.revert = sortable.options._revert;
                                 sortable.options.helper = sortable.options._helper;
      
                                 if (sortable.placeholder) {
                                     sortable.placeholder.remove();
                                 }
      
                                 // Restore and recalculate the draggable's offset considering the sortable
                                 // may have modified them in unexpected ways. (#8809, #10669)
                                 ui.helper.appendTo(draggable._parent);
                                 draggable._refreshOffsets(event);
                                 ui.position = draggable._generatePosition(event, true);
      
                                 draggable._trigger("fromSortable", event);
      
                                 // Inform draggable that the helper is no longer in a valid drop zone
                                 draggable.dropped = false;
      
                                 // Need to refreshPositions of all sortables just in case removing
                                 // from one sortable changes the location of other sortables (#9675)
                                 $.each(draggable.sortables, function () {
                                     this.refreshPositions();
                                 });
                             }
                         }
                     });
                 }
             });
      
             $.ui.plugin.add("draggable", "cursor", {
                 start: function (event, ui, instance) {
                     var t = $("body"),
                         o = instance.options;
      
                     if (t.css("cursor")) {
                         o._cursor = t.css("cursor");
                     }
                     t.css("cursor", o.cursor);
                 },
                 stop: function (event, ui, instance) {
                     var o = instance.options;
                     if (o._cursor) {
                         $("body").css("cursor", o._cursor);
                     }
                 }
             });
      
             $.ui.plugin.add("draggable", "opacity", {
                 start: function (event, ui, instance) {
                     var t = $(ui.helper),
                         o = instance.options;
                     if (t.css("opacity")) {
                         o._opacity = t.css("opacity");
                     }
                     t.css("opacity", o.opacity);
                 },
                 stop: function (event, ui, instance) {
                     var o = instance.options;
                     if (o._opacity) {
                         $(ui.helper).css("opacity", o._opacity);
                     }
                 }
             });
      
             $.ui.plugin.add("draggable", "scroll", {
                 start: function (event, ui, i) {
                     if (!i.scrollParentNotHidden) {
                         i.scrollParentNotHidden = i.helper.scrollParent(false);
                     }
      
                     if (i.scrollParentNotHidden[0] !== i.document[0] &&
                         i.scrollParentNotHidden[0].tagName !== "HTML") {
                         i.overflowOffset = i.scrollParentNotHidden.offset();
                     }
                 },
                 drag: function (event, ui, i) {
      
                     var o = i.options,
                         scrolled = false,
                         scrollParent = i.scrollParentNotHidden[0],
                         document = i.document[0];
      
                     if (scrollParent !== document && scrollParent.tagName !== "HTML") {
                         if (!o.axis || o.axis !== "x") {
                             if ((i.overflowOffset.top + scrollParent.offsetHeight) - event.pageY <
                                 o.scrollSensitivity) {
                                 scrollParent.scrollTop = scrolled = scrollParent.scrollTop + o
                                     .scrollSpeed;
                             } else if (event.pageY - i.overflowOffset.top < o.scrollSensitivity) {
                                 scrollParent.scrollTop = scrolled = scrollParent.scrollTop - o
                                     .scrollSpeed;
                             }
                         }
      
                         if (!o.axis || o.axis !== "y") {
                             if ((i.overflowOffset.left + scrollParent.offsetWidth) - event.pageX <
                                 o.scrollSensitivity) {
                                 scrollParent.scrollLeft = scrolled = scrollParent.scrollLeft + o
                                     .scrollSpeed;
                             } else if (event.pageX - i.overflowOffset.left < o.scrollSensitivity) {
                                 scrollParent.scrollLeft = scrolled = scrollParent.scrollLeft - o
                                     .scrollSpeed;
                             }
                         }
      
                     } else {
      
                         if (!o.axis || o.axis !== "x") {
                             if (event.pageY - $(document).scrollTop() < o.scrollSensitivity) {
                                 scrolled = $(document).scrollTop($(document).scrollTop() - o
                                     .scrollSpeed);
                             } else if ($(window).height() - (event.pageY - $(document).scrollTop()) <
                                 o.scrollSensitivity) {
                                 scrolled = $(document).scrollTop($(document).scrollTop() + o
                                     .scrollSpeed);
                             }
                         }
      
                         if (!o.axis || o.axis !== "y") {
                             if (event.pageX - $(document).scrollLeft() < o.scrollSensitivity) {
                                 scrolled = $(document).scrollLeft(
                                     $(document).scrollLeft() - o.scrollSpeed
                                 );
                             } else if ($(window).width() - (event.pageX - $(document).scrollLeft()) <
                                 o.scrollSensitivity) {
                                 scrolled = $(document).scrollLeft(
                                     $(document).scrollLeft() + o.scrollSpeed
                                 );
                             }
                         }
      
                     }
      
                     if (scrolled !== false && $.ui.ddmanager && !o.dropBehaviour) {
                         $.ui.ddmanager.prepareOffsets(i, event);
                     }
      
                 }
             });
      
             $.ui.plugin.add("draggable", "snap", {
                 start: function (event, ui, i) {
      
                     var o = i.options;
      
                     i.snapElements = [];
      
                     $(o.snap.constructor !== String ? (o.snap.items || ":data(ui-draggable)") : o.snap)
                         .each(function () {
                             var $t = $(this),
                                 $o = $t.offset();
                             if (this !== i.element[0]) {
                                 i.snapElements.push({
                                     item: this,
                                     width: $t.outerWidth(),
                                     height: $t.outerHeight(),
                                     top: $o.top,
                                     left: $o.left
                                 });
                             }
                         });
      
                 },
                 drag: function (event, ui, inst) {
      
                     var ts, bs, ls, rs, l, r, t, b, i, first,
                         o = inst.options,
                         d = o.snapTolerance,
                         x1 = ui.offset.left,
                         x2 = x1 + inst.helperProportions.width,
                         y1 = ui.offset.top,
                         y2 = y1 + inst.helperProportions.height;
      
                     for (i = inst.snapElements.length - 1; i >= 0; i--) {
      
                         l = inst.snapElements[i].left - inst.margins.left;
                         r = l + inst.snapElements[i].width;
                         t = inst.snapElements[i].top - inst.margins.top;
                         b = t + inst.snapElements[i].height;
      
                         if (x2 < l - d || x1 > r + d || y2 < t - d || y1 > b + d ||
                             !$.contains(inst.snapElements[i].item.ownerDocument,
                                 inst.snapElements[i].item)) {
                             if (inst.snapElements[i].snapping) {
                                 (inst.options.snap.release &&
                                     inst.options.snap.release.call(
                                         inst.element,
                                         event,
                                         $.extend(inst._uiHash(), {
                                             snapItem: inst.snapElements[i].item
                                         })
                                     ));
                             }
                             inst.snapElements[i].snapping = false;
                             continue;
                         }
      
                         if (o.snapMode !== "inner") {
                             ts = Math.abs(t - y2) <= d;
                             bs = Math.abs(b - y1) <= d;
                             ls = Math.abs(l - x2) <= d;
                             rs = Math.abs(r - x1) <= d;
                             if (ts) {
                                 ui.position.top = inst._convertPositionTo("relative", {
                                     top: t - inst.helperProportions.height,
                                     left: 0
                                 }).top;
                             }
                             if (bs) {
                                 ui.position.top = inst._convertPositionTo("relative", {
                                     top: b,
                                     left: 0
                                 }).top;
                             }
                             if (ls) {
                                 ui.position.left = inst._convertPositionTo("relative", {
                                     top: 0,
                                     left: l - inst.helperProportions.width
                                 }).left;
                             }
                             if (rs) {
                                 ui.position.left = inst._convertPositionTo("relative", {
                                     top: 0,
                                     left: r
                                 }).left;
                             }
                         }
      
                         first = (ts || bs || ls || rs);
      
                         if (o.snapMode !== "outer") {
                             ts = Math.abs(t - y1) <= d;
                             bs = Math.abs(b - y2) <= d;
                             ls = Math.abs(l - x1) <= d;
                             rs = Math.abs(r - x2) <= d;
                             if (ts) {
                                 ui.position.top = inst._convertPositionTo("relative", {
                                     top: t,
                                     left: 0
                                 }).top;
                             }
                             if (bs) {
                                 ui.position.top = inst._convertPositionTo("relative", {
                                     top: b - inst.helperProportions.height,
                                     left: 0
                                 }).top;
                             }
                             if (ls) {
                                 ui.position.left = inst._convertPositionTo("relative", {
                                     top: 0,
                                     left: l
                                 }).left;
                             }
                             if (rs) {
                                 ui.position.left = inst._convertPositionTo("relative", {
                                     top: 0,
                                     left: r - inst.helperProportions.width
                                 }).left;
                             }
                         }
      
                         if (!inst.snapElements[i].snapping && (ts || bs || ls || rs || first)) {
                             (inst.options.snap.snap &&
                                 inst.options.snap.snap.call(
                                     inst.element,
                                     event,
                                     $.extend(inst._uiHash(), {
                                         snapItem: inst.snapElements[i].item
                                     })));
                         }
                         inst.snapElements[i].snapping = (ts || bs || ls || rs || first);
      
                     }
      
                 }
             });
      
             $.ui.plugin.add("draggable", "stack", {
                 start: function (event, ui, instance) {
                     var min,
                         o = instance.options,
                         group = $.makeArray($(o.stack)).sort(function (a, b) {
                             return (parseInt($(a).css("zIndex"), 10) || 0) -
                                 (parseInt($(b).css("zIndex"), 10) || 0);
                         });
      
                     if (!group.length) {
                         return;
                     }
      
                     min = parseInt($(group[0]).css("zIndex"), 10) || 0;
                     $(group).each(function (i) {
                         $(this).css("zIndex", min + i);
                     });
                     this.css("zIndex", (min + group.length));
                 }
             });
      
             $.ui.plugin.add("draggable", "zIndex", {
                 start: function (event, ui, instance) {
                     var t = $(ui.helper),
                         o = instance.options;
      
                     if (t.css("zIndex")) {
                         o._zIndex = t.css("zIndex");
                     }
                     t.css("zIndex", o.zIndex);
                 },
                 stop: function (event, ui, instance) {
                     var o = instance.options;
      
                     if (o._zIndex) {
                         $(ui.helper).css("zIndex", o._zIndex);
                     }
                 }
             });
      
             var widgetsDraggable = $.ui.draggable;
      


             /*!
              * jQuery UI Resizable 1.12.1
              * http://jqueryui.com
              *
              * Copyright jQuery Foundation and other contributors
              * Released under the MIT license.
              * http://jquery.org/license
              */
      
             //>>label: Resizable
             //>>group: Interactions
             //>>description: Enables resize functionality for any element.
             //>>docs: http://api.jqueryui.com/resizable/
             //>>demos: http://jqueryui.com/resizable/
             //>>css.structure: ../../themes/base/core.css
             //>>css.structure: ../../themes/base/resizable.css
             //>>css.theme: ../../themes/base/theme.css
      


             $.widget("ui.resizable", $.ui.mouse, {
                 version: "1.12.1",
                 widgetEventPrefix: "resize",
                 options: {
                     alsoResize: false,
                     animate: false,
                     animateDuration: "slow",
                     animateEasing: "swing",
                     aspectRatio: false,
                     autoHide: false,
                     classes: {
                         "ui-resizable-se": "ui-icon ui-icon-gripsmall-diagonal-se"
                     },
                     containment: false,
                     ghost: false,
                     grid: false,
                     handles: "e,s,se",
                     helper: false,
                     maxHeight: null,
                     maxWidth: null,
                     minHeight: 10,
                     minWidth: 10,
      
                     // See #7960
                     zIndex: 90,
      
                     // Callbacks
                     resize: null,
                     start: null,
                     stop: null
                 },
      
                 _num: function (value) {
                     return parseFloat(value) || 0;
                 },
      
                 _isNumber: function (value) {
                     return !isNaN(parseFloat(value));
                 },
      
                 _hasScroll: function (el, a) {
      
                     if ($(el).css("overflow") === "hidden") {
                         return false;
                     }
      
                     var scroll = (a && a === "left") ? "scrollLeft" : "scrollTop",
                         has = false;
      
                     if (el[scroll] > 0) {
                         return true;
                     }
      
                     // TODO: determine which cases actually cause this to happen
                     // if the element doesn't have the scroll set, see if it's possible to
                     // set the scroll
                     el[scroll] = 1;
                     has = (el[scroll] > 0);
                     el[scroll] = 0;
                     return has;
                 },
      
                 _create: function () {
      
                     var margins,
                         o = this.options,
                         that = this;
                     this._addClass("ui-resizable");
      
                     $.extend(this, {
                         _aspectRatio: !!(o.aspectRatio),
                         aspectRatio: o.aspectRatio,
                         originalElement: this.element,
                         _proportionallyResizeElements: [],
                         _helper: o.helper || o.ghost || o.animate ? o.helper ||
                             "ui-resizable-helper" : null
                     });
      
                     // Wrap the element if it cannot hold child nodes
                     if (this.element[0].nodeName.match(
                             /^(canvas|textarea|input|select|button|img)$/i)) {
      
                         this.element.wrap(
      
      $("
      ").css({
                                 position: this.element.css("position"),
                                 width: this.element.outerWidth(),
                                 height: this.element.outerHeight(),
                                 top: this.element.css("top"),
                                 left: this.element.css("left")
                             })
                         );
      
                         this.element = this.element.parent().data(
                             "ui-resizable", this.element.resizable("instance")
                         );
      
                         this.elementIsWrapper = true;
      
                         margins = {
                             marginTop: this.originalElement.css("marginTop"),
                             marginRight: this.originalElement.css("marginRight"),
                             marginBottom: this.originalElement.css("marginBottom"),
                             marginLeft: this.originalElement.css("marginLeft")
                         };
      
                         this.element.css(margins);
                         this.originalElement.css("margin", 0);
      
                         // support: Safari
                         // Prevent Safari textarea resize
                         this.originalResizeStyle = this.originalElement.css("resize");
                         this.originalElement.css("resize", "none");
      
                         this._proportionallyResizeElements.push(this.originalElement.css({
                             position: "static",
                             zoom: 1,
                             display: "block"
                         }));
      
                         // Support: IE9
                         // avoid IE jump (hard set the margin)
                         this.originalElement.css(margins);
      
                         this._proportionallyResize();
                     }
      
                     this._setupHandles();
      
                     if (o.autoHide) {
                         $(this.element)
                             .on("mouseenter", function () {
                                 if (o.disabled) {
                                     return;
                                 }
                                 that._removeClass("ui-resizable-autohide");
                                 that._handles.show();
                             })
                             .on("mouseleave", function () {
                                 if (o.disabled) {
                                     return;
                                 }
                                 if (!that.resizing) {
                                     that._addClass("ui-resizable-autohide");
                                     that._handles.hide();
                                 }
                             });
                     }
      
                     this._mouseInit();
                 },
      
                 _destroy: function () {
      
                     this._mouseDestroy();
      
                     var wrapper,
                         _destroy = function (exp) {
                             $(exp)
                                 .removeData("resizable")
                                 .removeData("ui-resizable")
                                 .off(".resizable")
                                 .find(".ui-resizable-handle")
                                 .remove();
                         };
      
                     // TODO: Unwrap at same DOM position
                     if (this.elementIsWrapper) {
                         _destroy(this.element);
                         wrapper = this.element;
                         this.originalElement.css({
                             position: wrapper.css("position"),
                             width: wrapper.outerWidth(),
                             height: wrapper.outerHeight(),
                             top: wrapper.css("top"),
                             left: wrapper.css("left")
                         }).insertAfter(wrapper);
                         wrapper.remove();
                     }
      
                     this.originalElement.css("resize", this.originalResizeStyle);
                     _destroy(this.originalElement);
      
                     return this;
                 },
      
                 _setOption: function (key, value) {
                     this._super(key, value);
      
                     switch (key) {
                         case "handles":
                             this._removeHandles();
                             this._setupHandles();
                             break;
                         default:
                             break;
                     }
                 },
      
                 _setupHandles: function () {
                     var o = this.options,
                         handle, i, n, hname, axis, that = this;
                     this.handles = o.handles ||
                         (!$(".ui-resizable-handle", this.element).length ?
                             "e,s,se" : {
                                 n: ".ui-resizable-n",
                                 e: ".ui-resizable-e",
                                 s: ".ui-resizable-s",
                                 w: ".ui-resizable-w",
                                 se: ".ui-resizable-se",
                                 sw: ".ui-resizable-sw",
                                 ne: ".ui-resizable-ne",
                                 nw: ".ui-resizable-nw"
                             });
      
                     this._handles = $();
                     if (this.handles.constructor === String) {
      
                         if (this.handles === "all") {
                             this.handles = "n,e,s,w,se,sw,ne,nw";
                         }
      
                         n = this.handles.split(",");
                         this.handles = {};
      
                         for (i = 0; i < n.length; i++) {
      
                             handle = $.trim(n[i]);
                             hname = "ui-resizable-" + handle;
      
      axis = $("
      ");
                             this._addClass(axis, "ui-resizable-handle " + hname);
      
                             axis.css({
                                 zIndex: o.zIndex
                             });
      
                             this.handles[handle] = ".ui-resizable-" + handle;
                             this.element.append(axis);
                         }
      
                     }
      
                     this._renderAxis = function (target) {
      
                         var i, axis, padPos, padWrapper;
      
                         target = target || this.element;
      
                         for (i in this.handles) {
      
                             if (this.handles[i].constructor === String) {
                                 this.handles[i] = this.element.children(this.handles[i]).first()
                                     .show();
                             } else if (this.handles[i].jquery || this.handles[i].nodeType) {
                                 this.handles[i] = $(this.handles[i]);
                                 this._on(this.handles[i], {
                                     "mousedown": that._mouseDown
                                 });
                             }
      
                             if (this.elementIsWrapper &&
                                 this.originalElement[0]
                                 .nodeName
                                 .match(/^(textarea|input|select|button)$/i)) {
                                 axis = $(this.handles[i], this.element);
      
                                 padWrapper = /sw|ne|nw|se|n|s/.test(i) ?
                                     axis.outerHeight() :
                                     axis.outerWidth();
      
                                 padPos = ["padding",
                                     /ne|nw|n/.test(i) ? "Top" :
                                     /se|sw|s/.test(i) ? "Bottom" :
                                     /^e$/.test(i) ? "Right" : "Left"
                                 ].join("");
      
                                 target.css(padPos, padWrapper);
      
                                 this._proportionallyResize();
                             }
      
                             this._handles = this._handles.add(this.handles[i]);
                         }
                     };
      
                     // TODO: make renderAxis a prototype function
                     this._renderAxis(this.element);
      
                     this._handles = this._handles.add(this.element.find(".ui-resizable-handle"));
                     this._handles.disableSelection();
      
                     this._handles.on("mouseover", function () {
                         if (!that.resizing) {
                             if (this.className) {
                                 axis = this.className.match(
                                     /ui-resizable-(se|sw|ne|nw|n|e|s|w)/i);
                             }
                             that.axis = axis && axis[1] ? axis[1] : "se";
                         }
                     });
      
                     if (o.autoHide) {
                         this._handles.hide();
                         this._addClass("ui-resizable-autohide");
                     }
                 },
      
                 _removeHandles: function () {
                     this._handles.remove();
                 },
      
                 _mouseCapture: function (event) {
                     var i, handle,
                         capture = false;
      
                     for (i in this.handles) {
                         handle = $(this.handles[i])[0];
                         if (handle === event.target || $.contains(handle, event.target)) {
                             capture = true;
                         }
                     }
      
                     return !this.options.disabled && capture;
                 },
      
                 _mouseStart: function (event) {
      
                     var curleft, curtop, cursor,
                         o = this.options,
                         el = this.element;
      
                     this.resizing = true;
      
                     this._renderProxy();
      
                     curleft = this._num(this.helper.css("left"));
                     curtop = this._num(this.helper.css("top"));
      
                     if (o.containment) {
                         curleft += $(o.containment).scrollLeft() || 0;
                         curtop += $(o.containment).scrollTop() || 0;
                     }
      
                     this.offset = this.helper.offset();
                     this.position = {
                         left: curleft,
                         top: curtop
                     };
      
                     this.size = this._helper ? {
                         width: this.helper.width(),
                         height: this.helper.height()
                     } : {
                         width: el.width(),
                         height: el.height()
                     };
      
                     this.originalSize = this._helper ? {
                         width: el.outerWidth(),
                         height: el.outerHeight()
                     } : {
                         width: el.width(),
                         height: el.height()
                     };
      
                     this.sizeDiff = {
                         width: el.outerWidth() - el.width(),
                         height: el.outerHeight() - el.height()
                     };
      
                     this.originalPosition = {
                         left: curleft,
                         top: curtop
                     };
                     this.originalMousePosition = {
                         left: event.pageX,
                         top: event.pageY
                     };
      
                     this.aspectRatio = (typeof o.aspectRatio === "number") ?
                         o.aspectRatio :
                         ((this.originalSize.width / this.originalSize.height) || 1);
      
                     cursor = $(".ui-resizable-" + this.axis).css("cursor");
                     $("body").css("cursor", cursor === "auto" ? this.axis + "-resize" : cursor);
      
                     this._addClass("ui-resizable-resizing");
                     this._propagate("start", event);
                     return true;
                 },
      
                 _mouseDrag: function (event) {
      
                     var data, props,
                         smp = this.originalMousePosition,
                         a = this.axis,
                         dx = (event.pageX - smp.left) || 0,
                         dy = (event.pageY - smp.top) || 0,
                         trigger = this._change[a];
      
                     this._updatePrevProperties();
      
                     if (!trigger) {
                         return false;
                     }
      
                     data = trigger.apply(this, [event, dx, dy]);
      
                     this._updateVirtualBoundaries(event.shiftKey);
                     if (this._aspectRatio || event.shiftKey) {
                         data = this._updateRatio(data, event);
                     }
      
                     data = this._respectSize(data, event);
      
                     this._updateCache(data);
      
                     this._propagate("resize", event);
      
                     props = this._applyChanges();
      
                     if (!this._helper && this._proportionallyResizeElements.length) {
                         this._proportionallyResize();
                     }
      
                     if (!$.isEmptyObject(props)) {
                         this._updatePrevProperties();
                         this._trigger("resize", event, this.ui());
                         this._applyChanges();
                     }
      
                     return false;
                 },
      
                 _mouseStop: function (event) {
      
                     this.resizing = false;
                     var pr, ista, soffseth, soffsetw, s, left, top,
                         o = this.options,
                         that = this;
      
                     if (this._helper) {
      
                         pr = this._proportionallyResizeElements;
                         ista = pr.length && (/textarea/i).test(pr[0].nodeName);
                         soffseth = ista && this._hasScroll(pr[0], "left") ? 0 : that.sizeDiff.height;
                         soffsetw = ista ? 0 : that.sizeDiff.width;
      
                         s = {
                             width: (that.helper.width() - soffsetw),
                             height: (that.helper.height() - soffseth)
                         };
                         left = (parseFloat(that.element.css("left")) +
                             (that.position.left - that.originalPosition.left)) || null;
                         top = (parseFloat(that.element.css("top")) +
                             (that.position.top - that.originalPosition.top)) || null;
      
                         if (!o.animate) {
                             this.element.css($.extend(s, {
                                 top: top,
                                 left: left
                             }));
                         }
      
                         that.helper.height(that.size.height);
                         that.helper.width(that.size.width);
      
                         if (this._helper && !o.animate) {
                             this._proportionallyResize();
                         }
                     }
      
                     $("body").css("cursor", "auto");
      
                     this._removeClass("ui-resizable-resizing");
      
                     this._propagate("stop", event);
      
                     if (this._helper) {
                         this.helper.remove();
                     }
      
                     return false;
      
                 },
      
                 _updatePrevProperties: function () {
                     this.prevPosition = {
                         top: this.position.top,
                         left: this.position.left
                     };
                     this.prevSize = {
                         width: this.size.width,
                         height: this.size.height
                     };
                 },
      
                 _applyChanges: function () {
                     var props = {};
      
                     if (this.position.top !== this.prevPosition.top) {
                         props.top = this.position.top + "px";
                     }
                     if (this.position.left !== this.prevPosition.left) {
                         props.left = this.position.left + "px";
                     }
                     if (this.size.width !== this.prevSize.width) {
                         props.width = this.size.width + "px";
                     }
                     if (this.size.height !== this.prevSize.height) {
                         props.height = this.size.height + "px";
                     }
      
                     this.helper.css(props);
      
                     return props;
                 },
      
                 _updateVirtualBoundaries: function (forceAspectRatio) {
                     var pMinWidth, pMaxWidth, pMinHeight, pMaxHeight, b,
                         o = this.options;
      
                     b = {
                         minWidth: this._isNumber(o.minWidth) ? o.minWidth : 0,
                         maxWidth: this._isNumber(o.maxWidth) ? o.maxWidth : Infinity,
                         minHeight: this._isNumber(o.minHeight) ? o.minHeight : 0,
                         maxHeight: this._isNumber(o.maxHeight) ? o.maxHeight : Infinity
                     };
      
                     if (this._aspectRatio || forceAspectRatio) {
                         pMinWidth = b.minHeight * this.aspectRatio;
                         pMinHeight = b.minWidth / this.aspectRatio;
                         pMaxWidth = b.maxHeight * this.aspectRatio;
                         pMaxHeight = b.maxWidth / this.aspectRatio;
      
                         if (pMinWidth > b.minWidth) {
                             b.minWidth = pMinWidth;
                         }
                         if (pMinHeight > b.minHeight) {
                             b.minHeight = pMinHeight;
                         }
                         if (pMaxWidth < b.maxWidth) {
                             b.maxWidth = pMaxWidth;
                         }
                         if (pMaxHeight < b.maxHeight) {
                             b.maxHeight = pMaxHeight;
                         }
                     }
                     this._vBoundaries = b;
                 },
      
                 _updateCache: function (data) {
                     this.offset = this.helper.offset();
                     if (this._isNumber(data.left)) {
                         this.position.left = data.left;
                     }
                     if (this._isNumber(data.top)) {
                         this.position.top = data.top;
                     }
                     if (this._isNumber(data.height)) {
                         this.size.height = data.height;
                     }
                     if (this._isNumber(data.width)) {
                         this.size.width = data.width;
                     }
                 },
      
                 _updateRatio: function (data) {
      
                     var cpos = this.position,
                         csize = this.size,
                         a = this.axis;
      
                     if (this._isNumber(data.height)) {
                         data.width = (data.height * this.aspectRatio);
                     } else if (this._isNumber(data.width)) {
                         data.height = (data.width / this.aspectRatio);
                     }
      
                     if (a === "sw") {
                         data.left = cpos.left + (csize.width - data.width);
                         data.top = null;
                     }
                     if (a === "nw") {
                         data.top = cpos.top + (csize.height - data.height);
                         data.left = cpos.left + (csize.width - data.width);
                     }
      
                     return data;
                 },
      
                 _respectSize: function (data) {
      
                     var o = this._vBoundaries,
                         a = this.axis,
                         ismaxw = this._isNumber(data.width) && o.maxWidth && (o.maxWidth < data.width),
                         ismaxh = this._isNumber(data.height) && o.maxHeight && (o.maxHeight < data
                             .height),
                         isminw = this._isNumber(data.width) && o.minWidth && (o.minWidth > data.width),
                         isminh = this._isNumber(data.height) && o.minHeight && (o.minHeight > data
                             .height),
                         dw = this.originalPosition.left + this.originalSize.width,
                         dh = this.originalPosition.top + this.originalSize.height,
                         cw = /sw|nw|w/.test(a),
                         ch = /nw|ne|n/.test(a);
                     if (isminw) {
                         data.width = o.minWidth;
                     }
                     if (isminh) {
                         data.height = o.minHeight;
                     }
                     if (ismaxw) {
                         data.width = o.maxWidth;
                     }
                     if (ismaxh) {
                         data.height = o.maxHeight;
                     }
      
                     if (isminw && cw) {
                         data.left = dw - o.minWidth;
                     }
                     if (ismaxw && cw) {
                         data.left = dw - o.maxWidth;
                     }
                     if (isminh && ch) {
                         data.top = dh - o.minHeight;
                     }
                     if (ismaxh && ch) {
                         data.top = dh - o.maxHeight;
                     }
      
                     // Fixing jump error on top/left - bug #2330
                     if (!data.width && !data.height && !data.left && data.top) {
                         data.top = null;
                     } else if (!data.width && !data.height && !data.top && data.left) {
                         data.left = null;
                     }
      
                     return data;
                 },
      
                 _getPaddingPlusBorderDimensions: function (element) {
                     var i = 0,
                         widths = [],
                         borders = [
                             element.css("borderTopWidth"),
                             element.css("borderRightWidth"),
                             element.css("borderBottomWidth"),
                             element.css("borderLeftWidth")
                         ],
                         paddings = [
                             element.css("paddingTop"),
                             element.css("paddingRight"),
                             element.css("paddingBottom"),
                             element.css("paddingLeft")
                         ];
      
                     for (; i < 4; i++) {
                         widths[i] = (parseFloat(borders[i]) || 0);
                         widths[i] += (parseFloat(paddings[i]) || 0);
                     }
      
                     return {
                         height: widths[0] + widths[2],
                         width: widths[1] + widths[3]
                     };
                 },
      
                 _proportionallyResize: function () {
      
                     if (!this._proportionallyResizeElements.length) {
                         return;
                     }
      
                     var prel,
                         i = 0,
                         element = this.helper || this.element;
      
                     for (; i < this._proportionallyResizeElements.length; i++) {
      
                         prel = this._proportionallyResizeElements[i];
      
                         // TODO: Seems like a bug to cache this.outerDimensions
                         // considering that we are in a loop.
                         if (!this.outerDimensions) {
                             this.outerDimensions = this._getPaddingPlusBorderDimensions(prel);
                         }
      
                         prel.css({
                             height: (element.height() - this.outerDimensions.height) || 0,
                             width: (element.width() - this.outerDimensions.width) || 0
                         });
      
                     }
      
                 },
      
                 _renderProxy: function () {
      
                     var el = this.element,
                         o = this.options;
                     this.elementOffset = el.offset();
      
                     if (this._helper) {
      
      this.helper = this.helper || $("
      ");
                         this._addClass(this.helper, this._helper);
                         this.helper.css({
                             width: this.element.outerWidth(),
                             height: this.element.outerHeight(),
                             position: "absolute",
                             left: this.elementOffset.left + "px",
                             top: this.elementOffset.top + "px",
                             zIndex: ++o.zIndex //TODO: Don't modify option
                         });
      
                         this.helper
                             .appendTo("body")
                             .disableSelection();
      
                     } else {
                         this.helper = this.element;
                     }
      
