Difference between revisions of "Template:SDU-Denmark/js/vendor"
Deltaetabeta (Talk | contribs) |
|||
| Line 46,190: | Line 46,190: | ||
return initialSlideHeight || 100; | return initialSlideHeight || 100; | ||
}; | }; | ||
| − | |||
| − | |||
| − | |||
| − | |||
| − | |||
| − | |||
| − | |||
| − | |||
| − | |||
| − | |||
| − | |||
| − | |||
| − | |||
| − | |||
| − | |||
| − | |||
| − | |||
| − | |||
| − | |||
| − | |||
| − | |||
| − | |||
| − | |||
| − | |||
| − | |||
| − | |||
| − | |||
| − | |||
| − | |||
| − | |||
| − | |||
| − | |||
| − | |||
| − | |||
| − | |||
| − | |||
| − | |||
| − | |||
| − | |||
| − | |||
| − | |||
| − | |||
| − | |||
| − | |||
| − | |||
| − | |||
| − | |||
| − | |||
| − | |||
| − | |||
| − | |||
| − | |||
| − | |||
| − | |||
| − | |||
| − | |||
| − | |||
| − | |||
| − | |||
| − | |||
| − | |||
| − | |||
| − | |||
| − | |||
| − | |||
| − | |||
| − | |||
| − | |||
| − | |||
| − | |||
| − | |||
| − | |||
| − | |||
| − | |||
| − | |||
| − | |||
| − | |||
| − | |||
| − | |||
| − | |||
| − | |||
| − | |||
| − | |||
| − | |||
| − | |||
| − | |||
| − | |||
| − | |||
| − | |||
| − | |||
| − | |||
| − | |||
| − | |||
| − | |||
| − | |||
| − | |||
| − | |||
| − | |||
| − | |||
| − | |||
| − | |||
| − | |||
| − | |||
| − | |||
| − | |||
| − | |||
| − | |||
| − | |||
| − | |||
| − | |||
| − | |||
| − | |||
| − | |||
| − | |||
| − | |||
| − | |||
| − | |||
| − | |||
| − | |||
| − | |||
| − | |||
| − | |||
| − | |||
| − | |||
| − | |||
| − | |||
| − | |||
| − | |||
| − | |||
| − | |||
| − | |||
| − | |||
| − | |||
| − | |||
| − | |||
| − | |||
| − | |||
| − | |||
| − | |||
| − | |||
| − | |||
| − | |||
| − | |||
| − | |||
| − | |||
| − | |||
| − | |||
| − | |||
| − | |||
| − | |||
| − | |||
| − | |||
| − | |||
| − | |||
| − | |||
| − | |||
| − | |||
| − | |||
| − | |||
| − | |||
| − | |||
| − | |||
| − | |||
| − | |||
| − | |||
| − | |||
| − | |||
| − | |||
| − | |||
| − | |||
| − | |||
| − | |||
| − | |||
| − | |||
| − | |||
| − | |||
| − | |||
| − | |||
| − | |||
| − | |||
| − | |||
| − | |||
| − | |||
| − | |||
| − | |||
| − | |||
| − | |||
| − | |||
| − | |||
| − | |||
| − | |||
| − | |||
| − | |||
| − | |||
| − | |||
| − | |||
| − | |||
| − | |||
| − | |||
| − | |||
| − | |||
| − | |||
| − | |||
| − | |||
| − | |||
| − | |||
| − | |||
| − | |||
| − | |||
| − | |||
| − | |||
| − | |||
| − | |||
| − | |||
| − | |||
| − | |||
| − | |||
| − | |||
| − | |||
| − | |||
| − | |||
| − | |||
| − | |||
| − | |||
| − | |||
| − | |||
| − | |||
| − | |||
| − | |||
| − | |||
| − | |||
| − | |||
| − | |||
| − | |||
| − | |||
| − | |||
| − | |||
| − | |||
| − | |||
| − | |||
| − | |||
| − | |||
| − | |||
| − | |||
| − | |||
| − | |||
| − | |||
| − | |||
| − | |||
| − | |||
| − | |||
| − | |||
| − | |||
| − | |||
| − | |||
| − | |||
| − | |||
| − | |||
| − | |||
| − | |||
| − | |||
| − | |||
| − | |||
| − | |||
| − | |||
| − | |||
| − | |||
| − | |||
| − | |||
| − | |||
| − | |||
| − | |||
| − | |||
| − | |||
| − | |||
| − | |||
| − | |||
| − | |||
| − | |||
| − | |||
| − | |||
| − | |||
| − | |||
| − | |||
| − | |||
| − | |||
| − | |||
| − | |||
| − | |||
| − | |||
| − | |||
| − | |||
| − | |||
| − | |||
| − | |||
| − | |||
| − | |||
| − | |||
| − | |||
| − | |||
| − | |||
| − | |||
| − | |||
| − | |||
| − | |||
| − | |||
| − | |||
| − | |||
| − | |||
| − | |||
| − | |||
| − | |||
| − | |||
| − | |||
} | } | ||
Revision as of 00:25, 22 October 2019
(function() {
function syntheticDefaultExportPolyfill(input) {
if (input == null || ['function', 'object', 'array'].indexOf(typeof input) === -1) {
return;
}
// use hasOwnProperty to avoid triggering usage warnings from libraries like mobx
var hasDefaultProperty = Object.prototype.hasOwnProperty.call(input, 'default');
var hasModuleProperty = Object.prototype.hasOwnProperty.call(input, '__esModule');
// to get around frozen input
if (Object.isFrozen(input)) {
if (!hasDefaultProperty) {
input['default'] = input;
}
if (!hasModuleProperty) {
input['__esModule'] = true;
}
return;
}
// free to define properties
if (!hasDefaultProperty) {
Object.defineProperty(input, 'default', { value: input, writable: true, enumerable: false });
}
if (!hasModuleProperty) {
Object.defineProperty(input, '__esModule', { value: true });
}
}
var $fsx = (window.$fsx = {});
$fsx.f = {};
var splitConfig = {"entries":{"215":"dynamic1-dynamic1.js"},"scriptRoot":"/"};
function loadLocalScript(id, path) {
return new Promise((resolve, reject) => {
var scriptId = '__entry' + id + '__';
var script = document.getElementById(scriptId);
if (!script) {
script = document.createElement('script');
script.id = scriptId;
document.head.appendChild(script);
}
script.onload = function() {
if ($fsx.f[id]) {
return resolve($fsx.r(id));
} else reject('Resolve error of module ' + id);
};
if (!script.src) script.src = splitConfig.scriptRoot + path;
});
}
$fsx.m = {};
$fsx.r = function(id) {
var cached = $fsx.m[id];
// resolve if in cache
if (cached) {
return cached.m.exports;
}
var file = $fsx.f[id];
if (!file) {
if (splitConfig.entries[id]) return loadLocalScript(id, splitConfig.entries[id]);
return;
}
cached = $fsx.m[id] = {};
cached.exports = {};
cached.m = { exports: cached.exports };
file.call(cached.exports, cached.m, cached.exports);
syntheticDefaultExportPolyfill(cached.m.exports);
return cached.m.exports;
};
})(); // react/index.js $fsx.f[3] = (module, exports) => { 'use strict'; module.exports = $fsx.r(2);
} // react/cjs/react.production.min.js $fsx.f[2] = (module, exports) => { 'use strict'; var h = $fsx.r(1), n = "function" === typeof Symbol && Symbol.for, p = n ? Symbol.for("react.element") : 60103, q = n ? Symbol.for("react.portal") : 60106, r = n ? Symbol.for("react.fragment") : 60107, t = n ? Symbol.for("react.strict_mode") : 60108, u = n ? Symbol.for("react.profiler") : 60114, v = n ? Symbol.for("react.provider") : 60109, w = n ? Symbol.for("react.context") : 60110, x = n ? Symbol.for("react.forward_ref") : 60112, y = n ? Symbol.for("react.suspense") : 60113, aa = n ? Symbol.for("react.suspense_list") : 60120, ba = n ? Symbol.for("react.memo") :
60115, ca = n ? Symbol.for("react.lazy") : 60116;
n && Symbol.for("react.fundamental"); n && Symbol.for("react.responder"); var z = "function" === typeof Symbol && Symbol.iterator; function A(a) { for (var b = a.message, d = "https://reactjs.org/docs/error-decoder.html?invariant=" + b, c = 1; c < arguments.length; c++)
d += "&args[]=" + encodeURIComponent(arguments[c]); a.message = "Minified React error #" + b + "; visit " + d + " for the full message or use the non-minified dev environment for full errors and additional helpful warnings. "; return a; }
var B = { isMounted: function () { return !1; }, enqueueForceUpdate: function () { }, enqueueReplaceState: function () { }, enqueueSetState: function () { } }, C = {}; function D(a, b, d) { this.props = a; this.context = b; this.refs = C; this.updater = d || B; } D.prototype.isReactComponent = {}; D.prototype.setState = function (a, b) { if ("object" !== typeof a && "function" !== typeof a && null != a)
throw A(Error(85)); this.updater.enqueueSetState(this, a, b, "setState"); };
D.prototype.forceUpdate = function (a) { this.updater.enqueueForceUpdate(this, a, "forceUpdate"); }; function E() { } E.prototype = D.prototype; function F(a, b, d) { this.props = a; this.context = b; this.refs = C; this.updater = d || B; } var G = F.prototype = new E; G.constructor = F; h(G, D.prototype); G.isPureReactComponent = !0; var H = { current: null }, I = { suspense: null }, J = { current: null }, K = Object.prototype.hasOwnProperty, L = { key: !0, ref: !0, __self: !0, __source: !0 }; function M(a, b, d) { var c = void 0, e = {}, g = null, k = null; if (null != b)
for (c in void 0 !== b.ref && (k = b.ref), void 0 !== b.key && (g = "" + b.key), b)
K.call(b, c) && !L.hasOwnProperty(c) && (e[c] = b[c]); var f = arguments.length - 2; if (1 === f)
e.children = d;
else if (1 < f) {
for (var l = Array(f), m = 0; m < f; m++)
l[m] = arguments[m + 2];
e.children = l;
} if (a && a.defaultProps)
for (c in f = a.defaultProps, f)
void 0 === e[c] && (e[c] = f[c]); return { $$typeof: p, type: a, key: g, ref: k, props: e, _owner: J.current }; }
function da(a, b) { return { $$typeof: p, type: a.type, key: b, ref: a.ref, props: a.props, _owner: a._owner }; } function N(a) { return "object" === typeof a && null !== a && a.$$typeof === p; } function escape(a) { var b = { "=": "=0", ":": "=2" }; return "$" + ("" + a).replace(/[=:]/g, function (a) { return b[a]; }); } var O = /\/+/g, P = []; function Q(a, b, d, c) { if (P.length) {
var e = P.pop(); e.result = a; e.keyPrefix = b; e.func = d; e.context = c; e.count = 0; return e;
} return { result: a, keyPrefix: b, func: d, context: c, count: 0 }; } function R(a) { a.result = null; a.keyPrefix = null; a.func = null; a.context = null; a.count = 0; 10 > P.length && P.push(a); } function S(a, b, d, c) {
var e = typeof a;
if ("undefined" === e || "boolean" === e)
a = null;
var g = !1;
if (null === a)
g = !0;
else
switch (e) {
case "string":
case "number":
g = !0;
break;
case "object": switch (a.$$typeof) {
case p:
case q: g = !0;
}
}
if (g)
return d(c, a, "" === b ? "." + T(a, 0) : b), 1;
g = 0;
b = "" === b ? "." : b + ":";
if (Array.isArray(a))
for (var k = 0; k < a.length; k++) {
e = a[k];
var f = b + T(e, k);
g += S(e, f, d, c);
}
else if (null === a || "object" !== typeof a ? f = null : (f = z && a[z] || a["@@iterator"], f = "function" === typeof f ? f : null), "function" === typeof f)
for (a = f.call(a), k =
0; !(e = a.next()).done;)
e = e.value, f = b + T(e, k++), g += S(e, f, d, c);
else if ("object" === e)
throw d = "" + a, A(Error(31), "[object Object]" === d ? "object with keys {" + Object.keys(a).join(", ") + "}" : d, "");
return g;
} function U(a, b, d) { return null == a ? 0 : S(a, "", b, d); } function T(a, b) { return "object" === typeof a && null !== a && null != a.key ? escape(a.key) : b.toString(36); } function ea(a, b) { a.func.call(a.context, b, a.count++); } function fa(a, b, d) { var c = a.result, e = a.keyPrefix; a = a.func.call(a.context, b, a.count++); Array.isArray(a) ? V(a, c, d, function (a) { return a; }) : null != a && (N(a) && (a = da(a, e + (!a.key || b && b.key === a.key ? "" : ("" + a.key).replace(O, "$&/") + "/") + d)), c.push(a)); } function V(a, b, d, c, e) { var g = ""; null != d && (g = ("" + d).replace(O, "$&/") + "/"); b = Q(b, g, c, e); U(a, fa, b); R(b); } function W() { var a = H.current; if (null === a)
throw A(Error(321)); return a; }
var X = { Children: { map: function (a, b, d) { if (null == a)
return a; var c = []; V(a, c, null, b, d); return c; }, forEach: function (a, b, d) { if (null == a)
return a; b = Q(null, null, b, d); U(a, ea, b); R(b); }, count: function (a) { return U(a, function () { return null; }, null); }, toArray: function (a) { var b = []; V(a, b, null, function (a) { return a; }); return b; }, only: function (a) { if (!N(a))
throw A(Error(143)); return a; } }, createRef: function () { return { current: null }; }, Component: D, PureComponent: F, createContext: function (a, b) {
void 0 === b && (b = null);
a = { $$typeof: w, _calculateChangedBits: b,
_currentValue: a, _currentValue2: a, _threadCount: 0, Provider: null, Consumer: null };
a.Provider = { $$typeof: v, _context: a };
return a.Consumer = a;
}, forwardRef: function (a) { return { $$typeof: x, render: a }; }, lazy: function (a) { return { $$typeof: ca, _ctor: a, _status: -1, _result: null }; }, memo: function (a, b) { return { $$typeof: ba, type: a, compare: void 0 === b ? null : b }; }, useCallback: function (a, b) { return W().useCallback(a, b); }, useContext: function (a, b) { return W().useContext(a, b); }, useEffect: function (a, b) { return W().useEffect(a, b); }, useImperativeHandle: function (a, b, d) { return W().useImperativeHandle(a, b, d); }, useDebugValue: function () { }, useLayoutEffect: function (a, b) { return W().useLayoutEffect(a, b); }, useMemo: function (a, b) { return W().useMemo(a, b); }, useReducer: function (a, b, d) { return W().useReducer(a, b, d); }, useRef: function (a) { return W().useRef(a); }, useState: function (a) { return W().useState(a); }, Fragment: r, Profiler: u, StrictMode: t, Suspense: y, unstable_SuspenseList: aa, createElement: M, cloneElement: function (a, b, d) {
if (null === a || void 0 === a)
throw A(Error(267), a);
var c = void 0, e = h({}, a.props), g = a.key, k = a.ref, f = a._owner;
if (null != b) {
void 0 !== b.ref && (k = b.ref, f = J.current);
void 0 !== b.key && (g = "" + b.key);
var l = void 0;
a.type && a.type.defaultProps && (l = a.type.defaultProps);
for (c in b)
K.call(b, c) && !L.hasOwnProperty(c) && (e[c] = void 0 === b[c] && void 0 !== l ? l[c] : b[c]);
}
c = arguments.length - 2;
if (1 === c)
e.children = d;
else if (1 < c) {
l = Array(c);
for (var m = 0; m < c; m++)
l[m] = arguments[m + 2];
e.children = l;
}
return { $$typeof: p, type: a.type, key: g, ref: k, props: e, _owner: f };
}, createFactory: function (a) {
var b = M.bind(null, a);
b.type = a;
return b;
}, isValidElement: N, version: "16.9.0", unstable_withSuspenseConfig: function (a, b) { var d = I.suspense; I.suspense = void 0 === b ? null : b; try {
a();
}
finally {
I.suspense = d;
} }, __SECRET_INTERNALS_DO_NOT_USE_OR_YOU_WILL_BE_FIRED: { ReactCurrentDispatcher: H, ReactCurrentBatchConfig: I, ReactCurrentOwner: J, IsSomeRendererActing: { current: !1 }, assign: h } }, Y = { default: X }, Z = Y && X || Y;
module.exports = Z.default || Z;
} // object-assign/index.js $fsx.f[1] = (module, exports) => { 'use strict'; var getOwnPropertySymbols = Object.getOwnPropertySymbols; var hasOwnProperty = Object.prototype.hasOwnProperty; var propIsEnumerable = Object.prototype.propertyIsEnumerable; function toObject(val) {
if (val === null || val === undefined) {
throw new TypeError('Object.assign cannot be called with null or undefined');
}
return Object(val);
} function shouldUseNative() {
try {
if (!Object.assign) {
return false;
}
var test1 = new String('abc');
test1[5] = 'de';
if (Object.getOwnPropertyNames(test1)[0] === '5') {
return false;
}
var test2 = {};
for (var i = 0; i < 10; i++) {
test2['_' + String.fromCharCode(i)] = i;
}
var order2 = Object.getOwnPropertyNames(test2).map(function (n) {
return test2[n];
});
if (order2.join() !== '0123456789') {
return false;
}
var test3 = {};
'abcdefghijklmnopqrst'.split().forEach(function (letter) {
test3[letter] = letter;
});
if (Object.keys(Object.assign({}, test3)).join() !==
'abcdefghijklmnopqrst') {
return false;
}
return true;
}
catch (err) {
return false;
}
} module.exports = shouldUseNative() ? Object.assign : function (target, source) {
var from;
var to = toObject(target);
var symbols;
for (var s = 1; s < arguments.length; s++) {
from = Object(arguments[s]);
for (var key in from) {
if (hasOwnProperty.call(from, key)) {
to[key] = from[key];
}
}
if (getOwnPropertySymbols) {
symbols = getOwnPropertySymbols(from);
for (var i = 0; i < symbols.length; i++) {
if (propIsEnumerable.call(from, symbols[i])) {
to[symbols[i]] = from[symbols[i]];
}
}
}
}
return to;
};
} // react-dom/index.js $fsx.f[7] = (module, exports) => { 'use strict'; function checkDCE() {
if (typeof __REACT_DEVTOOLS_GLOBAL_HOOK__ === 'undefined' ||
typeof __REACT_DEVTOOLS_GLOBAL_HOOK__.checkDCE !== 'function') {
return;
}
try {
__REACT_DEVTOOLS_GLOBAL_HOOK__.checkDCE(checkDCE);
}
catch (err) {
console.error(err);
}
} checkDCE(); module.exports = $fsx.r(6);
} // react-dom/cjs/react-dom.production.min.js $fsx.f[6] = (module, exports) => { 'use strict'; var aa = $fsx.r(3), m = $fsx.r(1), q = $fsx.r(5); function t(a) { for (var b = a.message, c = "https://reactjs.org/docs/error-decoder.html?invariant=" + b, d = 1; d < arguments.length; d++)
c += "&args[]=" + encodeURIComponent(arguments[d]); a.message = "Minified React error #" + b + "; visit " + c + " for the full message or use the non-minified dev environment for full errors and additional helpful warnings. "; return a; }
if (!aa)
throw t(Error(227));
var ba = null, ca = {}; function da() { if (ba)
for (var a in ca) {
var b = ca[a], c = ba.indexOf(a);
if (!(-1 < c))
throw t(Error(96), a);
if (!ea[c]) {
if (!b.extractEvents)
throw t(Error(97), a);
ea[c] = b;
c = b.eventTypes;
for (var d in c) {
var e = void 0;
var f = c[d], h = b, g = d;
if (fa.hasOwnProperty(g))
throw t(Error(99), g);
fa[g] = f;
var k = f.phasedRegistrationNames;
if (k) {
for (e in k)
k.hasOwnProperty(e) && ha(k[e], h, g);
e = !0;
}
else
f.registrationName ? (ha(f.registrationName, h, g), e = !0) : e = !1;
if (!e)
throw t(Error(98), d, a);
}
}
} }
function ha(a, b, c) { if (ia[a])
throw t(Error(100), a); ia[a] = b; ja[a] = b.eventTypes[c].dependencies; }
var ea = [], fa = {}, ia = {}, ja = {}; function ka(a, b, c, d, e, f, h, g, k) { var l = Array.prototype.slice.call(arguments, 3); try {
b.apply(c, l);
} catch (n) {
this.onError(n);
} } var la = !1, ma = null, na = !1, oa = null, pa = { onError: function (a) { la = !0; ma = a; } }; function qa(a, b, c, d, e, f, h, g, k) { la = !1; ma = null; ka.apply(pa, arguments); } function ra(a, b, c, d, e, f, h, g, k) { qa.apply(this, arguments); if (la) {
if (la) {
var l = ma;
la = !1;
ma = null;
}
else
throw t(Error(198));
na || (na = !0, oa = l);
} } var sa = null, ta = null, va = null; function wa(a, b, c) { var d = a.type || "unknown-event"; a.currentTarget = va(c); ra(d, b, void 0, a); a.currentTarget = null; } function xa(a, b) { if (null == b)
throw t(Error(30)); if (null == a)
return b; if (Array.isArray(a)) {
if (Array.isArray(b))
return a.push.apply(a, b), a;
a.push(b);
return a;
} return Array.isArray(b) ? [a].concat(b) : [a, b]; } function ya(a, b, c) { Array.isArray(a) ? a.forEach(b, c) : a && b.call(c, a); } var za = null; function Aa(a) { if (a) {
var b = a._dispatchListeners, c = a._dispatchInstances;
if (Array.isArray(b))
for (var d = 0; d < b.length && !a.isPropagationStopped(); d++)
wa(a, b[d], c[d]);
else
b && wa(a, b, c);
a._dispatchListeners = null;
a._dispatchInstances = null;
a.isPersistent() || a.constructor.release(a);
} } function Ba(a) { null !== a && (za = xa(za, a)); a = za; za = null; if (a) {
ya(a, Aa);
if (za)
throw t(Error(95));
if (na)
throw a = oa, na = !1, oa = null, a;
} } var Ca = { injectEventPluginOrder: function (a) { if (ba)
throw t(Error(101)); ba = Array.prototype.slice.call(a); da(); }, injectEventPluginsByName: function (a) { var b = !1, c; for (c in a)
if (a.hasOwnProperty(c)) {
var d = a[c];
if (!ca.hasOwnProperty(c) || ca[c] !== d) {
if (ca[c])
throw t(Error(102), c);
ca[c] = d;
b = !0;
}
} b && da(); } };
function Da(a, b) {
var c = a.stateNode;
if (!c)
return null;
var d = sa(c);
if (!d)
return null;
c = d[b];
a: switch (b) {
case "onClick":
case "onClickCapture":
case "onDoubleClick":
case "onDoubleClickCapture":
case "onMouseDown":
case "onMouseDownCapture":
case "onMouseMove":
case "onMouseMoveCapture":
case "onMouseUp":
case "onMouseUpCapture":
(d = !d.disabled) || (a = a.type, d = !("button" === a || "input" === a || "select" === a || "textarea" === a));
a = !d;
break a;
default: a = !1;
}
if (a)
return null;
if (c && "function" !== typeof c)
throw t(Error(231), b, typeof c);
return c;
} var Ea = Math.random().toString(36).slice(2), Fa = "__reactInternalInstance$" + Ea, Ga = "__reactEventHandlers$" + Ea; function Ha(a) { if (a[Fa])
return a[Fa]; for (; !a[Fa];)
if (a.parentNode)
a = a.parentNode;
else
return null; a = a[Fa]; return 5 === a.tag || 6 === a.tag ? a : null; }
function Ia(a) { a = a[Fa]; return !a || 5 !== a.tag && 6 !== a.tag ? null : a; } function Ja(a) { if (5 === a.tag || 6 === a.tag)
return a.stateNode; throw t(Error(33)); }
function Ka(a) { return a[Ga] || null; } function La(a) { do
a = a.return;
while (a && 5 !== a.tag); return a ? a : null; } function Ma(a, b, c) { if (b = Da(a, c.dispatchConfig.phasedRegistrationNames[b]))
c._dispatchListeners = xa(c._dispatchListeners, b), c._dispatchInstances = xa(c._dispatchInstances, a); }
function Na(a) { if (a && a.dispatchConfig.phasedRegistrationNames) {
for (var b = a._targetInst, c = []; b;)
c.push(b), b = La(b);
for (b = c.length; 0 < b--;)
Ma(c[b], "captured", a);
for (b = 0; b < c.length; b++)
Ma(c[b], "bubbled", a);
} } function Oa(a, b, c) { a && c && c.dispatchConfig.registrationName && (b = Da(a, c.dispatchConfig.registrationName)) && (c._dispatchListeners = xa(c._dispatchListeners, b), c._dispatchInstances = xa(c._dispatchInstances, a)); } function Pa(a) { a && a.dispatchConfig.registrationName && Oa(a._targetInst, null, a); } function Qa(a) { ya(a, Na); } var Ra = !("undefined" === typeof window || "undefined" === typeof window.document || "undefined" === typeof window.document.createElement); function Sa(a, b) { var c = {}; c[a.toLowerCase()] = b.toLowerCase(); c["Webkit" + a] = "webkit" + b; c["Moz" + a] = "moz" + b; return c; } var Ta = { animationend: Sa("Animation", "AnimationEnd"), animationiteration: Sa("Animation", "AnimationIteration"), animationstart: Sa("Animation", "AnimationStart"), transitionend: Sa("Transition", "TransitionEnd") }, Ua = {}, Va = {}; Ra && (Va = document.createElement("div").style, "AnimationEvent" in window || (delete Ta.animationend.animation, delete Ta.animationiteration.animation, delete Ta.animationstart.animation), "TransitionEvent" in window || delete Ta.transitionend.transition); function Wa(a) { if (Ua[a])
return Ua[a]; if (!Ta[a])
return a; var b = Ta[a], c; for (c in b)
if (b.hasOwnProperty(c) && c in Va)
return Ua[a] = b[c]; return a; }
var Xa = Wa("animationend"), Ya = Wa("animationiteration"), Za = Wa("animationstart"), ab = Wa("transitionend"), bb = "abort canplay canplaythrough durationchange emptied encrypted ended error loadeddata loadedmetadata loadstart pause play playing progress ratechange seeked seeking stalled suspend timeupdate volumechange waiting".split(" "), cb = null, db = null, eb = null; function fb() { if (eb)
return eb; var a, b = db, c = b.length, d, e = "value" in cb ? cb.value : cb.textContent, f = e.length; for (a = 0; a < c && b[a] === e[a]; a++) ; var h = c - a; for (d = 1; d <= h && b[c - d] === e[f - d]; d++) ; return eb = e.slice(a, 1 < d ? 1 - d : void 0); }
function gb() { return !0; } function hb() { return !1; } function y(a, b, c, d) { this.dispatchConfig = a; this._targetInst = b; this.nativeEvent = c; a = this.constructor.Interface; for (var e in a)
a.hasOwnProperty(e) && ((b = a[e]) ? this[e] = b(c) : "target" === e ? this.target = d : this[e] = c[e]); this.isDefaultPrevented = (null != c.defaultPrevented ? c.defaultPrevented : !1 === c.returnValue) ? gb : hb; this.isPropagationStopped = hb; return this; }
m(y.prototype, { preventDefault: function () { this.defaultPrevented = !0; var a = this.nativeEvent; a && (a.preventDefault ? a.preventDefault() : "unknown" !== typeof a.returnValue && (a.returnValue = !1), this.isDefaultPrevented = gb); }, stopPropagation: function () { var a = this.nativeEvent; a && (a.stopPropagation ? a.stopPropagation() : "unknown" !== typeof a.cancelBubble && (a.cancelBubble = !0), this.isPropagationStopped = gb); }, persist: function () { this.isPersistent = gb; }, isPersistent: hb, destructor: function () {
var a = this.constructor.Interface, b;
for (b in a)
this[b] = null;
this.nativeEvent = this._targetInst = this.dispatchConfig = null;
this.isPropagationStopped = this.isDefaultPrevented = hb;
this._dispatchInstances = this._dispatchListeners = null;
} });
y.Interface = { type: null, target: null, currentTarget: function () { return null; }, eventPhase: null, bubbles: null, cancelable: null, timeStamp: function (a) { return a.timeStamp || Date.now(); }, defaultPrevented: null, isTrusted: null }; y.extend = function (a) { function b() { } function c() { return d.apply(this, arguments); } var d = this; b.prototype = d.prototype; var e = new b; m(e, c.prototype); c.prototype = e; c.prototype.constructor = c; c.Interface = m({}, d.Interface, a); c.extend = d.extend; ib(c); return c; }; ib(y); function jb(a, b, c, d) { if (this.eventPool.length) {
var e = this.eventPool.pop(); this.call(e, a, b, c, d); return e;
} return new this(a, b, c, d); } function kb(a) { if (!(a instanceof this))
throw t(Error(279)); a.destructor(); 10 > this.eventPool.length && this.eventPool.push(a); }
function ib(a) { a.eventPool = []; a.getPooled = jb; a.release = kb; } var lb = y.extend({ data: null }), mb = y.extend({ data: null }), nb = [9, 13, 27, 32], ob = Ra && "CompositionEvent" in window, pb = null; Ra && "documentMode" in document && (pb = document.documentMode); var qb = Ra && "TextEvent" in window && !pb, sb = Ra && (!ob || pb && 8 < pb && 11 >= pb), tb = String.fromCharCode(32), ub = { beforeInput: { phasedRegistrationNames: { bubbled: "onBeforeInput", captured: "onBeforeInputCapture" }, dependencies: ["compositionend", "keypress", "textInput", "paste"] }, compositionEnd: { phasedRegistrationNames: { bubbled: "onCompositionEnd", captured: "onCompositionEndCapture" }, dependencies: "blur compositionend keydown keypress keyup mousedown".split(" ") }, compositionStart: { phasedRegistrationNames: { bubbled: "onCompositionStart",
captured: "onCompositionStartCapture" }, dependencies: "blur compositionstart keydown keypress keyup mousedown".split(" ") }, compositionUpdate: { phasedRegistrationNames: { bubbled: "onCompositionUpdate", captured: "onCompositionUpdateCapture" }, dependencies: "blur compositionupdate keydown keypress keyup mousedown".split(" ") } }, vb = !1;
function wb(a, b) { switch (a) {
case "keyup": return -1 !== nb.indexOf(b.keyCode); case "keydown": return 229 !== b.keyCode; case "keypress": case "mousedown": case "blur": return !0; default: return !1;
} } function xb(a) { a = a.detail; return "object" === typeof a && "data" in a ? a.data : null; } var yb = !1; function Ab(a, b) { switch (a) {
case "compositionend": return xb(b);
case "keypress":
if (32 !== b.which)
return null;
vb = !0;
return tb;
case "textInput": return a = b.data, a === tb && vb ? null : a;
default: return null;
} } function Bb(a, b) { if (yb)
return "compositionend" === a || !ob && wb(a, b) ? (a = fb(), eb = db = cb = null, yb = !1, a) : null; switch (a) {
case "paste": return null;
case "keypress":
if (!(b.ctrlKey || b.altKey || b.metaKey) || b.ctrlKey && b.altKey) {
if (b.char && 1 < b.char.length)
return b.char;
if (b.which)
return String.fromCharCode(b.which);
}
return null;
case "compositionend": return sb && "ko" !== b.locale ? null : b.data;
default: return null;
} } var Cb = { eventTypes: ub, extractEvents: function (a, b, c, d) {
var e = void 0;
var f = void 0;
if (ob)
b: {
switch (a) {
case "compositionstart":
e = ub.compositionStart;
break b;
case "compositionend":
e = ub.compositionEnd;
break b;
case "compositionupdate":
e = ub.compositionUpdate;
break b;
}
e = void 0;
}
else
yb ? wb(a, c) && (e = ub.compositionEnd) : "keydown" === a && 229 === c.keyCode && (e = ub.compositionStart);
e ? (sb && "ko" !== c.locale && (yb || e !== ub.compositionStart ? e === ub.compositionEnd && yb && (f = fb()) : (cb = d, db = "value" in cb ? cb.value : cb.textContent, yb =
!0)), e = lb.getPooled(e, b, c, d), f ? e.data = f : (f = xb(c), null !== f && (e.data = f)), Qa(e), f = e) : f = null;
(a = qb ? Ab(a, c) : Bb(a, c)) ? (b = mb.getPooled(ub.beforeInput, b, c, d), b.data = a, Qa(b)) : b = null;
return null === f ? b : null === b ? f : [f, b];
} }, Db = null, Eb = null, Fb = null;
function Gb(a) { if (a = ta(a)) {
if ("function" !== typeof Db)
throw t(Error(280));
var b = sa(a.stateNode);
Db(a.stateNode, a.type, b);
} } function Hb(a) { Eb ? Fb ? Fb.push(a) : Fb = [a] : Eb = a; } function Ib() { if (Eb) {
var a = Eb, b = Fb;
Fb = Eb = null;
Gb(a);
if (b)
for (a = 0; a < b.length; a++)
Gb(b[a]);
} } function Jb(a, b) { return a(b); } function Kb(a, b, c, d) { return a(b, c, d); } function Lb() { } var Mb = Jb, Nb = !1; function Ob() { if (null !== Eb || null !== Fb)
Lb(), Ib(); }
var Pb = { color: !0, date: !0, datetime: !0, "datetime-local": !0, email: !0, month: !0, number: !0, password: !0, range: !0, search: !0, tel: !0, text: !0, time: !0, url: !0, week: !0 }; function Qb(a) { var b = a && a.nodeName && a.nodeName.toLowerCase(); return "input" === b ? !!Pb[a.type] : "textarea" === b ? !0 : !1; } function Rb(a) { a = a.target || a.srcElement || window; a.correspondingUseElement && (a = a.correspondingUseElement); return 3 === a.nodeType ? a.parentNode : a; } function Sb(a) { if (!Ra)
return !1; a = "on" + a; var b = a in document; b || (b = document.createElement("div"), b.setAttribute(a, "return;"), b = "function" === typeof b[a]); return b; }
function Tb(a) { var b = a.type; return (a = a.nodeName) && "input" === a.toLowerCase() && ("checkbox" === b || "radio" === b); } function Ub(a) {
var b = Tb(a) ? "checked" : "value", c = Object.getOwnPropertyDescriptor(a.constructor.prototype, b), d = "" + a[b];
if (!a.hasOwnProperty(b) && "undefined" !== typeof c && "function" === typeof c.get && "function" === typeof c.set) {
var e = c.get, f = c.set;
Object.defineProperty(a, b, { configurable: !0, get: function () { return e.call(this); }, set: function (a) { d = "" + a; f.call(this, a); } });
Object.defineProperty(a, b, { enumerable: c.enumerable });
return { getValue: function () { return d; }, setValue: function (a) { d = "" + a; }, stopTracking: function () {
a._valueTracker =
null;
delete a[b];
} };
}
} function Vb(a) { a._valueTracker || (a._valueTracker = Ub(a)); } function Wb(a) { if (!a)
return !1; var b = a._valueTracker; if (!b) return !0; var c = b.getValue(); var d = ""; a && (d = Tb(a) ? a.checked ? "true" : "false" : a.value); a = d; return a !== c ? (b.setValue(a), !0) : !1; }
var Xb = aa.__SECRET_INTERNALS_DO_NOT_USE_OR_YOU_WILL_BE_FIRED; Xb.hasOwnProperty("ReactCurrentDispatcher") || (Xb.ReactCurrentDispatcher = { current: null }); Xb.hasOwnProperty("ReactCurrentBatchConfig") || (Xb.ReactCurrentBatchConfig = { suspense: null }); var Yb = /^(.*)[\\\/]/, B = "function" === typeof Symbol && Symbol.for, Zb = B ? Symbol.for("react.element") : 60103, $b = B ? Symbol.for("react.portal") : 60106, ac = B ? Symbol.for("react.fragment") : 60107, bc = B ? Symbol.for("react.strict_mode") : 60108, cc = B ? Symbol.for("react.profiler") : 60114, dc = B ? Symbol.for("react.provider") : 60109, ec = B ? Symbol.for("react.context") : 60110, fc = B ? Symbol.for("react.concurrent_mode") : 60111, gc = B ? Symbol.for("react.forward_ref") : 60112, hc = B ? Symbol.for("react.suspense") : 60113, ic = B ? Symbol.for("react.suspense_list") :
60120, jc = B ? Symbol.for("react.memo") : 60115, kc = B ? Symbol.for("react.lazy") : 60116;
B && Symbol.for("react.fundamental"); B && Symbol.for("react.responder"); var lc = "function" === typeof Symbol && Symbol.iterator; function mc(a) { if (null === a || "object" !== typeof a)
return null; a = lc && a[lc] || a["@@iterator"]; return "function" === typeof a ? a : null; }
function oc(a) {
if (null == a)
return null;
if ("function" === typeof a)
return a.displayName || a.name || null;
if ("string" === typeof a)
return a;
switch (a) {
case ac: return "Fragment";
case $b: return "Portal";
case cc: return "Profiler";
case bc: return "StrictMode";
case hc: return "Suspense";
case ic: return "SuspenseList";
}
if ("object" === typeof a)
switch (a.$$typeof) {
case ec: return "Context.Consumer";
case dc: return "Context.Provider";
case gc:
var b = a.render;
b = b.displayName || b.name || "";
return a.displayName || ("" !== b ? "ForwardRef(" + b + ")" :
"ForwardRef");
case jc: return oc(a.type);
case kc: if (a = 1 === a._status ? a._result : null)
return oc(a);
}
return null;
} function pc(a) { var b = ""; do {
a: switch (a.tag) {
case 3:
case 4:
case 6:
case 7:
case 10:
case 9:
var c = "";
break a;
default:
var d = a._debugOwner, e = a._debugSource, f = oc(a.type);
c = null;
d && (c = oc(d.type));
d = f;
f = "";
e ? f = " (at " + e.fileName.replace(Yb, "") + ":" + e.lineNumber + ")" : c && (f = " (created by " + c + ")");
c = "\n in " + (d || "Unknown") + f;
}
b += c;
a = a.return;
} while (a); return b; } var qc = /^[:A-Z_a-z\u00C0-\u00D6\u00D8-\u00F6\u00F8-\u02FF\u0370-\u037D\u037F-\u1FFF\u200C-\u200D\u2070-\u218F\u2C00-\u2FEF\u3001-\uD7FF\uF900-\uFDCF\uFDF0-\uFFFD][:A-Z_a-z\u00C0-\u00D6\u00D8-\u00F6\u00F8-\u02FF\u0370-\u037D\u037F-\u1FFF\u200C-\u200D\u2070-\u218F\u2C00-\u2FEF\u3001-\uD7FF\uF900-\uFDCF\uFDF0-\uFFFD\-.0-9\u00B7\u0300-\u036F\u203F-\u2040]*$/, rc = Object.prototype.hasOwnProperty, sc = {}, tc = {}; function uc(a) { if (rc.call(tc, a))
return !0; if (rc.call(sc, a)) return !1; if (qc.test(a)) return tc[a] = !0; sc[a] = !0; return !1; }
function vc(a, b, c, d) { if (null !== c && 0 === c.type)
return !1; switch (typeof b) {
case "function":
case "symbol": return !0;
case "boolean":
if (d)
return !1;
if (null !== c)
return !c.acceptsBooleans;
a = a.toLowerCase().slice(0, 5);
return "data-" !== a && "aria-" !== a;
default: return !1;
} } function wc(a, b, c, d) { if (null === b || "undefined" === typeof b || vc(a, b, c, d))
return !0; if (d)
return !1; if (null !== c)
switch (c.type) {
case 3: return !b;
case 4: return !1 === b;
case 5: return isNaN(b);
case 6: return isNaN(b) || 1 > b;
} return !1; }
function D(a, b, c, d, e, f) { this.acceptsBooleans = 2 === b || 3 === b || 4 === b; this.attributeName = d; this.attributeNamespace = e; this.mustUseProperty = c; this.propertyName = a; this.type = b; this.sanitizeURL = f; } var F = {}; "children dangerouslySetInnerHTML defaultValue defaultChecked innerHTML suppressContentEditableWarning suppressHydrationWarning style".split(" ").forEach(function (a) { F[a] = new D(a, 0, !1, a, null, !1); }); [["acceptCharset", "accept-charset"], ["className", "class"], ["htmlFor", "for"], ["httpEquiv", "http-equiv"]].forEach(function (a) { var b = a[0]; F[b] = new D(b, 1, !1, a[1], null, !1); }); ["contentEditable", "draggable", "spellCheck", "value"].forEach(function (a) { F[a] = new D(a, 2, !1, a.toLowerCase(), null, !1); }); ["autoReverse", "externalResourcesRequired", "focusable", "preserveAlpha"].forEach(function (a) { F[a] = new D(a, 2, !1, a, null, !1); }); "allowFullScreen async autoFocus autoPlay controls default defer disabled disablePictureInPicture formNoValidate hidden loop noModule noValidate open playsInline readOnly required reversed scoped seamless itemScope".split(" ").forEach(function (a) { F[a] = new D(a, 3, !1, a.toLowerCase(), null, !1); }); ["checked", "multiple", "muted", "selected"].forEach(function (a) { F[a] = new D(a, 3, !0, a, null, !1); }); ["capture", "download"].forEach(function (a) { F[a] = new D(a, 4, !1, a, null, !1); }); ["cols", "rows", "size", "span"].forEach(function (a) { F[a] = new D(a, 6, !1, a, null, !1); }); ["rowSpan", "start"].forEach(function (a) { F[a] = new D(a, 5, !1, a.toLowerCase(), null, !1); }); var xc = /[\-:]([a-z])/g; function yc(a) { return a[1].toUpperCase(); } "accent-height alignment-baseline arabic-form baseline-shift cap-height clip-path clip-rule color-interpolation color-interpolation-filters color-profile color-rendering dominant-baseline enable-background fill-opacity fill-rule flood-color flood-opacity font-family font-size font-size-adjust font-stretch font-style font-variant font-weight glyph-name glyph-orientation-horizontal glyph-orientation-vertical horiz-adv-x horiz-origin-x image-rendering letter-spacing lighting-color marker-end marker-mid marker-start overline-position overline-thickness paint-order panose-1 pointer-events rendering-intent shape-rendering stop-color stop-opacity strikethrough-position strikethrough-thickness stroke-dasharray stroke-dashoffset stroke-linecap stroke-linejoin stroke-miterlimit stroke-opacity stroke-width text-anchor text-decoration text-rendering underline-position underline-thickness unicode-bidi unicode-range units-per-em v-alphabetic v-hanging v-ideographic v-mathematical vector-effect vert-adv-y vert-origin-x vert-origin-y word-spacing writing-mode xmlns:xlink x-height".split(" ").forEach(function (a) {
var b = a.replace(xc, yc); F[b] = new D(b, 1, !1, a, null, !1);
}); "xlink:actuate xlink:arcrole xlink:role xlink:show xlink:title xlink:type".split(" ").forEach(function (a) { var b = a.replace(xc, yc); F[b] = new D(b, 1, !1, a, "http://www.w3.org/1999/xlink", !1); }); ["xml:base", "xml:lang", "xml:space"].forEach(function (a) { var b = a.replace(xc, yc); F[b] = new D(b, 1, !1, a, "http://www.w3.org/XML/1998/namespace", !1); }); ["tabIndex", "crossOrigin"].forEach(function (a) { F[a] = new D(a, 1, !1, a.toLowerCase(), null, !1); }); F.xlinkHref = new D("xlinkHref", 1, !1, "xlink:href", "http://www.w3.org/1999/xlink", !0); ["src", "href", "action", "formAction"].forEach(function (a) { F[a] = new D(a, 1, !1, a.toLowerCase(), null, !0); }); function zc(a, b, c, d) { var e = F.hasOwnProperty(b) ? F[b] : null; var f = null !== e ? 0 === e.type : d ? !1 : !(2 < b.length) || "o" !== b[0] && "O" !== b[0] || "n" !== b[1] && "N" !== b[1] ? !1 : !0; f || (wc(b, c, e, d) && (c = null), d || null === e ? uc(b) && (null === c ? a.removeAttribute(b) : a.setAttribute(b, "" + c)) : e.mustUseProperty ? a[e.propertyName] = null === c ? 3 === e.type ? !1 : "" : c : (b = e.attributeName, d = e.attributeNamespace, null === c ? a.removeAttribute(b) : (e = e.type, c = 3 === e || 4 === e && !0 === c ? "" : "" + c, d ? a.setAttributeNS(d, b, c) : a.setAttribute(b, c)))); } function Ac(a) { switch (typeof a) {
case "boolean": case "number": case "object": case "string": case "undefined": return a; default: return "";
} } function Bc(a, b) { var c = b.checked; return m({}, b, { defaultChecked: void 0, defaultValue: void 0, value: void 0, checked: null != c ? c : a._wrapperState.initialChecked }); } function Cc(a, b) { var c = null == b.defaultValue ? "" : b.defaultValue, d = null != b.checked ? b.checked : b.defaultChecked; c = Ac(null != b.value ? b.value : c); a._wrapperState = { initialChecked: d, initialValue: c, controlled: "checkbox" === b.type || "radio" === b.type ? null != b.checked : null != b.value }; } function Dc(a, b) { b = b.checked; null != b && zc(a, "checked", b, !1); } function Ec(a, b) { Dc(a, b); var c = Ac(b.value), d = b.type; if (null != c)
if ("number" === d) {
if (0 === c && "" === a.value || a.value != c)
a.value = "" + c;
}
else
a.value !== "" + c && (a.value = "" + c);
else if ("submit" === d || "reset" === d) {
a.removeAttribute("value");
return;
} b.hasOwnProperty("value") ? Fc(a, b.type, c) : b.hasOwnProperty("defaultValue") && Fc(a, b.type, Ac(b.defaultValue)); null == b.checked && null != b.defaultChecked && (a.defaultChecked = !!b.defaultChecked); } function Gc(a, b, c) { if (b.hasOwnProperty("value") || b.hasOwnProperty("defaultValue")) {
var d = b.type;
if (!("submit" !== d && "reset" !== d || void 0 !== b.value && null !== b.value))
return;
b = "" + a._wrapperState.initialValue;
c || b === a.value || (a.value = b);
a.defaultValue = b;
} c = a.name; "" !== c && (a.name = ""); a.defaultChecked = !a.defaultChecked; a.defaultChecked = !!a._wrapperState.initialChecked; "" !== c && (a.name = c); } function Fc(a, b, c) { if ("number" !== b || a.ownerDocument.activeElement !== a)
null == c ? a.defaultValue = "" + a._wrapperState.initialValue : a.defaultValue !== "" + c && (a.defaultValue = "" + c); }
var Hc = { change: { phasedRegistrationNames: { bubbled: "onChange", captured: "onChangeCapture" }, dependencies: "blur change click focus input keydown keyup selectionchange".split(" ") } }; function Ic(a, b, c) { a = y.getPooled(Hc.change, a, b, c); a.type = "change"; Hb(c); Qa(a); return a; } var Jc = null, Kc = null; function Lc(a) { Ba(a); } function Mc(a) { var b = Ja(a); if (Wb(b))
return a; }
function Nc(a, b) { if ("change" === a)
return b; }
var Oc = !1; Ra && (Oc = Sb("input") && (!document.documentMode || 9 < document.documentMode)); function Pc() { Jc && (Jc.detachEvent("onpropertychange", Qc), Kc = Jc = null); } function Qc(a) { if ("value" === a.propertyName && Mc(Kc))
if (a = Ic(Kc, a, Rb(a)), Nb)
Ba(a);
else {
Nb = !0;
try {
Jb(Lc, a);
}
finally {
Nb = !1, Ob();
}
} }
function Rc(a, b, c) { "focus" === a ? (Pc(), Jc = b, Kc = c, Jc.attachEvent("onpropertychange", Qc)) : "blur" === a && Pc(); } function Sc(a) { if ("selectionchange" === a || "keyup" === a || "keydown" === a)
return Mc(Kc); }
function Tc(a, b) { if ("click" === a)
return Mc(b); }
function Uc(a, b) { if ("input" === a || "change" === a)
return Mc(b); }
var Vc = { eventTypes: Hc, _isInputEventSupported: Oc, extractEvents: function (a, b, c, d) { var e = b ? Ja(b) : window, f = void 0, h = void 0, g = e.nodeName && e.nodeName.toLowerCase(); "select" === g || "input" === g && "file" === e.type ? f = Nc : Qb(e) ? Oc ? f = Uc : (f = Sc, h = Rc) : (g = e.nodeName) && "input" === g.toLowerCase() && ("checkbox" === e.type || "radio" === e.type) && (f = Tc); if (f && (f = f(a, b)))
return Ic(f, c, d); h && h(a, e, b); "blur" === a && (a = e._wrapperState) && a.controlled && "number" === e.type && Fc(e, "number", e.value); } }, Wc = y.extend({ view: null, detail: null }), Xc = { Alt: "altKey",
Control: "ctrlKey", Meta: "metaKey", Shift: "shiftKey" };
function Yc(a) { var b = this.nativeEvent; return b.getModifierState ? b.getModifierState(a) : (a = Xc[a]) ? !!b[a] : !1; } function Zc() { return Yc; } var $c = 0, ad = 0, bd = !1, cd = !1, dd = Wc.extend({ screenX: null, screenY: null, clientX: null, clientY: null, pageX: null, pageY: null, ctrlKey: null, shiftKey: null, altKey: null, metaKey: null, getModifierState: Zc, button: null, buttons: null, relatedTarget: function (a) { return a.relatedTarget || (a.fromElement === a.srcElement ? a.toElement : a.fromElement); }, movementX: function (a) { if ("movementX" in a)
return a.movementX; var b = $c; $c = a.screenX; return bd ? "mousemove" === a.type ? a.screenX - b : 0 : (bd = !0, 0); }, movementY: function (a) {
if ("movementY" in a)
return a.movementY;
var b = ad;
ad = a.screenY;
return cd ? "mousemove" === a.type ? a.screenY - b : 0 : (cd = !0, 0);
} }), ed = dd.extend({ pointerId: null, width: null, height: null, pressure: null, tangentialPressure: null, tiltX: null, tiltY: null, twist: null, pointerType: null, isPrimary: null }), fd = { mouseEnter: { registrationName: "onMouseEnter", dependencies: ["mouseout", "mouseover"] }, mouseLeave: { registrationName: "onMouseLeave", dependencies: ["mouseout", "mouseover"] }, pointerEnter: { registrationName: "onPointerEnter", dependencies: ["pointerout", "pointerover"] }, pointerLeave: { registrationName: "onPointerLeave",
dependencies: ["pointerout", "pointerover"] } }, gd = { eventTypes: fd, extractEvents: function (a, b, c, d) {
var e = "mouseover" === a || "pointerover" === a, f = "mouseout" === a || "pointerout" === a;
if (e && (c.relatedTarget || c.fromElement) || !f && !e)
return null;
e = d.window === d ? d : (e = d.ownerDocument) ? e.defaultView || e.parentWindow : window;
f ? (f = b, b = (b = c.relatedTarget || c.toElement) ? Ha(b) : null) : f = null;
if (f === b)
return null;
var h = void 0, g = void 0, k = void 0, l = void 0;
if ("mouseout" === a || "mouseover" === a)
h = dd, g = fd.mouseLeave, k = fd.mouseEnter, l = "mouse";
else if ("pointerout" === a || "pointerover" === a)
h = ed, g = fd.pointerLeave, k = fd.pointerEnter, l = "pointer";
var n = null == f ? e : Ja(f);
e = null == b ? e : Ja(b);
a = h.getPooled(g, f, c, d);
a.type = l + "leave";
a.target = n;
a.relatedTarget = e;
c = h.getPooled(k, b, c, d);
c.type = l + "enter";
c.target = e;
c.relatedTarget = n;
d = b;
if (f && d)
a: {
b = f;
e = d;
l = 0;
for (h = b; h; h = La(h))
l++;
h = 0;
for (k = e; k; k = La(k))
h++;
for (; 0 < l - h;)
b = La(b), l--;
for (; 0 < h - l;)
e = La(e), h--;
for (; l--;) {
if (b === e || b === e.alternate)
break a;
b = La(b);
e = La(e);
}
b = null;
}
else
b = null;
e = b;
for (b = []; f && f !== e;) {
l =
f.alternate;
if (null !== l && l === e)
break;
b.push(f);
f = La(f);
}
for (f = []; d && d !== e;) {
l = d.alternate;
if (null !== l && l === e)
break;
f.push(d);
d = La(d);
}
for (d = 0; d < b.length; d++)
Oa(b[d], "bubbled", a);
for (d = f.length; 0 < d--;)
Oa(f[d], "captured", c);
return [a, c];
} };
function hd(a, b) { return a === b && (0 !== a || 1 / a === 1 / b) || a !== a && b !== b; } var id = Object.prototype.hasOwnProperty; function jd(a, b) { if (hd(a, b))
return !0; if ("object" !== typeof a || null === a || "object" !== typeof b || null === b)
return !1; var c = Object.keys(a), d = Object.keys(b); if (c.length !== d.length)
return !1; for (d = 0; d < c.length; d++)
if (!id.call(b, c[d]) || !hd(a[c[d]], b[c[d]]))
return !1; return !0; }
function kd(a, b) { return { responder: a, props: b }; } new Map; new Map; new Set; new Map; function ld(a) { var b = a; if (a.alternate)
for (; b.return;)
b = b.return;
else {
if (0 !== (b.effectTag & 2))
return 1;
for (; b.return;)
if (b = b.return, 0 !== (b.effectTag & 2))
return 1;
} return 3 === b.tag ? 2 : 3; } function od(a) { if (2 !== ld(a))
throw t(Error(188)); }
function pd(a) {
var b = a.alternate;
if (!b) {
b = ld(a);
if (3 === b)
throw t(Error(188));
return 1 === b ? null : a;
}
for (var c = a, d = b;;) {
var e = c.return;
if (null === e)
break;
var f = e.alternate;
if (null === f) {
d = e.return;
if (null !== d) {
c = d;
continue;
}
break;
}
if (e.child === f.child) {
for (f = e.child; f;) {
if (f === c)
return od(e), a;
if (f === d)
return od(e), b;
f = f.sibling;
}
throw t(Error(188));
}
if (c.return !== d.return)
c = e, d = f;
else {
for (var h = !1, g = e.child; g;) {
if (g === c) {
h = !0;
c = e;
d = f;
break;
}
if (g === d) {
h = !0;
d = e;
c = f;
break;
}
g = g.sibling;
}
if (!h) {
for (g = f.child; g;) {
if (g ===
c) {
h = !0;
c = f;
d = e;
break;
}
if (g === d) {
h = !0;
d = f;
c = e;
break;
}
g = g.sibling;
}
if (!h)
throw t(Error(189));
}
}
if (c.alternate !== d)
throw t(Error(190));
}
if (3 !== c.tag)
throw t(Error(188));
return c.stateNode.current === c ? a : b;
} function qd(a) { a = pd(a); if (!a)
return null; for (var b = a;;) {
if (5 === b.tag || 6 === b.tag)
return b;
if (b.child)
b.child.return = b, b = b.child;
else {
if (b === a)
break;
for (; !b.sibling;) {
if (!b.return || b.return === a)
return null;
b = b.return;
}
b.sibling.return = b.return;
b = b.sibling;
}
} return null; } var rd = y.extend({ animationName: null, elapsedTime: null, pseudoElement: null }), sd = y.extend({ clipboardData: function (a) { return "clipboardData" in a ? a.clipboardData : window.clipboardData; } }), td = Wc.extend({ relatedTarget: null }); function ud(a) { var b = a.keyCode; "charCode" in a ? (a = a.charCode, 0 === a && 13 === b && (a = 13)) : a = b; 10 === a && (a = 13); return 32 <= a || 13 === a ? a : 0; } var vd = { Esc: "Escape", Spacebar: " ", Left: "ArrowLeft", Up: "ArrowUp", Right: "ArrowRight", Down: "ArrowDown", Del: "Delete", Win: "OS", Menu: "ContextMenu", Apps: "ContextMenu", Scroll: "ScrollLock", MozPrintableKey: "Unidentified" }, wd = { 8: "Backspace", 9: "Tab", 12: "Clear", 13: "Enter", 16: "Shift", 17: "Control", 18: "Alt", 19: "Pause", 20: "CapsLock", 27: "Escape", 32: " ", 33: "PageUp", 34: "PageDown", 35: "End", 36: "Home", 37: "ArrowLeft", 38: "ArrowUp", 39: "ArrowRight", 40: "ArrowDown", 45: "Insert", 46: "Delete", 112: "F1", 113: "F2", 114: "F3", 115: "F4",
116: "F5", 117: "F6", 118: "F7", 119: "F8", 120: "F9", 121: "F10", 122: "F11", 123: "F12", 144: "NumLock", 145: "ScrollLock", 224: "Meta" }, xd = Wc.extend({ key: function (a) { if (a.key) {
var b = vd[a.key] || a.key;
if ("Unidentified" !== b)
return b;
} return "keypress" === a.type ? (a = ud(a), 13 === a ? "Enter" : String.fromCharCode(a)) : "keydown" === a.type || "keyup" === a.type ? wd[a.keyCode] || "Unidentified" : ""; }, location: null, ctrlKey: null, shiftKey: null, altKey: null, metaKey: null, repeat: null, locale: null, getModifierState: Zc, charCode: function (a) {
return "keypress" ===
a.type ? ud(a) : 0;
}, keyCode: function (a) { return "keydown" === a.type || "keyup" === a.type ? a.keyCode : 0; }, which: function (a) { return "keypress" === a.type ? ud(a) : "keydown" === a.type || "keyup" === a.type ? a.keyCode : 0; } }), yd = dd.extend({ dataTransfer: null }), zd = Wc.extend({ touches: null, targetTouches: null, changedTouches: null, altKey: null, metaKey: null, ctrlKey: null, shiftKey: null, getModifierState: Zc }), Ad = y.extend({ propertyName: null, elapsedTime: null, pseudoElement: null }), Bd = dd.extend({ deltaX: function (a) {
return "deltaX" in a ? a.deltaX : "wheelDeltaX" in
a ? -a.wheelDeltaX : 0;
}, deltaY: function (a) { return "deltaY" in a ? a.deltaY : "wheelDeltaY" in a ? -a.wheelDeltaY : "wheelDelta" in a ? -a.wheelDelta : 0; }, deltaZ: null, deltaMode: null }), Cd = [["blur", "blur", 0], ["cancel", "cancel", 0], ["click", "click", 0], ["close", "close", 0], ["contextmenu", "contextMenu", 0], ["copy", "copy", 0], ["cut", "cut", 0], ["auxclick", "auxClick", 0], ["dblclick", "doubleClick", 0], ["dragend", "dragEnd", 0], ["dragstart", "dragStart", 0], ["drop", "drop", 0], ["focus", "focus", 0], ["input", "input", 0], ["invalid", "invalid", 0],
["keydown", "keyDown", 0], ["keypress", "keyPress", 0], ["keyup", "keyUp", 0], ["mousedown", "mouseDown", 0], ["mouseup", "mouseUp", 0], ["paste", "paste", 0], ["pause", "pause", 0], ["play", "play", 0], ["pointercancel", "pointerCancel", 0], ["pointerdown", "pointerDown", 0], ["pointerup", "pointerUp", 0], ["ratechange", "rateChange", 0], ["reset", "reset", 0], ["seeked", "seeked", 0], ["submit", "submit", 0], ["touchcancel", "touchCancel", 0], ["touchend", "touchEnd", 0], ["touchstart", "touchStart", 0], ["volumechange", "volumeChange", 0], ["drag", "drag",
1], ["dragenter", "dragEnter", 1], ["dragexit", "dragExit", 1], ["dragleave", "dragLeave", 1], ["dragover", "dragOver", 1], ["mousemove", "mouseMove", 1], ["mouseout", "mouseOut", 1], ["mouseover", "mouseOver", 1], ["pointermove", "pointerMove", 1], ["pointerout", "pointerOut", 1], ["pointerover", "pointerOver", 1], ["scroll", "scroll", 1], ["toggle", "toggle", 1], ["touchmove", "touchMove", 1], ["wheel", "wheel", 1], ["abort", "abort", 2], [Xa, "animationEnd", 2], [Ya, "animationIteration", 2], [Za, "animationStart", 2], ["canplay", "canPlay", 2], ["canplaythrough",
"canPlayThrough", 2], ["durationchange", "durationChange", 2], ["emptied", "emptied", 2], ["encrypted", "encrypted", 2], ["ended", "ended", 2], ["error", "error", 2], ["gotpointercapture", "gotPointerCapture", 2], ["load", "load", 2], ["loadeddata", "loadedData", 2], ["loadedmetadata", "loadedMetadata", 2], ["loadstart", "loadStart", 2], ["lostpointercapture", "lostPointerCapture", 2], ["playing", "playing", 2], ["progress", "progress", 2], ["seeking", "seeking", 2], ["stalled", "stalled", 2], ["suspend", "suspend", 2], ["timeupdate", "timeUpdate",
2], [ab, "transitionEnd", 2], ["waiting", "waiting", 2]], Dd = {}, Ed = {}, Fd = 0;
for (; Fd < Cd.length; Fd++) {
var Gd = Cd[Fd], Hd = Gd[0], Id = Gd[1], Jd = Gd[2], Kd = "on" + (Id[0].toUpperCase() + Id.slice(1)), Ld = { phasedRegistrationNames: { bubbled: Kd, captured: Kd + "Capture" }, dependencies: [Hd], eventPriority: Jd };
Dd[Id] = Ld;
Ed[Hd] = Ld;
} var Md = { eventTypes: Dd, getEventPriority: function (a) { a = Ed[a]; return void 0 !== a ? a.eventPriority : 2; }, extractEvents: function (a, b, c, d) {
var e = Ed[a];
if (!e)
return null;
switch (a) {
case "keypress": if (0 === ud(c))
return null;
case "keydown":
case "keyup":
a = xd;
break;
case "blur":
case "focus":
a = td;
break;
case "click": if (2 === c.button)
return null;
case "auxclick":
case "dblclick":
case "mousedown":
case "mousemove":
case "mouseup":
case "mouseout":
case "mouseover":
case "contextmenu":
a = dd;
break;
case "drag":
case "dragend":
case "dragenter":
case "dragexit":
case "dragleave":
case "dragover":
case "dragstart":
case "drop":
a =
yd;
break;
case "touchcancel":
case "touchend":
case "touchmove":
case "touchstart":
a = zd;
break;
case Xa:
case Ya:
case Za:
a = rd;
break;
case ab:
a = Ad;
break;
case "scroll":
a = Wc;
break;
case "wheel":
a = Bd;
break;
case "copy":
case "cut":
case "paste":
a = sd;
break;
case "gotpointercapture":
case "lostpointercapture":
case "pointercancel":
case "pointerdown":
case "pointermove":
case "pointerout":
case "pointerover":
case "pointerup":
a = ed;
break;
default: a = y;
}
b = a.getPooled(e, b, c, d);
Qa(b);
return b;
} }, Nd = Md.getEventPriority, Od = [];
function Pd(a) { var b = a.targetInst, c = b; do {
if (!c) {
a.ancestors.push(c);
break;
}
var d;
for (d = c; d.return;)
d = d.return;
d = 3 !== d.tag ? null : d.stateNode.containerInfo;
if (!d)
break;
a.ancestors.push(c);
c = Ha(d);
} while (c); for (c = 0; c < a.ancestors.length; c++) {
b = a.ancestors[c];
var e = Rb(a.nativeEvent);
d = a.topLevelType;
for (var f = a.nativeEvent, h = null, g = 0; g < ea.length; g++) {
var k = ea[g];
k && (k = k.extractEvents(d, b, f, e)) && (h = xa(h, k));
}
Ba(h);
} } var Qd = !0; function G(a, b) { Rd(b, a, !1); } function Rd(a, b, c) { switch (Nd(b)) {
case 0:
var d = Sd.bind(null, b, 1);
break;
case 1:
d = Td.bind(null, b, 1);
break;
default: d = Ud.bind(null, b, 1);
} c ? a.addEventListener(b, d, !0) : a.addEventListener(b, d, !1); } function Sd(a, b, c) { Nb || Lb(); var d = Ud, e = Nb; Nb = !0; try {
Kb(d, a, b, c);
} finally {
(Nb = e) || Ob();
} } function Td(a, b, c) { Ud(a, b, c); } function Ud(a, b, c) { if (Qd) {
b = Rb(c);
b = Ha(b);
null === b || "number" !== typeof b.tag || 2 === ld(b) || (b = null);
if (Od.length) {
var d = Od.pop();
d.topLevelType = a;
d.nativeEvent = c;
d.targetInst = b;
a = d;
}
else
a = { topLevelType: a, nativeEvent: c, targetInst: b, ancestors: [] };
try {
if (c = a, Nb)
Pd(c, void 0);
else {
Nb = !0;
try {
Mb(Pd, c, void 0);
}
finally {
Nb = !1, Ob();
}
}
}
finally {
a.topLevelType = null, a.nativeEvent = null, a.targetInst = null, a.ancestors.length = 0, 10 > Od.length && Od.push(a);
}
} } var Vd = new ("function" === typeof WeakMap ? WeakMap : Map); function Wd(a) { var b = Vd.get(a); void 0 === b && (b = new Set, Vd.set(a, b)); return b; } function Xd(a) { a = a || ("undefined" !== typeof document ? document : void 0); if ("undefined" === typeof a)
return null; try {
return a.activeElement || a.body;
} catch (b) {
return a.body;
} } function Yd(a) { for (; a && a.firstChild;)
a = a.firstChild; return a; }
function Zd(a, b) { var c = Yd(a); a = 0; for (var d; c;) {
if (3 === c.nodeType) {
d = a + c.textContent.length;
if (a <= b && d >= b)
return { node: c, offset: b - a };
a = d;
}
a: {
for (; c;) {
if (c.nextSibling) {
c = c.nextSibling;
break a;
}
c = c.parentNode;
}
c = void 0;
}
c = Yd(c);
} } function $d(a, b) { return a && b ? a === b ? !0 : a && 3 === a.nodeType ? !1 : b && 3 === b.nodeType ? $d(a, b.parentNode) : "contains" in a ? a.contains(b) : a.compareDocumentPosition ? !!(a.compareDocumentPosition(b) & 16) : !1 : !1; } function ae() { for (var a = window, b = Xd(); b instanceof a.HTMLIFrameElement;) {
try {
var c = "string" === typeof b.contentWindow.location.href;
}
catch (d) {
c = !1;
}
if (c)
a = b.contentWindow;
else
break;
b = Xd(a.document);
} return b; } function be(a) { var b = a && a.nodeName && a.nodeName.toLowerCase(); return b && ("input" === b && ("text" === a.type || "search" === a.type || "tel" === a.type || "url" === a.type || "password" === a.type) || "textarea" === b || "true" === a.contentEditable); } var ce = Ra && "documentMode" in document && 11 >= document.documentMode, de = { select: { phasedRegistrationNames: { bubbled: "onSelect", captured: "onSelectCapture" }, dependencies: "blur contextmenu dragend focus keydown keyup mousedown mouseup selectionchange".split(" ") } }, ee = null, fe = null, ge = null, he = !1; function ie(a, b) { var c = b.window === b ? b.document : 9 === b.nodeType ? b : b.ownerDocument; if (he || null == ee || ee !== Xd(c))
return null; c = ee; "selectionStart" in c && be(c) ? c = { start: c.selectionStart, end: c.selectionEnd } : (c = (c.ownerDocument && c.ownerDocument.defaultView || window).getSelection(), c = { anchorNode: c.anchorNode, anchorOffset: c.anchorOffset, focusNode: c.focusNode, focusOffset: c.focusOffset }); return ge && jd(ge, c) ? null : (ge = c, a = y.getPooled(de.select, fe, a, b), a.type = "select", a.target = ee, Qa(a), a); }