                 },
      
                 _change: {
                     e: function (event, dx) {
                         return {
                             width: this.originalSize.width + dx
                         };
                     },
                     w: function (event, dx) {
                         var cs = this.originalSize,
                             sp = this.originalPosition;
                         return {
                             left: sp.left + dx,
                             width: cs.width - dx
                         };
                     },
                     n: function (event, dx, dy) {
                         var cs = this.originalSize,
                             sp = this.originalPosition;
                         return {
                             top: sp.top + dy,
                             height: cs.height - dy
                         };
                     },
                     s: function (event, dx, dy) {
                         return {
                             height: this.originalSize.height + dy
                         };
                     },
                     se: function (event, dx, dy) {
                         return $.extend(this._change.s.apply(this, arguments),
                             this._change.e.apply(this, [event, dx, dy]));
                     },
                     sw: function (event, dx, dy) {
                         return $.extend(this._change.s.apply(this, arguments),
                             this._change.w.apply(this, [event, dx, dy]));
                     },
                     ne: function (event, dx, dy) {
                         return $.extend(this._change.n.apply(this, arguments),
                             this._change.e.apply(this, [event, dx, dy]));
                     },
                     nw: function (event, dx, dy) {
                         return $.extend(this._change.n.apply(this, arguments),
                             this._change.w.apply(this, [event, dx, dy]));
                     }
                 },
      
                 _propagate: function (n, event) {
                     $.ui.plugin.call(this, n, [event, this.ui()]);
                     (n !== "resize" && this._trigger(n, event, this.ui()));
                 },
      
                 plugins: {},
      
                 ui: function () {
                     return {
                         originalElement: this.originalElement,
                         element: this.element,
                         helper: this.helper,
                         position: this.position,
                         size: this.size,
                         originalSize: this.originalSize,
                         originalPosition: this.originalPosition
                     };
                 }
      
             });
      
             /*
              * Resizable Extensions
              */
      
             $.ui.plugin.add("resizable", "animate", {
      
                 stop: function (event) {
                     var that = $(this).resizable("instance"),
                         o = that.options,
                         pr = that._proportionallyResizeElements,
                         ista = pr.length && (/textarea/i).test(pr[0].nodeName),
                         soffseth = ista && that._hasScroll(pr[0], "left") ? 0 : that.sizeDiff.height,
                         soffsetw = ista ? 0 : that.sizeDiff.width,
                         style = {
                             width: (that.size.width - soffsetw),
                             height: (that.size.height - soffseth)
                         },
                         left = (parseFloat(that.element.css("left")) +
                             (that.position.left - that.originalPosition.left)) || null,
                         top = (parseFloat(that.element.css("top")) +
                             (that.position.top - that.originalPosition.top)) || null;
      
                     that.element.animate(
                         $.extend(style, top && left ? {
                             top: top,
                             left: left
                         } : {}), {
                             duration: o.animateDuration,
                             easing: o.animateEasing,
                             step: function () {
      
                                 var data = {
                                     width: parseFloat(that.element.css("width")),
                                     height: parseFloat(that.element.css("height")),
                                     top: parseFloat(that.element.css("top")),
                                     left: parseFloat(that.element.css("left"))
                                 };
      
                                 if (pr && pr.length) {
                                     $(pr[0]).css({
                                         width: data.width,
                                         height: data.height
                                     });
                                 }
      
                                 // Propagating resize, and updating values for each animation step
                                 that._updateCache(data);
                                 that._propagate("resize", event);
      
                             }
                         }
                     );
                 }
      
             });
      
             $.ui.plugin.add("resizable", "containment", {
      
                 start: function () {
                     var element, p, co, ch, cw, width, height,
                         that = $(this).resizable("instance"),
                         o = that.options,
                         el = that.element,
                         oc = o.containment,
                         ce = (oc instanceof $) ?
                         oc.get(0) :
                         (/parent/.test(oc)) ? el.parent().get(0) : oc;
      
                     if (!ce) {
                         return;
                     }
      
                     that.containerElement = $(ce);
      
                     if (/document/.test(oc) || oc === document) {
                         that.containerOffset = {
                             left: 0,
                             top: 0
                         };
                         that.containerPosition = {
                             left: 0,
                             top: 0
                         };
      
                         that.parentData = {
                             element: $(document),
                             left: 0,
                             top: 0,
                             width: $(document).width(),
                             height: $(document).height() || document.body.parentNode.scrollHeight
                         };
                     } else {
                         element = $(ce);
                         p = [];
                         $(["Top", "Right", "Left", "Bottom"]).each(function (i, name) {
                             p[i] = that._num(element.css("padding" + name));
                         });
      
                         that.containerOffset = element.offset();
                         that.containerPosition = element.position();
                         that.containerSize = {
                             height: (element.innerHeight() - p[3]),
                             width: (element.innerWidth() - p[1])
                         };
      
                         co = that.containerOffset;
                         ch = that.containerSize.height;
                         cw = that.containerSize.width;
                         width = (that._hasScroll(ce, "left") ? ce.scrollWidth : cw);
                         height = (that._hasScroll(ce) ? ce.scrollHeight : ch);
      
                         that.parentData = {
                             element: ce,
                             left: co.left,
                             top: co.top,
                             width: width,
                             height: height
                         };
                     }
                 },
      
                 resize: function (event) {
                     var woset, hoset, isParent, isOffsetRelative,
                         that = $(this).resizable("instance"),
                         o = that.options,
                         co = that.containerOffset,
                         cp = that.position,
                         pRatio = that._aspectRatio || event.shiftKey,
                         cop = {
                             top: 0,
                             left: 0
                         },
                         ce = that.containerElement,
                         continueResize = true;
      
                     if (ce[0] !== document && (/static/).test(ce.css("position"))) {
                         cop = co;
                     }
      
                     if (cp.left < (that._helper ? co.left : 0)) {
                         that.size.width = that.size.width +
                             (that._helper ?
                                 (that.position.left - co.left) :
                                 (that.position.left - cop.left));
      
                         if (pRatio) {
                             that.size.height = that.size.width / that.aspectRatio;
                             continueResize = false;
                         }
                         that.position.left = o.helper ? co.left : 0;
                     }
      
                     if (cp.top < (that._helper ? co.top : 0)) {
                         that.size.height = that.size.height +
                             (that._helper ?
                                 (that.position.top - co.top) :
                                 that.position.top);
      
                         if (pRatio) {
                             that.size.width = that.size.height * that.aspectRatio;
                             continueResize = false;
                         }
                         that.position.top = that._helper ? co.top : 0;
                     }
      
                     isParent = that.containerElement.get(0) === that.element.parent().get(0);
                     isOffsetRelative = /relative|absolute/.test(that.containerElement.css("position"));
      
                     if (isParent && isOffsetRelative) {
                         that.offset.left = that.parentData.left + that.position.left;
                         that.offset.top = that.parentData.top + that.position.top;
                     } else {
                         that.offset.left = that.element.offset().left;
                         that.offset.top = that.element.offset().top;
                     }
      
                     woset = Math.abs(that.sizeDiff.width +
                         (that._helper ?
                             that.offset.left - cop.left :
                             (that.offset.left - co.left)));
      
                     hoset = Math.abs(that.sizeDiff.height +
                         (that._helper ?
                             that.offset.top - cop.top :
                             (that.offset.top - co.top)));
      
                     if (woset + that.size.width >= that.parentData.width) {
                         that.size.width = that.parentData.width - woset;
                         if (pRatio) {
                             that.size.height = that.size.width / that.aspectRatio;
                             continueResize = false;
                         }
                     }
      
                     if (hoset + that.size.height >= that.parentData.height) {
                         that.size.height = that.parentData.height - hoset;
                         if (pRatio) {
                             that.size.width = that.size.height * that.aspectRatio;
                             continueResize = false;
                         }
                     }
      
                     if (!continueResize) {
                         that.position.left = that.prevPosition.left;
                         that.position.top = that.prevPosition.top;
                         that.size.width = that.prevSize.width;
                         that.size.height = that.prevSize.height;
                     }
                 },
      
                 stop: function () {
                     var that = $(this).resizable("instance"),
                         o = that.options,
                         co = that.containerOffset,
                         cop = that.containerPosition,
                         ce = that.containerElement,
                         helper = $(that.helper),
                         ho = helper.offset(),
                         w = helper.outerWidth() - that.sizeDiff.width,
                         h = helper.outerHeight() - that.sizeDiff.height;
      
                     if (that._helper && !o.animate && (/relative/).test(ce.css("position"))) {
                         $(this).css({
                             left: ho.left - cop.left - co.left,
                             width: w,
                             height: h
                         });
                     }
      
                     if (that._helper && !o.animate && (/static/).test(ce.css("position"))) {
                         $(this).css({
                             left: ho.left - cop.left - co.left,
                             width: w,
                             height: h
                         });
                     }
                 }
             });
      
             $.ui.plugin.add("resizable", "alsoResize", {
      
                 start: function () {
                     var that = $(this).resizable("instance"),
                         o = that.options;
      
                     $(o.alsoResize).each(function () {
                         var el = $(this);
                         el.data("ui-resizable-alsoresize", {
                             width: parseFloat(el.width()),
                             height: parseFloat(el.height()),
                             left: parseFloat(el.css("left")),
                             top: parseFloat(el.css("top"))
                         });
                     });
                 },
      
                 resize: function (event, ui) {
                     var that = $(this).resizable("instance"),
                         o = that.options,
                         os = that.originalSize,
                         op = that.originalPosition,
                         delta = {
                             height: (that.size.height - os.height) || 0,
                             width: (that.size.width - os.width) || 0,
                             top: (that.position.top - op.top) || 0,
                             left: (that.position.left - op.left) || 0
                         };
      
                     $(o.alsoResize).each(function () {
                         var el = $(this),
                             start = $(this).data("ui-resizable-alsoresize"),
                             style = {},
                             css = el.parents(ui.originalElement[0]).length ? ["width",
                                 "height"
                             ] : ["width", "height", "top", "left"];
      
                         $.each(css, function (i, prop) {
                             var sum = (start[prop] || 0) + (delta[prop] || 0);
                             if (sum && sum >= 0) {
                                 style[prop] = sum || null;
                             }
                         });
      
                         el.css(style);
                     });
                 },
      
                 stop: function () {
                     $(this).removeData("ui-resizable-alsoresize");
                 }
             });
      
             $.ui.plugin.add("resizable", "ghost", {
      
                 start: function () {
      
                     var that = $(this).resizable("instance"),
                         cs = that.size;
      
                     that.ghost = that.originalElement.clone();
                     that.ghost.css({
                         opacity: 0.25,
                         display: "block",
                         position: "relative",
                         height: cs.height,
                         width: cs.width,
                         margin: 0,
                         left: 0,
                         top: 0
                     });
      
                     that._addClass(that.ghost, "ui-resizable-ghost");
      
                     // DEPRECATED
                     // TODO: remove after 1.12
                     if ($.uiBackCompat !== false && typeof that.options.ghost === "string") {
      
                         // Ghost option
                         that.ghost.addClass(this.options.ghost);
                     }
      
                     that.ghost.appendTo(that.helper);
      
                 },
      
                 resize: function () {
                     var that = $(this).resizable("instance");
                     if (that.ghost) {
                         that.ghost.css({
                             position: "relative",
                             height: that.size.height,
                             width: that.size.width
                         });
                     }
                 },
      
                 stop: function () {
                     var that = $(this).resizable("instance");
                     if (that.ghost && that.helper) {
                         that.helper.get(0).removeChild(that.ghost.get(0));
                     }
                 }
      
             });
      
             $.ui.plugin.add("resizable", "grid", {
      
                 resize: function () {
                     var outerDimensions,
                         that = $(this).resizable("instance"),
                         o = that.options,
                         cs = that.size,
                         os = that.originalSize,
                         op = that.originalPosition,
                         a = that.axis,
                         grid = typeof o.grid === "number" ? [o.grid, o.grid] : o.grid,
                         gridX = (grid[0] || 1),
                         gridY = (grid[1] || 1),
                         ox = Math.round((cs.width - os.width) / gridX) * gridX,
                         oy = Math.round((cs.height - os.height) / gridY) * gridY,
                         newWidth = os.width + ox,
                         newHeight = os.height + oy,
                         isMaxWidth = o.maxWidth && (o.maxWidth < newWidth),
                         isMaxHeight = o.maxHeight && (o.maxHeight < newHeight),
                         isMinWidth = o.minWidth && (o.minWidth > newWidth),
                         isMinHeight = o.minHeight && (o.minHeight > newHeight);
      
                     o.grid = grid;
      
                     if (isMinWidth) {
                         newWidth += gridX;
                     }
                     if (isMinHeight) {
                         newHeight += gridY;
                     }
                     if (isMaxWidth) {
                         newWidth -= gridX;
                     }
                     if (isMaxHeight) {
                         newHeight -= gridY;
                     }
      
                     if (/^(se|s|e)$/.test(a)) {
                         that.size.width = newWidth;
                         that.size.height = newHeight;
                     } else if (/^(ne)$/.test(a)) {
                         that.size.width = newWidth;
                         that.size.height = newHeight;
                         that.position.top = op.top - oy;
                     } else if (/^(sw)$/.test(a)) {
                         that.size.width = newWidth;
                         that.size.height = newHeight;
                         that.position.left = op.left - ox;
                     } else {
                         if (newHeight - gridY <= 0 || newWidth - gridX <= 0) {
                             outerDimensions = that._getPaddingPlusBorderDimensions(this);
                         }
      
                         if (newHeight - gridY > 0) {
                             that.size.height = newHeight;
                             that.position.top = op.top - oy;
                         } else {
                             newHeight = gridY - outerDimensions.height;
                             that.size.height = newHeight;
                             that.position.top = op.top + os.height - newHeight;
                         }
                         if (newWidth - gridX > 0) {
                             that.size.width = newWidth;
                             that.position.left = op.left - ox;
                         } else {
                             newWidth = gridX - outerDimensions.width;
                             that.size.width = newWidth;
                             that.position.left = op.left + os.width - newWidth;
                         }
                     }
                 }
      
             });
      
             var widgetsResizable = $.ui.resizable;
      


             /*!
              * jQuery UI Dialog 1.12.1
              * http://jqueryui.com
              *
              * Copyright jQuery Foundation and other contributors
              * Released under the MIT license.
              * http://jquery.org/license
              */
      
             //>>label: Dialog
             //>>group: Widgets
             //>>description: Displays customizable dialog windows.
             //>>docs: http://api.jqueryui.com/dialog/
             //>>demos: http://jqueryui.com/dialog/
             //>>css.structure: ../../themes/base/core.css
             //>>css.structure: ../../themes/base/dialog.css
             //>>css.theme: ../../themes/base/theme.css
      


             $.widget("ui.dialog", {
                 version: "1.12.1",
                 options: {
                     appendTo: "body",
                     autoOpen: true,
                     buttons: [],
                     classes: {
                         "ui-dialog": "ui-corner-all",
                         "ui-dialog-titlebar": "ui-corner-all"
                     },
                     closeOnEscape: true,
                     closeText: "Close",
                     draggable: true,
                     hide: null,
                     height: "auto",
                     maxHeight: null,
                     maxWidth: null,
                     minHeight: 150,
                     minWidth: 150,
                     modal: false,
                     position: {
                         my: "center",
                         at: "center",
                         of: window,
                         collision: "fit",
      
                         // Ensure the titlebar is always visible
                         using: function (pos) {
                             var topOffset = $(this).css(pos).offset().top;
                             if (topOffset < 0) {
                                 $(this).css("top", pos.top - topOffset);
                             }
                         }
                     },
                     resizable: true,
                     show: null,
                     title: null,
                     width: 300,
      
                     // Callbacks
                     beforeClose: null,
                     close: null,
                     drag: null,
                     dragStart: null,
                     dragStop: null,
                     focus: null,
                     open: null,
                     resize: null,
                     resizeStart: null,
                     resizeStop: null
                 },
      
                 sizeRelatedOptions: {
                     buttons: true,
                     height: true,
                     maxHeight: true,
                     maxWidth: true,
                     minHeight: true,
                     minWidth: true,
                     width: true
                 },
      
                 resizableRelatedOptions: {
                     maxHeight: true,
                     maxWidth: true,
                     minHeight: true,
                     minWidth: true
                 },
      
                 _create: function () {
                     this.originalCss = {
                         display: this.element[0].style.display,
                         width: this.element[0].style.width,
                         minHeight: this.element[0].style.minHeight,
                         maxHeight: this.element[0].style.maxHeight,
                         height: this.element[0].style.height
                     };
                     this.originalPosition = {
                         parent: this.element.parent(),
                         index: this.element.parent().children().index(this.element)
                     };
                     this.originalTitle = this.element.attr("title");
                     if (this.options.title == null && this.originalTitle != null) {
                         this.options.title = this.originalTitle;
                     }
      
                     // Dialogs can't be disabled
                     if (this.options.disabled) {
                         this.options.disabled = false;
                     }
      
                     this._createWrapper();
      
                     this.element
                         .show()
                         .removeAttr("title")
                         .appendTo(this.uiDialog);
      
                     this._addClass("ui-dialog-content", "ui-widget-content");
      
                     this._createTitlebar();
                     this._createButtonPane();
      
                     if (this.options.draggable && $.fn.draggable) {
                         this._makeDraggable();
                     }
                     if (this.options.resizable && $.fn.resizable) {
                         this._makeResizable();
                     }
      
                     this._isOpen = false;
      
                     this._trackFocus();
                 },
      
                 _init: function () {
                     if (this.options.autoOpen) {
                         this.open();
                     }
                 },
      
                 _appendTo: function () {
                     var element = this.options.appendTo;
                     if (element && (element.jquery || element.nodeType)) {
                         return $(element);
                     }
                     return this.document.find(element || "body").eq(0);
                 },
      
                 _destroy: function () {
                     var next,
                         originalPosition = this.originalPosition;
      
                     this._untrackInstance();
                     this._destroyOverlay();
      
                     this.element
                         .removeUniqueId()
                         .css(this.originalCss)
      
                         // Without detaching first, the following becomes really slow
                         .detach();
      
                     this.uiDialog.remove();
      
                     if (this.originalTitle) {
                         this.element.attr("title", this.originalTitle);
                     }
      
                     next = originalPosition.parent.children().eq(originalPosition.index);
      
                     // Don't try to place the dialog next to itself (#8613)
                     if (next.length && next[0] !== this.element[0]) {
                         next.before(this.element);
                     } else {
                         originalPosition.parent.append(this.element);
                     }
                 },
      
                 widget: function () {
                     return this.uiDialog;
                 },
      
                 disable: $.noop,
                 enable: $.noop,
      
                 close: function (event) {
                     var that = this;
      
                     if (!this._isOpen || this._trigger("beforeClose", event) === false) {
                         return;
                     }
      
                     this._isOpen = false;
                     this._focusedElement = null;
                     this._destroyOverlay();
                     this._untrackInstance();
      
                     if (!this.opener.filter(":focusable").trigger("focus").length) {
      
                         // Hiding a focused element doesn't trigger blur in WebKit
                         // so in case we have nothing to focus on, explicitly blur the active element
                         // https://bugs.webkit.org/show_bug.cgi?id=47182
                         $.ui.safeBlur($.ui.safeActiveElement(this.document[0]));
                     }
      
                     this._hide(this.uiDialog, this.options.hide, function () {
                         that._trigger("close", event);
                     });
                 },
      
                 isOpen: function () {
                     return this._isOpen;
                 },
      
                 moveToTop: function () {
                     this._moveToTop();
                 },
      
                 _moveToTop: function (event, silent) {
                     var moved = false,
                         zIndices = this.uiDialog.siblings(".ui-front:visible").map(function () {
                             return +$(this).css("z-index");
                         }).get(),
                         zIndexMax = Math.max.apply(null, zIndices);
      
                     if (zIndexMax >= +this.uiDialog.css("z-index")) {
                         this.uiDialog.css("z-index", zIndexMax + 1);
                         moved = true;
                     }
      
                     if (moved && !silent) {
                         this._trigger("focus", event);
                     }
                     return moved;
                 },
      
                 open: function () {
                     var that = this;
                     if (this._isOpen) {
                         if (this._moveToTop()) {
                             this._focusTabbable();
                         }
                         return;
                     }
      
                     this._isOpen = true;
                     this.opener = $($.ui.safeActiveElement(this.document[0]));
      
                     this._size();
                     this._position();
                     this._createOverlay();
                     this._moveToTop(null, true);
      
                     // Ensure the overlay is moved to the top with the dialog, but only when
                     // opening. The overlay shouldn't move after the dialog is open so that
                     // modeless dialogs opened after the modal dialog stack properly.
                     if (this.overlay) {
                         this.overlay.css("z-index", this.uiDialog.css("z-index") - 1);
                     }
      
                     this._show(this.uiDialog, this.options.show, function () {
                         that._focusTabbable();
                         that._trigger("focus");
                     });
      
                     // Track the dialog immediately upon openening in case a focus event
                     // somehow occurs outside of the dialog before an element inside the
                     // dialog is focused (#10152)
                     this._makeFocusTarget();
      
                     this._trigger("open");
                 },
      
                 _focusTabbable: function () {
      
                     // Set focus to the first match:
                     // 1. An element that was focused previously
                     // 2. First element inside the dialog matching [autofocus]
                     // 3. Tabbable element inside the content element
                     // 4. Tabbable element inside the buttonpane
                     // 5. The close button
                     // 6. The dialog itself
                     var hasFocus = this._focusedElement;
                     if (!hasFocus) {
                         hasFocus = this.element.find("[autofocus]");
                     }
                     if (!hasFocus.length) {
                         hasFocus = this.element.find(":tabbable");
                     }
                     if (!hasFocus.length) {
                         hasFocus = this.uiDialogButtonPane.find(":tabbable");
                     }
                     if (!hasFocus.length) {
                         hasFocus = this.uiDialogTitlebarClose.filter(":tabbable");
                     }
                     if (!hasFocus.length) {
                         hasFocus = this.uiDialog;
                     }
                     hasFocus.eq(0).trigger("focus");
                 },
      
                 _keepFocus: function (event) {
                     function checkFocus() {
                         var activeElement = $.ui.safeActiveElement(this.document[0]),
                             isActive = this.uiDialog[0] === activeElement ||
                             $.contains(this.uiDialog[0], activeElement);
                         if (!isActive) {
                             this._focusTabbable();
                         }
                     }
                     event.preventDefault();
                     checkFocus.call(this);
      
                     // support: IE
                     // IE <= 8 doesn't prevent moving focus even with event.preventDefault()
                     // so we check again later
                     this._delay(checkFocus);
                 },
      
                 _createWrapper: function () {
      
      this.uiDialog = $("
      ")
                         .hide()
                         .attr({
      
                             // Setting tabIndex makes the div focusable
                             tabIndex: -1,
                             role: "dialog"
                         })
                         .appendTo(this._appendTo());
      
                     this._addClass(this.uiDialog, "ui-dialog", "ui-widget ui-widget-content ui-front");
                     this._on(this.uiDialog, {
                         keydown: function (event) {
                             if (this.options.closeOnEscape && !event.isDefaultPrevented() &&
                                 event.keyCode &&
                                 event.keyCode === $.ui.keyCode.ESCAPE) {
                                 event.preventDefault();
                                 this.close(event);
                                 return;
                             }
      
                             // Prevent tabbing out of dialogs
                             if (event.keyCode !== $.ui.keyCode.TAB || event
                                 .isDefaultPrevented()) {
                                 return;
                             }
                             var tabbables = this.uiDialog.find(":tabbable"),
                                 first = tabbables.filter(":first"),
                                 last = tabbables.filter(":last");
      
                             if ((event.target === last[0] || event.target === this.uiDialog[
                                     0]) &&
                                 !event.shiftKey) {
                                 this._delay(function () {
                                     first.trigger("focus");
                                 });
                                 event.preventDefault();
                             } else if ((event.target === first[0] ||
                                     event.target === this.uiDialog[0]) && event.shiftKey) {
                                 this._delay(function () {
                                     last.trigger("focus");
                                 });
                                 event.preventDefault();
                             }
                         },
                         mousedown: function (event) {
                             if (this._moveToTop(event)) {
                                 this._focusTabbable();
                             }
                         }
                     });
      
                     // We assume that any existing aria-describedby attribute means
                     // that the dialog content is marked up properly
                     // otherwise we brute force the content as the description
                     if (!this.element.find("[aria-describedby]").length) {
                         this.uiDialog.attr({
                             "aria-describedby": this.element.uniqueId().attr("id")
                         });
                     }
                 },
      
                 _createTitlebar: function () {
                     var uiDialogTitle;
      
      this.uiDialogTitlebar = $("
      ");
                     this._addClass(this.uiDialogTitlebar,
                         "ui-dialog-titlebar", "ui-widget-header ui-helper-clearfix");
                     this._on(this.uiDialogTitlebar, {
                         mousedown: function (event) {
      
                             // Don't prevent click on close button (#8838)
                             // Focusing a dialog that is partially scrolled out of view
                             // causes the browser to scroll it into view, preventing the click event
                             if (!$(event.target).closest(".ui-dialog-titlebar-close")) {
      
                                 // Dialog isn't getting focus when dragging (#8063)
                                 this.uiDialog.trigger("focus");
                             }
                         }
                     });
      
                     // Support: IE
                     // Use type="button" to prevent enter keypresses in textboxes from closing the
                     // dialog in IE (#9312)
                     this.uiDialogTitlebarClose = $("<button type='button'></button>")
                         .button({
                             label: $("<a>").text(this.options.closeText).html(),
                             icon: "ui-icon-closethick",
                             showLabel: false
                         })
                         .appendTo(this.uiDialogTitlebar);
      
                     this._addClass(this.uiDialogTitlebarClose, "ui-dialog-titlebar-close");
                     this._on(this.uiDialogTitlebarClose, {
                         click: function (event) {
                             event.preventDefault();
                             this.close(event);
                         }
                     });
      
                     uiDialogTitle = $("").uniqueId().prependTo(this.uiDialogTitlebar);
                     this._addClass(uiDialogTitle, "ui-dialog-title");
                     this._title(uiDialogTitle);
      
                     this.uiDialogTitlebar.prependTo(this.uiDialog);
      
                     this.uiDialog.attr({
                         "aria-labelledby": uiDialogTitle.attr("id")
                     });
                 },
      
                 _title: function (title) {
                     if (this.options.title) {
                         title.text(this.options.title);
                     } else {
                         title.html(" ");
                     }
                 },
      
                 _createButtonPane: function () {
      
      this.uiDialogButtonPane = $("
      ");
                     this._addClass(this.uiDialogButtonPane, "ui-dialog-buttonpane",
                         "ui-widget-content ui-helper-clearfix");
      
      this.uiButtonSet = $("
      ")
                         .appendTo(this.uiDialogButtonPane);
                     this._addClass(this.uiButtonSet, "ui-dialog-buttonset");
      
                     this._createButtons();
                 },
      
                 _createButtons: function () {
                     var that = this,
                         buttons = this.options.buttons;
      
                     // If we already have a button pane, remove it
                     this.uiDialogButtonPane.remove();
                     this.uiButtonSet.empty();
      
                     if ($.isEmptyObject(buttons) || ($.isArray(buttons) && !buttons.length)) {
                         this._removeClass(this.uiDialog, "ui-dialog-buttons");
                         return;
                     }
      
                     $.each(buttons, function (name, props) {
                         var click, buttonOptions;
                         props = $.isFunction(props) ? {
                                 click: props,
                                 text: name
                             } :
                             props;
      
                         // Default to a non-submitting button
                         props = $.extend({
                             type: "button"
                         }, props);
      
                         // Change the context for the click callback to be the main element
                         click = props.click;
                         buttonOptions = {
                             icon: props.icon,
                             iconPosition: props.iconPosition,
                             showLabel: props.showLabel,
      
                             // Deprecated options
                             icons: props.icons,
                             text: props.text
                         };
      
                         delete props.click;
                         delete props.icon;
                         delete props.iconPosition;
                         delete props.showLabel;
      
                         // Deprecated options
                         delete props.icons;
                         if (typeof props.text === "boolean") {
                             delete props.text;
                         }
      
                         $("<button></button>", props)
                             .button(buttonOptions)
                             .appendTo(that.uiButtonSet)
                             .on("click", function () {
                                 click.apply(that.element[0], arguments);
                             });
                     });
                     this._addClass(this.uiDialog, "ui-dialog-buttons");
                     this.uiDialogButtonPane.appendTo(this.uiDialog);
                 },
      
                 _makeDraggable: function () {
                     var that = this,
                         options = this.options;
      
                     function filteredUi(ui) {
                         return {
                             position: ui.position,
                             offset: ui.offset
                         };
                     }
      
                     this.uiDialog.draggable({
                         cancel: ".ui-dialog-content, .ui-dialog-titlebar-close",
                         handle: ".ui-dialog-titlebar",
                         containment: "document",
                         start: function (event, ui) {
                             that._addClass($(this), "ui-dialog-dragging");
                             that._blockFrames();
                             that._trigger("dragStart", event, filteredUi(ui));
                         },
                         drag: function (event, ui) {
                             that._trigger("drag", event, filteredUi(ui));
                         },
                         stop: function (event, ui) {
                             var left = ui.offset.left - that.document.scrollLeft(),
                                 top = ui.offset.top - that.document.scrollTop();
      
                             options.position = {
                                 my: "left top",
                                 at: "left" + (left >= 0 ? "+" : "") + left + " " +
                                     "top" + (top >= 0 ? "+" : "") + top,
                                 of: that.window
                             };
                             that._removeClass($(this), "ui-dialog-dragging");
                             that._unblockFrames();
                             that._trigger("dragStop", event, filteredUi(ui));
                         }
                     });
                 },
      
                 _makeResizable: function () {
                     var that = this,
                         options = this.options,
                         handles = options.resizable,
      
                         // .ui-resizable has position: relative defined in the stylesheet
                         // but dialogs have to use absolute or fixed positioning
                         position = this.uiDialog.css("position"),
                         resizeHandles = typeof handles === "string" ?
                         handles :
                         "n,e,s,w,se,sw,ne,nw";
      
                     function filteredUi(ui) {
                         return {
                             originalPosition: ui.originalPosition,
                             originalSize: ui.originalSize,
                             position: ui.position,
                             size: ui.size
                         };
                     }
      
                     this.uiDialog.resizable({
                             cancel: ".ui-dialog-content",
                             containment: "document",
                             alsoResize: this.element,
                             maxWidth: options.maxWidth,
                             maxHeight: options.maxHeight,
                             minWidth: options.minWidth,
                             minHeight: this._minHeight(),
                             handles: resizeHandles,
                             start: function (event, ui) {
                                 that._addClass($(this), "ui-dialog-resizing");
                                 that._blockFrames();
                                 that._trigger("resizeStart", event, filteredUi(ui));
                             },
                             resize: function (event, ui) {
                                 that._trigger("resize", event, filteredUi(ui));
                             },
                             stop: function (event, ui) {
                                 var offset = that.uiDialog.offset(),
                                     left = offset.left - that.document.scrollLeft(),
                                     top = offset.top - that.document.scrollTop();
      
                                 options.height = that.uiDialog.height();
                                 options.width = that.uiDialog.width();
                                 options.position = {
                                     my: "left top",
                                     at: "left" + (left >= 0 ? "+" : "") + left + " " +
                                         "top" + (top >= 0 ? "+" : "") + top,
                                     of: that.window
                                 };
                                 that._removeClass($(this), "ui-dialog-resizing");
                                 that._unblockFrames();
                                 that._trigger("resizeStop", event, filteredUi(ui));
                             }
                         })
                         .css("position", position);
                 },
      
                 _trackFocus: function () {
                     this._on(this.widget(), {
                         focusin: function (event) {
                             this._makeFocusTarget();
                             this._focusedElement = $(event.target);
                         }
                     });
                 },
      
                 _makeFocusTarget: function () {
                     this._untrackInstance();
                     this._trackingInstances().unshift(this);
                 },
      
                 _untrackInstance: function () {
                     var instances = this._trackingInstances(),
                         exists = $.inArray(this, instances);
                     if (exists !== -1) {
                         instances.splice(exists, 1);
                     }
                 },
      
                 _trackingInstances: function () {
                     var instances = this.document.data("ui-dialog-instances");
                     if (!instances) {
                         instances = [];
                         this.document.data("ui-dialog-instances", instances);
                     }
                     return instances;
                 },
      
                 _minHeight: function () {
                     var options = this.options;
      
                     return options.height === "auto" ?
                         options.minHeight :
                         Math.min(options.minHeight, options.height);
                 },
      
                 _position: function () {
      
                     // Need to show the dialog to get the actual offset in the position plugin
                     var isVisible = this.uiDialog.is(":visible");
                     if (!isVisible) {
                         this.uiDialog.show();
                     }
                     this.uiDialog.position(this.options.position);
                     if (!isVisible) {
                         this.uiDialog.hide();
                     }
                 },
      
                 _setOptions: function (options) {
                     var that = this,
                         resize = false,
                         resizableOptions = {};
      
                     $.each(options, function (key, value) {
                         that._setOption(key, value);
      
                         if (key in that.sizeRelatedOptions) {
                             resize = true;
                         }
                         if (key in that.resizableRelatedOptions) {
                             resizableOptions[key] = value;
                         }
                     });
      
                     if (resize) {
                         this._size();
                         this._position();
                     }
                     if (this.uiDialog.is(":data(ui-resizable)")) {
                         this.uiDialog.resizable("option", resizableOptions);
                     }
                 },
      
                 _setOption: function (key, value) {
                     var isDraggable, isResizable,
                         uiDialog = this.uiDialog;
      
                     if (key === "disabled") {
                         return;
                     }
      
                     this._super(key, value);
      
                     if (key === "appendTo") {
                         this.uiDialog.appendTo(this._appendTo());
                     }
      
                     if (key === "buttons") {
                         this._createButtons();
                     }
      
                     if (key === "closeText") {
                         this.uiDialogTitlebarClose.button({
      
                             // Ensure that we always pass a string
                             label: $("<a>").text("" + this.options.closeText).html()
                         });
                     }
      
                     if (key === "draggable") {
                         isDraggable = uiDialog.is(":data(ui-draggable)");
                         if (isDraggable && !value) {
                             uiDialog.draggable("destroy");
                         }
      
                         if (!isDraggable && value) {
                             this._makeDraggable();
                         }
                     }
      
                     if (key === "position") {
                         this._position();
                     }
      
                     if (key === "resizable") {
      
                         // currently resizable, becoming non-resizable
                         isResizable = uiDialog.is(":data(ui-resizable)");
                         if (isResizable && !value) {
                             uiDialog.resizable("destroy");
                         }
      
                         // Currently resizable, changing handles
                         if (isResizable && typeof value === "string") {
                             uiDialog.resizable("option", "handles", value);
                         }
      
                         // Currently non-resizable, becoming resizable
                         if (!isResizable && value !== false) {
                             this._makeResizable();
                         }
                     }
      
                     if (key === "title") {
                         this._title(this.uiDialogTitlebar.find(".ui-dialog-title"));
                     }
                 },
      
                 _size: function () {
      
                     // If the user has resized the dialog, the .ui-dialog and .ui-dialog-content
                     // divs will both have width and height set, so we need to reset them
                     var nonContentHeight, minContentHeight, maxContentHeight,
                         options = this.options;
      
                     // Reset content sizing
                     this.element.show().css({
                         width: "auto",
                         minHeight: 0,
                         maxHeight: "none",
                         height: 0
                     });
      
                     if (options.minWidth > options.width) {
                         options.width = options.minWidth;
                     }
      
                     // Reset wrapper sizing
                     // determine the height of all the non-content elements
                     nonContentHeight = this.uiDialog.css({
                             height: "auto",
                             width: options.width
                         })
                         .outerHeight();
                     minContentHeight = Math.max(0, options.minHeight - nonContentHeight);
                     maxContentHeight = typeof options.maxHeight === "number" ?
                         Math.max(0, options.maxHeight - nonContentHeight) :
                         "none";
      
                     if (options.height === "auto") {
                         this.element.css({
                             minHeight: minContentHeight,
                             maxHeight: maxContentHeight,
                             height: "auto"
                         });
                     } else {
                         this.element.height(Math.max(0, options.height - nonContentHeight));
                     }
      
                     if (this.uiDialog.is(":data(ui-resizable)")) {
                         this.uiDialog.resizable("option", "minHeight", this._minHeight());
                     }
                 },
      
                 _blockFrames: function () {
                     this.iframeBlocks = this.document.find("iframe").map(function () {
                         var iframe = $(this);
      
      return $("
      ")
                             .css({
                                 position: "absolute",
                                 width: iframe.outerWidth(),
                                 height: iframe.outerHeight()
                             })
                             .appendTo(iframe.parent())
                             .offset(iframe.offset())[0];
                     });
                 },
      
                 _unblockFrames: function () {
                     if (this.iframeBlocks) {
                         this.iframeBlocks.remove();
                         delete this.iframeBlocks;
                     }
                 },
      
                 _allowInteraction: function (event) {
                     if ($(event.target).closest(".ui-dialog").length) {
                         return true;
                     }
      
                     // TODO: Remove hack when datepicker implements
                     // the .ui-front logic (#8989)
                     return !!$(event.target).closest(".ui-datepicker").length;
                 },
      
                 _createOverlay: function () {
                     if (!this.options.modal) {
                         return;
                     }
      
                     // We use a delay in case the overlay is created from an
                     // event that we're going to be cancelling (#2804)
                     var isOpening = true;
                     this._delay(function () {
                         isOpening = false;
                     });
      
                     if (!this.document.data("ui-dialog-overlays")) {
      
                         // Prevent use of anchors and inputs
                         // Using _on() for an event handler shared across many instances is
                         // safe because the dialogs stack and must be closed in reverse order
                         this._on(this.document, {
                             focusin: function (event) {
                                 if (isOpening) {
                                     return;
                                 }
      
                                 if (!this._allowInteraction(event)) {
                                     event.preventDefault();
                                     this._trackingInstances()[0]._focusTabbable();
                                 }
                             }
                         });
                     }
      
      this.overlay = $("
      ")
                         .appendTo(this._appendTo());
      
                     this._addClass(this.overlay, null, "ui-widget-overlay ui-front");
                     this._on(this.overlay, {
                         mousedown: "_keepFocus"
                     });
                     this.document.data("ui-dialog-overlays",
                         (this.document.data("ui-dialog-overlays") || 0) + 1);
                 },
      
                 _destroyOverlay: function () {
                     if (!this.options.modal) {
                         return;
                     }
      
                     if (this.overlay) {
                         var overlays = this.document.data("ui-dialog-overlays") - 1;
      
                         if (!overlays) {
                             this._off(this.document, "focusin");
                             this.document.removeData("ui-dialog-overlays");
                         } else {
                             this.document.data("ui-dialog-overlays", overlays);
                         }
      
                         this.overlay.remove();
                         this.overlay = null;
                     }
                 }
             });
      
             // DEPRECATED
             // TODO: switch return back to widget declaration at top of file when this is removed
             if ($.uiBackCompat !== false) {
      
                 // Backcompat for dialogClass option
                 $.widget("ui.dialog", $.ui.dialog, {
                     options: {
                         dialogClass: ""
                     },
                     _createWrapper: function () {
                         this._super();
                         this.uiDialog.addClass(this.options.dialogClass);
                     },
                     _setOption: function (key, value) {
                         if (key === "dialogClass") {
                             this.uiDialog
                                 .removeClass(this.options.dialogClass)
                                 .addClass(value);
                         }
                         this._superApply(arguments);
                     }
                 });
             }
      
             var widgetsDialog = $.ui.dialog;
      


             /*!
              * jQuery UI Droppable 1.12.1
              * http://jqueryui.com
              *
              * Copyright jQuery Foundation and other contributors
              * Released under the MIT license.
              * http://jquery.org/license
              */
      
             //>>label: Droppable
             //>>group: Interactions
             //>>description: Enables drop targets for draggable elements.
             //>>docs: http://api.jqueryui.com/droppable/
             //>>demos: http://jqueryui.com/droppable/
      


             $.widget("ui.droppable", {
                 version: "1.12.1",
                 widgetEventPrefix: "drop",
                 options: {
                     accept: "*",
                     addClasses: true,
                     greedy: false,
                     scope: "default",
                     tolerance: "intersect",
      
                     // Callbacks
                     activate: null,
                     deactivate: null,
                     drop: null,
                     out: null,
                     over: null
                 },
                 _create: function () {
      
                     var proportions,
                         o = this.options,
                         accept = o.accept;
      
                     this.isover = false;
                     this.isout = true;
      
                     this.accept = $.isFunction(accept) ? accept : function (d) {
                         return d.is(accept);
                     };
      
                     this.proportions = function ( /* valueToWrite */ ) {
                         if (arguments.length) {
      
                             // Store the droppable's proportions
                             proportions = arguments[0];
                         } else {
      
                             // Retrieve or derive the droppable's proportions
                             return proportions ?
                                 proportions :
                                 proportions = {
                                     width: this.element[0].offsetWidth,
                                     height: this.element[0].offsetHeight
                                 };
                         }
                     };
      
                     this._addToManager(o.scope);
      
                     o.addClasses && this._addClass("ui-droppable");
      
                 },
      
                 _addToManager: function (scope) {
      
                     // Add the reference and positions to the manager
                     $.ui.ddmanager.droppables[scope] = $.ui.ddmanager.droppables[scope] || [];
                     $.ui.ddmanager.droppables[scope].push(this);
                 },
      
                 _splice: function (drop) {
                     var i = 0;
                     for (; i < drop.length; i++) {
                         if (drop[i] === this) {
                             drop.splice(i, 1);
                         }
                     }
                 },
      
                 _destroy: function () {
                     var drop = $.ui.ddmanager.droppables[this.options.scope];
      
                     this._splice(drop);
                 },
      
                 _setOption: function (key, value) {
      
                     if (key === "accept") {
                         this.accept = $.isFunction(value) ? value : function (d) {
                             return d.is(value);
                         };
                     } else if (key === "scope") {
                         var drop = $.ui.ddmanager.droppables[this.options.scope];
      
                         this._splice(drop);
                         this._addToManager(value);
                     }
      
                     this._super(key, value);
                 },
      
                 _activate: function (event) {
                     var draggable = $.ui.ddmanager.current;
      
                     this._addActiveClass();
                     if (draggable) {
                         this._trigger("activate", event, this.ui(draggable));
                     }
                 },
      
                 _deactivate: function (event) {
                     var draggable = $.ui.ddmanager.current;
      
                     this._removeActiveClass();
                     if (draggable) {
                         this._trigger("deactivate", event, this.ui(draggable));
                     }
                 },
      
                 _over: function (event) {
      
                     var draggable = $.ui.ddmanager.current;
      
                     // Bail if draggable and droppable are same element
                     if (!draggable || (draggable.currentItem ||
                             draggable.element)[0] === this.element[0]) {
                         return;
                     }
      
                     if (this.accept.call(this.element[0], (draggable.currentItem ||
                             draggable.element))) {
                         this._addHoverClass();
                         this._trigger("over", event, this.ui(draggable));
                     }
      
                 },
      
                 _out: function (event) {
      
                     var draggable = $.ui.ddmanager.current;
      
                     // Bail if draggable and droppable are same element
                     if (!draggable || (draggable.currentItem ||
                             draggable.element)[0] === this.element[0]) {
                         return;
                     }
      
                     if (this.accept.call(this.element[0], (draggable.currentItem ||
                             draggable.element))) {
                         this._removeHoverClass();
                         this._trigger("out", event, this.ui(draggable));
                     }
      
                 },
      
                 _drop: function (event, custom) {
      
                     var draggable = custom || $.ui.ddmanager.current,
                         childrenIntersection = false;
      
                     // Bail if draggable and droppable are same element
                     if (!draggable || (draggable.currentItem ||
                             draggable.element)[0] === this.element[0]) {
                         return false;
                     }
      
                     this.element
                         .find(":data(ui-droppable)")
                         .not(".ui-draggable-dragging")
                         .each(function () {
                             var inst = $(this).droppable("instance");
                             if (
                                 inst.options.greedy &&
                                 !inst.options.disabled &&
                                 inst.options.scope === draggable.options.scope &&
                                 inst.accept.call(
                                     inst.element[0], (draggable.currentItem || draggable.element)
                                 ) &&
                                 intersect(
                                     draggable,
                                     $.extend(inst, {
                                         offset: inst.element.offset()
                                     }),
                                     inst.options.tolerance, event
                                 )
                             ) {
                                 childrenIntersection = true;
                                 return false;
                             }
                         });
                     if (childrenIntersection) {
                         return false;
                     }
      
                     if (this.accept.call(this.element[0],
                             (draggable.currentItem || draggable.element))) {
                         this._removeActiveClass();
                         this._removeHoverClass();
      
                         this._trigger("drop", event, this.ui(draggable));
                         return this.element;
                     }
      
                     return false;
      
                 },
      
                 ui: function (c) {
                     return {
                         draggable: (c.currentItem || c.element),
                         helper: c.helper,
                         position: c.position,
                         offset: c.positionAbs
                     };
                 },
      
                 // Extension points just to make backcompat sane and avoid duplicating logic
                 // TODO: Remove in 1.13 along with call to it below
                 _addHoverClass: function () {
                     this._addClass("ui-droppable-hover");
                 },
      
                 _removeHoverClass: function () {
                     this._removeClass("ui-droppable-hover");
                 },
      
                 _addActiveClass: function () {
                     this._addClass("ui-droppable-active");
                 },
      
                 _removeActiveClass: function () {
                     this._removeClass("ui-droppable-active");
                 }
             });
      
             var intersect = $.ui.intersect = (function () {
                 function isOverAxis(x, reference, size) {
                     return (x >= reference) && (x < (reference + size));
                 }
      
                 return function (draggable, droppable, toleranceMode, event) {
      
                     if (!droppable.offset) {
                         return false;
                     }
      
                     var x1 = (draggable.positionAbs ||
                             draggable.position.absolute).left + draggable.margins.left,
                         y1 = (draggable.positionAbs ||
                             draggable.position.absolute).top + draggable.margins.top,
                         x2 = x1 + draggable.helperProportions.width,
                         y2 = y1 + draggable.helperProportions.height,
                         l = droppable.offset.left,
                         t = droppable.offset.top,
                         r = l + droppable.proportions().width,
                         b = t + droppable.proportions().height;
      
                     switch (toleranceMode) {
                         case "fit":
                             return (l <= x1 && x2 <= r && t <= y1 && y2 <= b);
                         case "intersect":
                             return (l < x1 + (draggable.helperProportions.width / 2) && // Right Half
                                 x2 - (draggable.helperProportions.width / 2) < r && // Left Half
                                 t < y1 + (draggable.helperProportions.height / 2) && // Bottom Half
                                 y2 - (draggable.helperProportions.height / 2) < b); // Top Half
                         case "pointer":
                             return isOverAxis(event.pageY, t, droppable.proportions().height) &&
                                 isOverAxis(event.pageX, l, droppable.proportions().width);
                         case "touch":
                             return (
                                 (y1 >= t && y1 <= b) || // Top edge touching
                                 (y2 >= t && y2 <= b) || // Bottom edge touching
                                 (y1 < t && y2 > b) // Surrounded vertically
                             ) && (
                                 (x1 >= l && x1 <= r) || // Left edge touching
                                 (x2 >= l && x2 <= r) || // Right edge touching
                                 (x1 < l && x2 > r) // Surrounded horizontally
                             );
                         default:
                             return false;
                     }
                 };
             })();
      
             /*
             	This manager tracks offsets of draggables and droppables
             */
             $.ui.ddmanager = {
                 current: null,
                 droppables: {
                     "default": []
                 },
                 prepareOffsets: function (t, event) {
      
                     var i, j,
                         m = $.ui.ddmanager.droppables[t.options.scope] || [],
                         type = event ? event.type : null, // workaround for #2317
                         list = (t.currentItem || t.element).find(":data(ui-droppable)").addBack();
      
                     droppablesLoop: for (i = 0; i < m.length; i++) {
      
                         // No disabled and non-accepted
                         if (m[i].options.disabled || (t && !m[i].accept.call(m[i].element[0],
                                 (t.currentItem || t.element)))) {
                             continue;
                         }
      
                         // Filter out elements in the current dragged item
                         for (j = 0; j < list.length; j++) {
                             if (list[j] === m[i].element[0]) {
                                 m[i].proportions().height = 0;
                                 continue droppablesLoop;
                             }
                         }
      
                         m[i].visible = m[i].element.css("display") !== "none";
                         if (!m[i].visible) {
                             continue;
                         }
      
                         // Activate the droppable if used directly from draggables
                         if (type === "mousedown") {
                             m[i]._activate.call(m[i], event);
                         }
      
                         m[i].offset = m[i].element.offset();
                         m[i].proportions({
                             width: m[i].element[0].offsetWidth,
                             height: m[i].element[0].offsetHeight
                         });
      
                     }
      
                 },
                 drop: function (draggable, event) {
      
                     var dropped = false;
      
                     // Create a copy of the droppables in case the list changes during the drop (#9116)
                     $.each(($.ui.ddmanager.droppables[draggable.options.scope] || []).slice(), function () {
      
                         if (!this.options) {
                             return;
                         }
                         if (!this.options.disabled && this.visible &&
                             intersect(draggable, this, this.options.tolerance, event)) {
                             dropped = this._drop.call(this, event) || dropped;
                         }
      
                         if (!this.options.disabled && this.visible && this.accept.call(this.element[
                                     0],
                                 (draggable.currentItem || draggable.element))) {
                             this.isout = true;
                             this.isover = false;
                             this._deactivate.call(this, event);
                         }
      
                     });
                     return dropped;
      
                 },
                 dragStart: function (draggable, event) {
      
                     // Listen for scrolling so that if the dragging causes scrolling the position of the
                     // droppables can be recalculated (see #5003)
                     draggable.element.parentsUntil("body").on("scroll.droppable", function () {
                         if (!draggable.options.refreshPositions) {
                             $.ui.ddmanager.prepareOffsets(draggable, event);
                         }
                     });
                 },
                 drag: function (draggable, event) {
      
                     // If you have a highly dynamic page, you might try this option. It renders positions
                     // every time you move the mouse.
                     if (draggable.options.refreshPositions) {
                         $.ui.ddmanager.prepareOffsets(draggable, event);
                     }
      
                     // Run through all droppables and check their positions based on specific tolerance options
                     $.each($.ui.ddmanager.droppables[draggable.options.scope] || [], function () {
      
                         if (this.options.disabled || this.greedyChild || !this.visible) {
                             return;
                         }
      
                         var parentInstance, scope, parent,
                             intersects = intersect(draggable, this, this.options.tolerance, event),
                             c = !intersects && this.isover ?
                             "isout" :
                             (intersects && !this.isover ? "isover" : null);
                         if (!c) {
                             return;
                         }
      
                         if (this.options.greedy) {
      
                             // find droppable parents with same scope
                             scope = this.options.scope;
                             parent = this.element.parents(":data(ui-droppable)").filter(
                                 function () {
                                     return $(this).droppable("instance").options.scope ===
                                         scope;
                                 });
      
                             if (parent.length) {
                                 parentInstance = $(parent[0]).droppable("instance");
                                 parentInstance.greedyChild = (c === "isover");
                             }
                         }
      
                         // We just moved into a greedy child
                         if (parentInstance && c === "isover") {
                             parentInstance.isover = false;
                             parentInstance.isout = true;
                             parentInstance._out.call(parentInstance, event);
                         }
      
                         this[c] = true;
                         this[c === "isout" ? "isover" : "isout"] = false;
                         this[c === "isover" ? "_over" : "_out"].call(this, event);
      
                         // We just moved out of a greedy child
                         if (parentInstance && c === "isout") {
                             parentInstance.isout = false;
                             parentInstance.isover = true;
                             parentInstance._over.call(parentInstance, event);
                         }
                     });
      
                 },
                 dragStop: function (draggable, event) {
                     draggable.element.parentsUntil("body").off("scroll.droppable");
      
                     // Call prepareOffsets one final time since IE does not fire return scroll events when
                     // overflow was caused by drag (see #5003)
                     if (!draggable.options.refreshPositions) {
                         $.ui.ddmanager.prepareOffsets(draggable, event);
                     }
                 }
             };
      
             // DEPRECATED
             // TODO: switch return back to widget declaration at top of file when this is removed
             if ($.uiBackCompat !== false) {
      
                 // Backcompat for activeClass and hoverClass options
                 $.widget("ui.droppable", $.ui.droppable, {
                     options: {
                         hoverClass: false,
                         activeClass: false
                     },
                     _addActiveClass: function () {
                         this._super();
                         if (this.options.activeClass) {
                             this.element.addClass(this.options.activeClass);
                         }
                     },
                     _removeActiveClass: function () {
                         this._super();
                         if (this.options.activeClass) {
                             this.element.removeClass(this.options.activeClass);
                         }
                     },
                     _addHoverClass: function () {
                         this._super();
                         if (this.options.hoverClass) {
                             this.element.addClass(this.options.hoverClass);
                         }
                     },
                     _removeHoverClass: function () {
                         this._super();
                         if (this.options.hoverClass) {
                             this.element.removeClass(this.options.hoverClass);
                         }
                     }
                 });
             }
      
             var widgetsDroppable = $.ui.droppable;
      


             /*!
              * jQuery UI Progressbar 1.12.1
              * http://jqueryui.com
              *
              * Copyright jQuery Foundation and other contributors
              * Released under the MIT license.
              * http://jquery.org/license
              */
      
             //>>label: Progressbar
             //>>group: Widgets
             // jscs:disable maximumLineLength
             //>>description: Displays a status indicator for loading state, standard percentage, and other progress indicators.
             // jscs:enable maximumLineLength
             //>>docs: http://api.jqueryui.com/progressbar/
             //>>demos: http://jqueryui.com/progressbar/
             //>>css.structure: ../../themes/base/core.css
             //>>css.structure: ../../themes/base/progressbar.css
             //>>css.theme: ../../themes/base/theme.css
      


             var widgetsProgressbar = $.widget("ui.progressbar", {
                 version: "1.12.1",
                 options: {
                     classes: {
                         "ui-progressbar": "ui-corner-all",
                         "ui-progressbar-value": "ui-corner-left",
                         "ui-progressbar-complete": "ui-corner-right"
                     },
                     max: 100,
                     value: 0,
      
                     change: null,
                     complete: null
                 },
      
                 min: 0,
      
                 _create: function () {
      
                     // Constrain initial value
                     this.oldValue = this.options.value = this._constrainedValue();
      
                     this.element.attr({
      
                         // Only set static values; aria-valuenow and aria-valuemax are
                         // set inside _refreshValue()
                         role: "progressbar",
                         "aria-valuemin": this.min
                     });
                     this._addClass("ui-progressbar", "ui-widget ui-widget-content");
      
      this.valueDiv = $("
      ").appendTo(this.element);
                     this._addClass(this.valueDiv, "ui-progressbar-value", "ui-widget-header");
                     this._refreshValue();
                 },
      
                 _destroy: function () {
                     this.element.removeAttr("role aria-valuemin aria-valuemax aria-valuenow");
      
                     this.valueDiv.remove();
                 },
      
                 value: function (newValue) {
                     if (newValue === undefined) {
                         return this.options.value;
                     }
      
                     this.options.value = this._constrainedValue(newValue);
                     this._refreshValue();
                 },
      
                 _constrainedValue: function (newValue) {
                     if (newValue === undefined) {
                         newValue = this.options.value;
                     }
      
                     this.indeterminate = newValue === false;
      
                     // Sanitize value
                     if (typeof newValue !== "number") {
                         newValue = 0;
                     }
      
                     return this.indeterminate ? false :
                         Math.min(this.options.max, Math.max(this.min, newValue));
                 },
      
                 _setOptions: function (options) {
      
                     // Ensure "value" option is set after other values (like max)
                     var value = options.value;
                     delete options.value;
      
                     this._super(options);
      
                     this.options.value = this._constrainedValue(value);
                     this._refreshValue();
                 },
      
                 _setOption: function (key, value) {
                     if (key === "max") {
      
                         // Don't allow a max less than min
                         value = Math.max(this.min, value);
                     }
                     this._super(key, value);
                 },
      
                 _setOptionDisabled: function (value) {
                     this._super(value);
      
                     this.element.attr("aria-disabled", value);
                     this._toggleClass(null, "ui-state-disabled", !!value);
                 },
      
                 _percentage: function () {
                     return this.indeterminate ?
                         100 :
                         100 * (this.options.value - this.min) / (this.options.max - this.min);
                 },
      
                 _refreshValue: function () {
                     var value = this.options.value,
                         percentage = this._percentage();
      
                     this.valueDiv
                         .toggle(this.indeterminate || value > this.min)
                         .width(percentage.toFixed(0) + "%");
      
                     this
                         ._toggleClass(this.valueDiv, "ui-progressbar-complete", null,
                             value === this.options.max)
                         ._toggleClass("ui-progressbar-indeterminate", null, this.indeterminate);
      
                     if (this.indeterminate) {
                         this.element.removeAttr("aria-valuenow");
                         if (!this.overlayDiv) {
      
      this.overlayDiv = $("
      ").appendTo(this.valueDiv);
                             this._addClass(this.overlayDiv, "ui-progressbar-overlay");
                         }
                     } else {
                         this.element.attr({
                             "aria-valuemax": this.options.max,
                             "aria-valuenow": value
                         });
                         if (this.overlayDiv) {
                             this.overlayDiv.remove();
                             this.overlayDiv = null;
                         }
                     }
      
                     if (this.oldValue !== value) {
                         this.oldValue = value;
                         this._trigger("change");
                     }
                     if (value === this.options.max) {
                         this._trigger("complete");
                     }
                 }
             });
      


             /*!
              * jQuery UI Selectable 1.12.1
              * http://jqueryui.com
              *
              * Copyright jQuery Foundation and other contributors
              * Released under the MIT license.
              * http://jquery.org/license
              */
      
             //>>label: Selectable
             //>>group: Interactions
             //>>description: Allows groups of elements to be selected with the mouse.
             //>>docs: http://api.jqueryui.com/selectable/
             //>>demos: http://jqueryui.com/selectable/
             //>>css.structure: ../../themes/base/selectable.css
      


             var widgetsSelectable = $.widget("ui.selectable", $.ui.mouse, {
                 version: "1.12.1",
                 options: {
                     appendTo: "body",
                     autoRefresh: true,
                     distance: 0,
                     filter: "*",
                     tolerance: "touch",
      
                     // Callbacks
                     selected: null,
                     selecting: null,
                     start: null,
                     stop: null,
                     unselected: null,
                     unselecting: null
                 },
                 _create: function () {
                     var that = this;
      
                     this._addClass("ui-selectable");
      
                     this.dragged = false;
      
                     // Cache selectee children based on filter
                     this.refresh = function () {
                         that.elementPos = $(that.element[0]).offset();
                         that.selectees = $(that.options.filter, that.element[0]);
                         that._addClass(that.selectees, "ui-selectee");
                         that.selectees.each(function () {
                             var $this = $(this),
                                 selecteeOffset = $this.offset(),
                                 pos = {
                                     left: selecteeOffset.left - that.elementPos.left,
                                     top: selecteeOffset.top - that.elementPos.top
                                 };
                             $.data(this, "selectable-item", {
                                 element: this,
                                 $element: $this,
                                 left: pos.left,
                                 top: pos.top,
                                 right: pos.left + $this.outerWidth(),
                                 bottom: pos.top + $this.outerHeight(),
                                 startselected: false,
                                 selected: $this.hasClass("ui-selected"),
                                 selecting: $this.hasClass("ui-selecting"),
                                 unselecting: $this.hasClass("ui-unselecting")
                             });
                         });
                     };
                     this.refresh();
      
                     this._mouseInit();
      
      this.helper = $("
      ");
                     this._addClass(this.helper, "ui-selectable-helper");
                 },
      
                 _destroy: function () {
                     this.selectees.removeData("selectable-item");
                     this._mouseDestroy();
                 },
      
                 _mouseStart: function (event) {
                     var that = this,
                         options = this.options;
      
                     this.opos = [event.pageX, event.pageY];
                     this.elementPos = $(this.element[0]).offset();
      
                     if (this.options.disabled) {
                         return;
                     }
      
                     this.selectees = $(options.filter, this.element[0]);
      
                     this._trigger("start", event);
      
                     $(options.appendTo).append(this.helper);
      
                     // position helper (lasso)
                     this.helper.css({
                         "left": event.pageX,
                         "top": event.pageY,
                         "width": 0,
                         "height": 0
                     });
      
                     if (options.autoRefresh) {
                         this.refresh();
                     }
      
                     this.selectees.filter(".ui-selected").each(function () {
                         var selectee = $.data(this, "selectable-item");
                         selectee.startselected = true;
                         if (!event.metaKey && !event.ctrlKey) {
                             that._removeClass(selectee.$element, "ui-selected");
                             selectee.selected = false;
                             that._addClass(selectee.$element, "ui-unselecting");
                             selectee.unselecting = true;
      
                             // selectable UNSELECTING callback
                             that._trigger("unselecting", event, {
                                 unselecting: selectee.element
                             });
                         }
                     });
      
                     $(event.target).parents().addBack().each(function () {
                         var doSelect,
                             selectee = $.data(this, "selectable-item");
                         if (selectee) {
                             doSelect = (!event.metaKey && !event.ctrlKey) ||
                                 !selectee.$element.hasClass("ui-selected");
                             that._removeClass(selectee.$element, doSelect ? "ui-unselecting" :
                                     "ui-selected")
                                 ._addClass(selectee.$element, doSelect ? "ui-selecting" :
                                     "ui-unselecting");
                             selectee.unselecting = !doSelect;
                             selectee.selecting = doSelect;
                             selectee.selected = doSelect;
      
                             // selectable (UN)SELECTING callback
                             if (doSelect) {
                                 that._trigger("selecting", event, {
                                     selecting: selectee.element
                                 });
                             } else {
                                 that._trigger("unselecting", event, {
                                     unselecting: selectee.element
                                 });
                             }
                             return false;
                         }
                     });
      