var je = { eventTypes: de, extractEvents: function (a, b, c, d) {
var e = d.window === d ? d.document : 9 === d.nodeType ? d : d.ownerDocument, f;
if (!(f = !e)) {
a: {
e = Wd(e);
f = ja.onSelect;
for (var h = 0; h < f.length; h++)
if (!e.has(f[h])) {
e = !1;
break a;
}
e = !0;
}
f = !e;
}
if (f)
return null;
e = b ? Ja(b) : window;
switch (a) {
case "focus":
if (Qb(e) || "true" === e.contentEditable)
ee = e, fe = b, ge = null;
break;
case "blur":
ge = fe = ee = null;
break;
case "mousedown":
he = !0;
break;
case "contextmenu":
case "mouseup":
case "dragend": return he = !1, ie(c, d);
case "selectionchange": if (ce)
break;
case "keydown":
case "keyup": return ie(c, d);
}
return null;
} };
Ca.injectEventPluginOrder("ResponderEventPlugin SimpleEventPlugin EnterLeaveEventPlugin ChangeEventPlugin SelectEventPlugin BeforeInputEventPlugin".split(" ")); sa = Ka; ta = Ia; va = Ja; Ca.injectEventPluginsByName({ SimpleEventPlugin: Md, EnterLeaveEventPlugin: gd, ChangeEventPlugin: Vc, SelectEventPlugin: je, BeforeInputEventPlugin: Cb }); function ke(a) { var b = ""; aa.Children.forEach(a, function (a) { null != a && (b += a); }); return b; } function le(a, b) { a = m({ children: void 0 }, b); if (b = ke(b.children))
a.children = b; return a; }
function me(a, b, c, d) { a = a.options; if (b) {
b = {};
for (var e = 0; e < c.length; e++)
b["$" + c[e]] = !0;
for (c = 0; c < a.length; c++)
e = b.hasOwnProperty("$" + a[c].value), a[c].selected !== e && (a[c].selected = e), e && d && (a[c].defaultSelected = !0);
} else {
c = "" + Ac(c);
b = null;
for (e = 0; e < a.length; e++) {
if (a[e].value === c) {
a[e].selected = !0;
d && (a[e].defaultSelected = !0);
return;
}
null !== b || a[e].disabled || (b = a[e]);
}
null !== b && (b.selected = !0);
} } function ne(a, b) { if (null != b.dangerouslySetInnerHTML)
throw t(Error(91)); return m({}, b, { value: void 0, defaultValue: void 0, children: "" + a._wrapperState.initialValue }); }
function oe(a, b) { var c = b.value; if (null == c) {
c = b.defaultValue;
b = b.children;
if (null != b) {
if (null != c)
throw t(Error(92));
if (Array.isArray(b)) {
if (!(1 >= b.length))
throw t(Error(93));
b = b[0];
}
c = b;
}
null == c && (c = "");
} a._wrapperState = { initialValue: Ac(c) }; } function pe(a, b) { var c = Ac(b.value), d = Ac(b.defaultValue); null != c && (c = "" + c, c !== a.value && (a.value = c), null == b.defaultValue && a.defaultValue !== c && (a.defaultValue = c)); null != d && (a.defaultValue = "" + d); } function qe(a) { var b = a.textContent; b === a._wrapperState.initialValue && (a.value = b); } var re = { html: "http://www.w3.org/1999/xhtml", mathml: "http://www.w3.org/1998/Math/MathML", svg: "http://www.w3.org/2000/svg" }; function se(a) { switch (a) {
case "svg": return "http://www.w3.org/2000/svg"; case "math": return "http://www.w3.org/1998/Math/MathML"; default: return "http://www.w3.org/1999/xhtml";
} } function te(a, b) { return null == a || "http://www.w3.org/1999/xhtml" === a ? se(b) : "http://www.w3.org/2000/svg" === a && "foreignObject" === b ? "http://www.w3.org/1999/xhtml" : a; } var ue = void 0, ve = function (a) { return "undefined" !== typeof MSApp && MSApp.execUnsafeLocalFunction ? function (b, c, d, e) { MSApp.execUnsafeLocalFunction(function () { return a(b, c, d, e); }); } : a; }(function (a, b) { if (a.namespaceURI !== re.svg || "innerHTML" in a)
a.innerHTML = b;
else {
ue = ue || document.createElement("div");
ue.innerHTML = "<svg>" + b + "</svg>";
for (b = ue.firstChild; a.firstChild;)
a.removeChild(a.firstChild);
for (; b.firstChild;)
a.appendChild(b.firstChild);
} }); function we(a, b) { if (b) {
var c = a.firstChild;
if (c && c === a.lastChild && 3 === c.nodeType) {
c.nodeValue = b;
return;
}
} a.textContent = b; } var xe = { animationIterationCount: !0, borderImageOutset: !0, borderImageSlice: !0, borderImageWidth: !0, boxFlex: !0, boxFlexGroup: !0, boxOrdinalGroup: !0, columnCount: !0, columns: !0, flex: !0, flexGrow: !0, flexPositive: !0, flexShrink: !0, flexNegative: !0, flexOrder: !0, gridArea: !0, gridRow: !0, gridRowEnd: !0, gridRowSpan: !0, gridRowStart: !0, gridColumn: !0, gridColumnEnd: !0, gridColumnSpan: !0, gridColumnStart: !0, fontWeight: !0, lineClamp: !0, lineHeight: !0, opacity: !0, order: !0, orphans: !0, tabSize: !0, widows: !0, zIndex: !0, zoom: !0, fillOpacity: !0,
floodOpacity: !0, stopOpacity: !0, strokeDasharray: !0, strokeDashoffset: !0, strokeMiterlimit: !0, strokeOpacity: !0, strokeWidth: !0 }, ye = ["Webkit", "ms", "Moz", "O"];
Object.keys(xe).forEach(function (a) { ye.forEach(function (b) { b = b + a.charAt(0).toUpperCase() + a.substring(1); xe[b] = xe[a]; }); }); function ze(a, b, c) { return null == b || "boolean" === typeof b || "" === b ? "" : c || "number" !== typeof b || 0 === b || xe.hasOwnProperty(a) && xe[a] ? ("" + b).trim() : b + "px"; } function Ae(a, b) { a = a.style; for (var c in b)
if (b.hasOwnProperty(c)) {
var d = 0 === c.indexOf("--"), e = ze(c, b[c], d);
"float" === c && (c = "cssFloat");
d ? a.setProperty(c, e) : a[c] = e;
} }
var Ce = m({ menuitem: !0 }, { area: !0, base: !0, br: !0, col: !0, embed: !0, hr: !0, img: !0, input: !0, keygen: !0, link: !0, meta: !0, param: !0, source: !0, track: !0, wbr: !0 }); function De(a, b) { if (b) {
if (Ce[a] && (null != b.children || null != b.dangerouslySetInnerHTML))
throw t(Error(137), a, "");
if (null != b.dangerouslySetInnerHTML) {
if (null != b.children)
throw t(Error(60));
if (!("object" === typeof b.dangerouslySetInnerHTML && "__html" in b.dangerouslySetInnerHTML))
throw t(Error(61));
}
if (null != b.style && "object" !== typeof b.style)
throw t(Error(62), "");
} } function Ee(a, b) { if (-1 === a.indexOf("-"))
return "string" === typeof b.is; switch (a) {
case "annotation-xml":
case "color-profile":
case "font-face":
case "font-face-src":
case "font-face-uri":
case "font-face-format":
case "font-face-name":
case "missing-glyph": return !1;
default: return !0;
} } function Fe(a, b) { a = 9 === a.nodeType || 11 === a.nodeType ? a : a.ownerDocument; var c = Wd(a); b = ja[b]; for (var d = 0; d < b.length; d++) {
var e = b[d];
if (!c.has(e)) {
switch (e) {
case "scroll":
Rd(a, "scroll", !0);
break;
case "focus":
case "blur":
Rd(a, "focus", !0);
Rd(a, "blur", !0);
c.add("blur");
c.add("focus");
break;
case "cancel":
case "close":
Sb(e) && Rd(a, e, !0);
break;
case "invalid":
case "submit":
case "reset": break;
default: -1 === bb.indexOf(e) && G(e, a);
}
c.add(e);
}
} } function Ge() { } var He = null, Ie = null; function Je(a, b) { switch (a) {
case "button": case "input": case "select": case "textarea": return !!b.autoFocus;
} return !1; } function Ke(a, b) { return "textarea" === a || "option" === a || "noscript" === a || "string" === typeof b.children || "number" === typeof b.children || "object" === typeof b.dangerouslySetInnerHTML && null !== b.dangerouslySetInnerHTML && null != b.dangerouslySetInnerHTML.__html; } var Le = "function" === typeof setTimeout ? setTimeout : void 0, Me = "function" === typeof clearTimeout ? clearTimeout : void 0; function Ne(a) { for (; null != a; a = a.nextSibling) {
var b = a.nodeType;
if (1 === b || 3 === b)
break;
} return a; } new Set; var Oe = [], Pe = -1; function H(a) { 0 > Pe || (a.current = Oe[Pe], Oe[Pe] = null, Pe--); } function J(a, b) { Pe++; Oe[Pe] = a.current; a.current = b; } var Qe = {}, L = { current: Qe }, M = { current: !1 }, Re = Qe; function Se(a, b) { var c = a.type.contextTypes; if (!c)
return Qe; var d = a.stateNode; if (d && d.__reactInternalMemoizedUnmaskedChildContext === b)
return d.__reactInternalMemoizedMaskedChildContext; var e = {}, f; for (f in c)
e[f] = b[f]; d && (a = a.stateNode, a.__reactInternalMemoizedUnmaskedChildContext = b, a.__reactInternalMemoizedMaskedChildContext = e); return e; }
function N(a) { a = a.childContextTypes; return null !== a && void 0 !== a; } function Te(a) { H(M, a); H(L, a); } function Ue(a) { H(M, a); H(L, a); } function Ve(a, b, c) { if (L.current !== Qe)
throw t(Error(168)); J(L, b, a); J(M, c, a); }
function We(a, b, c) { var d = a.stateNode; a = b.childContextTypes; if ("function" !== typeof d.getChildContext)
return c; d = d.getChildContext(); for (var e in d)
if (!(e in a))
throw t(Error(108), oc(b) || "Unknown", e); return m({}, c, d); }
function Xe(a) { var b = a.stateNode; b = b && b.__reactInternalMemoizedMergedChildContext || Qe; Re = L.current; J(L, b, a); J(M, M.current, a); return !0; } function Ye(a, b, c) { var d = a.stateNode; if (!d)
throw t(Error(169)); c ? (b = We(a, b, Re), d.__reactInternalMemoizedMergedChildContext = b, H(M, a), H(L, a), J(L, b, a)) : H(M, a); J(M, c, a); }
var Ze = q.unstable_runWithPriority, $e = q.unstable_scheduleCallback, af = q.unstable_cancelCallback, bf = q.unstable_shouldYield, cf = q.unstable_requestPaint, df = q.unstable_now, ef = q.unstable_getCurrentPriorityLevel, ff = q.unstable_ImmediatePriority, hf = q.unstable_UserBlockingPriority, jf = q.unstable_NormalPriority, kf = q.unstable_LowPriority, lf = q.unstable_IdlePriority, mf = {}, nf = void 0 !== cf ? cf : function () { }, of = null, pf = null, qf = !1, rf = df(), sf = 1E4 > rf ? df : function () { return df() - rf; }; function tf() { switch (ef()) {
case ff: return 99; case hf: return 98; case jf: return 97; case kf: return 96; case lf: return 95; default: throw t(Error(332));
} } function uf(a) { switch (a) {
case 99: return ff; case 98: return hf; case 97: return jf; case 96: return kf; case 95: return lf; default: throw t(Error(332));
} } function vf(a, b) { a = uf(a); return Ze(a, b); } function wf(a, b, c) { a = uf(a); return $e(a, b, c); } function xf(a) { null === of ? (of = [a], pf = $e(ff, yf)) : of.push(a); return mf; } function O() { null !== pf && af(pf); yf(); } function yf() { if (!qf && null !== of) {
qf = !0;
var a = 0;
try {
var b = of;
vf(99, function () { for (; a < b.length; a++) {
var c = b[a];
do
c = c(!0);
while (null !== c);
} });
of = null;
}
catch (c) {
throw null !== of && (of = of.slice(a + 1)), $e(ff, O), c;
}
finally {
qf = !1;
}
} } function zf(a, b) { if (1073741823 === b)
return 99; if (1 === b) return 95; a = 10 * (1073741821 - b) - 10 * (1073741821 - a); return 0 >= a ? 99 : 250 >= a ? 98 : 5250 >= a ? 97 : 95; }
function Af(a, b) { if (a && a.defaultProps) {
b = m({}, b);
a = a.defaultProps;
for (var c in a)
void 0 === b[c] && (b[c] = a[c]);
} return b; } function Bf(a) { var b = a._result; switch (a._status) {
case 1: return b;
case 2: throw b;
case 0: throw b;
default:
a._status = 0;
b = a._ctor;
b = b();
b.then(function (b) { 0 === a._status && (b = b.default, a._status = 1, a._result = b); }, function (b) { 0 === a._status && (a._status = 2, a._result = b); });
switch (a._status) {
case 1: return a._result;
case 2: throw a._result;
}
a._result = b;
throw b;
} } var Cf = { current: null }, Df = null, Ef = null, Ff = null; function Gf() { Ff = Ef = Df = null; } function Hf(a, b) { var c = a.type._context; J(Cf, c._currentValue, a); c._currentValue = b; } function If(a) { var b = Cf.current; H(Cf, a); a.type._context._currentValue = b; } function Jf(a, b) { for (; null !== a;) {
var c = a.alternate;
if (a.childExpirationTime < b)
a.childExpirationTime = b, null !== c && c.childExpirationTime < b && (c.childExpirationTime = b);
else if (null !== c && c.childExpirationTime < b)
c.childExpirationTime = b;
else
break;
a = a.return;
} } function Kf(a, b) { Df = a; Ff = Ef = null; a = a.dependencies; null !== a && null !== a.firstContext && (a.expirationTime >= b && (Lf = !0), a.firstContext = null); } function Mf(a, b) { if (Ff !== a && !1 !== b && 0 !== b) {
if ("number" !== typeof b || 1073741823 === b)
Ff = a, b = 1073741823;
b = { context: a, observedBits: b, next: null };
if (null === Ef) {
if (null === Df)
throw t(Error(308));
Ef = b;
Df.dependencies = { expirationTime: 0, firstContext: b, responders: null };
}
else
Ef = Ef.next = b;
} return a._currentValue; } var Nf = !1; function Of(a) { return { baseState: a, firstUpdate: null, lastUpdate: null, firstCapturedUpdate: null, lastCapturedUpdate: null, firstEffect: null, lastEffect: null, firstCapturedEffect: null, lastCapturedEffect: null }; } function Pf(a) { return { baseState: a.baseState, firstUpdate: a.firstUpdate, lastUpdate: a.lastUpdate, firstCapturedUpdate: null, lastCapturedUpdate: null, firstEffect: null, lastEffect: null, firstCapturedEffect: null, lastCapturedEffect: null }; } function Qf(a, b) { return { expirationTime: a, suspenseConfig: b, tag: 0, payload: null, callback: null, next: null, nextEffect: null }; } function Rf(a, b) { null === a.lastUpdate ? a.firstUpdate = a.lastUpdate = b : (a.lastUpdate.next = b, a.lastUpdate = b); } function Sf(a, b) { var c = a.alternate; if (null === c) {
var d = a.updateQueue; var e = null; null === d && (d = a.updateQueue = Of(a.memoizedState));
} else
d = a.updateQueue, e = c.updateQueue, null === d ? null === e ? (d = a.updateQueue = Of(a.memoizedState), e = c.updateQueue = Of(c.memoizedState)) : d = a.updateQueue = Pf(e) : null === e && (e = c.updateQueue = Pf(d)); null === e || d === e ? Rf(d, b) : null === d.lastUpdate || null === e.lastUpdate ? (Rf(d, b), Rf(e, b)) : (Rf(d, b), e.lastUpdate = b); }
function Tf(a, b) { var c = a.updateQueue; c = null === c ? a.updateQueue = Of(a.memoizedState) : Uf(a, c); null === c.lastCapturedUpdate ? c.firstCapturedUpdate = c.lastCapturedUpdate = b : (c.lastCapturedUpdate.next = b, c.lastCapturedUpdate = b); } function Uf(a, b) { var c = a.alternate; null !== c && b === c.updateQueue && (b = a.updateQueue = Pf(b)); return b; } function Vf(a, b, c, d, e, f) { switch (c.tag) {
case 1: return a = c.payload, "function" === typeof a ? a.call(f, d, e) : a;
case 3: a.effectTag = a.effectTag & -2049 | 64;
case 0:
a = c.payload;
e = "function" === typeof a ? a.call(f, d, e) : a;
if (null === e || void 0 === e)
break;
return m({}, d, e);
case 2: Nf = !0;
} return d; } function Wf(a, b, c, d, e) {
Nf = !1;
b = Uf(a, b);
for (var f = b.baseState, h = null, g = 0, k = b.firstUpdate, l = f; null !== k;) {
var n = k.expirationTime;
n < e ? (null === h && (h = k, f = l), g < n && (g = n)) : (Xf(n, k.suspenseConfig), l = Vf(a, b, k, l, c, d), null !== k.callback && (a.effectTag |= 32, k.nextEffect = null, null === b.lastEffect ? b.firstEffect = b.lastEffect = k : (b.lastEffect.nextEffect = k, b.lastEffect = k)));
k = k.next;
}
n = null;
for (k = b.firstCapturedUpdate; null !== k;) {
var z = k.expirationTime;
z < e ? (null === n && (n = k, null === h && (f = l)), g < z && (g = z)) : (l = Vf(a, b, k, l, c, d), null !==
k.callback && (a.effectTag |= 32, k.nextEffect = null, null === b.lastCapturedEffect ? b.firstCapturedEffect = b.lastCapturedEffect = k : (b.lastCapturedEffect.nextEffect = k, b.lastCapturedEffect = k)));
k = k.next;
}
null === h && (b.lastUpdate = null);
null === n ? b.lastCapturedUpdate = null : a.effectTag |= 32;
null === h && null === n && (f = l);
b.baseState = f;
b.firstUpdate = h;
b.firstCapturedUpdate = n;
a.expirationTime = g;
a.memoizedState = l;
} function Yf(a, b, c) { null !== b.firstCapturedUpdate && (null !== b.lastUpdate && (b.lastUpdate.next = b.firstCapturedUpdate, b.lastUpdate = b.lastCapturedUpdate), b.firstCapturedUpdate = b.lastCapturedUpdate = null); Zf(b.firstEffect, c); b.firstEffect = b.lastEffect = null; Zf(b.firstCapturedEffect, c); b.firstCapturedEffect = b.lastCapturedEffect = null; } function Zf(a, b) { for (; null !== a;) {
var c = a.callback;
if (null !== c) {
a.callback = null;
var d = b;
if ("function" !== typeof c)
throw t(Error(191), c);
c.call(d);
}
a = a.nextEffect;
} } var $f = Xb.ReactCurrentBatchConfig, ag = (new aa.Component).refs; function bg(a, b, c, d) { b = a.memoizedState; c = c(d, b); c = null === c || void 0 === c ? b : m({}, b, c); a.memoizedState = c; d = a.updateQueue; null !== d && 0 === a.expirationTime && (d.baseState = c); } var fg = { isMounted: function (a) { return (a = a._reactInternalFiber) ? 2 === ld(a) : !1; }, enqueueSetState: function (a, b, c) { a = a._reactInternalFiber; var d = cg(), e = $f.suspense; d = dg(d, a, e); e = Qf(d, e); e.payload = b; void 0 !== c && null !== c && (e.callback = c); Sf(a, e); eg(a, d); }, enqueueReplaceState: function (a, b, c) { a = a._reactInternalFiber; var d = cg(), e = $f.suspense; d = dg(d, a, e); e = Qf(d, e); e.tag = 1; e.payload = b; void 0 !== c && null !== c && (e.callback = c); Sf(a, e); eg(a, d); }, enqueueForceUpdate: function (a, b) {
a = a._reactInternalFiber;
var c = cg(), d = $f.suspense;
c = dg(c, a, d);
d = Qf(c, d);
d.tag = 2;
void 0 !== b && null !== b && (d.callback = b);
Sf(a, d);
eg(a, c);
} };
function gg(a, b, c, d, e, f, h) { a = a.stateNode; return "function" === typeof a.shouldComponentUpdate ? a.shouldComponentUpdate(d, f, h) : b.prototype && b.prototype.isPureReactComponent ? !jd(c, d) || !jd(e, f) : !0; } function hg(a, b, c) { var d = !1, e = Qe; var f = b.contextType; "object" === typeof f && null !== f ? f = Mf(f) : (e = N(b) ? Re : L.current, d = b.contextTypes, f = (d = null !== d && void 0 !== d) ? Se(a, e) : Qe); b = new b(c, f); a.memoizedState = null !== b.state && void 0 !== b.state ? b.state : null; b.updater = fg; a.stateNode = b; b._reactInternalFiber = a; d && (a = a.stateNode, a.__reactInternalMemoizedUnmaskedChildContext = e, a.__reactInternalMemoizedMaskedChildContext = f); return b; } function ig(a, b, c, d) { a = b.state; "function" === typeof b.componentWillReceiveProps && b.componentWillReceiveProps(c, d); "function" === typeof b.UNSAFE_componentWillReceiveProps && b.UNSAFE_componentWillReceiveProps(c, d); b.state !== a && fg.enqueueReplaceState(b, b.state, null); } function jg(a, b, c, d) {
var e = a.stateNode;
e.props = c;
e.state = a.memoizedState;
e.refs = ag;
var f = b.contextType;
"object" === typeof f && null !== f ? e.context = Mf(f) : (f = N(b) ? Re : L.current, e.context = Se(a, f));
f = a.updateQueue;
null !== f && (Wf(a, f, c, e, d), e.state = a.memoizedState);
f = b.getDerivedStateFromProps;
"function" === typeof f && (bg(a, b, f, c), e.state = a.memoizedState);
"function" === typeof b.getDerivedStateFromProps || "function" === typeof e.getSnapshotBeforeUpdate || "function" !== typeof e.UNSAFE_componentWillMount && "function" !==
typeof e.componentWillMount || (b = e.state, "function" === typeof e.componentWillMount && e.componentWillMount(), "function" === typeof e.UNSAFE_componentWillMount && e.UNSAFE_componentWillMount(), b !== e.state && fg.enqueueReplaceState(e, e.state, null), f = a.updateQueue, null !== f && (Wf(a, f, c, e, d), e.state = a.memoizedState));
"function" === typeof e.componentDidMount && (a.effectTag |= 4);
} var kg = Array.isArray; function lg(a, b, c) { a = c.ref; if (null !== a && "function" !== typeof a && "object" !== typeof a) {
if (c._owner) {
c = c._owner;
var d = void 0;
if (c) {
if (1 !== c.tag)
throw t(Error(309));
d = c.stateNode;
}
if (!d)
throw t(Error(147), a);
var e = "" + a;
if (null !== b && null !== b.ref && "function" === typeof b.ref && b.ref._stringRef === e)
return b.ref;
b = function (a) { var b = d.refs; b === ag && (b = d.refs = {}); null === a ? delete b[e] : b[e] = a; };
b._stringRef = e;
return b;
}
if ("string" !== typeof a)
throw t(Error(284));
if (!c._owner)
throw t(Error(290), a);
} return a; } function mg(a, b) { if ("textarea" !== a.type)
throw t(Error(31), "[object Object]" === Object.prototype.toString.call(b) ? "object with keys {" + Object.keys(b).join(", ") + "}" : b, ""); }
function ng(a) {
function b(b, c) { if (a) {
var d = b.lastEffect;
null !== d ? (d.nextEffect = c, b.lastEffect = c) : b.firstEffect = b.lastEffect = c;
c.nextEffect = null;
c.effectTag = 8;
} }
function c(c, d) { if (!a)
return null; for (; null !== d;)
b(c, d), d = d.sibling; return null; }
function d(a, b) { for (a = new Map; null !== b;)
null !== b.key ? a.set(b.key, b) : a.set(b.index, b), b = b.sibling; return a; }
function e(a, b, c) { a = og(a, b, c); a.index = 0; a.sibling = null; return a; }
function f(b, c, d) {
b.index = d;
if (!a)
return c;
d = b.alternate;
if (null !== d)
return d = d.index, d < c ? (b.effectTag =
2, c) : d;
b.effectTag = 2;
return c;
}
function h(b) { a && null === b.alternate && (b.effectTag = 2); return b; }
function g(a, b, c, d) { if (null === b || 6 !== b.tag)
return b = pg(c, a.mode, d), b.return = a, b; b = e(b, c, d); b.return = a; return b; }
function k(a, b, c, d) { if (null !== b && b.elementType === c.type)
return d = e(b, c.props, d), d.ref = lg(a, b, c), d.return = a, d; d = qg(c.type, c.key, c.props, null, a.mode, d); d.ref = lg(a, b, c); d.return = a; return d; }
function l(a, b, c, d) {
if (null === b || 4 !== b.tag || b.stateNode.containerInfo !== c.containerInfo || b.stateNode.implementation !==
c.implementation)
return b = rg(c, a.mode, d), b.return = a, b;
b = e(b, c.children || [], d);
b.return = a;
return b;
}
function n(a, b, c, d, f) { if (null === b || 7 !== b.tag)
return b = sg(c, a.mode, d, f), b.return = a, b; b = e(b, c, d); b.return = a; return b; }
function z(a, b, c) {
if ("string" === typeof b || "number" === typeof b)
return b = pg("" + b, a.mode, c), b.return = a, b;
if ("object" === typeof b && null !== b) {
switch (b.$$typeof) {
case Zb: return c = qg(b.type, b.key, b.props, null, a.mode, c), c.ref = lg(a, null, b), c.return = a, c;
case $b: return b = rg(b, a.mode, c), b.return = a, b;
}
if (kg(b) ||
mc(b))
return b = sg(b, a.mode, c, null), b.return = a, b;
mg(a, b);
}
return null;
}
function x(a, b, c, d) { var e = null !== b ? b.key : null; if ("string" === typeof c || "number" === typeof c)
return null !== e ? null : g(a, b, "" + c, d); if ("object" === typeof c && null !== c) {
switch (c.$$typeof) {
case Zb: return c.key === e ? c.type === ac ? n(a, b, c.props.children, d, e) : k(a, b, c, d) : null;
case $b: return c.key === e ? l(a, b, c, d) : null;
}
if (kg(c) || mc(c))
return null !== e ? null : n(a, b, c, d, null);
mg(a, c);
} return null; }
function v(a, b, c, d, e) {
if ("string" === typeof d || "number" === typeof d)
return a =
a.get(c) || null, g(b, a, "" + d, e);
if ("object" === typeof d && null !== d) {
switch (d.$$typeof) {
case Zb: return a = a.get(null === d.key ? c : d.key) || null, d.type === ac ? n(b, a, d.props.children, e, d.key) : k(b, a, d, e);
case $b: return a = a.get(null === d.key ? c : d.key) || null, l(b, a, d, e);
}
if (kg(d) || mc(d))
return a = a.get(c) || null, n(b, a, d, e, null);
mg(b, d);
}
return null;
}
function rb(e, h, g, k) {
for (var l = null, u = null, n = h, w = h = 0, C = null; null !== n && w < g.length; w++) {
n.index > w ? (C = n, n = null) : C = n.sibling;
var p = x(e, n, g[w], k);
if (null === p) {
null === n && (n = C);
break;
}
a &&
n && null === p.alternate && b(e, n);
h = f(p, h, w);
null === u ? l = p : u.sibling = p;
u = p;
n = C;
}
if (w === g.length)
return c(e, n), l;
if (null === n) {
for (; w < g.length; w++)
n = z(e, g[w], k), null !== n && (h = f(n, h, w), null === u ? l = n : u.sibling = n, u = n);
return l;
}
for (n = d(e, n); w < g.length; w++)
C = v(n, e, w, g[w], k), null !== C && (a && null !== C.alternate && n.delete(null === C.key ? w : C.key), h = f(C, h, w), null === u ? l = C : u.sibling = C, u = C);
a && n.forEach(function (a) { return b(e, a); });
return l;
}
function Be(e, h, g, k) {
var l = mc(g);
if ("function" !== typeof l)
throw t(Error(150));
g = l.call(g);
if (null == g)
throw t(Error(151));
for (var n = l = null, u = h, w = h = 0, C = null, p = g.next(); null !== u && !p.done; w++, p = g.next()) {
u.index > w ? (C = u, u = null) : C = u.sibling;
var r = x(e, u, p.value, k);
if (null === r) {
null === u && (u = C);
break;
}
a && u && null === r.alternate && b(e, u);
h = f(r, h, w);
null === n ? l = r : n.sibling = r;
n = r;
u = C;
}
if (p.done)
return c(e, u), l;
if (null === u) {
for (; !p.done; w++, p = g.next())
p = z(e, p.value, k), null !== p && (h = f(p, h, w), null === n ? l = p : n.sibling = p, n = p);
return l;
}
for (u = d(e, u); !p.done; w++, p = g.next())
p = v(u, e, w, p.value, k), null !== p && (a && null !==
p.alternate && u.delete(null === p.key ? w : p.key), h = f(p, h, w), null === n ? l = p : n.sibling = p, n = p);
a && u.forEach(function (a) { return b(e, a); });
return l;
}
return function (a, d, f, g) {
var k = "object" === typeof f && null !== f && f.type === ac && null === f.key;
k && (f = f.props.children);
var l = "object" === typeof f && null !== f;
if (l)
switch (f.$$typeof) {
case Zb:
a: {
l = f.key;
for (k = d; null !== k;) {
if (k.key === l) {
if (7 === k.tag ? f.type === ac : k.elementType === f.type) {
c(a, k.sibling);
d = e(k, f.type === ac ? f.props.children : f.props, g);
d.ref = lg(a, k, f);
d.return = a;
a = d;
break a;
}
c(a, k);
break;
}
else
b(a, k);
k = k.sibling;
}
f.type === ac ? (d = sg(f.props.children, a.mode, g, f.key), d.return = a, a = d) : (g = qg(f.type, f.key, f.props, null, a.mode, g), g.ref = lg(a, d, f), g.return = a, a = g);
}
return h(a);
case $b:
a: {
for (k = f.key; null !== d;) {
if (d.key === k) {
if (4 === d.tag && d.stateNode.containerInfo === f.containerInfo && d.stateNode.implementation === f.implementation) {
c(a, d.sibling);
d = e(d, f.children || [], g);
d.return = a;
a = d;
break a;
}
c(a, d);
break;
}
else
b(a, d);
d = d.sibling;
}
d = rg(f, a.mode, g);
d.return = a;
a = d;
}
return h(a);
}
if ("string" === typeof f ||
"number" === typeof f)
return f = "" + f, null !== d && 6 === d.tag ? (c(a, d.sibling), d = e(d, f, g), d.return = a, a = d) : (c(a, d), d = pg(f, a.mode, g), d.return = a, a = d), h(a);
if (kg(f))
return rb(a, d, f, g);
if (mc(f))
return Be(a, d, f, g);
l && mg(a, f);
if ("undefined" === typeof f && !k)
switch (a.tag) {
case 1:
case 0: throw a = a.type, t(Error(152), a.displayName || a.name || "Component");
}
return c(a, d);
};
} var tg = ng(!0), ug = ng(!1), vg = {}, wg = { current: vg }, xg = { current: vg }, yg = { current: vg }; function zg(a) { if (a === vg)
throw t(Error(174)); return a; }
function Ag(a, b) { J(yg, b, a); J(xg, a, a); J(wg, vg, a); var c = b.nodeType; switch (c) {
case 9:
case 11:
b = (b = b.documentElement) ? b.namespaceURI : te(null, "");
break;
default: c = 8 === c ? b.parentNode : b, b = c.namespaceURI || null, c = c.tagName, b = te(b, c);
} H(wg, a); J(wg, b, a); } function Bg(a) { H(wg, a); H(xg, a); H(yg, a); } function Cg(a) { zg(yg.current); var b = zg(wg.current); var c = te(b, a.type); b !== c && (J(xg, a, a), J(wg, c, a)); } function Dg(a) { xg.current === a && (H(wg, a), H(xg, a)); } var Eg = 1, Fg = 1, Gg = 2, P = { current: 0 }; function Hg(a) { for (var b = a; null !== b;) {
if (13 === b.tag) {
if (null !== b.memoizedState)
return b;
}
else if (19 === b.tag && void 0 !== b.memoizedProps.revealOrder) {
if (0 !== (b.effectTag & 64))
return b;
}
else if (null !== b.child) {
b.child.return = b;
b = b.child;
continue;
}
if (b === a)
break;
for (; null === b.sibling;) {
if (null === b.return || b.return === a)
return null;
b = b.return;
}
b.sibling.return = b.return;
b = b.sibling;
} return null; } var Ig = 0, Jg = 2, Kg = 4, Lg = 8, Mg = 16, Ng = 32, Og = 64, Pg = 128, Qg = Xb.ReactCurrentDispatcher, Rg = 0, Sg = null, Q = null, Tg = null, Ug = null, R = null, Vg = null, Wg = 0, Xg = null, Yg = 0, Zg = !1, $g = null, ah = 0; function bh() { throw t(Error(321)); } function ch(a, b) { if (null === b)
return !1; for (var c = 0; c < b.length && c < a.length; c++)
if (!hd(a[c], b[c]))
return !1; return !0; }
function dh(a, b, c, d, e, f) { Rg = f; Sg = b; Tg = null !== a ? a.memoizedState : null; Qg.current = null === Tg ? eh : fh; b = c(d, e); if (Zg) {
do
Zg = !1, ah += 1, Tg = null !== a ? a.memoizedState : null, Vg = Ug, Xg = R = Q = null, Qg.current = fh, b = c(d, e);
while (Zg);
$g = null;
ah = 0;
} Qg.current = hh; a = Sg; a.memoizedState = Ug; a.expirationTime = Wg; a.updateQueue = Xg; a.effectTag |= Yg; a = null !== Q && null !== Q.next; Rg = 0; Vg = R = Ug = Tg = Q = Sg = null; Wg = 0; Xg = null; Yg = 0; if (a)
throw t(Error(300)); return b; }
function ih() { Qg.current = hh; Rg = 0; Vg = R = Ug = Tg = Q = Sg = null; Wg = 0; Xg = null; Yg = 0; Zg = !1; $g = null; ah = 0; } function jh() { var a = { memoizedState: null, baseState: null, queue: null, baseUpdate: null, next: null }; null === R ? Ug = R = a : R = R.next = a; return R; } function kh() { if (null !== Vg)
R = Vg, Vg = R.next, Q = Tg, Tg = null !== Q ? Q.next : null;
else {
if (null === Tg)
throw t(Error(310));
Q = Tg;
var a = { memoizedState: Q.memoizedState, baseState: Q.baseState, queue: Q.queue, baseUpdate: Q.baseUpdate, next: null };
R = null === R ? Ug = a : R.next = a;
Tg = Q.next;
} return R; } function lh(a, b) { return "function" === typeof b ? b(a) : b; } function mh(a) {
var b = kh(), c = b.queue;
if (null === c)
throw t(Error(311));
c.lastRenderedReducer = a;
if (0 < ah) {
var d = c.dispatch;
if (null !== $g) {
var e = $g.get(c);
if (void 0 !== e) {
$g.delete(c);
var f = b.memoizedState;
do
f = a(f, e.action), e = e.next;
while (null !== e);
hd(f, b.memoizedState) || (Lf = !0);
b.memoizedState = f;
b.baseUpdate === c.last && (b.baseState = f);
c.lastRenderedState = f;
return [f, d];
}
}
return [b.memoizedState, d];
}
d = c.last;
var h = b.baseUpdate;
f = b.baseState;
null !== h ? (null !== d && (d.next = null), d = h.next) : d = null !== d ? d.next : null;
if (null !==
d) {
var g = e = null, k = d, l = !1;
do {
var n = k.expirationTime;
n < Rg ? (l || (l = !0, g = h, e = f), n > Wg && (Wg = n)) : (Xf(n, k.suspenseConfig), f = k.eagerReducer === a ? k.eagerState : a(f, k.action));
h = k;
k = k.next;
} while (null !== k && k !== d);
l || (g = h, e = f);
hd(f, b.memoizedState) || (Lf = !0);
b.memoizedState = f;
b.baseUpdate = g;
b.baseState = e;
c.lastRenderedState = f;
}
return [b.memoizedState, c.dispatch];
} function nh(a, b, c, d) { a = { tag: a, create: b, destroy: c, deps: d, next: null }; null === Xg ? (Xg = { lastEffect: null }, Xg.lastEffect = a.next = a) : (b = Xg.lastEffect, null === b ? Xg.lastEffect = a.next = a : (c = b.next, b.next = a, a.next = c, Xg.lastEffect = a)); return a; } function oh(a, b, c, d) { var e = jh(); Yg |= a; e.memoizedState = nh(b, c, void 0, void 0 === d ? null : d); } function ph(a, b, c, d) { var e = kh(); d = void 0 === d ? null : d; var f = void 0; if (null !== Q) {
var h = Q.memoizedState;
f = h.destroy;
if (null !== d && ch(d, h.deps)) {
nh(Ig, c, f, d);
return;
}
} Yg |= a; e.memoizedState = nh(b, c, f, d); } function qh(a, b) { if ("function" === typeof b)
return a = a(), b(a), function () { b(null); }; if (null !== b && void 0 !== b)
return a = a(), b.current = a, function () { b.current = null; }; }
function rh() { } function sh(a, b, c) {
if (!(25 > ah))
throw t(Error(301));
var d = a.alternate;
if (a === Sg || null !== d && d === Sg)
if (Zg = !0, a = { expirationTime: Rg, suspenseConfig: null, action: c, eagerReducer: null, eagerState: null, next: null }, null === $g && ($g = new Map), c = $g.get(b), void 0 === c)
$g.set(b, a);
else {
for (b = c; null !== b.next;)
b = b.next;
b.next = a;
}
else {
var e = cg(), f = $f.suspense;
e = dg(e, a, f);
f = { expirationTime: e, suspenseConfig: f, action: c, eagerReducer: null, eagerState: null, next: null };
var h = b.last;
if (null === h)
f.next = f;
else {
var g = h.next;
null !== g &&
(f.next = g);
h.next = f;
}
b.last = f;
if (0 === a.expirationTime && (null === d || 0 === d.expirationTime) && (d = b.lastRenderedReducer, null !== d))
try {
var k = b.lastRenderedState, l = d(k, c);
f.eagerReducer = d;
f.eagerState = l;
if (hd(l, k))
return;
}
catch (n) { }
finally { }
eg(a, e);
}
} var hh = { readContext: Mf, useCallback: bh, useContext: bh, useEffect: bh, useImperativeHandle: bh, useLayoutEffect: bh, useMemo: bh, useReducer: bh, useRef: bh, useState: bh, useDebugValue: bh, useResponder: bh }, eh = { readContext: Mf, useCallback: function (a, b) { jh().memoizedState = [a, void 0 === b ? null : b]; return a; }, useContext: Mf, useEffect: function (a, b) { return oh(516, Pg | Og, a, b); }, useImperativeHandle: function (a, b, c) { c = null !== c && void 0 !== c ? c.concat([a]) : null; return oh(4, Kg | Ng, qh.bind(null, b, a), c); }, useLayoutEffect: function (a, b) {
return oh(4, Kg | Ng, a, b);
}, useMemo: function (a, b) { var c = jh(); b = void 0 === b ? null : b; a = a(); c.memoizedState = [a, b]; return a; }, useReducer: function (a, b, c) { var d = jh(); b = void 0 !== c ? c(b) : b; d.memoizedState = d.baseState = b; a = d.queue = { last: null, dispatch: null, lastRenderedReducer: a, lastRenderedState: b }; a = a.dispatch = sh.bind(null, Sg, a); return [d.memoizedState, a]; }, useRef: function (a) { var b = jh(); a = { current: a }; return b.memoizedState = a; }, useState: function (a) {
var b = jh();
"function" === typeof a && (a = a());
b.memoizedState = b.baseState = a;
a = b.queue =
{ last: null, dispatch: null, lastRenderedReducer: lh, lastRenderedState: a };
a = a.dispatch = sh.bind(null, Sg, a);
return [b.memoizedState, a];
}, useDebugValue: rh, useResponder: kd }, fh = { readContext: Mf, useCallback: function (a, b) { var c = kh(); b = void 0 === b ? null : b; var d = c.memoizedState; if (null !== d && null !== b && ch(b, d[1]))
return d[0]; c.memoizedState = [a, b]; return a; }, useContext: Mf, useEffect: function (a, b) { return ph(516, Pg | Og, a, b); }, useImperativeHandle: function (a, b, c) {
c = null !== c && void 0 !== c ? c.concat([a]) : null;
return ph(4, Kg | Ng, qh.bind(null, b, a), c);
}, useLayoutEffect: function (a, b) { return ph(4, Kg | Ng, a, b); }, useMemo: function (a, b) { var c = kh(); b = void 0 === b ? null : b; var d = c.memoizedState; if (null !== d && null !== b && ch(b, d[1]))
return d[0]; a = a(); c.memoizedState = [a, b]; return a; }, useReducer: mh, useRef: function () { return kh().memoizedState; }, useState: function (a) { return mh(lh, a); }, useDebugValue: rh, useResponder: kd }, th = null, uh = null, vh = !1;
function wh(a, b) { var c = xh(5, null, null, 0); c.elementType = "DELETED"; c.type = "DELETED"; c.stateNode = b; c.return = a; c.effectTag = 8; null !== a.lastEffect ? (a.lastEffect.nextEffect = c, a.lastEffect = c) : a.firstEffect = a.lastEffect = c; } function yh(a, b) { switch (a.tag) {
case 5:
var c = a.type;
b = 1 !== b.nodeType || c.toLowerCase() !== b.nodeName.toLowerCase() ? null : b;
return null !== b ? (a.stateNode = b, !0) : !1;
case 6: return b = "" === a.pendingProps || 3 !== b.nodeType ? null : b, null !== b ? (a.stateNode = b, !0) : !1;
case 13: return !1;
default: return !1;
} } function zh(a) { if (vh) {
var b = uh;
if (b) {
var c = b;
if (!yh(a, b)) {
b = Ne(c.nextSibling);
if (!b || !yh(a, b)) {
a.effectTag |= 2;
vh = !1;
th = a;
return;
}
wh(th, c);
}
th = a;
uh = Ne(b.firstChild);
}
else
a.effectTag |= 2, vh = !1, th = a;
} } function Ah(a) { for (a = a.return; null !== a && 5 !== a.tag && 3 !== a.tag && 18 !== a.tag;)
a = a.return; th = a; }
function Bh(a) { if (a !== th)
return !1; if (!vh)
return Ah(a), vh = !0, !1; var b = a.type; if (5 !== a.tag || "head" !== b && "body" !== b && !Ke(b, a.memoizedProps))
for (b = uh; b;)
wh(a, b), b = Ne(b.nextSibling); Ah(a); uh = th ? Ne(a.stateNode.nextSibling) : null; return !0; }
function Ch() { uh = th = null; vh = !1; } var Dh = Xb.ReactCurrentOwner, Lf = !1; function S(a, b, c, d) { b.child = null === a ? ug(b, null, c, d) : tg(b, a.child, c, d); } function Eh(a, b, c, d, e) { c = c.render; var f = b.ref; Kf(b, e); d = dh(a, b, c, d, f, e); if (null !== a && !Lf)
return b.updateQueue = a.updateQueue, b.effectTag &= -517, a.expirationTime <= e && (a.expirationTime = 0), Fh(a, b, e); b.effectTag |= 1; S(a, b, d, e); return b.child; }
function Gh(a, b, c, d, e, f) { if (null === a) {
var h = c.type;
if ("function" === typeof h && !Hh(h) && void 0 === h.defaultProps && null === c.compare && void 0 === c.defaultProps)
return b.tag = 15, b.type = h, Ih(a, b, h, d, e, f);
a = qg(c.type, null, d, null, b.mode, f);
a.ref = b.ref;
a.return = b;
return b.child = a;
} h = a.child; if (e < f && (e = h.memoizedProps, c = c.compare, c = null !== c ? c : jd, c(e, d) && a.ref === b.ref))
return Fh(a, b, f); b.effectTag |= 1; a = og(h, d, f); a.ref = b.ref; a.return = b; return b.child = a; }
function Ih(a, b, c, d, e, f) { return null !== a && jd(a.memoizedProps, d) && a.ref === b.ref && (Lf = !1, e < f) ? Fh(a, b, f) : Jh(a, b, c, d, f); } function Kh(a, b) { var c = b.ref; if (null === a && null !== c || null !== a && a.ref !== c)
b.effectTag |= 128; }
function Jh(a, b, c, d, e) { var f = N(c) ? Re : L.current; f = Se(b, f); Kf(b, e); c = dh(a, b, c, d, f, e); if (null !== a && !Lf)
return b.updateQueue = a.updateQueue, b.effectTag &= -517, a.expirationTime <= e && (a.expirationTime = 0), Fh(a, b, e); b.effectTag |= 1; S(a, b, c, e); return b.child; }
function Lh(a, b, c, d, e) {
if (N(c)) {
var f = !0;
Xe(b);
}
else
f = !1;
Kf(b, e);
if (null === b.stateNode)
null !== a && (a.alternate = null, b.alternate = null, b.effectTag |= 2), hg(b, c, d, e), jg(b, c, d, e), d = !0;
else if (null === a) {
var h = b.stateNode, g = b.memoizedProps;
h.props = g;
var k = h.context, l = c.contextType;
"object" === typeof l && null !== l ? l = Mf(l) : (l = N(c) ? Re : L.current, l = Se(b, l));
var n = c.getDerivedStateFromProps, z = "function" === typeof n || "function" === typeof h.getSnapshotBeforeUpdate;
z || "function" !== typeof h.UNSAFE_componentWillReceiveProps &&
"function" !== typeof h.componentWillReceiveProps || (g !== d || k !== l) && ig(b, h, d, l);
Nf = !1;
var x = b.memoizedState;
k = h.state = x;
var v = b.updateQueue;
null !== v && (Wf(b, v, d, h, e), k = b.memoizedState);
g !== d || x !== k || M.current || Nf ? ("function" === typeof n && (bg(b, c, n, d), k = b.memoizedState), (g = Nf || gg(b, c, g, d, x, k, l)) ? (z || "function" !== typeof h.UNSAFE_componentWillMount && "function" !== typeof h.componentWillMount || ("function" === typeof h.componentWillMount && h.componentWillMount(), "function" === typeof h.UNSAFE_componentWillMount &&
h.UNSAFE_componentWillMount()), "function" === typeof h.componentDidMount && (b.effectTag |= 4)) : ("function" === typeof h.componentDidMount && (b.effectTag |= 4), b.memoizedProps = d, b.memoizedState = k), h.props = d, h.state = k, h.context = l, d = g) : ("function" === typeof h.componentDidMount && (b.effectTag |= 4), d = !1);
}
else
h = b.stateNode, g = b.memoizedProps, h.props = b.type === b.elementType ? g : Af(b.type, g), k = h.context, l = c.contextType, "object" === typeof l && null !== l ? l = Mf(l) : (l = N(c) ? Re : L.current, l = Se(b, l)), n = c.getDerivedStateFromProps, (z =
"function" === typeof n || "function" === typeof h.getSnapshotBeforeUpdate) || "function" !== typeof h.UNSAFE_componentWillReceiveProps && "function" !== typeof h.componentWillReceiveProps || (g !== d || k !== l) && ig(b, h, d, l), Nf = !1, k = b.memoizedState, x = h.state = k, v = b.updateQueue, null !== v && (Wf(b, v, d, h, e), x = b.memoizedState), g !== d || k !== x || M.current || Nf ? ("function" === typeof n && (bg(b, c, n, d), x = b.memoizedState), (n = Nf || gg(b, c, g, d, k, x, l)) ? (z || "function" !== typeof h.UNSAFE_componentWillUpdate && "function" !== typeof h.componentWillUpdate ||
("function" === typeof h.componentWillUpdate && h.componentWillUpdate(d, x, l), "function" === typeof h.UNSAFE_componentWillUpdate && h.UNSAFE_componentWillUpdate(d, x, l)), "function" === typeof h.componentDidUpdate && (b.effectTag |= 4), "function" === typeof h.getSnapshotBeforeUpdate && (b.effectTag |= 256)) : ("function" !== typeof h.componentDidUpdate || g === a.memoizedProps && k === a.memoizedState || (b.effectTag |= 4), "function" !== typeof h.getSnapshotBeforeUpdate || g === a.memoizedProps && k === a.memoizedState || (b.effectTag |= 256), b.memoizedProps =
d, b.memoizedState = x), h.props = d, h.state = x, h.context = l, d = n) : ("function" !== typeof h.componentDidUpdate || g === a.memoizedProps && k === a.memoizedState || (b.effectTag |= 4), "function" !== typeof h.getSnapshotBeforeUpdate || g === a.memoizedProps && k === a.memoizedState || (b.effectTag |= 256), d = !1);
return Mh(a, b, c, d, f, e);
} function Mh(a, b, c, d, e, f) { Kh(a, b); var h = 0 !== (b.effectTag & 64); if (!d && !h)
return e && Ye(b, c, !1), Fh(a, b, f); d = b.stateNode; Dh.current = b; var g = h && "function" !== typeof c.getDerivedStateFromError ? null : d.render(); b.effectTag |= 1; null !== a && h ? (b.child = tg(b, a.child, null, f), b.child = tg(b, null, g, f)) : S(a, b, g, f); b.memoizedState = d.state; e && Ye(b, c, !0); return b.child; }
function Nh(a) { var b = a.stateNode; b.pendingContext ? Ve(a, b.pendingContext, b.pendingContext !== b.context) : b.context && Ve(a, b.context, !1); Ag(a, b.containerInfo); } var Oh = {}; function Ph(a, b, c) {
var d = b.mode, e = b.pendingProps, f = P.current, h = null, g = !1, k;
(k = 0 !== (b.effectTag & 64)) || (k = 0 !== (f & Gg) && (null === a || null !== a.memoizedState));
k ? (h = Oh, g = !0, b.effectTag &= -65) : null !== a && null === a.memoizedState || void 0 === e.fallback || !0 === e.unstable_avoidThisFallback || (f |= Fg);
f &= Eg;
J(P, f, b);
if (null === a)
if (g) {
e = e.fallback;
a = sg(null, d, 0, null);
a.return = b;
if (0 === (b.mode & 2))
for (g = null !== b.memoizedState ? b.child.child : b.child, a.child = g; null !== g;)
g.return = a, g = g.sibling;
c = sg(e, d, c, null);
c.return = b;
a.sibling =
c;
d = a;
}
else
d = c = ug(b, null, e.children, c);
else {
if (null !== a.memoizedState)
if (f = a.child, d = f.sibling, g) {
e = e.fallback;
c = og(f, f.pendingProps, 0);
c.return = b;
if (0 === (b.mode & 2) && (g = null !== b.memoizedState ? b.child.child : b.child, g !== f.child))
for (c.child = g; null !== g;)
g.return = c, g = g.sibling;
e = og(d, e, d.expirationTime);
e.return = b;
c.sibling = e;
d = c;
c.childExpirationTime = 0;
c = e;
}
else
d = c = tg(b, f.child, e.children, c);
else if (f = a.child, g) {
g = e.fallback;
e = sg(null, d, 0, null);
e.return = b;
e.child = f;
null !== f && (f.return = e);
if (0 === (b.mode &
2))
for (f = null !== b.memoizedState ? b.child.child : b.child, e.child = f; null !== f;)
f.return = e, f = f.sibling;
c = sg(g, d, c, null);
c.return = b;
e.sibling = c;
c.effectTag |= 2;
d = e;
e.childExpirationTime = 0;
}
else
c = d = tg(b, f, e.children, c);
b.stateNode = a.stateNode;
}
b.memoizedState = h;
b.child = d;
return c;
} function Qh(a, b, c, d, e) { var f = a.memoizedState; null === f ? a.memoizedState = { isBackwards: b, rendering: null, last: d, tail: c, tailExpiration: 0, tailMode: e } : (f.isBackwards = b, f.rendering = null, f.last = d, f.tail = c, f.tailExpiration = 0, f.tailMode = e); } function Rh(a, b, c) {
var d = b.pendingProps, e = d.revealOrder, f = d.tail;
S(a, b, d.children, c);
d = P.current;
if (0 !== (d & Gg))
d = d & Eg | Gg, b.effectTag |= 64;
else {
if (null !== a && 0 !== (a.effectTag & 64))
a: for (a = b.child; null !== a;) {
if (13 === a.tag) {
if (null !== a.memoizedState) {
a.expirationTime < c && (a.expirationTime = c);
var h = a.alternate;
null !== h && h.expirationTime < c && (h.expirationTime = c);
Jf(a.return, c);
}
}
else if (null !== a.child) {
a.child.return = a;
a = a.child;
continue;
}
if (a === b)
break a;
for (; null === a.sibling;) {
if (null === a.return || a.return ===
b)
break a;
a = a.return;
}
a.sibling.return = a.return;
a = a.sibling;
}
d &= Eg;
}
J(P, d, b);
if (0 === (b.mode & 2))
b.memoizedState = null;
else
switch (e) {
case "forwards":
c = b.child;
for (e = null; null !== c;)
d = c.alternate, null !== d && null === Hg(d) && (e = c), c = c.sibling;
c = e;
null === c ? (e = b.child, b.child = null) : (e = c.sibling, c.sibling = null);
Qh(b, !1, e, c, f);
break;
case "backwards":
c = null;
e = b.child;
for (b.child = null; null !== e;) {
d = e.alternate;
if (null !== d && null === Hg(d)) {
b.child = e;
break;
}
d = e.sibling;
e.sibling = c;
c = e;
e = d;
}
Qh(b, !0, c, null, f);
break;
case "together":
Qh(b, !1, null, null, void 0);
break;
default: b.memoizedState = null;
}
return b.child;
} function Fh(a, b, c) { null !== a && (b.dependencies = a.dependencies); if (b.childExpirationTime < c)
return null; if (null !== a && b.child !== a.child)
throw t(Error(153)); if (null !== b.child) {
a = b.child;
c = og(a, a.pendingProps, a.expirationTime);
b.child = c;
for (c.return = b; null !== a.sibling;)
a = a.sibling, c = c.sibling = og(a, a.pendingProps, a.expirationTime), c.return = b;
c.sibling = null;
} return b.child; } function Sh(a) { a.effectTag |= 4; } var Th = void 0, Uh = void 0, Vh = void 0, Wh = void 0; Th = function (a, b) { for (var c = b.child; null !== c;) {
if (5 === c.tag || 6 === c.tag)
a.appendChild(c.stateNode);
else if (20 === c.tag)
a.appendChild(c.stateNode.instance);
else if (4 !== c.tag && null !== c.child) {
c.child.return = c;
c = c.child;
continue;
}
if (c === b)
break;
for (; null === c.sibling;) {
if (null === c.return || c.return === b)
return;
c = c.return;
}
c.sibling.return = c.return;
c = c.sibling;
} }; Uh = function () { }; Vh = function (a, b, c, d, e) {
var f = a.memoizedProps;
if (f !== d) {
var h = b.stateNode;
zg(wg.current);
a = null;
switch (c) {
case "input":
f = Bc(h, f);
d = Bc(h, d);
a = [];
break;
case "option":
f = le(h, f);
d = le(h, d);
a = [];
break;
case "select":
f = m({}, f, { value: void 0 });
d = m({}, d, { value: void 0 });
a = [];
break;
case "textarea":
f = ne(h, f);
d = ne(h, d);
a = [];
break;
default: "function" !== typeof f.onClick && "function" === typeof d.onClick && (h.onclick = Ge);
}
De(c, d);
h = c = void 0;
var g = null;
for (c in f)
if (!d.hasOwnProperty(c) && f.hasOwnProperty(c) && null != f[c])
if ("style" ===
c) {
var k = f[c];
for (h in k)
k.hasOwnProperty(h) && (g || (g = {}), g[h] = "");
}
else
"dangerouslySetInnerHTML" !== c && "children" !== c && "suppressContentEditableWarning" !== c && "suppressHydrationWarning" !== c && "autoFocus" !== c && (ia.hasOwnProperty(c) ? a || (a = []) : (a = a || []).push(c, null));
for (c in d) {
var l = d[c];
k = null != f ? f[c] : void 0;
if (d.hasOwnProperty(c) && l !== k && (null != l || null != k))
if ("style" === c)
if (k) {
for (h in k)
!k.hasOwnProperty(h) || l && l.hasOwnProperty(h) || (g || (g = {}), g[h] = "");
for (h in l)
l.hasOwnProperty(h) && k[h] !== l[h] && (g ||
(g = {}), g[h] = l[h]);
}
else
g || (a || (a = []), a.push(c, g)), g = l;
else
"dangerouslySetInnerHTML" === c ? (l = l ? l.__html : void 0, k = k ? k.__html : void 0, null != l && k !== l && (a = a || []).push(c, "" + l)) : "children" === c ? k === l || "string" !== typeof l && "number" !== typeof l || (a = a || []).push(c, "" + l) : "suppressContentEditableWarning" !== c && "suppressHydrationWarning" !== c && (ia.hasOwnProperty(c) ? (null != l && Fe(e, c), a || k === l || (a = [])) : (a = a || []).push(c, l));
}
g && (a = a || []).push("style", g);
e = a;
(b.updateQueue = e) && Sh(b);
}
}; Wh = function (a, b, c, d) { c !== d && Sh(b); }; function $h(a, b) { switch (a.tailMode) {
case "hidden":
b = a.tail;
for (var c = null; null !== b;)
null !== b.alternate && (c = b), b = b.sibling;
null === c ? a.tail = null : c.sibling = null;
break;
case "collapsed":
c = a.tail;
for (var d = null; null !== c;)
null !== c.alternate && (d = c), c = c.sibling;
null === d ? b || null === a.tail ? a.tail = null : a.tail.sibling = null : d.sibling = null;
} } function ai(a) { switch (a.tag) {
case 1:
N(a.type) && Te(a);
var b = a.effectTag;
return b & 2048 ? (a.effectTag = b & -2049 | 64, a) : null;
case 3:
Bg(a);
Ue(a);
b = a.effectTag;
if (0 !== (b & 64))
throw t(Error(285));
a.effectTag = b & -2049 | 64;
return a;
case 5: return Dg(a), null;
case 13: return H(P, a), b = a.effectTag, b & 2048 ? (a.effectTag = b & -2049 | 64, a) : null;
case 18: return null;
case 19: return H(P, a), null;
case 4: return Bg(a), null;
case 10: return If(a), null;
default: return null;
} } function bi(a, b) { return { value: a, source: b, stack: pc(b) }; } var ci = "function" === typeof WeakSet ? WeakSet : Set; function di(a, b) { var c = b.source, d = b.stack; null === d && null !== c && (d = pc(c)); null !== c && oc(c.type); b = b.value; null !== a && 1 === a.tag && oc(a.type); try {
console.error(b);
} catch (e) {
setTimeout(function () { throw e; });
} } function ei(a, b) { try {
b.props = a.memoizedProps, b.state = a.memoizedState, b.componentWillUnmount();
} catch (c) {
fi(a, c);
} } function gi(a) { var b = a.ref; if (null !== b)
if ("function" === typeof b)
try {
b(null);
}
catch (c) {
fi(a, c);
}
else
b.current = null; }
function hi(a, b, c) { c = c.updateQueue; c = null !== c ? c.lastEffect : null; if (null !== c) {
var d = c = c.next;
do {
if ((d.tag & a) !== Ig) {
var e = d.destroy;
d.destroy = void 0;
void 0 !== e && e();
}
(d.tag & b) !== Ig && (e = d.create, d.destroy = e());
d = d.next;
} while (d !== c);
} } function ii(a, b) { "function" === typeof ji && ji(a); switch (a.tag) {
case 0:
case 11:
case 14:
case 15:
var c = a.updateQueue;
if (null !== c && (c = c.lastEffect, null !== c)) {
var d = c.next;
vf(97 < b ? 97 : b, function () { var b = d; do {
var c = b.destroy;
if (void 0 !== c) {
var h = a;
try {
c();
}
catch (g) {
fi(h, g);
}
}
b = b.next;
} while (b !== d); });
}
break;
case 1:
gi(a);
b = a.stateNode;
"function" === typeof b.componentWillUnmount && ei(a, b);
break;
case 5:
gi(a);
break;
case 4: ki(a, b);
} } function li(a, b) { for (var c = a;;)
if (ii(c, b), null !== c.child && 4 !== c.tag)
c.child.return = c, c = c.child;
else {
if (c === a)
break;
for (; null === c.sibling;) {
if (null === c.return || c.return === a)
return;
c = c.return;
}
c.sibling.return = c.return;
c = c.sibling;
} }
function mi(a) { return 5 === a.tag || 3 === a.tag || 4 === a.tag; } function ni(a) {
a: {
for (var b = a.return; null !== b;) {
if (mi(b)) {
var c = b;
break a;
}
b = b.return;
}
throw t(Error(160));
}
b = c.stateNode;
switch (c.tag) {
case 5:
var d = !1;
break;
case 3:
b = b.containerInfo;
d = !0;
break;
case 4:
b = b.containerInfo;
d = !0;
break;
default: throw t(Error(161));
}
c.effectTag & 16 && (we(b, ""), c.effectTag &= -17);
a: b: for (c = a;;) {
for (; null === c.sibling;) {
if (null === c.return || mi(c.return)) {
c = null;
break a;
}
c = c.return;
}
c.sibling.return = c.return;
for (c = c.sibling; 5 !== c.tag && 6 !== c.tag && 18 !== c.tag;) {
if (c.effectTag & 2)
continue b;
if (null === c.child || 4 === c.tag)
continue b;
else
c.child.return = c, c = c.child;
}
if (!(c.effectTag & 2)) {
c = c.stateNode;
break a;
}
}
for (var e = a;;) {
var f = 5 === e.tag || 6 === e.tag;
if (f || 20 === e.tag) {
var h = f ? e.stateNode : e.stateNode.instance;
if (c)
if (d) {
f = b;
var g = h;
h = c;
8 === f.nodeType ? f.parentNode.insertBefore(g, h) : f.insertBefore(g, h);
}
else
b.insertBefore(h, c);
else
d ? (g = b, 8 === g.nodeType ? (f = g.parentNode, f.insertBefore(h, g)) : (f = g, f.appendChild(h)), g = g._reactRootContainer, null !== g && void 0 !== g || null !== f.onclick || (f.onclick = Ge)) :
b.appendChild(h);
}
else if (4 !== e.tag && null !== e.child) {
e.child.return = e;
e = e.child;
continue;
}
if (e === a)
break;
for (; null === e.sibling;) {
if (null === e.return || e.return === a)
return;
e = e.return;
}
e.sibling.return = e.return;
e = e.sibling;
}
} function ki(a, b) {
for (var c = a, d = !1, e = void 0, f = void 0;;) {
if (!d) {
d = c.return;
a: for (;;) {
if (null === d)
throw t(Error(160));
e = d.stateNode;
switch (d.tag) {
case 5:
f = !1;
break a;
case 3:
e = e.containerInfo;
f = !0;
break a;
case 4:
e = e.containerInfo;
f = !0;
break a;
}
d = d.return;
}
d = !0;
}
if (5 === c.tag || 6 === c.tag)
if (li(c, b), f) {
var h = e, g = c.stateNode;
8 === h.nodeType ? h.parentNode.removeChild(g) : h.removeChild(g);
}
else
e.removeChild(c.stateNode);
else if (20 === c.tag)
g = c.stateNode.instance, li(c, b), f ? (h = e, 8 === h.nodeType ? h.parentNode.removeChild(g) :
h.removeChild(g)) : e.removeChild(g);
else if (4 === c.tag) {
if (null !== c.child) {
e = c.stateNode.containerInfo;
f = !0;
c.child.return = c;
c = c.child;
continue;
}
}
else if (ii(c, b), null !== c.child) {
c.child.return = c;
c = c.child;
continue;
}
if (c === a)
break;
for (; null === c.sibling;) {
if (null === c.return || c.return === a)
return;
c = c.return;
4 === c.tag && (d = !1);
}
c.sibling.return = c.return;
c = c.sibling;
}
} function oi(a, b) {
switch (b.tag) {
case 0:
case 11:
case 14:
case 15:
hi(Kg, Lg, b);
break;
case 1: break;
case 5:
var c = b.stateNode;
if (null != c) {
var d = b.memoizedProps, e = null !== a ? a.memoizedProps : d;
a = b.type;
var f = b.updateQueue;
b.updateQueue = null;
if (null !== f) {
c[Ga] = d;
"input" === a && "radio" === d.type && null != d.name && Dc(c, d);
Ee(a, e);
b = Ee(a, d);
for (e = 0; e < f.length; e += 2) {
var h = f[e], g = f[e + 1];
"style" === h ? Ae(c, g) : "dangerouslySetInnerHTML" === h ? ve(c, g) : "children" === h ? we(c, g) : zc(c, h, g, b);
}
switch (a) {
case "input":
Ec(c, d);
break;
case "textarea":
pe(c, d);
break;
case "select": b = c._wrapperState.wasMultiple, c._wrapperState.wasMultiple = !!d.multiple, a = d.value, null != a ? me(c, !!d.multiple, a, !1) : b !== !!d.multiple && (null != d.defaultValue ? me(c, !!d.multiple, d.defaultValue, !0) : me(c, !!d.multiple, d.multiple ? [] : "", !1));
}
}
}
break;
case 6:
if (null === b.stateNode)
throw t(Error(162));
b.stateNode.nodeValue = b.memoizedProps;
break;
case 3: break;
case 12: break;
case 13:
c = b;
null === b.memoizedState ? d = !1 : (d = !0, c = b.child, pi = sf());
if (null !== c)
a: for (a = c;;) {
if (5 === a.tag)
f = a.stateNode, d ? (f =
f.style, "function" === typeof f.setProperty ? f.setProperty("display", "none", "important") : f.display = "none") : (f = a.stateNode, e = a.memoizedProps.style, e = void 0 !== e && null !== e && e.hasOwnProperty("display") ? e.display : null, f.style.display = ze("display", e));
else if (6 === a.tag)
a.stateNode.nodeValue = d ? "" : a.memoizedProps;
else if (13 === a.tag && null !== a.memoizedState) {
f = a.child.sibling;
f.return = a;
a = f;
continue;
}
else if (null !== a.child) {
a.child.return = a;
a = a.child;
continue;
}
if (a === c)
break a;
for (; null === a.sibling;) {
if (null ===
a.return || a.return === c)
break a;
a = a.return;
}
a.sibling.return = a.return;
a = a.sibling;
}
qi(b);
break;
case 19:
qi(b);
break;
case 17: break;
case 20: break;
default: throw t(Error(163));
}
} function qi(a) { var b = a.updateQueue; if (null !== b) {
a.updateQueue = null;
var c = a.stateNode;
null === c && (c = a.stateNode = new ci);
b.forEach(function (b) { var d = ri.bind(null, a, b); c.has(b) || (c.add(b), b.then(d, d)); });
} } var si = "function" === typeof WeakMap ? WeakMap : Map; function ti(a, b, c) { c = Qf(c, null); c.tag = 3; c.payload = { element: null }; var d = b.value; c.callback = function () { ui || (ui = !0, vi = d); di(a, b); }; return c; } function wi(a, b, c) { c = Qf(c, null); c.tag = 3; var d = a.type.getDerivedStateFromError; if ("function" === typeof d) {
var e = b.value;
c.payload = function () { di(a, b); return d(e); };
} var f = a.stateNode; null !== f && "function" === typeof f.componentDidCatch && (c.callback = function () { "function" !== typeof d && (null === xi ? xi = new Set([this]) : xi.add(this), di(a, b)); var c = b.stack; this.componentDidCatch(b.value, { componentStack: null !== c ? c : "" }); }); return c; } var yi = Math.ceil, zi = Xb.ReactCurrentDispatcher, Ai = Xb.ReactCurrentOwner, T = 0, Bi = 8, Ci = 16, Di = 32, Ei = 0, Fi = 1, Gi = 2, Hi = 3, Ii = 4, U = T, Ji = null, V = null, W = 0, X = Ei, Ki = 1073741823, Li = 1073741823, Mi = null, Ni = !1, pi = 0, Oi = 500, Y = null, ui = !1, vi = null, xi = null, Pi = !1, Qi = null, Ri = 90, Si = 0, Ti = null, Ui = 0, Vi = null, Wi = 0; function cg() { return (U & (Ci | Di)) !== T ? 1073741821 - (sf() / 10 | 0) : 0 !== Wi ? Wi : Wi = 1073741821 - (sf() / 10 | 0); } function dg(a, b, c) { b = b.mode; if (0 === (b & 2))