                 },
      
                 _mouseDrag: function (event) {
      
                     this.dragged = true;
      
                     if (this.options.disabled) {
                         return;
                     }
      
                     var tmp,
                         that = this,
                         options = this.options,
                         x1 = this.opos[0],
                         y1 = this.opos[1],
                         x2 = event.pageX,
                         y2 = event.pageY;
      
                     if (x1 > x2) {
                         tmp = x2;
                         x2 = x1;
                         x1 = tmp;
                     }
                     if (y1 > y2) {
                         tmp = y2;
                         y2 = y1;
                         y1 = tmp;
                     }
                     this.helper.css({
                         left: x1,
                         top: y1,
                         width: x2 - x1,
                         height: y2 - y1
                     });
      
                     this.selectees.each(function () {
                         var selectee = $.data(this, "selectable-item"),
                             hit = false,
                             offset = {};
      
                         //prevent helper from being selected if appendTo: selectable
                         if (!selectee || selectee.element === that.element[0]) {
                             return;
                         }
      
                         offset.left = selectee.left + that.elementPos.left;
                         offset.right = selectee.right + that.elementPos.left;
                         offset.top = selectee.top + that.elementPos.top;
                         offset.bottom = selectee.bottom + that.elementPos.top;
      
                         if (options.tolerance === "touch") {
                             hit = (!(offset.left > x2 || offset.right < x1 || offset.top > y2 ||
                                 offset.bottom < y1));
                         } else if (options.tolerance === "fit") {
                             hit = (offset.left > x1 && offset.right < x2 && offset.top > y1 &&
                                 offset.bottom < y2);
                         }
      
                         if (hit) {
      
                             // SELECT
                             if (selectee.selected) {
                                 that._removeClass(selectee.$element, "ui-selected");
                                 selectee.selected = false;
                             }
                             if (selectee.unselecting) {
                                 that._removeClass(selectee.$element, "ui-unselecting");
                                 selectee.unselecting = false;
                             }
                             if (!selectee.selecting) {
                                 that._addClass(selectee.$element, "ui-selecting");
                                 selectee.selecting = true;
      
                                 // selectable SELECTING callback
                                 that._trigger("selecting", event, {
                                     selecting: selectee.element
                                 });
                             }
                         } else {
      
                             // UNSELECT
                             if (selectee.selecting) {
                                 if ((event.metaKey || event.ctrlKey) && selectee
                                     .startselected) {
                                     that._removeClass(selectee.$element, "ui-selecting");
                                     selectee.selecting = false;
                                     that._addClass(selectee.$element, "ui-selected");
                                     selectee.selected = true;
                                 } else {
                                     that._removeClass(selectee.$element, "ui-selecting");
                                     selectee.selecting = false;
                                     if (selectee.startselected) {
                                         that._addClass(selectee.$element, "ui-unselecting");
                                         selectee.unselecting = true;
                                     }
      
                                     // selectable UNSELECTING callback
                                     that._trigger("unselecting", event, {
                                         unselecting: selectee.element
                                     });
                                 }
                             }
                             if (selectee.selected) {
                                 if (!event.metaKey && !event.ctrlKey && !selectee
                                     .startselected) {
                                     that._removeClass(selectee.$element, "ui-selected");
                                     selectee.selected = false;
      
                                     that._addClass(selectee.$element, "ui-unselecting");
                                     selectee.unselecting = true;
      
                                     // selectable UNSELECTING callback
                                     that._trigger("unselecting", event, {
                                         unselecting: selectee.element
                                     });
                                 }
                             }
                         }
                     });
      
                     return false;
                 },
      
                 _mouseStop: function (event) {
                     var that = this;
      
                     this.dragged = false;
      
                     $(".ui-unselecting", this.element[0]).each(function () {
                         var selectee = $.data(this, "selectable-item");
                         that._removeClass(selectee.$element, "ui-unselecting");
                         selectee.unselecting = false;
                         selectee.startselected = false;
                         that._trigger("unselected", event, {
                             unselected: selectee.element
                         });
                     });
                     $(".ui-selecting", this.element[0]).each(function () {
                         var selectee = $.data(this, "selectable-item");
                         that._removeClass(selectee.$element, "ui-selecting")
                             ._addClass(selectee.$element, "ui-selected");
                         selectee.selecting = false;
                         selectee.selected = true;
                         selectee.startselected = true;
                         that._trigger("selected", event, {
                             selected: selectee.element
                         });
                     });
                     this._trigger("stop", event);
      
                     this.helper.remove();
      
                     return false;
                 }
      
             });
      


             /*!
              * jQuery UI Selectmenu 1.12.1
              * http://jqueryui.com
              *
              * Copyright jQuery Foundation and other contributors
              * Released under the MIT license.
              * http://jquery.org/license
              */
      
             //>>label: Selectmenu
             //>>group: Widgets
             // jscs:disable maximumLineLength
             //>>description: Duplicates and extends the functionality of a native HTML select element, allowing it to be customizable in behavior and appearance far beyond the limitations of a native select.
             // jscs:enable maximumLineLength
             //>>docs: http://api.jqueryui.com/selectmenu/
             //>>demos: http://jqueryui.com/selectmenu/
             //>>css.structure: ../../themes/base/core.css
             //>>css.structure: ../../themes/base/selectmenu.css, ../../themes/base/button.css
             //>>css.theme: ../../themes/base/theme.css
      


             var widgetsSelectmenu = $.widget("ui.selectmenu", [$.ui.formResetMixin, {
                 version: "1.12.1",
                 defaultElement: "<select>",
                 options: {
                     appendTo: null,
                     classes: {
                         "ui-selectmenu-button-open": "ui-corner-top",
                         "ui-selectmenu-button-closed": "ui-corner-all"
                     },
                     disabled: null,
                     icons: {
                         button: "ui-icon-triangle-1-s"
                     },
                     position: {
                         my: "left top",
                         at: "left bottom",
                         collision: "none"
                     },
                     width: false,
      
                     // Callbacks
                     change: null,
                     close: null,
                     focus: null,
                     open: null,
                     select: null
                 },
      
                 _create: function () {
                     var selectmenuId = this.element.uniqueId().attr("id");
                     this.ids = {
                         element: selectmenuId,
                         button: selectmenuId + "-button",
                         menu: selectmenuId + "-menu"
                     };
      
                     this._drawButton();
                     this._drawMenu();
                     this._bindFormResetHandler();
      
                     this._rendered = false;
                     this.menuItems = $();
                 },
      
                 _drawButton: function () {
                     var icon,
                         that = this,
                         item = this._parseOption(
                             this.element.find("option:selected"),
                             this.element[0].selectedIndex
                         );
      
                     // Associate existing label with the new button
                     this.labels = this.element.labels().attr("for", this.ids.button);
                     this._on(this.labels, {
                         click: function (event) {
                             this.button.focus();
                             event.preventDefault();
                         }
                     });
      
                     // Hide original select element
                     this.element.hide();
      
                     // Create button
                     this.button = $("", {
                             tabindex: this.options.disabled ? -1 : 0,
                             id: this.ids.button,
                             role: "combobox",
                             "aria-expanded": "false",
                             "aria-autocomplete": "list",
                             "aria-owns": this.ids.menu,
                             "aria-haspopup": "true",
                             title: this.element.attr("title")
                         })
                         .insertAfter(this.element);
      
                     this._addClass(this.button, "ui-selectmenu-button ui-selectmenu-button-closed",
                         "ui-button ui-widget");
      
                     icon = $("").appendTo(this.button);
                     this._addClass(icon, "ui-selectmenu-icon", "ui-icon " + this.options.icons
                         .button);
                     this.buttonItem = this._renderButtonItem(item)
                         .appendTo(this.button);
      
                     if (this.options.width !== false) {
                         this._resizeButton();
                     }
      
                     this._on(this.button, this._buttonEvents);
                     this.button.one("focusin", function () {
      
                         // Delay rendering the menu items until the button receives focus.
                         // The menu may have already been rendered via a programmatic open.
                         if (!that._rendered) {
                             that._refreshMenu();
                         }
                     });
                 },
      
                 _drawMenu: function () {
                     var that = this;
      
                     // Create menu
      
      this.menu = $("
        ", { "aria-hidden": "true", "aria-labelledby": this.ids.button, id: this.ids.menu }); // Wrap menu this.menuWrap = $("
        ").append(this.menu);
                       this._addClass(this.menuWrap, "ui-selectmenu-menu", "ui-front");
                       this.menuWrap.appendTo(this._appendTo());
        
                       // Initialize menu widget
                       this.menuInstance = this.menu
                           .menu({
                               classes: {
                                   "ui-menu": "ui-corner-bottom"
                               },
                               role: "listbox",
                               select: function (event, ui) {
                                   event.preventDefault();
        
                                   // Support: IE8
                                   // If the item was selected via a click, the text selection
                                   // will be destroyed in IE
                                   that._setSelection();
        
                                   that._select(ui.item.data("ui-selectmenu-item"), event);
                               },
                               focus: function (event, ui) {
                                   var item = ui.item.data("ui-selectmenu-item");
        
                                   // Prevent inital focus from firing and check if its a newly focused item
                                   if (that.focusIndex != null && item.index !== that
                                       .focusIndex) {
                                       that._trigger("focus", event, {
                                           item: item
                                       });
                                       if (!that.isOpen) {
                                           that._select(item, event);
                                       }
                                   }
                                   that.focusIndex = item.index;
        
                                   that.button.attr("aria-activedescendant",
                                       that.menuItems.eq(item.index).attr("id"));
                               }
                           })
                           .menu("instance");
        
                       // Don't close the menu on mouseleave
                       this.menuInstance._off(this.menu, "mouseleave");
        
                       // Cancel the menu's collapseAll on document click
                       this.menuInstance._closeOnDocumentClick = function () {
                           return false;
                       };
        
                       // Selects often contain empty items, but never contain dividers
                       this.menuInstance._isDivider = function () {
                           return false;
                       };
                   },
        
                   refresh: function () {
                       this._refreshMenu();
                       this.buttonItem.replaceWith(
                           this.buttonItem = this._renderButtonItem(
        
                               // Fall back to an empty object in case there are no options
                               this._getSelectedItem().data("ui-selectmenu-item") || {}
                           )
                       );
                       if (this.options.width === null) {
                           this._resizeButton();
                       }
                   },
        
                   _refreshMenu: function () {
                       var item,
                           options = this.element.find("option");
        
                       this.menu.empty();
        
                       this._parseOptions(options);
                       this._renderMenu(this.menu, this.items);
        
                       this.menuInstance.refresh();
                       this.menuItems = this.menu.find("li")
                           .not(".ui-selectmenu-optgroup")
                           .find(".ui-menu-item-wrapper");
        
                       this._rendered = true;
        
                       if (!options.length) {
                           return;
                       }
        
                       item = this._getSelectedItem();
        
                       // Update the menu to have the correct item focused
                       this.menuInstance.focus(null, item);
                       this._setAria(item.data("ui-selectmenu-item"));
        
                       // Set disabled state
                       this._setOption("disabled", this.element.prop("disabled"));
                   },
        
                   open: function (event) {
                       if (this.options.disabled) {
                           return;
                       }
        
                       // If this is the first time the menu is being opened, render the items
                       if (!this._rendered) {
                           this._refreshMenu();
                       } else {
        
                           // Menu clears focus on close, reset focus to selected item
                           this._removeClass(this.menu.find(".ui-state-active"), null,
                               "ui-state-active");
                           this.menuInstance.focus(null, this._getSelectedItem());
                       }
        
                       // If there are no options, don't open the menu
                       if (!this.menuItems.length) {
                           return;
                       }
        
                       this.isOpen = true;
                       this._toggleAttr();
                       this._resizeMenu();
                       this._position();
        
                       this._on(this.document, this._documentClick);
        
                       this._trigger("open", event);
                   },
        
                   _position: function () {
                       this.menuWrap.position($.extend({
                           of: this.button
                       }, this.options.position));
                   },
        
                   close: function (event) {
                       if (!this.isOpen) {
                           return;
                       }
        
                       this.isOpen = false;
                       this._toggleAttr();
        
                       this.range = null;
                       this._off(this.document);
        
                       this._trigger("close", event);
                   },
        
                   widget: function () {
                       return this.button;
                   },
        
                   menuWidget: function () {
                       return this.menu;
                   },
        
                   _renderButtonItem: function (item) {
                       var buttonItem = $("");
        
                       this._setText(buttonItem, item.label);
                       this._addClass(buttonItem, "ui-selectmenu-text");
        
                       return buttonItem;
                   },
        
                   _renderMenu: function (ul, items) {
                       var that = this,
                           currentOptgroup = "";
        
                       $.each(items, function (index, item) {
                           var li;
        
                           if (item.optgroup !== currentOptgroup) {
        
        li = $("
      • ", { text: item.optgroup }); that._addClass(li, "ui-selectmenu-optgroup", "ui-menu-divider" + (item.element.parent("optgroup").prop("disabled") ? " ui-state-disabled" : "")); li.appendTo(ul); currentOptgroup = item.optgroup; } that._renderItemData(ul, item); }); }, _renderItemData: function (ul, item) { return this._renderItem(ul, item).data("ui-selectmenu-item", item); }, _renderItem: function (ul, item) { var li = $("
      • "), wrapper = $("
        ", {
                               title: item.element.attr("title")
                           });
        
                       if (item.disabled) {
                           this._addClass(li, null, "ui-state-disabled");
                       }
                       this._setText(wrapper, item.label);
        
                       return li.append(wrapper).appendTo(ul);
                   },
        
                   _setText: function (element, value) {
                       if (value) {
                           element.text(value);
                       } else {
                           element.html(" ");
                       }
                   },
        
                   _move: function (direction, event) {
                       var item, next,
                           filter = ".ui-menu-item";
        
                       if (this.isOpen) {
                           item = this.menuItems.eq(this.focusIndex).parent("li");
                       } else {
                           item = this.menuItems.eq(this.element[0].selectedIndex).parent("li");
                           filter += ":not(.ui-state-disabled)";
                       }
        
                       if (direction === "first" || direction === "last") {
                           next = item[direction === "first" ? "prevAll" : "nextAll"](filter).eq(-1);
                       } else {
                           next = item[direction + "All"](filter).eq(0);
                       }
        
                       if (next.length) {
                           this.menuInstance.focus(event, next);
                       }
                   },
        
                   _getSelectedItem: function () {
                       return this.menuItems.eq(this.element[0].selectedIndex).parent("li");
                   },
        
                   _toggle: function (event) {
                       this[this.isOpen ? "close" : "open"](event);
                   },
        
                   _setSelection: function () {
                       var selection;
        
                       if (!this.range) {
                           return;
                       }
        
                       if (window.getSelection) {
                           selection = window.getSelection();
                           selection.removeAllRanges();
                           selection.addRange(this.range);
        
                           // Support: IE8
                       } else {
                           this.range.select();
                       }
        
                       // Support: IE
                       // Setting the text selection kills the button focus in IE, but
                       // restoring the focus doesn't kill the selection.
                       this.button.focus();
                   },
        
                   _documentClick: {
                       mousedown: function (event) {
                           if (!this.isOpen) {
                               return;
                           }
        
                           if (!$(event.target).closest(".ui-selectmenu-menu, #" +
                                   $.ui.escapeSelector(this.ids.button)).length) {
                               this.close(event);
                           }
                       }
                   },
        
                   _buttonEvents: {
        
                       // Prevent text selection from being reset when interacting with the selectmenu (#10144)
                       mousedown: function () {
                           var selection;
        
                           if (window.getSelection) {
                               selection = window.getSelection();
                               if (selection.rangeCount) {
                                   this.range = selection.getRangeAt(0);
                               }
        
                               // Support: IE8
                           } else {
                               this.range = document.selection.createRange();
                           }
                       },
        
                       click: function (event) {
                           this._setSelection();
                           this._toggle(event);
                       },
        
                       keydown: function (event) {
                           var preventDefault = true;
                           switch (event.keyCode) {
                               case $.ui.keyCode.TAB:
                               case $.ui.keyCode.ESCAPE:
                                   this.close(event);
                                   preventDefault = false;
                                   break;
                               case $.ui.keyCode.ENTER:
                                   if (this.isOpen) {
                                       this._selectFocusedItem(event);
                                   }
                                   break;
                               case $.ui.keyCode.UP:
                                   if (event.altKey) {
                                       this._toggle(event);
                                   } else {
                                       this._move("prev", event);
                                   }
                                   break;
                               case $.ui.keyCode.DOWN:
                                   if (event.altKey) {
                                       this._toggle(event);
                                   } else {
                                       this._move("next", event);
                                   }
                                   break;
                               case $.ui.keyCode.SPACE:
                                   if (this.isOpen) {
                                       this._selectFocusedItem(event);
                                   } else {
                                       this._toggle(event);
                                   }
                                   break;
                               case $.ui.keyCode.LEFT:
                                   this._move("prev", event);
                                   break;
                               case $.ui.keyCode.RIGHT:
                                   this._move("next", event);
                                   break;
                               case $.ui.keyCode.HOME:
                               case $.ui.keyCode.PAGE_UP:
                                   this._move("first", event);
                                   break;
                               case $.ui.keyCode.END:
                               case $.ui.keyCode.PAGE_DOWN:
                                   this._move("last", event);
                                   break;
                               default:
                                   this.menu.trigger(event);
                                   preventDefault = false;
                           }
        
                           if (preventDefault) {
                               event.preventDefault();
                           }
                       }
                   },
        
                   _selectFocusedItem: function (event) {
                       var item = this.menuItems.eq(this.focusIndex).parent("li");
                       if (!item.hasClass("ui-state-disabled")) {
                           this._select(item.data("ui-selectmenu-item"), event);
                       }
                   },
        
                   _select: function (item, event) {
                       var oldIndex = this.element[0].selectedIndex;
        
                       // Change native select element
                       this.element[0].selectedIndex = item.index;
                       this.buttonItem.replaceWith(this.buttonItem = this._renderButtonItem(item));
                       this._setAria(item);
                       this._trigger("select", event, {
                           item: item
                       });
        
                       if (item.index !== oldIndex) {
                           this._trigger("change", event, {
                               item: item
                           });
                       }
        
                       this.close(event);
                   },
        
                   _setAria: function (item) {
                       var id = this.menuItems.eq(item.index).attr("id");
        
                       this.button.attr({
                           "aria-labelledby": id,
                           "aria-activedescendant": id
                       });
                       this.menu.attr("aria-activedescendant", id);
                   },
        
                   _setOption: function (key, value) {
                       if (key === "icons") {
                           var icon = this.button.find("span.ui-icon");
                           this._removeClass(icon, null, this.options.icons.button)
                               ._addClass(icon, null, value.button);
                       }
        
                       this._super(key, value);
        
                       if (key === "appendTo") {
                           this.menuWrap.appendTo(this._appendTo());
                       }
        
                       if (key === "width") {
                           this._resizeButton();
                       }
                   },
        
                   _setOptionDisabled: function (value) {
                       this._super(value);
        
                       this.menuInstance.option("disabled", value);
                       this.button.attr("aria-disabled", value);
                       this._toggleClass(this.button, null, "ui-state-disabled", value);
        
                       this.element.prop("disabled", value);
                       if (value) {
                           this.button.attr("tabindex", -1);
                           this.close();
                       } else {
                           this.button.attr("tabindex", 0);
                       }
                   },
        
                   _appendTo: function () {
                       var element = this.options.appendTo;
        
                       if (element) {
                           element = element.jquery || element.nodeType ?
                               $(element) :
                               this.document.find(element).eq(0);
                       }
        
                       if (!element || !element[0]) {
                           element = this.element.closest(".ui-front, dialog");
                       }
        
                       if (!element.length) {
                           element = this.document[0].body;
                       }
        
                       return element;
                   },
        
                   _toggleAttr: function () {
                       this.button.attr("aria-expanded", this.isOpen);
        
                       // We can't use two _toggleClass() calls here, because we need to make sure
                       // we always remove classes first and add them second, otherwise if both classes have the
                       // same theme class, it will be removed after we add it.
                       this._removeClass(this.button, "ui-selectmenu-button-" +
                               (this.isOpen ? "closed" : "open"))
                           ._addClass(this.button, "ui-selectmenu-button-" +
                               (this.isOpen ? "open" : "closed"))
                           ._toggleClass(this.menuWrap, "ui-selectmenu-open", null, this.isOpen);
        
                       this.menu.attr("aria-hidden", !this.isOpen);
                   },
        
                   _resizeButton: function () {
                       var width = this.options.width;
        
                       // For `width: false`, just remove inline style and stop
                       if (width === false) {
                           this.button.css("width", "");
                           return;
                       }
        
                       // For `width: null`, match the width of the original element
                       if (width === null) {
                           width = this.element.show().outerWidth();
                           this.element.hide();
                       }
        
                       this.button.outerWidth(width);
                   },
        
                   _resizeMenu: function () {
                       this.menu.outerWidth(Math.max(
                           this.button.outerWidth(),
        
                           // Support: IE10
                           // IE10 wraps long text (possibly a rounding bug)
                           // so we add 1px to avoid the wrapping
                           this.menu.width("").outerWidth() + 1
                       ));
                   },
        
                   _getCreateOptions: function () {
                       var options = this._super();
        
                       options.disabled = this.element.prop("disabled");
        
                       return options;
                   },
        
                   _parseOptions: function (options) {
                       var that = this,
                           data = [];
                       options.each(function (index, item) {
                           data.push(that._parseOption($(item), index));
                       });
                       this.items = data;
                   },
        
                   _parseOption: function (option, index) {
                       var optgroup = option.parent("optgroup");
        
                       return {
                           element: option,
                           index: index,
                           value: option.val(),
                           label: option.text(),
                           optgroup: optgroup.attr("label") || "",
                           disabled: optgroup.prop("disabled") || option.prop("disabled")
                       };
                   },
        
                   _destroy: function () {
                       this._unbindFormResetHandler();
                       this.menuWrap.remove();
                       this.button.remove();
                       this.element.show();
                       this.element.removeUniqueId();
                       this.labels.attr("for", this.ids.element);
                   }
               }]);
        


               /*!
                * jQuery UI Slider 1.12.1
                * http://jqueryui.com
                *
                * Copyright jQuery Foundation and other contributors
                * Released under the MIT license.
                * http://jquery.org/license
                */
        
               //>>label: Slider
               //>>group: Widgets
               //>>description: Displays a flexible slider with ranges and accessibility via keyboard.
               //>>docs: http://api.jqueryui.com/slider/
               //>>demos: http://jqueryui.com/slider/
               //>>css.structure: ../../themes/base/core.css
               //>>css.structure: ../../themes/base/slider.css
               //>>css.theme: ../../themes/base/theme.css
        


               var widgetsSlider = $.widget("ui.slider", $.ui.mouse, {
                   version: "1.12.1",
                   widgetEventPrefix: "slide",
        
                   options: {
                       animate: false,
                       classes: {
                           "ui-slider": "ui-corner-all",
                           "ui-slider-handle": "ui-corner-all",
        
                           // Note: ui-widget-header isn't the most fittingly semantic framework class for this
                           // element, but worked best visually with a variety of themes
                           "ui-slider-range": "ui-corner-all ui-widget-header"
                       },
                       distance: 0,
                       max: 100,
                       min: 0,
                       orientation: "horizontal",
                       range: false,
                       step: 1,
                       value: 0,
                       values: null,
        
                       // Callbacks
                       change: null,
                       slide: null,
                       start: null,
                       stop: null
                   },
        
                   // Number of pages in a slider
                   // (how many times can you page up/down to go through the whole range)
                   numPages: 5,
        
                   _create: function () {
                       this._keySliding = false;
                       this._mouseSliding = false;
                       this._animateOff = true;
                       this._handleIndex = null;
                       this._detectOrientation();
                       this._mouseInit();
                       this._calculateNewMax();
        
                       this._addClass("ui-slider ui-slider-" + this.orientation,
                           "ui-widget ui-widget-content");
        
                       this._refresh();
        
                       this._animateOff = false;
                   },
        
                   _refresh: function () {
                       this._createRange();
                       this._createHandles();
                       this._setupEvents();
                       this._refreshValue();
                   },
        
                   _createHandles: function () {
                       var i, handleCount,
                           options = this.options,
                           existingHandles = this.element.find(".ui-slider-handle"),
                           handle = "",
                           handles = [];
        
                       handleCount = (options.values && options.values.length) || 1;
        
                       if (existingHandles.length > handleCount) {
                           existingHandles.slice(handleCount).remove();
                           existingHandles = existingHandles.slice(0, handleCount);
                       }
        
                       for (i = existingHandles.length; i < handleCount; i++) {
                           handles.push(handle);
                       }
        
                       this.handles = existingHandles.add($(handles.join("")).appendTo(this.element));
        
                       this._addClass(this.handles, "ui-slider-handle", "ui-state-default");
        
                       this.handle = this.handles.eq(0);
        
                       this.handles.each(function (i) {
                           $(this)
                               .data("ui-slider-handle-index", i)
                               .attr("tabIndex", 0);
                       });
                   },
        
                   _createRange: function () {
                       var options = this.options;
        
                       if (options.range) {
                           if (options.range === true) {
                               if (!options.values) {
                                   options.values = [this._valueMin(), this._valueMin()];
                               } else if (options.values.length && options.values.length !== 2) {
                                   options.values = [options.values[0], options.values[0]];
                               } else if ($.isArray(options.values)) {
                                   options.values = options.values.slice(0);
                               }
                           }
        
                           if (!this.range || !this.range.length) {
        
        this.range = $("
        ")
                                   .appendTo(this.element);
        
                               this._addClass(this.range, "ui-slider-range");
                           } else {
                               this._removeClass(this.range, "ui-slider-range-min ui-slider-range-max");
        
                               // Handle range switching from true to min/max
                               this.range.css({
                                   "left": "",
                                   "bottom": ""
                               });
                           }
                           if (options.range === "min" || options.range === "max") {
                               this._addClass(this.range, "ui-slider-range-" + options.range);
                           }
                       } else {
                           if (this.range) {
                               this.range.remove();
                           }
                           this.range = null;
                       }
                   },
        
                   _setupEvents: function () {
                       this._off(this.handles);
                       this._on(this.handles, this._handleEvents);
                       this._hoverable(this.handles);
                       this._focusable(this.handles);
                   },
        
                   _destroy: function () {
                       this.handles.remove();
                       if (this.range) {
                           this.range.remove();
                       }
        
                       this._mouseDestroy();
                   },
        
                   _mouseCapture: function (event) {
                       var position, normValue, distance, closestHandle, index, allowed, offset,
                           mouseOverHandle,
                           that = this,
                           o = this.options;
        
                       if (o.disabled) {
                           return false;
                       }
        
                       this.elementSize = {
                           width: this.element.outerWidth(),
                           height: this.element.outerHeight()
                       };
                       this.elementOffset = this.element.offset();
        
                       position = {
                           x: event.pageX,
                           y: event.pageY
                       };
                       normValue = this._normValueFromMouse(position);
                       distance = this._valueMax() - this._valueMin() + 1;
                       this.handles.each(function (i) {
                           var thisDistance = Math.abs(normValue - that.values(i));
                           if ((distance > thisDistance) ||
                               (distance === thisDistance &&
                                   (i === that._lastChangedValue || that.values(i) === o.min))) {
                               distance = thisDistance;
                               closestHandle = $(this);
                               index = i;
                           }
                       });
        
                       allowed = this._start(event, index);
                       if (allowed === false) {
                           return false;
                       }
                       this._mouseSliding = true;
        
                       this._handleIndex = index;
        
                       this._addClass(closestHandle, null, "ui-state-active");
                       closestHandle.trigger("focus");
        
                       offset = closestHandle.offset();
                       mouseOverHandle = !$(event.target).parents().addBack().is(".ui-slider-handle");
                       this._clickOffset = mouseOverHandle ? {
                           left: 0,
                           top: 0
                       } : {
                           left: event.pageX - offset.left - (closestHandle.width() / 2),
                           top: event.pageY - offset.top -
                               (closestHandle.height() / 2) -
                               (parseInt(closestHandle.css("borderTopWidth"), 10) || 0) -
                               (parseInt(closestHandle.css("borderBottomWidth"), 10) || 0) +
                               (parseInt(closestHandle.css("marginTop"), 10) || 0)
                       };
        
                       if (!this.handles.hasClass("ui-state-hover")) {
                           this._slide(event, index, normValue);
                       }
                       this._animateOff = true;
                       return true;
                   },
        
                   _mouseStart: function () {
                       return true;
                   },
        
                   _mouseDrag: function (event) {
                       var position = {
                               x: event.pageX,
                               y: event.pageY
                           },
                           normValue = this._normValueFromMouse(position);
        
                       this._slide(event, this._handleIndex, normValue);
        
                       return false;
                   },
        
                   _mouseStop: function (event) {
                       this._removeClass(this.handles, null, "ui-state-active");
                       this._mouseSliding = false;
        
                       this._stop(event, this._handleIndex);
                       this._change(event, this._handleIndex);
        
                       this._handleIndex = null;
                       this._clickOffset = null;
                       this._animateOff = false;
        
                       return false;
                   },
        
                   _detectOrientation: function () {
                       this.orientation = (this.options.orientation === "vertical") ? "vertical" :
                           "horizontal";
                   },
        
                   _normValueFromMouse: function (position) {
                       var pixelTotal,
                           pixelMouse,
                           percentMouse,
                           valueTotal,
                           valueMouse;
        
                       if (this.orientation === "horizontal") {
                           pixelTotal = this.elementSize.width;
                           pixelMouse = position.x - this.elementOffset.left -
                               (this._clickOffset ? this._clickOffset.left : 0);
                       } else {
                           pixelTotal = this.elementSize.height;
                           pixelMouse = position.y - this.elementOffset.top -
                               (this._clickOffset ? this._clickOffset.top : 0);
                       }
        
                       percentMouse = (pixelMouse / pixelTotal);
                       if (percentMouse > 1) {
                           percentMouse = 1;
                       }
                       if (percentMouse < 0) {
                           percentMouse = 0;
                       }
                       if (this.orientation === "vertical") {
                           percentMouse = 1 - percentMouse;
                       }
        
                       valueTotal = this._valueMax() - this._valueMin();
                       valueMouse = this._valueMin() + percentMouse * valueTotal;
        
                       return this._trimAlignValue(valueMouse);
                   },
        
                   _uiHash: function (index, value, values) {
                       var uiHash = {
                           handle: this.handles[index],
                           handleIndex: index,
                           value: value !== undefined ? value : this.value()
                       };
        
                       if (this._hasMultipleValues()) {
                           uiHash.value = value !== undefined ? value : this.values(index);
                           uiHash.values = values || this.values();
                       }
        
                       return uiHash;
                   },
        
                   _hasMultipleValues: function () {
                       return this.options.values && this.options.values.length;
                   },
        
                   _start: function (event, index) {
                       return this._trigger("start", event, this._uiHash(index));
                   },
        
                   _slide: function (event, index, newVal) {
                       var allowed, otherVal,
                           currentValue = this.value(),
                           newValues = this.values();
        
                       if (this._hasMultipleValues()) {
                           otherVal = this.values(index ? 0 : 1);
                           currentValue = this.values(index);
        
                           if (this.options.values.length === 2 && this.options.range === true) {
                               newVal = index === 0 ? Math.min(otherVal, newVal) : Math.max(otherVal,
                                   newVal);
                           }
        
                           newValues[index] = newVal;
                       }
        
                       if (newVal === currentValue) {
                           return;
                       }
        
                       allowed = this._trigger("slide", event, this._uiHash(index, newVal, newValues));
        
                       // A slide can be canceled by returning false from the slide callback
                       if (allowed === false) {
                           return;
                       }
        
                       if (this._hasMultipleValues()) {
                           this.values(index, newVal);
                       } else {
                           this.value(newVal);
                       }
                   },
        
                   _stop: function (event, index) {
                       this._trigger("stop", event, this._uiHash(index));
                   },
        
                   _change: function (event, index) {
                       if (!this._keySliding && !this._mouseSliding) {
        
                           //store the last changed value index for reference when handles overlap
                           this._lastChangedValue = index;
                           this._trigger("change", event, this._uiHash(index));
                       }
                   },
        
                   value: function (newValue) {
                       if (arguments.length) {
                           this.options.value = this._trimAlignValue(newValue);
                           this._refreshValue();
                           this._change(null, 0);
                           return;
                       }
        
                       return this._value();
                   },
        
                   values: function (index, newValue) {
                       var vals,
                           newValues,
                           i;
        
                       if (arguments.length > 1) {
                           this.options.values[index] = this._trimAlignValue(newValue);
                           this._refreshValue();
                           this._change(null, index);
                           return;
                       }
        
                       if (arguments.length) {
                           if ($.isArray(arguments[0])) {
                               vals = this.options.values;
                               newValues = arguments[0];
                               for (i = 0; i < vals.length; i += 1) {
                                   vals[i] = this._trimAlignValue(newValues[i]);
                                   this._change(null, i);
                               }
                               this._refreshValue();
                           } else {
                               if (this._hasMultipleValues()) {
                                   return this._values(index);
                               } else {
                                   return this.value();
                               }
                           }
                       } else {
                           return this._values();
                       }
                   },
        
                   _setOption: function (key, value) {
                       var i,
                           valsLength = 0;
        
                       if (key === "range" && this.options.range === true) {
                           if (value === "min") {
                               this.options.value = this._values(0);
                               this.options.values = null;
                           } else if (value === "max") {
                               this.options.value = this._values(this.options.values.length - 1);
                               this.options.values = null;
                           }
                       }
        
                       if ($.isArray(this.options.values)) {
                           valsLength = this.options.values.length;
                       }
        
                       this._super(key, value);
        
                       switch (key) {
                           case "orientation":
                               this._detectOrientation();
                               this._removeClass("ui-slider-horizontal ui-slider-vertical")
                                   ._addClass("ui-slider-" + this.orientation);
                               this._refreshValue();
                               if (this.options.range) {
                                   this._refreshRange(value);
                               }
        
                               // Reset positioning from previous orientation
                               this.handles.css(value === "horizontal" ? "bottom" : "left", "");
                               break;
                           case "value":
                               this._animateOff = true;
                               this._refreshValue();
                               this._change(null, 0);
                               this._animateOff = false;
                               break;
                           case "values":
                               this._animateOff = true;
                               this._refreshValue();
        
                               // Start from the last handle to prevent unreachable handles (#9046)
                               for (i = valsLength - 1; i >= 0; i--) {
                                   this._change(null, i);
                               }
                               this._animateOff = false;
                               break;
                           case "step":
                           case "min":
                           case "max":
                               this._animateOff = true;
                               this._calculateNewMax();
                               this._refreshValue();
                               this._animateOff = false;
                               break;
                           case "range":
                               this._animateOff = true;
                               this._refresh();
                               this._animateOff = false;
                               break;
                       }
                   },
        
                   _setOptionDisabled: function (value) {
                       this._super(value);
        
                       this._toggleClass(null, "ui-state-disabled", !!value);
                   },
        
                   //internal value getter
                   // _value() returns value trimmed by min and max, aligned by step
                   _value: function () {
                       var val = this.options.value;
                       val = this._trimAlignValue(val);
        
                       return val;
                   },
        
                   //internal values getter
                   // _values() returns array of values trimmed by min and max, aligned by step
                   // _values( index ) returns single value trimmed by min and max, aligned by step
                   _values: function (index) {
                       var val,
                           vals,
                           i;
        
                       if (arguments.length) {
                           val = this.options.values[index];
                           val = this._trimAlignValue(val);
        
                           return val;
                       } else if (this._hasMultipleValues()) {
        
                           // .slice() creates a copy of the array
                           // this copy gets trimmed by min and max and then returned
                           vals = this.options.values.slice();
                           for (i = 0; i < vals.length; i += 1) {
                               vals[i] = this._trimAlignValue(vals[i]);
                           }
        
                           return vals;
                       } else {
                           return [];
                       }
                   },
        
                   // Returns the step-aligned value that val is closest to, between (inclusive) min and max
                   _trimAlignValue: function (val) {
                       if (val <= this._valueMin()) {
                           return this._valueMin();
                       }
                       if (val >= this._valueMax()) {
                           return this._valueMax();
                       }
                       var step = (this.options.step > 0) ? this.options.step : 1,
                           valModStep = (val - this._valueMin()) % step,
                           alignValue = val - valModStep;
        
                       if (Math.abs(valModStep) * 2 >= step) {
                           alignValue += (valModStep > 0) ? step : (-step);
                       }
        
                       // Since JavaScript has problems with large floats, round
                       // the final value to 5 digits after the decimal point (see #4124)
                       return parseFloat(alignValue.toFixed(5));
                   },
        
                   _calculateNewMax: function () {
                       var max = this.options.max,
                           min = this._valueMin(),
                           step = this.options.step,
                           aboveMin = Math.round((max - min) / step) * step;
                       max = aboveMin + min;
                       if (max > this.options.max) {
        
                           //If max is not divisible by step, rounding off may increase its value
                           max -= step;
                       }
                       this.max = parseFloat(max.toFixed(this._precision()));
                   },
        
                   _precision: function () {
                       var precision = this._precisionOf(this.options.step);
                       if (this.options.min !== null) {
                           precision = Math.max(precision, this._precisionOf(this.options.min));
                       }
                       return precision;
                   },
        
                   _precisionOf: function (num) {
                       var str = num.toString(),
                           decimal = str.indexOf(".");
                       return decimal === -1 ? 0 : str.length - decimal - 1;
                   },
        
                   _valueMin: function () {
                       return this.options.min;
                   },
        
                   _valueMax: function () {
                       return this.max;
                   },
        
                   _refreshRange: function (orientation) {
                       if (orientation === "vertical") {
                           this.range.css({
                               "width": "",
                               "left": ""
                           });
                       }
                       if (orientation === "horizontal") {
                           this.range.css({
                               "height": "",
                               "bottom": ""
                           });
                       }
                   },
        
                   _refreshValue: function () {
                       var lastValPercent, valPercent, value, valueMin, valueMax,
                           oRange = this.options.range,
                           o = this.options,
                           that = this,
                           animate = (!this._animateOff) ? o.animate : false,
                           _set = {};
        
                       if (this._hasMultipleValues()) {
                           this.handles.each(function (i) {
                               valPercent = (that.values(i) - that._valueMin()) / (that
                                   ._valueMax() -
                                   that._valueMin()) * 100;
                               _set[that.orientation === "horizontal" ? "left" : "bottom"] =
                                   valPercent + "%";
                               $(this).stop(1, 1)[animate ? "animate" : "css"](_set, o.animate);
                               if (that.options.range === true) {
                                   if (that.orientation === "horizontal") {
                                       if (i === 0) {
                                           that.range.stop(1, 1)[animate ? "animate" : "css"]({
                                               left: valPercent + "%"
                                           }, o.animate);
                                       }
                                       if (i === 1) {
                                           that.range[animate ? "animate" : "css"]({
                                               width: (valPercent - lastValPercent) + "%"
                                           }, {
                                               queue: false,
                                               duration: o.animate
                                           });
                                       }
                                   } else {
                                       if (i === 0) {
                                           that.range.stop(1, 1)[animate ? "animate" : "css"]({
                                               bottom: (valPercent) + "%"
                                           }, o.animate);
                                       }
                                       if (i === 1) {
                                           that.range[animate ? "animate" : "css"]({
                                               height: (valPercent - lastValPercent) + "%"
                                           }, {
                                               queue: false,
                                               duration: o.animate
                                           });
                                       }
                                   }
                               }
                               lastValPercent = valPercent;
                           });
                       } else {
                           value = this.value();
                           valueMin = this._valueMin();
                           valueMax = this._valueMax();
                           valPercent = (valueMax !== valueMin) ?
                               (value - valueMin) / (valueMax - valueMin) * 100 :
                               0;
                           _set[this.orientation === "horizontal" ? "left" : "bottom"] = valPercent + "%";
                           this.handle.stop(1, 1)[animate ? "animate" : "css"](_set, o.animate);
        
                           if (oRange === "min" && this.orientation === "horizontal") {
                               this.range.stop(1, 1)[animate ? "animate" : "css"]({
                                   width: valPercent + "%"
                               }, o.animate);
                           }
                           if (oRange === "max" && this.orientation === "horizontal") {
                               this.range.stop(1, 1)[animate ? "animate" : "css"]({
                                   width: (100 - valPercent) + "%"
                               }, o.animate);
                           }
                           if (oRange === "min" && this.orientation === "vertical") {
                               this.range.stop(1, 1)[animate ? "animate" : "css"]({
                                   height: valPercent + "%"
                               }, o.animate);
                           }
                           if (oRange === "max" && this.orientation === "vertical") {
                               this.range.stop(1, 1)[animate ? "animate" : "css"]({
                                   height: (100 - valPercent) + "%"
                               }, o.animate);
                           }
                       }
                   },
        
                   _handleEvents: {
                       keydown: function (event) {
                           var allowed, curVal, newVal, step,
                               index = $(event.target).data("ui-slider-handle-index");
        
                           switch (event.keyCode) {
                               case $.ui.keyCode.HOME:
                               case $.ui.keyCode.END:
                               case $.ui.keyCode.PAGE_UP:
                               case $.ui.keyCode.PAGE_DOWN:
                               case $.ui.keyCode.UP:
                               case $.ui.keyCode.RIGHT:
                               case $.ui.keyCode.DOWN:
                               case $.ui.keyCode.LEFT:
                                   event.preventDefault();
                                   if (!this._keySliding) {
                                       this._keySliding = true;
                                       this._addClass($(event.target), null, "ui-state-active");
                                       allowed = this._start(event, index);
                                       if (allowed === false) {
                                           return;
                                       }
                                   }
                                   break;
                           }
        
                           step = this.options.step;
                           if (this._hasMultipleValues()) {
                               curVal = newVal = this.values(index);
                           } else {
                               curVal = newVal = this.value();
                           }
        
                           switch (event.keyCode) {
                               case $.ui.keyCode.HOME:
                                   newVal = this._valueMin();
                                   break;
                               case $.ui.keyCode.END:
                                   newVal = this._valueMax();
                                   break;
                               case $.ui.keyCode.PAGE_UP:
                                   newVal = this._trimAlignValue(
                                       curVal + ((this._valueMax() - this._valueMin()) / this.numPages)
                                   );
                                   break;
                               case $.ui.keyCode.PAGE_DOWN:
                                   newVal = this._trimAlignValue(
                                       curVal - ((this._valueMax() - this._valueMin()) / this.numPages)
                                   );
                                   break;
                               case $.ui.keyCode.UP:
                               case $.ui.keyCode.RIGHT:
                                   if (curVal === this._valueMax()) {
                                       return;
                                   }
                                   newVal = this._trimAlignValue(curVal + step);
                                   break;
                               case $.ui.keyCode.DOWN:
                               case $.ui.keyCode.LEFT:
                                   if (curVal === this._valueMin()) {
                                       return;
                                   }
                                   newVal = this._trimAlignValue(curVal - step);
                                   break;
                           }
        
                           this._slide(event, index, newVal);
                       },
                       keyup: function (event) {
                           var index = $(event.target).data("ui-slider-handle-index");
        
                           if (this._keySliding) {
                               this._keySliding = false;
                               this._stop(event, index);
                               this._change(event, index);
                               this._removeClass($(event.target), null, "ui-state-active");
                           }
                       }
                   }
               });
        


               /*!
                * jQuery UI Sortable 1.12.1
                * http://jqueryui.com
                *
                * Copyright jQuery Foundation and other contributors
                * Released under the MIT license.
                * http://jquery.org/license
                */
        
               //>>label: Sortable
               //>>group: Interactions
               //>>description: Enables items in a list to be sorted using the mouse.
               //>>docs: http://api.jqueryui.com/sortable/
               //>>demos: http://jqueryui.com/sortable/
               //>>css.structure: ../../themes/base/sortable.css
        


               var widgetsSortable = $.widget("ui.sortable", $.ui.mouse, {
                   version: "1.12.1",
                   widgetEventPrefix: "sort",
                   ready: false,
                   options: {
                       appendTo: "parent",
                       axis: false,
                       connectWith: false,
                       containment: false,
                       cursor: "auto",
                       cursorAt: false,
                       dropOnEmpty: true,
                       forcePlaceholderSize: false,
                       forceHelperSize: false,
                       grid: false,
                       handle: false,
                       helper: "original",
                       items: "> *",
                       opacity: false,
                       placeholder: false,
                       revert: false,
                       scroll: true,
                       scrollSensitivity: 20,
                       scrollSpeed: 20,
                       scope: "default",
                       tolerance: "intersect",
                       zIndex: 1000,
        
                       // Callbacks
                       activate: null,
                       beforeStop: null,
                       change: null,
                       deactivate: null,
                       out: null,
                       over: null,
                       receive: null,
                       remove: null,
                       sort: null,
                       start: null,
                       stop: null,
                       update: null
                   },
        
                   _isOverAxis: function (x, reference, size) {
                       return (x >= reference) && (x < (reference + size));
                   },
        
                   _isFloating: function (item) {
                       return (/left|right/).test(item.css("float")) ||
                           (/inline|table-cell/).test(item.css("display"));
                   },
        
                   _create: function () {
                       this.containerCache = {};
                       this._addClass("ui-sortable");
        
                       //Get the items
                       this.refresh();
        
                       //Let's determine the parent's offset
                       this.offset = this.element.offset();
        
                       //Initialize mouse events for interaction
                       this._mouseInit();
        
                       this._setHandleClassName();
        
                       //We're ready to go
                       this.ready = true;
        
                   },
        
                   _setOption: function (key, value) {
                       this._super(key, value);
        
                       if (key === "handle") {
                           this._setHandleClassName();
                       }
                   },
        
                   _setHandleClassName: function () {
                       var that = this;
                       this._removeClass(this.element.find(".ui-sortable-handle"), "ui-sortable-handle");
                       $.each(this.items, function () {
                           that._addClass(
                               this.instance.options.handle ?
                               this.item.find(this.instance.options.handle) :
                               this.item,
                               "ui-sortable-handle"
                           );
                       });
                   },
        
                   _destroy: function () {
                       this._mouseDestroy();
        
                       for (var i = this.items.length - 1; i >= 0; i--) {
                           this.items[i].item.removeData(this.widgetName + "-item");
                       }
        
                       return this;
                   },
        
                   _mouseCapture: function (event, overrideHandle) {
                       var currentItem = null,
                           validHandle = false,
                           that = this;
        
                       if (this.reverting) {
                           return false;
                       }
        
                       if (this.options.disabled || this.options.type === "static") {
                           return false;
                       }
        
                       //We have to refresh the items data once first
                       this._refreshItems(event);
        
                       //Find out if the clicked node (or one of its parents) is a actual item in this.items
                       $(event.target).parents().each(function () {
                           if ($.data(this, that.widgetName + "-item") === that) {
                               currentItem = $(this);
                               return false;
                           }
                       });
                       if ($.data(event.target, that.widgetName + "-item") === that) {
                           currentItem = $(event.target);
                       }
        
                       if (!currentItem) {
                           return false;
                       }
                       if (this.options.handle && !overrideHandle) {
                           $(this.options.handle, currentItem).find("*").addBack().each(function () {
                               if (this === event.target) {
                                   validHandle = true;
                               }
                           });
                           if (!validHandle) {
                               return false;
                           }
                       }
        
                       this.currentItem = currentItem;
                       this._removeCurrentsFromItems();
                       return true;
        
                   },
        
                   _mouseStart: function (event, overrideHandle, noActivation) {
        
                       var i, body,
                           o = this.options;
        
                       this.currentContainer = this;
        
                       //We only need to call refreshPositions, because the refreshItems call has been moved to
                       // mouseCapture
                       this.refreshPositions();
        
                       //Create and append the visible helper
                       this.helper = this._createHelper(event);
        
                       //Cache the helper size
                       this._cacheHelperProportions();
        
                       /*
                        * - Position generation -
                        * This block generates everything position related - it's the core of draggables.
                        */
        
                       //Cache the margins of the original element
                       this._cacheMargins();
        
                       //Get the next scrolling parent
                       this.scrollParent = this.helper.scrollParent();
        
                       //The element's absolute position on the page minus margins
                       this.offset = this.currentItem.offset();
                       this.offset = {
                           top: this.offset.top - this.margins.top,
                           left: this.offset.left - this.margins.left
                       };
        
                       $.extend(this.offset, {
                           click: { //Where the click happened, relative to the element
                               left: event.pageX - this.offset.left,
                               top: event.pageY - this.offset.top
                           },
                           parent: this._getParentOffset(),
        
                           // This is a relative to absolute position minus the actual position calculation -
                           // only used for relative positioned helper
                           relative: this._getRelativeOffset()
                       });
        
                       // Only after we got the offset, we can change the helper's position to absolute
                       // TODO: Still need to figure out a way to make relative sorting possible
                       this.helper.css("position", "absolute");
                       this.cssPosition = this.helper.css("position");
        
                       //Generate the original position
                       this.originalPosition = this._generatePosition(event);
                       this.originalPageX = event.pageX;
                       this.originalPageY = event.pageY;
        
                       //Adjust the mouse offset relative to the helper if "cursorAt" is supplied
                       (o.cursorAt && this._adjustOffsetFromHelper(o.cursorAt));
        
                       //Cache the former DOM position
                       this.domPosition = {
                           prev: this.currentItem.prev()[0],
                           parent: this.currentItem.parent()[0]
                       };
        
                       // If the helper is not the original, hide the original so it's not playing any role during
                       // the drag, won't cause anything bad this way
                       if (this.helper[0] !== this.currentItem[0]) {
                           this.currentItem.hide();
                       }
        
                       //Create the placeholder
                       this._createPlaceholder();
        
                       //Set a containment if given in the options
                       if (o.containment) {
                           this._setContainment();
                       }
        
                       if (o.cursor && o.cursor !== "auto") { // cursor option
                           body = this.document.find("body");
        
                           // Support: IE
                           this.storedCursor = body.css("cursor");
                           body.css("cursor", o.cursor);
        
                           this.storedStylesheet =
                               $("<style>*{ cursor: " + o.cursor + " !important; }</style>").appendTo(
                                   body);
                       }
        
                       if (o.opacity) { // opacity option
                           if (this.helper.css("opacity")) {
                               this._storedOpacity = this.helper.css("opacity");
                           }
                           this.helper.css("opacity", o.opacity);
                       }
        
                       if (o.zIndex) { // zIndex option
                           if (this.helper.css("zIndex")) {
                               this._storedZIndex = this.helper.css("zIndex");
                           }
                           this.helper.css("zIndex", o.zIndex);
                       }
        
                       //Prepare scrolling
                       if (this.scrollParent[0] !== this.document[0] &&
                           this.scrollParent[0].tagName !== "HTML") {
                           this.overflowOffset = this.scrollParent.offset();
                       }
        
                       //Call callbacks
                       this._trigger("start", event, this._uiHash());
        
                       //Recache the helper size
                       if (!this._preserveHelperProportions) {
                           this._cacheHelperProportions();
                       }
        
                       //Post "activate" events to possible containers
                       if (!noActivation) {
                           for (i = this.containers.length - 1; i >= 0; i--) {
                               this.containers[i]._trigger("activate", event, this._uiHash(this));
                           }
                       }
        
                       //Prepare possible droppables
                       if ($.ui.ddmanager) {
                           $.ui.ddmanager.current = this;
                       }
        
                       if ($.ui.ddmanager && !o.dropBehaviour) {
                           $.ui.ddmanager.prepareOffsets(this, event);
                       }
        
                       this.dragging = true;
        
                       this._addClass(this.helper, "ui-sortable-helper");
        
                       // Execute the drag once - this causes the helper not to be visiblebefore getting its
                       // correct position
                       this._mouseDrag(event);
                       return true;
        
                   },
        
                   _mouseDrag: function (event) {
                       var i, item, itemElement, intersection,
                           o = this.options,
                           scrolled = false;
        
                       //Compute the helpers position
                       this.position = this._generatePosition(event);
                       this.positionAbs = this._convertPositionTo("absolute");
        
                       if (!this.lastPositionAbs) {
                           this.lastPositionAbs = this.positionAbs;
                       }
        
                       //Do scrolling
                       if (this.options.scroll) {
                           if (this.scrollParent[0] !== this.document[0] &&
                               this.scrollParent[0].tagName !== "HTML") {
        
                               if ((this.overflowOffset.top + this.scrollParent[0].offsetHeight) -
                                   event.pageY < o.scrollSensitivity) {
                                   this.scrollParent[0].scrollTop =
                                       scrolled = this.scrollParent[0].scrollTop + o.scrollSpeed;
                               } else if (event.pageY - this.overflowOffset.top < o.scrollSensitivity) {
                                   this.scrollParent[0].scrollTop =
                                       scrolled = this.scrollParent[0].scrollTop - o.scrollSpeed;
                               }
        
                               if ((this.overflowOffset.left + this.scrollParent[0].offsetWidth) -
                                   event.pageX < o.scrollSensitivity) {
                                   this.scrollParent[0].scrollLeft = scrolled =
                                       this.scrollParent[0].scrollLeft + o.scrollSpeed;
                               } else if (event.pageX - this.overflowOffset.left < o.scrollSensitivity) {
                                   this.scrollParent[0].scrollLeft = scrolled =
                                       this.scrollParent[0].scrollLeft - o.scrollSpeed;
                               }
        
                           } else {
        
                               if (event.pageY - this.document.scrollTop() < o.scrollSensitivity) {
                                   scrolled = this.document.scrollTop(this.document.scrollTop() - o
                                       .scrollSpeed);
                               } else if (this.window.height() - (event.pageY - this.document
                                       .scrollTop()) <
                                   o.scrollSensitivity) {
                                   scrolled = this.document.scrollTop(this.document.scrollTop() + o
                                       .scrollSpeed);
                               }
        
                               if (event.pageX - this.document.scrollLeft() < o.scrollSensitivity) {
                                   scrolled = this.document.scrollLeft(
                                       this.document.scrollLeft() - o.scrollSpeed
                                   );
                               } else if (this.window.width() - (event.pageX - this.document
                                       .scrollLeft()) <
                                   o.scrollSensitivity) {
                                   scrolled = this.document.scrollLeft(
                                       this.document.scrollLeft() + o.scrollSpeed
                                   );
                               }
        
                           }
        
                           if (scrolled !== false && $.ui.ddmanager && !o.dropBehaviour) {
                               $.ui.ddmanager.prepareOffsets(this, event);
                           }
                       }
        
                       //Regenerate the absolute position used for position checks
                       this.positionAbs = this._convertPositionTo("absolute");
        
                       //Set the helper position
                       if (!this.options.axis || this.options.axis !== "y") {
                           this.helper[0].style.left = this.position.left + "px";
                       }
                       if (!this.options.axis || this.options.axis !== "x") {
                           this.helper[0].style.top = this.position.top + "px";
                       }
        
                       //Rearrange
                       for (i = this.items.length - 1; i >= 0; i--) {
        
                           //Cache variables and intersection, continue if no intersection
                           item = this.items[i];
                           itemElement = item.item[0];
                           intersection = this._intersectsWithPointer(item);
                           if (!intersection) {
                               continue;
                           }
        
                           // Only put the placeholder inside the current Container, skip all
                           // items from other containers. This works because when moving
                           // an item from one container to another the
                           // currentContainer is switched before the placeholder is moved.
                           //
                           // Without this, moving items in "sub-sortables" can cause
                           // the placeholder to jitter between the outer and inner container.
                           if (item.instance !== this.currentContainer) {
                               continue;
                           }
        
                           // Cannot intersect with itself
                           // no useless actions that have been done before
                           // no action if the item moved is the parent of the item checked
                           if (itemElement !== this.currentItem[0] &&
                               this.placeholder[intersection === 1 ? "next" : "prev"]()[0] !==
                               itemElement &&
                               !$.contains(this.placeholder[0], itemElement) &&
                               (this.options.type === "semi-dynamic" ?
                                   !$.contains(this.element[0], itemElement) :
                                   true
                               )
                           ) {
        
                               this.direction = intersection === 1 ? "down" : "up";
        
                               if (this.options.tolerance === "pointer" || this._intersectsWithSides(
                                       item)) {
                                   this._rearrange(event, item);
                               } else {
                                   break;
                               }
        
                               this._trigger("change", event, this._uiHash());
                               break;
                           }
                       }
        
                       //Post events to containers
                       this._contactContainers(event);
        
                       //Interconnect with droppables
                       if ($.ui.ddmanager) {
                           $.ui.ddmanager.drag(this, event);
                       }
        
                       //Call callbacks
                       this._trigger("sort", event, this._uiHash());
        
                       this.lastPositionAbs = this.positionAbs;
                       return false;
        
                   },
        
                   _mouseStop: function (event, noPropagation) {
        
                       if (!event) {
                           return;
                       }
        
                       //If we are using droppables, inform the manager about the drop
                       if ($.ui.ddmanager && !this.options.dropBehaviour) {
                           $.ui.ddmanager.drop(this, event);
                       }
        
                       if (this.options.revert) {
                           var that = this,
                               cur = this.placeholder.offset(),
                               axis = this.options.axis,
                               animation = {};
        
                           if (!axis || axis === "x") {
                               animation.left = cur.left - this.offset.parent.left - this.margins.left +
                                   (this.offsetParent[0] === this.document[0].body ?
                                       0 :
                                       this.offsetParent[0].scrollLeft
                                   );
                           }
                           if (!axis || axis === "y") {
                               animation.top = cur.top - this.offset.parent.top - this.margins.top +
                                   (this.offsetParent[0] === this.document[0].body ?
                                       0 :
                                       this.offsetParent[0].scrollTop
                                   );
                           }
                           this.reverting = true;
                           $(this.helper).animate(
                               animation,
                               parseInt(this.options.revert, 10) || 500,
                               function () {
                                   that._clear(event);
                               }
                           );
                       } else {
                           this._clear(event, noPropagation);
                       }
        
                       return false;
        
                   },
        
                   cancel: function () {
        
                       if (this.dragging) {
        
                           this._mouseUp(new $.Event("mouseup", {
                               target: null
                           }));
        
                           if (this.options.helper === "original") {
                               this.currentItem.css(this._storedCSS);
                               this._removeClass(this.currentItem, "ui-sortable-helper");
                           } else {
                               this.currentItem.show();
                           }
        
                           //Post deactivating events to containers
                           for (var i = this.containers.length - 1; i >= 0; i--) {
                               this.containers[i]._trigger("deactivate", null, this._uiHash(this));
                               if (this.containers[i].containerCache.over) {
                                   this.containers[i]._trigger("out", null, this._uiHash(this));
                                   this.containers[i].containerCache.over = 0;
                               }
                           }
        
                       }
        
                       if (this.placeholder) {
        
                           //$(this.placeholder[0]).remove(); would have been the jQuery way - unfortunately,
                           // it unbinds ALL events from the original node!
                           if (this.placeholder[0].parentNode) {
                               this.placeholder[0].parentNode.removeChild(this.placeholder[0]);
                           }
                           if (this.options.helper !== "original" && this.helper &&
                               this.helper[0].parentNode) {
                               this.helper.remove();
                           }
        
                           $.extend(this, {
                               helper: null,
                               dragging: false,
                               reverting: false,
                               _noFinalSort: null
                           });
        
                           if (this.domPosition.prev) {
                               $(this.domPosition.prev).after(this.currentItem);
                           } else {
                               $(this.domPosition.parent).prepend(this.currentItem);
                           }
                       }
        
                       return this;
        
                   },
        
                   serialize: function (o) {
        
                       var items = this._getItemsAsjQuery(o && o.connected),
                           str = [];
                       o = o || {};
        
                       $(items).each(function () {
                           var res = ($(o.item || this).attr(o.attribute || "id") || "")
                               .match(o.expression || (/(.+)[\-=_](.+)/));
                           if (res) {
                               str.push(
                                   (o.key || res[1] + "[]") +
                                   "=" + (o.key && o.expression ? res[1] : res[2]));
                           }
                       });
        
                       if (!str.length && o.key) {
                           str.push(o.key + "=");
                       }
        
                       return str.join("&");
        
                   },
        
                   toArray: function (o) {
        
                       var items = this._getItemsAsjQuery(o && o.connected),
                           ret = [];
        
                       o = o || {};
        
                       items.each(function () {
                           ret.push($(o.item || this).attr(o.attribute || "id") || "");
                       });
                       return ret;
        
                   },
        
                   /* Be careful with the following core functions */
                   _intersectsWith: function (item) {
        
                       var x1 = this.positionAbs.left,
                           x2 = x1 + this.helperProportions.width,
                           y1 = this.positionAbs.top,
                           y2 = y1 + this.helperProportions.height,
                           l = item.left,
                           r = l + item.width,
                           t = item.top,
                           b = t + item.height,
                           dyClick = this.offset.click.top,
                           dxClick = this.offset.click.left,
                           isOverElementHeight = (this.options.axis === "x") || ((y1 + dyClick) > t &&
                               (y1 + dyClick) < b),
                           isOverElementWidth = (this.options.axis === "y") || ((x1 + dxClick) > l &&
                               (x1 + dxClick) < r),
                           isOverElement = isOverElementHeight && isOverElementWidth;
        
                       if (this.options.tolerance === "pointer" ||
                           this.options.forcePointerForContainers ||
                           (this.options.tolerance !== "pointer" &&
                               this.helperProportions[this.floating ? "width" : "height"] >
                               item[this.floating ? "width" : "height"])
                       ) {
                           return isOverElement;
                       } else {
        
                           return (l < x1 + (this.helperProportions.width / 2) && // Right Half
                               x2 - (this.helperProportions.width / 2) < r && // Left Half
                               t < y1 + (this.helperProportions.height / 2) && // Bottom Half
                               y2 - (this.helperProportions.height / 2) < b); // Top Half
        