return 1073741823; var d = tf(); if (0 === (b & 4)) return 99 === d ? 1073741823 : 1073741822; if ((U & Ci) !== T) return W; if (null !== c) a = 1073741821 - 25 * (((1073741821 - a + (c.timeoutMs | 0 || 5E3) / 10) / 25 | 0) + 1);
else
switch (d) {
case 99:
a = 1073741823;
break;
case 98:
a = 1073741821 - 10 * (((1073741821 - a + 15) / 10 | 0) + 1);
break;
case 97:
case 96:
a = 1073741821 - 25 * (((1073741821 - a + 500) / 25 | 0) + 1);
break;
case 95:
a = 1;
break;
default: throw t(Error(326));
} null !== Ji && a === W && --a; return a; }
var Xi = 0; function eg(a, b) { if (50 < Ui)
throw Ui = 0, Vi = null, t(Error(185)); a = Yi(a, b); if (null !== a) {
a.pingTime = 0;
var c = tf();
if (1073741823 === b)
if ((U & Bi) !== T && (U & (Ci | Di)) === T)
for (var d = Z(a, 1073741823, !0); null !== d;)
d = d(!0);
else
Zi(a, 99, 1073741823), U === T && O();
else
Zi(a, c, b);
(U & 4) === T || 98 !== c && 99 !== c || (null === Ti ? Ti = new Map(a, b) : (c = Ti.get(a), (void 0 === c || c > b) && Ti.set(a, b)));
} } function Yi(a, b) {
a.expirationTime < b && (a.expirationTime = b);
var c = a.alternate;
null !== c && c.expirationTime < b && (c.expirationTime = b);
var d = a.return, e = null;
if (null === d && 3 === a.tag)
e = a.stateNode;
else
for (; null !== d;) {
c = d.alternate;
d.childExpirationTime < b && (d.childExpirationTime = b);
null !== c && c.childExpirationTime < b && (c.childExpirationTime = b);
if (null === d.return && 3 === d.tag) {
e = d.stateNode;
break;
}
d = d.return;
}
null !== e && (b > e.firstPendingTime && (e.firstPendingTime = b), a = e.lastPendingTime, 0 === a || b < a) && (e.lastPendingTime =
b);
return e;
} function Zi(a, b, c) { if (a.callbackExpirationTime < c) {
var d = a.callbackNode;
null !== d && d !== mf && af(d);
a.callbackExpirationTime = c;
1073741823 === c ? a.callbackNode = xf($i.bind(null, a, Z.bind(null, a, c))) : (d = null, 1 !== c && (d = { timeout: 10 * (1073741821 - c) - sf() }), a.callbackNode = wf(b, $i.bind(null, a, Z.bind(null, a, c)), d));
} } function $i(a, b, c) { var d = a.callbackNode, e = null; try {
return e = b(c), null !== e ? $i.bind(null, a, e) : null;
} finally {
null === e && d === a.callbackNode && (a.callbackNode = null, a.callbackExpirationTime = 0);
} } function aj() { (U & (1 | Ci | Di)) === T && (bj(), cj()); } function dj(a, b) { var c = a.firstBatch; return null !== c && c._defer && c._expirationTime >= b ? (wf(97, function () { c._onComplete(); return null; }), !0) : !1; } function bj() { if (null !== Ti) {
var a = Ti;
Ti = null;
a.forEach(function (a, c) { xf(Z.bind(null, c, a)); });
O();
} } function ej(a, b) { var c = U; U |= 1; try {
return a(b);
} finally {
U = c, U === T && O();
} } function fj(a, b, c, d) { var e = U; U |= 4; try {
return vf(98, a.bind(null, b, c, d));
} finally {
U = e, U === T && O();
} } function gj(a, b) { var c = U; U &= -2; U |= Bi; try {
return a(b);
} finally {
U = c, U === T && O();
} } function hj(a, b) { a.finishedWork = null; a.finishedExpirationTime = 0; var c = a.timeoutHandle; -1 !== c && (a.timeoutHandle = -1, Me(c)); if (null !== V)
for (c = V.return; null !== c;) {
var d = c;
switch (d.tag) {
case 1:
var e = d.type.childContextTypes;
null !== e && void 0 !== e && Te(d);
break;
case 3:
Bg(d);
Ue(d);
break;
case 5:
Dg(d);
break;
case 4:
Bg(d);
break;
case 13:
H(P, d);
break;
case 19:
H(P, d);
break;
case 10: If(d);
}
c = c.return;
} Ji = a; V = og(a.current, null, b); W = b; X = Ei; Li = Ki = 1073741823; Mi = null; Ni = !1; }
function Z(a, b, c) {
if ((U & (Ci | Di)) !== T)
throw t(Error(327));
if (a.firstPendingTime < b)
return null;
if (c && a.finishedExpirationTime === b)
return ij.bind(null, a);
cj();
if (a !== Ji || b !== W)
hj(a, b);
else if (X === Hi)
if (Ni)
hj(a, b);
else {
var d = a.lastPendingTime;
if (d < b)
return Z.bind(null, a, d);
}
if (null !== V) {
d = U;
U |= Ci;
var e = zi.current;
null === e && (e = hh);
zi.current = hh;
if (c) {
if (1073741823 !== b) {
var f = cg();
if (f < b)
return U = d, Gf(), zi.current = e, Z.bind(null, a, f);
}
}
else
Wi = 0;
do
try {
if (c)
for (; null !== V;)
V = jj(V);
else
for (; null !== V && !bf();)
V =
jj(V);
break;
}
catch (rb) {
Gf();
ih();
f = V;
if (null === f || null === f.return)
throw hj(a, b), U = d, rb;
a: {
var h = a, g = f.return, k = f, l = rb, n = W;
k.effectTag |= 1024;
k.firstEffect = k.lastEffect = null;
if (null !== l && "object" === typeof l && "function" === typeof l.then) {
var z = l, x = 0 !== (P.current & Fg);
l = g;
do {
var v;
if (v = 13 === l.tag)
null !== l.memoizedState ? v = !1 : (v = l.memoizedProps, v = void 0 === v.fallback ? !1 : !0 !== v.unstable_avoidThisFallback ? !0 : x ? !1 : !0);
if (v) {
g = l.updateQueue;
null === g ? (g = new Set, g.add(z), l.updateQueue = g) : g.add(z);
if (0 === (l.mode &
2)) {
l.effectTag |= 64;
k.effectTag &= -1957;
1 === k.tag && (null === k.alternate ? k.tag = 17 : (n = Qf(1073741823, null), n.tag = 2, Sf(k, n)));
k.expirationTime = 1073741823;
break a;
}
k = h;
h = n;
x = k.pingCache;
null === x ? (x = k.pingCache = new si, g = new Set, x.set(z, g)) : (g = x.get(z), void 0 === g && (g = new Set, x.set(z, g)));
g.has(h) || (g.add(h), k = kj.bind(null, k, z, h), z.then(k, k));
l.effectTag |= 2048;
l.expirationTime = n;
break a;
}
l = l.return;
} while (null !== l);
l = Error((oc(k.type) || "A React component") + " suspended while rendering, but no fallback UI was specified.\n\nAdd a <Suspense fallback=...> component higher in the tree to provide a loading indicator or placeholder to display." +
pc(k));
}
X !== Ii && (X = Fi);
l = bi(l, k);
k = g;
do {
switch (k.tag) {
case 3:
k.effectTag |= 2048;
k.expirationTime = n;
n = ti(k, l, n);
Tf(k, n);
break a;
case 1: if (z = l, h = k.type, g = k.stateNode, 0 === (k.effectTag & 64) && ("function" === typeof h.getDerivedStateFromError || null !== g && "function" === typeof g.componentDidCatch && (null === xi || !xi.has(g)))) {
k.effectTag |= 2048;
k.expirationTime = n;
n = wi(k, z, n);
Tf(k, n);
break a;
}
}
k = k.return;
} while (null !== k);
}
V = lj(f);
}
while (1);
U = d;
Gf();
zi.current = e;
if (null !== V)
return Z.bind(null, a, b);
}
a.finishedWork = a.current.alternate;
a.finishedExpirationTime = b;
if (dj(a, b))
return null;
Ji = null;
switch (X) {
case Ei: throw t(Error(328));
case Fi: return d = a.lastPendingTime, d < b ? Z.bind(null, a, d) : c ? ij.bind(null, a) : (hj(a, b), xf(Z.bind(null, a, b)), null);
case Gi:
if (1073741823 === Ki && !c && (c = pi + Oi - sf(), 10 < c)) {
if (Ni)
return hj(a, b), Z.bind(null, a, b);
d = a.lastPendingTime;
if (d < b)
return Z.bind(null, a, d);
a.timeoutHandle = Le(ij.bind(null, a), c);
return null;
}
return ij.bind(null, a);
case Hi:
if (!c) {
if (Ni)
return hj(a, b), Z.bind(null, a, b);
c = a.lastPendingTime;
if (c < b)
return Z.bind(null, a, c);
1073741823 !== Li ? c = 10 * (1073741821 - Li) - sf() : 1073741823 === Ki ? c = 0 : (c = 10 * (1073741821 - Ki) - 5E3, d = sf(), b = 10 * (1073741821 - b) - d, c = d - c, 0 > c && (c = 0), c = (120 > c ? 120 : 480 > c ? 480 : 1080 > c ? 1080 : 1920 > c ? 1920 : 3E3 > c ? 3E3 : 4320 > c ? 4320 : 1960 * yi(c / 1960)) - c, b < c && (c = b));
if (10 < c)
return a.timeoutHandle = Le(ij.bind(null, a), c), null;
}
return ij.bind(null, a);
case Ii: return !c && 1073741823 !== Ki && null !== Mi && (d = Ki, e = Mi, b = e.busyMinDurationMs | 0, 0 >= b ? b = 0 : (c = e.busyDelayMs | 0, d = sf() - (10 * (1073741821 - d) - (e.timeoutMs | 0 || 5E3)), b = d <= c ? 0 : c + b - d), 10 < b) ? (a.timeoutHandle =
Le(ij.bind(null, a), b), null) : ij.bind(null, a);
default: throw t(Error(329));
}
} function Xf(a, b) { a < Ki && 1 < a && (Ki = a); null !== b && a < Li && 1 < a && (Li = a, Mi = b); } function jj(a) { var b = mj(a.alternate, a, W); a.memoizedProps = a.pendingProps; null === b && (b = lj(a)); Ai.current = null; return b; } function lj(a) {
V = a;
do {
var b = V.alternate;
a = V.return;
if (0 === (V.effectTag & 1024)) {
a: {
var c = b;
b = V;
var d = W, e = b.pendingProps;
switch (b.tag) {
case 2: break;
case 16: break;
case 15:
case 0: break;
case 1:
N(b.type) && Te(b);
break;
case 3:
Bg(b);
Ue(b);
d = b.stateNode;
d.pendingContext && (d.context = d.pendingContext, d.pendingContext = null);
if (null === c || null === c.child)
Bh(b), b.effectTag &= -3;
Uh(b);
break;
case 5:
Dg(b);
d = zg(yg.current);
var f = b.type;
if (null !== c && null != b.stateNode)
Vh(c, b, f, e, d), c.ref !== b.ref && (b.effectTag |= 128);
else if (e) {
var h = zg(wg.current);
if (Bh(b)) {
c = b;
e = void 0;
f = c.stateNode;
var g = c.type, k = c.memoizedProps;
f[Fa] = c;
f[Ga] = k;
switch (g) {
case "iframe":
case "object":
case "embed":
G("load", f);
break;
case "video":
case "audio":
for (var l = 0; l < bb.length; l++)
G(bb[l], f);
break;
case "source":
G("error", f);
break;
case "img":
case "image":
case "link":
G("error", f);
G("load", f);
break;
case "form":
G("reset", f);
G("submit", f);
break;
case "details":
G("toggle", f);
break;
case "input":
Cc(f, k);
G("invalid", f);
Fe(d, "onChange");
break;
case "select":
f._wrapperState =
{ wasMultiple: !!k.multiple };
G("invalid", f);
Fe(d, "onChange");
break;
case "textarea": oe(f, k), G("invalid", f), Fe(d, "onChange");
}
De(g, k);
l = null;
for (e in k)
k.hasOwnProperty(e) && (h = k[e], "children" === e ? "string" === typeof h ? f.textContent !== h && (l = ["children", h]) : "number" === typeof h && f.textContent !== "" + h && (l = ["children", "" + h]) : ia.hasOwnProperty(e) && null != h && Fe(d, e));
switch (g) {
case "input":
Vb(f);
Gc(f, k, !0);
break;
case "textarea":
Vb(f);
qe(f, k);
break;
case "select":
case "option": break;
default: "function" === typeof k.onClick &&
(f.onclick = Ge);
}
d = l;
c.updateQueue = d;
null !== d && Sh(b);
}
else {
k = f;
c = e;
g = b;
l = 9 === d.nodeType ? d : d.ownerDocument;
h === re.html && (h = se(k));
h === re.html ? "script" === k ? (k = l.createElement("div"), k.innerHTML = "<script>\x3c/script>", l = k.removeChild(k.firstChild)) : "string" === typeof c.is ? l = l.createElement(k, { is: c.is }) : (l = l.createElement(k), "select" === k && (k = l, c.multiple ? k.multiple = !0 : c.size && (k.size = c.size))) : l = l.createElementNS(h, k);
k = l;
k[Fa] = g;
k[Ga] = c;
c = k;
Th(c, b, !1, !1);
g = c;
var n = d, z = Ee(f, e);
switch (f) {
case "iframe":
case "object":
case "embed":
G("load", g);
d = e;
break;
case "video":
case "audio":
for (d = 0; d < bb.length; d++)
G(bb[d], g);
d = e;
break;
case "source":
G("error", g);
d = e;
break;
case "img":
case "image":
case "link":
G("error", g);
G("load", g);
d = e;
break;
case "form":
G("reset", g);
G("submit", g);
d = e;
break;
case "details":
G("toggle", g);
d = e;
break;
case "input":
Cc(g, e);
d = Bc(g, e);
G("invalid", g);
Fe(n, "onChange");
break;
case "option":
d = le(g, e);
break;
case "select":
g._wrapperState = { wasMultiple: !!e.multiple };
d = m({}, e, { value: void 0 });
G("invalid", g);
Fe(n, "onChange");
break;
case "textarea":
oe(g, e);
d = ne(g, e);
G("invalid", g);
Fe(n, "onChange");
break;
default: d = e;
}
De(f, d);
k = void 0;
l = f;
h = g;
var x = d;
for (k in x)
if (x.hasOwnProperty(k)) {
var v = x[k];
"style" === k ? Ae(h, v) : "dangerouslySetInnerHTML" === k ? (v = v ? v.__html : void 0, null != v && ve(h, v)) : "children" === k ? "string" === typeof v ? ("textarea" !== l || "" !== v) && we(h, v) : "number" === typeof v && we(h, "" + v) : "suppressContentEditableWarning" !== k && "suppressHydrationWarning" !== k && "autoFocus" !== k && (ia.hasOwnProperty(k) ? null != v && Fe(n, k) : null != v && zc(h, k, v, z));
}
switch (f) {
case "input":
Vb(g);
Gc(g, e, !1);
break;
case "textarea":
Vb(g);
qe(g, e);
break;
case "option":
null != e.value && g.setAttribute("value", "" + Ac(e.value));
break;
case "select":
d = g;
g = e;
d.multiple = !!g.multiple;
k = g.value;
null != k ? me(d, !!g.multiple, k, !1) : null != g.defaultValue && me(d, !!g.multiple, g.defaultValue, !0);
break;
default: "function" === typeof d.onClick && (g.onclick = Ge);
}
Je(f, e) && Sh(b);
b.stateNode = c;
}
null !== b.ref && (b.effectTag |= 128);
}
else if (null === b.stateNode)
throw t(Error(166));
break;
case 6:
if (c && null != b.stateNode)
Wh(c, b, c.memoizedProps, e);
else {
if ("string" !== typeof e && null === b.stateNode)
throw t(Error(166));
c = zg(yg.current);
zg(wg.current);
Bh(b) ? (d = b.stateNode, c = b.memoizedProps, d[Fa] = b, d.nodeValue !== c && Sh(b)) : (d = b, c = (9 === c.nodeType ? c : c.ownerDocument).createTextNode(e), c[Fa] = b, d.stateNode = c);
}
break;
case 11: break;
case 13:
H(P, b);
e = b.memoizedState;
if (0 !== (b.effectTag & 64)) {
b.expirationTime = d;
break a;
}
d = null !== e;
e = !1;
null === c ? Bh(b) : (f = c.memoizedState, e = null !== f, d || null === f || (f = c.child.sibling, null !== f && (g = b.firstEffect, null !== g ? (b.firstEffect =
f, f.nextEffect = g) : (b.firstEffect = b.lastEffect = f, f.nextEffect = null), f.effectTag = 8)));
if (d && !e && 0 !== (b.mode & 2))
if (null === c && !0 !== b.memoizedProps.unstable_avoidThisFallback || 0 !== (P.current & Fg))
X === Ei && (X = Gi);
else if (X === Ei || X === Gi)
X = Hi;
if (d || e)
b.effectTag |= 4;
break;
case 7: break;
case 8: break;
case 12: break;
case 4:
Bg(b);
Uh(b);
break;
case 10:
If(b);
break;
case 9: break;
case 14: break;
case 17:
N(b.type) && Te(b);
break;
case 18: break;
case 19:
H(P, b);
e = b.memoizedState;
if (null === e)
break;
f = 0 !== (b.effectTag & 64);
g = e.rendering;
if (null === g)
if (f)
$h(e, !1);
else {
if (X !== Ei || null !== c && 0 !== (c.effectTag & 64))
for (c = b.child; null !== c;) {
g = Hg(c);
if (null !== g) {
b.effectTag |= 64;
$h(e, !1);
c = g.updateQueue;
null !== c && (b.updateQueue = c, b.effectTag |= 4);
b.firstEffect = b.lastEffect = null;
for (c = b.child; null !== c;)
e = c, f = d, e.effectTag &= 2, e.nextEffect = null, e.firstEffect = null, e.lastEffect = null, g = e.alternate, null === g ? (e.childExpirationTime = 0, e.expirationTime = f, e.child = null, e.memoizedProps = null, e.memoizedState = null, e.updateQueue = null, e.dependencies = null) : (e.childExpirationTime =
g.childExpirationTime, e.expirationTime = g.expirationTime, e.child = g.child, e.memoizedProps = g.memoizedProps, e.memoizedState = g.memoizedState, e.updateQueue = g.updateQueue, f = g.dependencies, e.dependencies = null === f ? null : { expirationTime: f.expirationTime, firstContext: f.firstContext, responders: f.responders }), c = c.sibling;
J(P, P.current & Eg | Gg, b);
b = b.child;
break a;
}
c = c.sibling;
}
}
else {
if (!f)
if (c = Hg(g), null !== c) {
if (b.effectTag |= 64, f = !0, $h(e, !0), null === e.tail && "hidden" === e.tailMode) {
d = c.updateQueue;
null !== d && (b.updateQueue =
d, b.effectTag |= 4);
b = b.lastEffect = e.lastEffect;
null !== b && (b.nextEffect = null);
break;
}
}
else
sf() > e.tailExpiration && 1 < d && (b.effectTag |= 64, f = !0, $h(e, !1), b.expirationTime = b.childExpirationTime = d - 1);
e.isBackwards ? (g.sibling = b.child, b.child = g) : (d = e.last, null !== d ? d.sibling = g : b.child = g, e.last = g);
}
if (null !== e.tail) {
0 === e.tailExpiration && (e.tailExpiration = sf() + 500);
d = e.tail;
e.rendering = d;
e.tail = d.sibling;
e.lastEffect = b.lastEffect;
d.sibling = null;
c = P.current;
c = f ? c & Eg | Gg : c & Eg;
J(P, c, b);
b = d;
break a;
}
break;
case 20: break;
default: throw t(Error(156));
}
b = null;
}
d = V;
if (1 === W || 1 !== d.childExpirationTime) {
c = 0;
for (e = d.child; null !== e;)
f = e.expirationTime, g = e.childExpirationTime, f > c && (c = f), g > c && (c = g), e = e.sibling;
d.childExpirationTime = c;
}
if (null !== b)
return b;
null !== a && 0 === (a.effectTag & 1024) && (null === a.firstEffect && (a.firstEffect = V.firstEffect), null !== V.lastEffect && (null !== a.lastEffect && (a.lastEffect.nextEffect = V.firstEffect), a.lastEffect = V.lastEffect), 1 < V.effectTag && (null !== a.lastEffect ? a.lastEffect.nextEffect = V : a.firstEffect = V,
a.lastEffect = V));
}
else {
b = ai(V, W);
if (null !== b)
return b.effectTag &= 1023, b;
null !== a && (a.firstEffect = a.lastEffect = null, a.effectTag |= 1024);
}
b = V.sibling;
if (null !== b)
return b;
V = a;
} while (null !== V);
X === Ei && (X = Ii);
return null;
} function ij(a) { var b = tf(); vf(99, nj.bind(null, a, b)); null !== Qi && wf(97, function () { cj(); return null; }); return null; } function nj(a, b) {
cj();
if ((U & (Ci | Di)) !== T)
throw t(Error(327));
var c = a.finishedWork, d = a.finishedExpirationTime;
if (null === c)
return null;
a.finishedWork = null;
a.finishedExpirationTime = 0;
if (c === a.current)
throw t(Error(177));
a.callbackNode = null;
a.callbackExpirationTime = 0;
var e = c.expirationTime, f = c.childExpirationTime;
e = f > e ? f : e;
a.firstPendingTime = e;
e < a.lastPendingTime && (a.lastPendingTime = e);
a === Ji && (V = Ji = null, W = 0);
1 < c.effectTag ? null !== c.lastEffect ? (c.lastEffect.nextEffect = c, e = c.firstEffect) : e = c : e = c.firstEffect;
if (null !== e) {
f = U;
U |= Di;
Ai.current = null;
He = Qd;
var h = ae();
if (be(h)) {
if ("selectionStart" in h)
var g = { start: h.selectionStart, end: h.selectionEnd };
else
a: {
g = (g = h.ownerDocument) && g.defaultView || window;
var k = g.getSelection && g.getSelection();
if (k && 0 !== k.rangeCount) {
g = k.anchorNode;
var l = k.anchorOffset, n = k.focusNode;
k = k.focusOffset;
try {
g.nodeType, n.nodeType;
}
catch (zb) {
g = null;
break a;
}
var z = 0, x = -1, v = -1, rb = 0, Be = 0, u = h, w = null;
b: for (;;) {
for (var C;;) {
u !== g || 0 !== l && 3 !== u.nodeType || (x = z + l);
u !== n || 0 !== k && 3 !== u.nodeType ||
(v = z + k);
3 === u.nodeType && (z += u.nodeValue.length);
if (null === (C = u.firstChild))
break;
w = u;
u = C;
}
for (;;) {
if (u === h)
break b;
w === g && ++rb === l && (x = z);
w === n && ++Be === k && (v = z);
if (null !== (C = u.nextSibling))
break;
u = w;
w = u.parentNode;
}
u = C;
}
g = -1 === x || -1 === v ? null : { start: x, end: v };
}
else
g = null;
}
g = g || { start: 0, end: 0 };
}
else
g = null;
Ie = { focusedElem: h, selectionRange: g };
Qd = !1;
Y = e;
do
try {
for (; null !== Y;) {
if (0 !== (Y.effectTag & 256)) {
var I = Y.alternate;
h = Y;
switch (h.tag) {
case 0:
case 11:
case 15:
hi(Jg, Ig, h);
break;
case 1:
if (h.effectTag & 256 && null !==
I) {
var E = I.memoizedProps, ua = I.memoizedState, gh = h.stateNode, oj = gh.getSnapshotBeforeUpdate(h.elementType === h.type ? E : Af(h.type, E), ua);
gh.__reactInternalSnapshotBeforeUpdate = oj;
}
break;
case 3:
case 5:
case 6:
case 4:
case 17: break;
default: throw t(Error(163));
}
}
Y = Y.nextEffect;
}
}
catch (zb) {
if (null === Y)
throw t(Error(330));
fi(Y, zb);
Y = Y.nextEffect;
}
while (null !== Y);
Y = e;
do
try {
for (I = b; null !== Y;) {
var A = Y.effectTag;
A & 16 && we(Y.stateNode, "");
if (A & 128) {
var p = Y.alternate;
if (null !== p) {
var r = p.ref;
null !== r && ("function" === typeof r ?
r(null) : r.current = null);
}
}
switch (A & 14) {
case 2:
ni(Y);
Y.effectTag &= -3;
break;
case 6:
ni(Y);
Y.effectTag &= -3;
oi(Y.alternate, Y);
break;
case 4:
oi(Y.alternate, Y);
break;
case 8:
E = Y;
ki(E, I);
E.return = null;
E.child = null;
E.memoizedState = null;
E.updateQueue = null;
E.dependencies = null;
var K = E.alternate;
null !== K && (K.return = null, K.child = null, K.memoizedState = null, K.updateQueue = null, K.dependencies = null);
}
Y = Y.nextEffect;
}
}
catch (zb) {
if (null === Y)
throw t(Error(330));
fi(Y, zb);
Y = Y.nextEffect;
}
while (null !== Y);
r = Ie;
p = ae();
A = r.focusedElem;
I = r.selectionRange;
if (p !== A && A && A.ownerDocument && $d(A.ownerDocument.documentElement, A)) {
null !== I && be(A) && (p = I.start, r = I.end, void 0 === r && (r = p), "selectionStart" in A ? (A.selectionStart = p, A.selectionEnd = Math.min(r, A.value.length)) : (r = (p = A.ownerDocument || document) && p.defaultView || window, r.getSelection && (r = r.getSelection(), E = A.textContent.length, K = Math.min(I.start, E), I = void 0 === I.end ? K : Math.min(I.end, E), !r.extend && K > I && (E = I, I = K, K = E), E = Zd(A, K), ua = Zd(A, I), E && ua && (1 !== r.rangeCount || r.anchorNode !== E.node || r.anchorOffset !==
E.offset || r.focusNode !== ua.node || r.focusOffset !== ua.offset) && (p = p.createRange(), p.setStart(E.node, E.offset), r.removeAllRanges(), K > I ? (r.addRange(p), r.extend(ua.node, ua.offset)) : (p.setEnd(ua.node, ua.offset), r.addRange(p))))));
p = [];
for (r = A; r = r.parentNode;)
1 === r.nodeType && p.push({ element: r, left: r.scrollLeft, top: r.scrollTop });
"function" === typeof A.focus && A.focus();
for (A = 0; A < p.length; A++)
r = p[A], r.element.scrollLeft = r.left, r.element.scrollTop = r.top;
}
Ie = null;
Qd = !!He;
He = null;
a.current = c;
Y = e;
do
try {
for (A = d; null !==
Y;) {
var $a = Y.effectTag;
if ($a & 36) {
var nc = Y.alternate;
p = Y;
r = A;
switch (p.tag) {
case 0:
case 11:
case 15:
hi(Mg, Ng, p);
break;
case 1:
var md = p.stateNode;
if (p.effectTag & 4)
if (null === nc)
md.componentDidMount();
else {
var Fj = p.elementType === p.type ? nc.memoizedProps : Af(p.type, nc.memoizedProps);
md.componentDidUpdate(Fj, nc.memoizedState, md.__reactInternalSnapshotBeforeUpdate);
}
var Xh = p.updateQueue;
null !== Xh && Yf(p, Xh, md, r);
break;
case 3:
var Yh = p.updateQueue;
if (null !== Yh) {
K = null;
if (null !== p.child)
switch (p.child.tag) {
case 5:
K =
p.child.stateNode;
break;
case 1: K = p.child.stateNode;
}
Yf(p, Yh, K, r);
}
break;
case 5:
var Gj = p.stateNode;
null === nc && p.effectTag & 4 && (r = Gj, Je(p.type, p.memoizedProps) && r.focus());
break;
case 6: break;
case 4: break;
case 12: break;
case 13:
case 19:
case 17:
case 20: break;
default: throw t(Error(163));
}
}
if ($a & 128) {
var nd = Y.ref;
if (null !== nd) {
var Zh = Y.stateNode;
switch (Y.tag) {
case 5:
var gf = Zh;
break;
default: gf = Zh;
}
"function" === typeof nd ? nd(gf) : nd.current = gf;
}
}
$a & 512 && (Pi = !0);
Y = Y.nextEffect;
}
}
catch (zb) {
if (null === Y)
throw t(Error(330));
fi(Y, zb);
Y = Y.nextEffect;
}
while (null !== Y);
Y = null;
nf();
U = f;
}
else
a.current = c;
if (Pi)
Pi = !1, Qi = a, Si = d, Ri = b;
else
for (Y = e; null !== Y;)
b = Y.nextEffect, Y.nextEffect = null, Y = b;
b = a.firstPendingTime;
0 !== b ? ($a = cg(), $a = zf($a, b), Zi(a, $a, b)) : xi = null;
"function" === typeof pj && pj(c.stateNode, d);
1073741823 === b ? a === Vi ? Ui++ : (Ui = 0, Vi = a) : Ui = 0;
if (ui)
throw ui = !1, a = vi, vi = null, a;
if ((U & Bi) !== T)
return null;
O();
return null;
} function cj() { if (null === Qi)
return !1; var a = Qi, b = Si, c = Ri; Qi = null; Si = 0; Ri = 90; return vf(97 < c ? 97 : c, qj.bind(null, a, b)); }
function qj(a) { if ((U & (Ci | Di)) !== T)
throw t(Error(331)); var b = U; U |= Di; for (a = a.current.firstEffect; null !== a;) {
try {
var c = a;
if (0 !== (c.effectTag & 512))
switch (c.tag) {
case 0:
case 11:
case 15: hi(Pg, Ig, c), hi(Ig, Og, c);
}
}
catch (d) {
if (null === a)
throw t(Error(330));
fi(a, d);
}
c = a.nextEffect;
a.nextEffect = null;
a = c;
} U = b; O(); return !0; } function rj(a, b, c) { b = bi(c, b); b = ti(a, b, 1073741823); Sf(a, b); a = Yi(a, 1073741823); null !== a && Zi(a, 99, 1073741823); } function fi(a, b) { if (3 === a.tag)
rj(a, a, b);
else
for (var c = a.return; null !== c;) {
if (3 === c.tag) {
rj(c, a, b);
break;
}
else if (1 === c.tag) {
var d = c.stateNode;
if ("function" === typeof c.type.getDerivedStateFromError || "function" === typeof d.componentDidCatch && (null === xi || !xi.has(d))) {
a = bi(b, a);
a = wi(c, a, 1073741823);
Sf(c, a);
c = Yi(c, 1073741823);
null !== c && Zi(c, 99, 1073741823);
break;
}
}
c = c.return;
} }
function kj(a, b, c) { var d = a.pingCache; null !== d && d.delete(b); Ji === a && W === c ? X === Hi || X === Gi && 1073741823 === Ki && sf() - pi < Oi ? hj(a, W) : Ni = !0 : a.lastPendingTime < c || (b = a.pingTime, 0 !== b && b < c || (a.pingTime = c, a.finishedExpirationTime === c && (a.finishedExpirationTime = 0, a.finishedWork = null), b = cg(), b = zf(b, c), Zi(a, b, c))); } function ri(a, b) { var c = a.stateNode; null !== c && c.delete(b); c = cg(); b = dg(c, a, null); c = zf(c, b); a = Yi(a, b); null !== a && Zi(a, c, b); } var mj = void 0; mj = function (a, b, c) {
var d = b.expirationTime;
if (null !== a) {
var e = b.pendingProps;
if (a.memoizedProps !== e || M.current)
Lf = !0;
else if (d < c) {
Lf = !1;
switch (b.tag) {
case 3:
Nh(b);
Ch();
break;
case 5:
Cg(b);
if (b.mode & 4 && 1 !== c && e.hidden)
return b.expirationTime = b.childExpirationTime = 1, null;
break;
case 1:
N(b.type) && Xe(b);
break;
case 4:
Ag(b, b.stateNode.containerInfo);
break;
case 10:
Hf(b, b.memoizedProps.value);
break;
case 13:
if (null !== b.memoizedState) {
d = b.child.childExpirationTime;
if (0 !== d && d >= c)
return Ph(a, b, c);
J(P, P.current &
Eg, b);
b = Fh(a, b, c);
return null !== b ? b.sibling : null;
}
J(P, P.current & Eg, b);
break;
case 19:
d = b.childExpirationTime >= c;
if (0 !== (a.effectTag & 64)) {
if (d)
return Rh(a, b, c);
b.effectTag |= 64;
}
e = b.memoizedState;
null !== e && (e.rendering = null, e.tail = null);
J(P, P.current, b);
if (!d)
return null;
}
return Fh(a, b, c);
}
}
else
Lf = !1;
b.expirationTime = 0;
switch (b.tag) {
case 2:
d = b.type;
null !== a && (a.alternate = null, b.alternate = null, b.effectTag |= 2);
a = b.pendingProps;
e = Se(b, L.current);
Kf(b, c);
e = dh(null, b, d, a, e, c);
b.effectTag |= 1;
if ("object" === typeof e &&
null !== e && "function" === typeof e.render && void 0 === e.$$typeof) {
b.tag = 1;
ih();
if (N(d)) {
var f = !0;
Xe(b);
}
else
f = !1;
b.memoizedState = null !== e.state && void 0 !== e.state ? e.state : null;
var h = d.getDerivedStateFromProps;
"function" === typeof h && bg(b, d, h, a);
e.updater = fg;
b.stateNode = e;
e._reactInternalFiber = b;
jg(b, d, a, c);
b = Mh(null, b, d, !0, f, c);
}
else
b.tag = 0, S(null, b, e, c), b = b.child;
return b;
case 16:
e = b.elementType;
null !== a && (a.alternate = null, b.alternate = null, b.effectTag |= 2);
a = b.pendingProps;
e = Bf(e);
b.type = e;
f = b.tag = sj(e);
a = Af(e, a);
switch (f) {
case 0:
b = Jh(null, b, e, a, c);
break;
case 1:
b = Lh(null, b, e, a, c);
break;
case 11:
b = Eh(null, b, e, a, c);
break;
case 14:
b = Gh(null, b, e, Af(e.type, a), d, c);
break;
default: throw t(Error(306), e, "");
}
return b;
case 0: return d = b.type, e = b.pendingProps, e = b.elementType === d ? e : Af(d, e), Jh(a, b, d, e, c);
case 1: return d = b.type, e = b.pendingProps, e = b.elementType === d ? e : Af(d, e), Lh(a, b, d, e, c);
case 3:
Nh(b);
d = b.updateQueue;
if (null === d)
throw t(Error(282));
e = b.memoizedState;
e = null !== e ? e.element : null;
Wf(b, d, b.pendingProps, null, c);
d = b.memoizedState.element;
if (d === e)
Ch(), b = Fh(a, b, c);
else {
e = b.stateNode;
if (e = (null === a || null === a.child) && e.hydrate)
uh = Ne(b.stateNode.containerInfo.firstChild), th = b, e = vh = !0;
e ? (b.effectTag |= 2, b.child = ug(b, null, d, c)) : (S(a, b, d, c), Ch());
b = b.child;
}
return b;
case 5: return Cg(b), null === a && zh(b), d = b.type, e = b.pendingProps, f = null !== a ? a.memoizedProps : null, h = e.children, Ke(d, e) ? h = null : null !== f && Ke(d, f) && (b.effectTag |= 16), Kh(a, b), b.mode & 4 && 1 !== c && e.hidden ? (b.expirationTime = b.childExpirationTime = 1, b = null) :
(S(a, b, h, c), b = b.child), b;
case 6: return null === a && zh(b), null;
case 13: return Ph(a, b, c);
case 4: return Ag(b, b.stateNode.containerInfo), d = b.pendingProps, null === a ? b.child = tg(b, null, d, c) : S(a, b, d, c), b.child;
case 11: return d = b.type, e = b.pendingProps, e = b.elementType === d ? e : Af(d, e), Eh(a, b, d, e, c);
case 7: return S(a, b, b.pendingProps, c), b.child;
case 8: return S(a, b, b.pendingProps.children, c), b.child;
case 12: return S(a, b, b.pendingProps.children, c), b.child;
case 10:
a: {
d = b.type._context;
e = b.pendingProps;
h = b.memoizedProps;
f = e.value;
Hf(b, f);
if (null !== h) {
var g = h.value;
f = hd(g, f) ? 0 : ("function" === typeof d._calculateChangedBits ? d._calculateChangedBits(g, f) : 1073741823) | 0;
if (0 === f) {
if (h.children === e.children && !M.current) {
b = Fh(a, b, c);
break a;
}
}
else
for (g = b.child, null !== g && (g.return = b); null !== g;) {
var k = g.dependencies;
if (null !== k) {
h = g.child;
for (var l = k.firstContext; null !== l;) {
if (l.context === d && 0 !== (l.observedBits & f)) {
1 === g.tag && (l = Qf(c, null), l.tag = 2, Sf(g, l));
g.expirationTime < c && (g.expirationTime = c);
l = g.alternate;
null !== l && l.expirationTime <
c && (l.expirationTime = c);
Jf(g.return, c);
k.expirationTime < c && (k.expirationTime = c);
break;
}
l = l.next;
}
}
else
h = 10 === g.tag ? g.type === b.type ? null : g.child : g.child;
if (null !== h)
h.return = g;
else
for (h = g; null !== h;) {
if (h === b) {
h = null;
break;
}
g = h.sibling;
if (null !== g) {
g.return = h.return;
h = g;
break;
}
h = h.return;
}
g = h;
}
}
S(a, b, e.children, c);
b = b.child;
}
return b;
case 9: return e = b.type, f = b.pendingProps, d = f.children, Kf(b, c), e = Mf(e, f.unstable_observedBits), d = d(e), b.effectTag |= 1, S(a, b, d, c), b.child;
case 14: return e = b.type, f = Af(e, b.pendingProps),
f = Af(e.type, f), Gh(a, b, e, f, d, c);
case 15: return Ih(a, b, b.type, b.pendingProps, d, c);
case 17: return d = b.type, e = b.pendingProps, e = b.elementType === d ? e : Af(d, e), null !== a && (a.alternate = null, b.alternate = null, b.effectTag |= 2), b.tag = 1, N(d) ? (a = !0, Xe(b)) : a = !1, Kf(b, c), hg(b, d, e, c), jg(b, d, e, c), Mh(null, b, d, !0, a, c);
case 19: return Rh(a, b, c);
}
throw t(Error(156));
}; var pj = null, ji = null; function tj(a) { if ("undefined" === typeof __REACT_DEVTOOLS_GLOBAL_HOOK__)
return !1; var b = __REACT_DEVTOOLS_GLOBAL_HOOK__; if (b.isDisabled || !b.supportsFiber)
return !0; try {
var c = b.inject(a);
pj = function (a) { try {
b.onCommitFiberRoot(c, a, void 0, 64 === (a.current.effectTag & 64));
}
catch (e) { } };
ji = function (a) { try {
b.onCommitFiberUnmount(c, a);
}
catch (e) { } };
} catch (d) { } return !0; } function uj(a, b, c, d) { this.tag = a; this.key = c; this.sibling = this.child = this.return = this.stateNode = this.type = this.elementType = null; this.index = 0; this.ref = null; this.pendingProps = b; this.dependencies = this.memoizedState = this.updateQueue = this.memoizedProps = null; this.mode = d; this.effectTag = 0; this.lastEffect = this.firstEffect = this.nextEffect = null; this.childExpirationTime = this.expirationTime = 0; this.alternate = null; } function xh(a, b, c, d) { return new uj(a, b, c, d); } function Hh(a) { a = a.prototype; return !(!a || !a.isReactComponent); } function sj(a) { if ("function" === typeof a)
return Hh(a) ? 1 : 0; if (void 0 !== a && null !== a) {
a = a.$$typeof;
if (a === gc)
return 11;
if (a === jc)
return 14;
} return 2; } function og(a, b) {
var c = a.alternate;
null === c ? (c = xh(a.tag, b, a.key, a.mode), c.elementType = a.elementType, c.type = a.type, c.stateNode = a.stateNode, c.alternate = a, a.alternate = c) : (c.pendingProps = b, c.effectTag = 0, c.nextEffect = null, c.firstEffect = null, c.lastEffect = null);
c.childExpirationTime = a.childExpirationTime;
c.expirationTime = a.expirationTime;
c.child = a.child;
c.memoizedProps = a.memoizedProps;
c.memoizedState = a.memoizedState;
c.updateQueue = a.updateQueue;
b = a.dependencies;
c.dependencies = null === b ? null : { expirationTime: b.expirationTime,
firstContext: b.firstContext, responders: b.responders };
c.sibling = a.sibling;
c.index = a.index;
c.ref = a.ref;
return c;
} function qg(a, b, c, d, e, f) {
var h = 2;
d = a;
if ("function" === typeof a)
Hh(a) && (h = 1);
else if ("string" === typeof a)
h = 5;
else
a: switch (a) {
case ac: return sg(c.children, e, f, b);
case fc:
h = 8;
e |= 7;
break;
case bc:
h = 8;
e |= 1;
break;
case cc: return a = xh(12, c, b, e | 8), a.elementType = cc, a.type = cc, a.expirationTime = f, a;
case hc: return a = xh(13, c, b, e), a.type = hc, a.elementType = hc, a.expirationTime = f, a;
case ic: return a = xh(19, c, b, e), a.elementType = ic, a.expirationTime = f, a;
default:
if ("object" === typeof a && null !== a)
switch (a.$$typeof) {
case dc:
h =
10;
break a;
case ec:
h = 9;
break a;
case gc:
h = 11;
break a;
case jc:
h = 14;
break a;
case kc:
h = 16;
d = null;
break a;
}
throw t(Error(130), null == a ? a : typeof a, "");
}
b = xh(h, c, b, e);
b.elementType = a;
b.type = d;
b.expirationTime = f;
return b;
} function sg(a, b, c, d) { a = xh(7, a, d, b); a.expirationTime = c; return a; } function pg(a, b, c) { a = xh(6, a, null, b); a.expirationTime = c; return a; } function rg(a, b, c) { b = xh(4, null !== a.children ? a.children : [], a.key, b); b.expirationTime = c; b.stateNode = { containerInfo: a.containerInfo, pendingChildren: null, implementation: a.implementation }; return b; } function vj(a, b, c) { this.tag = b; this.current = null; this.containerInfo = a; this.pingCache = this.pendingChildren = null; this.finishedExpirationTime = 0; this.finishedWork = null; this.timeoutHandle = -1; this.pendingContext = this.context = null; this.hydrate = c; this.callbackNode = this.firstBatch = null; this.pingTime = this.lastPendingTime = this.firstPendingTime = this.callbackExpirationTime = 0; } function wj(a, b, c) { a = new vj(a, b, c); b = xh(3, null, null, 2 === b ? 7 : 1 === b ? 3 : 0); a.current = b; return b.stateNode = a; } function xj(a, b, c, d, e, f) {
var h = b.current;
a: if (c) {
c = c._reactInternalFiber;
b: {
if (2 !== ld(c) || 1 !== c.tag)
throw t(Error(170));
var g = c;
do {
switch (g.tag) {
case 3:
g = g.stateNode.context;
break b;
case 1: if (N(g.type)) {
g = g.stateNode.__reactInternalMemoizedMergedChildContext;
break b;
}
}
g = g.return;
} while (null !== g);
throw t(Error(171));
}
if (1 === c.tag) {
var k = c.type;
if (N(k)) {
c = We(c, k, g);
break a;
}
}
c = g;
}
else
c = Qe;
null === b.context ? b.context = c : b.pendingContext = c;
b = f;
e = Qf(d, e);
e.payload = { element: a };
b = void 0 === b ? null : b;
null !== b &&
(e.callback = b);
Sf(h, e);
eg(h, d);
return d;
} function yj(a, b, c, d) { var e = b.current, f = cg(), h = $f.suspense; e = dg(f, e, h); return xj(a, b, c, e, h, d); } function zj(a) { a = a.current; if (!a.child)
return null; switch (a.child.tag) {
case 5: return a.child.stateNode;
default: return a.child.stateNode;
} } function Aj(a, b, c) { var d = 3 < arguments.length && void 0 !== arguments[3] ? arguments[3] : null; return { $$typeof: $b, key: null == d ? null : "" + d, children: a, containerInfo: b, implementation: c }; } Db = function (a, b, c) { switch (b) {
case "input":
Ec(a, c);
b = c.name;
if ("radio" === c.type && null != b) {
for (c = a; c.parentNode;)
c = c.parentNode;
c = c.querySelectorAll("input[name=" + JSON.stringify("" + b) + '][type="radio"]');
for (b = 0; b < c.length; b++) {
var d = c[b];
if (d !== a && d.form === a.form) {
var e = Ka(d);
if (!e)
throw t(Error(90));
Wb(d);
Ec(d, e);
}
}
}
break;
case "textarea":
pe(a, c);
break;
case "select": b = c.value, null != b && me(a, !!c.multiple, b, !1);
} }; function Bj(a) { var b = 1073741821 - 25 * (((1073741821 - cg() + 500) / 25 | 0) + 1); b <= Xi && --b; this._expirationTime = Xi = b; this._root = a; this._callbacks = this._next = null; this._hasChildren = this._didComplete = !1; this._children = null; this._defer = !0; } Bj.prototype.render = function (a) { if (!this._defer)
throw t(Error(250)); this._hasChildren = !0; this._children = a; var b = this._root._internalRoot, c = this._expirationTime, d = new Cj; xj(a, b, null, c, null, d._onCommit); return d; };
Bj.prototype.then = function (a) { if (this._didComplete)
a();
else {
var b = this._callbacks; null === b && (b = this._callbacks = []); b.push(a);
} }; Bj.prototype.commit = function () {
var a = this._root._internalRoot, b = a.firstBatch;
if (!this._defer || null === b)
throw t(Error(251));
if (this._hasChildren) {
var c = this._expirationTime;
if (b !== this) {
this._hasChildren && (c = this._expirationTime = b._expirationTime, this.render(this._children));
for (var d = null, e = b; e !== this;)
d = e, e = e._next;
if (null === d)
throw t(Error(251));
d._next = e._next;
this._next = b;
a.firstBatch = this;
}
this._defer = !1;
b = c;
if ((U & (Ci | Di)) !== T)
throw t(Error(253));
xf(Z.bind(null, a, b));
O();
b = this._next;
this._next =
null;
b = a.firstBatch = b;
null !== b && b._hasChildren && b.render(b._children);
}
else
this._next = null, this._defer = !1;
}; Bj.prototype._onComplete = function () { if (!this._didComplete) {
this._didComplete = !0;
var a = this._callbacks;
if (null !== a)
for (var b = 0; b < a.length; b++)
(0, a[b])();
} }; function Cj() { this._callbacks = null; this._didCommit = !1; this._onCommit = this._onCommit.bind(this); } Cj.prototype.then = function (a) { if (this._didCommit)
a();
else {
var b = this._callbacks; null === b && (b = this._callbacks = []); b.push(a);
} }; Cj.prototype._onCommit = function () { if (!this._didCommit) {
this._didCommit = !0;
var a = this._callbacks;
if (null !== a)
for (var b = 0; b < a.length; b++) {
var c = a[b];
if ("function" !== typeof c)
throw t(Error(191), c);
c();
}
} }; function Dj(a, b, c) { this._internalRoot = wj(a, b, c); } function Ej(a, b) { this._internalRoot = wj(a, 2, b); } Ej.prototype.render = Dj.prototype.render = function (a, b) { var c = this._internalRoot, d = new Cj; b = void 0 === b ? null : b; null !== b && d.then(b); yj(a, c, null, d._onCommit); return d; }; Ej.prototype.unmount = Dj.prototype.unmount = function (a) { var b = this._internalRoot, c = new Cj; a = void 0 === a ? null : a; null !== a && c.then(a); yj(null, b, null, c._onCommit); return c; }; Ej.prototype.createBatch = function () { var a = new Bj(this), b = a._expirationTime, c = this._internalRoot, d = c.firstBatch; if (null === d)
c.firstBatch = a, a._next = null;
else {
for (c = null; null !== d && d._expirationTime >= b;)
c = d, d = d._next;
a._next = d;
null !== c && (c._next = a);
} return a; }; function Hj(a) { return !(!a || 1 !== a.nodeType && 9 !== a.nodeType && 11 !== a.nodeType && (8 !== a.nodeType || " react-mount-point-unstable " !== a.nodeValue)); } Jb = ej; Kb = fj; Lb = aj; Mb = function (a, b) { var c = U; U |= 2; try {
return a(b);
} finally {
U = c, U === T && O();
} }; function Ij(a, b) { b || (b = a ? 9 === a.nodeType ? a.documentElement : a.firstChild : null, b = !(!b || 1 !== b.nodeType || !b.hasAttribute("data-reactroot"))); if (!b)
for (var c; c = a.lastChild;)
a.removeChild(c); return new Dj(a, 0, b); }
function Jj(a, b, c, d, e) { var f = c._reactRootContainer, h = void 0; if (f) {
h = f._internalRoot;
if ("function" === typeof e) {
var g = e;
e = function () { var a = zj(h); g.call(a); };
}
yj(b, h, a, e);
} else {
f = c._reactRootContainer = Ij(c, d);
h = f._internalRoot;
if ("function" === typeof e) {
var k = e;
e = function () { var a = zj(h); k.call(a); };
}
gj(function () { yj(b, h, a, e); });
} return zj(h); } function Kj(a, b) { var c = 2 < arguments.length && void 0 !== arguments[2] ? arguments[2] : null; if (!Hj(b))
throw t(Error(200)); return Aj(a, b, null, c); }
var Nj = { createPortal: Kj, findDOMNode: function (a) { if (null == a)
a = null;
else if (1 !== a.nodeType) {
var b = a._reactInternalFiber;
if (void 0 === b) {
if ("function" === typeof a.render)
throw t(Error(188));
throw t(Error(268), Object.keys(a));
}
a = qd(b);
a = null === a ? null : a.stateNode;
} return a; }, hydrate: function (a, b, c) { if (!Hj(b))
throw t(Error(200)); return Jj(null, a, b, !0, c); }, render: function (a, b, c) { if (!Hj(b))
throw t(Error(200)); return Jj(null, a, b, !1, c); }, unstable_renderSubtreeIntoContainer: function (a, b, c, d) {
if (!Hj(c))
throw t(Error(200));
if (null == a || void 0 === a._reactInternalFiber)
throw t(Error(38));
return Jj(a, b, c, !1, d);
}, unmountComponentAtNode: function (a) { if (!Hj(a))
throw t(Error(40)); return a._reactRootContainer ? (gj(function () { Jj(null, null, a, !1, function () { a._reactRootContainer = null; }); }), !0) : !1; }, unstable_createPortal: function () { return Kj.apply(void 0, arguments); }, unstable_batchedUpdates: ej, unstable_interactiveUpdates: function (a, b, c, d) { aj(); return fj(a, b, c, d); }, unstable_discreteUpdates: fj, unstable_flushDiscreteUpdates: aj, flushSync: function (a, b) { if ((U & (Ci | Di)) !== T)
throw t(Error(187)); var c = U; U |= 1; try {
return vf(99, a.bind(null, b));
}
finally {
U = c, O();
} }, unstable_createRoot: Lj, unstable_createSyncRoot: Mj, unstable_flushControlled: function (a) { var b = U; U |= 1; try {
vf(99, a);
}
finally {
U = b, U === T && O();
} }, __SECRET_INTERNALS_DO_NOT_USE_OR_YOU_WILL_BE_FIRED: { Events: [Ia, Ja, Ka, Ca.injectEventPluginsByName, fa, Qa, function (a) { ya(a, Pa); }, Hb, Ib, Ud, Ba, cj, { current: !1 }] } };
function Lj(a, b) { if (!Hj(a))
throw t(Error(299), "unstable_createRoot"); return new Ej(a, null != b && !0 === b.hydrate); }
function Mj(a, b) { if (!Hj(a))
throw t(Error(299), "unstable_createRoot"); return new Dj(a, 1, null != b && !0 === b.hydrate); }
(function (a) { var b = a.findFiberByHostInstance; return tj(m({}, a, { overrideHookState: null, overrideProps: null, setSuspenseHandler: null, scheduleUpdate: null, currentDispatcherRef: Xb.ReactCurrentDispatcher, findHostInstanceByFiber: function (a) { a = qd(a); return null === a ? null : a.stateNode; }, findFiberByHostInstance: function (a) { return b ? b(a) : null; }, findHostInstancesForRefresh: null, scheduleRefresh: null, scheduleRoot: null, setRefreshHandler: null, getCurrentFiber: null })); })({ findFiberByHostInstance: Ha, bundleType: 0, version: "16.9.0",
rendererPackageName: "react-dom" });
var Oj = { default: Nj }, Pj = Oj && Nj || Oj; module.exports = Pj.default || Pj;
} // scheduler/index.js $fsx.f[5] = (module, exports) => { 'use strict'; module.exports = $fsx.r(4);
} // scheduler/cjs/scheduler.production.min.js $fsx.f[4] = (module, exports) => { 'use strict'; Object.defineProperty(exports, "__esModule", { value: !0 }); var d = void 0, e = void 0, g = void 0, m = void 0, n = void 0; exports.unstable_now = void 0; exports.unstable_forceFrameRate = void 0; if ("undefined" === typeof window || "function" !== typeof MessageChannel) {
var p = null, q = null, r = function () { if (null !== p)
try {
var a = exports.unstable_now();
p(!0, a);
p = null;
}
catch (b) {
throw setTimeout(r, 0), b;
} };
exports.unstable_now = function () { return Date.now(); };
d = function (a) { null !== p ? setTimeout(d, 0, a) : (p = a, setTimeout(r, 0)); };
e = function (a, b) { q = setTimeout(a, b); };
g = function () { clearTimeout(q); };
m = function () { return !1; };
n = exports.unstable_forceFrameRate = function () { };
} else {
var t = window.performance, u = window.Date, v = window.setTimeout, w = window.clearTimeout, x = window.requestAnimationFrame, y = window.cancelAnimationFrame;
"undefined" !== typeof console && ("function" !== typeof x && console.error("This browser doesn't support requestAnimationFrame. Make sure that you load a polyfill in older browsers. https://fb.me/react-polyfills"), "function" !== typeof y && console.error("This browser doesn't support cancelAnimationFrame. Make sure that you load a polyfill in older browsers. https://fb.me/react-polyfills"));
exports.unstable_now = "object" === typeof t &&
"function" === typeof t.now ? function () { return t.now(); } : function () { return u.now(); };
var z = !1, A = null, B = -1, C = -1, D = 33.33, E = -1, F = -1, G = 0, H = !1;
m = function () { return exports.unstable_now() >= G; };
n = function () { };
exports.unstable_forceFrameRate = function (a) { 0 > a || 125 < a ? console.error("forceFrameRate takes a positive int between 0 and 125, forcing framerates higher than 125 fps is not unsupported") : 0 < a ? (D = Math.floor(1E3 / a), H = !0) : (D = 33.33, H = !1); };
var J = function () {
if (null !== A) {
var a = exports.unstable_now(), b = 0 < G - a;
try {
A(b, a) || (A = null);
}
catch (c) {
throw I.postMessage(null), c;
}
}
}, K = new MessageChannel, I = K.port2;
K.port1.onmessage = J;
var L = function (a) { if (null === A)
F = E = -1, z = !1;
else {
z = !0;
x(function (a) { w(B); L(a); });
var b = function () { G = exports.unstable_now() + D / 2; J(); B = v(b, 3 * D); };
B = v(b, 3 * D);
if (-1 !== E && .1 < a - E) {
var c = a - E;
!H && -1 !== F && c < D && F < D && (D = c < F ? F : c, 8.33 > D && (D = 8.33));
F = c;
}
E = a;
G = a + D;
I.postMessage(null);
} };
d = function (a) { A = a; z || (z = !0, x(function (a) { L(a); })); };
e = function (a, b) { C = v(function () { a(exports.unstable_now()); }, b); };
g = function () {
w(C);
C = -1;
};
} var M = null, N = null, O = null, P = 3, Q = !1, R = !1, S = !1; function T(a, b) {
var c = a.next;
if (c === a)
M = null;
else {
a === M && (M = c);
var f = a.previous;
f.next = c;
c.previous = f;
}
a.next = a.previous = null;
c = a.callback;
f = P;
var l = O;
P = a.priorityLevel;
O = a;
try {
var h = a.expirationTime <= b;
switch (P) {
case 1:
var k = c(h);
break;
case 2:
k = c(h);
break;
case 3:
k = c(h);
break;
case 4:
k = c(h);
break;
case 5: k = c(h);
}
}
catch (Z) {
throw Z;
}
finally {
P = f, O = l;
}
if ("function" === typeof k)
if (b = a.expirationTime, a.callback = k, null === M)
M = a.next = a.previous = a;
else {
k = null;
h = M;
do {
if (b <= h.expirationTime) {
k = h;
break;
}
h = h.next;
} while (h !==
M);
null === k ? k = M : k === M && (M = a);
b = k.previous;
b.next = k.previous = a;
a.next = k;
a.previous = b;
}
} function U(a) { if (null !== N && N.startTime <= a) {
do {
var b = N, c = b.next;
if (b === c)
N = null;
else {
N = c;
var f = b.previous;
f.next = c;
c.previous = f;
}
b.next = b.previous = null;
V(b, b.expirationTime);
} while (null !== N && N.startTime <= a);
} } function W(a) { S = !1; U(a); R || (null !== M ? (R = !0, d(X)) : null !== N && e(W, N.startTime - a)); } function X(a, b) { R = !1; S && (S = !1, g()); U(b); Q = !0; try {
if (!a)
for (; null !== M && M.expirationTime <= b;)
T(M, b), b = exports.unstable_now(), U(b);
else if (null !== M) {
do
T(M, b), b = exports.unstable_now(), U(b);
while (null !== M && !m());
}
if (null !== M)
return !0;
null !== N && e(W, N.startTime - b);
return !1;
} finally {
Q = !1;
} } function Y(a) { switch (a) {
case 1: return -1; case 2: return 250; case 5: return 1073741823; case 4: return 1E4; default: return 5E3;
} } function V(a, b) { if (null === M)
M = a.next = a.previous = a;
else {
var c = null, f = M;
do {
if (b < f.expirationTime) {
c = f;
break;
}
f = f.next;
} while (f !== M);
null === c ? c = M : c === M && (M = a);
b = c.previous;
b.next = c.previous = a;
a.next = c;
a.previous = b;
} } var aa = n; exports.unstable_ImmediatePriority = 1; exports.unstable_UserBlockingPriority = 2; exports.unstable_NormalPriority = 3; exports.unstable_IdlePriority = 5; exports.unstable_LowPriority = 4; exports.unstable_runWithPriority = function (a, b) { switch (a) {
case 1: case 2: case 3: case 4: case 5: break; default: a = 3;
} var c = P; P = a; try {
return b();
} finally {
P = c;
} }; exports.unstable_next = function (a) { switch (P) {
case 1:
case 2:
case 3:
var b = 3;
break;
default: b = P;
} var c = P; P = b; try {
return a();
} finally {
P = c;
} }; exports.unstable_scheduleCallback = function (a, b, c) {
var f = exports.unstable_now();
if ("object" === typeof c && null !== c) {
var l = c.delay;
l = "number" === typeof l && 0 < l ? f + l : f;
c = "number" === typeof c.timeout ? c.timeout : Y(a);
}
else
c = Y(a), l = f;
c = l + c;
a = { callback: b, priorityLevel: a, startTime: l, expirationTime: c, next: null, previous: null };
if (l > f) {
c = l;
if (null === N)
N = a.next = a.previous = a;
else {
b = null;
var h = N;
do {
if (c < h.startTime) {
b = h;
break;
}
h = h.next;
} while (h !== N);
null === b ? b = N : b === N && (N = a);
c = b.previous;
c.next = b.previous = a;
a.next = b;
a.previous =
c;
}
null === M && N === a && (S ? g() : S = !0, e(W, l - f));
}
else
V(a, c), R || Q || (R = !0, d(X));
return a;
}; exports.unstable_cancelCallback = function (a) { var b = a.next; if (null !== b) {
if (a === b)
a === M ? M = null : a === N && (N = null);
else {
a === M ? M = b : a === N && (N = b);
var c = a.previous;
c.next = b;
b.previous = c;
}
a.next = a.previous = null;
} }; exports.unstable_wrapCallback = function (a) { var b = P; return function () { var c = P; P = b; try {
return a.apply(this, arguments);
} finally {
P = c;
} }; }; exports.unstable_getCurrentPriorityLevel = function () { return P; }; exports.unstable_shouldYield = function () { var a = exports.unstable_now(); U(a); return null !== O && null !== M && M.startTime <= a && M.expirationTime < O.expirationTime || m(); }; exports.unstable_requestPaint = aa; exports.unstable_continueExecution = function () { R || Q || (R = !0, d(X)); }; exports.unstable_pauseExecution = function () { }; exports.unstable_getFirstCallbackNode = function () { return M; };
} // tslib/tslib.es6.js $fsx.f[8] = (module, exports) => { "use strict"; Object.defineProperty(exports, "__esModule", { value: true }); var extendStatics = function (d, b) {
extendStatics = Object.setPrototypeOf ||
({ __proto__: [] } instanceof Array && function (d, b) { d.__proto__ = b; }) ||
function (d, b) { for (var p in b)
if (b.hasOwnProperty(p))
d[p] = b[p]; };
return extendStatics(d, b);
}; function __extends(d, b) {
extendStatics(d, b);
function __() { this.constructor = d; }
d.prototype = b === null ? Object.create(b) : (__.prototype = b.prototype, new __());
} exports.__extends = __extends; exports.__assign = function () {
exports.__assign = Object.assign || function __assign(t) {
for (var s, i = 1, n = arguments.length; i < n; i++) {
s = arguments[i];
for (var p in s)
if (Object.prototype.hasOwnProperty.call(s, p))
t[p] = s[p];
}
return t;
};
return exports.__assign.apply(this, arguments);
}; function __rest(s, e) {
var t = {};
for (var p in s)
if (Object.prototype.hasOwnProperty.call(s, p) && e.indexOf(p) < 0)
t[p] = s[p];
if (s != null && typeof Object.getOwnPropertySymbols === "function")
for (var i = 0, p = Object.getOwnPropertySymbols(s); i < p.length; i++) {
if (e.indexOf(p[i]) < 0 && Object.prototype.propertyIsEnumerable.call(s, p[i]))
t[p[i]] = s[p[i]];
}
return t;
} exports.__rest = __rest; function __decorate(decorators, target, key, desc) {
var c = arguments.length, r = c < 3 ? target : desc === null ? desc = Object.getOwnPropertyDescriptor(target, key) : desc, d;
if (typeof Reflect === "object" && typeof Reflect.decorate === "function")
r = Reflect.decorate(decorators, target, key, desc);
else
for (var i = decorators.length - 1; i >= 0; i--)
if (d = decorators[i])
r = (c < 3 ? d(r) : c > 3 ? d(target, key, r) : d(target, key)) || r;
return c > 3 && r && Object.defineProperty(target, key, r), r;
} exports.__decorate = __decorate; function __param(paramIndex, decorator) {
return function (target, key) { decorator(target, key, paramIndex); };
} exports.__param = __param; function __metadata(metadataKey, metadataValue) {
if (typeof Reflect === "object" && typeof Reflect.metadata === "function")
return Reflect.metadata(metadataKey, metadataValue);
} exports.__metadata = __metadata; function __awaiter(thisArg, _arguments, P, generator) {
return new (P || (P = Promise))(function (resolve, reject) {
function fulfilled(value) { try {
step(generator.next(value));
}
catch (e) {
reject(e);
} }
function rejected(value) { try {
step(generator["throw"](value));
}
catch (e) {
reject(e);
} }
function step(result) { result.done ? resolve(result.value) : new P(function (resolve) { resolve(result.value); }).then(fulfilled, rejected); }
step((generator = generator.apply(thisArg, _arguments || [])).next());
});
} exports.__awaiter = __awaiter; function __generator(thisArg, body) {
var _ = { label: 0, sent: function () { if (t[0] & 1)
throw t[1]; return t[1]; }, trys: [], ops: [] }, f, y, t, g;
return g = { next: verb(0), "throw": verb(1), "return": verb(2) }, typeof Symbol === "function" && (g[Symbol.iterator] = function () { return this; }), g;
function verb(n) { return function (v) { return step([n, v]); }; }
function step(op) {
if (f)
throw new TypeError("Generator is already executing.");
while (_)
try {
if (f = 1, y && (t = op[0] & 2 ? y["return"] : op[0] ? y["throw"] || ((t = y["return"]) && t.call(y), 0) : y.next) && !(t = t.call(y, op[1])).done)
return t;
if (y = 0, t)
op = [op[0] & 2, t.value];
switch (op[0]) {
case 0:
case 1:
t = op;
break;
case 4:
_.label++;
return { value: op[1], done: false };
case 5:
_.label++;
y = op[1];
op = [0];
continue;
case 7:
op = _.ops.pop();
_.trys.pop();
continue;
default:
if (!(t = _.trys, t = t.length > 0 && t[t.length - 1]) && (op[0] === 6 || op[0] === 2)) {
_ = 0;
continue;
}
if (op[0] === 3 && (!t || (op[1] > t[0] && op[1] < t[3]))) {
_.label = op[1];
break;
}
if (op[0] === 6 && _.label < t[1]) {
_.label = t[1];
t = op;
break;
}
if (t && _.label < t[2]) {
_.label = t[2];
_.ops.push(op);
break;
}
if (t[2])
_.ops.pop();
_.trys.pop();
continue;
}
op = body.call(thisArg, _);
}
catch (e) {
op = [6, e];
y = 0;
}
finally {
f = t = 0;
}
if (op[0] & 5)
throw op[1];
return { value: op[0] ? op[1] : void 0, done: true };
}
} exports.__generator = __generator; function __exportStar(m, exports) {
for (var p in m)
if (!exports.hasOwnProperty(p))
exports[p] = m[p];
} exports.__exportStar = __exportStar; function __values(o) {
var m = typeof Symbol === "function" && o[Symbol.iterator], i = 0;
if (m)
return m.call(o);
return {
next: function () {
if (o && i >= o.length)
o = void 0;
return { value: o && o[i++], done: !o };
}
};
} exports.__values = __values; function __read(o, n) {
var m = typeof Symbol === "function" && o[Symbol.iterator];
if (!m)
return o;
var i = m.call(o), r, ar = [], e;
try {
while ((n === void 0 || n-- > 0) && !(r = i.next()).done)
ar.push(r.value);
}
catch (error) {
e = { error: error };
}
finally {
try {
if (r && !r.done && (m = i["return"]))
m.call(i);
}
finally {
if (e)
throw e.error;
}
}
return ar;
} exports.__read = __read; function __spread() {
for (var ar = [], i = 0; i < arguments.length; i++)
ar = ar.concat(__read(arguments[i]));
return ar;
} exports.__spread = __spread; function __spreadArrays() {
for (var s = 0, i = 0, il = arguments.length; i < il; i++)
s += arguments[i].length;
for (var r = Array(s), k = 0, i = 0; i < il; i++)
for (var a = arguments[i], j = 0, jl = a.length; j < jl; j++, k++)
r[k] = a[j];
return r;
} exports.__spreadArrays = __spreadArrays;
function __await(v) {
return this instanceof __await ? (this.v = v, this) : new __await(v);
} exports.__await = __await; function __asyncGenerator(thisArg, _arguments, generator) {
if (!Symbol.asyncIterator)
throw new TypeError("Symbol.asyncIterator is not defined.");
var g = generator.apply(thisArg, _arguments || []), i, q = [];
return i = {}, verb("next"), verb("throw"), verb("return"), i[Symbol.asyncIterator] = function () { return this; }, i;
function verb(n) { if (g[n])
i[n] = function (v) { return new Promise(function (a, b) { q.push([n, v, a, b]) > 1 || resume(n, v); }); }; }
function resume(n, v) { try {
step(g[n](v));
}
catch (e) {
settle(q[0][3], e);
} }
function step(r) { r.value instanceof __await ? Promise.resolve(r.value.v).then(fulfill, reject) : settle(q[0][2], r); }
function fulfill(value) { resume("next", value); }
function reject(value) { resume("throw", value); }
function settle(f, v) { if (f(v), q.shift(), q.length)
resume(q[0][0], q[0][1]); }
} exports.__asyncGenerator = __asyncGenerator; function __asyncDelegator(o) {
var i, p;
return i = {}, verb("next"), verb("throw", function (e) { throw e; }), verb("return"), i[Symbol.iterator] = function () { return this; }, i;
function verb(n, f) { i[n] = o[n] ? function (v) { return (p = !p) ? { value: __await(o[n](v)), done: n === "return" } : f ? f(v) : v; } : f; }
} exports.__asyncDelegator = __asyncDelegator; function __asyncValues(o) {
if (!Symbol.asyncIterator)
throw new TypeError("Symbol.asyncIterator is not defined.");