                       }
                   },
        
                   _intersectsWithPointer: function (item) {
                       var verticalDirection, horizontalDirection,
                           isOverElementHeight = (this.options.axis === "x") ||
                           this._isOverAxis(
                               this.positionAbs.top + this.offset.click.top, item.top, item.height),
                           isOverElementWidth = (this.options.axis === "y") ||
                           this._isOverAxis(
                               this.positionAbs.left + this.offset.click.left, item.left, item.width),
                           isOverElement = isOverElementHeight && isOverElementWidth;
        
                       if (!isOverElement) {
                           return false;
                       }
        
                       verticalDirection = this._getDragVerticalDirection();
                       horizontalDirection = this._getDragHorizontalDirection();
        
                       return this.floating ?
                           ((horizontalDirection === "right" || verticalDirection === "down") ? 2 : 1) :
                           (verticalDirection && (verticalDirection === "down" ? 2 : 1));
        
                   },
        
                   _intersectsWithSides: function (item) {
        
                       var isOverBottomHalf = this._isOverAxis(this.positionAbs.top +
                               this.offset.click.top, item.top + (item.height / 2), item.height),
                           isOverRightHalf = this._isOverAxis(this.positionAbs.left +
                               this.offset.click.left, item.left + (item.width / 2), item.width),
                           verticalDirection = this._getDragVerticalDirection(),
                           horizontalDirection = this._getDragHorizontalDirection();
        
                       if (this.floating && horizontalDirection) {
                           return ((horizontalDirection === "right" && isOverRightHalf) ||
                               (horizontalDirection === "left" && !isOverRightHalf));
                       } else {
                           return verticalDirection && ((verticalDirection === "down" &&
                                   isOverBottomHalf) ||
                               (verticalDirection === "up" && !isOverBottomHalf));
                       }
        
                   },
        
                   _getDragVerticalDirection: function () {
                       var delta = this.positionAbs.top - this.lastPositionAbs.top;
                       return delta !== 0 && (delta > 0 ? "down" : "up");
                   },
        
                   _getDragHorizontalDirection: function () {
                       var delta = this.positionAbs.left - this.lastPositionAbs.left;
                       return delta !== 0 && (delta > 0 ? "right" : "left");
                   },
        
                   refresh: function (event) {
                       this._refreshItems(event);
                       this._setHandleClassName();
                       this.refreshPositions();
                       return this;
                   },
        
                   _connectWith: function () {
                       var options = this.options;
                       return options.connectWith.constructor === String ? [options.connectWith] :
                           options.connectWith;
                   },
        
                   _getItemsAsjQuery: function (connected) {
        
                       var i, j, cur, inst,
                           items = [],
                           queries = [],
                           connectWith = this._connectWith();
        
                       if (connectWith && connected) {
                           for (i = connectWith.length - 1; i >= 0; i--) {
                               cur = $(connectWith[i], this.document[0]);
                               for (j = cur.length - 1; j >= 0; j--) {
                                   inst = $.data(cur[j], this.widgetFullName);
                                   if (inst && inst !== this && !inst.options.disabled) {
                                       queries.push([$.isFunction(inst.options.items) ?
                                           inst.options.items.call(inst.element) :
                                           $(inst.options.items, inst.element)
                                           .not(".ui-sortable-helper")
                                           .not(".ui-sortable-placeholder"), inst
                                       ]);
                                   }
                               }
                           }
                       }
        
                       queries.push([$.isFunction(this.options.items) ?
                           this.options.items
                           .call(this.element, null, {
                               options: this.options,
                               item: this.currentItem
                           }) :
                           $(this.options.items, this.element)
                           .not(".ui-sortable-helper")
                           .not(".ui-sortable-placeholder"), this
                       ]);
        
                       function addItems() {
                           items.push(this);
                       }
                       for (i = queries.length - 1; i >= 0; i--) {
                           queries[i][0].each(addItems);
                       }
        
                       return $(items);
        
                   },
        
                   _removeCurrentsFromItems: function () {
        
                       var list = this.currentItem.find(":data(" + this.widgetName + "-item)");
        
                       this.items = $.grep(this.items, function (item) {
                           for (var j = 0; j < list.length; j++) {
                               if (list[j] === item.item[0]) {
                                   return false;
                               }
                           }
                           return true;
                       });
        
                   },
        
                   _refreshItems: function (event) {
        
                       this.items = [];
                       this.containers = [this];
        
                       var i, j, cur, inst, targetData, _queries, item, queriesLength,
                           items = this.items,
                           queries = [
                               [$.isFunction(this.options.items) ?
                                   this.options.items.call(this.element[0], event, {
                                       item: this.currentItem
                                   }) :
                                   $(this.options.items, this.element), this
                               ]
                           ],
                           connectWith = this._connectWith();
        
                       //Shouldn't be run the first time through due to massive slow-down
                       if (connectWith && this.ready) {
                           for (i = connectWith.length - 1; i >= 0; i--) {
                               cur = $(connectWith[i], this.document[0]);
                               for (j = cur.length - 1; j >= 0; j--) {
                                   inst = $.data(cur[j], this.widgetFullName);
                                   if (inst && inst !== this && !inst.options.disabled) {
                                       queries.push([$.isFunction(inst.options.items) ?
                                           inst.options.items
                                           .call(inst.element[0], event, {
                                               item: this.currentItem
                                           }) :
                                           $(inst.options.items, inst.element), inst
                                       ]);
                                       this.containers.push(inst);
                                   }
                               }
                           }
                       }
        
                       for (i = queries.length - 1; i >= 0; i--) {
                           targetData = queries[i][1];
                           _queries = queries[i][0];
        
                           for (j = 0, queriesLength = _queries.length; j < queriesLength; j++) {
                               item = $(_queries[j]);
        
                               // Data for target checking (mouse manager)
                               item.data(this.widgetName + "-item", targetData);
        
                               items.push({
                                   item: item,
                                   instance: targetData,
                                   width: 0,
                                   height: 0,
                                   left: 0,
                                   top: 0
                               });
                           }
                       }
        
                   },
        
                   refreshPositions: function (fast) {
        
                       // Determine whether items are being displayed horizontally
                       this.floating = this.items.length ?
                           this.options.axis === "x" || this._isFloating(this.items[0].item) :
                           false;
        
                       //This has to be redone because due to the item being moved out/into the offsetParent,
                       // the offsetParent's position will change
                       if (this.offsetParent && this.helper) {
                           this.offset.parent = this._getParentOffset();
                       }
        
                       var i, item, t, p;
        
                       for (i = this.items.length - 1; i >= 0; i--) {
                           item = this.items[i];
        
                           //We ignore calculating positions of all connected containers when we're not over them
                           if (item.instance !== this.currentContainer && this.currentContainer &&
                               item.item[0] !== this.currentItem[0]) {
                               continue;
                           }
        
                           t = this.options.toleranceElement ?
                               $(this.options.toleranceElement, item.item) :
                               item.item;
        
                           if (!fast) {
                               item.width = t.outerWidth();
                               item.height = t.outerHeight();
                           }
        
                           p = t.offset();
                           item.left = p.left;
                           item.top = p.top;
                       }
        
                       if (this.options.custom && this.options.custom.refreshContainers) {
                           this.options.custom.refreshContainers.call(this);
                       } else {
                           for (i = this.containers.length - 1; i >= 0; i--) {
                               p = this.containers[i].element.offset();
                               this.containers[i].containerCache.left = p.left;
                               this.containers[i].containerCache.top = p.top;
                               this.containers[i].containerCache.width =
                                   this.containers[i].element.outerWidth();
                               this.containers[i].containerCache.height =
                                   this.containers[i].element.outerHeight();
                           }
                       }
        
                       return this;
                   },
        
                   _createPlaceholder: function (that) {
                       that = that || this;
                       var className,
                           o = that.options;
        
                       if (!o.placeholder || o.placeholder.constructor === String) {
                           className = o.placeholder;
                           o.placeholder = {
                               element: function () {
        
                                   var nodeName = that.currentItem[0].nodeName.toLowerCase(),
                                       element = $("<" + nodeName + ">", that.document[0]);
        
                                   that._addClass(element, "ui-sortable-placeholder",
                                           className || that.currentItem[0].className)
                                       ._removeClass(element, "ui-sortable-helper");
        
                                   if (nodeName === "tbody") {
                                       that._createTrPlaceholder(
                                           that.currentItem.find("tr").eq(0),
                                           $("<tr>", that.document[0]).appendTo(element)
                                       );
                                   } else if (nodeName === "tr") {
                                       that._createTrPlaceholder(that.currentItem, element);
                                   } else if (nodeName === "img") {
                                       element.attr("src", that.currentItem.attr("src"));
                                   }
        
                                   if (!className) {
                                       element.css("visibility", "hidden");
                                   }
        
                                   return element;
                               },
                               update: function (container, p) {
        
                                   // 1. If a className is set as 'placeholder option, we don't force sizes -
                                   // the class is responsible for that
                                   // 2. The option 'forcePlaceholderSize can be enabled to force it even if a
                                   // class name is specified
                                   if (className && !o.forcePlaceholderSize) {
                                       return;
                                   }
        
                                   //If the element doesn't have a actual height by itself (without styles coming
                                   // from a stylesheet), it receives the inline height from the dragged item
                                   if (!p.height()) {
                                       p.height(
                                           that.currentItem.innerHeight() -
                                           parseInt(that.currentItem.css("paddingTop") || 0,
                                               10) -
                                           parseInt(that.currentItem.css("paddingBottom") || 0,
                                               10));
                                   }
                                   if (!p.width()) {
                                       p.width(
                                           that.currentItem.innerWidth() -
                                           parseInt(that.currentItem.css("paddingLeft") || 0,
                                               10) -
                                           parseInt(that.currentItem.css("paddingRight") || 0,
                                               10));
                                   }
                               }
                           };
                       }
        
                       //Create the placeholder
                       that.placeholder = $(o.placeholder.element.call(that.element, that.currentItem));
        
                       //Append it after the actual current item
                       that.currentItem.after(that.placeholder);
        
                       //Update the size of the placeholder (TODO: Logic to fuzzy, see line 316/317)
                       o.placeholder.update(that, that.placeholder);
        
                   },
        
                   _createTrPlaceholder: function (sourceTr, targetTr) {
                       var that = this;
        
                       sourceTr.children().each(function () {
                           $("<td> </td>", that.document[0])
                               .attr("colspan", $(this).attr("colspan") || 1)
                               .appendTo(targetTr);
                       });
                   },
        
                   _contactContainers: function (event) {
                       var i, j, dist, itemWithLeastDistance, posProperty, sizeProperty, cur, nearBottom,
                           floating, axis,
                           innermostContainer = null,
                           innermostIndex = null;
        
                       // Get innermost container that intersects with item
                       for (i = this.containers.length - 1; i >= 0; i--) {
        
                           // Never consider a container that's located within the item itself
                           if ($.contains(this.currentItem[0], this.containers[i].element[0])) {
                               continue;
                           }
        
                           if (this._intersectsWith(this.containers[i].containerCache)) {
        
                               // If we've already found a container and it's more "inner" than this, then continue
                               if (innermostContainer &&
                                   $.contains(
                                       this.containers[i].element[0],
                                       innermostContainer.element[0])) {
                                   continue;
                               }
        
                               innermostContainer = this.containers[i];
                               innermostIndex = i;
        
                           } else {
        
                               // container doesn't intersect. trigger "out" event if necessary
                               if (this.containers[i].containerCache.over) {
                                   this.containers[i]._trigger("out", event, this._uiHash(this));
                                   this.containers[i].containerCache.over = 0;
                               }
                           }
        
                       }
        
                       // If no intersecting containers found, return
                       if (!innermostContainer) {
                           return;
                       }
        
                       // Move the item into the container if it's not there already
                       if (this.containers.length === 1) {
                           if (!this.containers[innermostIndex].containerCache.over) {
                               this.containers[innermostIndex]._trigger("over", event, this._uiHash(this));
                               this.containers[innermostIndex].containerCache.over = 1;
                           }
                       } else {
        
                           // When entering a new container, we will find the item with the least distance and
                           // append our item near it
                           dist = 10000;
                           itemWithLeastDistance = null;
                           floating = innermostContainer.floating || this._isFloating(this.currentItem);
                           posProperty = floating ? "left" : "top";
                           sizeProperty = floating ? "width" : "height";
                           axis = floating ? "pageX" : "pageY";
        
                           for (j = this.items.length - 1; j >= 0; j--) {
                               if (!$.contains(
                                       this.containers[innermostIndex].element[0], this.items[j].item[0]
                                   )) {
                                   continue;
                               }
                               if (this.items[j].item[0] === this.currentItem[0]) {
                                   continue;
                               }
        
                               cur = this.items[j].item.offset()[posProperty];
                               nearBottom = false;
                               if (event[axis] - cur > this.items[j][sizeProperty] / 2) {
                                   nearBottom = true;
                               }
        
                               if (Math.abs(event[axis] - cur) < dist) {
                                   dist = Math.abs(event[axis] - cur);
                                   itemWithLeastDistance = this.items[j];
                                   this.direction = nearBottom ? "up" : "down";
                               }
                           }
        
                           //Check if dropOnEmpty is enabled
                           if (!itemWithLeastDistance && !this.options.dropOnEmpty) {
                               return;
                           }
        
                           if (this.currentContainer === this.containers[innermostIndex]) {
                               if (!this.currentContainer.containerCache.over) {
                                   this.containers[innermostIndex]._trigger("over", event, this._uiHash());
                                   this.currentContainer.containerCache.over = 1;
                               }
                               return;
                           }
        
                           itemWithLeastDistance ?
                               this._rearrange(event, itemWithLeastDistance, null, true) :
                               this._rearrange(event, null, this.containers[innermostIndex].element, true);
                           this._trigger("change", event, this._uiHash());
                           this.containers[innermostIndex]._trigger("change", event, this._uiHash(this));
                           this.currentContainer = this.containers[innermostIndex];
        
                           //Update the placeholder
                           this.options.placeholder.update(this.currentContainer, this.placeholder);
        
                           this.containers[innermostIndex]._trigger("over", event, this._uiHash(this));
                           this.containers[innermostIndex].containerCache.over = 1;
                       }
        
                   },
        
                   _createHelper: function (event) {
        
                       var o = this.options,
                           helper = $.isFunction(o.helper) ?
                           $(o.helper.apply(this.element[0], [event, this.currentItem])) :
                           (o.helper === "clone" ? this.currentItem.clone() : this.currentItem);
        
                       //Add the helper to the DOM if that didn't happen already
                       if (!helper.parents("body").length) {
                           $(o.appendTo !== "parent" ?
                               o.appendTo :
                               this.currentItem[0].parentNode)[0].appendChild(helper[0]);
                       }
        
                       if (helper[0] === this.currentItem[0]) {
                           this._storedCSS = {
                               width: this.currentItem[0].style.width,
                               height: this.currentItem[0].style.height,
                               position: this.currentItem.css("position"),
                               top: this.currentItem.css("top"),
                               left: this.currentItem.css("left")
                           };
                       }
        
                       if (!helper[0].style.width || o.forceHelperSize) {
                           helper.width(this.currentItem.width());
                       }
                       if (!helper[0].style.height || o.forceHelperSize) {
                           helper.height(this.currentItem.height());
                       }
        
                       return helper;
        
                   },
        
                   _adjustOffsetFromHelper: function (obj) {
                       if (typeof obj === "string") {
                           obj = obj.split(" ");
                       }
                       if ($.isArray(obj)) {
                           obj = {
                               left: +obj[0],
                               top: +obj[1] || 0
                           };
                       }
                       if ("left" in obj) {
                           this.offset.click.left = obj.left + this.margins.left;
                       }
                       if ("right" in obj) {
                           this.offset.click.left = this.helperProportions.width - obj.right + this.margins
                               .left;
                       }
                       if ("top" in obj) {
                           this.offset.click.top = obj.top + this.margins.top;
                       }
                       if ("bottom" in obj) {
                           this.offset.click.top = this.helperProportions.height - obj.bottom + this
                               .margins.top;
                       }
                   },
        
                   _getParentOffset: function () {
        
                       //Get the offsetParent and cache its position
                       this.offsetParent = this.helper.offsetParent();
                       var po = this.offsetParent.offset();
        
                       // This is a special case where we need to modify a offset calculated on start, since the
                       // following happened:
                       // 1. The position of the helper is absolute, so it's position is calculated based on the
                       // next positioned parent
                       // 2. The actual offset parent is a child of the scroll parent, and the scroll parent isn't
                       // the document, which means that the scroll is included in the initial calculation of the
                       // offset of the parent, and never recalculated upon drag
                       if (this.cssPosition === "absolute" && this.scrollParent[0] !== this.document[0] &&
                           $.contains(this.scrollParent[0], this.offsetParent[0])) {
                           po.left += this.scrollParent.scrollLeft();
                           po.top += this.scrollParent.scrollTop();
                       }
        
                       // This needs to be actually done for all browsers, since pageX/pageY includes this
                       // information with an ugly IE fix
                       if (this.offsetParent[0] === this.document[0].body ||
                           (this.offsetParent[0].tagName &&
                               this.offsetParent[0].tagName.toLowerCase() === "html" && $.ui.ie)) {
                           po = {
                               top: 0,
                               left: 0
                           };
                       }
        
                       return {
                           top: po.top + (parseInt(this.offsetParent.css("borderTopWidth"), 10) || 0),
                           left: po.left + (parseInt(this.offsetParent.css("borderLeftWidth"), 10) || 0)
                       };
        
                   },
        
                   _getRelativeOffset: function () {
        
                       if (this.cssPosition === "relative") {
                           var p = this.currentItem.position();
                           return {
                               top: p.top - (parseInt(this.helper.css("top"), 10) || 0) +
                                   this.scrollParent.scrollTop(),
                               left: p.left - (parseInt(this.helper.css("left"), 10) || 0) +
                                   this.scrollParent.scrollLeft()
                           };
                       } else {
                           return {
                               top: 0,
                               left: 0
                           };
                       }
        
                   },
        
                   _cacheMargins: function () {
                       this.margins = {
                           left: (parseInt(this.currentItem.css("marginLeft"), 10) || 0),
                           top: (parseInt(this.currentItem.css("marginTop"), 10) || 0)
                       };
                   },
        
                   _cacheHelperProportions: function () {
                       this.helperProportions = {
                           width: this.helper.outerWidth(),
                           height: this.helper.outerHeight()
                       };
                   },
        
                   _setContainment: function () {
        
                       var ce, co, over,
                           o = this.options;
                       if (o.containment === "parent") {
                           o.containment = this.helper[0].parentNode;
                       }
                       if (o.containment === "document" || o.containment === "window") {
                           this.containment = [
                               0 - this.offset.relative.left - this.offset.parent.left,
                               0 - this.offset.relative.top - this.offset.parent.top,
                               o.containment === "document" ?
                               this.document.width() :
                               this.window.width() - this.helperProportions.width - this.margins.left,
                               (o.containment === "document" ?
                                   (this.document.height() || document.body.parentNode.scrollHeight) :
                                   this.window.height() || this.document[0].body.parentNode
                                   .scrollHeight
                               ) - this.helperProportions.height - this.margins.top
                           ];
                       }
        
                       if (!(/^(document|window|parent)$/).test(o.containment)) {
                           ce = $(o.containment)[0];
                           co = $(o.containment).offset();
                           over = ($(ce).css("overflow") !== "hidden");
        
                           this.containment = [
                               co.left + (parseInt($(ce).css("borderLeftWidth"), 10) || 0) +
                               (parseInt($(ce).css("paddingLeft"), 10) || 0) - this.margins.left,
                               co.top + (parseInt($(ce).css("borderTopWidth"), 10) || 0) +
                               (parseInt($(ce).css("paddingTop"), 10) || 0) - this.margins.top,
                               co.left + (over ? Math.max(ce.scrollWidth, ce.offsetWidth) : ce
                                   .offsetWidth) -
                               (parseInt($(ce).css("borderLeftWidth"), 10) || 0) -
                               (parseInt($(ce).css("paddingRight"), 10) || 0) -
                               this.helperProportions.width - this.margins.left,
                               co.top + (over ? Math.max(ce.scrollHeight, ce.offsetHeight) : ce
                                   .offsetHeight) -
                               (parseInt($(ce).css("borderTopWidth"), 10) || 0) -
                               (parseInt($(ce).css("paddingBottom"), 10) || 0) -
                               this.helperProportions.height - this.margins.top
                           ];
                       }
        
                   },
        
                   _convertPositionTo: function (d, pos) {
        
                       if (!pos) {
                           pos = this.position;
                       }
                       var mod = d === "absolute" ? 1 : -1,
                           scroll = this.cssPosition === "absolute" &&
                           !(this.scrollParent[0] !== this.document[0] &&
                               $.contains(this.scrollParent[0], this.offsetParent[0])) ?
                           this.offsetParent :
                           this.scrollParent,
                           scrollIsRootNode = (/(html|body)/i).test(scroll[0].tagName);
        
                       return {
                           top: (
        
                               // The absolute mouse position
                               pos.top +
        
                               // Only for relative positioned nodes: Relative offset from element to offset parent
                               this.offset.relative.top * mod +
        
                               // The offsetParent's offset without borders (offset + border)
                               this.offset.parent.top * mod -
                               ((this.cssPosition === "fixed" ?
                                   -this.scrollParent.scrollTop() :
                                   (scrollIsRootNode ? 0 : scroll.scrollTop())) * mod)
                           ),
                           left: (
        
                               // The absolute mouse position
                               pos.left +
        
                               // Only for relative positioned nodes: Relative offset from element to offset parent
                               this.offset.relative.left * mod +
        
                               // The offsetParent's offset without borders (offset + border)
                               this.offset.parent.left * mod -
                               ((this.cssPosition === "fixed" ?
                                   -this.scrollParent.scrollLeft() : scrollIsRootNode ? 0 :
                                   scroll.scrollLeft()) * mod)
                           )
                       };
        
                   },
        
                   _generatePosition: function (event) {
        
                       var top, left,
                           o = this.options,
                           pageX = event.pageX,
                           pageY = event.pageY,
                           scroll = this.cssPosition === "absolute" &&
                           !(this.scrollParent[0] !== this.document[0] &&
                               $.contains(this.scrollParent[0], this.offsetParent[0])) ?
                           this.offsetParent :
                           this.scrollParent,
                           scrollIsRootNode = (/(html|body)/i).test(scroll[0].tagName);
        
                       // This is another very weird special case that only happens for relative elements:
                       // 1. If the css position is relative
                       // 2. and the scroll parent is the document or similar to the offset parent
                       // we have to refresh the relative offset during the scroll so there are no jumps
                       if (this.cssPosition === "relative" && !(this.scrollParent[0] !== this.document[
                                   0] &&
                               this.scrollParent[0] !== this.offsetParent[0])) {
                           this.offset.relative = this._getRelativeOffset();
                       }
        
                       /*
                        * - Position constraining -
                        * Constrain the position to a mix of grid, containment.
                        */
        
                       if (this
                           .originalPosition) { //If we are not dragging yet, we won't check for options
        
                           if (this.containment) {
                               if (event.pageX - this.offset.click.left < this.containment[0]) {
                                   pageX = this.containment[0] + this.offset.click.left;
                               }
                               if (event.pageY - this.offset.click.top < this.containment[1]) {
                                   pageY = this.containment[1] + this.offset.click.top;
                               }
                               if (event.pageX - this.offset.click.left > this.containment[2]) {
                                   pageX = this.containment[2] + this.offset.click.left;
                               }
                               if (event.pageY - this.offset.click.top > this.containment[3]) {
                                   pageY = this.containment[3] + this.offset.click.top;
                               }
                           }
        
                           if (o.grid) {
                               top = this.originalPageY + Math.round((pageY - this.originalPageY) /
                                   o.grid[1]) * o.grid[1];
                               pageY = this.containment ?
                                   ((top - this.offset.click.top >= this.containment[1] &&
                                           top - this.offset.click.top <= this.containment[3]) ?
                                       top :
                                       ((top - this.offset.click.top >= this.containment[1]) ?
                                           top - o.grid[1] : top + o.grid[1])) :
                                   top;
        
                               left = this.originalPageX + Math.round((pageX - this.originalPageX) /
                                   o.grid[0]) * o.grid[0];
                               pageX = this.containment ?
                                   ((left - this.offset.click.left >= this.containment[0] &&
                                           left - this.offset.click.left <= this.containment[2]) ?
                                       left :
                                       ((left - this.offset.click.left >= this.containment[0]) ?
                                           left - o.grid[0] : left + o.grid[0])) :
                                   left;
                           }
        
                       }
        
                       return {
                           top: (
        
                               // The absolute mouse position
                               pageY -
        
                               // Click offset (relative to the element)
                               this.offset.click.top -
        
                               // Only for relative positioned nodes: Relative offset from element to offset parent
                               this.offset.relative.top -
        
                               // The offsetParent's offset without borders (offset + border)
                               this.offset.parent.top +
                               ((this.cssPosition === "fixed" ?
                                   -this.scrollParent.scrollTop() :
                                   (scrollIsRootNode ? 0 : scroll.scrollTop())))
                           ),
                           left: (
        
                               // The absolute mouse position
                               pageX -
        
                               // Click offset (relative to the element)
                               this.offset.click.left -
        
                               // Only for relative positioned nodes: Relative offset from element to offset parent
                               this.offset.relative.left -
        
                               // The offsetParent's offset without borders (offset + border)
                               this.offset.parent.left +
                               ((this.cssPosition === "fixed" ?
                                   -this.scrollParent.scrollLeft() :
                                   scrollIsRootNode ? 0 : scroll.scrollLeft()))
                           )
                       };
        
                   },
        
                   _rearrange: function (event, i, a, hardRefresh) {
        
                       a ? a[0].appendChild(this.placeholder[0]) :
                           i.item[0].parentNode.insertBefore(this.placeholder[0],
                               (this.direction === "down" ? i.item[0] : i.item[0].nextSibling));
        
                       //Various things done here to improve the performance:
                       // 1. we create a setTimeout, that calls refreshPositions
                       // 2. on the instance, we have a counter variable, that get's higher after every append
                       // 3. on the local scope, we copy the counter variable, and check in the timeout,
                       // if it's still the same
                       // 4. this lets only the last addition to the timeout stack through
                       this.counter = this.counter ? ++this.counter : 1;
                       var counter = this.counter;
        
                       this._delay(function () {
                           if (counter === this.counter) {
        
                               //Precompute after each DOM insertion, NOT on mousemove
                               this.refreshPositions(!hardRefresh);
                           }
                       });
        
                   },
        
                   _clear: function (event, noPropagation) {
        
                       this.reverting = false;
        
                       // We delay all events that have to be triggered to after the point where the placeholder
                       // has been removed and everything else normalized again
                       var i,
                           delayedTriggers = [];
        
                       // We first have to update the dom position of the actual currentItem
                       // Note: don't do it if the current item is already removed (by a user), or it gets
                       // reappended (see #4088)
                       if (!this._noFinalSort && this.currentItem.parent().length) {
                           this.placeholder.before(this.currentItem);
                       }
                       this._noFinalSort = null;
        
                       if (this.helper[0] === this.currentItem[0]) {
                           for (i in this._storedCSS) {
                               if (this._storedCSS[i] === "auto" || this._storedCSS[i] === "static") {
                                   this._storedCSS[i] = "";
                               }
                           }
                           this.currentItem.css(this._storedCSS);
                           this._removeClass(this.currentItem, "ui-sortable-helper");
                       } else {
                           this.currentItem.show();
                       }
        
                       if (this.fromOutside && !noPropagation) {
                           delayedTriggers.push(function (event) {
                               this._trigger("receive", event, this._uiHash(this.fromOutside));
                           });
                       }
                       if ((this.fromOutside ||
                               this.domPosition.prev !==
                               this.currentItem.prev().not(".ui-sortable-helper")[0] ||
                               this.domPosition.parent !== this.currentItem.parent()[0]) && !
                           noPropagation) {
        
                           // Trigger update callback if the DOM position has changed
                           delayedTriggers.push(function (event) {
                               this._trigger("update", event, this._uiHash());
                           });
                       }
        
                       // Check if the items Container has Changed and trigger appropriate
                       // events.
                       if (this !== this.currentContainer) {
                           if (!noPropagation) {
                               delayedTriggers.push(function (event) {
                                   this._trigger("remove", event, this._uiHash());
                               });
                               delayedTriggers.push((function (c) {
                                   return function (event) {
                                       c._trigger("receive", event, this._uiHash(this));
                                   };
                               }).call(this, this.currentContainer));
                               delayedTriggers.push((function (c) {
                                   return function (event) {
                                       c._trigger("update", event, this._uiHash(this));
                                   };
                               }).call(this, this.currentContainer));
                           }
                       }
        
                       //Post events to containers
                       function delayEvent(type, instance, container) {
                           return function (event) {
                               container._trigger(type, event, instance._uiHash(instance));
                           };
                       }
                       for (i = this.containers.length - 1; i >= 0; i--) {
                           if (!noPropagation) {
                               delayedTriggers.push(delayEvent("deactivate", this, this.containers[i]));
                           }
                           if (this.containers[i].containerCache.over) {
                               delayedTriggers.push(delayEvent("out", this, this.containers[i]));
                               this.containers[i].containerCache.over = 0;
                           }
                       }
        
                       //Do what was originally in plugins
                       if (this.storedCursor) {
                           this.document.find("body").css("cursor", this.storedCursor);
                           this.storedStylesheet.remove();
                       }
                       if (this._storedOpacity) {
                           this.helper.css("opacity", this._storedOpacity);
                       }
                       if (this._storedZIndex) {
                           this.helper.css("zIndex", this._storedZIndex === "auto" ? "" : this
                               ._storedZIndex);
                       }
        
                       this.dragging = false;
        
                       if (!noPropagation) {
                           this._trigger("beforeStop", event, this._uiHash());
                       }
        
                       //$(this.placeholder[0]).remove(); would have been the jQuery way - unfortunately,
                       // it unbinds ALL events from the original node!
                       this.placeholder[0].parentNode.removeChild(this.placeholder[0]);
        
                       if (!this.cancelHelperRemoval) {
                           if (this.helper[0] !== this.currentItem[0]) {
                               this.helper.remove();
                           }
                           this.helper = null;
                       }
        
                       if (!noPropagation) {
                           for (i = 0; i < delayedTriggers.length; i++) {
        
                               // Trigger all delayed events
                               delayedTriggers[i].call(this, event);
                           }
                           this._trigger("stop", event, this._uiHash());
                       }
        
                       this.fromOutside = false;
                       return !this.cancelHelperRemoval;
        
                   },
        
                   _trigger: function () {
                       if ($.Widget.prototype._trigger.apply(this, arguments) === false) {
                           this.cancel();
                       }
                   },
        
                   _uiHash: function (_inst) {
                       var inst = _inst || this;
                       return {
                           helper: inst.helper,
                           placeholder: inst.placeholder || $([]),
                           position: inst.position,
                           originalPosition: inst.originalPosition,
                           offset: inst.positionAbs,
                           item: inst.currentItem,
                           sender: _inst ? _inst.element : null
                       };
                   }
        
               });
        


               /*!
                * jQuery UI Spinner 1.12.1
                * http://jqueryui.com
                *
                * Copyright jQuery Foundation and other contributors
                * Released under the MIT license.
                * http://jquery.org/license
                */
        