var m = o[Symbol.asyncIterator], i;
return m ? m.call(o) : (o = typeof __values === "function" ? __values(o) : o[Symbol.iterator](), i = {}, verb("next"), verb("throw"), verb("return"), i[Symbol.asyncIterator] = function () { return this; }, i);
function verb(n) { i[n] = o[n] && function (v) { return new Promise(function (resolve, reject) { v = o[n](v), settle(resolve, reject, v.done, v.value); }); }; }
function settle(resolve, reject, d, v) { Promise.resolve(v).then(function (v) { resolve({ value: v, done: d }); }, reject); }
} exports.__asyncValues = __asyncValues; function __makeTemplateObject(cooked, raw) {
if (Object.defineProperty) {
Object.defineProperty(cooked, "raw", { value: raw });
}
else {
cooked.raw = raw;
}
return cooked;
} exports.__makeTemplateObject = __makeTemplateObject;
function __importStar(mod) {
if (mod && mod.__esModule)
return mod;
var result = {};
if (mod != null)
for (var k in mod)
if (Object.hasOwnProperty.call(mod, k))
result[k] = mod[k];
result.default = mod;
return result;
} exports.__importStar = __importStar; function __importDefault(mod) {
return (mod && mod.__esModule) ? mod : { default: mod };
} exports.__importDefault = __importDefault;
} // react-router-dom/esm/react-router-dom.js $fsx.f[29] = (module, exports) => { "use strict"; Object.defineProperty(exports, "__esModule", { value: true }); const tslib_1 = $fsx.r(8); const inheritsLoose_1 = $fsx.r(9); const react_1 = $fsx.r(3); const react_router_1 = $fsx.r(28); tslib_1.__exportStar($fsx.r(28), exports); const history_1 = $fsx.r(21); const extends_1 = $fsx.r(16); const objectWithoutPropertiesLoose_1 = $fsx.r(24); const tiny_invariant_1 = $fsx.r(20); var BrowserRouter = function (_React$Component) {
inheritsLoose_1.default(BrowserRouter, _React$Component);
function BrowserRouter() {
var _this;
for (var _len = arguments.length, args = new Array(_len), _key = 0; _key < _len; _key++) {
args[_key] = arguments[_key];
}
_this = _React$Component.call.apply(_React$Component, [this].concat(args)) || this;
_this.history = history_1.createBrowserHistory(_this.props);
return _this;
}
var _proto = BrowserRouter.prototype;
_proto.render = function render() {
return react_1.default.createElement(react_router_1.Router, {
history: this.history,
children: this.props.children
});
};
return BrowserRouter;
}(react_1.default.Component); exports.BrowserRouter = BrowserRouter; var HashRouter = function (_React$Component) {
inheritsLoose_1.default(HashRouter, _React$Component);
function HashRouter() {
var _this;
for (var _len = arguments.length, args = new Array(_len), _key = 0; _key < _len; _key++) {
args[_key] = arguments[_key];
}
_this = _React$Component.call.apply(_React$Component, [this].concat(args)) || this;
_this.history = history_1.createHashHistory(_this.props);
return _this;
}
var _proto = HashRouter.prototype;
_proto.render = function render() {
return react_1.default.createElement(react_router_1.Router, {
history: this.history,
children: this.props.children
});
};
return HashRouter;
}(react_1.default.Component); exports.HashRouter = HashRouter; function isModifiedEvent(event) {
return !!(event.metaKey || event.altKey || event.ctrlKey || event.shiftKey);
} var Link = function (_React$Component) {
inheritsLoose_1.default(Link, _React$Component);
function Link() {
return _React$Component.apply(this, arguments) || this;
}
var _proto = Link.prototype;
_proto.handleClick = function handleClick(event, history) {
try {
if (this.props.onClick)
this.props.onClick(event);
}
catch (ex) {
event.preventDefault();
throw ex;
}
if (!event.defaultPrevented &&
event.button === 0 && (!this.props.target || this.props.target === "_self") &&
!isModifiedEvent(event)) {
event.preventDefault();
var method = this.props.replace ? history.replace : history.push;
method(this.props.to);
}
};
_proto.render = function render() {
var _this = this;
var _this$props = this.props, innerRef = _this$props.innerRef, replace = _this$props.replace, to = _this$props.to, rest = objectWithoutPropertiesLoose_1.default(_this$props, ["innerRef", "replace", "to"]);
return react_1.default.createElement(react_router_1.__RouterContext.Consumer, null, function (context) {
!context ? "production" !== "production" ? tiny_invariant_1.default(false, "You should not use <Link> outside a <Router>") : tiny_invariant_1.default(false) : void 0;
var location = typeof to === "string" ? history_1.createLocation(to, null, null, context.location) : to;
var href = location ? context.history.createHref(location) : "";
return react_1.default.createElement("a", extends_1.default({}, rest, {
onClick: function onClick(event) {
return _this.handleClick(event, context.history);
},
href: href,
ref: innerRef
}));
});
};
return Link;
}(react_1.default.Component); exports.Link = Link; function joinClassnames() {
for (var _len = arguments.length, classnames = new Array(_len), _key = 0; _key < _len; _key++) {
classnames[_key] = arguments[_key];
}
return classnames.filter(function (i) {
return i;
}).join(" ");
} function NavLink(_ref) {
var _ref$ariaCurrent = _ref["aria-current"], ariaCurrent = _ref$ariaCurrent === void 0 ? "page" : _ref$ariaCurrent, _ref$activeClassName = _ref.activeClassName, activeClassName = _ref$activeClassName === void 0 ? "active" : _ref$activeClassName, activeStyle = _ref.activeStyle, classNameProp = _ref.className, exact = _ref.exact, isActiveProp = _ref.isActive, locationProp = _ref.location, strict = _ref.strict, styleProp = _ref.style, to = _ref.to, rest = objectWithoutPropertiesLoose_1.default(_ref, ["aria-current", "activeClassName", "activeStyle", "className", "exact", "isActive", "location", "strict", "style", "to"]);
var path = typeof to === "object" ? to.pathname : to;
var escapedPath = path && path.replace(/([.+*?=^!:${}()[\]|/\\])/g, "\\$1");
return react_1.default.createElement(react_router_1.__RouterContext.Consumer, null, function (context) {
!context ? "production" !== "production" ? tiny_invariant_1.default(false, "You should not use <NavLink> outside a <Router>") : tiny_invariant_1.default(false) : void 0;
var pathToMatch = locationProp ? locationProp.pathname : context.location.pathname;
var match = escapedPath ? react_router_1.matchPath(pathToMatch, {
path: escapedPath,
exact: exact,
strict: strict
}) : null;
var isActive = !!(isActiveProp ? isActiveProp(match, context.location) : match);
var className = isActive ? joinClassnames(classNameProp, activeClassName) : classNameProp;
var style = isActive ? extends_1.default({}, styleProp, activeStyle) : styleProp;
return react_1.default.createElement(Link, extends_1.default({
"aria-current": isActive && ariaCurrent || null,
className: className,
style: style,
to: to
}, rest));
});
} exports.NavLink = NavLink;
} // @babel/runtime/helpers/esm/inheritsLoose.js $fsx.f[9] = (module, exports) => { "use strict"; Object.defineProperty(exports, "__esModule", { value: true }); function _inheritsLoose(subClass, superClass) {
subClass.prototype = Object.create(superClass.prototype); subClass.prototype.constructor = subClass; subClass.__proto__ = superClass;
} exports.default = _inheritsLoose;
} // react-router/esm/react-router.js $fsx.f[28] = (module, exports) => { "use strict"; Object.defineProperty(exports, "__esModule", { value: true }); const mini_create_react_context_1 = $fsx.r(15); const inheritsLoose_1 = $fsx.r(9); const react_1 = $fsx.r(3); const history_1 = $fsx.r(21); const tiny_invariant_1 = $fsx.r(20); const path_to_regexp_1 = $fsx.r(23); const extends_1 = $fsx.r(16); const objectWithoutPropertiesLoose_1 = $fsx.r(24); const hoist_non_react_statics_1 = $fsx.r(27); var createNamedContext = function createNamedContext(name) {
var context = mini_create_react_context_1.default(); context.displayName = name; return context;
}; var context = createNamedContext("Router"); exports.__RouterContext = context; var Router = function (_React$Component) {
inheritsLoose_1.default(Router, _React$Component);
Router.computeRootMatch = function computeRootMatch(pathname) {
return {
path: "/",
url: "/",
params: {},
isExact: pathname === "/"
};
};
function Router(props) {
var _this;
_this = _React$Component.call(this, props) || this;
_this.state = {
location: props.history.location
};
_this._isMounted = false;
_this._pendingLocation = null;
if (!props.staticContext) {
_this.unlisten = props.history.listen(function (location) {
if (_this._isMounted) {
_this.setState({
location: location
});
}
else {
_this._pendingLocation = location;
}
});
}
return _this;
}
var _proto = Router.prototype;
_proto.componentDidMount = function componentDidMount() {
this._isMounted = true;
if (this._pendingLocation) {
this.setState({
location: this._pendingLocation
});
}
};
_proto.componentWillUnmount = function componentWillUnmount() {
if (this.unlisten)
this.unlisten();
};
_proto.render = function render() {
return react_1.default.createElement(context.Provider, {
children: this.props.children || null,
value: {
history: this.props.history,
location: this.state.location,
match: Router.computeRootMatch(this.state.location.pathname),
staticContext: this.props.staticContext
}
});
};
return Router;
}(react_1.default.Component); exports.Router = Router; var MemoryRouter = function (_React$Component) {
inheritsLoose_1.default(MemoryRouter, _React$Component);
function MemoryRouter() {
var _this;
for (var _len = arguments.length, args = new Array(_len), _key = 0; _key < _len; _key++) {
args[_key] = arguments[_key];
}
_this = _React$Component.call.apply(_React$Component, [this].concat(args)) || this;
_this.history = history_1.createMemoryHistory(_this.props);
return _this;
}
var _proto = MemoryRouter.prototype;
_proto.render = function render() {
return react_1.default.createElement(Router, {
history: this.history,
children: this.props.children
});
};
return MemoryRouter;
}(react_1.default.Component); exports.MemoryRouter = MemoryRouter; var Lifecycle = function (_React$Component) {
inheritsLoose_1.default(Lifecycle, _React$Component);
function Lifecycle() {
return _React$Component.apply(this, arguments) || this;
}
var _proto = Lifecycle.prototype;
_proto.componentDidMount = function componentDidMount() {
if (this.props.onMount)
this.props.onMount.call(this, this);
};
_proto.componentDidUpdate = function componentDidUpdate(prevProps) {
if (this.props.onUpdate)
this.props.onUpdate.call(this, this, prevProps);
};
_proto.componentWillUnmount = function componentWillUnmount() {
if (this.props.onUnmount)
this.props.onUnmount.call(this, this);
};
_proto.render = function render() {
return null;
};
return Lifecycle;
}(react_1.default.Component); function Prompt(_ref) {
var message = _ref.message, _ref$when = _ref.when, when = _ref$when === void 0 ? true : _ref$when;
return react_1.default.createElement(context.Consumer, null, function (context$$1) {
!context$$1 ? "production" !== "production" ? tiny_invariant_1.default(false, "You should not use <Prompt> outside a <Router>") : tiny_invariant_1.default(false) : void 0;
if (!when || context$$1.staticContext)
return null;
var method = context$$1.history.block;
return react_1.default.createElement(Lifecycle, {
onMount: function onMount(self) {
self.release = method(message);
},
onUpdate: function onUpdate(self, prevProps) {
if (prevProps.message !== message) {
self.release();
self.release = method(message);
}
},
onUnmount: function onUnmount(self) {
self.release();
},
message: message
});
});
} exports.Prompt = Prompt; var cache = {}; var cacheLimit = 10000; var cacheCount = 0; function compilePath(path) {
if (cache[path])
return cache[path];
var generator = path_to_regexp_1.default.compile(path);
if (cacheCount < cacheLimit) {
cache[path] = generator;
cacheCount++;
}
return generator;
} function generatePath(path, params) {
if (path === void 0) {
path = "/";
}
if (params === void 0) {
params = {};
}
return path === "/" ? path : compilePath(path)(params, {
pretty: true
});
} exports.generatePath = generatePath; function Redirect(_ref) {
var computedMatch = _ref.computedMatch, to = _ref.to, _ref$push = _ref.push, push = _ref$push === void 0 ? false : _ref$push;
return react_1.default.createElement(context.Consumer, null, function (context$$1) {
!context$$1 ? "production" !== "production" ? tiny_invariant_1.default(false, "You should not use <Redirect> outside a <Router>") : tiny_invariant_1.default(false) : void 0;
var history = context$$1.history, staticContext = context$$1.staticContext;
var method = push ? history.push : history.replace;
var location = history_1.createLocation(computedMatch ? typeof to === "string" ? generatePath(to, computedMatch.params) : extends_1.default({}, to, {
pathname: generatePath(to.pathname, computedMatch.params)
}) : to);
if (staticContext) {
method(location);
return null;
}
return react_1.default.createElement(Lifecycle, {
onMount: function onMount() {
method(location);
},
onUpdate: function onUpdate(self, prevProps) {
var prevLocation = history_1.createLocation(prevProps.to);
if (!history_1.locationsAreEqual(prevLocation, extends_1.default({}, location, {
key: prevLocation.key
}))) {
method(location);
}
},
to: to
});
});
} exports.Redirect = Redirect; var cache$1 = {}; var cacheLimit$1 = 10000; var cacheCount$1 = 0; function compilePath$1(path, options) {
var cacheKey = "" + options.end + options.strict + options.sensitive;
var pathCache = cache$1[cacheKey] || (cache$1[cacheKey] = {});
if (pathCache[path])
return pathCache[path];
var keys = [];
var regexp = path_to_regexp_1.default(path, keys, options);
var result = {
regexp: regexp,
keys: keys
};
if (cacheCount$1 < cacheLimit$1) {
pathCache[path] = result;
cacheCount$1++;
}
return result;
} function matchPath(pathname, options) {
if (options === void 0) {
options = {};
}
if (typeof options === "string")
options = {
path: options
};
var _options = options, path = _options.path, _options$exact = _options.exact, exact = _options$exact === void 0 ? false : _options$exact, _options$strict = _options.strict, strict = _options$strict === void 0 ? false : _options$strict, _options$sensitive = _options.sensitive, sensitive = _options$sensitive === void 0 ? false : _options$sensitive;
var paths = [].concat(path);
return paths.reduce(function (matched, path) {
if (!path)
return null;
if (matched)
return matched;
var _compilePath = compilePath$1(path, {
end: exact,
strict: strict,
sensitive: sensitive
}), regexp = _compilePath.regexp, keys = _compilePath.keys;
var match = regexp.exec(pathname);
if (!match)
return null;
var url = match[0], values = match.slice(1);
var isExact = pathname === url;
if (exact && !isExact)
return null;
return {
path: path,
url: path === "/" && url === "" ? "/" : url,
isExact: isExact,
params: keys.reduce(function (memo, key, index) {
memo[key.name] = values[index];
return memo;
}, {})
};
}, null);
} exports.matchPath = matchPath; function isEmptyChildren(children) {
return react_1.default.Children.count(children) === 0;
} var Route = function (_React$Component) {
inheritsLoose_1.default(Route, _React$Component);
function Route() {
return _React$Component.apply(this, arguments) || this;
}
var _proto = Route.prototype;
_proto.render = function render() {
var _this = this;
return react_1.default.createElement(context.Consumer, null, function (context$$1) {
!context$$1 ? "production" !== "production" ? tiny_invariant_1.default(false, "You should not use <Route> outside a <Router>") : tiny_invariant_1.default(false) : void 0;
var location = _this.props.location || context$$1.location;
var match = _this.props.computedMatch ? _this.props.computedMatch
: _this.props.path ? matchPath(location.pathname, _this.props) : context$$1.match;
var props = extends_1.default({}, context$$1, {
location: location,
match: match
});
var _this$props = _this.props, children = _this$props.children, component = _this$props.component, render = _this$props.render;
if (Array.isArray(children) && children.length === 0) {
children = null;
}
if (typeof children === "function") {
children = children(props);
if (children === undefined) {
children = null;
}
}
return react_1.default.createElement(context.Provider, {
value: props
}, children && !isEmptyChildren(children) ? children : props.match ? component ? react_1.default.createElement(component, props) : render ? render(props) : null : null);
});
};
return Route;
}(react_1.default.Component); exports.Route = Route; function addLeadingSlash(path) {
return path.charAt(0) === "/" ? path : "/" + path;
} function addBasename(basename, location) {
if (!basename)
return location;
return extends_1.default({}, location, {
pathname: addLeadingSlash(basename) + location.pathname
});
} function stripBasename(basename, location) {
if (!basename)
return location;
var base = addLeadingSlash(basename);
if (location.pathname.indexOf(base) !== 0)
return location;
return extends_1.default({}, location, {
pathname: location.pathname.substr(base.length)
});
} function createURL(location) {
return typeof location === "string" ? location : history_1.createPath(location);
} function staticHandler(methodName) {
return function () {
"production" !== "production" ? tiny_invariant_1.default(false, "You cannot %s with <StaticRouter>", methodName) : tiny_invariant_1.default(false);
};
} function noop() { } var StaticRouter = function (_React$Component) {
inheritsLoose_1.default(StaticRouter, _React$Component);
function StaticRouter() {
var _this;
for (var _len = arguments.length, args = new Array(_len), _key = 0; _key < _len; _key++) {
args[_key] = arguments[_key];
}
_this = _React$Component.call.apply(_React$Component, [this].concat(args)) || this;
_this.handlePush = function (location) {
return _this.navigateTo(location, "PUSH");
};
_this.handleReplace = function (location) {
return _this.navigateTo(location, "REPLACE");
};
_this.handleListen = function () {
return noop;
};
_this.handleBlock = function () {
return noop;
};
return _this;
}
var _proto = StaticRouter.prototype;
_proto.navigateTo = function navigateTo(location, action) {
var _this$props = this.props, _this$props$basename = _this$props.basename, basename = _this$props$basename === void 0 ? "" : _this$props$basename, _this$props$context = _this$props.context, context = _this$props$context === void 0 ? {} : _this$props$context;
context.action = action;
context.location = addBasename(basename, history_1.createLocation(location));
context.url = createURL(context.location);
};
_proto.render = function render() {
var _this$props2 = this.props, _this$props2$basename = _this$props2.basename, basename = _this$props2$basename === void 0 ? "" : _this$props2$basename, _this$props2$context = _this$props2.context, context = _this$props2$context === void 0 ? {} : _this$props2$context, _this$props2$location = _this$props2.location, location = _this$props2$location === void 0 ? "/" : _this$props2$location, rest = objectWithoutPropertiesLoose_1.default(_this$props2, ["basename", "context", "location"]);
var history = {
createHref: function createHref(path) {
return addLeadingSlash(basename + createURL(path));
},
action: "POP",
location: stripBasename(basename, history_1.createLocation(location)),
push: this.handlePush,
replace: this.handleReplace,
go: staticHandler("go"),
goBack: staticHandler("goBack"),
goForward: staticHandler("goForward"),
listen: this.handleListen,
block: this.handleBlock
};
return react_1.default.createElement(Router, extends_1.default({}, rest, {
history: history,
staticContext: context
}));
};
return StaticRouter;
}(react_1.default.Component); exports.StaticRouter = StaticRouter; var Switch = function (_React$Component) {
inheritsLoose_1.default(Switch, _React$Component);
function Switch() {
return _React$Component.apply(this, arguments) || this;
}
var _proto = Switch.prototype;
_proto.render = function render() {
var _this = this;
return react_1.default.createElement(context.Consumer, null, function (context$$1) {
!context$$1 ? "production" !== "production" ? tiny_invariant_1.default(false, "You should not use <Switch> outside a <Router>") : tiny_invariant_1.default(false) : void 0;
var location = _this.props.location || context$$1.location;
var element, match;
react_1.default.Children.forEach(_this.props.children, function (child) {
if (match == null && react_1.default.isValidElement(child)) {
element = child;
var path = child.props.path || child.props.from;
match = path ? matchPath(location.pathname, extends_1.default({}, child.props, {
path: path
})) : context$$1.match;
}
});
return match ? react_1.default.cloneElement(element, {
location: location,
computedMatch: match
}) : null;
});
};
return Switch;
}(react_1.default.Component); exports.Switch = Switch; function withRouter(Component) {
var displayName = "withRouter(" + (Component.displayName || Component.name) + ")";
var C = function C(props) {
var wrappedComponentRef = props.wrappedComponentRef, remainingProps = objectWithoutPropertiesLoose_1.default(props, ["wrappedComponentRef"]);
return react_1.default.createElement(context.Consumer, null, function (context$$1) {
!context$$1 ? "production" !== "production" ? tiny_invariant_1.default(false, "You should not use <" + displayName + " /> outside a <Router>") : tiny_invariant_1.default(false) : void 0;
return react_1.default.createElement(Component, extends_1.default({}, remainingProps, context$$1, {
ref: wrappedComponentRef
}));
});
};
C.displayName = displayName;
C.WrappedComponent = Component;
return hoist_non_react_statics_1.default(C, Component);
} exports.withRouter = withRouter;
} // mini-create-react-context/dist/esm/index.js $fsx.f[15] = (module, exports) => { "use strict"; Object.defineProperty(exports, "__esModule", { value: true }); const react_1 = $fsx.r(3); const inheritsLoose_1 = $fsx.r(10); const prop_types_1 = $fsx.r(13); const gud_1 = $fsx.r(14); var MAX_SIGNED_31_BIT_INT = 1073741823; function objectIs(x, y) {
if (x === y) {
return x !== 0 || 1 / x === 1 / y;
}
else {
return x !== x && y !== y;
}
} function createEventEmitter(value) {
var handlers = [];
return {
on: function on(handler) {
handlers.push(handler);
},
off: function off(handler) {
handlers = handlers.filter(function (h) {
return h !== handler;
});
},
get: function get() {
return value;
},
set: function set(newValue, changedBits) {
value = newValue;
handlers.forEach(function (handler) {
return handler(value, changedBits);
});
}
};
} function onlyChild(children) {
return Array.isArray(children) ? children[0] : children;
} function createReactContext(defaultValue, calculateChangedBits) {
var _Provider$childContex, _Consumer$contextType;
var contextProp = '__create-react-context-' + gud_1.default() + '__';
var Provider = function (_Component) {
inheritsLoose_1.default(Provider, _Component);
function Provider() {
var _this;
_this = _Component.apply(this, arguments) || this;
_this.emitter = createEventEmitter(_this.props.value);
return _this;
}
var _proto = Provider.prototype;
_proto.getChildContext = function getChildContext() {
var _ref;
return _ref = {}, _ref[contextProp] = this.emitter, _ref;
};
_proto.componentWillReceiveProps = function componentWillReceiveProps(nextProps) {
if (this.props.value !== nextProps.value) {
var oldValue = this.props.value;
var newValue = nextProps.value;
var changedBits;
if (objectIs(oldValue, newValue)) {
changedBits = 0;
}
else {
changedBits = typeof calculateChangedBits === 'function' ? calculateChangedBits(oldValue, newValue) : MAX_SIGNED_31_BIT_INT;
changedBits |= 0;
if (changedBits !== 0) {
this.emitter.set(nextProps.value, changedBits);
}
}
}
};
_proto.render = function render() {
return this.props.children;
};
return Provider;
}(react_1.Component);
Provider.childContextTypes = (_Provider$childContex = {}, _Provider$childContex[contextProp] = prop_types_1.default.object.isRequired, _Provider$childContex);
var Consumer = function (_Component2) {
inheritsLoose_1.default(Consumer, _Component2);
function Consumer() {
var _this2;
_this2 = _Component2.apply(this, arguments) || this;
_this2.state = {
value: _this2.getValue()
};
_this2.onUpdate = function (newValue, changedBits) {
var observedBits = _this2.observedBits | 0;
if ((observedBits & changedBits) !== 0) {
_this2.setState({
value: _this2.getValue()
});
}
};
return _this2;
}
var _proto2 = Consumer.prototype;
_proto2.componentWillReceiveProps = function componentWillReceiveProps(nextProps) {
var observedBits = nextProps.observedBits;
this.observedBits = observedBits === undefined || observedBits === null ? MAX_SIGNED_31_BIT_INT : observedBits;
};
_proto2.componentDidMount = function componentDidMount() {
if (this.context[contextProp]) {
this.context[contextProp].on(this.onUpdate);
}
var observedBits = this.props.observedBits;
this.observedBits = observedBits === undefined || observedBits === null ? MAX_SIGNED_31_BIT_INT : observedBits;
};
_proto2.componentWillUnmount = function componentWillUnmount() {
if (this.context[contextProp]) {
this.context[contextProp].off(this.onUpdate);
}
};
_proto2.getValue = function getValue() {
if (this.context[contextProp]) {
return this.context[contextProp].get();
}
else {
return defaultValue;
}
};
_proto2.render = function render() {
return onlyChild(this.props.children)(this.state.value);
};
return Consumer;
}(react_1.Component);
Consumer.contextTypes = (_Consumer$contextType = {}, _Consumer$contextType[contextProp] = prop_types_1.default.object, _Consumer$contextType);
return {
Provider: Provider,
Consumer: Consumer
};
} var index = react_1.default.createContext || createReactContext; exports.default = index;
} // @babel/runtime/helpers/inheritsLoose.js $fsx.f[10] = (module, exports) => { function _inheritsLoose(subClass, superClass) {
subClass.prototype = Object.create(superClass.prototype); subClass.prototype.constructor = subClass; subClass.__proto__ = superClass;
} module.exports = _inheritsLoose;
} // prop-types/index.js $fsx.f[13] = (module, exports) => { module.exports = $fsx.r(12)();
} // prop-types/factoryWithThrowingShims.js $fsx.f[12] = (module, exports) => { 'use strict'; var ReactPropTypesSecret = $fsx.r(11); function emptyFunction() { } function emptyFunctionWithReset() { } emptyFunctionWithReset.resetWarningCache = emptyFunction; module.exports = function () {
function shim(props, propName, componentName, location, propFullName, secret) {
if (secret === ReactPropTypesSecret) {
return;
}
var err = new Error('Calling PropTypes validators directly is not supported by the `prop-types` package. ' +
'Use PropTypes.checkPropTypes() to call them. ' +
'Read more at http://fb.me/use-check-prop-types');
err.name = 'Invariant Violation';
throw err;
}
;
shim.isRequired = shim;
function getShim() {
return shim;
}
;
var ReactPropTypes = {
array: shim,
bool: shim,
func: shim,
number: shim,
object: shim,
string: shim,
symbol: shim,
any: shim,
arrayOf: getShim,
element: shim,
elementType: shim,
instanceOf: getShim,
node: shim,
objectOf: getShim,
oneOf: getShim,
oneOfType: getShim,
shape: getShim,
exact: getShim,
checkPropTypes: emptyFunctionWithReset,
resetWarningCache: emptyFunction
};
ReactPropTypes.PropTypes = ReactPropTypes;
return ReactPropTypes;
};
} // prop-types/lib/ReactPropTypesSecret.js $fsx.f[11] = (module, exports) => { 'use strict'; var ReactPropTypesSecret = 'SECRET_DO_NOT_PASS_THIS_OR_YOU_WILL_BE_FIRED'; module.exports = ReactPropTypesSecret;
} // gud/index.js $fsx.f[14] = (module, exports) => { 'use strict'; var key = '__global_unique_id__'; module.exports = function () {
return global[key] = (global[key] || 0) + 1;
};
} // history/esm/history.js $fsx.f[21] = (module, exports) => { "use strict"; Object.defineProperty(exports, "__esModule", { value: true }); const extends_1 = $fsx.r(16); const resolve_pathname_1 = $fsx.r(17); const value_equal_1 = $fsx.r(18); const tiny_warning_1 = $fsx.r(19); const tiny_invariant_1 = $fsx.r(20); function addLeadingSlash(path) {
return path.charAt(0) === '/' ? path : '/' + path;
} function stripLeadingSlash(path) {
return path.charAt(0) === '/' ? path.substr(1) : path;
} function hasBasename(path, prefix) {
return new RegExp('^' + prefix + '(\\/|\\?|#|$)', 'i').test(path);
} function stripBasename(path, prefix) {
return hasBasename(path, prefix) ? path.substr(prefix.length) : path;
} function stripTrailingSlash(path) {
return path.charAt(path.length - 1) === '/' ? path.slice(0, -1) : path;
} function parsePath(path) {
var pathname = path || '/';
var search = ;
var hash = ;
var hashIndex = pathname.indexOf('#');
if (hashIndex !== -1) {
hash = pathname.substr(hashIndex);
pathname = pathname.substr(0, hashIndex);
}
var searchIndex = pathname.indexOf('?');
if (searchIndex !== -1) {
search = pathname.substr(searchIndex);
pathname = pathname.substr(0, searchIndex);
}
return {
pathname: pathname,
search: search === '?' ? : search,
hash: hash === '#' ? : hash
};
} exports.parsePath = parsePath; function createPath(location) {
var pathname = location.pathname, search = location.search, hash = location.hash;
var path = pathname || '/';
if (search && search !== '?')
path += search.charAt(0) === '?' ? search : "?" + search;
if (hash && hash !== '#')
path += hash.charAt(0) === '#' ? hash : "#" + hash;
return path;
} exports.createPath = createPath; function createLocation(path, state, key, currentLocation) {
var location;
if (typeof path === 'string') {
location = parsePath(path);
location.state = state;
}
else {
location = extends_1.default({}, path);
if (location.pathname === undefined)
location.pathname = ;
if (location.search) {
if (location.search.charAt(0) !== '?')
location.search = '?' + location.search;
}
else {
location.search = ;
}
if (location.hash) {
if (location.hash.charAt(0) !== '#')
location.hash = '#' + location.hash;
}
else {
location.hash = ;
}
if (state !== undefined && location.state === undefined)
location.state = state;
}
try {
location.pathname = decodeURI(location.pathname);
}
catch (e) {
if (e instanceof URIError) {
throw new URIError('Pathname "' + location.pathname + '" could not be decoded. ' + 'This is likely caused by an invalid percent-encoding.');
}
else {
throw e;
}
}
if (key)
location.key = key;
if (currentLocation) {
if (!location.pathname) {
location.pathname = currentLocation.pathname;
}
else if (location.pathname.charAt(0) !== '/') {
location.pathname = resolve_pathname_1.default(location.pathname, currentLocation.pathname);
}
}
else {
if (!location.pathname) {
location.pathname = '/';
}
}
return location;
} exports.createLocation = createLocation; function locationsAreEqual(a, b) {
return a.pathname === b.pathname && a.search === b.search && a.hash === b.hash && a.key === b.key && value_equal_1.default(a.state, b.state);
} exports.locationsAreEqual = locationsAreEqual; function createTransitionManager() {
var prompt = null;
function setPrompt(nextPrompt) {
"production" !== "production" ? tiny_warning_1.default(prompt == null, 'A history supports only one prompt at a time') : void 0;
prompt = nextPrompt;
return function () {
if (prompt === nextPrompt)
prompt = null;
};
}
function confirmTransitionTo(location, action, getUserConfirmation, callback) {
if (prompt != null) {
var result = typeof prompt === 'function' ? prompt(location, action) : prompt;
if (typeof result === 'string') {
if (typeof getUserConfirmation === 'function') {
getUserConfirmation(result, callback);
}
else {
"production" !== "production" ? tiny_warning_1.default(false, 'A history needs a getUserConfirmation function in order to use a prompt message') : void 0;
callback(true);
}
}
else {
callback(result !== false);
}
}
else {
callback(true);
}
}
var listeners = [];
function appendListener(fn) {
var isActive = true;
function listener() {
if (isActive)
fn.apply(void 0, arguments);
}
listeners.push(listener);
return function () {
isActive = false;
listeners = listeners.filter(function (item) {
return item !== listener;
});
};
}
function notifyListeners() {
for (var _len = arguments.length, args = new Array(_len), _key = 0; _key < _len; _key++) {
args[_key] = arguments[_key];
}
listeners.forEach(function (listener) {
return listener.apply(void 0, args);
});
}
return {
setPrompt: setPrompt,
confirmTransitionTo: confirmTransitionTo,
appendListener: appendListener,
notifyListeners: notifyListeners
};
} var canUseDOM = !!(typeof window !== 'undefined' && window.document && window.document.createElement); function getConfirmation(message, callback) {
callback(window.confirm(message));
} function supportsHistory() {
var ua = window.navigator.userAgent;
if ((ua.indexOf('Android 2.') !== -1 || ua.indexOf('Android 4.0') !== -1) && ua.indexOf('Mobile Safari') !== -1 && ua.indexOf('Chrome') === -1 && ua.indexOf('Windows Phone') === -1)
return false;
return window.history && 'pushState' in window.history;
} function supportsPopStateOnHashChange() {
return window.navigator.userAgent.indexOf('Trident') === -1;
} function supportsGoWithoutReloadUsingHash() {
return window.navigator.userAgent.indexOf('Firefox') === -1;
} function isExtraneousPopstateEvent(event) {
event.state === undefined && navigator.userAgent.indexOf('CriOS') === -1;
} var PopStateEvent = 'popstate'; var HashChangeEvent = 'hashchange'; function getHistoryState() {
try {
return window.history.state || {};
}
catch (e) {
return {};
}
} function createBrowserHistory(props) {
if (props === void 0) {
props = {};
}
!canUseDOM ? "production" !== "production" ? tiny_invariant_1.default(false, 'Browser history needs a DOM') : tiny_invariant_1.default(false) : void 0;
var globalHistory = window.history;
var canUseHistory = supportsHistory();
var needsHashChangeListener = !supportsPopStateOnHashChange();
var _props = props, _props$forceRefresh = _props.forceRefresh, forceRefresh = _props$forceRefresh === void 0 ? false : _props$forceRefresh, _props$getUserConfirm = _props.getUserConfirmation, getUserConfirmation = _props$getUserConfirm === void 0 ? getConfirmation : _props$getUserConfirm, _props$keyLength = _props.keyLength, keyLength = _props$keyLength === void 0 ? 6 : _props$keyLength;
var basename = props.basename ? stripTrailingSlash(addLeadingSlash(props.basename)) : ;
function getDOMLocation(historyState) {
var _ref = historyState || {}, key = _ref.key, state = _ref.state;
var _window$location = window.location, pathname = _window$location.pathname, search = _window$location.search, hash = _window$location.hash;
var path = pathname + search + hash;
"production" !== "production" ? tiny_warning_1.default(!basename || hasBasename(path, basename), 'You are attempting to use a basename on a page whose URL path does not begin ' + 'with the basename. Expected path "' + path + '" to begin with "' + basename + '".') : void 0;
if (basename)
path = stripBasename(path, basename);
return createLocation(path, state, key);
}
function createKey() {
return Math.random().toString(36).substr(2, keyLength);
}
var transitionManager = createTransitionManager();
function setState(nextState) {
extends_1.default(history, nextState);
history.length = globalHistory.length;
transitionManager.notifyListeners(history.location, history.action);
}
function handlePopState(event) {
if (isExtraneousPopstateEvent(event))
return;
handlePop(getDOMLocation(event.state));
}
function handleHashChange() {
handlePop(getDOMLocation(getHistoryState()));
}
var forceNextPop = false;
function handlePop(location) {
if (forceNextPop) {
forceNextPop = false;
setState();
}
else {
var action = 'POP';
transitionManager.confirmTransitionTo(location, action, getUserConfirmation, function (ok) {
if (ok) {
setState({
action: action,
location: location
});
}
else {
revertPop(location);
}
});
}
}
function revertPop(fromLocation) {
var toLocation = history.location;
var toIndex = allKeys.indexOf(toLocation.key);
if (toIndex === -1)
toIndex = 0;
var fromIndex = allKeys.indexOf(fromLocation.key);
if (fromIndex === -1)
fromIndex = 0;
var delta = toIndex - fromIndex;
if (delta) {
forceNextPop = true;
go(delta);
}
}
var initialLocation = getDOMLocation(getHistoryState());
var allKeys = [initialLocation.key];
function createHref(location) {
return basename + createPath(location);
}
function push(path, state) {
"production" !== "production" ? tiny_warning_1.default(!(typeof path === 'object' && path.state !== undefined && state !== undefined), 'You should avoid providing a 2nd state argument to push when the 1st ' + 'argument is a location-like object that already has state; it is ignored') : void 0;
var action = 'PUSH';
var location = createLocation(path, state, createKey(), history.location);
transitionManager.confirmTransitionTo(location, action, getUserConfirmation, function (ok) {
if (!ok)
return;
var href = createHref(location);
var key = location.key, state = location.state;
if (canUseHistory) {
globalHistory.pushState({
key: key,
state: state
}, null, href);
if (forceRefresh) {
window.location.href = href;
}
else {
var prevIndex = allKeys.indexOf(history.location.key);
var nextKeys = allKeys.slice(0, prevIndex === -1 ? 0 : prevIndex + 1);
nextKeys.push(location.key);
allKeys = nextKeys;
setState({
action: action,
location: location
});
}
}
else {
"production" !== "production" ? tiny_warning_1.default(state === undefined, 'Browser history cannot push state in browsers that do not support HTML5 history') : void 0;
window.location.href = href;
}
});
}
function replace(path, state) {
"production" !== "production" ? tiny_warning_1.default(!(typeof path === 'object' && path.state !== undefined && state !== undefined), 'You should avoid providing a 2nd state argument to replace when the 1st ' + 'argument is a location-like object that already has state; it is ignored') : void 0;
var action = 'REPLACE';
var location = createLocation(path, state, createKey(), history.location);
transitionManager.confirmTransitionTo(location, action, getUserConfirmation, function (ok) {
if (!ok)
return;
var href = createHref(location);
var key = location.key, state = location.state;
if (canUseHistory) {
globalHistory.replaceState({
key: key,
state: state
}, null, href);
if (forceRefresh) {
window.location.replace(href);
}
else {
var prevIndex = allKeys.indexOf(history.location.key);
if (prevIndex !== -1)
allKeys[prevIndex] = location.key;
setState({
action: action,
location: location
});
}
}
else {
"production" !== "production" ? tiny_warning_1.default(state === undefined, 'Browser history cannot replace state in browsers that do not support HTML5 history') : void 0;
window.location.replace(href);
}
});
}
function go(n) {
globalHistory.go(n);
}
function goBack() {
go(-1);
}
function goForward() {
go(1);
}
var listenerCount = 0;
function checkDOMListeners(delta) {
listenerCount += delta;
if (listenerCount === 1 && delta === 1) {
window.addEventListener(PopStateEvent, handlePopState);
if (needsHashChangeListener)
window.addEventListener(HashChangeEvent, handleHashChange);
}
else if (listenerCount === 0) {
window.removeEventListener(PopStateEvent, handlePopState);
if (needsHashChangeListener)
window.removeEventListener(HashChangeEvent, handleHashChange);
}
}
var isBlocked = false;
function block(prompt) {
if (prompt === void 0) {
prompt = false;
}
var unblock = transitionManager.setPrompt(prompt);
if (!isBlocked) {
checkDOMListeners(1);
isBlocked = true;
}
return function () {
if (isBlocked) {
isBlocked = false;
checkDOMListeners(-1);
}
return unblock();
};
}
function listen(listener) {
var unlisten = transitionManager.appendListener(listener);
checkDOMListeners(1);
return function () {
checkDOMListeners(-1);
unlisten();
};
}
var history = {
length: globalHistory.length,
action: 'POP',
location: initialLocation,
createHref: createHref,
push: push,
replace: replace,
go: go,
goBack: goBack,
goForward: goForward,
block: block,
listen: listen
};
return history;
} exports.createBrowserHistory = createBrowserHistory; var HashChangeEvent$1 = 'hashchange'; var HashPathCoders = {
hashbang: {
encodePath: function encodePath(path) {
return path.charAt(0) === '!' ? path : '!/' + stripLeadingSlash(path);
},
decodePath: function decodePath(path) {
return path.charAt(0) === '!' ? path.substr(1) : path;
}
},
noslash: {
encodePath: stripLeadingSlash,
decodePath: addLeadingSlash
},
slash: {
encodePath: addLeadingSlash,
decodePath: addLeadingSlash
}
}; function getHashPath() {
var href = window.location.href;
var hashIndex = href.indexOf('#');
return hashIndex === -1 ? : href.substring(hashIndex + 1);
} function pushHashPath(path) {
window.location.hash = path;
} function replaceHashPath(path) {
var hashIndex = window.location.href.indexOf('#');
window.location.replace(window.location.href.slice(0, hashIndex >= 0 ? hashIndex : 0) + '#' + path);
} function createHashHistory(props) {
if (props === void 0) {
props = {};
}
!canUseDOM ? "production" !== "production" ? tiny_invariant_1.default(false, 'Hash history needs a DOM') : tiny_invariant_1.default(false) : void 0;
var globalHistory = window.history;
var canGoWithoutReload = supportsGoWithoutReloadUsingHash();
var _props = props, _props$getUserConfirm = _props.getUserConfirmation, getUserConfirmation = _props$getUserConfirm === void 0 ? getConfirmation : _props$getUserConfirm, _props$hashType = _props.hashType, hashType = _props$hashType === void 0 ? 'slash' : _props$hashType;
var basename = props.basename ? stripTrailingSlash(addLeadingSlash(props.basename)) : ;
var _HashPathCoders$hashT = HashPathCoders[hashType], encodePath = _HashPathCoders$hashT.encodePath, decodePath = _HashPathCoders$hashT.decodePath;
function getDOMLocation() {
var path = decodePath(getHashPath());
"production" !== "production" ? tiny_warning_1.default(!basename || hasBasename(path, basename), 'You are attempting to use a basename on a page whose URL path does not begin ' + 'with the basename. Expected path "' + path + '" to begin with "' + basename + '".') : void 0;
if (basename)
path = stripBasename(path, basename);
return createLocation(path);
}
var transitionManager = createTransitionManager();
function setState(nextState) {
extends_1.default(history, nextState);
history.length = globalHistory.length;
transitionManager.notifyListeners(history.location, history.action);
}
var forceNextPop = false;
var ignorePath = null;
function handleHashChange() {
var path = getHashPath();
var encodedPath = encodePath(path);
if (path !== encodedPath) {
replaceHashPath(encodedPath);
}
else {
var location = getDOMLocation();
var prevLocation = history.location;
if (!forceNextPop && locationsAreEqual(prevLocation, location))
return;
if (ignorePath === createPath(location))
return;
ignorePath = null;
handlePop(location);
}
}
function handlePop(location) {
if (forceNextPop) {
forceNextPop = false;
setState();
}
else {
var action = 'POP';
transitionManager.confirmTransitionTo(location, action, getUserConfirmation, function (ok) {
if (ok) {
setState({
action: action,
location: location
});
}
else {
revertPop(location);
}
});
}
}
function revertPop(fromLocation) {
var toLocation = history.location;
var toIndex = allPaths.lastIndexOf(createPath(toLocation));
if (toIndex === -1)
toIndex = 0;
var fromIndex = allPaths.lastIndexOf(createPath(fromLocation));
if (fromIndex === -1)
fromIndex = 0;
var delta = toIndex - fromIndex;
if (delta) {
forceNextPop = true;
go(delta);
}
}
var path = getHashPath();
var encodedPath = encodePath(path);
if (path !== encodedPath)
replaceHashPath(encodedPath);
var initialLocation = getDOMLocation();
var allPaths = [createPath(initialLocation)];
function createHref(location) {
return '#' + encodePath(basename + createPath(location));
}
function push(path, state) {
"production" !== "production" ? tiny_warning_1.default(state === undefined, 'Hash history cannot push state; it is ignored') : void 0;
var action = 'PUSH';
var location = createLocation(path, undefined, undefined, history.location);
transitionManager.confirmTransitionTo(location, action, getUserConfirmation, function (ok) {
if (!ok)
return;
var path = createPath(location);
var encodedPath = encodePath(basename + path);
var hashChanged = getHashPath() !== encodedPath;
if (hashChanged) {
ignorePath = path;
pushHashPath(encodedPath);
var prevIndex = allPaths.lastIndexOf(createPath(history.location));
var nextPaths = allPaths.slice(0, prevIndex === -1 ? 0 : prevIndex + 1);
nextPaths.push(path);
allPaths = nextPaths;
setState({
action: action,
location: location
});
}
else {
"production" !== "production" ? tiny_warning_1.default(false, 'Hash history cannot PUSH the same path; a new entry will not be added to the history stack') : void 0;
setState();
}
});
}
function replace(path, state) {
"production" !== "production" ? tiny_warning_1.default(state === undefined, 'Hash history cannot replace state; it is ignored') : void 0;
var action = 'REPLACE';
var location = createLocation(path, undefined, undefined, history.location);
transitionManager.confirmTransitionTo(location, action, getUserConfirmation, function (ok) {
if (!ok)
return;
var path = createPath(location);
var encodedPath = encodePath(basename + path);
var hashChanged = getHashPath() !== encodedPath;
if (hashChanged) {
ignorePath = path;
replaceHashPath(encodedPath);
}
var prevIndex = allPaths.indexOf(createPath(history.location));
if (prevIndex !== -1)
allPaths[prevIndex] = path;
setState({
action: action,
location: location
});
});
}
function go(n) {
"production" !== "production" ? tiny_warning_1.default(canGoWithoutReload, 'Hash history go(n) causes a full page reload in this browser') : void 0;
globalHistory.go(n);
}
function goBack() {
go(-1);
}
function goForward() {
go(1);
}
var listenerCount = 0;
function checkDOMListeners(delta) {
listenerCount += delta;
if (listenerCount === 1 && delta === 1) {
window.addEventListener(HashChangeEvent$1, handleHashChange);
}
else if (listenerCount === 0) {
window.removeEventListener(HashChangeEvent$1, handleHashChange);
}
}
var isBlocked = false;
function block(prompt) {
if (prompt === void 0) {
prompt = false;
}
var unblock = transitionManager.setPrompt(prompt);
if (!isBlocked) {
checkDOMListeners(1);
isBlocked = true;
}
return function () {
if (isBlocked) {
isBlocked = false;
checkDOMListeners(-1);
}
return unblock();
};
}
function listen(listener) {
var unlisten = transitionManager.appendListener(listener);
checkDOMListeners(1);
return function () {
checkDOMListeners(-1);
unlisten();
};
}
var history = {
length: globalHistory.length,
action: 'POP',
location: initialLocation,
createHref: createHref,
push: push,
replace: replace,
go: go,
goBack: goBack,
goForward: goForward,
block: block,
listen: listen
};
return history;
} exports.createHashHistory = createHashHistory; function clamp(n, lowerBound, upperBound) {
return Math.min(Math.max(n, lowerBound), upperBound);
} function createMemoryHistory(props) {
if (props === void 0) {
props = {};
}
var _props = props, getUserConfirmation = _props.getUserConfirmation, _props$initialEntries = _props.initialEntries, initialEntries = _props$initialEntries === void 0 ? ['/'] : _props$initialEntries, _props$initialIndex = _props.initialIndex, initialIndex = _props$initialIndex === void 0 ? 0 : _props$initialIndex, _props$keyLength = _props.keyLength, keyLength = _props$keyLength === void 0 ? 6 : _props$keyLength;
var transitionManager = createTransitionManager();
function setState(nextState) {
extends_1.default(history, nextState);
history.length = history.entries.length;
transitionManager.notifyListeners(history.location, history.action);
}
function createKey() {
return Math.random().toString(36).substr(2, keyLength);
}
var index = clamp(initialIndex, 0, initialEntries.length - 1);
var entries = initialEntries.map(function (entry) {
return typeof entry === 'string' ? createLocation(entry, undefined, createKey()) : createLocation(entry, undefined, entry.key || createKey());
});
var createHref = createPath;
function push(path, state) {
"production" !== "production" ? tiny_warning_1.default(!(typeof path === 'object' && path.state !== undefined && state !== undefined), 'You should avoid providing a 2nd state argument to push when the 1st ' + 'argument is a location-like object that already has state; it is ignored') : void 0;
var action = 'PUSH';
var location = createLocation(path, state, createKey(), history.location);
transitionManager.confirmTransitionTo(location, action, getUserConfirmation, function (ok) {
if (!ok)
return;
var prevIndex = history.index;
var nextIndex = prevIndex + 1;
var nextEntries = history.entries.slice(0);
if (nextEntries.length > nextIndex) {
nextEntries.splice(nextIndex, nextEntries.length - nextIndex, location);
}
else {
nextEntries.push(location);
}
setState({
action: action,
location: location,
index: nextIndex,
entries: nextEntries
});
});
}
function replace(path, state) {
"production" !== "production" ? tiny_warning_1.default(!(typeof path === 'object' && path.state !== undefined && state !== undefined), 'You should avoid providing a 2nd state argument to replace when the 1st ' + 'argument is a location-like object that already has state; it is ignored') : void 0;
var action = 'REPLACE';
var location = createLocation(path, state, createKey(), history.location);
transitionManager.confirmTransitionTo(location, action, getUserConfirmation, function (ok) {
if (!ok)
return;
history.entries[history.index] = location;
setState({
action: action,
location: location
});
});
}
function go(n) {
var nextIndex = clamp(history.index + n, 0, history.entries.length - 1);
var action = 'POP';
var location = history.entries[nextIndex];
transitionManager.confirmTransitionTo(location, action, getUserConfirmation, function (ok) {
if (ok) {
setState({
action: action,
location: location,
index: nextIndex
});
}
else {
setState();
}
});
}
function goBack() {
go(-1);
}
function goForward() {
go(1);
}
function canGo(n) {
var nextIndex = history.index + n;
return nextIndex >= 0 && nextIndex < history.entries.length;
}
function block(prompt) {
if (prompt === void 0) {
prompt = false;
}
return transitionManager.setPrompt(prompt);
}
function listen(listener) {
return transitionManager.appendListener(listener);
}
var history = {
length: entries.length,
action: 'POP',
location: entries[index],
index: index,
entries: entries,
createHref: createHref,
push: push,
replace: replace,
go: go,
goBack: goBack,
goForward: goForward,
canGo: canGo,
block: block,
listen: listen
};
return history;
} exports.createMemoryHistory = createMemoryHistory;
} // @babel/runtime/helpers/esm/extends.js $fsx.f[16] = (module, exports) => { "use strict"; Object.defineProperty(exports, "__esModule", { value: true }); function _extends() {
exports._extends = _extends = Object.assign || function (target) {
for (var i = 1; i < arguments.length; i++) {
var source = arguments[i];
for (var key in source) {
if (Object.prototype.hasOwnProperty.call(source, key)) {
target[key] = source[key];
}
}
}
return target;
};
return _extends.apply(this, arguments);
} exports.default = _extends;
} // resolve-pathname/index.js $fsx.f[17] = (module, exports) => { "use strict"; Object.defineProperty(exports, "__esModule", { value: true }); function isAbsolute(pathname) {
return pathname.charAt(0) === '/';
} function spliceOne(list, index) {
for (var i = index, k = i + 1, n = list.length; k < n; i += 1, k += 1) {
list[i] = list[k];
}
list.pop();
} function resolvePathname(to) {
var from = arguments.length > 1 && arguments[1] !== undefined ? arguments[1] : ;
var toParts = to && to.split('/') || [];
var fromParts = from && from.split('/') || [];
var isToAbs = to && isAbsolute(to);
var isFromAbs = from && isAbsolute(from);
var mustEndAbs = isToAbs || isFromAbs;
if (to && isAbsolute(to)) {
fromParts = toParts;
}
else if (toParts.length) {
fromParts.pop();
fromParts = fromParts.concat(toParts);
}
if (!fromParts.length)
return '/';
var hasTrailingSlash = void 0;
if (fromParts.length) {
var last = fromParts[fromParts.length - 1];
hasTrailingSlash = last === '.' || last === '..' || last === ;
}
else {
hasTrailingSlash = false;
}
var up = 0;
for (var i = fromParts.length; i >= 0; i--) {
var part = fromParts[i];
if (part === '.') {
spliceOne(fromParts, i);
}
else if (part === '..') {
spliceOne(fromParts, i);
up++;
}
else if (up) {
spliceOne(fromParts, i);
up--;
}
}
if (!mustEndAbs)
for (; up--; up) {
fromParts.unshift('..');
}
if (mustEndAbs && fromParts[0] !== && (!fromParts[0] || !isAbsolute(fromParts[0])))
fromParts.unshift();
var result = fromParts.join('/');
if (hasTrailingSlash && result.substr(-1) !== '/')
result += '/';
return result;
} exports.default = resolvePathname;
} // value-equal/index.js $fsx.f[18] = (module, exports) => { "use strict"; Object.defineProperty(exports, "__esModule", { value: true }); var _typeof = typeof Symbol === "function" && typeof Symbol.iterator === "symbol" ? function (obj) { return typeof obj; } : function (obj) { return obj && typeof Symbol === "function" && obj.constructor === Symbol && obj !== Symbol.prototype ? "symbol" : typeof obj; }; function valueEqual(a, b) {
if (a === b)
return true;
if (a == null || b == null)
return false;
if (Array.isArray(a)) {
return Array.isArray(b) && a.length === b.length && a.every(function (item, index) {
return valueEqual(item, b[index]);
});
}
var aType = typeof a === 'undefined' ? 'undefined' : _typeof(a);
var bType = typeof b === 'undefined' ? 'undefined' : _typeof(b);
if (aType !== bType)
return false;
if (aType === 'object') {
var aValue = a.valueOf();
var bValue = b.valueOf();
if (aValue !== a || bValue !== b)
return valueEqual(aValue, bValue);
var aKeys = Object.keys(a);
var bKeys = Object.keys(b);
if (aKeys.length !== bKeys.length)
return false;
return aKeys.every(function (key) {
return valueEqual(a[key], b[key]);
});
}
return false;
} exports.default = valueEqual;
} // tiny-warning/dist/tiny-warning.esm.js $fsx.f[19] = (module, exports) => { "use strict"; Object.defineProperty(exports, "__esModule", { value: true }); var isProduction = "production" === 'production'; function warning(condition, message) {
if (!isProduction) {
if (condition) {
return;
}
var text = "Warning: " + message;
if (typeof console !== 'undefined') {
console.warn(text);
}
try {
throw Error(text);
}
catch (x) { }
}
} exports.default = warning;
} // tiny-invariant/dist/tiny-invariant.esm.js $fsx.f[20] = (module, exports) => { "use strict"; Object.defineProperty(exports, "__esModule", { value: true }); var isProduction = "production" === 'production'; var prefix = 'Invariant failed'; function invariant(condition, message) {
if (condition) {
return;
}
if (isProduction) {
throw new Error(prefix);
}
else {
throw new Error(prefix + ": " + (message || ));
}
} exports.default = invariant;
} // path-to-regexp/index.js $fsx.f[23] = (module, exports) => { var isarray = $fsx.r(22); module.exports = pathToRegexp; module.exports.parse = parse; module.exports.compile = compile; module.exports.tokensToFunction = tokensToFunction; module.exports.tokensToRegExp = tokensToRegExp; var PATH_REGEXP = new RegExp([
'(\\\\.)', '([\\/.])?(?:(?:\\:(\\w+)(?:\\(((?:\\\\.|[^\\\\()])+)\\))?|\\(((?:\\\\.|[^\\\\()])+)\\))([+*?])?|(\\*))'
].join('|'), 'g'); function parse(str, options) {
var tokens = [];
var key = 0;
var index = 0;
var path = ;
var defaultDelimiter = options && options.delimiter || '/';
var res;
while ((res = PATH_REGEXP.exec(str)) != null) {
var m = res[0];
var escaped = res[1];
var offset = res.index;
path += str.slice(index, offset);
index = offset + m.length;
if (escaped) {
path += escaped[1];
continue;
}
var next = str[index];
var prefix = res[2];
var name = res[3];
var capture = res[4];
var group = res[5];
var modifier = res[6];
var asterisk = res[7];
if (path) {
tokens.push(path);
path = ;
}
var partial = prefix != null && next != null && next !== prefix;
var repeat = modifier === '+' || modifier === '*';
var optional = modifier === '?' || modifier === '*';
var delimiter = res[2] || defaultDelimiter;
var pattern = capture || group;
tokens.push({
name: name || key++,
prefix: prefix || ,
delimiter: delimiter,
optional: optional,
repeat: repeat,
partial: partial,
asterisk: !!asterisk,
pattern: pattern ? escapeGroup(pattern) : (asterisk ? '.*' : '[^' + escapeString(delimiter) + ']+?')
});
}
if (index < str.length) {
path += str.substr(index);
}
if (path) {
tokens.push(path);
}
return tokens;
} function compile(str, options) {
return tokensToFunction(parse(str, options));
} function encodeURIComponentPretty(str) {
return encodeURI(str).replace(/[\/?#]/g, function (c) {
return '%' + c.charCodeAt(0).toString(16).toUpperCase();
});
} function encodeAsterisk(str) {
return encodeURI(str).replace(/[?#]/g, function (c) {
return '%' + c.charCodeAt(0).toString(16).toUpperCase();
});
} function tokensToFunction(tokens) {
var matches = new Array(tokens.length);
for (var i = 0; i < tokens.length; i++) {
if (typeof tokens[i] === 'object') {
matches[i] = new RegExp('^(?:' + tokens[i].pattern + ')$');
}
}
return function (obj, opts) {
var path = ;
var data = obj || {};
var options = opts || {};
var encode = options.pretty ? encodeURIComponentPretty : encodeURIComponent;
for (var i = 0; i < tokens.length; i++) {
var token = tokens[i];
if (typeof token === 'string') {
path += token;
continue;
}
var value = data[token.name];
var segment;
if (value == null) {
if (token.optional) {
if (token.partial) {
path += token.prefix;
}
continue;
}
else {
throw new TypeError('Expected "' + token.name + '" to be defined');
}
}
if (isarray(value)) {
if (!token.repeat) {
throw new TypeError('Expected "' + token.name + '" to not repeat, but received `' + JSON.stringify(value) + '`');
}
if (value.length === 0) {
if (token.optional) {
continue;
}
else {
throw new TypeError('Expected "' + token.name + '" to not be empty');
}
}
for (var j = 0; j < value.length; j++) {
segment = encode(value[j]);
if (!matches[i].test(segment)) {
throw new TypeError('Expected all "' + token.name + '" to match "' + token.pattern + '", but received `' + JSON.stringify(segment) + '`');
}
path += (j === 0 ? token.prefix : token.delimiter) + segment;
}
continue;
}
segment = token.asterisk ? encodeAsterisk(value) : encode(value);
if (!matches[i].test(segment)) {
throw new TypeError('Expected "' + token.name + '" to match "' + token.pattern + '", but received "' + segment + '"');
}
path += token.prefix + segment;
}
return path;
};
} function escapeString(str) {
return str.replace(/([.+*?=^!:${}()[\]|\/\\])/g, '\\$1');
} function escapeGroup(group) {
return group.replace(/([=!:$\/()])/g, '\\$1');
} function attachKeys(re, keys) {
re.keys = keys; return re;
} function flags(options) {
return options.sensitive ? : 'i';
} function regexpToRegexp(path, keys) {
var groups = path.source.match(/\((?!\?)/g);
if (groups) {
for (var i = 0; i < groups.length; i++) {
keys.push({
name: i,
prefix: null,
delimiter: null,
optional: false,
repeat: false,
partial: false,
asterisk: false,
pattern: null
});
}
}
return attachKeys(path, keys);
} function arrayToRegexp(path, keys, options) {
var parts = [];
for (var i = 0; i < path.length; i++) {
parts.push(pathToRegexp(path[i], keys, options).source);
}
var regexp = new RegExp('(?:' + parts.join('|') + ')', flags(options));
return attachKeys(regexp, keys);
} function stringToRegexp(path, keys, options) {
return tokensToRegExp(parse(path, options), keys, options);
} function tokensToRegExp(tokens, keys, options) {
if (!isarray(keys)) {
options = (keys || options);
keys = [];
}
options = options || {};
var strict = options.strict;
var end = options.end !== false;
var route = ;
for (var i = 0; i < tokens.length; i++) {
var token = tokens[i];
if (typeof token === 'string') {
route += escapeString(token);
}
else {
var prefix = escapeString(token.prefix);
var capture = '(?:' + token.pattern + ')';
keys.push(token);
if (token.repeat) {
capture += '(?:' + prefix + capture + ')*';
}
if (token.optional) {
if (!token.partial) {
capture = '(?:' + prefix + '(' + capture + '))?';
}
else {
capture = prefix + '(' + capture + ')?';
}
}
else {
capture = prefix + '(' + capture + ')';
}
route += capture;
}
}
var delimiter = escapeString(options.delimiter || '/');
var endsWithDelimiter = route.slice(-delimiter.length) === delimiter;
if (!strict) {
route = (endsWithDelimiter ? route.slice(0, -delimiter.length) : route) + '(?:' + delimiter + '(?=$))?';
}
if (end) {
route += '$';
}
else {
route += strict && endsWithDelimiter ? : '(?=' + delimiter + '|$)';
}
return attachKeys(new RegExp('^' + route, flags(options)), keys);
} function pathToRegexp(path, keys, options) {
if (!isarray(keys)) {
options = (keys || options);
keys = [];
}
options = options || {};
if (path instanceof RegExp) {
return regexpToRegexp(path, (keys));
}
if (isarray(path)) {
return arrayToRegexp((path), (keys), options);
}
return stringToRegexp((path), (keys), options);
}
} // isarray/index.js $fsx.f[22] = (module, exports) => { module.exports = Array.isArray || function (arr) {
return Object.prototype.toString.call(arr) == '[object Array]';
};
} // @babel/runtime/helpers/esm/objectWithoutPropertiesLoose.js $fsx.f[24] = (module, exports) => { "use strict"; Object.defineProperty(exports, "__esModule", { value: true }); function _objectWithoutPropertiesLoose(source, excluded) {
if (source == null)
return {};
var target = {};
var sourceKeys = Object.keys(source);
var key, i;
for (i = 0; i < sourceKeys.length; i++) {
key = sourceKeys[i];
if (excluded.indexOf(key) >= 0)
continue;
target[key] = source[key];
}
return target;
} exports.default = _objectWithoutPropertiesLoose;
} // hoist-non-react-statics/dist/hoist-non-react-statics.cjs.js $fsx.f[27] = (module, exports) => { 'use strict'; var ReactIs = $fsx.r(26); var REACT_STATICS = {
childContextTypes: true, contextType: true, contextTypes: true, defaultProps: true, displayName: true, getDefaultProps: true, getDerivedStateFromError: true, getDerivedStateFromProps: true, mixins: true, propTypes: true, type: true
}; var KNOWN_STATICS = {
name: true, length: true, prototype: true, caller: true, callee: true, arguments: true, arity: true
}; var FORWARD_REF_STATICS = {
'$$typeof': true, render: true, defaultProps: true, displayName: true, propTypes: true
}; var MEMO_STATICS = {
'$$typeof': true, compare: true, defaultProps: true, displayName: true, propTypes: true, type: true
}; var TYPE_STATICS = {}; TYPE_STATICS[ReactIs.ForwardRef] = FORWARD_REF_STATICS; function getStatics(component) {
if (ReactIs.isMemo(component)) {
return MEMO_STATICS;
}
return TYPE_STATICS[component['$$typeof']] || REACT_STATICS;
} var defineProperty = Object.defineProperty; var getOwnPropertyNames = Object.getOwnPropertyNames; var getOwnPropertySymbols = Object.getOwnPropertySymbols; var getOwnPropertyDescriptor = Object.getOwnPropertyDescriptor; var getPrototypeOf = Object.getPrototypeOf; var objectPrototype = Object.prototype; function hoistNonReactStatics(targetComponent, sourceComponent, blacklist) {
if (typeof sourceComponent !== 'string') {
if (objectPrototype) {
var inheritedComponent = getPrototypeOf(sourceComponent);
if (inheritedComponent && inheritedComponent !== objectPrototype) {
hoistNonReactStatics(targetComponent, inheritedComponent, blacklist);
}
}
var keys = getOwnPropertyNames(sourceComponent);
if (getOwnPropertySymbols) {
keys = keys.concat(getOwnPropertySymbols(sourceComponent));
}
var targetStatics = getStatics(targetComponent);
var sourceStatics = getStatics(sourceComponent);
for (var i = 0; i < keys.length; ++i) {
var key = keys[i];
if (!KNOWN_STATICS[key] && !(blacklist && blacklist[key]) && !(sourceStatics && sourceStatics[key]) && !(targetStatics && targetStatics[key])) {
var descriptor = getOwnPropertyDescriptor(sourceComponent, key);
try {
defineProperty(targetComponent, key, descriptor);
}
catch (e) { }
}
}
return targetComponent;
}
return targetComponent;
} module.exports = hoistNonReactStatics;
} // react-is/index.js $fsx.f[26] = (module, exports) => { 'use strict'; module.exports = $fsx.r(25);
} // react-is/cjs/react-is.production.min.js $fsx.f[25] = (module, exports) => { 'use strict'; Object.defineProperty(exports, "__esModule", { value: !0 }); var b = "function" === typeof Symbol && Symbol.for, c = b ? Symbol.for("react.element") : 60103, d = b ? Symbol.for("react.portal") : 60106, e = b ? Symbol.for("react.fragment") : 60107, f = b ? Symbol.for("react.strict_mode") : 60108, g = b ? Symbol.for("react.profiler") : 60114, h = b ? Symbol.for("react.provider") : 60109, k = b ? Symbol.for("react.context") : 60110, l = b ? Symbol.for("react.async_mode") : 60111, m = b ? Symbol.for("react.concurrent_mode") : 60111, n = b ? Symbol.for("react.forward_ref") : 60112, p = b ? Symbol.for("react.suspense") : 60113, q = b ? Symbol.for("react.suspense_list") :
60120, r = b ? Symbol.for("react.memo") : 60115, t = b ? Symbol.for("react.lazy") : 60116, v = b ? Symbol.for("react.fundamental") : 60117, w = b ? Symbol.for("react.responder") : 60118;
function x(a) { if ("object" === typeof a && null !== a) {
var u = a.$$typeof;
switch (u) {
case c: switch (a = a.type, a) {
case l:
case m:
case e:
case g:
case f:
case p: return a;
default: switch (a = a && a.$$typeof, a) {
case k:
case n:
case h: return a;
default: return u;
}
}
case t:
case r:
case d: return u;
}
} } function y(a) { return x(a) === m; } exports.typeOf = x; exports.AsyncMode = l; exports.ConcurrentMode = m; exports.ContextConsumer = k; exports.ContextProvider = h; exports.Element = c; exports.ForwardRef = n; exports.Fragment = e; exports.Lazy = t; exports.Memo = r; exports.Portal = d; exports.Profiler = g; exports.StrictMode = f; exports.Suspense = p; exports.isValidElementType = function (a) { return "string" === typeof a || "function" === typeof a || a === e || a === m || a === g || a === f || a === p || a === q || "object" === typeof a && null !== a && (a.$$typeof === t || a.$$typeof === r || a.$$typeof === h || a.$$typeof === k || a.$$typeof === n || a.$$typeof === v || a.$$typeof === w); }; exports.isAsyncMode = function (a) { return y(a) || x(a) === l; }; exports.isConcurrentMode = y; exports.isContextConsumer = function (a) { return x(a) === k; }; exports.isContextProvider = function (a) { return x(a) === h; }; exports.isElement = function (a) { return "object" === typeof a && null !== a && a.$$typeof === c; }; exports.isForwardRef = function (a) { return x(a) === n; }; exports.isFragment = function (a) { return x(a) === e; }; exports.isLazy = function (a) { return x(a) === t; }; exports.isMemo = function (a) { return x(a) === r; }; exports.isPortal = function (a) { return x(a) === d; }; exports.isProfiler = function (a) { return x(a) === g; }; exports.isStrictMode = function (a) { return x(a) === f; }; exports.isSuspense = function (a) { return x(a) === p; };
} // react-transition-group/esm/index.js $fsx.f[43] = (module, exports) => { "use strict"; Object.defineProperty(exports, "__esModule", { value: true }); var CSSTransition_1 = $fsx.r(37); exports.CSSTransition = CSSTransition_1.default; var ReplaceTransition_1 = $fsx.r(41); exports.ReplaceTransition = ReplaceTransition_1.default; var SwitchTransition_1 = $fsx.r(42); exports.SwitchTransition = SwitchTransition_1.default; var TransitionGroup_1 = $fsx.r(40); exports.TransitionGroup = TransitionGroup_1.default; var Transition_1 = $fsx.r(36); exports.Transition = Transition_1.default; var config_1 = $fsx.r(33); exports.config = config_1.default;
} // react-transition-group/esm/CSSTransition.js $fsx.f[37] = (module, exports) => { "use strict"; Object.defineProperty(exports, "__esModule", { value: true }); const extends_1 = $fsx.r(16); const objectWithoutPropertiesLoose_1 = $fsx.r(24); const inheritsLoose_1 = $fsx.r(9); const prop_types_1 = $fsx.r(13); const addClass_1 = $fsx.r(31); const removeClass_1 = $fsx.r(32); const react_1 = $fsx.r(3); const Transition_1 = $fsx.r(36); const PropTypes_1 = $fsx.r(34); var _addClass = function addClass(node, classes) {
return node && classes && classes.split(' ').forEach(function (c) {
return addClass_1.default(node, c);
});
}; var removeClass = function removeClass(node, classes) {
return node && classes && classes.split(' ').forEach(function (c) {
return removeClass_1.default(node, c);
});
}; var CSSTransition = function (_React$Component) {
inheritsLoose_1.default(CSSTransition, _React$Component);
function CSSTransition() {
var _this;
for (var _len = arguments.length, args = new Array(_len), _key = 0; _key < _len; _key++) {
args[_key] = arguments[_key];
}
_this = _React$Component.call.apply(_React$Component, [this].concat(args)) || this;
_this.appliedClasses = {
appear: {},
enter: {},
exit: {}
};
_this.onEnter = function (node, appearing) {
_this.removeClasses(node, 'exit');
_this.addClass(node, appearing ? 'appear' : 'enter', 'base');
if (_this.props.onEnter) {
_this.props.onEnter(node, appearing);
}
};
_this.onEntering = function (node, appearing) {
var type = appearing ? 'appear' : 'enter';
_this.addClass(node, type, 'active');
if (_this.props.onEntering) {
_this.props.onEntering(node, appearing);
}
};
_this.onEntered = function (node, appearing) {
var type = appearing ? 'appear' : 'enter';
_this.removeClasses(node, type);
_this.addClass(node, type, 'done');
if (_this.props.onEntered) {
_this.props.onEntered(node, appearing);
}
};
_this.onExit = function (node) {
_this.removeClasses(node, 'appear');
_this.removeClasses(node, 'enter');
_this.addClass(node, 'exit', 'base');
if (_this.props.onExit) {
_this.props.onExit(node);
}
};
_this.onExiting = function (node) {
_this.addClass(node, 'exit', 'active');
if (_this.props.onExiting) {
_this.props.onExiting(node);
}
};
_this.onExited = function (node) {
_this.removeClasses(node, 'exit');
_this.addClass(node, 'exit', 'done');
if (_this.props.onExited) {
_this.props.onExited(node);
}
};
_this.getClassNames = function (type) {
var classNames = _this.props.classNames;
var isStringClassNames = typeof classNames === 'string';
var prefix = isStringClassNames && classNames ? classNames + "-" : ;
var baseClassName = isStringClassNames ? "" + prefix + type : classNames[type];
var activeClassName = isStringClassNames ? baseClassName + "-active" : classNames[type + "Active"];
var doneClassName = isStringClassNames ? baseClassName + "-done" : classNames[type + "Done"];
return {
baseClassName: baseClassName,
activeClassName: activeClassName,
doneClassName: doneClassName
};
};
return _this;
}
var _proto = CSSTransition.prototype;
_proto.addClass = function addClass(node, type, phase) {
var className = this.getClassNames(type)[phase + "ClassName"];
if (type === 'appear' && phase === 'done') {
className += " " + this.getClassNames('enter').doneClassName;
}
if (phase === 'active') {
node && node.scrollTop;
}
this.appliedClasses[type][phase] = className;
_addClass(node, className);
};
_proto.removeClasses = function removeClasses(node, type) {
var _this$appliedClasses$ = this.appliedClasses[type], baseClassName = _this$appliedClasses$.base, activeClassName = _this$appliedClasses$.active, doneClassName = _this$appliedClasses$.done;
this.appliedClasses[type] = {};
if (baseClassName) {
removeClass(node, baseClassName);
}
if (activeClassName) {
removeClass(node, activeClassName);
}
if (doneClassName) {
removeClass(node, doneClassName);
}
};
_proto.render = function render() {
var _this$props = this.props, _ = _this$props.classNames, props = objectWithoutPropertiesLoose_1.default(_this$props, ["classNames"]);
return react_1.default.createElement(Transition_1.default, extends_1.default({}, props, {
onEnter: this.onEnter,
onEntered: this.onEntered,
onEntering: this.onEntering,
onExit: this.onExit,
onExiting: this.onExiting,
onExited: this.onExited
}));
};
return CSSTransition;
}(react_1.default.Component); CSSTransition.defaultProps = {
classNames:
}; CSSTransition.propTypes = "production" !== "production" ? extends_1.default({}, Transition_1.default.propTypes, {
classNames: PropTypes_1.classNamesShape, onEnter: prop_types_1.default.func, onEntering: prop_types_1.default.func, onEntered: prop_types_1.default.func, onExit: prop_types_1.default.func, onExiting: prop_types_1.default.func, onExited: prop_types_1.default.func
}) : {}; exports.default = CSSTransition;
} // dom-helpers/esm/addClass.js $fsx.f[31] = (module, exports) => { "use strict"; Object.defineProperty(exports, "__esModule", { value: true }); const hasClass_1 = $fsx.r(30); function addClass(element, className) {
if (element.classList)
element.classList.add(className);
else if (!hasClass_1.default(element, className))
if (typeof element.className === 'string')
element.className = element.className + " " + className;
else
element.setAttribute('class', (element.className && element.className.baseVal || ) + " " + className);
} exports.default = addClass;
} // dom-helpers/esm/hasClass.js $fsx.f[30] = (module, exports) => { "use strict"; Object.defineProperty(exports, "__esModule", { value: true }); function hasClass(element, className) {
if (element.classList)
return !!className && element.classList.contains(className);
return (" " + (element.className.baseVal || element.className) + " ").indexOf(" " + className + " ") !== -1;
} exports.default = hasClass;
} // dom-helpers/esm/removeClass.js $fsx.f[32] = (module, exports) => { "use strict"; Object.defineProperty(exports, "__esModule", { value: true }); function replaceClassName(origClass, classToRemove) {
return origClass.replace(new RegExp("(^|\\s)" + classToRemove + "(?:\\s|$)", 'g'), '$1').replace(/\s+/g, ' ').replace(/^\s*|\s*$/g, );
} function removeClass(element, className) {
if (element.classList) {
element.classList.remove(className);
}
else if (typeof element.className === 'string') {
;
element.className = replaceClassName(element.className, className);
}
else {
element.setAttribute('class', replaceClassName(element.className && element.className.baseVal || , className));
}
} exports.default = removeClass;
} // react-transition-group/esm/Transition.js $fsx.f[36] = (module, exports) => { "use strict"; Object.defineProperty(exports, "__esModule", { value: true }); const objectWithoutPropertiesLoose_1 = $fsx.r(24); const inheritsLoose_1 = $fsx.r(9); const prop_types_1 = $fsx.r(13); const react_1 = $fsx.r(3); const react_dom_1 = $fsx.r(7); const config_1 = $fsx.r(33); const PropTypes_1 = $fsx.r(34); const TransitionGroupContext_1 = $fsx.r(35); exports.UNMOUNTED = 'unmounted'; exports.EXITED = 'exited'; exports.ENTERING = 'entering'; exports.ENTERED = 'entered'; exports.EXITING = 'exiting'; var Transition = function (_React$Component) {
inheritsLoose_1.default(Transition, _React$Component);
function Transition(props, context) {
var _this;
_this = _React$Component.call(this, props, context) || this;
var parentGroup = context;
var appear = parentGroup && !parentGroup.isMounting ? props.enter : props.appear;
var initialStatus;
_this.appearStatus = null;
if (props.in) {
if (appear) {
initialStatus = exports.EXITED;
_this.appearStatus = exports.ENTERING;
}
else {
initialStatus = exports.ENTERED;
}
}
else {
if (props.unmountOnExit || props.mountOnEnter) {
initialStatus = exports.UNMOUNTED;
}
else {
initialStatus = exports.EXITED;
}
}
_this.state = {
status: initialStatus
};
_this.nextCallback = null;
return _this;
}
Transition.getDerivedStateFromProps = function getDerivedStateFromProps(_ref, prevState) {
var nextIn = _ref.in;
if (nextIn && prevState.status === exports.UNMOUNTED) {
return {
status: exports.EXITED
};
}
return null;
};
var _proto = Transition.prototype;
_proto.componentDidMount = function componentDidMount() {
this.updateStatus(true, this.appearStatus);
};
_proto.componentDidUpdate = function componentDidUpdate(prevProps) {
var nextStatus = null;
if (prevProps !== this.props) {
var status = this.state.status;
if (this.props.in) {
if (status !== exports.ENTERING && status !== exports.ENTERED) {
nextStatus = exports.ENTERING;
}
}
else {
if (status === exports.ENTERING || status === exports.ENTERED) {
nextStatus = exports.EXITING;
}
}
}
this.updateStatus(false, nextStatus);
};
_proto.componentWillUnmount = function componentWillUnmount() {
this.cancelNextCallback();
};
_proto.getTimeouts = function getTimeouts() {
var timeout = this.props.timeout;
var exit, enter, appear;
exit = enter = appear = timeout;
if (timeout != null && typeof timeout !== 'number') {
exit = timeout.exit;
enter = timeout.enter;
appear = timeout.appear !== undefined ? timeout.appear : enter;
}
return {
exit: exit,
enter: enter,
appear: appear
};
};
_proto.updateStatus = function updateStatus(mounting, nextStatus) {
if (mounting === void 0) {
mounting = false;
}
if (nextStatus !== null) {
this.cancelNextCallback();
var node = react_dom_1.default.findDOMNode(this);
if (nextStatus === exports.ENTERING) {
this.performEnter(node, mounting);
}
else {
this.performExit(node);
}
}
else if (this.props.unmountOnExit && this.state.status === exports.EXITED) {
this.setState({
status: exports.UNMOUNTED
});
}
};
_proto.performEnter = function performEnter(node, mounting) {
var _this2 = this;
var enter = this.props.enter;
var appearing = this.context ? this.context.isMounting : mounting;
var timeouts = this.getTimeouts();
var enterTimeout = appearing ? timeouts.appear : timeouts.enter;
if (!mounting && !enter || config_1.default.disabled) {
this.safeSetState({
status: exports.ENTERED
}, function () {
_this2.props.onEntered(node);
});
return;
}
this.props.onEnter(node, appearing);
this.safeSetState({
status: exports.ENTERING
}, function () {
_this2.props.onEntering(node, appearing);
_this2.onTransitionEnd(node, enterTimeout, function () {
_this2.safeSetState({
status: exports.ENTERED
}, function () {
_this2.props.onEntered(node, appearing);
});
});
});
};
_proto.performExit = function performExit(node) {
var _this3 = this;
var exit = this.props.exit;
var timeouts = this.getTimeouts();
if (!exit || config_1.default.disabled) {
this.safeSetState({
status: exports.EXITED
}, function () {
_this3.props.onExited(node);
});
return;
}
this.props.onExit(node);
this.safeSetState({
status: exports.EXITING
}, function () {
_this3.props.onExiting(node);
_this3.onTransitionEnd(node, timeouts.exit, function () {
_this3.safeSetState({
status: exports.EXITED
}, function () {
_this3.props.onExited(node);
});
});
});
};
_proto.cancelNextCallback = function cancelNextCallback() {
if (this.nextCallback !== null) {
this.nextCallback.cancel();
this.nextCallback = null;
}
};
_proto.safeSetState = function safeSetState(nextState, callback) {
callback = this.setNextCallback(callback);
this.setState(nextState, callback);
};
_proto.setNextCallback = function setNextCallback(callback) {
var _this4 = this;
var active = true;
this.nextCallback = function (event) {
if (active) {
active = false;
_this4.nextCallback = null;
callback(event);
}
};
this.nextCallback.cancel = function () {
active = false;
};
return this.nextCallback;
};
_proto.onTransitionEnd = function onTransitionEnd(node, timeout, handler) {
this.setNextCallback(handler);
var doesNotHaveTimeoutOrListener = timeout == null && !this.props.addEndListener;
if (!node || doesNotHaveTimeoutOrListener) {
setTimeout(this.nextCallback, 0);
return;
}
if (this.props.addEndListener) {
this.props.addEndListener(node, this.nextCallback);
}
if (timeout != null) {
setTimeout(this.nextCallback, timeout);
}
};
_proto.render = function render() {
var status = this.state.status;
if (status === exports.UNMOUNTED) {
return null;
}
var _this$props = this.props, children = _this$props.children, childProps = objectWithoutPropertiesLoose_1.default(_this$props, ["children"]);
delete childProps.in;
delete childProps.mountOnEnter;
delete childProps.unmountOnExit;
delete childProps.appear;
delete childProps.enter;
delete childProps.exit;
delete childProps.timeout;
delete childProps.addEndListener;
delete childProps.onEnter;
delete childProps.onEntering;
delete childProps.onEntered;
delete childProps.onExit;
delete childProps.onExiting;
delete childProps.onExited;
if (typeof children === 'function') {
return react_1.default.createElement(TransitionGroupContext_1.default.Provider, {
value: null
}, children(status, childProps));
}
var child = react_1.default.Children.only(children);
return (react_1.default.createElement(TransitionGroupContext_1.default.Provider, {
value: null
}, react_1.default.cloneElement(child, childProps)));
};
return Transition;
}(react_1.default.Component); Transition.contextType = TransitionGroupContext_1.default; Transition.propTypes = "production" !== "production" ? {
children: prop_types_1.default.oneOfType([prop_types_1.default.func.isRequired, prop_types_1.default.element.isRequired]).isRequired,
in: prop_types_1.default.bool,
mountOnEnter: prop_types_1.default.bool,
unmountOnExit: prop_types_1.default.bool,
appear: prop_types_1.default.bool,
enter: prop_types_1.default.bool,
exit: prop_types_1.default.bool,
timeout: function timeout(props) {
var pt = PropTypes_1.timeoutsShape;
if (!props.addEndListener)
pt = pt.isRequired;
for (var _len = arguments.length, args = new Array(_len > 1 ? _len - 1 : 0), _key = 1; _key < _len; _key++) {
args[_key - 1] = arguments[_key];
}
return pt.apply(void 0, [props].concat(args));
},
addEndListener: prop_types_1.default.func,
onEnter: prop_types_1.default.func,
onEntering: prop_types_1.default.func,
onEntered: prop_types_1.default.func,
onExit: prop_types_1.default.func,
onExiting: prop_types_1.default.func,
onExited: prop_types_1.default.func
} : {}; function noop() { } Transition.defaultProps = {
in: false, mountOnEnter: false, unmountOnExit: false, appear: false, enter: true, exit: true, onEnter: noop, onEntering: noop, onEntered: noop, onExit: noop, onExiting: noop, onExited: noop
}; Transition.UNMOUNTED = 0; Transition.EXITED = 1; Transition.ENTERING = 2; Transition.ENTERED = 3; Transition.EXITING = 4; exports.default = Transition;
} // react-transition-group/esm/config.js $fsx.f[33] = (module, exports) => { "use strict"; Object.defineProperty(exports, "__esModule", { value: true }); exports.default = {
disabled: false
};
} // react-transition-group/esm/utils/PropTypes.js $fsx.f[34] = (module, exports) => { "use strict"; Object.defineProperty(exports, "__esModule", { value: true }); const prop_types_1 = $fsx.r(13); exports.timeoutsShape = "production" !== 'production' ? prop_types_1.default.oneOfType([prop_types_1.default.number, prop_types_1.default.shape({
enter: prop_types_1.default.number,
exit: prop_types_1.default.number,
appear: prop_types_1.default.number
}).isRequired]) : null;
exports.classNamesShape = "production" !== 'production' ? prop_types_1.default.oneOfType([prop_types_1.default.string, prop_types_1.default.shape({
enter: prop_types_1.default.string,
exit: prop_types_1.default.string,
active: prop_types_1.default.string
}), prop_types_1.default.shape({
enter: prop_types_1.default.string,
enterDone: prop_types_1.default.string,
enterActive: prop_types_1.default.string,
exit: prop_types_1.default.string,
exitDone: prop_types_1.default.string,
exitActive: prop_types_1.default.string
})]) : null;
} // react-transition-group/esm/TransitionGroupContext.js $fsx.f[35] = (module, exports) => { "use strict"; Object.defineProperty(exports, "__esModule", { value: true }); const react_1 = $fsx.r(3); exports.default = react_1.default.createContext(null);
} // react-transition-group/esm/ReplaceTransition.js $fsx.f[41] = (module, exports) => { "use strict"; Object.defineProperty(exports, "__esModule", { value: true }); const objectWithoutPropertiesLoose_1 = $fsx.r(24); const inheritsLoose_1 = $fsx.r(9); const prop_types_1 = $fsx.r(13); const react_1 = $fsx.r(3); const react_dom_1 = $fsx.r(7); const TransitionGroup_1 = $fsx.r(40); var ReplaceTransition = function (_React$Component) {
inheritsLoose_1.default(ReplaceTransition, _React$Component);
function ReplaceTransition() {
var _this;
for (var _len = arguments.length, _args = new Array(_len), _key = 0; _key < _len; _key++) {
_args[_key] = arguments[_key];
}
_this = _React$Component.call.apply(_React$Component, [this].concat(_args)) || this;
_this.handleEnter = function () {
for (var _len2 = arguments.length, args = new Array(_len2), _key2 = 0; _key2 < _len2; _key2++) {
args[_key2] = arguments[_key2];
}
return _this.handleLifecycle('onEnter', 0, args);
};
_this.handleEntering = function () {
for (var _len3 = arguments.length, args = new Array(_len3), _key3 = 0; _key3 < _len3; _key3++) {
args[_key3] = arguments[_key3];
}
return _this.handleLifecycle('onEntering', 0, args);
};
_this.handleEntered = function () {
for (var _len4 = arguments.length, args = new Array(_len4), _key4 = 0; _key4 < _len4; _key4++) {
args[_key4] = arguments[_key4];
}
return _this.handleLifecycle('onEntered', 0, args);
};
_this.handleExit = function () {
for (var _len5 = arguments.length, args = new Array(_len5), _key5 = 0; _key5 < _len5; _key5++) {
args[_key5] = arguments[_key5];
}
return _this.handleLifecycle('onExit', 1, args);
};
_this.handleExiting = function () {
for (var _len6 = arguments.length, args = new Array(_len6), _key6 = 0; _key6 < _len6; _key6++) {
args[_key6] = arguments[_key6];
}
return _this.handleLifecycle('onExiting', 1, args);
};
_this.handleExited = function () {
for (var _len7 = arguments.length, args = new Array(_len7), _key7 = 0; _key7 < _len7; _key7++) {
args[_key7] = arguments[_key7];
}
return _this.handleLifecycle('onExited', 1, args);
};
return _this;
}
var _proto = ReplaceTransition.prototype;
_proto.handleLifecycle = function handleLifecycle(handler, idx, originalArgs) {
var _child$props;
var children = this.props.children;
var child = react_1.default.Children.toArray(children)[idx];
if (child.props[handler])
(_child$props = child.props)[handler].apply(_child$props, originalArgs);
if (this.props[handler])
this.props[handler](react_dom_1.default.findDOMNode(this));
};
_proto.render = function render() {
var _this$props = this.props, children = _this$props.children, inProp = _this$props.in, props = objectWithoutPropertiesLoose_1.default(_this$props, ["children", "in"]);
var _React$Children$toArr = react_1.default.Children.toArray(children), first = _React$Children$toArr[0], second = _React$Children$toArr[1];
delete props.onEnter;
delete props.onEntering;
delete props.onEntered;
delete props.onExit;
delete props.onExiting;
delete props.onExited;
return react_1.default.createElement(TransitionGroup_1.default, props, inProp ? react_1.default.cloneElement(first, {
key: 'first',
onEnter: this.handleEnter,
onEntering: this.handleEntering,
onEntered: this.handleEntered
}) : react_1.default.cloneElement(second, {
key: 'second',
onEnter: this.handleExit,
onEntering: this.handleExiting,
onEntered: this.handleExited
}));
};
return ReplaceTransition;
}(react_1.default.Component); ReplaceTransition.propTypes = "production" !== "production" ? {
in: prop_types_1.default.bool.isRequired,
children: function children(props, propName) {
if (react_1.default.Children.count(props[propName]) !== 2)
return new Error("\"" + propName + "\" must be exactly two transition components.");
return null;
}
} : {}; exports.default = ReplaceTransition;
} // react-transition-group/esm/TransitionGroup.js $fsx.f[40] = (module, exports) => { "use strict"; Object.defineProperty(exports, "__esModule", { value: true }); const objectWithoutPropertiesLoose_1 = $fsx.r(24); const extends_1 = $fsx.r(16); const inheritsLoose_1 = $fsx.r(9); const assertThisInitialized_1 = $fsx.r(38); const prop_types_1 = $fsx.r(13); const react_1 = $fsx.r(3); const TransitionGroupContext_1 = $fsx.r(35); const ChildMapping_1 = $fsx.r(39); var values = Object.values || function (obj) {
return Object.keys(obj).map(function (k) {
return obj[k];
});
}; var defaultProps = {
component: 'div',
childFactory: function childFactory(child) {
return child;
}
}; var TransitionGroup = function (_React$Component) {
inheritsLoose_1.default(TransitionGroup, _React$Component);
function TransitionGroup(props, context) {
var _this;
_this = _React$Component.call(this, props, context) || this;
var handleExited = _this.handleExited.bind(assertThisInitialized_1.default(assertThisInitialized_1.default(_this)));
_this.state = {
contextValue: {
isMounting: true
},
handleExited: handleExited,
firstRender: true
};
return _this;
}
var _proto = TransitionGroup.prototype;
_proto.componentDidMount = function componentDidMount() {
this.mounted = true;
this.setState({
contextValue: {
isMounting: false
}
});
};
_proto.componentWillUnmount = function componentWillUnmount() {
this.mounted = false;
};
TransitionGroup.getDerivedStateFromProps = function getDerivedStateFromProps(nextProps, _ref) {
var prevChildMapping = _ref.children, handleExited = _ref.handleExited, firstRender = _ref.firstRender;
return {
children: firstRender ? ChildMapping_1.getInitialChildMapping(nextProps, handleExited) : ChildMapping_1.getNextChildMapping(nextProps, prevChildMapping, handleExited),
firstRender: false
};
};
_proto.handleExited = function handleExited(child, node) {
var currentChildMapping = ChildMapping_1.getChildMapping(this.props.children);
if (child.key in currentChildMapping)
return;
if (child.props.onExited) {
child.props.onExited(node);
}
if (this.mounted) {
this.setState(function (state) {
var children = extends_1.default({}, state.children);
delete children[child.key];
return {
children: children
};
});
}
};
_proto.render = function render() {
var _this$props = this.props, Component = _this$props.component, childFactory = _this$props.childFactory, props = objectWithoutPropertiesLoose_1.default(_this$props, ["component", "childFactory"]);
var contextValue = this.state.contextValue;
var children = values(this.state.children).map(childFactory);
delete props.appear;
delete props.enter;
delete props.exit;
if (Component === null) {
return react_1.default.createElement(TransitionGroupContext_1.default.Provider, {
value: contextValue
}, children);
}
return react_1.default.createElement(TransitionGroupContext_1.default.Provider, {
value: contextValue
}, react_1.default.createElement(Component, props, children));
};
return TransitionGroup;
}(react_1.default.Component); TransitionGroup.propTypes = "production" !== "production" ? {
component: prop_types_1.default.any, children: prop_types_1.default.node, appear: prop_types_1.default.bool, enter: prop_types_1.default.bool, exit: prop_types_1.default.bool, childFactory: prop_types_1.default.func
} : {}; TransitionGroup.defaultProps = defaultProps; exports.default = TransitionGroup;
} // @babel/runtime/helpers/esm/assertThisInitialized.js $fsx.f[38] = (module, exports) => { "use strict"; Object.defineProperty(exports, "__esModule", { value: true }); function _assertThisInitialized(self) {
if (self === void 0) {
throw new ReferenceError("this hasn't been initialised - super() hasn't been called");
}
return self;
} exports.default = _assertThisInitialized;
} // react-transition-group/esm/utils/ChildMapping.js $fsx.f[39] = (module, exports) => { "use strict"; Object.defineProperty(exports, "__esModule", { value: true }); const react_1 = $fsx.r(3); function getChildMapping(children, mapFn) {
var mapper = function mapper(child) {
return mapFn && react_1.isValidElement(child) ? mapFn(child) : child;
};
var result = Object.create(null);
if (children)
react_1.Children.map(children, function (c) {
return c;
}).forEach(function (child) {
result[child.key] = mapper(child);
});
return result;
} exports.getChildMapping = getChildMapping; function mergeChildMappings(prev, next) {
prev = prev || {};
next = next || {};
function getValueForKey(key) {
return key in next ? next[key] : prev[key];
}
var nextKeysPending = Object.create(null);
var pendingKeys = [];
for (var prevKey in prev) {
if (prevKey in next) {
if (pendingKeys.length) {
nextKeysPending[prevKey] = pendingKeys;
pendingKeys = [];
}
}
else {
pendingKeys.push(prevKey);
}
}
var i;
var childMapping = {};
for (var nextKey in next) {
if (nextKeysPending[nextKey]) {
for (i = 0; i < nextKeysPending[nextKey].length; i++) {
var pendingNextKey = nextKeysPending[nextKey][i];
childMapping[nextKeysPending[nextKey][i]] = getValueForKey(pendingNextKey);
}
}
childMapping[nextKey] = getValueForKey(nextKey);
}
for (i = 0; i < pendingKeys.length; i++) {
childMapping[pendingKeys[i]] = getValueForKey(pendingKeys[i]);
}
return childMapping;
} exports.mergeChildMappings = mergeChildMappings; function getProp(child, prop, props) {
return props[prop] != null ? props[prop] : child.props[prop];
} function getInitialChildMapping(props, onExited) {
return getChildMapping(props.children, function (child) {
return react_1.cloneElement(child, {
onExited: onExited.bind(null, child),
in: true,
appear: getProp(child, 'appear', props),
enter: getProp(child, 'enter', props),
exit: getProp(child, 'exit', props)
});
});
} exports.getInitialChildMapping = getInitialChildMapping; function getNextChildMapping(nextProps, prevChildMapping, onExited) {
var nextChildMapping = getChildMapping(nextProps.children);
var children = mergeChildMappings(prevChildMapping, nextChildMapping);
Object.keys(children).forEach(function (key) {
var child = children[key];
if (!react_1.isValidElement(child))
return;
var hasPrev = key in prevChildMapping;
var hasNext = key in nextChildMapping;
var prevChild = prevChildMapping[key];
var isLeaving = react_1.isValidElement(prevChild) && !prevChild.props.in;
if (hasNext && (!hasPrev || isLeaving)) {
children[key] = react_1.cloneElement(child, {
onExited: onExited.bind(null, child),
in: true,
exit: getProp(child, 'exit', nextProps),
enter: getProp(child, 'enter', nextProps)
});
}
else if (!hasNext && hasPrev && !isLeaving) {
children[key] = react_1.cloneElement(child, {
in: false
});
}
else if (hasNext && hasPrev && react_1.isValidElement(prevChild)) {
children[key] = react_1.cloneElement(child, {
onExited: onExited.bind(null, child),
in: prevChild.props.in,
exit: getProp(child, 'exit', nextProps),
enter: getProp(child, 'enter', nextProps)
});
}
});
return children;
} exports.getNextChildMapping = getNextChildMapping;
} // react-transition-group/esm/SwitchTransition.js $fsx.f[42] = (module, exports) => { "use strict"; Object.defineProperty(exports, "__esModule", { value: true }); const inheritsLoose_1 = $fsx.r(9); var _leaveRenders, _enterRenders; const react_1 = $fsx.r(3); const prop_types_1 = $fsx.r(13); const Transition_1 = $fsx.r(36); const TransitionGroupContext_1 = $fsx.r(35); function areChildrenDifferent(oldChildren, newChildren) {
if (oldChildren === newChildren)
return false;
if (react_1.default.isValidElement(oldChildren) && react_1.default.isValidElement(newChildren) && oldChildren.key != null && oldChildren.key === newChildren.key) {
return false;
}
return true;
} exports.modes = {
out: 'out-in', in: 'in-out'
}; var callHook = function callHook(element, name, cb) {
return function () {
var _element$props;
element.props[name] && (_element$props = element.props)[name].apply(_element$props, arguments);
cb();
};
}; var leaveRenders = (_leaveRenders = {}, _leaveRenders[exports.modes.out] = function (_ref) {
var current = _ref.current, changeState = _ref.changeState;
return react_1.default.cloneElement(current, {
in: false,
onExited: callHook(current, 'onExited', function () {
changeState(Transition_1.ENTERING, null);
})
});
}, _leaveRenders[exports.modes.in] = function (_ref2) {
var current = _ref2.current, changeState = _ref2.changeState, children = _ref2.children;
return [current, react_1.default.cloneElement(children, {
in: true,
onEntered: callHook(children, 'onEntered', function () {
changeState(Transition_1.ENTERING);
})
})];
}, _leaveRenders); var enterRenders = (_enterRenders = {}, _enterRenders[exports.modes.out] = function (_ref3) {
var children = _ref3.children, changeState = _ref3.changeState;
return react_1.default.cloneElement(children, {
in: true,
onEntered: callHook(children, 'onEntered', function () {
changeState(Transition_1.ENTERED, react_1.default.cloneElement(children, {
in: true
}));
})
});
}, _enterRenders[exports.modes.in] = function (_ref4) {
var current = _ref4.current, children = _ref4.children, changeState = _ref4.changeState;
return [react_1.default.cloneElement(current, {
in: false,
onExited: callHook(current, 'onExited', function () {
changeState(Transition_1.ENTERED, react_1.default.cloneElement(children, {
in: true
}));
})
}), react_1.default.cloneElement(children, {
in: true
})];
}, _enterRenders); var SwitchTransition = function (_React$Component) {
inheritsLoose_1.default(SwitchTransition, _React$Component);
function SwitchTransition() {
var _this;
for (var _len = arguments.length, args = new Array(_len), _key = 0; _key < _len; _key++) {
args[_key] = arguments[_key];
}
_this = _React$Component.call.apply(_React$Component, [this].concat(args)) || this;
_this.state = {
status: Transition_1.ENTERED,
current: null
};
_this.appeared = false;
_this.changeState = function (status, current) {
if (current === void 0) {
current = _this.state.current;
}
_this.setState({
status: status,
current: current
});
};
return _this;
}
var _proto = SwitchTransition.prototype;
_proto.componentDidMount = function componentDidMount() {
this.appeared = true;
};
SwitchTransition.getDerivedStateFromProps = function getDerivedStateFromProps(props, state) {
if (props.children == null) {
return {
current: null
};
}
if (state.status === Transition_1.ENTERING && props.mode === exports.modes.in) {
return {
status: Transition_1.ENTERING
};
}
if (state.current && areChildrenDifferent(state.current, props.children)) {
return {
status: Transition_1.EXITING
};
}
return {
current: react_1.default.cloneElement(props.children, {
in: true
})
};
};
_proto.render = function render() {
var _this$props = this.props, children = _this$props.children, mode = _this$props.mode, _this$state = this.state, status = _this$state.status, current = _this$state.current;
var data = {
children: children,
current: current,
changeState: this.changeState,
status: status
};
var component;
switch (status) {
case Transition_1.ENTERING:
component = enterRenders[mode](data);
break;
case Transition_1.EXITING:
component = leaveRenders[mode](data);
break;
case Transition_1.ENTERED:
component = current;
}
return react_1.default.createElement(TransitionGroupContext_1.default.Provider, {
value: {
isMounting: !this.appeared
}
}, component);
};
return SwitchTransition;
}(react_1.default.Component); SwitchTransition.propTypes = "production" !== "production" ? {
mode: prop_types_1.default.oneOf([exports.modes.in, exports.modes.out]), children: prop_types_1.default.oneOfType([prop_types_1.default.element.isRequired])
} : {}; SwitchTransition.defaultProps = {
mode: exports.modes.out
}; exports.default = SwitchTransition;
} // lodash/lodash.js $fsx.f[44] = (module, exports) => { "use strict"; Object.defineProperty(exports, "__esModule", { value: true }); const global = {};
(function () {
var undefined; var VERSION = '4.17.14'; var LARGE_ARRAY_SIZE = 200; var CORE_ERROR_TEXT = 'Unsupported core-js use. Try https://npms.io/search?q=ponyfill.', FUNC_ERROR_TEXT = 'Expected a function'; var HASH_UNDEFINED = '__lodash_hash_undefined__'; var MAX_MEMOIZE_SIZE = 500; var PLACEHOLDER = '__lodash_placeholder__'; var CLONE_DEEP_FLAG = 1, CLONE_FLAT_FLAG = 2, CLONE_SYMBOLS_FLAG = 4; var COMPARE_PARTIAL_FLAG = 1, COMPARE_UNORDERED_FLAG = 2; var WRAP_BIND_FLAG = 1, WRAP_BIND_KEY_FLAG = 2, WRAP_CURRY_BOUND_FLAG = 4, WRAP_CURRY_FLAG = 8, WRAP_CURRY_RIGHT_FLAG = 16, WRAP_PARTIAL_FLAG = 32, WRAP_PARTIAL_RIGHT_FLAG = 64, WRAP_ARY_FLAG = 128, WRAP_REARG_FLAG = 256, WRAP_FLIP_FLAG = 512; var DEFAULT_TRUNC_LENGTH = 30, DEFAULT_TRUNC_OMISSION = '...'; var HOT_COUNT = 800, HOT_SPAN = 16; var LAZY_FILTER_FLAG = 1, LAZY_MAP_FLAG = 2, LAZY_WHILE_FLAG = 3; var INFINITY = 1 / 0, MAX_SAFE_INTEGER = 9007199254740991, MAX_INTEGER = 1.7976931348623157e+308, NAN = 0 / 0; var MAX_ARRAY_LENGTH = 4294967295, MAX_ARRAY_INDEX = MAX_ARRAY_LENGTH - 1, HALF_MAX_ARRAY_LENGTH = MAX_ARRAY_LENGTH >>> 1; var wrapFlags = [ ['ary', WRAP_ARY_FLAG], ['bind', WRAP_BIND_FLAG], ['bindKey', WRAP_BIND_KEY_FLAG], ['curry', WRAP_CURRY_FLAG], ['curryRight', WRAP_CURRY_RIGHT_FLAG], ['flip', WRAP_FLIP_FLAG], ['partial', WRAP_PARTIAL_FLAG], ['partialRight', WRAP_PARTIAL_RIGHT_FLAG], ['rearg', WRAP_REARG_FLAG] ]; var argsTag = '[object Arguments]', arrayTag = '[object Array]', asyncTag = '[object AsyncFunction]', boolTag = '[object Boolean]', dateTag = '[object Date]', domExcTag = '[object DOMException]', errorTag = '[object Error]', funcTag = '[object Function]', genTag = '[object GeneratorFunction]', mapTag = '[object Map]', numberTag = '[object Number]', nullTag = '[object Null]', objectTag = '[object Object]', promiseTag = '[object Promise]', proxyTag = '[object Proxy]', regexpTag = '[object RegExp]', setTag = '[object Set]', stringTag = '[object String]', symbolTag = '[object Symbol]', undefinedTag = '[object Undefined]', weakMapTag = '[object WeakMap]', weakSetTag = '[object WeakSet]'; var arrayBufferTag = '[object ArrayBuffer]', dataViewTag = '[object DataView]', float32Tag = '[object Float32Array]', float64Tag = '[object Float64Array]', int8Tag = '[object Int8Array]', int16Tag = '[object Int16Array]', int32Tag = '[object Int32Array]', uint8Tag = '[object Uint8Array]', uint8ClampedTag = '[object Uint8ClampedArray]', uint16Tag = '[object Uint16Array]', uint32Tag = '[object Uint32Array]'; var reEmptyStringLeading = /\b__p \+= ;/g, reEmptyStringMiddle = /\b(__p \+=) \+/g, reEmptyStringTrailing = /(__e\(.*?\)|\b__t\)) \+\n;/g; var reEscapedHtml = /&(?:amp|lt|gt|quot|#39);/g, reUnescapedHtml = /[&<>"']/g, reHasEscapedHtml = RegExp(reEscapedHtml.source), reHasUnescapedHtml = RegExp(reUnescapedHtml.source); var reEscape = /<%-([\s\S]+?)%>/g, reEvaluate = /<%([\s\S]+?)%>/g, reInterpolate = /<%=([\s\S]+?)%>/g; var reIsDeepProp = /\.|\[(?:[^[\]]*|(["'])(?:(?!\1)[^\\]|\\.)*?\1)\]/, reIsPlainProp = /^\w*$/, rePropName = /[^.[\]]+|\[(?:(-?\d+(?:\.\d+)?)|(["'])((?:(?!\2)[^\\]|\\.)*?)\2)\]|(?=(?:\.|\[\])(?:\.|\[\]|$))/g; var reRegExpChar = /[\\^$.*+?()[\]{}|]/g, reHasRegExpChar = RegExp(reRegExpChar.source); var reTrim = /^\s+|\s+$/g, reTrimStart = /^\s+/, reTrimEnd = /\s+$/; var reWrapComment = /\{(?:\n\/\* \[wrapped with .+\] \*\/)?\n?/, reWrapDetails = /\{\n\/\* \[wrapped with (.+)\] \*/, reSplitDetails = /,? & /; var reAsciiWord = /[^\x00-\x2f\x3a-\x40\x5b-\x60\x7b-\x7f]+/g; var reEscapeChar = /\\(\\)?/g; var reEsTemplate = /\$\{([^\\}]*(?:\\.[^\\}]*)*)\}/g; var reFlags = /\w*$/; var reIsBadHex = /^[-+]0x[0-9a-f]+$/i; var reIsBinary = /^0b[01]+$/i; var reIsHostCtor = /^\[object .+?Constructor\]$/; var reIsOctal = /^0o[0-7]+$/i; var reIsUint = /^(?:0|[1-9]\d*)$/; var reLatin = /[\xc0-\xd6\xd8-\xf6\xf8-\xff\u0100-\u017f]/g; var reNoMatch = /($^)/; var reUnescapedString = /['\n\r\u2028\u2029\\]/g; var rsAstralRange = '\\ud800-\\udfff', rsComboMarksRange = '\\u0300-\\u036f', reComboHalfMarksRange = '\\ufe20-\\ufe2f', rsComboSymbolsRange = '\\u20d0-\\u20ff', rsComboRange = rsComboMarksRange + reComboHalfMarksRange + rsComboSymbolsRange, rsDingbatRange = '\\u2700-\\u27bf', rsLowerRange = 'a-z\\xdf-\\xf6\\xf8-\\xff', rsMathOpRange = '\\xac\\xb1\\xd7\\xf7', rsNonCharRange = '\\x00-\\x2f\\x3a-\\x40\\x5b-\\x60\\x7b-\\xbf', rsPunctuationRange = '\\u2000-\\u206f', rsSpaceRange = ' \\t\\x0b\\f\\xa0\\ufeff\\n\\r\\u2028\\u2029\\u1680\\u180e\\u2000\\u2001\\u2002\\u2003\\u2004\\u2005\\u2006\\u2007\\u2008\\u2009\\u200a\\u202f\\u205f\\u3000', rsUpperRange = 'A-Z\\xc0-\\xd6\\xd8-\\xde', rsVarRange = '\\ufe0e\\ufe0f', rsBreakRange = rsMathOpRange + rsNonCharRange + rsPunctuationRange + rsSpaceRange; var rsApos = "['\u2019]", rsAstral = '[' + rsAstralRange + ']', rsBreak = '[' + rsBreakRange + ']', rsCombo = '[' + rsComboRange + ']', rsDigits = '\\d+', rsDingbat = '[' + rsDingbatRange + ']', rsLower = '[' + rsLowerRange + ']', rsMisc = '[^' + rsAstralRange + rsBreakRange + rsDigits + rsDingbatRange + rsLowerRange + rsUpperRange + ']', rsFitz = '\\ud83c[\\udffb-\\udfff]', rsModifier = '(?:' + rsCombo + '|' + rsFitz + ')', rsNonAstral = '[^' + rsAstralRange + ']', rsRegional = '(?:\\ud83c[\\udde6-\\uddff]){2}', rsSurrPair = '[\\ud800-\\udbff][\\udc00-\\udfff]', rsUpper = '[' + rsUpperRange + ']', rsZWJ = '\\u200d'; var rsMiscLower = '(?:' + rsLower + '|' + rsMisc + ')', rsMiscUpper = '(?:' + rsUpper + '|' + rsMisc + ')', rsOptContrLower = '(?:' + rsApos + '(?:d|ll|m|re|s|t|ve))?', rsOptContrUpper = '(?:' + rsApos + '(?:D|LL|M|RE|S|T|VE))?', reOptMod = rsModifier + '?', rsOptVar = '[' + rsVarRange + ']?', rsOptJoin = '(?:' + rsZWJ + '(?:' + [rsNonAstral, rsRegional, rsSurrPair].join('|') + ')' + rsOptVar + reOptMod + ')*', rsOrdLower = '\\d*(?:1st|2nd|3rd|(?![123])\\dth)(?=\\b|[A-Z_])', rsOrdUpper = '\\d*(?:1ST|2ND|3RD|(?![123])\\dTH)(?=\\b|[a-z_])', rsSeq = rsOptVar + reOptMod + rsOptJoin, rsEmoji = '(?:' + [rsDingbat, rsRegional, rsSurrPair].join('|') + ')' + rsSeq, rsSymbol = '(?:' + [rsNonAstral + rsCombo + '?', rsCombo, rsRegional, rsSurrPair, rsAstral].join('|') + ')'; var reApos = RegExp(rsApos, 'g'); var reComboMark = RegExp(rsCombo, 'g'); var reUnicode = RegExp(rsFitz + '(?=' + rsFitz + ')|' + rsSymbol + rsSeq, 'g'); var reUnicodeWord = RegExp([ rsUpper + '?' + rsLower + '+' + rsOptContrLower + '(?=' + [rsBreak, rsUpper, '$'].join('|') + ')', rsMiscUpper + '+' + rsOptContrUpper + '(?=' + [rsBreak, rsUpper + rsMiscLower, '$'].join('|') + ')', rsUpper + '?' + rsMiscLower + '+' + rsOptContrLower, rsUpper + '+' + rsOptContrUpper, rsOrdUpper, rsOrdLower, rsDigits, rsEmoji ].join('|'), 'g'); var reHasUnicode = RegExp('[' + rsZWJ + rsAstralRange + rsComboRange + rsVarRange + ']'); var reHasUnicodeWord = /[a-z][A-Z]|[A-Z]{2}[a-z]|[0-9][a-zA-Z]|[a-zA-Z][0-9]|[^a-zA-Z0-9 ]/; var contextProps = [ 'Array', 'Buffer', 'DataView', 'Date', 'Error', 'Float32Array', 'Float64Array', 'Function', 'Int8Array', 'Int16Array', 'Int32Array', 'Map', 'Math', 'Object', 'Promise', 'RegExp', 'Set', 'String', 'Symbol', 'TypeError', 'Uint8Array', 'Uint8ClampedArray', 'Uint16Array', 'Uint32Array', 'WeakMap', '_', 'clearTimeout', 'isFinite', 'parseInt', 'setTimeout' ]; var templateCounter = -1; var typedArrayTags = {}; typedArrayTags[float32Tag] = typedArrayTags[float64Tag] = typedArrayTags[int8Tag] = typedArrayTags[int16Tag] = typedArrayTags[int32Tag] = typedArrayTags[uint8Tag] = typedArrayTags[uint8ClampedTag] = typedArrayTags[uint16Tag] = typedArrayTags[uint32Tag] = true; typedArrayTags[argsTag] = typedArrayTags[arrayTag] = typedArrayTags[arrayBufferTag] = typedArrayTags[boolTag] = typedArrayTags[dataViewTag] = typedArrayTags[dateTag] = typedArrayTags[errorTag] = typedArrayTags[funcTag] = typedArrayTags[mapTag] = typedArrayTags[numberTag] = typedArrayTags[objectTag] = typedArrayTags[regexpTag] = typedArrayTags[setTag] = typedArrayTags[stringTag] = typedArrayTags[weakMapTag] = false; var cloneableTags = {}; cloneableTags[argsTag] = cloneableTags[arrayTag] = cloneableTags[arrayBufferTag] = cloneableTags[dataViewTag] = cloneableTags[boolTag] = cloneableTags[dateTag] = cloneableTags[float32Tag] = cloneableTags[float64Tag] = cloneableTags[int8Tag] = cloneableTags[int16Tag] = cloneableTags[int32Tag] = cloneableTags[mapTag] = cloneableTags[numberTag] = cloneableTags[objectTag] = cloneableTags[regexpTag] = cloneableTags[setTag] = cloneableTags[stringTag] = cloneableTags[symbolTag] = cloneableTags[uint8Tag] = cloneableTags[uint8ClampedTag] = cloneableTags[uint16Tag] = cloneableTags[uint32Tag] = true; cloneableTags[errorTag] = cloneableTags[funcTag] = cloneableTags[weakMapTag] = false; var deburredLetters = { '\xc0': 'A', '\xc1': 'A', '\xc2': 'A', '\xc3': 'A', '\xc4': 'A', '\xc5': 'A', '\xe0': 'a', '\xe1': 'a', '\xe2': 'a', '\xe3': 'a', '\xe4': 'a', '\xe5': 'a', '\xc7': 'C', '\xe7': 'c', '\xd0': 'D', '\xf0': 'd', '\xc8': 'E', '\xc9': 'E', '\xca': 'E', '\xcb': 'E', '\xe8': 'e', '\xe9': 'e', '\xea': 'e', '\xeb': 'e', '\xcc': 'I', '\xcd': 'I', '\xce': 'I', '\xcf': 'I', '\xec': 'i', '\xed': 'i', '\xee': 'i', '\xef': 'i', '\xd1': 'N', '\xf1': 'n', '\xd2': 'O', '\xd3': 'O', '\xd4': 'O', '\xd5': 'O', '\xd6': 'O', '\xd8': 'O', '\xf2': 'o', '\xf3': 'o', '\xf4': 'o', '\xf5': 'o', '\xf6': 'o', '\xf8': 'o', '\xd9': 'U', '\xda': 'U', '\xdb': 'U', '\xdc': 'U', '\xf9': 'u', '\xfa': 'u', '\xfb': 'u', '\xfc': 'u', '\xdd': 'Y', '\xfd': 'y', '\xff': 'y', '\xc6': 'Ae', '\xe6': 'ae', '\xde': 'Th', '\xfe': 'th', '\xdf': 'ss', '\u0100': 'A', '\u0102': 'A', '\u0104': 'A', '\u0101': 'a', '\u0103': 'a', '\u0105': 'a', '\u0106': 'C', '\u0108': 'C', '\u010a': 'C', '\u010c': 'C', '\u0107': 'c', '\u0109': 'c', '\u010b': 'c', '\u010d': 'c', '\u010e': 'D', '\u0110': 'D', '\u010f': 'd', '\u0111': 'd', '\u0112': 'E', '\u0114': 'E', '\u0116': 'E', '\u0118': 'E', '\u011a': 'E', '\u0113': 'e', '\u0115': 'e', '\u0117': 'e', '\u0119': 'e', '\u011b': 'e', '\u011c': 'G', '\u011e': 'G', '\u0120': 'G', '\u0122': 'G', '\u011d': 'g', '\u011f': 'g', '\u0121': 'g', '\u0123': 'g', '\u0124': 'H', '\u0126': 'H', '\u0125': 'h', '\u0127': 'h', '\u0128': 'I', '\u012a': 'I', '\u012c': 'I', '\u012e': 'I', '\u0130': 'I', '\u0129': 'i', '\u012b': 'i', '\u012d': 'i', '\u012f': 'i', '\u0131': 'i', '\u0134': 'J', '\u0135': 'j', '\u0136': 'K', '\u0137': 'k', '\u0138': 'k', '\u0139': 'L', '\u013b': 'L', '\u013d': 'L', '\u013f': 'L', '\u0141': 'L', '\u013a': 'l', '\u013c': 'l', '\u013e': 'l', '\u0140': 'l', '\u0142': 'l', '\u0143': 'N', '\u0145': 'N', '\u0147': 'N', '\u014a': 'N', '\u0144': 'n', '\u0146': 'n', '\u0148': 'n', '\u014b': 'n', '\u014c': 'O', '\u014e': 'O', '\u0150': 'O', '\u014d': 'o', '\u014f': 'o', '\u0151': 'o', '\u0154': 'R', '\u0156': 'R', '\u0158': 'R', '\u0155': 'r', '\u0157': 'r', '\u0159': 'r', '\u015a': 'S', '\u015c': 'S', '\u015e': 'S', '\u0160': 'S', '\u015b': 's', '\u015d': 's', '\u015f': 's', '\u0161': 's', '\u0162': 'T', '\u0164': 'T', '\u0166': 'T', '\u0163': 't', '\u0165': 't', '\u0167': 't', '\u0168': 'U', '\u016a': 'U', '\u016c': 'U', '\u016e': 'U', '\u0170': 'U', '\u0172': 'U', '\u0169': 'u', '\u016b': 'u', '\u016d': 'u', '\u016f': 'u', '\u0171': 'u', '\u0173': 'u', '\u0174': 'W', '\u0175': 'w', '\u0176': 'Y', '\u0177': 'y', '\u0178': 'Y', '\u0179': 'Z', '\u017b': 'Z', '\u017d': 'Z', '\u017a': 'z', '\u017c': 'z', '\u017e': 'z', '\u0132': 'IJ', '\u0133': 'ij', '\u0152': 'Oe', '\u0153': 'oe', '\u0149': "'n", '\u017f': 's' }; var htmlEscapes = { '&': '&', '<': '<', '>': '>', '"': '"', "'": ''' }; var htmlUnescapes = { '&': '&', '<': '<', '>': '>', '"': '"', ''': "'" }; var stringEscapes = { '\\': '\\', "'": "'", '\n': 'n', '\r': 'r', '\u2028': 'u2028', '\u2029': 'u2029' }; var freeParseFloat = parseFloat, freeParseInt = parseInt; var freeGlobal = typeof global == 'object' && global && global.Object === Object && global; var freeSelf = typeof self == 'object' && self && self.Object === Object && self; var root = freeGlobal || freeSelf || Function('return this')(); var freeExports = typeof exports == 'object' && exports && !exports.nodeType && exports; var freeModule = freeExports && typeof module == 'object' && module && !module.nodeType && module; var moduleExports = freeModule && freeModule.exports === freeExports; var freeProcess = moduleExports && freeGlobal.process; var nodeUtil = (function () { try { var types = freeModule && freeModule.require && freeModule.require('util').types; if (types) { return types; } return freeProcess && freeProcess.binding && freeProcess.binding('util'); } catch (e) { } }()); var nodeIsArrayBuffer = nodeUtil && nodeUtil.isArrayBuffer, nodeIsDate = nodeUtil && nodeUtil.isDate, nodeIsMap = nodeUtil && nodeUtil.isMap, nodeIsRegExp = nodeUtil && nodeUtil.isRegExp, nodeIsSet = nodeUtil && nodeUtil.isSet, nodeIsTypedArray = nodeUtil && nodeUtil.isTypedArray; function apply(func, thisArg, args) { switch (args.length) { case 0: return func.call(thisArg); case 1: return func.call(thisArg, args[0]); case 2: return func.call(thisArg, args[0], args[1]); case 3: return func.call(thisArg, args[0], args[1], args[2]); } return func.apply(thisArg, args); } function arrayAggregator(array, setter, iteratee, accumulator) { var index = -1, length = array == null ? 0 : array.length; while (++index < length) { var value = array[index]; setter(accumulator, value, iteratee(value), array); } return accumulator; } function arrayEach(array, iteratee) { var index = -1, length = array == null ? 0 : array.length; while (++index < length) { if (iteratee(array[index], index, array) === false) { break; } } return array; } function arrayEachRight(array, iteratee) { var length = array == null ? 0 : array.length; while (length--) { if (iteratee(array[length], length, array) === false) { break; } } return array; } function arrayEvery(array, predicate) { var index = -1, length = array == null ? 0 : array.length; while (++index < length) { if (!predicate(array[index], index, array)) { return false; } } return true; } function arrayFilter(array, predicate) { var index = -1, length = array == null ? 0 : array.length, resIndex = 0, result = []; while (++index < length) { var value = array[index]; if (predicate(value, index, array)) { result[resIndex++] = value; } } return result; } function arrayIncludes(array, value) { var length = array == null ? 0 : array.length; return !!length && baseIndexOf(array, value, 0) > -1; } function arrayIncludesWith(array, value, comparator) { var index = -1, length = array == null ? 0 : array.length; while (++index < length) { if (comparator(value, array[index])) { return true; } } return false; } function arrayMap(array, iteratee) { var index = -1, length = array == null ? 0 : array.length, result = Array(length); while (++index < length) { result[index] = iteratee(array[index], index, array); } return result; } function arrayPush(array, values) { var index = -1, length = values.length, offset = array.length; while (++index < length) { array[offset + index] = values[index]; } return array; } function arrayReduce(array, iteratee, accumulator, initAccum) { var index = -1, length = array == null ? 0 : array.length; if (initAccum && length) { accumulator = array[++index]; } while (++index < length) { accumulator = iteratee(accumulator, array[index], index, array); } return accumulator; } function arrayReduceRight(array, iteratee, accumulator, initAccum) { var length = array == null ? 0 : array.length; if (initAccum && length) { accumulator = array[--length]; } while (length--) { accumulator = iteratee(accumulator, array[length], length, array); } return accumulator; } function arraySome(array, predicate) { var index = -1, length = array == null ? 0 : array.length; while (++index < length) { if (predicate(array[index], index, array)) { return true; } } return false; } var asciiSize = baseProperty('length'); function asciiToArray(string) { return string.split(); } function asciiWords(string) { return string.match(reAsciiWord) || []; } function baseFindKey(collection, predicate, eachFunc) { var result; eachFunc(collection, function (value, key, collection) { if (predicate(value, key, collection)) { result = key; return false; } }); return result; } function baseFindIndex(array, predicate, fromIndex, fromRight) { var length = array.length, index = fromIndex + (fromRight ? 1 : -1); while ((fromRight ? index-- : ++index < length)) { if (predicate(array[index], index, array)) { return index; } } return -1; } function baseIndexOf(array, value, fromIndex) { return value === value ? strictIndexOf(array, value, fromIndex) : baseFindIndex(array, baseIsNaN, fromIndex); } function baseIndexOfWith(array, value, fromIndex, comparator) { var index = fromIndex - 1, length = array.length; while (++index < length) { if (comparator(array[index], value)) { return index; } } return -1; } function baseIsNaN(value) { return value !== value; } function baseMean(array, iteratee) { var length = array == null ? 0 : array.length; return length ? (baseSum(array, iteratee) / length) : NAN; } function baseProperty(key) { return function (object) { return object == null ? undefined : object[key]; }; } function basePropertyOf(object) { return function (key) { return object == null ? undefined : object[key]; }; } function baseReduce(collection, iteratee, accumulator, initAccum, eachFunc) { eachFunc(collection, function (value, index, collection) { accumulator = initAccum ? (initAccum = false, value) : iteratee(accumulator, value, index, collection); }); return accumulator; } function baseSortBy(array, comparer) { var length = array.length; array.sort(comparer); while (length--) { array[length] = array[length].value; } return array; } function baseSum(array, iteratee) { var result, index = -1, length = array.length; while (++index < length) { var current = iteratee(array[index]); if (current !== undefined) { result = result === undefined ? current : (result + current); } } return result; } function baseTimes(n, iteratee) { var index = -1, result = Array(n); while (++index < n) { result[index] = iteratee(index); } return result; } function baseToPairs(object, props) { return arrayMap(props, function (key) { return [key, object[key]]; }); } function baseUnary(func) { return function (value) { return func(value); }; } function baseValues(object, props) { return arrayMap(props, function (key) { return object[key]; }); } function cacheHas(cache, key) { return cache.has(key); } function charsStartIndex(strSymbols, chrSymbols) { var index = -1, length = strSymbols.length; while (++index < length && baseIndexOf(chrSymbols, strSymbols[index], 0) > -1) { } return index; } function charsEndIndex(strSymbols, chrSymbols) { var index = strSymbols.length; while (index-- && baseIndexOf(chrSymbols, strSymbols[index], 0) > -1) { } return index; } function countHolders(array, placeholder) { var length = array.length, result = 0; while (length--) { if (array[length] === placeholder) { ++result; } } return result; } var deburrLetter = basePropertyOf(deburredLetters); var escapeHtmlChar = basePropertyOf(htmlEscapes); function escapeStringChar(chr) { return '\\' + stringEscapes[chr]; } function getValue(object, key) { return object == null ? undefined : object[key]; } function hasUnicode(string) { return reHasUnicode.test(string); } function hasUnicodeWord(string) { return reHasUnicodeWord.test(string); } function iteratorToArray(iterator) { var data, result = []; while (!(data = iterator.next()).done) { result.push(data.value); } return result; } function mapToArray(map) { var index = -1, result = Array(map.size); map.forEach(function (value, key) { result[++index] = [key, value]; }); return result; } function overArg(func, transform) { return function (arg) { return func(transform(arg)); }; } function replaceHolders(array, placeholder) { var index = -1, length = array.length, resIndex = 0, result = []; while (++index < length) { var value = array[index]; if (value === placeholder || value === PLACEHOLDER) { array[index] = PLACEHOLDER; result[resIndex++] = index; } } return result; } function setToArray(set) { var index = -1, result = Array(set.size); set.forEach(function (value) { result[++index] = value; }); return result; } function setToPairs(set) { var index = -1, result = Array(set.size); set.forEach(function (value) { result[++index] = [value, value]; }); return result; } function strictIndexOf(array, value, fromIndex) { var index = fromIndex - 1, length = array.length; while (++index < length) { if (array[index] === value) { return index; } } return -1; } function strictLastIndexOf(array, value, fromIndex) { var index = fromIndex + 1; while (index--) { if (array[index] === value) { return index; } } return index; } function stringSize(string) { return hasUnicode(string) ? unicodeSize(string) : asciiSize(string); } function stringToArray(string) { return hasUnicode(string) ? unicodeToArray(string) : asciiToArray(string); } var unescapeHtmlChar = basePropertyOf(htmlUnescapes); function unicodeSize(string) { var result = reUnicode.lastIndex = 0; while (reUnicode.test(string)) { ++result; } return result; } function unicodeToArray(string) { return string.match(reUnicode) || []; } function unicodeWords(string) { return string.match(reUnicodeWord) || []; } var runInContext = (function runInContext(context) { context = context == null ? root : _.defaults(root.Object(), context, _.pick(root, contextProps)); var Array = context.Array, Date = context.Date, Error = context.Error, Function = context.Function, Math = context.Math, Object = context.Object, RegExp = context.RegExp, String = context.String, TypeError = context.TypeError; var arrayProto = Array.prototype, funcProto = Function.prototype, objectProto = Object.prototype; var coreJsData = context['__core-js_shared__']; var funcToString = funcProto.toString; var hasOwnProperty = objectProto.hasOwnProperty; var idCounter = 0; var maskSrcKey = (function () { var uid = /[^.]