               //>>label: Spinner
               //>>group: Widgets
               //>>description: Displays buttons to easily input numbers via the keyboard or mouse.
               //>>docs: http://api.jqueryui.com/spinner/
               //>>demos: http://jqueryui.com/spinner/
               //>>css.structure: ../../themes/base/core.css
               //>>css.structure: ../../themes/base/spinner.css
               //>>css.theme: ../../themes/base/theme.css
        


               function spinnerModifer(fn) {
                   return function () {
                       var previous = this.element.val();
                       fn.apply(this, arguments);
                       this._refresh();
                       if (previous !== this.element.val()) {
                           this._trigger("change");
                       }
                   };
               }
        
               $.widget("ui.spinner", {
                   version: "1.12.1",
                   defaultElement: "<input>",
                   widgetEventPrefix: "spin",
                   options: {
                       classes: {
                           "ui-spinner": "ui-corner-all",
                           "ui-spinner-down": "ui-corner-br",
                           "ui-spinner-up": "ui-corner-tr"
                       },
                       culture: null,
                       icons: {
                           down: "ui-icon-triangle-1-s",
                           up: "ui-icon-triangle-1-n"
                       },
                       incremental: true,
                       max: null,
                       min: null,
                       numberFormat: null,
                       page: 10,
                       step: 1,
        
                       change: null,
                       spin: null,
                       start: null,
                       stop: null
                   },
        
                   _create: function () {
        
                       // handle string values that need to be parsed
                       this._setOption("max", this.options.max);
                       this._setOption("min", this.options.min);
                       this._setOption("step", this.options.step);
        
                       // Only format if there is a value, prevents the field from being marked
                       // as invalid in Firefox, see #9573.
                       if (this.value() !== "") {
        
                           // Format the value, but don't constrain.
                           this._value(this.element.val(), true);
                       }
        
                       this._draw();
                       this._on(this._events);
                       this._refresh();
        
                       // Turning off autocomplete prevents the browser from remembering the
                       // value when navigating through history, so we re-enable autocomplete
                       // if the page is unloaded before the widget is destroyed. #7790
                       this._on(this.window, {
                           beforeunload: function () {
                               this.element.removeAttr("autocomplete");
                           }
                       });
                   },
        
                   _getCreateOptions: function () {
                       var options = this._super();
                       var element = this.element;
        
                       $.each(["min", "max", "step"], function (i, option) {
                           var value = element.attr(option);
                           if (value != null && value.length) {
                               options[option] = value;
                           }
                       });
        
                       return options;
                   },
        
                   _events: {
                       keydown: function (event) {
                           if (this._start(event) && this._keydown(event)) {
                               event.preventDefault();
                           }
                       },
                       keyup: "_stop",
                       focus: function () {
                           this.previous = this.element.val();
                       },
                       blur: function (event) {
                           if (this.cancelBlur) {
                               delete this.cancelBlur;
                               return;
                           }
        
                           this._stop();
                           this._refresh();
                           if (this.previous !== this.element.val()) {
                               this._trigger("change", event);
                           }
                       },
                       mousewheel: function (event, delta) {
                           if (!delta) {
                               return;
                           }
                           if (!this.spinning && !this._start(event)) {
                               return false;
                           }
        
                           this._spin((delta > 0 ? 1 : -1) * this.options.step, event);
                           clearTimeout(this.mousewheelTimer);
                           this.mousewheelTimer = this._delay(function () {
                               if (this.spinning) {
                                   this._stop(event);
                               }
                           }, 100);
                           event.preventDefault();
                       },
                       "mousedown .ui-spinner-button": function (event) {
                           var previous;
        
                           // We never want the buttons to have focus; whenever the user is
                           // interacting with the spinner, the focus should be on the input.
                           // If the input is focused then this.previous is properly set from
                           // when the input first received focus. If the input is not focused
                           // then we need to set this.previous based on the value before spinning.
                           previous = this.element[0] === $.ui.safeActiveElement(this.document[0]) ?
                               this.previous : this.element.val();
        
                           function checkFocus() {
                               var isActive = this.element[0] === $.ui.safeActiveElement(this.document[0]);
                               if (!isActive) {
                                   this.element.trigger("focus");
                                   this.previous = previous;
        
                                   // support: IE
                                   // IE sets focus asynchronously, so we need to check if focus
                                   // moved off of the input because the user clicked on the button.
                                   this._delay(function () {
                                       this.previous = previous;
                                   });
                               }
                           }
        
                           // Ensure focus is on (or stays on) the text field
                           event.preventDefault();
                           checkFocus.call(this);
        
                           // Support: IE
                           // IE doesn't prevent moving focus even with event.preventDefault()
                           // so we set a flag to know when we should ignore the blur event
                           // and check (again) if focus moved off of the input.
                           this.cancelBlur = true;
                           this._delay(function () {
                               delete this.cancelBlur;
                               checkFocus.call(this);
                           });
        
                           if (this._start(event) === false) {
                               return;
                           }
        
                           this._repeat(null, $(event.currentTarget)
                               .hasClass("ui-spinner-up") ? 1 : -1, event);
                       },
                       "mouseup .ui-spinner-button": "_stop",
                       "mouseenter .ui-spinner-button": function (event) {
        
                           // button will add ui-state-active if mouse was down while mouseleave and kept down
                           if (!$(event.currentTarget).hasClass("ui-state-active")) {
                               return;
                           }
        
                           if (this._start(event) === false) {
                               return false;
                           }
                           this._repeat(null, $(event.currentTarget)
                               .hasClass("ui-spinner-up") ? 1 : -1, event);
                       },
        
                       // TODO: do we really want to consider this a stop?
                       // shouldn't we just stop the repeater and wait until mouseup before
                       // we trigger the stop event?
                       "mouseleave .ui-spinner-button": "_stop"
                   },
        
                   // Support mobile enhanced option and make backcompat more sane
                   _enhance: function () {
                       this.uiSpinner = this.element
                           .attr("autocomplete", "off")
                           .wrap("")
                           .parent()
        
                           // Add buttons
                           .append(
                               "<a></a><a></a>"
                           );
                   },
        
                   _draw: function () {
                       this._enhance();
        
                       this._addClass(this.uiSpinner, "ui-spinner", "ui-widget ui-widget-content");
                       this._addClass("ui-spinner-input");
        
                       this.element.attr("role", "spinbutton");
        
                       // Button bindings
                       this.buttons = this.uiSpinner.children("a")
                           .attr("tabIndex", -1)
                           .attr("aria-hidden", true)
                           .button({
                               classes: {
                                   "ui-button": ""
                               }
                           });
        
                       // TODO: Right now button does not support classes this is already updated in button PR
                       this._removeClass(this.buttons, "ui-corner-all");
        
                       this._addClass(this.buttons.first(), "ui-spinner-button ui-spinner-up");
                       this._addClass(this.buttons.last(), "ui-spinner-button ui-spinner-down");
                       this.buttons.first().button({
                           "icon": this.options.icons.up,
                           "showLabel": false
                       });
                       this.buttons.last().button({
                           "icon": this.options.icons.down,
                           "showLabel": false
                       });
        
                       // IE 6 doesn't understand height: 50% for the buttons
                       // unless the wrapper has an explicit height
                       if (this.buttons.height() > Math.ceil(this.uiSpinner.height() * 0.5) &&
                           this.uiSpinner.height() > 0) {
                           this.uiSpinner.height(this.uiSpinner.height());
                       }
                   },
        
                   _keydown: function (event) {
                       var options = this.options,
                           keyCode = $.ui.keyCode;
        
                       switch (event.keyCode) {
                           case keyCode.UP:
                               this._repeat(null, 1, event);
                               return true;
                           case keyCode.DOWN:
                               this._repeat(null, -1, event);
                               return true;
                           case keyCode.PAGE_UP:
                               this._repeat(null, options.page, event);
                               return true;
                           case keyCode.PAGE_DOWN:
                               this._repeat(null, -options.page, event);
                               return true;
                       }
        
                       return false;
                   },
        
                   _start: function (event) {
                       if (!this.spinning && this._trigger("start", event) === false) {
                           return false;
                       }
        
                       if (!this.counter) {
                           this.counter = 1;
                       }
                       this.spinning = true;
                       return true;
                   },
        
                   _repeat: function (i, steps, event) {
                       i = i || 500;
        
                       clearTimeout(this.timer);
                       this.timer = this._delay(function () {
                           this._repeat(40, steps, event);
                       }, i);
        
                       this._spin(steps * this.options.step, event);
                   },
        
                   _spin: function (step, event) {
                       var value = this.value() || 0;
        
                       if (!this.counter) {
                           this.counter = 1;
                       }
        
                       value = this._adjustValue(value + step * this._increment(this.counter));
        
                       if (!this.spinning || this._trigger("spin", event, {
                               value: value
                           }) !== false) {
                           this._value(value);
                           this.counter++;
                       }
                   },
        
                   _increment: function (i) {
                       var incremental = this.options.incremental;
        
                       if (incremental) {
                           return $.isFunction(incremental) ?
                               incremental(i) :
                               Math.floor(i * i * i / 50000 - i * i / 500 + 17 * i / 200 + 1);
                       }
        
                       return 1;
                   },
        
                   _precision: function () {
                       var precision = this._precisionOf(this.options.step);
                       if (this.options.min !== null) {
                           precision = Math.max(precision, this._precisionOf(this.options.min));
                       }
                       return precision;
                   },
        
                   _precisionOf: function (num) {
                       var str = num.toString(),
                           decimal = str.indexOf(".");
                       return decimal === -1 ? 0 : str.length - decimal - 1;
                   },
        
                   _adjustValue: function (value) {
                       var base, aboveMin,
                           options = this.options;
        
                       // Make sure we're at a valid step
                       // - find out where we are relative to the base (min or 0)
                       base = options.min !== null ? options.min : 0;
                       aboveMin = value - base;
        
                       // - round to the nearest step
                       aboveMin = Math.round(aboveMin / options.step) * options.step;
        
                       // - rounding is based on 0, so adjust back to our base
                       value = base + aboveMin;
        
                       // Fix precision from bad JS floating point math
                       value = parseFloat(value.toFixed(this._precision()));
        
                       // Clamp the value
                       if (options.max !== null && value > options.max) {
                           return options.max;
                       }
                       if (options.min !== null && value < options.min) {
                           return options.min;
                       }
        
                       return value;
                   },
        
                   _stop: function (event) {
                       if (!this.spinning) {
                           return;
                       }
        
                       clearTimeout(this.timer);
                       clearTimeout(this.mousewheelTimer);
                       this.counter = 0;
                       this.spinning = false;
                       this._trigger("stop", event);
                   },
        
                   _setOption: function (key, value) {
                       var prevValue, first, last;
        
                       if (key === "culture" || key === "numberFormat") {
                           prevValue = this._parse(this.element.val());
                           this.options[key] = value;
                           this.element.val(this._format(prevValue));
                           return;
                       }
        
                       if (key === "max" || key === "min" || key === "step") {
                           if (typeof value === "string") {
                               value = this._parse(value);
                           }
                       }
                       if (key === "icons") {
                           first = this.buttons.first().find(".ui-icon");
                           this._removeClass(first, null, this.options.icons.up);
                           this._addClass(first, null, value.up);
                           last = this.buttons.last().find(".ui-icon");
                           this._removeClass(last, null, this.options.icons.down);
                           this._addClass(last, null, value.down);
                       }
        
                       this._super(key, value);
                   },
        
                   _setOptionDisabled: function (value) {
                       this._super(value);
        
                       this._toggleClass(this.uiSpinner, null, "ui-state-disabled", !!value);
                       this.element.prop("disabled", !!value);
                       this.buttons.button(value ? "disable" : "enable");
                   },
        
                   _setOptions: spinnerModifer(function (options) {
                       this._super(options);
                   }),
        
                   _parse: function (val) {
                       if (typeof val === "string" && val !== "") {
                           val = window.Globalize && this.options.numberFormat ?
                               Globalize.parseFloat(val, 10, this.options.culture) : +val;
                       }
                       return val === "" || isNaN(val) ? null : val;
                   },
        
                   _format: function (value) {
                       if (value === "") {
                           return "";
                       }
                       return window.Globalize && this.options.numberFormat ?
                           Globalize.format(value, this.options.numberFormat, this.options.culture) :
                           value;
                   },
        
                   _refresh: function () {
                       this.element.attr({
                           "aria-valuemin": this.options.min,
                           "aria-valuemax": this.options.max,
        
                           // TODO: what should we do with values that can't be parsed?
                           "aria-valuenow": this._parse(this.element.val())
                       });
                   },
        
                   isValid: function () {
                       var value = this.value();
        
                       // Null is invalid
                       if (value === null) {
                           return false;
                       }
        
                       // If value gets adjusted, it's invalid
                       return value === this._adjustValue(value);
                   },
        
                   // Update the value without triggering change
                   _value: function (value, allowAny) {
                       var parsed;
                       if (value !== "") {
                           parsed = this._parse(value);
                           if (parsed !== null) {
                               if (!allowAny) {
                                   parsed = this._adjustValue(parsed);
                               }
                               value = this._format(parsed);
                           }
                       }
                       this.element.val(value);
                       this._refresh();
                   },
        
                   _destroy: function () {
                       this.element
                           .prop("disabled", false)
                           .removeAttr("autocomplete role aria-valuemin aria-valuemax aria-valuenow");
        
                       this.uiSpinner.replaceWith(this.element);
                   },
        
                   stepUp: spinnerModifer(function (steps) {
                       this._stepUp(steps);
                   }),
                   _stepUp: function (steps) {
                       if (this._start()) {
                           this._spin((steps || 1) * this.options.step);
                           this._stop();
                       }
                   },
        
                   stepDown: spinnerModifer(function (steps) {
                       this._stepDown(steps);
                   }),
                   _stepDown: function (steps) {
                       if (this._start()) {
                           this._spin((steps || 1) * -this.options.step);
                           this._stop();
                       }
                   },
        
                   pageUp: spinnerModifer(function (pages) {
                       this._stepUp((pages || 1) * this.options.page);
                   }),
        
                   pageDown: spinnerModifer(function (pages) {
                       this._stepDown((pages || 1) * this.options.page);
                   }),
        
                   value: function (newVal) {
                       if (!arguments.length) {
                           return this._parse(this.element.val());
                       }
                       spinnerModifer(this._value).call(this, newVal);
                   },
        
                   widget: function () {
                       return this.uiSpinner;
                   }
               });
        
               // DEPRECATED
               // TODO: switch return back to widget declaration at top of file when this is removed
               if ($.uiBackCompat !== false) {
        
                   // Backcompat for spinner html extension points
                   $.widget("ui.spinner", $.ui.spinner, {
                       _enhance: function () {
                           this.uiSpinner = this.element
                               .attr("autocomplete", "off")
                               .wrap(this._uiSpinnerHtml())
                               .parent()
        
                               // Add buttons
                               .append(this._buttonHtml());
                       },
                       _uiSpinnerHtml: function () {
                           return "";
                       },
        
                       _buttonHtml: function () {
                           return "<a></a><a></a>";
                       }
                   });
               }
        
               var widgetsSpinner = $.ui.spinner;
        


               /*!
                * jQuery UI Tabs 1.12.1
                * http://jqueryui.com
                *
                * Copyright jQuery Foundation and other contributors
                * Released under the MIT license.
                * http://jquery.org/license
                */
        
               //>>label: Tabs
               //>>group: Widgets
               //>>description: Transforms a set of container elements into a tab structure.
               //>>docs: http://api.jqueryui.com/tabs/
               //>>demos: http://jqueryui.com/tabs/
               //>>css.structure: ../../themes/base/core.css
               //>>css.structure: ../../themes/base/tabs.css
               //>>css.theme: ../../themes/base/theme.css
        


               $.widget("ui.tabs", {
                   version: "1.12.1",
                   delay: 300,
                   options: {
                       active: null,
                       classes: {
                           "ui-tabs": "ui-corner-all",
                           "ui-tabs-nav": "ui-corner-all",
                           "ui-tabs-panel": "ui-corner-bottom",
                           "ui-tabs-tab": "ui-corner-top"
                       },
                       collapsible: false,
                       event: "click",
                       heightStyle: "content",
                       hide: null,
                       show: null,
        
                       // Callbacks
                       activate: null,
                       beforeActivate: null,
                       beforeLoad: null,
                       load: null
                   },
        
                   _isLocal: (function () {
                       var rhash = /#.*$/;
        
                       return function (anchor) {
                           var anchorUrl, locationUrl;
        
                           anchorUrl = anchor.href.replace(rhash, "");
                           locationUrl = location.href.replace(rhash, "");
        
                           // Decoding may throw an error if the URL isn't UTF-8 (#9518)
                           try {
                               anchorUrl = decodeURIComponent(anchorUrl);
                           } catch (error) {}
                           try {
                               locationUrl = decodeURIComponent(locationUrl);
                           } catch (error) {}
        
                           return anchor.hash.length > 1 && anchorUrl === locationUrl;
                       };
                   })(),
        
                   _create: function () {
                       var that = this,
                           options = this.options;
        
                       this.running = false;
        
                       this._addClass("ui-tabs", "ui-widget ui-widget-content");
                       this._toggleClass("ui-tabs-collapsible", null, options.collapsible);
        
                       this._processTabs();
                       options.active = this._initialActive();
        
                       // Take disabling tabs via class attribute from HTML
                       // into account and update option properly.
                       if ($.isArray(options.disabled)) {
                           options.disabled = $.unique(options.disabled.concat(
                               $.map(this.tabs.filter(".ui-state-disabled"), function (li) {
                                   return that.tabs.index(li);
                               })
                           )).sort();
                       }
        
                       // Check for length avoids error when initializing empty list
                       if (this.options.active !== false && this.anchors.length) {
                           this.active = this._findActive(options.active);
                       } else {
                           this.active = $();
                       }
        
                       this._refresh();
        
                       if (this.active.length) {
                           this.load(options.active);
                       }
                   },
        
                   _initialActive: function () {
                       var active = this.options.active,
                           collapsible = this.options.collapsible,
                           locationHash = location.hash.substring(1);
        
                       if (active === null) {
        
                           // check the fragment identifier in the URL
                           if (locationHash) {
                               this.tabs.each(function (i, tab) {
                                   if ($(tab).attr("aria-controls") === locationHash) {
                                       active = i;
                                       return false;
                                   }
                               });
                           }
        
                           // Check for a tab marked active via a class
                           if (active === null) {
                               active = this.tabs.index(this.tabs.filter(".ui-tabs-active"));
                           }
        
                           // No active tab, set to false
                           if (active === null || active === -1) {
                               active = this.tabs.length ? 0 : false;
                           }
                       }
        
                       // Handle numbers: negative, out of range
                       if (active !== false) {
                           active = this.tabs.index(this.tabs.eq(active));
                           if (active === -1) {
                               active = collapsible ? false : 0;
                           }
                       }
        
                       // Don't allow collapsible: false and active: false
                       if (!collapsible && active === false && this.anchors.length) {
                           active = 0;
                       }
        
                       return active;
                   },
        
                   _getCreateEventData: function () {
                       return {
                           tab: this.active,
                           panel: !this.active.length ? $() : this._getPanelForTab(this.active)
                       };
                   },
        
                   _tabKeydown: function (event) {
                       var focusedTab = $($.ui.safeActiveElement(this.document[0])).closest("li"),
                           selectedIndex = this.tabs.index(focusedTab),
                           goingForward = true;
        
                       if (this._handlePageNav(event)) {
                           return;
                       }
        
                       switch (event.keyCode) {
                           case $.ui.keyCode.RIGHT:
                           case $.ui.keyCode.DOWN:
                               selectedIndex++;
                               break;
                           case $.ui.keyCode.UP:
                           case $.ui.keyCode.LEFT:
                               goingForward = false;
                               selectedIndex--;
                               break;
                           case $.ui.keyCode.END:
                               selectedIndex = this.anchors.length - 1;
                               break;
                           case $.ui.keyCode.HOME:
                               selectedIndex = 0;
                               break;
                           case $.ui.keyCode.SPACE:
        
                               // Activate only, no collapsing
                               event.preventDefault();
                               clearTimeout(this.activating);
                               this._activate(selectedIndex);
                               return;
                           case $.ui.keyCode.ENTER:
        
                               // Toggle (cancel delayed activation, allow collapsing)
                               event.preventDefault();
                               clearTimeout(this.activating);
        
                               // Determine if we should collapse or activate
                               this._activate(selectedIndex === this.options.active ? false :
                                   selectedIndex);
                               return;
                           default:
                               return;
                       }
        
                       // Focus the appropriate tab, based on which key was pressed
                       event.preventDefault();
                       clearTimeout(this.activating);
                       selectedIndex = this._focusNextTab(selectedIndex, goingForward);
        
                       // Navigating with control/command key will prevent automatic activation
                       if (!event.ctrlKey && !event.metaKey) {
        
                           // Update aria-selected immediately so that AT think the tab is already selected.
                           // Otherwise AT may confuse the user by stating that they need to activate the tab,
                           // but the tab will already be activated by the time the announcement finishes.
                           focusedTab.attr("aria-selected", "false");
                           this.tabs.eq(selectedIndex).attr("aria-selected", "true");
        
                           this.activating = this._delay(function () {
                               this.option("active", selectedIndex);
                           }, this.delay);
                       }
                   },
        
                   _panelKeydown: function (event) {
                       if (this._handlePageNav(event)) {
                           return;
                       }
        
                       // Ctrl+up moves focus to the current tab
                       if (event.ctrlKey && event.keyCode === $.ui.keyCode.UP) {
                           event.preventDefault();
                           this.active.trigger("focus");
                       }
                   },
        
                   // Alt+page up/down moves focus to the previous/next tab (and activates)
                   _handlePageNav: function (event) {
                       if (event.altKey && event.keyCode === $.ui.keyCode.PAGE_UP) {
                           this._activate(this._focusNextTab(this.options.active - 1, false));
                           return true;
                       }
                       if (event.altKey && event.keyCode === $.ui.keyCode.PAGE_DOWN) {
                           this._activate(this._focusNextTab(this.options.active + 1, true));
                           return true;
                       }
                   },
        
                   _findNextTab: function (index, goingForward) {
                       var lastTabIndex = this.tabs.length - 1;
        
                       function constrain() {
                           if (index > lastTabIndex) {
                               index = 0;
                           }
                           if (index < 0) {
                               index = lastTabIndex;
                           }
                           return index;
                       }
        
                       while ($.inArray(constrain(), this.options.disabled) !== -1) {
                           index = goingForward ? index + 1 : index - 1;
                       }
        
                       return index;
                   },
        
                   _focusNextTab: function (index, goingForward) {
                       index = this._findNextTab(index, goingForward);
                       this.tabs.eq(index).trigger("focus");
                       return index;
                   },
        
                   _setOption: function (key, value) {
                       if (key === "active") {
        
                           // _activate() will handle invalid values and update this.options
                           this._activate(value);
                           return;
                       }
        
                       this._super(key, value);
        
                       if (key === "collapsible") {
                           this._toggleClass("ui-tabs-collapsible", null, value);
        
                           // Setting collapsible: false while collapsed; open first panel
                           if (!value && this.options.active === false) {
                               this._activate(0);
                           }
                       }
        
                       if (key === "event") {
                           this._setupEvents(value);
                       }
        
                       if (key === "heightStyle") {
                           this._setupHeightStyle(value);
                       }
                   },
        
                   _sanitizeSelector: function (hash) {
                       return hash ? hash.replace(/[!"$%&'()*+,.\/:;<=>?@\[\]\^`{|}~]/g, "\\$&") : "";
                   },
        
                   refresh: function () {
                       var options = this.options,
                           lis = this.tablist.children(":has(a[href])");
        
                       // Get disabled tabs from class attribute from HTML
                       // this will get converted to a boolean if needed in _refresh()
                       options.disabled = $.map(lis.filter(".ui-state-disabled"), function (tab) {
                           return lis.index(tab);
                       });
        
                       this._processTabs();
        
                       // Was collapsed or no tabs
                       if (options.active === false || !this.anchors.length) {
                           options.active = false;
                           this.active = $();
        
                           // was active, but active tab is gone
                       } else if (this.active.length && !$.contains(this.tablist[0], this.active[0])) {
        
                           // all remaining tabs are disabled
                           if (this.tabs.length === options.disabled.length) {
                               options.active = false;
                               this.active = $();
        
                               // activate previous tab
                           } else {
                               this._activate(this._findNextTab(Math.max(0, options.active - 1), false));
                           }
        
                           // was active, active tab still exists
                       } else {
        
                           // make sure active index is correct
                           options.active = this.tabs.index(this.active);
                       }
        
                       this._refresh();
                   },
        
                   _refresh: function () {
                       this._setOptionDisabled(this.options.disabled);
                       this._setupEvents(this.options.event);
                       this._setupHeightStyle(this.options.heightStyle);
        
                       this.tabs.not(this.active).attr({
                           "aria-selected": "false",
                           "aria-expanded": "false",
                           tabIndex: -1
                       });
                       this.panels.not(this._getPanelForTab(this.active))
                           .hide()
                           .attr({
                               "aria-hidden": "true"
                           });
        
                       // Make sure one tab is in the tab order
                       if (!this.active.length) {
                           this.tabs.eq(0).attr("tabIndex", 0);
                       } else {
                           this.active
                               .attr({
                                   "aria-selected": "true",
                                   "aria-expanded": "true",
                                   tabIndex: 0
                               });
                           this._addClass(this.active, "ui-tabs-active", "ui-state-active");
                           this._getPanelForTab(this.active)
                               .show()
                               .attr({
                                   "aria-hidden": "false"
                               });
                       }
                   },
        
                   _processTabs: function () {
                       var that = this,
                           prevTabs = this.tabs,
                           prevAnchors = this.anchors,
                           prevPanels = this.panels;
        
                       this.tablist = this._getList().attr("role", "tablist");
                       this._addClass(this.tablist, "ui-tabs-nav",
                           "ui-helper-reset ui-helper-clearfix ui-widget-header");
        
                       // Prevent users from focusing disabled tabs via click
                       this.tablist
                           .on("mousedown" + this.eventNamespace, "> li", function (event) {
                               if ($(this).is(".ui-state-disabled")) {
                                   event.preventDefault();
                               }
                           })
        
                           // Support: IE <9
                           // Preventing the default action in mousedown doesn't prevent IE
                           // from focusing the element, so if the anchor gets focused, blur.
                           // We don't have to worry about focusing the previously focused
                           // element since clicking on a non-focusable element should focus
                           // the body anyway.
                           .on("focus" + this.eventNamespace, ".ui-tabs-anchor", function () {
                               if ($(this).closest("li").is(".ui-state-disabled")) {
                                   this.blur();
                               }
                           });
        
                       this.tabs = this.tablist.find("> li:has(a[href])")
                           .attr({
                               role: "tab",
                               tabIndex: -1
                           });
                       this._addClass(this.tabs, "ui-tabs-tab", "ui-state-default");
        
                       this.anchors = this.tabs.map(function () {
                               return $("a", this)[0];
                           })
                           .attr({
                               role: "presentation",
                               tabIndex: -1
                           });
                       this._addClass(this.anchors, "ui-tabs-anchor");
        
                       this.panels = $();
        
                       this.anchors.each(function (i, anchor) {
                           var selector, panel, panelId,
                               anchorId = $(anchor).uniqueId().attr("id"),
                               tab = $(anchor).closest("li"),
                               originalAriaControls = tab.attr("aria-controls");
        
                           // Inline tab
                           if (that._isLocal(anchor)) {
                               selector = anchor.hash;
                               panelId = selector.substring(1);
                               panel = that.element.find(that._sanitizeSelector(selector));
        
                               // remote tab
                           } else {
        
                               // If the tab doesn't already have aria-controls,
                               // generate an id by using a throw-away element
                               panelId = tab.attr("aria-controls") || $({}).uniqueId()[0].id;
                               selector = "#" + panelId;
                               panel = that.element.find(selector);
                               if (!panel.length) {
                                   panel = that._createPanel(panelId);
                                   panel.insertAfter(that.panels[i - 1] || that.tablist);
                               }
                               panel.attr("aria-live", "polite");
                           }
        
                           if (panel.length) {
                               that.panels = that.panels.add(panel);
                           }
                           if (originalAriaControls) {
                               tab.data("ui-tabs-aria-controls", originalAriaControls);
                           }
                           tab.attr({
                               "aria-controls": panelId,
                               "aria-labelledby": anchorId
                           });
                           panel.attr("aria-labelledby", anchorId);
                       });
        
                       this.panels.attr("role", "tabpanel");
                       this._addClass(this.panels, "ui-tabs-panel", "ui-widget-content");
        
                       // Avoid memory leaks (#10056)
                       if (prevTabs) {
                           this._off(prevTabs.not(this.tabs));
                           this._off(prevAnchors.not(this.anchors));
                           this._off(prevPanels.not(this.panels));
                       }
                   },
        
                   // Allow overriding how to find the list for rare usage scenarios (#7715)
                   _getList: function () {
                       return this.tablist || this.element.find("ol, ul").eq(0);
                   },
        
                   _createPanel: function (id) {
        
        return $("
        ")
                           .attr("id", id)
                           .data("ui-tabs-destroy", true);
                   },
        
                   _setOptionDisabled: function (disabled) {
                       var currentItem, li, i;
        
                       if ($.isArray(disabled)) {
                           if (!disabled.length) {
                               disabled = false;
                           } else if (disabled.length === this.anchors.length) {
                               disabled = true;
                           }
                       }
        
                       // Disable tabs
                       for (i = 0;
                           (li = this.tabs[i]); i++) {
                           currentItem = $(li);
                           if (disabled === true || $.inArray(i, disabled) !== -1) {
                               currentItem.attr("aria-disabled", "true");
                               this._addClass(currentItem, null, "ui-state-disabled");
                           } else {
                               currentItem.removeAttr("aria-disabled");
                               this._removeClass(currentItem, null, "ui-state-disabled");
                           }
                       }
        
                       this.options.disabled = disabled;
        
                       this._toggleClass(this.widget(), this.widgetFullName + "-disabled", null,
                           disabled === true);
                   },
        
                   _setupEvents: function (event) {
                       var events = {};
                       if (event) {
                           $.each(event.split(" "), function (index, eventName) {
                               events[eventName] = "_eventHandler";
                           });
                       }
        
                       this._off(this.anchors.add(this.tabs).add(this.panels));
        
                       // Always prevent the default action, even when disabled
                       this._on(true, this.anchors, {
                           click: function (event) {
                               event.preventDefault();
                           }
                       });
                       this._on(this.anchors, events);
                       this._on(this.tabs, {
                           keydown: "_tabKeydown"
                       });
                       this._on(this.panels, {
                           keydown: "_panelKeydown"
                       });
        
                       this._focusable(this.tabs);
                       this._hoverable(this.tabs);
                   },
        
                   _setupHeightStyle: function (heightStyle) {
                       var maxHeight,
                           parent = this.element.parent();
        
                       if (heightStyle === "fill") {
                           maxHeight = parent.height();
                           maxHeight -= this.element.outerHeight() - this.element.height();
        