+$/.exec(coreJsData && coreJsData.keys && coreJsData.keys.IE_PROTO || ); return uid ? ('Symbol(src)_1.' + uid) : ; }()); var nativeObjectToString = objectProto.toString; var objectCtorString = funcToString.call(Object); var oldDash = root._; var reIsNative = RegExp('^' + funcToString.call(hasOwnProperty).replace(reRegExpChar, '\\$&') .replace(/hasOwnProperty|(function).*?(?=\\\()| for .+?(?=\\\])/g, '$1.*?') + '$'); var Buffer = moduleExports ? context.Buffer : undefined, Symbol = context.Symbol, Uint8Array = context.Uint8Array, allocUnsafe = Buffer ? Buffer.allocUnsafe : undefined, getPrototype = overArg(Object.getPrototypeOf, Object), objectCreate = Object.create, propertyIsEnumerable = objectProto.propertyIsEnumerable, splice = arrayProto.splice, spreadableSymbol = Symbol ? Symbol.isConcatSpreadable : undefined, symIterator = Symbol ? Symbol.iterator : undefined, symToStringTag = Symbol ? Symbol.toStringTag : undefined; var defineProperty = (function () { try { var func = getNative(Object, 'defineProperty'); func({}, , {}); return func; } catch (e) { } }()); var ctxClearTimeout = context.clearTimeout !== root.clearTimeout && context.clearTimeout, ctxNow = Date && Date.now !== root.Date.now && Date.now, ctxSetTimeout = context.setTimeout !== root.setTimeout && context.setTimeout; var nativeCeil = Math.ceil, nativeFloor = Math.floor, nativeGetSymbols = Object.getOwnPropertySymbols, nativeIsBuffer = Buffer ? Buffer.isBuffer : undefined, nativeIsFinite = context.isFinite, nativeJoin = arrayProto.join, nativeKeys = overArg(Object.keys, Object), nativeMax = Math.max, nativeMin = Math.min, nativeNow = Date.now, nativeParseInt = context.parseInt, nativeRandom = Math.random, nativeReverse = arrayProto.reverse; var DataView = getNative(context, 'DataView'), Map = getNative(context, 'Map'), Promise = getNative(context, 'Promise'), Set = getNative(context, 'Set'), WeakMap = getNative(context, 'WeakMap'), nativeCreate = getNative(Object, 'create'); var metaMap = WeakMap && new WeakMap; var realNames = {}; var dataViewCtorString = toSource(DataView), mapCtorString = toSource(Map), promiseCtorString = toSource(Promise), setCtorString = toSource(Set), weakMapCtorString = toSource(WeakMap); var symbolProto = Symbol ? Symbol.prototype : undefined, symbolValueOf = symbolProto ? symbolProto.valueOf : undefined, symbolToString = symbolProto ? symbolProto.toString : undefined; function lodash(value) { if (isObjectLike(value) && !isArray(value) && !(value instanceof LazyWrapper)) { if (value instanceof LodashWrapper) { return value; } if (hasOwnProperty.call(value, '__wrapped__')) { return wrapperClone(value); } } return new LodashWrapper(value); } var baseCreate = (function () { function object() { } return function (proto) { if (!isObject(proto)) { return {}; } if (objectCreate) { return objectCreate(proto); } object.prototype = proto; var result = new object; object.prototype = undefined; return result; }; }()); function baseLodash() { } function LodashWrapper(value, chainAll) { this.__wrapped__ = value; this.__actions__ = []; this.__chain__ = !!chainAll; this.__index__ = 0; this.__values__ = undefined; } lodash.templateSettings = { 'escape': reEscape, 'evaluate': reEvaluate, 'interpolate': reInterpolate, 'variable': , 'imports': { '_': lodash } }; lodash.prototype = baseLodash.prototype; lodash.prototype.constructor = lodash; LodashWrapper.prototype = baseCreate(baseLodash.prototype); LodashWrapper.prototype.constructor = LodashWrapper; function LazyWrapper(value) { this.__wrapped__ = value; this.__actions__ = []; this.__dir__ = 1; this.__filtered__ = false; this.__iteratees__ = []; this.__takeCount__ = MAX_ARRAY_LENGTH; this.__views__ = []; } function lazyClone() { var result = new LazyWrapper(this.__wrapped__); result.__actions__ = copyArray(this.__actions__); result.__dir__ = this.__dir__; result.__filtered__ = this.__filtered__; result.__iteratees__ = copyArray(this.__iteratees__); result.__takeCount__ = this.__takeCount__; result.__views__ = copyArray(this.__views__); return result; } function lazyReverse() { if (this.__filtered__) { var result = new LazyWrapper(this); result.__dir__ = -1; result.__filtered__ = true; } else { result = this.clone(); result.__dir__ *= -1; } return result; } function lazyValue() { var array = this.__wrapped__.value(), dir = this.__dir__, isArr = isArray(array), isRight = dir < 0, arrLength = isArr ? array.length : 0, view = getView(0, arrLength, this.__views__), start = view.start, end = view.end, length = end - start, index = isRight ? end : (start - 1), iteratees = this.__iteratees__, iterLength = iteratees.length, resIndex = 0, takeCount = nativeMin(length, this.__takeCount__); if (!isArr || (!isRight && arrLength == length && takeCount == length)) { return baseWrapperValue(array, this.__actions__); } var result = []; outer: while (length-- && resIndex < takeCount) { index += dir; var iterIndex = -1, value = array[index]; while (++iterIndex < iterLength) { var data = iteratees[iterIndex], iteratee = data.iteratee, type = data.type, computed = iteratee(value); if (type == LAZY_MAP_FLAG) { value = computed; } else if (!computed) { if (type == LAZY_FILTER_FLAG) { continue outer; } else { break outer; } } } result[resIndex++] = value; } return result; } LazyWrapper.prototype = baseCreate(baseLodash.prototype); LazyWrapper.prototype.constructor = LazyWrapper; function Hash(entries) { var index = -1, length = entries == null ? 0 : entries.length; this.clear(); while (++index < length) { var entry = entries[index]; this.set(entry[0], entry[1]); } } function hashClear() { this.__data__ = nativeCreate ? nativeCreate(null) : {}; this.size = 0; } function hashDelete(key) { var result = this.has(key) && delete this.__data__[key]; this.size -= result ? 1 : 0; return result; } function hashGet(key) { var data = this.__data__; if (nativeCreate) { var result = data[key]; return result === HASH_UNDEFINED ? undefined : result; } return hasOwnProperty.call(data, key) ? data[key] : undefined; } function hashHas(key) { var data = this.__data__; return nativeCreate ? (data[key] !== undefined) : hasOwnProperty.call(data, key); } function hashSet(key, value) { var data = this.__data__; this.size += this.has(key) ? 0 : 1; data[key] = (nativeCreate && value === undefined) ? HASH_UNDEFINED : value; return this; } Hash.prototype.clear = hashClear; Hash.prototype['delete'] = hashDelete; Hash.prototype.get = hashGet; Hash.prototype.has = hashHas; Hash.prototype.set = hashSet; function ListCache(entries) { var index = -1, length = entries == null ? 0 : entries.length; this.clear(); while (++index < length) { var entry = entries[index]; this.set(entry[0], entry[1]); } } function listCacheClear() { this.__data__ = []; this.size = 0; } function listCacheDelete(key) { var data = this.__data__, index = assocIndexOf(data, key); if (index < 0) { return false; } var lastIndex = data.length - 1; if (index == lastIndex) { data.pop(); } else { splice.call(data, index, 1); } --this.size; return true; } function listCacheGet(key) { var data = this.__data__, index = assocIndexOf(data, key); return index < 0 ? undefined : data[index][1]; } function listCacheHas(key) { return assocIndexOf(this.__data__, key) > -1; } function listCacheSet(key, value) { var data = this.__data__, index = assocIndexOf(data, key); if (index < 0) { ++this.size; data.push([key, value]); } else { data[index][1] = value; } return this; } ListCache.prototype.clear = listCacheClear; ListCache.prototype['delete'] = listCacheDelete; ListCache.prototype.get = listCacheGet; ListCache.prototype.has = listCacheHas; ListCache.prototype.set = listCacheSet; function MapCache(entries) { var index = -1, length = entries == null ? 0 : entries.length; this.clear(); while (++index < length) { var entry = entries[index]; this.set(entry[0], entry[1]); } } function mapCacheClear() { this.size = 0; this.__data__ = { 'hash': new Hash, 'map': new (Map || ListCache), 'string': new Hash }; } function mapCacheDelete(key) { var result = getMapData(this, key)['delete'](key); this.size -= result ? 1 : 0; return result; } function mapCacheGet(key) { return getMapData(this, key).get(key); } function mapCacheHas(key) { return getMapData(this, key).has(key); } function mapCacheSet(key, value) { var data = getMapData(this, key), size = data.size; data.set(key, value); this.size += data.size == size ? 0 : 1; return this; } MapCache.prototype.clear = mapCacheClear; MapCache.prototype['delete'] = mapCacheDelete; MapCache.prototype.get = mapCacheGet; MapCache.prototype.has = mapCacheHas; MapCache.prototype.set = mapCacheSet; function SetCache(values) { var index = -1, length = values == null ? 0 : values.length; this.__data__ = new MapCache; while (++index < length) { this.add(values[index]); } } function setCacheAdd(value) { this.__data__.set(value, HASH_UNDEFINED); return this; } function setCacheHas(value) { return this.__data__.has(value); } SetCache.prototype.add = SetCache.prototype.push = setCacheAdd; SetCache.prototype.has = setCacheHas; function Stack(entries) { var data = this.__data__ = new ListCache(entries); this.size = data.size; } function stackClear() { this.__data__ = new ListCache; this.size = 0; } function stackDelete(key) { var data = this.__data__, result = data['delete'](key); this.size = data.size; return result; } function stackGet(key) { return this.__data__.get(key); } function stackHas(key) { return this.__data__.has(key); } function stackSet(key, value) { var data = this.__data__; if (data instanceof ListCache) { var pairs = data.__data__; if (!Map || (pairs.length < LARGE_ARRAY_SIZE - 1)) { pairs.push([key, value]); this.size = ++data.size; return this; } data = this.__data__ = new MapCache(pairs); } data.set(key, value); this.size = data.size; return this; } Stack.prototype.clear = stackClear; Stack.prototype['delete'] = stackDelete; Stack.prototype.get = stackGet; Stack.prototype.has = stackHas; Stack.prototype.set = stackSet; function arrayLikeKeys(value, inherited) { var isArr = isArray(value), isArg = !isArr && isArguments(value), isBuff = !isArr && !isArg && isBuffer(value), isType = !isArr && !isArg && !isBuff && isTypedArray(value), skipIndexes = isArr || isArg || isBuff || isType, result = skipIndexes ? baseTimes(value.length, String) : [], length = result.length; for (var key in value) { if ((inherited || hasOwnProperty.call(value, key)) && !(skipIndexes && (key == 'length' || (isBuff && (key == 'offset' || key == 'parent')) || (isType && (key == 'buffer' || key == 'byteLength' || key == 'byteOffset')) || isIndex(key, length)))) { result.push(key); } } return result; } function arraySample(array) { var length = array.length; return length ? array[baseRandom(0, length - 1)] : undefined; } function arraySampleSize(array, n) { return shuffleSelf(copyArray(array), baseClamp(n, 0, array.length)); } function arrayShuffle(array) { return shuffleSelf(copyArray(array)); } function assignMergeValue(object, key, value) { if ((value !== undefined && !eq(object[key], value)) || (value === undefined && !(key in object))) { baseAssignValue(object, key, value); } } function assignValue(object, key, value) { var objValue = object[key]; if (!(hasOwnProperty.call(object, key) && eq(objValue, value)) || (value === undefined && !(key in object))) { baseAssignValue(object, key, value); } } function assocIndexOf(array, key) { var length = array.length; while (length--) { if (eq(array[length][0], key)) { return length; } } return -1; } function baseAggregator(collection, setter, iteratee, accumulator) { baseEach(collection, function (value, key, collection) { setter(accumulator, value, iteratee(value), collection); }); return accumulator; } function baseAssign(object, source) { return object && copyObject(source, keys(source), object); } function baseAssignIn(object, source) { return object && copyObject(source, keysIn(source), object); } function baseAssignValue(object, key, value) { if (key == '__proto__' && defineProperty) { defineProperty(object, key, { 'configurable': true, 'enumerable': true, 'value': value, 'writable': true }); } else { object[key] = value; } } function baseAt(object, paths) { var index = -1, length = paths.length, result = Array(length), skip = object == null; while (++index < length) { result[index] = skip ? undefined : get(object, paths[index]); } return result; } function baseClamp(number, lower, upper) { if (number === number) { if (upper !== undefined) { number = number <= upper ? number : upper; } if (lower !== undefined) { number = number >= lower ? number : lower; } } return number; } function baseClone(value, bitmask, customizer, key, object, stack) { var result, isDeep = bitmask & CLONE_DEEP_FLAG, isFlat = bitmask & CLONE_FLAT_FLAG, isFull = bitmask & CLONE_SYMBOLS_FLAG; if (customizer) { result = object ? customizer(value, key, object, stack) : customizer(value); } if (result !== undefined) { return result; } if (!isObject(value)) { return value; } var isArr = isArray(value); if (isArr) { result = initCloneArray(value); if (!isDeep) { return copyArray(value, result); } } else { var tag = getTag(value), isFunc = tag == funcTag || tag == genTag; if (isBuffer(value)) { return cloneBuffer(value, isDeep); } if (tag == objectTag || tag == argsTag || (isFunc && !object)) { result = (isFlat || isFunc) ? {} : initCloneObject(value); if (!isDeep) { return isFlat ? copySymbolsIn(value, baseAssignIn(result, value)) : copySymbols(value, baseAssign(result, value)); } } else { if (!cloneableTags[tag]) { return object ? value : {}; } result = initCloneByTag(value, tag, isDeep); } } stack || (stack = new Stack); var stacked = stack.get(value); if (stacked) { return stacked; } stack.set(value, result); if (isSet(value)) { value.forEach(function (subValue) { result.add(baseClone(subValue, bitmask, customizer, subValue, value, stack)); }); } else if (isMap(value)) { value.forEach(function (subValue, key) { result.set(key, baseClone(subValue, bitmask, customizer, key, value, stack)); }); } var keysFunc = isFull ? (isFlat ? getAllKeysIn : getAllKeys) : (isFlat ? keysIn : keys); var props = isArr ? undefined : keysFunc(value); arrayEach(props || value, function (subValue, key) { if (props) { key = subValue; subValue = value[key]; } assignValue(result, key, baseClone(subValue, bitmask, customizer, key, value, stack)); }); return result; } function baseConforms(source) { var props = keys(source); return function (object) { return baseConformsTo(object, source, props); }; } function baseConformsTo(object, source, props) { var length = props.length; if (object == null) { return !length; } object = Object(object); while (length--) { var key = props[length], predicate = source[key], value = object[key]; if ((value === undefined && !(key in object)) || !predicate(value)) { return false; } } return true; } function baseDelay(func, wait, args) { if (typeof func != 'function') { throw new TypeError(FUNC_ERROR_TEXT); } return setTimeout(function () { func.apply(undefined, args); }, wait); } function baseDifference(array, values, iteratee, comparator) { var index = -1, includes = arrayIncludes, isCommon = true, length = array.length, result = [], valuesLength = values.length; if (!length) { return result; } if (iteratee) { values = arrayMap(values, baseUnary(iteratee)); } if (comparator) { includes = arrayIncludesWith; isCommon = false; } else if (values.length >= LARGE_ARRAY_SIZE) { includes = cacheHas; isCommon = false; values = new SetCache(values); } outer: while (++index < length) { var value = array[index], computed = iteratee == null ? value : iteratee(value); value = (comparator || value !== 0) ? value : 0; if (isCommon && computed === computed) { var valuesIndex = valuesLength; while (valuesIndex--) { if (values[valuesIndex] === computed) { continue outer; } } result.push(value); } else if (!includes(values, computed, comparator)) { result.push(value); } } return result; } var baseEach = createBaseEach(baseForOwn); var baseEachRight = createBaseEach(baseForOwnRight, true); function baseEvery(collection, predicate) { var result = true; baseEach(collection, function (value, index, collection) { result = !!predicate(value, index, collection); return result; }); return result; } function baseExtremum(array, iteratee, comparator) { var index = -1, length = array.length; while (++index < length) { var value = array[index], current = iteratee(value); if (current != null && (computed === undefined ? (current === current && !isSymbol(current)) : comparator(current, computed))) { var computed = current, result = value; } } return result; } function baseFill(array, value, start, end) { var length = array.length; start = toInteger(start); if (start < 0) { start = -start > length ? 0 : (length + start); } end = (end === undefined || end > length) ? length : toInteger(end); if (end < 0) { end += length; } end = start > end ? 0 : toLength(end); while (start < end) { array[start++] = value; } return array; } function baseFilter(collection, predicate) { var result = []; baseEach(collection, function (value, index, collection) { if (predicate(value, index, collection)) { result.push(value); } }); return result; } function baseFlatten(array, depth, predicate, isStrict, result) { var index = -1, length = array.length; predicate || (predicate = isFlattenable); result || (result = []); while (++index < length) { var value = array[index]; if (depth > 0 && predicate(value)) { if (depth > 1) { baseFlatten(value, depth - 1, predicate, isStrict, result); } else { arrayPush(result, value); } } else if (!isStrict) { result[result.length] = value; } } return result; } var baseFor = createBaseFor(); var baseForRight = createBaseFor(true); function baseForOwn(object, iteratee) { return object && baseFor(object, iteratee, keys); } function baseForOwnRight(object, iteratee) { return object && baseForRight(object, iteratee, keys); } function baseFunctions(object, props) { return arrayFilter(props, function (key) { return isFunction(object[key]); }); } function baseGet(object, path) { path = castPath(path, object); var index = 0, length = path.length; while (object != null && index < length) { object = object[toKey(path[index++])]; } return (index && index == length) ? object : undefined; } function baseGetAllKeys(object, keysFunc, symbolsFunc) { var result = keysFunc(object); return isArray(object) ? result : arrayPush(result, symbolsFunc(object)); } function baseGetTag(value) { if (value == null) { return value === undefined ? undefinedTag : nullTag; } return (symToStringTag && symToStringTag in Object(value)) ? getRawTag(value) : objectToString(value); } function baseGt(value, other) { return value > other; } function baseHas(object, key) { return object != null && hasOwnProperty.call(object, key); } function baseHasIn(object, key) { return object != null && key in Object(object); } function baseInRange(number, start, end) { return number >= nativeMin(start, end) && number < nativeMax(start, end); } function baseIntersection(arrays, iteratee, comparator) { var includes = comparator ? arrayIncludesWith : arrayIncludes, length = arrays[0].length, othLength = arrays.length, othIndex = othLength, caches = Array(othLength), maxLength = Infinity, result = []; while (othIndex--) { var array = arrays[othIndex]; if (othIndex && iteratee) { array = arrayMap(array, baseUnary(iteratee)); } maxLength = nativeMin(array.length, maxLength); caches[othIndex] = !comparator && (iteratee || (length >= 120 && array.length >= 120)) ? new SetCache(othIndex && array) : undefined; } array = arrays[0]; var index = -1, seen = caches[0]; outer: while (++index < length && result.length < maxLength) { var value = array[index], computed = iteratee ? iteratee(value) : value; value = (comparator || value !== 0) ? value : 0; if (!(seen ? cacheHas(seen, computed) : includes(result, computed, comparator))) { othIndex = othLength; while (--othIndex) { var cache = caches[othIndex]; if (!(cache ? cacheHas(cache, computed) : includes(arrays[othIndex], computed, comparator))) { continue outer; } } if (seen) { seen.push(computed); } result.push(value); } } return result; } function baseInverter(object, setter, iteratee, accumulator) { baseForOwn(object, function (value, key, object) { setter(accumulator, iteratee(value), key, object); }); return accumulator; } function baseInvoke(object, path, args) { path = castPath(path, object); object = parent(object, path); var func = object == null ? object : object[toKey(last(path))]; return func == null ? undefined : apply(func, object, args); } function baseIsArguments(value) { return isObjectLike(value) && baseGetTag(value) == argsTag; } function baseIsArrayBuffer(value) { return isObjectLike(value) && baseGetTag(value) == arrayBufferTag; } function baseIsDate(value) { return isObjectLike(value) && baseGetTag(value) == dateTag; } function baseIsEqual(value, other, bitmask, customizer, stack) { if (value === other) { return true; } if (value == null || other == null || (!isObjectLike(value) && !isObjectLike(other))) { return value !== value && other !== other; } return baseIsEqualDeep(value, other, bitmask, customizer, baseIsEqual, stack); } function baseIsEqualDeep(object, other, bitmask, customizer, equalFunc, stack) { var objIsArr = isArray(object), othIsArr = isArray(other), objTag = objIsArr ? arrayTag : getTag(object), othTag = othIsArr ? arrayTag : getTag(other); objTag = objTag == argsTag ? objectTag : objTag; othTag = othTag == argsTag ? objectTag : othTag; var objIsObj = objTag == objectTag, othIsObj = othTag == objectTag, isSameTag = objTag == othTag; if (isSameTag && isBuffer(object)) { if (!isBuffer(other)) { return false; } objIsArr = true; objIsObj = false; } if (isSameTag && !objIsObj) { stack || (stack = new Stack); return (objIsArr || isTypedArray(object)) ? equalArrays(object, other, bitmask, customizer, equalFunc, stack) : equalByTag(object, other, objTag, bitmask, customizer, equalFunc, stack); } if (!(bitmask & COMPARE_PARTIAL_FLAG)) { var objIsWrapped = objIsObj && hasOwnProperty.call(object, '__wrapped__'), othIsWrapped = othIsObj && hasOwnProperty.call(other, '__wrapped__'); if (objIsWrapped || othIsWrapped) { var objUnwrapped = objIsWrapped ? object.value() : object, othUnwrapped = othIsWrapped ? other.value() : other; stack || (stack = new Stack); return equalFunc(objUnwrapped, othUnwrapped, bitmask, customizer, stack); } } if (!isSameTag) { return false; } stack || (stack = new Stack); return equalObjects(object, other, bitmask, customizer, equalFunc, stack); } function baseIsMap(value) { return isObjectLike(value) && getTag(value) == mapTag; } function baseIsMatch(object, source, matchData, customizer) { var index = matchData.length, length = index, noCustomizer = !customizer; if (object == null) { return !length; } object = Object(object); while (index--) { var data = matchData[index]; if ((noCustomizer && data[2]) ? data[1] !== object[data[0]] : !(data[0] in object)) { return false; } } while (++index < length) { data = matchData[index]; var key = data[0], objValue = object[key], srcValue = data[1]; if (noCustomizer && data[2]) { if (objValue === undefined && !(key in object)) { return false; } } else { var stack = new Stack; if (customizer) { var result = customizer(objValue, srcValue, key, object, source, stack); } if (!(result === undefined ? baseIsEqual(srcValue, objValue, COMPARE_PARTIAL_FLAG | COMPARE_UNORDERED_FLAG, customizer, stack) : result)) { return false; } } } return true; } function baseIsNative(value) { if (!isObject(value) || isMasked(value)) { return false; } var pattern = isFunction(value) ? reIsNative : reIsHostCtor; return pattern.test(toSource(value)); } function baseIsRegExp(value) { return isObjectLike(value) && baseGetTag(value) == regexpTag; } function baseIsSet(value) { return isObjectLike(value) && getTag(value) == setTag; } function baseIsTypedArray(value) { return isObjectLike(value) && isLength(value.length) && !!typedArrayTags[baseGetTag(value)]; } function baseIteratee(value) { if (typeof value == 'function') { return value; } if (value == null) { return identity; } if (typeof value == 'object') { return isArray(value) ? baseMatchesProperty(value[0], value[1]) : baseMatches(value); } return property(value); } function baseKeys(object) { if (!isPrototype(object)) { return nativeKeys(object); } var result = []; for (var key in Object(object)) { if (hasOwnProperty.call(object, key) && key != 'constructor') { result.push(key); } } return result; } function baseKeysIn(object) { if (!isObject(object)) { return nativeKeysIn(object); } var isProto = isPrototype(object), result = []; for (var key in object) { if (!(key == 'constructor' && (isProto || !hasOwnProperty.call(object, key)))) { result.push(key); } } return result; } function baseLt(value, other) { return value < other; } function baseMap(collection, iteratee) { var index = -1, result = isArrayLike(collection) ? Array(collection.length) : []; baseEach(collection, function (value, key, collection) { result[++index] = iteratee(value, key, collection); }); return result; } function baseMatches(source) { var matchData = getMatchData(source); if (matchData.length == 1 && matchData[0][2]) { return matchesStrictComparable(matchData[0][0], matchData[0][1]); } return function (object) { return object === source || baseIsMatch(object, source, matchData); }; } function baseMatchesProperty(path, srcValue) { if (isKey(path) && isStrictComparable(srcValue)) { return matchesStrictComparable(toKey(path), srcValue); } return function (object) { var objValue = get(object, path); return (objValue === undefined && objValue === srcValue) ? hasIn(object, path) : baseIsEqual(srcValue, objValue, COMPARE_PARTIAL_FLAG | COMPARE_UNORDERED_FLAG); }; } function baseMerge(object, source, srcIndex, customizer, stack) { if (object === source) { return; } baseFor(source, function (srcValue, key) { stack || (stack = new Stack); if (isObject(srcValue)) { baseMergeDeep(object, source, key, srcIndex, baseMerge, customizer, stack); } else { var newValue = customizer ? customizer(safeGet(object, key), srcValue, (key + ), object, source, stack) : undefined; if (newValue === undefined) { newValue = srcValue; } assignMergeValue(object, key, newValue); } }, keysIn); } function baseMergeDeep(object, source, key, srcIndex, mergeFunc, customizer, stack) { var objValue = safeGet(object, key), srcValue = safeGet(source, key), stacked = stack.get(srcValue); if (stacked) { assignMergeValue(object, key, stacked); return; } var newValue = customizer ? customizer(objValue, srcValue, (key + ), object, source, stack) : undefined; var isCommon = newValue === undefined; if (isCommon) { var isArr = isArray(srcValue), isBuff = !isArr && isBuffer(srcValue), isTyped = !isArr && !isBuff && isTypedArray(srcValue); newValue = srcValue; if (isArr || isBuff || isTyped) { if (isArray(objValue)) { newValue = objValue; } else if (isArrayLikeObject(objValue)) { newValue = copyArray(objValue); } else if (isBuff) { isCommon = false; newValue = cloneBuffer(srcValue, true); } else if (isTyped) { isCommon = false; newValue = cloneTypedArray(srcValue, true); } else { newValue = []; } } else if (isPlainObject(srcValue) || isArguments(srcValue)) { newValue = objValue; if (isArguments(objValue)) { newValue = toPlainObject(objValue); } else if (!isObject(objValue) || isFunction(objValue)) { newValue = initCloneObject(srcValue); } } else { isCommon = false; } } if (isCommon) { stack.set(srcValue, newValue); mergeFunc(newValue, srcValue, srcIndex, customizer, stack); stack['delete'](srcValue); } assignMergeValue(object, key, newValue); } function baseNth(array, n) { var length = array.length; if (!length) { return; } n += n < 0 ? length : 0; return isIndex(n, length) ? array[n] : undefined; } function baseOrderBy(collection, iteratees, orders) { var index = -1; iteratees = arrayMap(iteratees.length ? iteratees : [identity], baseUnary(getIteratee())); var result = baseMap(collection, function (value, key, collection) { var criteria = arrayMap(iteratees, function (iteratee) { return iteratee(value); }); return { 'criteria': criteria, 'index': ++index, 'value': value }; }); return baseSortBy(result, function (object, other) { return compareMultiple(object, other, orders); }); } function basePick(object, paths) { return basePickBy(object, paths, function (value, path) { return hasIn(object, path); }); } function basePickBy(object, paths, predicate) { var index = -1, length = paths.length, result = {}; while (++index < length) { var path = paths[index], value = baseGet(object, path); if (predicate(value, path)) { baseSet(result, castPath(path, object), value); } } return result; } function basePropertyDeep(path) { return function (object) { return baseGet(object, path); }; } function basePullAll(array, values, iteratee, comparator) { var indexOf = comparator ? baseIndexOfWith : baseIndexOf, index = -1, length = values.length, seen = array; if (array === values) { values = copyArray(values); } if (iteratee) { seen = arrayMap(array, baseUnary(iteratee)); } while (++index < length) { var fromIndex = 0, value = values[index], computed = iteratee ? iteratee(value) : value; while ((fromIndex = indexOf(seen, computed, fromIndex, comparator)) > -1) { if (seen !== array) { splice.call(seen, fromIndex, 1); } splice.call(array, fromIndex, 1); } } return array; } function basePullAt(array, indexes) { var length = array ? indexes.length : 0, lastIndex = length - 1; while (length--) { var index = indexes[length]; if (length == lastIndex || index !== previous) { var previous = index; if (isIndex(index)) { splice.call(array, index, 1); } else { baseUnset(array, index); } } } return array; } function baseRandom(lower, upper) { return lower + nativeFloor(nativeRandom() * (upper - lower + 1)); } function baseRange(start, end, step, fromRight) { var index = -1, length = nativeMax(nativeCeil((end - start) / (step || 1)), 0), result = Array(length); while (length--) { result[fromRight ? length : ++index] = start; start += step; } return result; } function baseRepeat(string, n) { var result = ; if (!string || n < 1 || n > MAX_SAFE_INTEGER) { return result; } do { if (n % 2) { result += string; } n = nativeFloor(n / 2); if (n) { string += string; } } while (n); return result; } function baseRest(func, start) { return setToString(overRest(func, start, identity), func + ); } function baseSample(collection) { return arraySample(values(collection)); } function baseSampleSize(collection, n) { var array = values(collection); return shuffleSelf(array, baseClamp(n, 0, array.length)); } function baseSet(object, path, value, customizer) { if (!isObject(object)) { return object; } path = castPath(path, object); var index = -1, length = path.length, lastIndex = length - 1, nested = object; while (nested != null && ++index < length) { var key = toKey(path[index]), newValue = value; if (index != lastIndex) { var objValue = nested[key]; newValue = customizer ? customizer(objValue, key, nested) : undefined; if (newValue === undefined) { newValue = isObject(objValue) ? objValue : (isIndex(path[index + 1]) ? [] : {}); } } assignValue(nested, key, newValue); nested = nested[key]; } return object; } var baseSetData = !metaMap ? identity : function (func, data) { metaMap.set(func, data); return func; }; var baseSetToString = !defineProperty ? identity : function (func, string) { return defineProperty(func, 'toString', { 'configurable': true, 'enumerable': false, 'value': constant(string), 'writable': true }); }; function baseShuffle(collection) { return shuffleSelf(values(collection)); } function baseSlice(array, start, end) { var index = -1, length = array.length; if (start < 0) { start = -start > length ? 0 : (length + start); } end = end > length ? length : end; if (end < 0) { end += length; } length = start > end ? 0 : ((end - start) >>> 0); start >>>= 0; var result = Array(length); while (++index < length) { result[index] = array[index + start]; } return result; } function baseSome(collection, predicate) { var result; baseEach(collection, function (value, index, collection) { result = predicate(value, index, collection); return !result; }); return !!result; } function baseSortedIndex(array, value, retHighest) { var low = 0, high = array == null ? low : array.length; if (typeof value == 'number' && value === value && high <= HALF_MAX_ARRAY_LENGTH) { while (low < high) { var mid = (low + high) >>> 1, computed = array[mid]; if (computed !== null && !isSymbol(computed) && (retHighest ? (computed <= value) : (computed < value))) { low = mid + 1; } else { high = mid; } } return high; } return baseSortedIndexBy(array, value, identity, retHighest); } function baseSortedIndexBy(array, value, iteratee, retHighest) { value = iteratee(value); var low = 0, high = array == null ? 0 : array.length, valIsNaN = value !== value, valIsNull = value === null, valIsSymbol = isSymbol(value), valIsUndefined = value === undefined; while (low < high) { var mid = nativeFloor((low + high) / 2), computed = iteratee(array[mid]), othIsDefined = computed !== undefined, othIsNull = computed === null, othIsReflexive = computed === computed, othIsSymbol = isSymbol(computed); if (valIsNaN) { var setLow = retHighest || othIsReflexive; } else if (valIsUndefined) { setLow = othIsReflexive && (retHighest || othIsDefined); } else if (valIsNull) { setLow = othIsReflexive && othIsDefined && (retHighest || !othIsNull); } else if (valIsSymbol) { setLow = othIsReflexive && othIsDefined && !othIsNull && (retHighest || !othIsSymbol); } else if (othIsNull || othIsSymbol) { setLow = false; } else { setLow = retHighest ? (computed <= value) : (computed < value); } if (setLow) { low = mid + 1; } else { high = mid; } } return nativeMin(high, MAX_ARRAY_INDEX); } function baseSortedUniq(array, iteratee) { var index = -1, length = array.length, resIndex = 0, result = []; while (++index < length) { var value = array[index], computed = iteratee ? iteratee(value) : value; if (!index || !eq(computed, seen)) { var seen = computed; result[resIndex++] = value === 0 ? 0 : value; } } return result; } function baseToNumber(value) { if (typeof value == 'number') { return value; } if (isSymbol(value)) { return NAN; } return +value; } function baseToString(value) { if (typeof value == 'string') { return value; } if (isArray(value)) { return arrayMap(value, baseToString) + ; } if (isSymbol(value)) { return symbolToString ? symbolToString.call(value) : ; } var result = (value + ); return (result == '0' && (1 / value) == -INFINITY) ? '-0' : result; } function baseUniq(array, iteratee, comparator) { var index = -1, includes = arrayIncludes, length = array.length, isCommon = true, result = [], seen = result; if (comparator) { isCommon = false; includes = arrayIncludesWith; } else if (length >= LARGE_ARRAY_SIZE) { var set = iteratee ? null : createSet(array); if (set) { return setToArray(set); } isCommon = false; includes = cacheHas; seen = new SetCache; } else { seen = iteratee ? [] : result; } outer: while (++index < length) { var value = array[index], computed = iteratee ? iteratee(value) : value; value = (comparator || value !== 0) ? value : 0; if (isCommon && computed === computed) { var seenIndex = seen.length; while (seenIndex--) { if (seen[seenIndex] === computed) { continue outer; } } if (iteratee) { seen.push(computed); } result.push(value); } else if (!includes(seen, computed, comparator)) { if (seen !== result) { seen.push(computed); } result.push(value); } } return result; } function baseUnset(object, path) { path = castPath(path, object); object = parent(object, path); return object == null || delete object[toKey(last(path))]; } function baseUpdate(object, path, updater, customizer) { return baseSet(object, path, updater(baseGet(object, path)), customizer); } function baseWhile(array, predicate, isDrop, fromRight) { var length = array.length, index = fromRight ? length : -1; while ((fromRight ? index-- : ++index < length) && predicate(array[index], index, array)) { } return isDrop ? baseSlice(array, (fromRight ? 0 : index), (fromRight ? index + 1 : length)) : baseSlice(array, (fromRight ? index + 1 : 0), (fromRight ? length : index)); } function baseWrapperValue(value, actions) { var result = value; if (result instanceof LazyWrapper) { result = result.value(); } return arrayReduce(actions, function (result, action) { return action.func.apply(action.thisArg, arrayPush([result], action.args)); }, result); } function baseXor(arrays, iteratee, comparator) { var length = arrays.length; if (length < 2) { return length ? baseUniq(arrays[0]) : []; } var index = -1, result = Array(length); while (++index < length) { var array = arrays[index], othIndex = -1; while (++othIndex < length) { if (othIndex != index) { result[index] = baseDifference(result[index] || array, arrays[othIndex], iteratee, comparator); } } } return baseUniq(baseFlatten(result, 1), iteratee, comparator); } function baseZipObject(props, values, assignFunc) { var index = -1, length = props.length, valsLength = values.length, result = {}; while (++index < length) { var value = index < valsLength ? values[index] : undefined; assignFunc(result, props[index], value); } return result; } function castArrayLikeObject(value) { return isArrayLikeObject(value) ? value : []; } function castFunction(value) { return typeof value == 'function' ? value : identity; } function castPath(value, object) { if (isArray(value)) { return value; } return isKey(value, object) ? [value] : stringToPath(toString(value)); } var castRest = baseRest; function castSlice(array, start, end) { var length = array.length; end = end === undefined ? length : end; return (!start && end >= length) ? array : baseSlice(array, start, end); } var clearTimeout = ctxClearTimeout || function (id) { return root.clearTimeout(id); }; function cloneBuffer(buffer, isDeep) { if (isDeep) { return buffer.slice(); } var length = buffer.length, result = allocUnsafe ? allocUnsafe(length) : new buffer.constructor(length); buffer.copy(result); return result; } function cloneArrayBuffer(arrayBuffer) { var result = new arrayBuffer.constructor(arrayBuffer.byteLength); new Uint8Array(result).set(new Uint8Array(arrayBuffer)); return result; } function cloneDataView(dataView, isDeep) { var buffer = isDeep ? cloneArrayBuffer(dataView.buffer) : dataView.buffer; return new dataView.constructor(buffer, dataView.byteOffset, dataView.byteLength); } function cloneRegExp(regexp) { var result = new regexp.constructor(regexp.source, reFlags.exec(regexp)); result.lastIndex = regexp.lastIndex; return result; } function cloneSymbol(symbol) { return symbolValueOf ? Object(symbolValueOf.call(symbol)) : {}; } function cloneTypedArray(typedArray, isDeep) { var buffer = isDeep ? cloneArrayBuffer(typedArray.buffer) : typedArray.buffer; return new typedArray.constructor(buffer, typedArray.byteOffset, typedArray.length); } function compareAscending(value, other) { if (value !== other) { var valIsDefined = value !== undefined, valIsNull = value === null, valIsReflexive = value === value, valIsSymbol = isSymbol(value); var othIsDefined = other !== undefined, othIsNull = other === null, othIsReflexive = other === other, othIsSymbol = isSymbol(other); if ((!othIsNull && !othIsSymbol && !valIsSymbol && value > other) || (valIsSymbol && othIsDefined && othIsReflexive && !othIsNull && !othIsSymbol) || (valIsNull && othIsDefined && othIsReflexive) || (!valIsDefined && othIsReflexive) || !valIsReflexive) { return 1; } if ((!valIsNull && !valIsSymbol && !othIsSymbol && value < other) || (othIsSymbol && valIsDefined && valIsReflexive && !valIsNull && !valIsSymbol) || (othIsNull && valIsDefined && valIsReflexive) || (!othIsDefined && valIsReflexive) || !othIsReflexive) { return -1; } } return 0; } function compareMultiple(object, other, orders) { var index = -1, objCriteria = object.criteria, othCriteria = other.criteria, length = objCriteria.length, ordersLength = orders.length; while (++index < length) { var result = compareAscending(objCriteria[index], othCriteria[index]); if (result) { if (index >= ordersLength) { return result; } var order = orders[index]; return result * (order == 'desc' ? -1 : 1); } } return object.index - other.index; } function composeArgs(args, partials, holders, isCurried) { var argsIndex = -1, argsLength = args.length, holdersLength = holders.length, leftIndex = -1, leftLength = partials.length, rangeLength = nativeMax(argsLength - holdersLength, 0), result = Array(leftLength + rangeLength), isUncurried = !isCurried; while (++leftIndex < leftLength) { result[leftIndex] = partials[leftIndex]; } while (++argsIndex < holdersLength) { if (isUncurried || argsIndex < argsLength) { result[holders[argsIndex]] = args[argsIndex]; } } while (rangeLength--) { result[leftIndex++] = args[argsIndex++]; } return result; } function composeArgsRight(args, partials, holders, isCurried) { var argsIndex = -1, argsLength = args.length, holdersIndex = -1, holdersLength = holders.length, rightIndex = -1, rightLength = partials.length, rangeLength = nativeMax(argsLength - holdersLength, 0), result = Array(rangeLength + rightLength), isUncurried = !isCurried; while (++argsIndex < rangeLength) { result[argsIndex] = args[argsIndex]; } var offset = argsIndex; while (++rightIndex < rightLength) { result[offset + rightIndex] = partials[rightIndex]; } while (++holdersIndex < holdersLength) { if (isUncurried || argsIndex < argsLength) { result[offset + holders[holdersIndex]] = args[argsIndex++]; } } return result; } function copyArray(source, array) { var index = -1, length = source.length; array || (array = Array(length)); while (++index < length) { array[index] = source[index]; } return array; } function copyObject(source, props, object, customizer) { var isNew = !object; object || (object = {}); var index = -1, length = props.length; while (++index < length) { var key = props[index]; var newValue = customizer ? customizer(object[key], source[key], key, object, source) : undefined; if (newValue === undefined) { newValue = source[key]; } if (isNew) { baseAssignValue(object, key, newValue); } else { assignValue(object, key, newValue); } } return object; } function copySymbols(source, object) { return copyObject(source, getSymbols(source), object); } function copySymbolsIn(source, object) { return copyObject(source, getSymbolsIn(source), object); } function createAggregator(setter, initializer) { return function (collection, iteratee) { var func = isArray(collection) ? arrayAggregator : baseAggregator, accumulator = initializer ? initializer() : {}; return func(collection, setter, getIteratee(iteratee, 2), accumulator); }; } function createAssigner(assigner) { return baseRest(function (object, sources) { var index = -1, length = sources.length, customizer = length > 1 ? sources[length - 1] : undefined, guard = length > 2 ? sources[2] : undefined; customizer = (assigner.length > 3 && typeof customizer == 'function') ? (length--, customizer) : undefined; if (guard && isIterateeCall(sources[0], sources[1], guard)) { customizer = length < 3 ? undefined : customizer; length = 1; } object = Object(object); while (++index < length) { var source = sources[index]; if (source) { assigner(object, source, index, customizer); } } return object; }); } function createBaseEach(eachFunc, fromRight) { return function (collection, iteratee) { if (collection == null) { return collection; } if (!isArrayLike(collection)) { return eachFunc(collection, iteratee); } var length = collection.length, index = fromRight ? length : -1, iterable = Object(collection); while ((fromRight ? index-- : ++index < length)) { if (iteratee(iterable[index], index, iterable) === false) { break; } } return collection; }; } function createBaseFor(fromRight) { return function (object, iteratee, keysFunc) { var index = -1, iterable = Object(object), props = keysFunc(object), length = props.length; while (length--) { var key = props[fromRight ? length : ++index]; if (iteratee(iterable[key], key, iterable) === false) { break; } } return object; }; } function createBind(func, bitmask, thisArg) { var isBind = bitmask & WRAP_BIND_FLAG, Ctor = createCtor(func); function wrapper() { var fn = (this && this !== root && this instanceof wrapper) ? Ctor : func; return fn.apply(isBind ? thisArg : this, arguments); } return wrapper; } function createCaseFirst(methodName) { return function (string) { string = toString(string); var strSymbols = hasUnicode(string) ? stringToArray(string) : undefined; var chr = strSymbols ? strSymbols[0] : string.charAt(0); var trailing = strSymbols ? castSlice(strSymbols, 1).join() : string.slice(1); return chr[methodName]() + trailing; }; } function createCompounder(callback) { return function (string) { return arrayReduce(words(deburr(string).replace(reApos, )), callback, ); }; } function createCtor(Ctor) { return function () { var args = arguments; switch (args.length) { case 0: return new Ctor; case 1: return new Ctor(args[0]); case 2: return new Ctor(args[0], args[1]); case 3: return new Ctor(args[0], args[1], args[2]); case 4: return new Ctor(args[0], args[1], args[2], args[3]); case 5: return new Ctor(args[0], args[1], args[2], args[3], args[4]); case 6: return new Ctor(args[0], args[1], args[2], args[3], args[4], args[5]); case 7: return new Ctor(args[0], args[1], args[2], args[3], args[4], args[5], args[6]); } var thisBinding = baseCreate(Ctor.prototype), result = Ctor.apply(thisBinding, args); return isObject(result) ? result : thisBinding; }; } function createCurry(func, bitmask, arity) { var Ctor = createCtor(func); function wrapper() { var length = arguments.length, args = Array(length), index = length, placeholder = getHolder(wrapper); while (index--) { args[index] = arguments[index]; } var holders = (length < 3 && args[0] !== placeholder && args[length - 1] !== placeholder) ? [] : replaceHolders(args, placeholder); length -= holders.length; if (length < arity) { return createRecurry(func, bitmask, createHybrid, wrapper.placeholder, undefined, args, holders, undefined, undefined, arity - length); } var fn = (this && this !== root && this instanceof wrapper) ? Ctor : func; return apply(fn, this, args); } return wrapper; } function createFind(findIndexFunc) { return function (collection, predicate, fromIndex) { var iterable = Object(collection); if (!isArrayLike(collection)) { var iteratee = getIteratee(predicate, 3); collection = keys(collection); predicate = function (key) { return iteratee(iterable[key], key, iterable); }; } var index = findIndexFunc(collection, predicate, fromIndex); return index > -1 ? iterable[iteratee ? collection[index] : index] : undefined; }; } function createFlow(fromRight) { return flatRest(function (funcs) { var length = funcs.length, index = length, prereq = LodashWrapper.prototype.thru; if (fromRight) { funcs.reverse(); } while (index--) { var func = funcs[index]; if (typeof func != 'function') { throw new TypeError(FUNC_ERROR_TEXT); } if (prereq && !wrapper && getFuncName(func) == 'wrapper') { var wrapper = new LodashWrapper([], true); } } index = wrapper ? index : length; while (++index < length) { func = funcs[index]; var funcName = getFuncName(func), data = funcName == 'wrapper' ? getData(func) : undefined; if (data && isLaziable(data[0]) && data[1] == (WRAP_ARY_FLAG | WRAP_CURRY_FLAG | WRAP_PARTIAL_FLAG | WRAP_REARG_FLAG) && !data[4].length && data[9] == 1) { wrapper = wrapper[getFuncName(data[0])].apply(wrapper, data[3]); } else { wrapper = (func.length == 1 && isLaziable(func)) ? wrapper[funcName]() : wrapper.thru(func); } } return function () { var args = arguments, value = args[0]; if (wrapper && args.length == 1 && isArray(value)) { return wrapper.plant(value).value(); } var index = 0, result = length ? funcs[index].apply(this, args) : value; while (++index < length) { result = funcs[index].call(this, result); } return result; }; }); } function createHybrid(func, bitmask, thisArg, partials, holders, partialsRight, holdersRight, argPos, ary, arity) { var isAry = bitmask & WRAP_ARY_FLAG, isBind = bitmask & WRAP_BIND_FLAG, isBindKey = bitmask & WRAP_BIND_KEY_FLAG, isCurried = bitmask & (WRAP_CURRY_FLAG | WRAP_CURRY_RIGHT_FLAG), isFlip = bitmask & WRAP_FLIP_FLAG, Ctor = isBindKey ? undefined : createCtor(func); function wrapper() { var length = arguments.length, args = Array(length), index = length; while (index--) { args[index] = arguments[index]; } if (isCurried) { var placeholder = getHolder(wrapper), holdersCount = countHolders(args, placeholder); } if (partials) { args = composeArgs(args, partials, holders, isCurried); } if (partialsRight) { args = composeArgsRight(args, partialsRight, holdersRight, isCurried); } length -= holdersCount; if (isCurried && length < arity) { var newHolders = replaceHolders(args, placeholder); return createRecurry(func, bitmask, createHybrid, wrapper.placeholder, thisArg, args, newHolders, argPos, ary, arity - length); } var thisBinding = isBind ? thisArg : this, fn = isBindKey ? thisBinding[func] : func; length = args.length; if (argPos) { args = reorder(args, argPos); } else if (isFlip && length > 1) { args.reverse(); } if (isAry && ary < length) { args.length = ary; } if (this && this !== root && this instanceof wrapper) { fn = Ctor || createCtor(fn); } return fn.apply(thisBinding, args); } return wrapper; } function createInverter(setter, toIteratee) { return function (object, iteratee) { return baseInverter(object, setter, toIteratee(iteratee), {}); }; } function createMathOperation(operator, defaultValue) { return function (value, other) { var result; if (value === undefined && other === undefined) { return defaultValue; } if (value !== undefined) { result = value; } if (other !== undefined) { if (result === undefined) { return other; } if (typeof value == 'string' || typeof other == 'string') { value = baseToString(value); other = baseToString(other); } else { value = baseToNumber(value); other = baseToNumber(other); } result = operator(value, other); } return result; }; } function createOver(arrayFunc) { return flatRest(function (iteratees) { iteratees = arrayMap(iteratees, baseUnary(getIteratee())); return baseRest(function (args) { var thisArg = this; return arrayFunc(iteratees, function (iteratee) { return apply(iteratee, thisArg, args); }); }); }); } function createPadding(length, chars) { chars = chars === undefined ? ' ' : baseToString(chars); var charsLength = chars.length; if (charsLength < 2) { return charsLength ? baseRepeat(chars, length) : chars; } var result = baseRepeat(chars, nativeCeil(length / stringSize(chars))); return hasUnicode(chars) ? castSlice(stringToArray(result), 0, length).join() : result.slice(0, length); } function createPartial(func, bitmask, thisArg, partials) { var isBind = bitmask & WRAP_BIND_FLAG, Ctor = createCtor(func); function wrapper() { var argsIndex = -1, argsLength = arguments.length, leftIndex = -1, leftLength = partials.length, args = Array(leftLength + argsLength), fn = (this && this !== root && this instanceof wrapper) ? Ctor : func; while (++leftIndex < leftLength) { args[leftIndex] = partials[leftIndex]; } while (argsLength--) { args[leftIndex++] = arguments[++argsIndex]; } return apply(fn, isBind ? thisArg : this, args); } return wrapper; } function createRange(fromRight) { return function (start, end, step) { if (step && typeof step != 'number' && isIterateeCall(start, end, step)) { end = step = undefined; } start = toFinite(start); if (end === undefined) { end = start; start = 0; } else { end = toFinite(end); } step = step === undefined ? (start < end ? 1 : -1) : toFinite(step); return baseRange(start, end, step, fromRight); }; } function createRelationalOperation(operator) { return function (value, other) { if (!(typeof value == 'string' && typeof other == 'string')) { value = toNumber(value); other = toNumber(other); } return operator(value, other); }; } function createRecurry(func, bitmask, wrapFunc, placeholder, thisArg, partials, holders, argPos, ary, arity) { var isCurry = bitmask & WRAP_CURRY_FLAG, newHolders = isCurry ? holders : undefined, newHoldersRight = isCurry ? undefined : holders, newPartials = isCurry ? partials : undefined, newPartialsRight = isCurry ? undefined : partials; bitmask |= (isCurry ? WRAP_PARTIAL_FLAG : WRAP_PARTIAL_RIGHT_FLAG); bitmask &= ~(isCurry ? WRAP_PARTIAL_RIGHT_FLAG : WRAP_PARTIAL_FLAG); if (!(bitmask & WRAP_CURRY_BOUND_FLAG)) { bitmask &= ~(WRAP_BIND_FLAG | WRAP_BIND_KEY_FLAG); } var newData = [ func, bitmask, thisArg, newPartials, newHolders, newPartialsRight, newHoldersRight, argPos, ary, arity ]; var result = wrapFunc.apply(undefined, newData); if (isLaziable(func)) { setData(result, newData); } result.placeholder = placeholder; return setWrapToString(result, func, bitmask); } function createRound(methodName) { var func = Math[methodName]; return function (number, precision) { number = toNumber(number); precision = precision == null ? 0 : nativeMin(toInteger(precision), 292); if (precision && nativeIsFinite(number)) { var pair = (toString(number) + 'e').split('e'), value = func(pair[0] + 'e' + (+pair[1] + precision)); pair = (toString(value) + 'e').split('e'); return +(pair[0] + 'e' + (+pair[1] - precision)); } return func(number); }; } var createSet = !(Set && (1 / setToArray(new Set([, -0]))[1]) == INFINITY) ? noop : function (values) { return new Set(values); }; function createToPairs(keysFunc) { return function (object) { var tag = getTag(object); if (tag == mapTag) { return mapToArray(object); } if (tag == setTag) { return setToPairs(object); } return baseToPairs(object, keysFunc(object)); }; } function createWrap(func, bitmask, thisArg, partials, holders, argPos, ary, arity) { var isBindKey = bitmask & WRAP_BIND_KEY_FLAG; if (!isBindKey && typeof func != 'function') { throw new TypeError(FUNC_ERROR_TEXT); } var length = partials ? partials.length : 0; if (!length) { bitmask &= ~(WRAP_PARTIAL_FLAG | WRAP_PARTIAL_RIGHT_FLAG); partials = holders = undefined; } ary = ary === undefined ? ary : nativeMax(toInteger(ary), 0); arity = arity === undefined ? arity : toInteger(arity); length -= holders ? holders.length : 0; if (bitmask & WRAP_PARTIAL_RIGHT_FLAG) { var partialsRight = partials, holdersRight = holders; partials = holders = undefined; } var data = isBindKey ? undefined : getData(func); var newData = [ func, bitmask, thisArg, partials, holders, partialsRight, holdersRight, argPos, ary, arity ]; if (data) { mergeData(newData, data); } func = newData[0]; bitmask = newData[1]; thisArg = newData[2]; partials = newData[3]; holders = newData[4]; arity = newData[9] = newData[9] === undefined ? (isBindKey ? 0 : func.length) : nativeMax(newData[9] - length, 0); if (!arity && bitmask & (WRAP_CURRY_FLAG | WRAP_CURRY_RIGHT_FLAG)) { bitmask &= ~(WRAP_CURRY_FLAG | WRAP_CURRY_RIGHT_FLAG); } if (!bitmask || bitmask == WRAP_BIND_FLAG) { var result = createBind(func, bitmask, thisArg); } else if (bitmask == WRAP_CURRY_FLAG || bitmask == WRAP_CURRY_RIGHT_FLAG) { result = createCurry(func, bitmask, arity); } else if ((bitmask == WRAP_PARTIAL_FLAG || bitmask == (WRAP_BIND_FLAG | WRAP_PARTIAL_FLAG)) && !holders.length) { result = createPartial(func, bitmask, thisArg, partials); } else { result = createHybrid.apply(undefined, newData); } var setter = data ? baseSetData : setData; return setWrapToString(setter(result, newData), func, bitmask); } function customDefaultsAssignIn(objValue, srcValue, key, object) { if (objValue === undefined || (eq(objValue, objectProto[key]) && !hasOwnProperty.call(object, key))) { return srcValue; } return objValue; } function customDefaultsMerge(objValue, srcValue, key, object, source, stack) { if (isObject(objValue) && isObject(srcValue)) { stack.set(srcValue, objValue); baseMerge(objValue, srcValue, undefined, customDefaultsMerge, stack); stack['delete'](srcValue); } return objValue; } function customOmitClone(value) { return isPlainObject(value) ? undefined : value; } function equalArrays(array, other, bitmask, customizer, equalFunc, stack) { var isPartial = bitmask & COMPARE_PARTIAL_FLAG, arrLength = array.length, othLength = other.length; if (arrLength != othLength && !(isPartial && othLength > arrLength)) { return false; } var stacked = stack.get(array); if (stacked && stack.get(other)) { return stacked == other; } var index = -1, result = true, seen = (bitmask & COMPARE_UNORDERED_FLAG) ? new SetCache : undefined; stack.set(array, other); stack.set(other, array); while (++index < arrLength) { var arrValue = array[index], othValue = other[index]; if (customizer) { var compared = isPartial ? customizer(othValue, arrValue, index, other, array, stack) : customizer(arrValue, othValue, index, array, other, stack); } if (compared !== undefined) { if (compared) { continue; } result = false; break; } if (seen) { if (!arraySome(other, function (othValue, othIndex) { if (!cacheHas(seen, othIndex) && (arrValue === othValue || equalFunc(arrValue, othValue, bitmask, customizer, stack))) { return seen.push(othIndex); } })) { result = false; break; } } else if (!(arrValue === othValue || equalFunc(arrValue, othValue, bitmask, customizer, stack))) { result = false; break; } } stack['delete'](array); stack['delete'](other); return result; } function equalByTag(object, other, tag, bitmask, customizer, equalFunc, stack) { switch (tag) { case dataViewTag: if ((object.byteLength != other.byteLength) || (object.byteOffset != other.byteOffset)) { return false; } object = object.buffer; other = other.buffer; case arrayBufferTag: if ((object.byteLength != other.byteLength) || !equalFunc(new Uint8Array(object), new Uint8Array(other))) { return false; } return true; case boolTag: case dateTag: case numberTag: return eq(+object, +other); case errorTag: return object.name == other.name && object.message == other.message; case regexpTag: case stringTag: return object == (other + ); case mapTag: var convert = mapToArray; case setTag: var isPartial = bitmask & COMPARE_PARTIAL_FLAG; convert || (convert = setToArray); if (object.size != other.size && !isPartial) { return false; } var stacked = stack.get(object); if (stacked) { return stacked == other; } bitmask |= COMPARE_UNORDERED_FLAG; stack.set(object, other); var result = equalArrays(convert(object), convert(other), bitmask, customizer, equalFunc, stack); stack['delete'](object); return result; case symbolTag: if (symbolValueOf) { return symbolValueOf.call(object) == symbolValueOf.call(other); } } return false; } function equalObjects(object, other, bitmask, customizer, equalFunc, stack) { var isPartial = bitmask & COMPARE_PARTIAL_FLAG, objProps = getAllKeys(object), objLength = objProps.length, othProps = getAllKeys(other), othLength = othProps.length; if (objLength != othLength && !isPartial) { return false; } var index = objLength; while (index--) { var key = objProps[index]; if (!(isPartial ? key in other : hasOwnProperty.call(other, key))) { return false; } } var stacked = stack.get(object); if (stacked && stack.get(other)) { return stacked == other; } var result = true; stack.set(object, other); stack.set(other, object); var skipCtor = isPartial; while (++index < objLength) { key = objProps[index]; var objValue = object[key], othValue = other[key]; if (customizer) { var compared = isPartial ? customizer(othValue, objValue, key, other, object, stack) : customizer(objValue, othValue, key, object, other, stack); } if (!(compared === undefined ? (objValue === othValue || equalFunc(objValue, othValue, bitmask, customizer, stack)) : compared)) { result = false; break; } skipCtor || (skipCtor = key == 'constructor'); } if (result && !skipCtor) { var objCtor = object.constructor, othCtor = other.constructor; if (objCtor != othCtor && ('constructor' in object && 'constructor' in other) && !(typeof objCtor == 'function' && objCtor instanceof objCtor && typeof othCtor == 'function' && othCtor instanceof othCtor)) { result = false; } } stack['delete'](object); stack['delete'](other); return result; } function flatRest(func) { return setToString(overRest(func, undefined, flatten), func + ); } function getAllKeys(object) { return baseGetAllKeys(object, keys, getSymbols); } function getAllKeysIn(object) { return baseGetAllKeys(object, keysIn, getSymbolsIn); } var getData = !metaMap ? noop : function (func) { return metaMap.get(func); }; function getFuncName(func) { var result = (func.name + ), array = realNames[result], length = hasOwnProperty.call(realNames, result) ? array.length : 0; while (length--) { var data = array[length], otherFunc = data.func; if (otherFunc == null || otherFunc == func) { return data.name; } } return result; } function getHolder(func) { var object = hasOwnProperty.call(lodash, 'placeholder') ? lodash : func; return object.placeholder; } function getIteratee() { var result = lodash.iteratee || iteratee; result = result === iteratee ? baseIteratee : result; return arguments.length ? result(arguments[0], arguments[1]) : result; } function getMapData(map, key) { var data = map.__data__; return isKeyable(key) ? data[typeof key == 'string' ? 'string' : 'hash'] : data.map; } function getMatchData(object) { var result = keys(object), length = result.length; while (length--) { var key = result[length], value = object[key]; result[length] = [key, value, isStrictComparable(value)]; } return result; } function getNative(object, key) { var value = getValue(object, key); return baseIsNative(value) ? value : undefined; } function getRawTag(value) { var isOwn = hasOwnProperty.call(value, symToStringTag), tag = value[symToStringTag]; try { value[symToStringTag] = undefined; var unmasked = true; } catch (e) { } var result = nativeObjectToString.call(value); if (unmasked) { if (isOwn) { value[symToStringTag] = tag; } else { delete value[symToStringTag]; } } return result; } var getSymbols = !nativeGetSymbols ? stubArray : function (object) { if (object == null) { return []; } object = Object(object); return arrayFilter(nativeGetSymbols(object), function (symbol) { return propertyIsEnumerable.call(object, symbol); }); }; var getSymbolsIn = !nativeGetSymbols ? stubArray : function (object) { var result = []; while (object) { arrayPush(result, getSymbols(object)); object = getPrototype(object); } return result; }; var getTag = baseGetTag; if ((DataView && getTag(new DataView(new ArrayBuffer(1))) != dataViewTag) || (Map && getTag(new Map) != mapTag) || (Promise && getTag(Promise.resolve()) != promiseTag) || (Set && getTag(new Set) != setTag) || (WeakMap && getTag(new WeakMap) != weakMapTag)) { getTag = function (value) { var result = baseGetTag(value), Ctor = result == objectTag ? value.constructor : undefined, ctorString = Ctor ? toSource(Ctor) : ; if (ctorString) { switch (ctorString) { case dataViewCtorString: return dataViewTag; case mapCtorString: return mapTag; case promiseCtorString: return promiseTag; case setCtorString: return setTag; case weakMapCtorString: return weakMapTag; } } return result; }; } function getView(start, end, transforms) { var index = -1, length = transforms.length; while (++index < length) { var data = transforms[index], size = data.size; switch (data.type) { case 'drop': start += size; break; case 'dropRight': end -= size; break; case 'take': end = nativeMin(end, start + size); break; case 'takeRight': start = nativeMax(start, end - size); break; } } return { 'start': start, 'end': end }; } function getWrapDetails(source) { var match = source.match(reWrapDetails); return match ? match[1].split(reSplitDetails) : []; } function hasPath(object, path, hasFunc) { path = castPath(path, object); var index = -1, length = path.length, result = false; while (++index < length) { var key = toKey(path[index]); if (!(result = object != null && hasFunc(object, key))) { break; } object = object[key]; } if (result || ++index != length) { return result; } length = object == null ? 0 : object.length; return !!length && isLength(length) && isIndex(key, length) && (isArray(object) || isArguments(object)); } function initCloneArray(array) { var length = array.length, result = new array.constructor(length); if (length && typeof array[0] == 'string' && hasOwnProperty.call(array, 'index')) { result.index = array.index; result.input = array.input; } return result; } function initCloneObject(object) { return (typeof object.constructor == 'function' && !isPrototype(object)) ? baseCreate(getPrototype(object)) : {}; } function initCloneByTag(object, tag, isDeep) { var Ctor = object.constructor; switch (tag) { case arrayBufferTag: return cloneArrayBuffer(object); case boolTag: case dateTag: return new Ctor(+object); case dataViewTag: return cloneDataView(object, isDeep); case float32Tag: case float64Tag: case int8Tag: case int16Tag: case int32Tag: case uint8Tag: case uint8ClampedTag: case uint16Tag: case uint32Tag: return cloneTypedArray(object, isDeep); case mapTag: return new Ctor; case numberTag: case stringTag: return new Ctor(object); case regexpTag: return cloneRegExp(object); case setTag: return new Ctor; case symbolTag: return cloneSymbol(object); } } function insertWrapDetails(source, details) { var length = details.length; if (!length) { return source; } var lastIndex = length - 1; details[lastIndex] = (length > 1 ? '& ' : ) + details[lastIndex]; details = details.join(length > 2 ? ', ' : ' '); return source.replace(reWrapComment, '{\n/* [wrapped with ' + details + '] */\n'); } function isFlattenable(value) { return isArray(value) || isArguments(value) || !!(spreadableSymbol && value && value[spreadableSymbol]); } function isIndex(value, length) { var type = typeof value; length = length == null ? MAX_SAFE_INTEGER : length; return !!length && (type == 'number' || (type != 'symbol' && reIsUint.test(value))) && (value > -1 && value % 1 == 0 && value < length); } function isIterateeCall(value, index, object) { if (!isObject(object)) { return false; } var type = typeof index; if (type == 'number' ? (isArrayLike(object) && isIndex(index, object.length)) : (type == 'string' && index in object)) { return eq(object[index], value); } return false; } function isKey(value, object) { if (isArray(value)) { return false; } var type = typeof value; if (type == 'number' || type == 'symbol' || type == 'boolean' || value == null || isSymbol(value)) { return true; } return reIsPlainProp.test(value) || !reIsDeepProp.test(value) || (object != null && value in Object(object)); } function isKeyable(value) { var type = typeof value; return (type == 'string' || type == 'number' || type == 'symbol' || type == 'boolean') ? (value !== '__proto__') : (value === null); } function isLaziable(func) { var funcName = getFuncName(func), other = lodash[funcName]; if (typeof other != 'function' || !(funcName in LazyWrapper.prototype)) { return false; } if (func === other) { return true; } var data = getData(other); return !!data && func === data[0]; } function isMasked(func) { return !!maskSrcKey && (maskSrcKey in func); } var isMaskable = coreJsData ? isFunction : stubFalse; function isPrototype(value) { var Ctor = value && value.constructor, proto = (typeof Ctor == 'function' && Ctor.prototype) || objectProto; return value === proto; } function isStrictComparable(value) { return value === value && !isObject(value); } function matchesStrictComparable(key, srcValue) { return function (object) { if (object == null) { return false; } return object[key] === srcValue && (srcValue !== undefined || (key in Object(object))); }; } function memoizeCapped(func) { var result = memoize(func, function (key) { if (cache.size === MAX_MEMOIZE_SIZE) { cache.clear(); } return key; }); var cache = result.cache; return result; } function mergeData(data, source) { var bitmask = data[1], srcBitmask = source[1], newBitmask = bitmask | srcBitmask, isCommon = newBitmask < (WRAP_BIND_FLAG | WRAP_BIND_KEY_FLAG | WRAP_ARY_FLAG); var isCombo = ((srcBitmask == WRAP_ARY_FLAG) && (bitmask == WRAP_CURRY_FLAG)) || ((srcBitmask == WRAP_ARY_FLAG) && (bitmask == WRAP_REARG_FLAG) && (data[7].length <= source[8])) || ((srcBitmask == (WRAP_ARY_FLAG | WRAP_REARG_FLAG)) && (source[7].length <= source[8]) && (bitmask == WRAP_CURRY_FLAG)); if (!(isCommon || isCombo)) { return data; } if (srcBitmask & WRAP_BIND_FLAG) { data[2] = source[2]; newBitmask |= bitmask & WRAP_BIND_FLAG ? 0 : WRAP_CURRY_BOUND_FLAG; } var value = source[3]; if (value) { var partials = data[3]; data[3] = partials ? composeArgs(partials, value, source[4]) : value; data[4] = partials ? replaceHolders(data[3], PLACEHOLDER) : source[4]; } value = source[5]; if (value) { partials = data[5]; data[5] = partials ? composeArgsRight(partials, value, source[6]) : value; data[6] = partials ? replaceHolders(data[5], PLACEHOLDER) : source[6]; } value = source[7]; if (value) { data[7] = value; } if (srcBitmask & WRAP_ARY_FLAG) { data[8] = data[8] == null ? source[8] : nativeMin(data[8], source[8]); } if (data[9] == null) { data[9] = source[9]; } data[0] = source[0]; data[1] = newBitmask; return data; } function nativeKeysIn(object) { var result = []; if (object != null) { for (var key in Object(object)) { result.push(key); } } return result; } function objectToString(value) { return nativeObjectToString.call(value); } function overRest(func, start, transform) { start = nativeMax(start === undefined ? (func.length - 1) : start, 0); return function () { var args = arguments, index = -1, length = nativeMax(args.length - start, 0), array = Array(length); while (++index < length) { array[index] = args[start + index]; } index = -1; var otherArgs = Array(start + 1); while (++index < start) { otherArgs[index] = args[index]; } otherArgs[start] = transform(array); return apply(func, this, otherArgs); }; } function parent(object, path) { return path.length < 2 ? object : baseGet(object, baseSlice(path, 0, -1)); } function reorder(array, indexes) { var arrLength = array.length, length = nativeMin(indexes.length, arrLength), oldArray = copyArray(array); while (length--) { var index = indexes[length]; array[length] = isIndex(index, arrLength) ? oldArray[index] : undefined; } return array; } function safeGet(object, key) { if (key === 'constructor' && typeof object[key] === 'function') { return; } if (key == '__proto__') { return; } return object[key]; } var setData = shortOut(baseSetData); var setTimeout = ctxSetTimeout || function (func, wait) { return root.setTimeout(func, wait); }; var setToString = shortOut(baseSetToString); function setWrapToString(wrapper, reference, bitmask) { var source = (reference + ); return setToString(wrapper, insertWrapDetails(source, updateWrapDetails(getWrapDetails(source), bitmask))); } function shortOut(func) { var count = 0, lastCalled = 0; return function () { var stamp = nativeNow(), remaining = HOT_SPAN - (stamp - lastCalled); lastCalled = stamp; if (remaining > 0) { if (++count >= HOT_COUNT) { return arguments[0]; } } else { count = 0; } return func.apply(undefined, arguments); }; } function shuffleSelf(array, size) { var index = -1, length = array.length, lastIndex = length - 1; size = size === undefined ? length : size; while (++index < size) { var rand = baseRandom(index, lastIndex), value = array[rand]; array[rand] = array[index]; array[index] = value; } array.length = size; return array; } var stringToPath = memoizeCapped(function (string) { var result = []; if (string.charCodeAt(0) === 46) { result.push(); } string.replace(rePropName, function (match, number, quote, subString) { result.push(quote ? subString.replace(reEscapeChar, '$1') : (number || match)); }); return result; }); function toKey(value) { if (typeof value == 'string' || isSymbol(value)) { return value; } var result = (value + ); return (result == '0' && (1 / value) == -INFINITY) ? '-0' : result; } function toSource(func) { if (func != null) { try { return funcToString.call(func); } catch (e) { } try { return (func + ); } catch (e) { } } return ; } function updateWrapDetails(details, bitmask) { arrayEach(wrapFlags, function (pair) { var value = '_.' + pair[0]; if ((bitmask & pair[1]) && !arrayIncludes(details, value)) { details.push(value); } }); return details.sort(); } function wrapperClone(wrapper) { if (wrapper instanceof LazyWrapper) { return wrapper.clone(); } var result = new LodashWrapper(wrapper.__wrapped__, wrapper.__chain__); result.__actions__ = copyArray(wrapper.__actions__); result.__index__ = wrapper.__index__; result.__values__ = wrapper.__values__; return result; } function chunk(array, size, guard) { if ((guard ? isIterateeCall(array, size, guard) : size === undefined)) { size = 1; } else { size = nativeMax(toInteger(size), 0); } var length = array == null ? 0 : array.length; if (!length || size < 1) { return []; } var index = 0, resIndex = 0, result = Array(nativeCeil(length / size)); while (index < length) { result[resIndex++] = baseSlice(array, index, (index += size)); } return result; } function compact(array) { var index = -1, length = array == null ? 0 : array.length, resIndex = 0, result = []; while (++index < length) { var value = array[index]; if (value) { result[resIndex++] = value; } } return result; } function concat() { var length = arguments.length; if (!length) { return []; } var args = Array(length - 1), array = arguments[0], index = length; while (index--) { args[index - 1] = arguments[index]; } return arrayPush(isArray(array) ? copyArray(array) : [array], baseFlatten(args, 1)); } var difference = baseRest(function (array, values) { return isArrayLikeObject(array) ? baseDifference(array, baseFlatten(values, 1, isArrayLikeObject, true)) : []; }); var differenceBy = baseRest(function (array, values) { var iteratee = last(values); if (isArrayLikeObject(iteratee)) { iteratee = undefined; } return isArrayLikeObject(array) ? baseDifference(array, baseFlatten(values, 1, isArrayLikeObject, true), getIteratee(iteratee, 2)) : []; }); var differenceWith = baseRest(function (array, values) { var comparator = last(values); if (isArrayLikeObject(comparator)) { comparator = undefined; } return isArrayLikeObject(array) ? baseDifference(array, baseFlatten(values, 1, isArrayLikeObject, true), undefined, comparator) : []; }); function drop(array, n, guard) { var length = array == null ? 0 : array.length; if (!length) { return []; } n = (guard || n === undefined) ? 1 : toInteger(n); return baseSlice(array, n < 0 ? 0 : n, length); } function dropRight(array, n, guard) { var length = array == null ? 0 : array.length; if (!length) { return []; } n = (guard || n === undefined) ? 1 : toInteger(n); n = length - n; return baseSlice(array, 0, n < 0 ? 0 : n); } function dropRightWhile(array, predicate) { return (array && array.length) ? baseWhile(array, getIteratee(predicate, 3), true, true) : []; } function dropWhile(array, predicate) { return (array && array.length) ? baseWhile(array, getIteratee(predicate, 3), true) : []; } function fill(array, value, start, end) { var length = array == null ? 0 : array.length; if (!length) { return []; } if (start && typeof start != 'number' && isIterateeCall(array, value, start)) { start = 0; end = length; } return baseFill(array, value, start, end); } function findIndex(array, predicate, fromIndex) { var length = array == null ? 0 : array.length; if (!length) { return -1; } var index = fromIndex == null ? 0 : toInteger(fromIndex); if (index < 0) { index = nativeMax(length + index, 0); } return baseFindIndex(array, getIteratee(predicate, 3), index); } function findLastIndex(array, predicate, fromIndex) { var length = array == null ? 0 : array.length; if (!length) { return -1; } var index = length - 1; if (fromIndex !== undefined) { index = toInteger(fromIndex); index = fromIndex < 0 ? nativeMax(length + index, 0) : nativeMin(index, length - 1); } return baseFindIndex(array, getIteratee(predicate, 3), index, true); } function flatten(array) { var length = array == null ? 0 : array.length; return length ? baseFlatten(array, 1) : []; } function flattenDeep(array) { var length = array == null ? 0 : array.length; return length ? baseFlatten(array, INFINITY) : []; } function flattenDepth(array, depth) { var length = array == null ? 0 : array.length; if (!length) { return []; } depth = depth === undefined ? 1 : toInteger(depth); return baseFlatten(array, depth); } function fromPairs(pairs) { var index = -1, length = pairs == null ? 0 : pairs.length, result = {}; while (++index < length) { var pair = pairs[index]; result[pair[0]] = pair[1]; } return result; } function head(array) { return (array && array.length) ? array[0] : undefined; } function indexOf(array, value, fromIndex) { var length = array == null ? 0 : array.length; if (!length) { return -1; } var index = fromIndex == null ? 0 : toInteger(fromIndex); if (index < 0) { index = nativeMax(length + index, 0); } return baseIndexOf(array, value, index); } function initial(array) { var length = array == null ? 0 : array.length; return length ? baseSlice(array, 0, -1) : []; } var intersection = baseRest(function (arrays) { var mapped = arrayMap(arrays, castArrayLikeObject); return (mapped.length && mapped[0] === arrays[0]) ? baseIntersection(mapped) : []; }); var intersectionBy = baseRest(function (arrays) { var iteratee = last(arrays), mapped = arrayMap(arrays, castArrayLikeObject); if (iteratee === last(mapped)) { iteratee = undefined; } else { mapped.pop(); } return (mapped.length && mapped[0] === arrays[0]) ? baseIntersection(mapped, getIteratee(iteratee, 2)) : []; }); var intersectionWith = baseRest(function (arrays) { var comparator = last(arrays), mapped = arrayMap(arrays, castArrayLikeObject); comparator = typeof comparator == 'function' ? comparator : undefined; if (comparator) { mapped.pop(); } return (mapped.length && mapped[0] === arrays[0]) ? baseIntersection(mapped, undefined, comparator) : []; }); function join(array, separator) { return array == null ? : nativeJoin.call(array, separator); } function last(array) { var length = array == null ? 0 : array.length; return length ? array[length - 1] : undefined; } function lastIndexOf(array, value, fromIndex) { var length = array == null ? 0 : array.length; if (!length) { return -1; } var index = length; if (fromIndex !== undefined) { index = toInteger(fromIndex); index = index < 0 ? nativeMax(length + index, 0) : nativeMin(index, length - 1); } return value === value ? strictLastIndexOf(array, value, index) : baseFindIndex(array, baseIsNaN, index, true); } function nth(array, n) { return (array && array.length) ? baseNth(array, toInteger(n)) : undefined; } var pull = baseRest(pullAll); function pullAll(array, values) { return (array && array.length && values && values.length) ? basePullAll(array, values) : array; } function pullAllBy(array, values, iteratee) { return (array && array.length && values && values.length) ? basePullAll(array, values, getIteratee(iteratee, 2)) : array; } function pullAllWith(array, values, comparator) { return (array && array.length && values && values.length) ? basePullAll(array, values, undefined, comparator) : array; } var pullAt = flatRest(function (array, indexes) { var length = array == null ? 0 : array.length, result = baseAt(array, indexes); basePullAt(array, arrayMap(indexes, function (index) { return isIndex(index, length) ? +index : index; }).sort(compareAscending)); return result; }); function remove(array, predicate) { var result = []; if (!(array && array.length)) { return result; } var index = -1, indexes = [], length = array.length; predicate = getIteratee(predicate, 3); while (++index < length) { var value = array[index]; if (predicate(value, index, array)) { result.push(value); indexes.push(index); } } basePullAt(array, indexes); return result; } function reverse(array) { return array == null ? array : nativeReverse.call(array); } function slice(array, start, end) { var length = array == null ? 0 : array.length; if (!length) { return []; } if (end && typeof end != 'number' && isIterateeCall(array, start, end)) { start = 0; end = length; } else { start = start == null ? 0 : toInteger(start); end = end === undefined ? length : toInteger(end); } return baseSlice(array, start, end); } function sortedIndex(array, value) { return baseSortedIndex(array, value); } function sortedIndexBy(array, value, iteratee) { return baseSortedIndexBy(array, value, getIteratee(iteratee, 2)); } function sortedIndexOf(array, value) { var length = array == null ? 0 : array.length; if (length) { var index = baseSortedIndex(array, value); if (index < length && eq(array[index], value)) { return index; } } return -1; } function sortedLastIndex(array, value) { return baseSortedIndex(array, value, true); } function sortedLastIndexBy(array, value, iteratee) { return baseSortedIndexBy(array, value, getIteratee(iteratee, 2), true); } function sortedLastIndexOf(array, value) { var length = array == null ? 0 : array.length; if (length) { var index = baseSortedIndex(array, value, true) - 1; if (eq(array[index], value)) { return index; } } return -1; } function sortedUniq(array) { return (array && array.length) ? baseSortedUniq(array) : []; } function sortedUniqBy(array, iteratee) { return (array && array.length) ? baseSortedUniq(array, getIteratee(iteratee, 2)) : []; } function tail(array) { var length = array == null ? 0 : array.length; return length ? baseSlice(array, 1, length) : []; } function take(array, n, guard) { if (!(array && array.length)) { return []; } n = (guard || n === undefined) ? 1 : toInteger(n); return baseSlice(array, 0, n < 0 ? 0 : n); } function takeRight(array, n, guard) { var length = array == null ? 0 : array.length; if (!length) { return []; } n = (guard || n === undefined) ? 1 : toInteger(n); n = length - n; return baseSlice(array, n < 0 ? 0 : n, length); } function takeRightWhile(array, predicate) { return (array && array.length) ? baseWhile(array, getIteratee(predicate, 3), false, true) : []; } function takeWhile(array, predicate) { return (array && array.length) ? baseWhile(array, getIteratee(predicate, 3)) : []; } var union = baseRest(function (arrays) { return baseUniq(baseFlatten(arrays, 1, isArrayLikeObject, true)); }); var unionBy = baseRest(function (arrays) { var iteratee = last(arrays); if (isArrayLikeObject(iteratee)) { iteratee = undefined; } return baseUniq(baseFlatten(arrays, 1, isArrayLikeObject, true), getIteratee(iteratee, 2)); }); var unionWith = baseRest(function (arrays) { var comparator = last(arrays); comparator = typeof comparator == 'function' ? comparator : undefined; return baseUniq(baseFlatten(arrays, 1, isArrayLikeObject, true), undefined, comparator); }); function uniq(array) { return (array && array.length) ? baseUniq(array) : []; } function uniqBy(array, iteratee) { return (array && array.length) ? baseUniq(array, getIteratee(iteratee, 2)) : []; } function uniqWith(array, comparator) { comparator = typeof comparator == 'function' ? comparator : undefined; return (array && array.length) ? baseUniq(array, undefined, comparator) : []; } function unzip(array) { if (!(array && array.length)) { return []; } var length = 0; array = arrayFilter(array, function (group) { if (isArrayLikeObject(group)) { length = nativeMax(group.length, length); return true; } }); return baseTimes(length, function (index) { return arrayMap(array, baseProperty(index)); }); } function unzipWith(array, iteratee) { if (!(array && array.length)) { return []; } var result = unzip(array); if (iteratee == null) { return result; } return arrayMap(result, function (group) { return apply(iteratee, undefined, group); }); } var without = baseRest(function (array, values) { return isArrayLikeObject(array) ? baseDifference(array, values) : []; }); var xor = baseRest(function (arrays) { return baseXor(arrayFilter(arrays, isArrayLikeObject)); }); var xorBy = baseRest(function (arrays) { var iteratee = last(arrays); if (isArrayLikeObject(iteratee)) { iteratee = undefined; } return baseXor(arrayFilter(arrays, isArrayLikeObject), getIteratee(iteratee, 2)); }); var xorWith = baseRest(function (arrays) { var comparator = last(arrays); comparator = typeof comparator == 'function' ? comparator : undefined; return baseXor(arrayFilter(arrays, isArrayLikeObject), undefined, comparator); }); var zip = baseRest(unzip); function zipObject(props, values) { return baseZipObject(props || [], values || [], assignValue); } function zipObjectDeep(props, values) { return baseZipObject(props || [], values || [], baseSet); } var zipWith = baseRest(function (arrays) { var length = arrays.length, iteratee = length > 1 ? arrays[length - 1] : undefined; iteratee = typeof iteratee == 'function' ? (arrays.pop(), iteratee) : undefined; return unzipWith(arrays, iteratee); }); function chain(value) { var result = lodash(value); result.__chain__ = true; return result; } function tap(value, interceptor) { interceptor(value); return value; } function thru(value, interceptor) { return interceptor(value); } var wrapperAt = flatRest(function (paths) { var length = paths.length, start = length ? paths[0] : 0, value = this.__wrapped__, interceptor = function (object) { return baseAt(object, paths); }; if (length > 1 || this.__actions__.length || !(value instanceof LazyWrapper) || !isIndex(start)) { return this.thru(interceptor); } value = value.slice(start, +start + (length ? 1 : 0)); value.__actions__.push({ 'func': thru, 'args': [interceptor], 'thisArg': undefined }); return new LodashWrapper(value, this.__chain__).thru(function (array) { if (length && !array.length) { array.push(undefined); } return array; }); }); function wrapperChain() { return chain(this); } function wrapperCommit() { return new LodashWrapper(this.value(), this.__chain__); } function wrapperNext() { if (this.__values__ === undefined) { this.__values__ = toArray(this.value()); } var done = this.__index__ >= this.__values__.length, value = done ? undefined : this.__values__[this.__index__++]; return { 'done': done, 'value': value }; } function wrapperToIterator() { return this; } function wrapperPlant(value) { var result, parent = this; while (parent instanceof baseLodash) { var clone = wrapperClone(parent); clone.__index__ = 0; clone.__values__ = undefined; if (result) { previous.__wrapped__ = clone; } else { result = clone; } var previous = clone; parent = parent.__wrapped__; } previous.__wrapped__ = value; return result; } function wrapperReverse() { var value = this.__wrapped__; if (value instanceof LazyWrapper) { var wrapped = value; if (this.__actions__.length) { wrapped = new LazyWrapper(this); } wrapped = wrapped.reverse(); wrapped.__actions__.push({ 'func': thru, 'args': [reverse], 'thisArg': undefined }); return new LodashWrapper(wrapped, this.__chain__); } return this.thru(reverse); } function wrapperValue() { return baseWrapperValue(this.__wrapped__, this.__actions__); } var countBy = createAggregator(function (result, value, key) { if (hasOwnProperty.call(result, key)) { ++result[key]; } else { baseAssignValue(result, key, 1); } }); function every(collection, predicate, guard) { var func = isArray(collection) ? arrayEvery : baseEvery; if (guard && isIterateeCall(collection, predicate, guard)) { predicate = undefined; } return func(collection, getIteratee(predicate, 3)); } function filter(collection, predicate) { var func = isArray(collection) ? arrayFilter : baseFilter; return func(collection, getIteratee(predicate, 3)); } var find = createFind(findIndex); var findLast = createFind(findLastIndex); function flatMap(collection, iteratee) { return baseFlatten(map(collection, iteratee), 1); } function flatMapDeep(collection, iteratee) { return baseFlatten(map(collection, iteratee), INFINITY); } function flatMapDepth(collection, iteratee, depth) { depth = depth === undefined ? 1 : toInteger(depth); return baseFlatten(map(collection, iteratee), depth); } function forEach(collection, iteratee) { var func = isArray(collection) ? arrayEach : baseEach; return func(collection, getIteratee(iteratee, 3)); } function forEachRight(collection, iteratee) { var func = isArray(collection) ? arrayEachRight : baseEachRight; return func(collection, getIteratee(iteratee, 3)); } var groupBy = createAggregator(function (result, value, key) { if (hasOwnProperty.call(result, key)) { result[key].push(value); } else { baseAssignValue(result, key, [value]); } }); function includes(collection, value, fromIndex, guard) { collection = isArrayLike(collection) ? collection : values(collection); fromIndex = (fromIndex && !guard) ? toInteger(fromIndex) : 0; var length = collection.length; if (fromIndex < 0) { fromIndex = nativeMax(length + fromIndex, 0); } return isString(collection) ? (fromIndex <= length && collection.indexOf(value, fromIndex) > -1) : (!!length && baseIndexOf(collection, value, fromIndex) > -1); } var invokeMap = baseRest(function (collection, path, args) { var index = -1, isFunc = typeof path == 'function', result = isArrayLike(collection) ? Array(collection.length) : []; baseEach(collection, function (value) { result[++index] = isFunc ? apply(path, value, args) : baseInvoke(value, path, args); }); return result; }); var keyBy = createAggregator(function (result, value, key) { baseAssignValue(result, key, value); }); function map(collection, iteratee) { var func = isArray(collection) ? arrayMap : baseMap; return func(collection, getIteratee(iteratee, 3)); } function orderBy(collection, iteratees, orders, guard) { if (collection == null) { return []; } if (!isArray(iteratees)) { iteratees = iteratees == null ? [] : [iteratees]; } orders = guard ? undefined : orders; if (!isArray(orders)) { orders = orders == null ? [] : [orders]; } return baseOrderBy(collection, iteratees, orders); } var partition = createAggregator(function (result, value, key) { result[key ? 0 : 1].push(value); }, function () { return [[], []]; }); function reduce(collection, iteratee, accumulator) { var func = isArray(collection) ? arrayReduce : baseReduce, initAccum = arguments.length < 3; return func(collection, getIteratee(iteratee, 4), accumulator, initAccum, baseEach); } function reduceRight(collection, iteratee, accumulator) { var func = isArray(collection) ? arrayReduceRight : baseReduce, initAccum = arguments.length < 3; return func(collection, getIteratee(iteratee, 4), accumulator, initAccum, baseEachRight); } function reject(collection, predicate) { var func = isArray(collection) ? arrayFilter : baseFilter; return func(collection, negate(getIteratee(predicate, 3))); } function sample(collection) { var func = isArray(collection) ? arraySample : baseSample; return func(collection); } function sampleSize(collection, n, guard) { if ((guard ? isIterateeCall(collection, n, guard) : n === undefined)) { n = 1; } else { n = toInteger(n); } var func = isArray(collection) ? arraySampleSize : baseSampleSize; return func(collection, n); } function shuffle(collection) { var func = isArray(collection) ? arrayShuffle : baseShuffle; return func(collection); } function size(collection) { if (collection == null) { return 0; } if (isArrayLike(collection)) { return isString(collection) ? stringSize(collection) : collection.length; } var tag = getTag(collection); if (tag == mapTag || tag == setTag) { return collection.size; } return baseKeys(collection).length; } function some(collection, predicate, guard) { var func = isArray(collection) ? arraySome : baseSome; if (guard && isIterateeCall(collection, predicate, guard)) { predicate = undefined; } return func(collection, getIteratee(predicate, 3)); } var sortBy = baseRest(function (collection, iteratees) { if (collection == null) { return []; } var length = iteratees.length; if (length > 1 && isIterateeCall(collection, iteratees[0], iteratees[1])) { iteratees = []; } else if (length > 2 && isIterateeCall(iteratees[0], iteratees[1], iteratees[2])) { iteratees = [iteratees[0]]; } return baseOrderBy(collection, baseFlatten(iteratees, 1), []); }); var now = ctxNow || function () { return root.Date.now(); }; function after(n, func) { if (typeof func != 'function') { throw new TypeError(FUNC_ERROR_TEXT); } n = toInteger(n); return function () { if (--n < 1) { return func.apply(this, arguments); } }; } function ary(func, n, guard) { n = guard ? undefined : n; n = (func && n == null) ? func.length : n; return createWrap(func, WRAP_ARY_FLAG, undefined, undefined, undefined, undefined, n); } function before(n, func) { var result; if (typeof func != 'function') { throw new TypeError(FUNC_ERROR_TEXT); } n = toInteger(n); return function () { if (--n > 0) { result = func.apply(this, arguments); } if (n <= 1) { func = undefined; } return result; }; } var bind = baseRest(function (func, thisArg, partials) { var bitmask = WRAP_BIND_FLAG; if (partials.length) { var holders = replaceHolders(partials, getHolder(bind)); bitmask |= WRAP_PARTIAL_FLAG; } return createWrap(func, bitmask, thisArg, partials, holders); }); var bindKey = baseRest(function (object, key, partials) { var bitmask = WRAP_BIND_FLAG | WRAP_BIND_KEY_FLAG; if (partials.length) { var holders = replaceHolders(partials, getHolder(bindKey)); bitmask |= WRAP_PARTIAL_FLAG; } return createWrap(key, bitmask, object, partials, holders); }); function curry(func, arity, guard) { arity = guard ? undefined : arity; var result = createWrap(func, WRAP_CURRY_FLAG, undefined, undefined, undefined, undefined, undefined, arity); result.placeholder = curry.placeholder; return result; } function curryRight(func, arity, guard) { arity = guard ? undefined : arity; var result = createWrap(func, WRAP_CURRY_RIGHT_FLAG, undefined, undefined, undefined, undefined, undefined, arity); result.placeholder = curryRight.placeholder; return result; } function debounce(func, wait, options) { var lastArgs, lastThis, maxWait, result, timerId, lastCallTime, lastInvokeTime = 0, leading = false, maxing = false, trailing = true; if (typeof func != 'function') { throw new TypeError(FUNC_ERROR_TEXT); } wait = toNumber(wait) || 0; if (isObject(options)) { leading = !!options.leading; maxing = 'maxWait' in options; maxWait = maxing ? nativeMax(toNumber(options.maxWait) || 0, wait) : maxWait; trailing = 'trailing' in options ? !!options.trailing : trailing; } function invokeFunc(time) { var args = lastArgs, thisArg = lastThis; lastArgs = lastThis = undefined; lastInvokeTime = time; result = func.apply(thisArg, args); return result; } function leadingEdge(time) { lastInvokeTime = time; timerId = setTimeout(timerExpired, wait); return leading ? invokeFunc(time) : result; } function remainingWait(time) { var timeSinceLastCall = time - lastCallTime, timeSinceLastInvoke = time - lastInvokeTime, timeWaiting = wait - timeSinceLastCall; return maxing ? nativeMin(timeWaiting, maxWait - timeSinceLastInvoke) : timeWaiting; } function shouldInvoke(time) { var timeSinceLastCall = time - lastCallTime, timeSinceLastInvoke = time - lastInvokeTime; return (lastCallTime === undefined || (timeSinceLastCall >= wait) || (timeSinceLastCall < 0) || (maxing && timeSinceLastInvoke >= maxWait)); } function timerExpired() { var time = now(); if (shouldInvoke(time)) { return trailingEdge(time); } timerId = setTimeout(timerExpired, remainingWait(time)); } function trailingEdge(time) { timerId = undefined; if (trailing && lastArgs) { return invokeFunc(time); } lastArgs = lastThis = undefined; return result; } function cancel() { if (timerId !== undefined) { clearTimeout(timerId); } lastInvokeTime = 0; lastArgs = lastCallTime = lastThis = timerId = undefined; } function flush() { return timerId === undefined ? result : trailingEdge(now()); } function debounced() { var time = now(), isInvoking = shouldInvoke(time); lastArgs = arguments; lastThis = this; lastCallTime = time; if (isInvoking) { if (timerId === undefined) { return leadingEdge(lastCallTime); } if (maxing) { clearTimeout(timerId); timerId = setTimeout(timerExpired, wait); return invokeFunc(lastCallTime); } } if (timerId === undefined) { timerId = setTimeout(timerExpired, wait); } return result; } debounced.cancel = cancel; debounced.flush = flush; return debounced; } var defer = baseRest(function (func, args) { return baseDelay(func, 1, args); }); var delay = baseRest(function (func, wait, args) { return baseDelay(func, toNumber(wait) || 0, args); }); function flip(func) { return createWrap(func, WRAP_FLIP_FLAG); } function memoize(func, resolver) { if (typeof func != 'function' || (resolver != null && typeof resolver != 'function')) { throw new TypeError(FUNC_ERROR_TEXT); } var memoized = function () { var args = arguments, key = resolver ? resolver.apply(this, args) : args[0], cache = memoized.cache; if (cache.has(key)) { return cache.get(key); } var result = func.apply(this, args); memoized.cache = cache.set(key, result) || cache; return result; }; memoized.cache = new (memoize.Cache || MapCache); return memoized; } memoize.Cache = MapCache; function negate(predicate) { if (typeof predicate != 'function') { throw new TypeError(FUNC_ERROR_TEXT); } return function () { var args = arguments; switch (args.length) { case 0: return !predicate.call(this); case 1: return !predicate.call(this, args[0]); case 2: return !predicate.call(this, args[0], args[1]); case 3: return !predicate.call(this, args[0], args[1], args[2]); } return !predicate.apply(this, args); }; } function once(func) { return before(2, func); } var overArgs = castRest(function (func, transforms) { transforms = (transforms.length == 1 && isArray(transforms[0])) ? arrayMap(transforms[0], baseUnary(getIteratee())) : arrayMap(baseFlatten(transforms, 1), baseUnary(getIteratee())); var funcsLength = transforms.length; return baseRest(function (args) { var index = -1, length = nativeMin(args.length, funcsLength); while (++index < length) { args[index] = transforms[index].call(this, args[index]); } return apply(func, this, args); }); }); var partial = baseRest(function (func, partials) { var holders = replaceHolders(partials, getHolder(partial)); return createWrap(func, WRAP_PARTIAL_FLAG, undefined, partials, holders); }); var partialRight = baseRest(function (func, partials) { var holders = replaceHolders(partials, getHolder(partialRight)); return createWrap(func, WRAP_PARTIAL_RIGHT_FLAG, undefined, partials, holders); }); var rearg = flatRest(function (func, indexes) { return createWrap(func, WRAP_REARG_FLAG, undefined, undefined, undefined, indexes); }); function rest(func, start) { if (typeof func != 'function') { throw new TypeError(FUNC_ERROR_TEXT); } start = start === undefined ? start : toInteger(start); return baseRest(func, start); } function spread(func, start) { if (typeof func != 'function') { throw new TypeError(FUNC_ERROR_TEXT); } start = start == null ? 0 : nativeMax(toInteger(start), 0); return baseRest(function (args) { var array = args[start], otherArgs = castSlice(args, 0, start); if (array) { arrayPush(otherArgs, array); } return apply(func, this, otherArgs); }); } function throttle(func, wait, options) { var leading = true, trailing = true; if (typeof func != 'function') { throw new TypeError(FUNC_ERROR_TEXT); } if (isObject(options)) { leading = 'leading' in options ? !!options.leading : leading; trailing = 'trailing' in options ? !!options.trailing : trailing; } return debounce(func, wait, { 'leading': leading, 'maxWait': wait, 'trailing': trailing }); } function unary(func) { return ary(func, 1); } function wrap(value, wrapper) { return partial(castFunction(wrapper), value); } function castArray() { if (!arguments.length) { return []; } var value = arguments[0]; return isArray(value) ? value : [value]; } function clone(value) { return baseClone(value, CLONE_SYMBOLS_FLAG); } function cloneWith(value, customizer) { customizer = typeof customizer == 'function' ? customizer : undefined; return baseClone(value, CLONE_SYMBOLS_FLAG, customizer); } function cloneDeep(value) { return baseClone(value, CLONE_DEEP_FLAG | CLONE_SYMBOLS_FLAG); } function cloneDeepWith(value, customizer) { customizer = typeof customizer == 'function' ? customizer : undefined; return baseClone(value, CLONE_DEEP_FLAG | CLONE_SYMBOLS_FLAG, customizer); } function conformsTo(object, source) { return source == null || baseConformsTo(object, source, keys(source)); } function eq(value, other) { return value === other || (value !== value && other !== other); } var gt = createRelationalOperation(baseGt); var gte = createRelationalOperation(function (value, other) { return value >= other; }); var isArguments = baseIsArguments(function () { return arguments; }()) ? baseIsArguments : function (value) { return isObjectLike(value) && hasOwnProperty.call(value, 'callee') && !propertyIsEnumerable.call(value, 'callee'); }; var isArray = Array.isArray; var isArrayBuffer = nodeIsArrayBuffer ? baseUnary(nodeIsArrayBuffer) : baseIsArrayBuffer; function isArrayLike(value) { return value != null && isLength(value.length) && !isFunction(value); } function isArrayLikeObject(value) { return isObjectLike(value) && isArrayLike(value); } function isBoolean(value) { return value === true || value === false || (isObjectLike(value) && baseGetTag(value) == boolTag); } var isBuffer = nativeIsBuffer || stubFalse; var isDate = nodeIsDate ? baseUnary(nodeIsDate) : baseIsDate; function isElement(value) { return isObjectLike(value) && value.nodeType === 1 && !isPlainObject(value); } function isEmpty(value) { if (value == null) { return true; } if (isArrayLike(value) && (isArray(value) || typeof value == 'string' || typeof value.splice == 'function' || isBuffer(value) || isTypedArray(value) || isArguments(value))) { return !value.length; } var tag = getTag(value); if (tag == mapTag || tag == setTag) { return !value.size; } if (isPrototype(value)) { return !baseKeys(value).length; } for (var key in value) { if (hasOwnProperty.call(value, key)) { return false; } } return true; } function isEqual(value, other) { return baseIsEqual(value, other); } function isEqualWith(value, other, customizer) { customizer = typeof customizer == 'function' ? customizer : undefined; var result = customizer ? customizer(value, other) : undefined; return result === undefined ? baseIsEqual(value, other, undefined, customizer) : !!result; } function isError(value) { if (!isObjectLike(value)) { return false; } var tag = baseGetTag(value); return tag == errorTag || tag == domExcTag || (typeof value.message == 'string' && typeof value.name == 'string' && !isPlainObject(value)); } function isFinite(value) { return typeof value == 'number' && nativeIsFinite(value); } function isFunction(value) { if (!isObject(value)) { return false; } var tag = baseGetTag(value); return tag == funcTag || tag == genTag || tag == asyncTag || tag == proxyTag; } function isInteger(value) { return typeof value == 'number' && value == toInteger(value); } function isLength(value) { return typeof value == 'number' && value > -1 && value % 1 == 0 && value <= MAX_SAFE_INTEGER; } function isObject(value) { var type = typeof value; return value != null && (type == 'object' || type == 'function'); } function isObjectLike(value) { return value != null && typeof value == 'object'; } var isMap = nodeIsMap ? baseUnary(nodeIsMap) : baseIsMap; function isMatch(object, source) { return object === source || baseIsMatch(object, source, getMatchData(source)); } function isMatchWith(object, source, customizer) { customizer = typeof customizer == 'function' ? customizer : undefined; return baseIsMatch(object, source, getMatchData(source), customizer); } function isNaN(value) { return isNumber(value) && value != +value; } function isNative(value) { if (isMaskable(value)) { throw new Error(CORE_ERROR_TEXT); } return baseIsNative(value); } function isNull(value) { return value === null; } function isNil(value) { return value == null; } function isNumber(value) { return typeof value == 'number' || (isObjectLike(value) && baseGetTag(value) == numberTag); } function isPlainObject(value) { if (!isObjectLike(value) || baseGetTag(value) != objectTag) { return false; } var proto = getPrototype(value); if (proto === null) { return true; } var Ctor = hasOwnProperty.call(proto, 'constructor') && proto.constructor; return typeof Ctor == 'function' && Ctor instanceof Ctor && funcToString.call(Ctor) == objectCtorString; } var isRegExp = nodeIsRegExp ? baseUnary(nodeIsRegExp) : baseIsRegExp; function isSafeInteger(value) { return isInteger(value) && value >= -MAX_SAFE_INTEGER && value <= MAX_SAFE_INTEGER; } var isSet = nodeIsSet ? baseUnary(nodeIsSet) : baseIsSet; function isString(value) { return typeof value == 'string' || (!isArray(value) && isObjectLike(value) && baseGetTag(value) == stringTag); } function isSymbol(value) { return typeof value == 'symbol' || (isObjectLike(value) && baseGetTag(value) == symbolTag); } var isTypedArray = nodeIsTypedArray ? baseUnary(nodeIsTypedArray) : baseIsTypedArray; function isUndefined(value) { return value === undefined; } function isWeakMap(value) { return isObjectLike(value) && getTag(value) == weakMapTag; } function isWeakSet(value) { return isObjectLike(value) && baseGetTag(value) == weakSetTag; } var lt = createRelationalOperation(baseLt); var lte = createRelationalOperation(function (value, other) { return value <= other; }); function toArray(value) { if (!value) { return []; } if (isArrayLike(value)) { return isString(value) ? stringToArray(value) : copyArray(value); } if (symIterator && value[symIterator]) { return iteratorToArray(value[symIterator]()); } var tag = getTag(value), func = tag == mapTag ? mapToArray : (tag == setTag ? setToArray : values); return func(value); } function toFinite(value) { if (!value) { return value === 0 ? value : 0; } value = toNumber(value); if (value === INFINITY || value === -INFINITY) { var sign = (value < 0 ? -1 : 1); return sign * MAX_INTEGER; } return value === value ? value : 0; } function toInteger(value) { var result = toFinite(value), remainder = result % 1; return result === result ? (remainder ? result - remainder : result) : 0; } function toLength(value) { return value ? baseClamp(toInteger(value), 0, MAX_ARRAY_LENGTH) : 0; } function toNumber(value) { if (typeof value == 'number') { return value; } if (isSymbol(value)) { return NAN; } if (isObject(value)) { var other = typeof value.valueOf == 'function' ? value.valueOf() : value; value = isObject(other) ? (other + ) : other; } if (typeof value != 'string') { return value === 0 ? value : +value; } value = value.replace(reTrim, ); var isBinary = reIsBinary.test(value); return (isBinary || reIsOctal.test(value)) ? freeParseInt(value.slice(2), isBinary ? 2 : 8) : (reIsBadHex.test(value) ? NAN : +value); } function toPlainObject(value) { return copyObject(value, keysIn(value)); } function toSafeInteger(value) { return value ? baseClamp(toInteger(value), -MAX_SAFE_INTEGER, MAX_SAFE_INTEGER) : (value === 0 ? value : 0); } function toString(value) { return value == null ? : baseToString(value); } var assign = createAssigner(function (object, source) { if (isPrototype(source) || isArrayLike(source)) { copyObject(source, keys(source), object); return; } for (var key in source) { if (hasOwnProperty.call(source, key)) { assignValue(object, key, source[key]); } } }); var assignIn = createAssigner(function (object, source) { copyObject(source, keysIn(source), object); }); var assignInWith = createAssigner(function (object, source, srcIndex, customizer) { copyObject(source, keysIn(source), object, customizer); }); var assignWith = createAssigner(function (object, source, srcIndex, customizer) { copyObject(source, keys(source), object, customizer); }); var at = flatRest(baseAt); function create(prototype, properties) { var result = baseCreate(prototype); return properties == null ? result : baseAssign(result, properties); } var defaults = baseRest(function (object, sources) { object = Object(object); var index = -1; var length = sources.length; var guard = length > 2 ? sources[2] : undefined; if (guard && isIterateeCall(sources[0], sources[1], guard)) { length = 1; } while (++index < length) { var source = sources[index]; var props = keysIn(source); var propsIndex = -1; var propsLength = props.length; while (++propsIndex < propsLength) { var key = props[propsIndex]; var value = object[key]; if (value === undefined || (eq(value, objectProto[key]) && !hasOwnProperty.call(object, key))) { object[key] = source[key]; } } } return object; }); var defaultsDeep = baseRest(function (args) { args.push(undefined, customDefaultsMerge); return apply(mergeWith, undefined, args); }); function findKey(object, predicate) { return baseFindKey(object, getIteratee(predicate, 3), baseForOwn); } function findLastKey(object, predicate) { return baseFindKey(object, getIteratee(predicate, 3), baseForOwnRight); } function forIn(object, iteratee) { return object == null ? object : baseFor(object, getIteratee(iteratee, 3), keysIn); } function forInRight(object, iteratee) { return object == null ? object : baseForRight(object, getIteratee(iteratee, 3), keysIn); } function forOwn(object, iteratee) { return object && baseForOwn(object, getIteratee(iteratee, 3)); } function forOwnRight(object, iteratee) { return object && baseForOwnRight(object, getIteratee(iteratee, 3)); } function functions(object) { return object == null ? [] : baseFunctions(object, keys(object)); } function functionsIn(object) { return object == null ? [] : baseFunctions(object, keysIn(object)); } function get(object, path, defaultValue) { var result = object == null ? undefined : baseGet(object, path); return result === undefined ? defaultValue : result; } function has(object, path) { return object != null && hasPath(object, path, baseHas); } function hasIn(object, path) { return object != null && hasPath(object, path, baseHasIn); } var invert = createInverter(function (result, value, key) { if (value != null && typeof value.toString != 'function') { value = nativeObjectToString.call(value); } result[value] = key; }, constant(identity)); var invertBy = createInverter(function (result, value, key) { if (value != null && typeof value.toString != 'function') { value = nativeObjectToString.call(value); } if (hasOwnProperty.call(result, value)) { result[value].push(key); } else { result[value] = [key]; } }, getIteratee); var invoke = baseRest(baseInvoke); function keys(object) { return isArrayLike(object) ? arrayLikeKeys(object) : baseKeys(object); } function keysIn(object) { return isArrayLike(object) ? arrayLikeKeys(object, true) : baseKeysIn(object); } function mapKeys(object, iteratee) { var result = {}; iteratee = getIteratee(iteratee, 3); baseForOwn(object, function (value, key, object) { baseAssignValue(result, iteratee(value, key, object), value); }); return result; } function mapValues(object, iteratee) { var result = {}; iteratee = getIteratee(iteratee, 3); baseForOwn(object, function (value, key, object) { baseAssignValue(result, key, iteratee(value, key, object)); }); return result; } var merge = createAssigner(function (object, source, srcIndex) { baseMerge(object, source, srcIndex); }); var mergeWith = createAssigner(function (object, source, srcIndex, customizer) { baseMerge(object, source, srcIndex, customizer); }); var omit = flatRest(function (object, paths) { var result = {}; if (object == null) { return result; } var isDeep = false; paths = arrayMap(paths, function (path) { path = castPath(path, object); isDeep || (isDeep = path.length > 1); return path; }); copyObject(object, getAllKeysIn(object), result); if (isDeep) { result = baseClone(result, CLONE_DEEP_FLAG | CLONE_FLAT_FLAG | CLONE_SYMBOLS_FLAG, customOmitClone); } var length = paths.length; while (length--) { baseUnset(result, paths[length]); } return result; }); function omitBy(object, predicate) { return pickBy(object, negate(getIteratee(predicate))); } var pick = flatRest(function (object, paths) { return object == null ? {} : basePick(object, paths); }); function pickBy(object, predicate) { if (object == null) { return {}; } var props = arrayMap(getAllKeysIn(object), function (prop) { return [prop]; }); predicate = getIteratee(predicate); return basePickBy(object, props, function (value, path) { return predicate(value, path[0]); }); } function result(object, path, defaultValue) { path = castPath(path, object); var index = -1, length = path.length; if (!length) { length = 1; object = undefined; } while (++index < length) { var value = object == null ? undefined : object[toKey(path[index])]; if (value === undefined) { index = length; value = defaultValue; } object = isFunction(value) ? value.call(object) : value; } return object; } function set(object, path, value) { return object == null ? object : baseSet(object, path, value); } function setWith(object, path, value, customizer) { customizer = typeof customizer == 'function' ? customizer : undefined; return object == null ? object : baseSet(object, path, value, customizer); } var toPairs = createToPairs(keys); var toPairsIn = createToPairs(keysIn); function transform(object, iteratee, accumulator) { var isArr = isArray(object), isArrLike = isArr || isBuffer(object) || isTypedArray(object); iteratee = getIteratee(iteratee, 4); if (accumulator == null) { var Ctor = object && object.constructor; if (isArrLike) { accumulator = isArr ? new Ctor : []; } else if (isObject(object)) { accumulator = isFunction(Ctor) ? baseCreate(getPrototype(object)) : {}; } else { accumulator = {}; } } (isArrLike ? arrayEach : baseForOwn)(object, function (value, index, object) { return iteratee(accumulator, value, index, object); }); return accumulator; } function unset(object, path) { return object == null ? true : baseUnset(object, path); } function update(object, path, updater) { return object == null ? object : baseUpdate(object, path, castFunction(updater)); } function updateWith(object, path, updater, customizer) { customizer = typeof customizer == 'function' ? customizer : undefined; return object == null ? object : baseUpdate(object, path, castFunction(updater), customizer); } function values(object) { return object == null ? [] : baseValues(object, keys(object)); } function valuesIn(object) { return object == null ? [] : baseValues(object, keysIn(object)); } function clamp(number, lower, upper) { if (upper === undefined) { upper = lower; lower = undefined; } if (upper !== undefined) { upper = toNumber(upper); upper = upper === upper ? upper : 0; } if (lower !== undefined) { lower = toNumber(lower); lower = lower === lower ? lower : 0; } return baseClamp(toNumber(number), lower, upper); } function inRange(number, start, end) { start = toFinite(start); if (end === undefined) { end = start; start = 0; } else { end = toFinite(end); } number = toNumber(number); return baseInRange(number, start, end); } function random(lower, upper, floating) { if (floating && typeof floating != 'boolean' && isIterateeCall(lower, upper, floating)) { upper = floating = undefined; } if (floating === undefined) { if (typeof upper == 'boolean') { floating = upper; upper = undefined; } else if (typeof lower == 'boolean') { floating = lower; lower = undefined; } } if (lower === undefined && upper === undefined) { lower = 0; upper = 1; } else { lower = toFinite(lower); if (upper === undefined) { upper = lower; lower = 0; } else { upper = toFinite(upper); } } if (lower > upper) { var temp = lower; lower = upper; upper = temp; } if (floating || lower % 1 || upper % 1) { var rand = nativeRandom(); return nativeMin(lower + (rand * (upper - lower + freeParseFloat('1e-' + ((rand + ).length - 1)))), upper); } return baseRandom(lower, upper); } var camelCase = createCompounder(function (result, word, index) { word = word.toLowerCase(); return result + (index ? capitalize(word) : word); }); function capitalize(string) { return upperFirst(toString(string).toLowerCase()); } function deburr(string) { string = toString(string); return string && string.replace(reLatin, deburrLetter).replace(reComboMark, ); } function endsWith(string, target, position) { string = toString(string); target = baseToString(target); var length = string.length; position = position === undefined ? length : baseClamp(toInteger(position), 0, length); var end = position; position -= target.length; return position >= 0 && string.slice(position, end) == target; } function escape(string) { string = toString(string); return (string && reHasUnescapedHtml.test(string)) ? string.replace(reUnescapedHtml, escapeHtmlChar) : string; } function escapeRegExp(string) { string = toString(string); return (string && reHasRegExpChar.test(string)) ? string.replace(reRegExpChar, '\\$&') : string; } var kebabCase = createCompounder(function (result, word, index) { return result + (index ? '-' : ) + word.toLowerCase(); }); var lowerCase = createCompounder(function (result, word, index) { return result + (index ? ' ' : ) + word.toLowerCase(); }); var lowerFirst = createCaseFirst('toLowerCase'); function pad(string, length, chars) { string = toString(string); length = toInteger(length); var strLength = length ? stringSize(string) : 0; if (!length || strLength >= length) { return string; } var mid = (length - strLength) / 2; return (createPadding(nativeFloor(mid), chars) + string + createPadding(nativeCeil(mid), chars)); } function padEnd(string, length, chars) { string = toString(string); length = toInteger(length); var strLength = length ? stringSize(string) : 0; return (length && strLength < length) ? (string + createPadding(length - strLength, chars)) : string; } function padStart(string, length, chars) { string = toString(string); length = toInteger(length); var strLength = length ? stringSize(string) : 0; return (length && strLength < length) ? (createPadding(length - strLength, chars) + string) : string; } function parseInt(string, radix, guard) { if (guard || radix == null) { radix = 0; } else if (radix) { radix = +radix; } return nativeParseInt(toString(string).replace(reTrimStart, ), radix || 0); } function repeat(string, n, guard) { if ((guard ? isIterateeCall(string, n, guard) : n === undefined)) { n = 1; } else { n = toInteger(n); } return baseRepeat(toString(string), n); } function replace() { var args = arguments, string = toString(args[0]); return args.length < 3 ? string : string.replace(args[1], args[2]); } var snakeCase = createCompounder(function (result, word, index) { return result + (index ? '_' : ) + word.toLowerCase(); }); function split(string, separator, limit) { if (limit && typeof limit != 'number' && isIterateeCall(string, separator, limit)) { separator = limit = undefined; } limit = limit === undefined ? MAX_ARRAY_LENGTH : limit >>> 0; if (!limit) { return []; } string = toString(string); if (string && (typeof separator == 'string' || (separator != null && !isRegExp(separator)))) { separator = baseToString(separator); if (!separator && hasUnicode(string)) { return castSlice(stringToArray(string), 0, limit); } } return string.split(separator, limit); } var startCase = createCompounder(function (result, word, index) { return result + (index ? ' ' : ) + upperFirst(word); }); function startsWith(string, target, position) { string = toString(string); position = position == null ? 0 : baseClamp(toInteger(position), 0, string.length); target = baseToString(target); return string.slice(position, position + target.length) == target; } function template(string, options, guard) { var settings = lodash.templateSettings; if (guard && isIterateeCall(string, options, guard)) { options = undefined; } string = toString(string); options = assignInWith({}, options, settings, customDefaultsAssignIn); var imports = assignInWith({}, options.imports, settings.imports, customDefaultsAssignIn), importsKeys = keys(imports), importsValues = baseValues(imports, importsKeys); var isEscaping, isEvaluating, index = 0, interpolate = options.interpolate || reNoMatch, source = "__p += '"; var reDelimiters = RegExp((options.escape || reNoMatch).source + '|' + interpolate.source + '|' + (interpolate === reInterpolate ? reEsTemplate : reNoMatch).source + '|' + (options.evaluate || reNoMatch).source + '|$', 'g'); var sourceURL = '//# sourceURL=' + (hasOwnProperty.call(options, 'sourceURL') ? (options.sourceURL + ).replace(/[\r\n]/g, ' ') : ('lodash.templateSources[' + (++templateCounter) + ']')) + '\n'; string.replace(reDelimiters, function (match, escapeValue, interpolateValue, esTemplateValue, evaluateValue, offset) { interpolateValue || (interpolateValue = esTemplateValue); source += string.slice(index, offset).replace(reUnescapedString, escapeStringChar); if (escapeValue) { isEscaping = true; source += "' +\n__e(" + escapeValue + ") +\n'"; } if (evaluateValue) { isEvaluating = true; source += "';\n" + evaluateValue + ";\n__p += '"; } if (interpolateValue) { source += "' +\n((__t = (" + interpolateValue + ")) == null ? : __t) +\n'"; } index = offset + match.length; return match; }); source += "';\n"; var variable = hasOwnProperty.call(options, 'variable') && options.variable; if (!variable) { source = 'with (obj) {\n' + source + '\n}\n'; } source = (isEvaluating ? source.replace(reEmptyStringLeading, ) : source) .replace(reEmptyStringMiddle, '$1') .replace(reEmptyStringTrailing, '$1;'); source = 'function(' + (variable || 'obj') + ') {\n' + (variable ? : 'obj || (obj = {});\n') + "var __t, __p = " + (isEscaping ? ', __e = _.escape' : ) + (isEvaluating ? ', __j = Array.prototype.join;\n' + "function print() { __p += __j.call(arguments, ) }\n" : ';\n') + source + 'return __p\n}'; var result = attempt(function () { return Function(importsKeys, sourceURL + 'return ' + source) .apply(undefined, importsValues); }); result.source = source; if (isError(result)) { throw result; } return result; } function toLower(value) { return toString(value).toLowerCase(); } function toUpper(value) { return toString(value).toUpperCase(); } function trim(string, chars, guard) { string = toString(string); if (string && (guard || chars === undefined)) { return string.replace(reTrim, ); } if (!string || !(chars = baseToString(chars))) { return string; } var strSymbols = stringToArray(string), chrSymbols = stringToArray(chars), start = charsStartIndex(strSymbols, chrSymbols), end = charsEndIndex(strSymbols, chrSymbols) + 1; return castSlice(strSymbols, start, end).join(); } function trimEnd(string, chars, guard) { string = toString(string); if (string && (guard || chars === undefined)) { return string.replace(reTrimEnd, ); } if (!string || !(chars = baseToString(chars))) { return string; } var strSymbols = stringToArray(string), end = charsEndIndex(strSymbols, stringToArray(chars)) + 1; return castSlice(strSymbols, 0, end).join(); } function trimStart(string, chars, guard) { string = toString(string); if (string && (guard || chars === undefined)) { return string.replace(reTrimStart, ); } if (!string || !(chars = baseToString(chars))) { return string; } var strSymbols = stringToArray(string), start = charsStartIndex(strSymbols, stringToArray(chars)); return castSlice(strSymbols, start).join(); } function truncate(string, options) { var length = DEFAULT_TRUNC_LENGTH, omission = DEFAULT_TRUNC_OMISSION; if (isObject(options)) { var separator = 'separator' in options ? options.separator : separator; length = 'length' in options ? toInteger(options.length) : length; omission = 'omission' in options ? baseToString(options.omission) : omission; } string = toString(string); var strLength = string.length; if (hasUnicode(string)) { var strSymbols = stringToArray(string); strLength = strSymbols.length; } if (length >= strLength) { return string; } var end = length - stringSize(omission); if (end < 1) { return omission; } var result = strSymbols ? castSlice(strSymbols, 0, end).join() : string.slice(0, end); if (separator === undefined) { return result + omission; } if (strSymbols) { end += (result.length - end); } if (isRegExp(separator)) { if (string.slice(end).search(separator)) { var match, substring = result; if (!separator.global) { separator = RegExp(separator.source, toString(reFlags.exec(separator)) + 'g'); } separator.lastIndex = 0; while ((match = separator.exec(substring))) { var newEnd = match.index; } result = result.slice(0, newEnd === undefined ? end : newEnd); } } else if (string.indexOf(baseToString(separator), end) != end) { var index = result.lastIndexOf(separator); if (index > -1) { result = result.slice(0, index); } } return result + omission; } function unescape(string) { string = toString(string); return (string && reHasEscapedHtml.test(string)) ? string.replace(reEscapedHtml, unescapeHtmlChar) : string; } var upperCase = createCompounder(function (result, word, index) { return result + (index ? ' ' : ) + word.toUpperCase(); }); var upperFirst = createCaseFirst('toUpperCase'); function words(string, pattern, guard) { string = toString(string); pattern = guard ? undefined : pattern; if (pattern === undefined) { return hasUnicodeWord(string) ? unicodeWords(string) : asciiWords(string); } return string.match(pattern) || []; } var attempt = baseRest(function (func, args) { try { return apply(func, undefined, args); } catch (e) { return isError(e) ? e : new Error(e); } }); var bindAll = flatRest(function (object, methodNames) { arrayEach(methodNames, function (key) { key = toKey(key); baseAssignValue(object, key, bind(object[key], object)); }); return object; }); function cond(pairs) { var length = pairs == null ? 0 : pairs.length, toIteratee = getIteratee(); pairs = !length ? [] : arrayMap(pairs, function (pair) { if (typeof pair[1] != 'function') { throw new TypeError(FUNC_ERROR_TEXT); } return [toIteratee(pair[0]), pair[1]]; }); return baseRest(function (args) { var index = -1; while (++index < length) { var pair = pairs[index]; if (apply(pair[0], this, args)) { return apply(pair[1], this, args); } } }); } function conforms(source) { return baseConforms(baseClone(source, CLONE_DEEP_FLAG)); } function constant(value) { return function () { return value; }; } function defaultTo(value, defaultValue) { return (value == null || value !== value) ? defaultValue : value; } var flow = createFlow(); var flowRight = createFlow(true); function identity(value) { return value; } function iteratee(func) { return baseIteratee(typeof func == 'function' ? func : baseClone(func, CLONE_DEEP_FLAG)); } function matches(source) { return baseMatches(baseClone(source, CLONE_DEEP_FLAG)); } function matchesProperty(path, srcValue) { return baseMatchesProperty(path, baseClone(srcValue, CLONE_DEEP_FLAG)); } var method = baseRest(function (path, args) { return function (object) { return baseInvoke(object, path, args); }; }); var methodOf = baseRest(function (object, args) { return function (path) { return baseInvoke(object, path, args); }; }); function mixin(object, source, options) { var props = keys(source), methodNames = baseFunctions(source, props); if (options == null && !(isObject(source) && (methodNames.length || !props.length))) { options = source; source = object; object = this; methodNames = baseFunctions(source, keys(source)); } var chain = !