                           this.element.siblings(":visible").each(function () {
                               var elem = $(this),
                                   position = elem.css("position");
        
                               if (position === "absolute" || position === "fixed") {
                                   return;
                               }
                               maxHeight -= elem.outerHeight(true);
                           });
        
                           this.element.children().not(this.panels).each(function () {
                               maxHeight -= $(this).outerHeight(true);
                           });
        
                           this.panels.each(function () {
                                   $(this).height(Math.max(0, maxHeight -
                                       $(this).innerHeight() + $(this).height()));
                               })
                               .css("overflow", "auto");
                       } else if (heightStyle === "auto") {
                           maxHeight = 0;
                           this.panels.each(function () {
                               maxHeight = Math.max(maxHeight, $(this).height("").height());
                           }).height(maxHeight);
                       }
                   },
        
                   _eventHandler: function (event) {
                       var options = this.options,
                           active = this.active,
                           anchor = $(event.currentTarget),
                           tab = anchor.closest("li"),
                           clickedIsActive = tab[0] === active[0],
                           collapsing = clickedIsActive && options.collapsible,
                           toShow = collapsing ? $() : this._getPanelForTab(tab),
                           toHide = !active.length ? $() : this._getPanelForTab(active),
                           eventData = {
                               oldTab: active,
                               oldPanel: toHide,
                               newTab: collapsing ? $() : tab,
                               newPanel: toShow
                           };
        
                       event.preventDefault();
        
                       if (tab.hasClass("ui-state-disabled") ||
        
                           // tab is already loading
                           tab.hasClass("ui-tabs-loading") ||
        
                           // can't switch durning an animation
                           this.running ||
        
                           // click on active header, but not collapsible
                           (clickedIsActive && !options.collapsible) ||
        
                           // allow canceling activation
                           (this._trigger("beforeActivate", event, eventData) === false)) {
                           return;
                       }
        
                       options.active = collapsing ? false : this.tabs.index(tab);
        
                       this.active = clickedIsActive ? $() : tab;
                       if (this.xhr) {
                           this.xhr.abort();
                       }
        
                       if (!toHide.length && !toShow.length) {
                           $.error("jQuery UI Tabs: Mismatching fragment identifier.");
                       }
        
                       if (toShow.length) {
                           this.load(this.tabs.index(tab), event);
                       }
                       this._toggle(event, eventData);
                   },
        
                   // Handles show/hide for selecting tabs
                   _toggle: function (event, eventData) {
                       var that = this,
                           toShow = eventData.newPanel,
                           toHide = eventData.oldPanel;
        
                       this.running = true;
        
                       function complete() {
                           that.running = false;
                           that._trigger("activate", event, eventData);
                       }
        
                       function show() {
                           that._addClass(eventData.newTab.closest("li"), "ui-tabs-active",
                               "ui-state-active");
        
                           if (toShow.length && that.options.show) {
                               that._show(toShow, that.options.show, complete);
                           } else {
                               toShow.show();
                               complete();
                           }
                       }
        
                       // Start out by hiding, then showing, then completing
                       if (toHide.length && this.options.hide) {
                           this._hide(toHide, this.options.hide, function () {
                               that._removeClass(eventData.oldTab.closest("li"),
                                   "ui-tabs-active", "ui-state-active");
                               show();
                           });
                       } else {
                           this._removeClass(eventData.oldTab.closest("li"),
                               "ui-tabs-active", "ui-state-active");
                           toHide.hide();
                           show();
                       }
        
                       toHide.attr("aria-hidden", "true");
                       eventData.oldTab.attr({
                           "aria-selected": "false",
                           "aria-expanded": "false"
                       });
        
                       // If we're switching tabs, remove the old tab from the tab order.
                       // If we're opening from collapsed state, remove the previous tab from the tab order.
                       // If we're collapsing, then keep the collapsing tab in the tab order.
                       if (toShow.length && toHide.length) {
                           eventData.oldTab.attr("tabIndex", -1);
                       } else if (toShow.length) {
                           this.tabs.filter(function () {
                                   return $(this).attr("tabIndex") === 0;
                               })
                               .attr("tabIndex", -1);
                       }
        
                       toShow.attr("aria-hidden", "false");
                       eventData.newTab.attr({
                           "aria-selected": "true",
                           "aria-expanded": "true",
                           tabIndex: 0
                       });
                   },
        
                   _activate: function (index) {
                       var anchor,
                           active = this._findActive(index);
        
                       // Trying to activate the already active panel
                       if (active[0] === this.active[0]) {
                           return;
                       }
        
                       // Trying to collapse, simulate a click on the current active header
                       if (!active.length) {
                           active = this.active;
                       }
        
                       anchor = active.find(".ui-tabs-anchor")[0];
                       this._eventHandler({
                           target: anchor,
                           currentTarget: anchor,
                           preventDefault: $.noop
                       });
                   },
        
                   _findActive: function (index) {
                       return index === false ? $() : this.tabs.eq(index);
                   },
        
                   _getIndex: function (index) {
        
                       // meta-function to give users option to provide a href string instead of a numerical index.
                       if (typeof index === "string") {
                           index = this.anchors.index(this.anchors.filter("[href$='" +
                               $.ui.escapeSelector(index) + "']"));
                       }
        
                       return index;
                   },
        
                   _destroy: function () {
                       if (this.xhr) {
                           this.xhr.abort();
                       }
        
                       this.tablist
                           .removeAttr("role")
                           .off(this.eventNamespace);
        
                       this.anchors
                           .removeAttr("role tabIndex")
                           .removeUniqueId();
        
                       this.tabs.add(this.panels).each(function () {
                           if ($.data(this, "ui-tabs-destroy")) {
                               $(this).remove();
                           } else {
                               $(this).removeAttr("role tabIndex " +
                                   "aria-live aria-busy aria-selected aria-labelledby aria-hidden aria-expanded"
                               );
                           }
                       });
        
                       this.tabs.each(function () {
                           var li = $(this),
                               prev = li.data("ui-tabs-aria-controls");
                           if (prev) {
                               li
                                   .attr("aria-controls", prev)
                                   .removeData("ui-tabs-aria-controls");
                           } else {
                               li.removeAttr("aria-controls");
                           }
                       });
        
                       this.panels.show();
        
                       if (this.options.heightStyle !== "content") {
                           this.panels.css("height", "");
                       }
                   },
        
                   enable: function (index) {
                       var disabled = this.options.disabled;
                       if (disabled === false) {
                           return;
                       }
        
                       if (index === undefined) {
                           disabled = false;
                       } else {
                           index = this._getIndex(index);
                           if ($.isArray(disabled)) {
                               disabled = $.map(disabled, function (num) {
                                   return num !== index ? num : null;
                               });
                           } else {
                               disabled = $.map(this.tabs, function (li, num) {
                                   return num !== index ? num : null;
                               });
                           }
                       }
                       this._setOptionDisabled(disabled);
                   },
        
                   disable: function (index) {
                       var disabled = this.options.disabled;
                       if (disabled === true) {
                           return;
                       }
        
                       if (index === undefined) {
                           disabled = true;
                       } else {
                           index = this._getIndex(index);
                           if ($.inArray(index, disabled) !== -1) {
                               return;
                           }
                           if ($.isArray(disabled)) {
                               disabled = $.merge([index], disabled).sort();
                           } else {
                               disabled = [index];
                           }
                       }
                       this._setOptionDisabled(disabled);
                   },
        
                   load: function (index, event) {
                       index = this._getIndex(index);
                       var that = this,
                           tab = this.tabs.eq(index),
                           anchor = tab.find(".ui-tabs-anchor"),
                           panel = this._getPanelForTab(tab),
                           eventData = {
                               tab: tab,
                               panel: panel
                           },
                           complete = function (jqXHR, status) {
                               if (status === "abort") {
                                   that.panels.stop(false, true);
                               }
        
                               that._removeClass(tab, "ui-tabs-loading");
                               panel.removeAttr("aria-busy");
        
                               if (jqXHR === that.xhr) {
                                   delete that.xhr;
                               }
                           };
        
                       // Not remote
                       if (this._isLocal(anchor[0])) {
                           return;
                       }
        
                       this.xhr = $.ajax(this._ajaxSettings(anchor, event, eventData));
        
                       // Support: jQuery <1.8
                       // jQuery <1.8 returns false if the request is canceled in beforeSend,
                       // but as of 1.8, $.ajax() always returns a jqXHR object.
                       if (this.xhr && this.xhr.statusText !== "canceled") {
                           this._addClass(tab, "ui-tabs-loading");
                           panel.attr("aria-busy", "true");
        
                           this.xhr
                               .done(function (response, status, jqXHR) {
        
                                   // support: jQuery <1.8
                                   // http://bugs.jquery.com/ticket/11778
                                   setTimeout(function () {
                                       panel.html(response);
                                       that._trigger("load", event, eventData);
        
                                       complete(jqXHR, status);
                                   }, 1);
                               })
                               .fail(function (jqXHR, status) {
        
                                   // support: jQuery <1.8
                                   // http://bugs.jquery.com/ticket/11778
                                   setTimeout(function () {
                                       complete(jqXHR, status);
                                   }, 1);
                               });
                       }
                   },
        
                   _ajaxSettings: function (anchor, event, eventData) {
                       var that = this;
                       return {
        
                           // Support: IE <11 only
                           // Strip any hash that exists to prevent errors with the Ajax request
                           url: anchor.attr("href").replace(/#.*$/, ""),
                           beforeSend: function (jqXHR, settings) {
                               return that._trigger("beforeLoad", event,
                                   $.extend({
                                       jqXHR: jqXHR,
                                       ajaxSettings: settings
                                   }, eventData));
                           }
                       };
                   },
        
                   _getPanelForTab: function (tab) {
                       var id = $(tab).attr("aria-controls");
                       return this.element.find(this._sanitizeSelector("#" + id));
                   }
               });
        
               // DEPRECATED
               // TODO: Switch return back to widget declaration at top of file when this is removed
               if ($.uiBackCompat !== false) {
        
                   // Backcompat for ui-tab class (now ui-tabs-tab)
                   $.widget("ui.tabs", $.ui.tabs, {
                       _processTabs: function () {
                           this._superApply(arguments);
                           this._addClass(this.tabs, "ui-tab");
                       }
                   });
               }
        
               var widgetsTabs = $.ui.tabs;
        


               /*!
                * jQuery UI Tooltip 1.12.1
                * http://jqueryui.com
                *
                * Copyright jQuery Foundation and other contributors
                * Released under the MIT license.
                * http://jquery.org/license
                */
        
               //>>label: Tooltip
               //>>group: Widgets
               //>>description: Shows additional information for any element on hover or focus.
               //>>docs: http://api.jqueryui.com/tooltip/
               //>>demos: http://jqueryui.com/tooltip/
               //>>css.structure: ../../themes/base/core.css
               //>>css.structure: ../../themes/base/tooltip.css
               //>>css.theme: ../../themes/base/theme.css
        


               $.widget("ui.tooltip", {
                   version: "1.12.1",
                   options: {
                       classes: {
                           "ui-tooltip": "ui-corner-all ui-widget-shadow"
                       },
                       content: function () {
        
                           // support: IE<9, Opera in jQuery <1.7
                           // .text() can't accept undefined, so coerce to a string
                           var title = $(this).attr("title") || "";
        
                           // Escape title, since we're going from an attribute to raw HTML
                           return $("<a>").text(title).html();
                       },
                       hide: true,
        
                       // Disabled elements have inconsistent behavior across browsers (#8661)
                       items: "[title]:not([disabled])",
                       position: {
                           my: "left top+15",
                           at: "left bottom",
                           collision: "flipfit flip"
                       },
                       show: true,
                       track: false,
        
                       // Callbacks
                       close: null,
                       open: null
                   },
        
                   _addDescribedBy: function (elem, id) {
                       var describedby = (elem.attr("aria-describedby") || "").split(/\s+/);
                       describedby.push(id);
                       elem
                           .data("ui-tooltip-id", id)
                           .attr("aria-describedby", $.trim(describedby.join(" ")));
                   },
        
                   _removeDescribedBy: function (elem) {
                       var id = elem.data("ui-tooltip-id"),
                           describedby = (elem.attr("aria-describedby") || "").split(/\s+/),
                           index = $.inArray(id, describedby);
        
                       if (index !== -1) {
                           describedby.splice(index, 1);
                       }
        
                       elem.removeData("ui-tooltip-id");
                       describedby = $.trim(describedby.join(" "));
                       if (describedby) {
                           elem.attr("aria-describedby", describedby);
                       } else {
                           elem.removeAttr("aria-describedby");
                       }
                   },
        
                   _create: function () {
                       this._on({
                           mouseover: "open",
                           focusin: "open"
                       });
        
                       // IDs of generated tooltips, needed for destroy
                       this.tooltips = {};
        
                       // IDs of parent tooltips where we removed the title attribute
                       this.parents = {};
        
                       // Append the aria-live region so tooltips announce correctly
        
        this.liveRegion = $("
        ")
                           .attr({
                               role: "log",
                               "aria-live": "assertive",
                               "aria-relevant": "additions"
                           })
                           .appendTo(this.document[0].body);
                       this._addClass(this.liveRegion, null, "ui-helper-hidden-accessible");
        
                       this.disabledTitles = $([]);
                   },
        
                   _setOption: function (key, value) {
                       var that = this;
        
                       this._super(key, value);
        
                       if (key === "content") {
                           $.each(this.tooltips, function (id, tooltipData) {
                               that._updateContent(tooltipData.element);
                           });
                       }
                   },
        
                   _setOptionDisabled: function (value) {
                       this[value ? "_disable" : "_enable"]();
                   },
        
                   _disable: function () {
                       var that = this;
        
                       // Close open tooltips
                       $.each(this.tooltips, function (id, tooltipData) {
                           var event = $.Event("blur");
                           event.target = event.currentTarget = tooltipData.element[0];
                           that.close(event, true);
                       });
        
                       // Remove title attributes to prevent native tooltips
                       this.disabledTitles = this.disabledTitles.add(
                           this.element.find(this.options.items).addBack()
                           .filter(function () {
                               var element = $(this);
                               if (element.is("[title]")) {
                                   return element
                                       .data("ui-tooltip-title", element.attr("title"))
                                       .removeAttr("title");
                               }
                           })
                       );
                   },
        
                   _enable: function () {
        
                       // restore title attributes
                       this.disabledTitles.each(function () {
                           var element = $(this);
                           if (element.data("ui-tooltip-title")) {
                               element.attr("title", element.data("ui-tooltip-title"));
                           }
                       });
                       this.disabledTitles = $([]);
                   },
        
                   open: function (event) {
                       var that = this,
                           target = $(event ? event.target : this.element)
        
                           // we need closest here due to mouseover bubbling,
                           // but always pointing at the same event target
                           .closest(this.options.items);
        
                       // No element to show a tooltip for or the tooltip is already open
                       if (!target.length || target.data("ui-tooltip-id")) {
                           return;
                       }
        
                       if (target.attr("title")) {
                           target.data("ui-tooltip-title", target.attr("title"));
                       }
        
                       target.data("ui-tooltip-open", true);
        
                       // Kill parent tooltips, custom or native, for hover
                       if (event && event.type === "mouseover") {
                           target.parents().each(function () {
                               var parent = $(this),
                                   blurEvent;
                               if (parent.data("ui-tooltip-open")) {
                                   blurEvent = $.Event("blur");
                                   blurEvent.target = blurEvent.currentTarget = this;
                                   that.close(blurEvent, true);
                               }
                               if (parent.attr("title")) {
                                   parent.uniqueId();
                                   that.parents[this.id] = {
                                       element: this,
                                       title: parent.attr("title")
                                   };
                                   parent.attr("title", "");
                               }
                           });
                       }
        
                       this._registerCloseHandlers(event, target);
                       this._updateContent(target, event);
                   },
        
                   _updateContent: function (target, event) {
                       var content,
                           contentOption = this.options.content,
                           that = this,
                           eventType = event ? event.type : null;
        
                       if (typeof contentOption === "string" || contentOption.nodeType ||
                           contentOption.jquery) {
                           return this._open(event, target, contentOption);
                       }
        
                       content = contentOption.call(target[0], function (response) {
        
                           // IE may instantly serve a cached response for ajax requests
                           // delay this call to _open so the other call to _open runs first
                           that._delay(function () {
        
                               // Ignore async response if tooltip was closed already
                               if (!target.data("ui-tooltip-open")) {
                                   return;
                               }
        
                               // JQuery creates a special event for focusin when it doesn't
                               // exist natively. To improve performance, the native event
                               // object is reused and the type is changed. Therefore, we can't
                               // rely on the type being correct after the event finished
                               // bubbling, so we set it back to the previous value. (#8740)
                               if (event) {
                                   event.type = eventType;
                               }
                               this._open(event, target, response);
                           });
                       });
                       if (content) {
                           this._open(event, target, content);
                       }
                   },
        
                   _open: function (event, target, content) {
                       var tooltipData, tooltip, delayedShow, a11yContent,
                           positionOption = $.extend({}, this.options.position);
        
                       if (!content) {
                           return;
                       }
        
                       // Content can be updated multiple times. If the tooltip already
                       // exists, then just update the content and bail.
                       tooltipData = this._find(target);
                       if (tooltipData) {
                           tooltipData.tooltip.find(".ui-tooltip-content").html(content);
                           return;
                       }
        
                       // If we have a title, clear it to prevent the native tooltip
                       // we have to check first to avoid defining a title if none exists
                       // (we don't want to cause an element to start matching [title])
                       //
                       // We use removeAttr only for key events, to allow IE to export the correct
                       // accessible attributes. For mouse events, set to empty string to avoid
                       // native tooltip showing up (happens only when removing inside mouseover).
                       if (target.is("[title]")) {
                           if (event && event.type === "mouseover") {
                               target.attr("title", "");
                           } else {
                               target.removeAttr("title");
                           }
                       }
        
                       tooltipData = this._tooltip(target);
                       tooltip = tooltipData.tooltip;
                       this._addDescribedBy(target, tooltip.attr("id"));
                       tooltip.find(".ui-tooltip-content").html(content);
        
                       // Support: Voiceover on OS X, JAWS on IE <= 9
                       // JAWS announces deletions even when aria-relevant="additions"
                       // Voiceover will sometimes re-read the entire log region's contents from the beginning
                       this.liveRegion.children().hide();
        
        a11yContent = $("
        ").html(tooltip.find(".ui-tooltip-content").html());
                       a11yContent.removeAttr("name").find("[name]").removeAttr("name");
                       a11yContent.removeAttr("id").find("[id]").removeAttr("id");
                       a11yContent.appendTo(this.liveRegion);
        
                       function position(event) {
                           positionOption.of = event;
                           if (tooltip.is(":hidden")) {
                               return;
                           }
                           tooltip.position(positionOption);
                       }
                       if (this.options.track && event && /^mouse/.test(event.type)) {
                           this._on(this.document, {
                               mousemove: position
                           });
        
                           // trigger once to override element-relative positioning
                           position(event);
                       } else {
                           tooltip.position($.extend({
                               of: target
                           }, this.options.position));
                       }
        
                       tooltip.hide();
        
                       this._show(tooltip, this.options.show);
        
                       // Handle tracking tooltips that are shown with a delay (#8644). As soon
                       // as the tooltip is visible, position the tooltip using the most recent
                       // event.
                       // Adds the check to add the timers only when both delay and track options are set (#14682)
                       if (this.options.track && this.options.show && this.options.show.delay) {
                           delayedShow = this.delayedShow = setInterval(function () {
                               if (tooltip.is(":visible")) {
                                   position(positionOption.of);
                                   clearInterval(delayedShow);
                               }
                           }, $.fx.interval);
                       }
        
                       this._trigger("open", event, {
                           tooltip: tooltip
                       });
                   },
        
                   _registerCloseHandlers: function (event, target) {
                       var events = {
                           keyup: function (event) {
                               if (event.keyCode === $.ui.keyCode.ESCAPE) {
                                   var fakeEvent = $.Event(event);
                                   fakeEvent.currentTarget = target[0];
                                   this.close(fakeEvent, true);
                               }
                           }
                       };
        
                       // Only bind remove handler for delegated targets. Non-delegated
                       // tooltips will handle this in destroy.
                       if (target[0] !== this.element[0]) {
                           events.remove = function () {
                               this._removeTooltip(this._find(target).tooltip);
                           };
                       }
        
                       if (!event || event.type === "mouseover") {
                           events.mouseleave = "close";
                       }
                       if (!event || event.type === "focusin") {
                           events.focusout = "close";
                       }
                       this._on(true, target, events);
                   },
        
                   close: function (event) {
                       var tooltip,
                           that = this,
                           target = $(event ? event.currentTarget : this.element),
                           tooltipData = this._find(target);
        
                       // The tooltip may already be closed
                       if (!tooltipData) {
        
                           // We set ui-tooltip-open immediately upon open (in open()), but only set the
                           // additional data once there's actually content to show (in _open()). So even if the
                           // tooltip doesn't have full data, we always remove ui-tooltip-open in case we're in
                           // the period between open() and _open().
                           target.removeData("ui-tooltip-open");
                           return;
                       }
        
                       tooltip = tooltipData.tooltip;
        
                       // Disabling closes the tooltip, so we need to track when we're closing
                       // to avoid an infinite loop in case the tooltip becomes disabled on close
                       if (tooltipData.closing) {
                           return;
                       }
        
                       // Clear the interval for delayed tracking tooltips
                       clearInterval(this.delayedShow);
        
                       // Only set title if we had one before (see comment in _open())
                       // If the title attribute has changed since open(), don't restore
                       if (target.data("ui-tooltip-title") && !target.attr("title")) {
                           target.attr("title", target.data("ui-tooltip-title"));
                       }
        
                       this._removeDescribedBy(target);
        
                       tooltipData.hiding = true;
                       tooltip.stop(true);
                       this._hide(tooltip, this.options.hide, function () {
                           that._removeTooltip($(this));
                       });
        
                       target.removeData("ui-tooltip-open");
                       this._off(target, "mouseleave focusout keyup");
        
                       // Remove 'remove' binding only on delegated targets
                       if (target[0] !== this.element[0]) {
                           this._off(target, "remove");
                       }
                       this._off(this.document, "mousemove");
        
                       if (event && event.type === "mouseleave") {
                           $.each(this.parents, function (id, parent) {
                               $(parent.element).attr("title", parent.title);
                               delete that.parents[id];
                           });
                       }
        
                       tooltipData.closing = true;
                       this._trigger("close", event, {
                           tooltip: tooltip
                       });
                       if (!tooltipData.hiding) {
                           tooltipData.closing = false;
                       }
                   },
        
                   _tooltip: function (element) {
        
        var tooltip = $("
        ").attr("role", "tooltip"), content = $("
        ").appendTo(tooltip),
                           id = tooltip.uniqueId().attr("id");
        
                       this._addClass(content, "ui-tooltip-content");
                       this._addClass(tooltip, "ui-tooltip", "ui-widget ui-widget-content");
        
                       tooltip.appendTo(this._appendTo(element));
        
                       return this.tooltips[id] = {
                           element: element,
                           tooltip: tooltip
                       };
                   },
        
                   _find: function (target) {
                       var id = target.data("ui-tooltip-id");
                       return id ? this.tooltips[id] : null;
                   },
        
                   _removeTooltip: function (tooltip) {
                       tooltip.remove();
                       delete this.tooltips[tooltip.attr("id")];
                   },
        
                   _appendTo: function (target) {
                       var element = target.closest(".ui-front, dialog");
        
                       if (!element.length) {
                           element = this.document[0].body;
                       }
        
                       return element;
                   },
        
                   _destroy: function () {
                       var that = this;
        
                       // Close open tooltips
                       $.each(this.tooltips, function (id, tooltipData) {
        
                           // Delegate to close method to handle common cleanup
                           var event = $.Event("blur"),
                               element = tooltipData.element;
                           event.target = event.currentTarget = element[0];
                           that.close(event, true);
        
                           // Remove immediately; destroying an open tooltip doesn't use the
                           // hide animation
                           $("#" + id).remove();
        
                           // Restore the title
                           if (element.data("ui-tooltip-title")) {
        
                               // If the title attribute has changed since open(), don't restore
                               if (!element.attr("title")) {
                                   element.attr("title", element.data("ui-tooltip-title"));
                               }
                               element.removeData("ui-tooltip-title");
                           }
                       });
                       this.liveRegion.remove();
                   }
               });
        
               // DEPRECATED
               // TODO: Switch return back to widget declaration at top of file when this is removed
               if ($.uiBackCompat !== false) {
        
                   // Backcompat for tooltipClass option
                   $.widget("ui.tooltip", $.ui.tooltip, {
                       options: {
                           tooltipClass: null
                       },
                       _tooltip: function () {
                           var tooltipData = this._superApply(arguments);
                           if (this.options.tooltipClass) {
                               tooltipData.tooltip.addClass(this.options.tooltipClass);
                           }
                           return tooltipData;
                       }
                   });
               }
        
               var widgetsTooltip = $.ui.tooltip;
        



           }));
           /*
            * jQuery Easing v1.4.1 - http://gsgd.co.uk/sandbox/jquery/easing/
            * Open source under the BSD License.
            * Copyright © 2008 George McGinley Smith
            * All rights reserved.
            * https://raw.github.com/gdsmith/jquery-easing/master/LICENSE
            */
        
           (function (factory) {
               if (typeof define === "function" && define.amd) {
                   define(['jquery'], function ($) {
                       return factory($);
                   });
               } else if (typeof module === "object" && typeof module.exports === "object") {
                   exports = factory(require('jquery'));
               } else {
                   factory(jQuery);
               }
           })(function ($) {
        
               // Preserve the original jQuery "swing" easing as "jswing"
               $.easing.jswing = $.easing.swing;
        
               var pow = Math.pow,
                   sqrt = Math.sqrt,
                   sin = Math.sin,
                   cos = Math.cos,
                   PI = Math.PI,
                   c1 = 1.70158,
                   c2 = c1 * 1.525,
                   c3 = c1 + 1,
                   c4 = (2 * PI) / 3,
                   c5 = (2 * PI) / 4.5;
        
               // x is the fraction of animation progress, in the range 0..1
               function bounceOut(x) {
                   var n1 = 7.5625,
                       d1 = 2.75;
                   if (x < 1 / d1) {
                       return n1 * x * x;
                   } else if (x < 2 / d1) {
                       return n1 * (x -= (1.5 / d1)) * x + 0.75;
                   } else if (x < 2.5 / d1) {
                       return n1 * (x -= (2.25 / d1)) * x + 0.9375;
                   } else {
                       return n1 * (x -= (2.625 / d1)) * x + 0.984375;
                   }
               }
        
               $.extend($.easing, {
                   def: 'easeOutQuad',
                   swing: function (x) {
                       return $.easing[$.easing.def](x);
                   },
                   easeInQuad: function (x) {
                       return x * x;
                   },
                   easeOutQuad: function (x) {
                       return 1 - (1 - x) * (1 - x);
                   },
                   easeInOutQuad: function (x) {
                       return x < 0.5 ?
                           2 * x * x :
                           1 - pow(-2 * x + 2, 2) / 2;
                   },
                   easeInCubic: function (x) {
                       return x * x * x;
                   },
                   easeOutCubic: function (x) {
                       return 1 - pow(1 - x, 3);
                   },
                   easeInOutCubic: function (x) {
                       return x < 0.5 ?
                           4 * x * x * x :
                           1 - pow(-2 * x + 2, 3) / 2;
                   },
                   easeInQuart: function (x) {
                       return x * x * x * x;
                   },
                   easeOutQuart: function (x) {
                       return 1 - pow(1 - x, 4);
                   },
                   easeInOutQuart: function (x) {
                       return x < 0.5 ?
                           8 * x * x * x * x :
                           1 - pow(-2 * x + 2, 4) / 2;
                   },
                   easeInQuint: function (x) {
                       return x * x * x * x * x;
                   },
                   easeOutQuint: function (x) {
                       return 1 - pow(1 - x, 5);
                   },
                   easeInOutQuint: function (x) {
                       return x < 0.5 ?
                           16 * x * x * x * x * x :
                           1 - pow(-2 * x + 2, 5) / 2;
                   },
                   easeInSine: function (x) {
                       return 1 - cos(x * PI / 2);
                   },
                   easeOutSine: function (x) {
                       return sin(x * PI / 2);
                   },
                   easeInOutSine: function (x) {
                       return -(cos(PI * x) - 1) / 2;
                   },
                   easeInExpo: function (x) {
                       return x === 0 ? 0 : pow(2, 10 * x - 10);
                   },
                   easeOutExpo: function (x) {
                       return x === 1 ? 1 : 1 - pow(2, -10 * x);
                   },
                   easeInOutExpo: function (x) {
                       return x === 0 ? 0 : x === 1 ? 1 : x < 0.5 ?
                           pow(2, 20 * x - 10) / 2 :
                           (2 - pow(2, -20 * x + 10)) / 2;
                   },
                   easeInCirc: function (x) {
                       return 1 - sqrt(1 - pow(x, 2));
                   },
                   easeOutCirc: function (x) {
                       return sqrt(1 - pow(x - 1, 2));
                   },
                   easeInOutCirc: function (x) {
                       return x < 0.5 ?
                           (1 - sqrt(1 - pow(2 * x, 2))) / 2 :
                           (sqrt(1 - pow(-2 * x + 2, 2)) + 1) / 2;
                   },
                   easeInElastic: function (x) {
                       return x === 0 ? 0 : x === 1 ? 1 :
                           -pow(2, 10 * x - 10) * sin((x * 10 - 10.75) * c4);
                   },
                   easeOutElastic: function (x) {
                       return x === 0 ? 0 : x === 1 ? 1 :
                           pow(2, -10 * x) * sin((x * 10 - 0.75) * c4) + 1;
                   },
                   easeInOutElastic: function (x) {
                       return x === 0 ? 0 : x === 1 ? 1 : x < 0.5 ?
                           -(pow(2, 20 * x - 10) * sin((20 * x - 11.125) * c5)) / 2 :
                           pow(2, -20 * x + 10) * sin((20 * x - 11.125) * c5) / 2 + 1;
                   },
                   easeInBack: function (x) {
                       return c3 * x * x * x - c1 * x * x;
                   },
                   easeOutBack: function (x) {
                       return 1 + c3 * pow(x - 1, 3) + c1 * pow(x - 1, 2);
                   },
                   easeInOutBack: function (x) {
                       return x < 0.5 ?
                           (pow(2 * x, 2) * ((c2 + 1) * 2 * x - c2)) / 2 :
                           (pow(2 * x - 2, 2) * ((c2 + 1) * (x * 2 - 2) + c2) + 2) / 2;
                   },
                   easeInBounce: function (x) {
                       return 1 - bounceOut(1 - x);
                   },
                   easeOutBounce: bounceOut,
                   easeInOutBounce: function (x) {
                       return x < 0.5 ?
                           (1 - bounceOut(1 - 2 * x)) / 2 :
                           (1 + bounceOut(2 * x - 1)) / 2;
                   }
               });
        
        });