(isObject(options) && 'chain' in options) || !!options.chain, isFunc = isFunction(object); arrayEach(methodNames, function (methodName) { var func = source[methodName]; object[methodName] = func; if (isFunc) { object.prototype[methodName] = function () { var chainAll = this.__chain__; if (chain || chainAll) { var result = object(this.__wrapped__), actions = result.__actions__ = copyArray(this.__actions__); actions.push({ 'func': func, 'args': arguments, 'thisArg': object }); result.__chain__ = chainAll; return result; } return func.apply(object, arrayPush([this.value()], arguments)); }; } }); return object; } function noConflict() { if (root._ === this) { root._ = oldDash; } return this; } function noop() { } function nthArg(n) { n = toInteger(n); return baseRest(function (args) { return baseNth(args, n); }); } var over = createOver(arrayMap); var overEvery = createOver(arrayEvery); var overSome = createOver(arraySome); function property(path) { return isKey(path) ? baseProperty(toKey(path)) : basePropertyDeep(path); } function propertyOf(object) { return function (path) { return object == null ? undefined : baseGet(object, path); }; } var range = createRange(); var rangeRight = createRange(true); function stubArray() { return []; } function stubFalse() { return false; } function stubObject() { return {}; } function stubString() { return ; } function stubTrue() { return true; } function times(n, iteratee) { n = toInteger(n); if (n < 1 || n > MAX_SAFE_INTEGER) { return []; } var index = MAX_ARRAY_LENGTH, length = nativeMin(n, MAX_ARRAY_LENGTH); iteratee = getIteratee(iteratee); n -= MAX_ARRAY_LENGTH; var result = baseTimes(length, iteratee); while (++index < n) { iteratee(index); } return result; } function toPath(value) { if (isArray(value)) { return arrayMap(value, toKey); } return isSymbol(value) ? [value] : copyArray(stringToPath(toString(value))); } function uniqueId(prefix) { var id = ++idCounter; return toString(prefix) + id; } var add = createMathOperation(function (augend, addend) { return augend + addend; }, 0); var ceil = createRound('ceil'); var divide = createMathOperation(function (dividend, divisor) { return dividend / divisor; }, 1); var floor = createRound('floor'); function max(array) { return (array && array.length) ? baseExtremum(array, identity, baseGt) : undefined; } function maxBy(array, iteratee) { return (array && array.length) ? baseExtremum(array, getIteratee(iteratee, 2), baseGt) : undefined; } function mean(array) { return baseMean(array, identity); } function meanBy(array, iteratee) { return baseMean(array, getIteratee(iteratee, 2)); } function min(array) { return (array && array.length) ? baseExtremum(array, identity, baseLt) : undefined; } function minBy(array, iteratee) { return (array && array.length) ? baseExtremum(array, getIteratee(iteratee, 2), baseLt) : undefined; } var multiply = createMathOperation(function (multiplier, multiplicand) { return multiplier * multiplicand; }, 1); var round = createRound('round'); var subtract = createMathOperation(function (minuend, subtrahend) { return minuend - subtrahend; }, 0); function sum(array) { return (array && array.length) ? baseSum(array, identity) : 0; } function sumBy(array, iteratee) { return (array && array.length) ? baseSum(array, getIteratee(iteratee, 2)) : 0; } lodash.after = after; lodash.ary = ary; lodash.assign = assign; lodash.assignIn = assignIn; lodash.assignInWith = assignInWith; lodash.assignWith = assignWith; lodash.at = at; lodash.before = before; lodash.bind = bind; lodash.bindAll = bindAll; lodash.bindKey = bindKey; lodash.castArray = castArray; lodash.chain = chain; lodash.chunk = chunk; lodash.compact = compact; lodash.concat = concat; lodash.cond = cond; lodash.conforms = conforms; lodash.constant = constant; lodash.countBy = countBy; lodash.create = create; lodash.curry = curry; lodash.curryRight = curryRight; lodash.debounce = debounce; lodash.defaults = defaults; lodash.defaultsDeep = defaultsDeep; lodash.defer = defer; lodash.delay = delay; lodash.difference = difference; lodash.differenceBy = differenceBy; lodash.differenceWith = differenceWith; lodash.drop = drop; lodash.dropRight = dropRight; lodash.dropRightWhile = dropRightWhile; lodash.dropWhile = dropWhile; lodash.fill = fill; lodash.filter = filter; lodash.flatMap = flatMap; lodash.flatMapDeep = flatMapDeep; lodash.flatMapDepth = flatMapDepth; lodash.flatten = flatten; lodash.flattenDeep = flattenDeep; lodash.flattenDepth = flattenDepth; lodash.flip = flip; lodash.flow = flow; lodash.flowRight = flowRight; lodash.fromPairs = fromPairs; lodash.functions = functions; lodash.functionsIn = functionsIn; lodash.groupBy = groupBy; lodash.initial = initial; lodash.intersection = intersection; lodash.intersectionBy = intersectionBy; lodash.intersectionWith = intersectionWith; lodash.invert = invert; lodash.invertBy = invertBy; lodash.invokeMap = invokeMap; lodash.iteratee = iteratee; lodash.keyBy = keyBy; lodash.keys = keys; lodash.keysIn = keysIn; lodash.map = map; lodash.mapKeys = mapKeys; lodash.mapValues = mapValues; lodash.matches = matches; lodash.matchesProperty = matchesProperty; lodash.memoize = memoize; lodash.merge = merge; lodash.mergeWith = mergeWith; lodash.method = method; lodash.methodOf = methodOf; lodash.mixin = mixin; lodash.negate = negate; lodash.nthArg = nthArg; lodash.omit = omit; lodash.omitBy = omitBy; lodash.once = once; lodash.orderBy = orderBy; lodash.over = over; lodash.overArgs = overArgs; lodash.overEvery = overEvery; lodash.overSome = overSome; lodash.partial = partial; lodash.partialRight = partialRight; lodash.partition = partition; lodash.pick = pick; lodash.pickBy = pickBy; lodash.property = property; lodash.propertyOf = propertyOf; lodash.pull = pull; lodash.pullAll = pullAll; lodash.pullAllBy = pullAllBy; lodash.pullAllWith = pullAllWith; lodash.pullAt = pullAt; lodash.range = range; lodash.rangeRight = rangeRight; lodash.rearg = rearg; lodash.reject = reject; lodash.remove = remove; lodash.rest = rest; lodash.reverse = reverse; lodash.sampleSize = sampleSize; lodash.set = set; lodash.setWith = setWith; lodash.shuffle = shuffle; lodash.slice = slice; lodash.sortBy = sortBy; lodash.sortedUniq = sortedUniq; lodash.sortedUniqBy = sortedUniqBy; lodash.split = split; lodash.spread = spread; lodash.tail = tail; lodash.take = take; lodash.takeRight = takeRight; lodash.takeRightWhile = takeRightWhile; lodash.takeWhile = takeWhile; lodash.tap = tap; lodash.throttle = throttle; lodash.thru = thru; lodash.toArray = toArray; lodash.toPairs = toPairs; lodash.toPairsIn = toPairsIn; lodash.toPath = toPath; lodash.toPlainObject = toPlainObject; lodash.transform = transform; lodash.unary = unary; lodash.union = union; lodash.unionBy = unionBy; lodash.unionWith = unionWith; lodash.uniq = uniq; lodash.uniqBy = uniqBy; lodash.uniqWith = uniqWith; lodash.unset = unset; lodash.unzip = unzip; lodash.unzipWith = unzipWith; lodash.update = update; lodash.updateWith = updateWith; lodash.values = values; lodash.valuesIn = valuesIn; lodash.without = without; lodash.words = words; lodash.wrap = wrap; lodash.xor = xor; lodash.xorBy = xorBy; lodash.xorWith = xorWith; lodash.zip = zip; lodash.zipObject = zipObject; lodash.zipObjectDeep = zipObjectDeep; lodash.zipWith = zipWith; lodash.entries = toPairs; lodash.entriesIn = toPairsIn; lodash.extend = assignIn; lodash.extendWith = assignInWith; mixin(lodash, lodash); lodash.add = add; lodash.attempt = attempt; lodash.camelCase = camelCase; lodash.capitalize = capitalize; lodash.ceil = ceil; lodash.clamp = clamp; lodash.clone = clone; lodash.cloneDeep = cloneDeep; lodash.cloneDeepWith = cloneDeepWith; lodash.cloneWith = cloneWith; lodash.conformsTo = conformsTo; lodash.deburr = deburr; lodash.defaultTo = defaultTo; lodash.divide = divide; lodash.endsWith = endsWith; lodash.eq = eq; lodash.escape = escape; lodash.escapeRegExp = escapeRegExp; lodash.every = every; lodash.find = find; lodash.findIndex = findIndex; lodash.findKey = findKey; lodash.findLast = findLast; lodash.findLastIndex = findLastIndex; lodash.findLastKey = findLastKey; lodash.floor = floor; lodash.forEach = forEach; lodash.forEachRight = forEachRight; lodash.forIn = forIn; lodash.forInRight = forInRight; lodash.forOwn = forOwn; lodash.forOwnRight = forOwnRight; lodash.get = get; lodash.gt = gt; lodash.gte = gte; lodash.has = has; lodash.hasIn = hasIn; lodash.head = head; lodash.identity = identity; lodash.includes = includes; lodash.indexOf = indexOf; lodash.inRange = inRange; lodash.invoke = invoke; lodash.isArguments = isArguments; lodash.isArray = isArray; lodash.isArrayBuffer = isArrayBuffer; lodash.isArrayLike = isArrayLike; lodash.isArrayLikeObject = isArrayLikeObject; lodash.isBoolean = isBoolean; lodash.isBuffer = isBuffer; lodash.isDate = isDate; lodash.isElement = isElement; lodash.isEmpty = isEmpty; lodash.isEqual = isEqual; lodash.isEqualWith = isEqualWith; lodash.isError = isError; lodash.isFinite = isFinite; lodash.isFunction = isFunction; lodash.isInteger = isInteger; lodash.isLength = isLength; lodash.isMap = isMap; lodash.isMatch = isMatch; lodash.isMatchWith = isMatchWith; lodash.isNaN = isNaN; lodash.isNative = isNative; lodash.isNil = isNil; lodash.isNull = isNull; lodash.isNumber = isNumber; lodash.isObject = isObject; lodash.isObjectLike = isObjectLike; lodash.isPlainObject = isPlainObject; lodash.isRegExp = isRegExp; lodash.isSafeInteger = isSafeInteger; lodash.isSet = isSet; lodash.isString = isString; lodash.isSymbol = isSymbol; lodash.isTypedArray = isTypedArray; lodash.isUndefined = isUndefined; lodash.isWeakMap = isWeakMap; lodash.isWeakSet = isWeakSet; lodash.join = join; lodash.kebabCase = kebabCase; lodash.last = last; lodash.lastIndexOf = lastIndexOf; lodash.lowerCase = lowerCase; lodash.lowerFirst = lowerFirst; lodash.lt = lt; lodash.lte = lte; lodash.max = max; lodash.maxBy = maxBy; lodash.mean = mean; lodash.meanBy = meanBy; lodash.min = min; lodash.minBy = minBy; lodash.stubArray = stubArray; lodash.stubFalse = stubFalse; lodash.stubObject = stubObject; lodash.stubString = stubString; lodash.stubTrue = stubTrue; lodash.multiply = multiply; lodash.nth = nth; lodash.noConflict = noConflict; lodash.noop = noop; lodash.now = now; lodash.pad = pad; lodash.padEnd = padEnd; lodash.padStart = padStart; lodash.parseInt = parseInt; lodash.random = random; lodash.reduce = reduce; lodash.reduceRight = reduceRight; lodash.repeat = repeat; lodash.replace = replace; lodash.result = result; lodash.round = round; lodash.runInContext = runInContext; lodash.sample = sample; lodash.size = size; lodash.snakeCase = snakeCase; lodash.some = some; lodash.sortedIndex = sortedIndex; lodash.sortedIndexBy = sortedIndexBy; lodash.sortedIndexOf = sortedIndexOf; lodash.sortedLastIndex = sortedLastIndex; lodash.sortedLastIndexBy = sortedLastIndexBy; lodash.sortedLastIndexOf = sortedLastIndexOf; lodash.startCase = startCase; lodash.startsWith = startsWith; lodash.subtract = subtract; lodash.sum = sum; lodash.sumBy = sumBy; lodash.template = template; lodash.times = times; lodash.toFinite = toFinite; lodash.toInteger = toInteger; lodash.toLength = toLength; lodash.toLower = toLower; lodash.toNumber = toNumber; lodash.toSafeInteger = toSafeInteger; lodash.toString = toString; lodash.toUpper = toUpper; lodash.trim = trim; lodash.trimEnd = trimEnd; lodash.trimStart = trimStart; lodash.truncate = truncate; lodash.unescape = unescape; lodash.uniqueId = uniqueId; lodash.upperCase = upperCase; lodash.upperFirst = upperFirst; lodash.each = forEach; lodash.eachRight = forEachRight; lodash.first = head; mixin(lodash, (function () { var source = {}; baseForOwn(lodash, function (func, methodName) { if (!hasOwnProperty.call(lodash.prototype, methodName)) { source[methodName] = func; } }); return source; }()), { 'chain': false }); lodash.VERSION = VERSION; arrayEach(['bind', 'bindKey', 'curry', 'curryRight', 'partial', 'partialRight'], function (methodName) { lodash[methodName].placeholder = lodash; }); arrayEach(['drop', 'take'], function (methodName, index) { LazyWrapper.prototype[methodName] = function (n) { n = n === undefined ? 1 : nativeMax(toInteger(n), 0); var result = (this.__filtered__ && !index) ? new LazyWrapper(this) : this.clone(); if (result.__filtered__) { result.__takeCount__ = nativeMin(n, result.__takeCount__); } else { result.__views__.push({ 'size': nativeMin(n, MAX_ARRAY_LENGTH), 'type': methodName + (result.__dir__ < 0 ? 'Right' : ) }); } return result; }; LazyWrapper.prototype[methodName + 'Right'] = function (n) { return this.reverse()[methodName](n).reverse(); }; }); arrayEach(['filter', 'map', 'takeWhile'], function (methodName, index) { var type = index + 1, isFilter = type == LAZY_FILTER_FLAG || type == LAZY_WHILE_FLAG; LazyWrapper.prototype[methodName] = function (iteratee) { var result = this.clone(); result.__iteratees__.push({ 'iteratee': getIteratee(iteratee, 3), 'type': type }); result.__filtered__ = result.__filtered__ || isFilter; return result; }; }); arrayEach(['head', 'last'], function (methodName, index) { var takeName = 'take' + (index ? 'Right' : ); LazyWrapper.prototype[methodName] = function () { return this[takeName](1).value()[0]; }; }); arrayEach(['initial', 'tail'], function (methodName, index) { var dropName = 'drop' + (index ? : 'Right'); LazyWrapper.prototype[methodName] = function () { return this.__filtered__ ? new LazyWrapper(this) : this[dropName](1); }; }); LazyWrapper.prototype.compact = function () { return this.filter(identity); }; LazyWrapper.prototype.find = function (predicate) { return this.filter(predicate).head(); }; LazyWrapper.prototype.findLast = function (predicate) { return this.reverse().find(predicate); }; LazyWrapper.prototype.invokeMap = baseRest(function (path, args) { if (typeof path == 'function') { return new LazyWrapper(this); } return this.map(function (value) { return baseInvoke(value, path, args); }); }); LazyWrapper.prototype.reject = function (predicate) { return this.filter(negate(getIteratee(predicate))); }; LazyWrapper.prototype.slice = function (start, end) { start = toInteger(start); var result = this; if (result.__filtered__ && (start > 0 || end < 0)) { return new LazyWrapper(result); } if (start < 0) { result = result.takeRight(-start); } else if (start) { result = result.drop(start); } if (end !== undefined) { end = toInteger(end); result = end < 0 ? result.dropRight(-end) : result.take(end - start); } return result; }; LazyWrapper.prototype.takeRightWhile = function (predicate) { return this.reverse().takeWhile(predicate).reverse(); }; LazyWrapper.prototype.toArray = function () { return this.take(MAX_ARRAY_LENGTH); }; baseForOwn(LazyWrapper.prototype, function (func, methodName) { var checkIteratee = /^(?:filter|find|map|reject)|While$/.test(methodName), isTaker = /^(?:head|last)$/.test(methodName), lodashFunc = lodash[isTaker ? ('take' + (methodName == 'last' ? 'Right' : )) : methodName], retUnwrapped = isTaker || /^find/.test(methodName); if (!lodashFunc) { return; } lodash.prototype[methodName] = function () { var value = this.__wrapped__, args = isTaker ? [1] : arguments, isLazy = value instanceof LazyWrapper, iteratee = args[0], useLazy = isLazy || isArray(value); var interceptor = function (value) { var result = lodashFunc.apply(lodash, arrayPush([value], args)); return (isTaker && chainAll) ? result[0] : result; }; if (useLazy && checkIteratee && typeof iteratee == 'function' && iteratee.length != 1) { isLazy = useLazy = false; } var chainAll = this.__chain__, isHybrid = !!this.__actions__.length, isUnwrapped = retUnwrapped && !chainAll, onlyLazy = isLazy && !isHybrid; if (!retUnwrapped && useLazy) { value = onlyLazy ? value : new LazyWrapper(this); var result = func.apply(value, args); result.__actions__.push({ 'func': thru, 'args': [interceptor], 'thisArg': undefined }); return new LodashWrapper(result, chainAll); } if (isUnwrapped && onlyLazy) { return func.apply(this, args); } result = this.thru(interceptor); return isUnwrapped ? (isTaker ? result.value()[0] : result.value()) : result; }; }); arrayEach(['pop', 'push', 'shift', 'sort', 'splice', 'unshift'], function (methodName) { var func = arrayProto[methodName], chainName = /^(?:push|sort|unshift)$/.test(methodName) ? 'tap' : 'thru', retUnwrapped = /^(?:pop|shift)$/.test(methodName); lodash.prototype[methodName] = function () { var args = arguments; if (retUnwrapped && !this.__chain__) { var value = this.value(); return func.apply(isArray(value) ? value : [], args); } return this[chainName](function (value) { return func.apply(isArray(value) ? value : [], args); }); }; }); baseForOwn(LazyWrapper.prototype, function (func, methodName) { var lodashFunc = lodash[methodName]; if (lodashFunc) { var key = lodashFunc.name + ; if (!hasOwnProperty.call(realNames, key)) { realNames[key] = []; } realNames[key].push({ 'name': methodName, 'func': lodashFunc }); } }); realNames[createHybrid(undefined, WRAP_BIND_KEY_FLAG).name] = [{ 'name': 'wrapper', 'func': undefined }]; LazyWrapper.prototype.clone = lazyClone; LazyWrapper.prototype.reverse = lazyReverse; LazyWrapper.prototype.value = lazyValue; lodash.prototype.at = wrapperAt; lodash.prototype.chain = wrapperChain; lodash.prototype.commit = wrapperCommit; lodash.prototype.next = wrapperNext; lodash.prototype.plant = wrapperPlant; lodash.prototype.reverse = wrapperReverse; lodash.prototype.toJSON = lodash.prototype.valueOf = lodash.prototype.value = wrapperValue; lodash.prototype.first = lodash.prototype.head; if (symIterator) { lodash.prototype[symIterator] = wrapperToIterator; } return lodash; }); var _ = runInContext(); if (typeof define == 'function' && typeof define.amd == 'object' && define.amd) { root._ = _; define(function () { return _; }); } else if (freeModule) { (freeModule.exports = _)._ = _; freeExports._ = _; } else { root._ = _; }
}.call(this));
} // react-pose/dist/react-pose.es.js $fsx.f[57] = (module, exports) => { "use strict"; Object.defineProperty(exports, "__esModule", { value: true }); const tslib_1 = $fsx.r(8); const react_1 = $fsx.r(3); const popmotion_pose_1 = $fsx.r(54); const is_prop_valid_1 = $fsx.r(56); const hey_listen_1 = $fsx.r(47); var hasChanged = function (prev, next) {
if (prev === next)
return false;
var prevIsArray = Array.isArray(prev);
var nextIsArray = Array.isArray(next);
if (prevIsArray !== nextIsArray || (!prevIsArray && !nextIsArray)) {
return true;
}
else if (prevIsArray && nextIsArray) {
var numPrev = prev.length;
var numNext = next.length;
if (numPrev !== numNext)
return true;
for (var i = 0; i < numPrev; i++) {
if (prev[i] !== next[i])
return true;
}
}
return false;
}; var pickAssign = function (shouldPick, sources) {
return sources.reduce(function (picked, source) {
for (var key in source) {
if (shouldPick(key)) {
picked[key] = source[key];
}
}
return picked;
}, {});
}; var _a = react_1.createContext({}), PoseParentConsumer = _a.Consumer, PoseParentProvider = _a.Provider; var calcPopFromFlowStyle = function (el) {
var offsetTop = el.offsetTop, offsetLeft = el.offsetLeft, offsetWidth = el.offsetWidth, offsetHeight = el.offsetHeight;
return {
position: 'absolute',
top: offsetTop,
left: offsetLeft,
width: offsetWidth,
height: offsetHeight
};
}; var hasPose = function (pose, key) {
return Array.isArray(pose) ? pose.indexOf(key) !== -1 : pose === key;
}; var objectToMap = function (obj) {
return Object.keys(obj).reduce(function (map, key) {
map.set(key, { raw: obj[key] });
return map;
}, new Map());
}; var testAlwaysTrue = function () { return true; }; var filterProps = function (_a) {
var elementType = _a.elementType, poseConfig = _a.poseConfig, onValueChange = _a.onValueChange, innerRef = _a.innerRef, _pose = _a._pose, pose = _a.pose, initialPose = _a.initialPose, poseKey = _a.poseKey, onPoseComplete = _a.onPoseComplete, getParentPoseConfig = _a.getParentPoseConfig, registerChild = _a.registerChild, onUnmount = _a.onUnmount, getInitialPoseFromParent = _a.getInitialPoseFromParent, popFromFlow = _a.popFromFlow, values = _a.values, parentValues = _a.parentValues, onDragStart = _a.onDragStart, onDragEnd = _a.onDragEnd, onPressStart = _a.onPressStart, onPressEnd = _a.onPressEnd, props = tslib_1.__rest(_a, ["elementType", "poseConfig", "onValueChange", "innerRef", "_pose", "pose", "initialPose", "poseKey", "onPoseComplete", "getParentPoseConfig", "registerChild", "onUnmount", "getInitialPoseFromParent", "popFromFlow", "values", "parentValues", "onDragStart", "onDragEnd", "onPressStart", "onPressEnd"]); return props;
}; var PoseElement = (function (_super) {
tslib_1.__extends(PoseElement, _super);
function PoseElement(props) {
var _this = _super.call(this, props) || this;
_this.children = new Set();
_this.childrenHandlers = {
registerChild: function (props) {
_this.children.add(props);
if (_this.poser)
_this.flushChildren();
},
onUnmount: function (child) { return _this.poser.removeChild(child); },
getParentPoseConfig: function () { return _this.poseConfig; },
getInitialPoseFromParent: function () { return _this.getInitialPose(); }
};
_this.setRef = function (ref) {
hey_listen_1.warning(ref === null || (ref instanceof Element && _this.ref === undefined), 'ref must be provided to the same DOM component for the entire lifecycle of a posed component.');
_this.ref = ref;
var innerRef = _this.props.innerRef;
if (!innerRef)
return;
if (typeof innerRef === 'function') {
innerRef(ref);
}
else {
innerRef.current = ref;
}
};
_this.shouldForwardProp =
typeof _this.props.elementType === 'string' ? is_prop_valid_1.default : testAlwaysTrue;
var poseConfig = _this.props.poseConfig;
_this.poseConfig =
typeof poseConfig === 'function'
? poseConfig(filterProps(props))
: poseConfig;
return _this;
}
PoseElement.prototype.getInitialPose = function () {
var _a = this.props, getInitialPoseFromParent = _a.getInitialPoseFromParent, pose = _a.pose, _pose = _a._pose, initialPose = _a.initialPose;
if (initialPose) {
return initialPose;
}
else {
var parentPose = getInitialPoseFromParent && getInitialPoseFromParent();
var initialPoses = (Array.isArray(parentPose)
? parentPose
: [parentPose])
.concat(pose, _pose)
.filter(Boolean);
return initialPoses.length > 0 ? initialPoses : undefined;
}
};
PoseElement.prototype.getFirstPose = function () {
var _a = this.props, initialPose = _a.initialPose, pose = _a.pose, _pose = _a._pose;
if (!initialPose)
return;
var firstPose = (Array.isArray(pose) ? pose : [pose])
.concat(_pose)
.filter(Boolean);
return firstPose.length === 1 ? firstPose[0] : firstPose;
};
PoseElement.prototype.getSetProps = function () {
var props = filterProps(this.props);
if (this.props.popFromFlow && this.ref && this.ref instanceof HTMLElement) {
if (!this.popStyle) {
props.style = tslib_1.__assign({}, props.style, calcPopFromFlowStyle(this.ref));
this.popStyle = props.style;
}
else {
props.style = this.popStyle;
}
}
else {
this.popStyle = null;
}
return props;
};
PoseElement.prototype.componentDidMount = function () {
var _this = this;
hey_listen_1.invariant(this.ref instanceof Element, "No valid DOM ref found. If you're converting an existing component via posed(Component), you must ensure you're passing the ref to the host DOM node via the React.forwardRef function.");
var _a = this.props, onValueChange = _a.onValueChange, registerChild = _a.registerChild, values = _a.values, parentValues = _a.parentValues, onDragStart = _a.onDragStart, onDragEnd = _a.onDragEnd, onPressStart = _a.onPressStart, onPressEnd = _a.onPressEnd;
var config = tslib_1.__assign({}, this.poseConfig, { initialPose: this.getInitialPose(), values: values || this.poseConfig.values, parentValues: parentValues ? objectToMap(parentValues) : undefined, props: this.getSetProps(), onDragStart: onDragStart,
onDragEnd: onDragEnd,
onPressStart: onPressStart,
onPressEnd: onPressEnd, onChange: onValueChange });
if (!registerChild) {
this.initPoser(popmotion_pose_1.default(this.ref, config));
}
else {
registerChild({
element: this.ref,
poseConfig: config,
onRegistered: function (poser) { return _this.initPoser(poser); }
});
}
};
PoseElement.prototype.getSnapshotBeforeUpdate = function () {
var _a = this.props, pose = _a.pose, _pose = _a._pose;
if (hasPose(pose, 'flip') || hasPose(_pose, 'flip'))
this.poser.measure();
return null;
};
PoseElement.prototype.componentDidUpdate = function (prevProps) {
var _a = this.props, pose = _a.pose, _pose = _a._pose, poseKey = _a.poseKey;
this.poser.setProps(this.getSetProps());
if (poseKey !== prevProps.poseKey ||
hasChanged(prevProps.pose, pose) ||
pose === 'flip') {
this.setPose(pose);
}
if (_pose !== prevProps._pose || _pose === 'flip')
this.setPose(_pose);
};
PoseElement.prototype.componentWillUnmount = function () {
if (!this.poser)
return;
var onUnmount = this.props.onUnmount;
if (onUnmount)
onUnmount(this.poser);
this.poser.destroy();
};
PoseElement.prototype.initPoser = function (poser) {
this.poser = poser;
this.flushChildren();
var firstPose = this.getFirstPose();
if (firstPose)
this.setPose(firstPose);
};
PoseElement.prototype.setPose = function (pose) {
var _this = this;
var onPoseComplete = this.props.onPoseComplete;
var poseList = Array.isArray(pose) ? pose : [pose];
Promise.all(poseList.map(function (key) { return key && _this.poser.set(key); })).then(function () { return onPoseComplete && onPoseComplete(pose); });
};
PoseElement.prototype.flushChildren = function () {
var _this = this;
this.children.forEach(function (_a) {
var element = _a.element, poseConfig = _a.poseConfig, onRegistered = _a.onRegistered;
return onRegistered(_this.poser.addChild(element, poseConfig));
});
this.children.clear();
};
PoseElement.prototype.render = function () {
var elementType = this.props.elementType;
return (react_1.default.createElement(PoseParentProvider, { value: this.childrenHandlers }, react_1.createElement(elementType, pickAssign(this.shouldForwardProp, [
this.getSetProps(),
{ ref: this.setRef }
]))));
};
return PoseElement;
}(react_1.PureComponent)); var supportedElements = [
'a', 'article', 'aside', 'audio', 'b', 'blockquote', 'body', 'br', 'button', 'canvas', 'caption', 'cite', 'code', 'col', 'colgroup', 'data', 'datalist', 'dialog', 'div', 'em', 'embed', 'fieldset', 'figcaption', 'figure', 'footer', 'form', 'h1', 'h2', 'h3', 'h4', 'h5', 'h6', 'head', 'header', 'hgroup', 'hr', 'i', 'iframe', 'img', 'input', 'label', 'legend', 'li', 'nav', 'object', 'ol', 'option', 'p', 'param', 'picture', 'pre', 'progress', 'q', 'section', 'select', 'span', 'strong', 'table', 'tbody', 'td', 'textarea', 'tfoot', 'th', 'thead', 'time', 'title', 'tr', 'ul', 'video', 'circle', 'clipPath', 'defs', 'ellipse', 'g', 'image', 'line', 'linearGradient', 'mask', 'path', 'pattern', 'polygon', 'polyline', 'radialGradient', 'rect', 'stop', 'svg', 'text', 'tspan'
]; var componentCache = new Map(); var createComponentFactory = function (key) {
var componentFactory = function (poseConfig) {
if (poseConfig === void 0) {
poseConfig = {};
}
return react_1.forwardRef(function (_a, ref) {
var _b = _a.withParent, withParent = _b === void 0 ? true : _b, props = tslib_1.__rest(_a, ["withParent"]);
hey_listen_1.warning(props.innerRef === undefined, 'innerRef is deprecated. Please use ref instead.');
return !withParent || props.parentValues ? (react_1.default.createElement(PoseElement, tslib_1.__assign({ poseConfig: poseConfig, innerRef: ref, elementType: key }, props))) : (react_1.default.createElement(PoseParentConsumer, null, function (parentCtx) { return (react_1.default.createElement(PoseElement, tslib_1.__assign({ poseConfig: poseConfig, elementType: key, innerRef: ref }, props, parentCtx))); }));
});
};
componentCache.set(key, componentFactory);
return componentFactory;
}; var getComponentFactory = function (key) {
return componentCache.has(key)
? componentCache.get(key)
: createComponentFactory(key);
}; var posed = (function (component) {
return getComponentFactory(component);
}); supportedElements.reduce(function (acc, key) {
acc[key] = createComponentFactory(key); return acc;
}, posed); var getKey = function (child) {
hey_listen_1.invariant(child && child.key !== null, 'Every child of Transition must be given a unique key');
var childKey = typeof child.key === 'number' ? child.key.toString() : child.key;
return childKey.replace('.$', );
}; var prependProps = function (element, props) {
return react_1.createElement(element.type, tslib_1.__assign({ key: element.key, ref: element.ref }, props, element.props));
}; var handleTransition = function (_a, _b) {
var displayedChildren = _b.displayedChildren, finishedLeaving = _b.finishedLeaving, hasInitialized = _b.hasInitialized, indexedChildren = _b.indexedChildren, scheduleChildRemoval = _b.scheduleChildRemoval;
var incomingChildren = _a.children, preEnterPose = _a.preEnterPose, enterPose = _a.enterPose, exitPose = _a.exitPose, animateOnMount = _a.animateOnMount, enterAfterExit = _a.enterAfterExit, flipMove = _a.flipMove, onRest = _a.onRest, propsForChildren = tslib_1.__rest(_a, ["children", "preEnterPose", "enterPose", "exitPose", "animateOnMount", "enterAfterExit", "flipMove", "onRest"]);
var targetChildren = makeChildList(incomingChildren);
var nextState = {
displayedChildren: []
};
var prevKeys = displayedChildren.map(getKey);
var nextKeys = targetChildren.map(getKey);
var hasPropsForChildren = Object.keys(propsForChildren).length !== 0;
var entering = new Set(nextKeys.filter(function (key) { return finishedLeaving.hasOwnProperty(key) || prevKeys.indexOf(key) === -1; }));
entering.forEach(function (key) { return delete finishedLeaving[key]; });
var leaving = [];
var newlyLeaving = {};
prevKeys.forEach(function (key) {
if (entering.has(key)) {
return;
}
var isLeaving = finishedLeaving.hasOwnProperty(key);
if (!isLeaving && nextKeys.indexOf(key) !== -1) {
return;
}
leaving.push(key);
if (!isLeaving) {
finishedLeaving[key] = false;
newlyLeaving[key] = true;
}
});
var moving = new Set(prevKeys.filter(function (key, i) {
return !entering.has(key) || leaving.indexOf(key) === -1;
}));
targetChildren.forEach(function (child) {
var newChildProps = {};
if (entering.has(child.key)) {
if (hasInitialized || animateOnMount) {
newChildProps.initialPose = preEnterPose;
}
newChildProps._pose = enterPose;
}
else if (moving.has(child.key) && flipMove) {
newChildProps._pose = [enterPose, 'flip'];
}
else {
newChildProps._pose = enterPose;
}
var newChild = react_1.cloneElement(child, newChildProps);
indexedChildren[child.key] = newChild;
nextState.displayedChildren.push(hasPropsForChildren ? prependProps(newChild, propsForChildren) : newChild);
});
leaving.forEach(function (key) {
var child = indexedChildren[key];
var newChild = newlyLeaving[key]
? react_1.cloneElement(child, {
_pose: exitPose,
onPoseComplete: function (pose) {
if (pose === exitPose)
scheduleChildRemoval(key);
var onPoseComplete = child.props.onPoseComplete;
if (onPoseComplete)
onPoseComplete(pose);
},
popFromFlow: flipMove
})
: child;
var insertionIndex = prevKeys.indexOf(key);
indexedChildren[child.key] = newChild;
nextState.displayedChildren.splice(insertionIndex, 0, hasPropsForChildren ? prependProps(newChild, propsForChildren) : newChild);
});
return nextState;
}; var handleChildrenTransitions = (function (props, state) {
var newState = handleTransition(props, state); newState.hasInitialized = true; return newState;
}); var makeChildList = function (children) {
var list = [];
react_1.Children.forEach(children, function (child) { return child && list.push(child); });
return list;
}; var Transition = (function (_super) {
tslib_1.__extends(Transition, _super);
function Transition() {
var _this = _super !== null && _super.apply(this, arguments) || this;
_this.state = {
displayedChildren: [],
finishedLeaving: {},
hasInitialized: false,
indexedChildren: {},
scheduleChildRemoval: function (key) { return _this.removeChild(key); }
};
return _this;
}
Transition.prototype.removeChild = function (key) {
var _a = this.state, displayedChildren = _a.displayedChildren, finishedLeaving = _a.finishedLeaving;
var _b = this.props, enterAfterExit = _b.enterAfterExit, onRest = _b.onRest;
if (!finishedLeaving.hasOwnProperty(key))
return;
finishedLeaving[key] = true;
if (!Object.keys(finishedLeaving).every(function (leavingKey) { return finishedLeaving[leavingKey]; })) {
return;
}
var targetChildren = displayedChildren.filter(function (child) { return !finishedLeaving.hasOwnProperty(child.key); });
var newState = enterAfterExit
? tslib_1.__assign({ finishedLeaving: {} }, handleChildrenTransitions(tslib_1.__assign({}, this.props, { enterAfterExit: false }), tslib_1.__assign({}, this.state, { displayedChildren: targetChildren }))) : {
finishedLeaving: {},
displayedChildren: targetChildren
};
this.setState(newState, onRest);
};
Transition.prototype.shouldComponentUpdate = function (nextProps, nextState) {
return this.state !== nextState;
};
Transition.prototype.render = function () {
return this.state.displayedChildren;
};
Transition.defaultProps = {
flipMove: false,
enterAfterExit: false,
preEnterPose: 'exit',
enterPose: 'enter',
exitPose: 'exit'
};
Transition.getDerivedStateFromProps = handleChildrenTransitions;
return Transition;
}(react_1.Component)); exports.Transition = Transition; var PoseGroup = (function (_super) {
tslib_1.__extends(PoseGroup, _super);
function PoseGroup() {
return _super !== null && _super.apply(this, arguments) || this;
}
PoseGroup.prototype.render = function () {
return react_1.createElement(Transition, tslib_1.__assign({}, this.props));
};
PoseGroup.defaultProps = {
flipMove: true
};
return PoseGroup;
}(react_1.Component)); exports.PoseGroup = PoseGroup; exports.default = posed;
} // popmotion-pose/dist/popmotion-pose.es.js $fsx.f[54] = (module, exports) => { "use strict"; Object.defineProperty(exports, "__esModule", { value: true }); const popmotion_1 = $fsx.r(52); const easing_1 = $fsx.r(49); const style_value_types_1 = $fsx.r(46); const pose_core_1 = $fsx.r(53); const hey_listen_1 = $fsx.r(47); var __assign = function () {
__assign = Object.assign || function __assign(t) {
for (var s, i = 1, n = arguments.length; i < n; i++) {
s = arguments[i];
for (var p in s)
if (Object.prototype.hasOwnProperty.call(s, p))
t[p] = s[p];
}
return t;
};
return __assign.apply(this, arguments);
}; function __rest(s, e) {
var t = {};
for (var p in s)
if (Object.prototype.hasOwnProperty.call(s, p) && e.indexOf(p) < 0)
t[p] = s[p];
if (s != null && typeof Object.getOwnPropertySymbols === "function")
for (var i = 0, p = Object.getOwnPropertySymbols(s); i < p.length; i++)
if (e.indexOf(p[i]) < 0)
t[p[i]] = s[p[i]];
return t;
} var BoundingBoxDimension; (function (BoundingBoxDimension) {
BoundingBoxDimension["width"] = "width"; BoundingBoxDimension["height"] = "height"; BoundingBoxDimension["left"] = "left"; BoundingBoxDimension["right"] = "right"; BoundingBoxDimension["top"] = "top"; BoundingBoxDimension["bottom"] = "bottom";
})(BoundingBoxDimension || (BoundingBoxDimension = {})); var measureWithoutTransform = function (element) {
var transform$$1 = element.style.transform; element.style.transform = ; var bbox = element.getBoundingClientRect(); element.style.transform = transform$$1; return bbox;
}; var resolveProp = function (target, props) {
return typeof target === 'function' ? target(props) : target;
}; var interpolate = popmotion_1.transform.interpolate; var singleAxisPointer = function (axis) {
return function (from) {
var _a;
return popmotion_1.pointer((_a = {}, _a[axis] = typeof from === 'string' ? parseFloat(from) : from, _a)).pipe(function (v) {
return v[axis];
});
};
}; var pointerX = singleAxisPointer('x'); var pointerY = singleAxisPointer('y'); var createPointer = function (axisPointerCreator, min, max, measurement) {
return function (transitionProps) {
var from = transitionProps.from, type = transitionProps.type, dimensions = transitionProps.dimensions, dragBounds = transitionProps.dragBounds;
var axisPointer = axisPointerCreator(dimensions.measurementAsPixels(measurement, from, type));
var transformQueue = [];
if (dragBounds) {
var resolvedDragBounds_1 = resolveProp(dragBounds, transitionProps);
if (resolvedDragBounds_1[min] !== undefined) {
transformQueue.push(function (v) {
return Math.max(v, dimensions.measurementAsPixels(measurement, resolvedDragBounds_1[min], type));
});
}
if (resolvedDragBounds_1[max] !== undefined) {
transformQueue.push(function (v) {
return Math.min(v, dimensions.measurementAsPixels(measurement, resolvedDragBounds_1[max], type));
});
}
}
if (type === style_value_types_1.percent) {
transformQueue.push(interpolate([0, dimensions.get(measurement)], [0, 100], { clamp: false }), function (v) {
return v + '%';
});
}
return transformQueue.length ? axisPointer.pipe.apply(axisPointer, transformQueue) : axisPointer;
};
}; var just = function (from) {
return popmotion_1.action(function (_a) {
var update = _a.update, complete = _a.complete;
update(from);
complete();
});
}; var underDampedSpring = function (_a) {
var from = _a.from, velocity = _a.velocity, to = _a.to;
return popmotion_1.spring({
from: from,
to: to,
velocity: velocity,
stiffness: 500,
damping: 25,
restDelta: 0.5,
restSpeed: 10
});
}; var overDampedSpring = function (_a) {
var from = _a.from, velocity = _a.velocity, to = _a.to;
return popmotion_1.spring({ from: from, to: to, velocity: velocity, stiffness: 700, damping: to === 0 ? 100 : 35 });
}; var linearTween = function (_a) {
var from = _a.from, to = _a.to;
return popmotion_1.tween({ from: from, to: to, ease: easing_1.linear });
}; var intelligentTransition = {
x: underDampedSpring, y: underDampedSpring, z: underDampedSpring, rotate: underDampedSpring, rotateX: underDampedSpring, rotateY: underDampedSpring, rotateZ: underDampedSpring, scaleX: overDampedSpring, scaleY: overDampedSpring, scale: overDampedSpring, opacity: linearTween, default: popmotion_1.tween
}; var dragAction = __assign({}, intelligentTransition, { x: createPointer(pointerX, 'left', 'right', BoundingBoxDimension.width), y: createPointer(pointerY, 'top', 'bottom', BoundingBoxDimension.height) }); var justAxis = function (_a) {
var from = _a.from; return just(from);
}; var intelligentDragEnd = __assign({}, intelligentTransition, { x: justAxis, y: justAxis }); var defaultTransitions = new Map([['default', intelligentTransition], ['drag', dragAction], ['dragEnd', intelligentDragEnd]]); var animationLookup = {
tween: popmotion_1.tween, spring: popmotion_1.spring, decay: popmotion_1.decay, keyframes: popmotion_1.keyframes, physics: popmotion_1.physics
}; var easingLookup = {
linear: easing_1.linear, easeIn: easing_1.easeIn, easeOut: easing_1.easeOut, easeInOut: easing_1.easeInOut, circIn: easing_1.circIn, circOut: easing_1.circOut, circInOut: easing_1.circInOut, backIn: easing_1.backIn, backOut: easing_1.backOut, backInOut: easing_1.backInOut, anticipate: easing_1.anticipate
}; var auto = {
test: function (v) {
return v === 'auto';
},
parse: function (v) {
return v;
}
}; var valueTypeTests = [style_value_types_1.number, style_value_types_1.degrees, style_value_types_1.percent, style_value_types_1.px, style_value_types_1.vw, style_value_types_1.vh, auto]; var testValueType = function (v) {
return function (type) {
return type.test(v);
};
}; var getValueType = function (v) {
return valueTypeTests.find(testValueType(v));
}; var createPassiveValue = function (init, parent, transform$$1) {
var raw = popmotion_1.value(transform$$1(init));
parent.raw.subscribe(function (v) {
return raw.update(transform$$1(v));
});
return { raw: raw };
}; var createValue = function (init) {
var type = getValueType(init);
var raw = popmotion_1.value(init);
return { raw: raw, type: type };
}; var addActionDelay = function (delay$$1, transition) {
if (delay$$1 === void 0) {
delay$$1 = 0;
}
return popmotion_1.chain(popmotion_1.delay(delay$$1), transition);
}; var isCubicBezierArgs = function (args) {
return typeof args[0] === 'number';
}; var getAction = function (v, _a, _b) {
var from = _b.from, to = _b.to, velocity = _b.velocity;
var _c = _a.type, type = _c === void 0 ? 'tween' : _c, definedEase = _a.ease, def = __rest(_a, ["type", "ease"]);
hey_listen_1.invariant(animationLookup[type] !== undefined, "Invalid transition type '" + type + "'. Valid transition types are: tween, spring, decay, physics and keyframes.");
var ease;
if (type === 'tween') {
if (typeof definedEase !== 'function') {
if (typeof definedEase === 'string') {
hey_listen_1.invariant(easingLookup[definedEase] !== undefined, "Invalid easing type '" + definedEase + "'. popmotion.io/pose/api/config");
ease = easingLookup[definedEase];
}
else if (Array.isArray(definedEase) && isCubicBezierArgs(definedEase)) {
hey_listen_1.invariant(definedEase.length === 4, "Cubic bezier arrays must contain four numerical values.");
var x1 = definedEase[0], y1 = definedEase[1], x2 = definedEase[2], y2 = definedEase[3];
ease = easing_1.cubicBezier(x1, y1, x2, y2);
}
}
}
ease = ease || definedEase;
var baseProps = type !== 'keyframes' ? {
from: from,
to: to,
velocity: velocity,
ease: ease
} : { ease: ease };
return animationLookup[type](__assign({}, baseProps, def));
}; var isAction = function (action$$1) {
return typeof action$$1.start !== 'undefined';
}; var pose = function (_a) {
var transformPose = _a.transformPose, addListenerToValue = _a.addListenerToValue, extendAPI = _a.extendAPI, readValueFromSource = _a.readValueFromSource, posePriority = _a.posePriority, setValueNative = _a.setValueNative;
return pose_core_1.default({
bindOnChange: function (values, onChange) {
return function (key) {
if (!values.has(key))
return;
var raw = values.get(key).raw;
raw.subscribe(onChange[key]);
};
},
readValue: function (_a) {
var raw = _a.raw;
return raw.get();
},
setValue: function (_a, to) {
var raw = _a.raw;
return raw.update(to);
},
createValue: function (init, key, _a, _b) {
var elementStyler = _a.elementStyler;
var _c = _b === void 0 ? {} : _b, passiveParent = _c.passiveParent, passiveProps = _c.passiveProps;
var val = passiveParent ? createPassiveValue(init, passiveParent, passiveProps) : createValue(init);
val.raw.subscribe(addListenerToValue(key, elementStyler));
return val;
},
convertValue: function (raw, key, _a) {
var elementStyler = _a.elementStyler;
raw.subscribe(addListenerToValue(key, elementStyler));
return {
raw: raw,
type: getValueType(raw.get())
};
},
getTransitionProps: function (_a, to) {
var raw = _a.raw, type = _a.type;
return {
from: raw.get(),
velocity: raw.getVelocity(),
to: to,
type: type
};
},
resolveTarget: function (_, to) {
return to;
},
selectValueToRead: function (_a) {
var raw = _a.raw;
return raw;
},
startAction: function (_a, action$$1, complete) {
var raw = _a.raw;
var reaction = {
update: function (v) {
return raw.update(v);
},
complete: complete
};
return action$$1.start(reaction);
},
stopAction: function (action$$1) {
return action$$1.stop();
},
getInstantTransition: function (_, _a) {
var to = _a.to;
return just(to);
},
convertTransitionDefinition: function (val, def, props) {
if (isAction(def))
return def;
var delay$$1 = def.delay, min = def.min, max = def.max, round = def.round, remainingDef = __rest(def, ["delay", "min", "max", "round"]);
var action$$1 = getAction(val, remainingDef, props);
var outputPipe = [];
if (delay$$1)
action$$1 = addActionDelay(delay$$1, action$$1);
if (min !== undefined)
outputPipe.push(function (v) {
return Math.max(v, min);
});
if (max !== undefined)
outputPipe.push(function (v) {
return Math.min(v, max);
});
if (round)
outputPipe.push(Math.round);
return outputPipe.length ? action$$1.pipe.apply(action$$1, outputPipe) : action$$1;
},
setValueNative: setValueNative,
addActionDelay: addActionDelay,
defaultTransitions: defaultTransitions,
transformPose: transformPose,
readValueFromSource: readValueFromSource,
posePriority: posePriority,
extendAPI: extendAPI
});
}; var createDimensions = function (element) {
var hasMeasured = false;
var current = {
width: 0,
height: 0,
top: 0,
left: 0,
bottom: 0,
right: 0
};
return {
get: function (measurement) {
return measurement ? current[measurement] : current;
},
measure: function () {
current = element.getBoundingClientRect();
hasMeasured = true;
return current;
},
measurementAsPixels: function (measurement, value$$1, type) {
return type === style_value_types_1.percent ? (typeof value$$1 === 'string' ? parseFloat(value$$1) : value$$1) / 100 * current[measurement] : value$$1;
},
has: function () {
return hasMeasured;
}
};
}; var makeUIEventApplicator = function (_a) {
var startEvents = _a.startEvents, endEvents = _a.endEvents, startPose = _a.startPose, endPose = _a.endPose, startCallback = _a.startCallback, endCallback = _a.endCallback, useDocumentToEnd = _a.useDocumentToEnd, preventScroll = _a.preventScroll;
return function (element, activeActions, poser, config) {
var startListener = startPose + 'Start';
var endListener = startPose + 'End';
var moveListener = startPose + 'Move';
if (preventScroll) {
var touchMoveListener = popmotion_1.listen(element, 'touchmove', {
passive: false
}).start(function (e) {
e.preventDefault();
});
activeActions.set(moveListener, touchMoveListener);
}
var eventStartListener = popmotion_1.listen(element, startEvents).start(function (startEvent) {
poser.unset(endPose);
poser.set(startPose);
if (startCallback && config[startCallback])
config[startCallback](startEvent);
var eventEndListener = popmotion_1.listen(useDocumentToEnd ? document.documentElement : element, endEvents + (useDocumentToEnd ? ' mouseenter' : )).start(function (endEvent) {
if (useDocumentToEnd && endEvent.type === 'mouseenter' && endEvent.buttons === 1) {
return;
}
activeActions.get(endListener).stop();
poser.unset(startPose);
poser.set(endPose);
if (endCallback && config[endCallback])
config[endCallback](endEvent);
});
activeActions.set(endListener, eventEndListener);
});
activeActions.set(startListener, eventStartListener);
};
}; var events = {
draggable: makeUIEventApplicator({
startEvents: 'mousedown touchstart',
endEvents: 'mouseup touchend',
startPose: 'drag',
endPose: 'dragEnd',
startCallback: 'onDragStart',
endCallback: 'onDragEnd',
useDocumentToEnd: true,
preventScroll: true
}),
hoverable: makeUIEventApplicator({
startEvents: 'mouseenter',
endEvents: 'mouseleave',
startPose: 'hover',
endPose: 'hoverEnd'
}),
focusable: makeUIEventApplicator({
startEvents: 'focus',
endEvents: 'blur',
startPose: 'focus',
endPose: 'blur'
}),
pressable: makeUIEventApplicator({
startEvents: 'mousedown touchstart',
endEvents: 'mouseup touchend',
startPose: 'press',
endPose: 'pressEnd',
startCallback: 'onPressStart',
endCallback: 'onPressEnd',
useDocumentToEnd: true
})
}; var eventKeys = Object.keys(events); var appendEventListeners = function (element, activeActions, poser, _a) {
var props = _a.props;
return eventKeys.forEach(function (key) {
if (props[key])
events[key](element, activeActions, poser, props);
});
}; var ORIGIN_START = 0; var ORIGIN_CENTER = '50%'; var ORIGIN_END = '100%'; var findCenter = function (_a) {
var top = _a.top, right = _a.right, bottom = _a.bottom, left = _a.left;
return {
x: (left + right) / 2,
y: (top + bottom) / 2
};
}; var positionalProps = ['width', 'height', 'top', 'left', 'bottom', 'right']; var positionalPropsDict = new Set(positionalProps); var checkPositionalProp = function (key) {
return positionalPropsDict.has(key);
}; var hasPositionalProps = function (pose) {
return Object.keys(pose).some(checkPositionalProp);
}; var isFlipPose = function (flip, key, state) {
return state.props.element instanceof HTMLElement && (flip === true || key === 'flip');
}; var setValue = function (_a, key, to) {
var values = _a.values, props = _a.props;
if (values.has(key)) {
var raw = values.get(key).raw;
raw.update(to);
raw.update(to);
}
else {
values.set(key, {
raw: popmotion_1.value(to, function (v) {
return props.elementStyler.set(key, v);
})
});
}
}; var explicitlyFlipPose = function (state, nextPose) {
var _a = state.props, dimensions = _a.dimensions, elementStyler = _a.elementStyler;
dimensions.measure();
var width = nextPose.width, height = nextPose.height, top = nextPose.top, left = nextPose.left, bottom = nextPose.bottom, right = nextPose.right, position = nextPose.position, remainingPose = __rest(nextPose, ["width", "height", "top", "left", "bottom", "right", "position"]);
var propsToSet = positionalProps.concat('position').reduce(function (acc, key) {
if (nextPose[key] !== undefined) {
acc[key] = resolveProp(nextPose[key], state.props);
}
return acc;
}, {});
elementStyler.set(propsToSet).render();
return implicitlyFlipPose(state, remainingPose);
}; var implicitlyFlipPose = function (state, nextPose) {
var _a = state.props, dimensions = _a.dimensions, element = _a.element, elementStyler = _a.elementStyler;
if (!dimensions.has())
return {};
var prev = dimensions.get();
var next = measureWithoutTransform(element);
var originX = prev.left === next.left ? ORIGIN_START : prev.right === next.right ? ORIGIN_END : ORIGIN_CENTER;
var originY = prev.top === next.top ? ORIGIN_START : prev.bottom === next.bottom ? ORIGIN_END : ORIGIN_CENTER;
elementStyler.set({ originX: originX, originY: originY });
if (prev.width !== next.width) {
setValue(state, 'scaleX', prev.width / next.width);
nextPose.scaleX = 1;
}
if (prev.height !== next.height) {
setValue(state, 'scaleY', prev.height / next.height);
nextPose.scaleY = 1;
}
var prevCenter = findCenter(prev);
var nextCenter = findCenter(next);
if (originX === ORIGIN_CENTER) {
setValue(state, 'x', prevCenter.x - nextCenter.x);
nextPose.x = 0;
}
if (originY === ORIGIN_CENTER) {
setValue(state, 'y', prevCenter.y - nextCenter.y);
nextPose.y = 0;
}
elementStyler.render();
return nextPose;
}; var flipPose = function (props, nextPose) {
return hasPositionalProps(nextPose) ? explicitlyFlipPose(props, nextPose) : implicitlyFlipPose(props, nextPose);
}; var getPosFromMatrix = function (matrix, pos) {
return parseFloat(matrix.split(', ')[pos]);
}; var getTranslateFromMatrix = function (pos2, pos3) {
return function (element, bbox, _a) {
var transform$$1 = _a.transform;
if (transform$$1 === 'none')
return 0;
var matrix3d = transform$$1.match(/^matrix3d\((.+)\)$/);
if (matrix3d)
return getPosFromMatrix(matrix3d[1], pos3);
return getPosFromMatrix(transform$$1.match(/^matrix\((.+)\)$/)[1], pos2);
};
}; var positionalValues = {
width: function (element, _a) {
var width = _a.width;
return width;
},
height: function (element, _a) {
var height = _a.height;
return height;
},
top: function (element, bbox, _a) {
var top = _a.top;
return parseFloat(top);
},
left: function (element, bbox, _a) {
var left = _a.left;
return parseFloat(left);
},
bottom: function (element, _a, _b) {
var height = _a.height;
var top = _b.top;
return parseFloat(top) + height;
},
right: function (element, _a, _b) {
var width = _a.width;
var left = _b.left;
return parseFloat(left) + width;
},
x: getTranslateFromMatrix(4, 13),
y: getTranslateFromMatrix(5, 14)
}; var isPositionalKey = function (v) {
return positionalValues[v] !== undefined;
}; var isPositional = function (pose) {
return Object.keys(pose).some(isPositionalKey);
}; var convertPositionalUnits = function (state, nextPose) {
var values = state.values, props = state.props;
var element = props.element, elementStyler = props.elementStyler;
var positionalPoseKeys = Object.keys(nextPose).filter(isPositionalKey);
var changedPositionalKeys = [];
var elementComputedStyle = getComputedStyle(element);
var applyAtEndHasBeenCopied = false;
positionalPoseKeys.forEach(function (key) {
var value$$1 = values.get(key);
var fromValueType = getValueType(value$$1.raw.get());
var to = resolveProp(nextPose[key], props);
var toValueType = getValueType(to);
if (fromValueType !== toValueType) {
changedPositionalKeys.push(key);
if (!applyAtEndHasBeenCopied) {
applyAtEndHasBeenCopied = true;
nextPose.applyAtEnd = nextPose.applyAtEnd ? __assign({}, nextPose.applyAtEnd) : {};
}
nextPose.applyAtEnd[key] = nextPose.applyAtEnd[key] || nextPose[key];
setValue(state, key, to);
}
});
if (!changedPositionalKeys.length)
return nextPose;
var originBbox = element.getBoundingClientRect();
var top = elementComputedStyle.top, left = elementComputedStyle.left, bottom = elementComputedStyle.bottom, right = elementComputedStyle.right, transform$$1 = elementComputedStyle.transform;
var originComputedStyle = { top: top, left: left, bottom: bottom, right: right, transform: transform$$1 };
elementStyler.render();
var targetBbox = element.getBoundingClientRect();
changedPositionalKeys.forEach(function (key) {
setValue(state, key, positionalValues[key](element, originBbox, originComputedStyle));
nextPose[key] = positionalValues[key](element, targetBbox, elementComputedStyle);
});
elementStyler.render();
return nextPose;
}; var getCurrent = function (prop) {
return function (_a) {
var elementStyler = _a.elementStyler;
return elementStyler.get(prop);
};
}; var dragPoses = function (draggable) {
var drag = {
preTransition: function (_a) {
var dimensions = _a.dimensions;
return dimensions.measure();
}
};
var dragEnd = {};
if (draggable === true || draggable === 'x') {
drag.x = dragEnd.x = getCurrent('x');
}
if (draggable === true || draggable === 'y') {
drag.y = dragEnd.y = getCurrent('y');
}
return { drag: drag, dragEnd: dragEnd };
}; var createPoseConfig = function (element, _a) {
var onDragStart = _a.onDragStart, onDragEnd = _a.onDragEnd, onPressStart = _a.onPressStart, onPressEnd = _a.onPressEnd, draggable = _a.draggable, hoverable = _a.hoverable, focusable = _a.focusable, pressable = _a.pressable, dragBounds = _a.dragBounds, config = __rest(_a, ["onDragStart", "onDragEnd", "onPressStart", "onPressEnd", "draggable", "hoverable", "focusable", "pressable", "dragBounds"]);
var poseConfig = __assign({ flip: {} }, config, { props: __assign({}, config.props, { onDragStart: onDragStart,
onDragEnd: onDragEnd,
onPressStart: onPressStart,
onPressEnd: onPressEnd,
dragBounds: dragBounds,
draggable: draggable,
hoverable: hoverable,
focusable: focusable,
pressable: pressable,
element: element, elementStyler: popmotion_1.styler(element, { preparseOutput: false }), dimensions: createDimensions(element) }) });
if (draggable) {
var _b = dragPoses(draggable), drag = _b.drag, dragEnd = _b.dragEnd;
poseConfig.drag = __assign({}, drag, poseConfig.drag);
poseConfig.dragEnd = __assign({}, dragEnd, poseConfig.dragEnd);
}
return poseConfig;
}; var domPose = pose({
posePriority: ['drag', 'press', 'focus', 'hover'],
transformPose: function (_a, name, state) {
var flip = _a.flip, pose$$1 = __rest(_a, ["flip"]);
if (isFlipPose(flip, name, state)) {
return flipPose(state, pose$$1);
}
else if (isPositional(pose$$1)) {
return convertPositionalUnits(state, pose$$1);
}
return pose$$1;
},
forceRender: function (_a) {
var elementStyler = _a.elementStyler;
elementStyler.render();
},
addListenerToValue: function (key, elementStyler) {
return function (v) {
return elementStyler.set(key, v);
};
},
readValueFromSource: function (key, _a) {
var elementStyler = _a.elementStyler, dragBounds = _a.dragBounds;
var value$$1 = elementStyler.get(key);
if (dragBounds && (key === 'x' || key === 'y')) {
var bound = key === 'x' ? dragBounds.left || dragBounds.right : dragBounds.top || dragBounds.bottom;
if (bound) {
var boundType = getValueType(bound);
value$$1 = boundType.transform(value$$1);
}
}
return isNaN(value$$1) ? value$$1 : parseFloat(value$$1);
},
setValueNative: function (key, to, _a) {
var elementStyler = _a.elementStyler;
return elementStyler.set(key, to);
},
extendAPI: function (api, _a, config) {
var props = _a.props, activeActions = _a.activeActions;
var measure = props.dimensions.measure;
var poserApi = __assign({}, api, { addChild: function (element, childConfig) {
return api._addChild(createPoseConfig(element, childConfig), domPose);
}, measure: measure, flip: function (op) {
if (op) {
measure();
op();
}
return api.set('flip');
} });
props.elementStyler.render();
appendEventListeners(props.element, activeActions, poserApi, config);
return poserApi;
}
}); var domPose$1 = function (element, config) {
return domPose(createPoseConfig(element, config));
}; exports.default = domPose$1;
} // popmotion/dist/popmotion.es.js $fsx.f[52] = (module, exports) => { "use strict"; Object.defineProperty(exports, "__esModule", { value: true }); const tslib_1 = $fsx.r(8); const popcorn_1 = $fsx.r(50); const framesync_1 = $fsx.r(48); const styleValueTypes = $fsx.r(46); exports.valueTypes = styleValueTypes; const style_value_types_1 = $fsx.r(46); const easing = $fsx.r(49); exports.easing = easing; const easing_1 = $fsx.r(49); const stylefire_1 = $fsx.r(51); var stylefire_2 = $fsx.r(51); exports.styler = stylefire_2.default; const hey_listen_1 = $fsx.r(47); var Chainable = function () {
function Chainable(props) {
if (props === void 0) {
props = {};
}
this.props = props;
}
Chainable.prototype.applyMiddleware = function (middleware) {
return this.create(tslib_1.__assign({}, this.props, { middleware: this.props.middleware ? [middleware].concat(this.props.middleware) : [middleware] }));
};
Chainable.prototype.pipe = function () {
var funcs = [];
for (var _i = 0; _i < arguments.length; _i++) {
funcs[_i] = arguments[_i];
}
var pipedUpdate = funcs.length === 1 ? funcs[0] : popcorn_1.pipe.apply(void 0, funcs);
return this.applyMiddleware(function (update) {
return function (v) {
return update(pipedUpdate(v));
};
});
};
Chainable.prototype.while = function (predicate) {
return this.applyMiddleware(function (update, complete) {
return function (v) {
return predicate(v) ? update(v) : complete();
};
});
};
Chainable.prototype.filter = function (predicate) {
return this.applyMiddleware(function (update) {
return function (v) {
return predicate(v) && update(v);
};
});
};
return Chainable;
}(); var Observer = function () {
function Observer(_a, observer) {
var middleware = _a.middleware, onComplete = _a.onComplete;
var _this = this;
this.isActive = true;
this.update = function (v) {
if (_this.observer.update)
_this.updateObserver(v);
};
this.complete = function () {
if (_this.observer.complete && _this.isActive)
_this.observer.complete();
if (_this.onComplete)
_this.onComplete();
_this.isActive = false;
};
this.error = function (err) {
if (_this.observer.error && _this.isActive)
_this.observer.error(err);
_this.isActive = false;
};
this.observer = observer;
this.updateObserver = function (v) {
return observer.update(v);
};
this.onComplete = onComplete;
if (observer.update && middleware && middleware.length) {
middleware.forEach(function (m) {
return _this.updateObserver = m(_this.updateObserver, _this.complete);
});
}
}
return Observer;
}(); var createObserver = function (observerCandidate, _a, onComplete) {
var middleware = _a.middleware;
if (typeof observerCandidate === 'function') {
return new Observer({ middleware: middleware, onComplete: onComplete }, { update: observerCandidate });
}
else {
return new Observer({ middleware: middleware, onComplete: onComplete }, observerCandidate);
}
}; var Action = function (_super) {
tslib_1.__extends(Action, _super);
function Action() {
return _super !== null && _super.apply(this, arguments) || this;
}
Action.prototype.create = function (props) {
return new Action(props);
};
Action.prototype.start = function (observerCandidate) {
if (observerCandidate === void 0) {
observerCandidate = {};
}
var isComplete = false;
var subscription = {
stop: function () {
return undefined;
}
};
var _a = this.props, init = _a.init, observerProps = tslib_1.__rest(_a, ["init"]);
var observer = createObserver(observerCandidate, observerProps, function () {
isComplete = true;
subscription.stop();
});
var api = init(observer);
subscription = api ? tslib_1.__assign({}, subscription, api) : subscription;
if (observerCandidate.registerParent) {
observerCandidate.registerParent(subscription);
}
if (isComplete)
subscription.stop();
return subscription;
};
return Action;
}(Chainable); exports.Action = Action; var action = function (init) {
return new Action({ init: init });
}; exports.action = action; var BaseMulticast = function (_super) {
tslib_1.__extends(BaseMulticast, _super);
function BaseMulticast() {
var _this = _super !== null && _super.apply(this, arguments) || this;
_this.subscribers = [];
return _this;
}
BaseMulticast.prototype.complete = function () {
this.subscribers.forEach(function (subscriber) {
return subscriber.complete();
});
};
BaseMulticast.prototype.error = function (err) {
this.subscribers.forEach(function (subscriber) {
return subscriber.error(err);
});
};
BaseMulticast.prototype.update = function (v) {
for (var i = 0; i < this.subscribers.length; i++) {
this.subscribers[i].update(v);
}
};
BaseMulticast.prototype.subscribe = function (observerCandidate) {
var _this = this;
var observer = createObserver(observerCandidate, this.props);
this.subscribers.push(observer);
var subscription = {
unsubscribe: function () {
var index = _this.subscribers.indexOf(observer);
if (index !== -1)
_this.subscribers.splice(index, 1);
}
};
return subscription;
};
BaseMulticast.prototype.stop = function () {
if (this.parent)
this.parent.stop();
};
BaseMulticast.prototype.registerParent = function (subscription) {
this.stop();
this.parent = subscription;
};
return BaseMulticast;
}(Chainable); var Multicast = function (_super) {
tslib_1.__extends(Multicast, _super);
function Multicast() {
return _super !== null && _super.apply(this, arguments) || this;
}
Multicast.prototype.create = function (props) {
return new Multicast(props);
};
return Multicast;
}(BaseMulticast); var multicast = function () {
return new Multicast();
}; exports.multicast = multicast; var stepProgress = function (steps, progress$$1) {
var segment = 1 / (steps - 1); var subsegment = 1 / (2 * (steps - 1)); var percentProgressOfTarget = Math.min(progress$$1, 1); var subsegmentProgressOfTarget = percentProgressOfTarget / subsegment; var segmentProgressOfTarget = Math.floor((subsegmentProgressOfTarget + 1) / 2); return segmentProgressOfTarget * segment;
}; var calc = Object.freeze({
angle: popcorn_1.angle, degreesToRadians: popcorn_1.degreesToRadians, distance: popcorn_1.distance, isPoint3D: popcorn_1.isPoint3D, isPoint: popcorn_1.isPoint, dilate: popcorn_1.mix, getValueFromProgress: popcorn_1.mix, pointFromAngleAndDistance: popcorn_1.pointFromVector, getProgressFromValue: popcorn_1.progress, radiansToDegrees: popcorn_1.radiansToDegrees, smooth: popcorn_1.smoothFrame, speedPerFrame: popcorn_1.velocityPerFrame, speedPerSecond: popcorn_1.velocityPerSecond, stepProgress: stepProgress
}); exports.calc = calc; var isValueList = function (v) {
return Array.isArray(v);
}; var isSingleValue = function (v) {
var typeOfV = typeof v; return typeOfV === 'string' || typeOfV === 'number';
}; var ValueReaction = function (_super) {
tslib_1.__extends(ValueReaction, _super);
function ValueReaction(props) {
var _this = _super.call(this, props) || this;
_this.scheduleVelocityCheck = function () {
return framesync_1.default.postRender(_this.velocityCheck);
};
_this.velocityCheck = function (_a) {
var timestamp = _a.timestamp;
if (timestamp !== _this.lastUpdated) {
_this.prev = _this.current;
}
};
_this.prev = _this.current = props.value || 0;
if (isSingleValue(_this.current)) {
_this.updateCurrent = function (v) {
return _this.current = v;
};
_this.getVelocityOfCurrent = function () {
return _this.getSingleVelocity(_this.current, _this.prev);
};
}
else if (isValueList(_this.current)) {
_this.updateCurrent = function (v) {
return _this.current = v.slice();
};
_this.getVelocityOfCurrent = function () {
return _this.getListVelocity();
};
}
else {
_this.updateCurrent = function (v) {
_this.current = {};
for (var key in v) {
if (v.hasOwnProperty(key)) {
_this.current[key] = v[key];
}
}
};
_this.getVelocityOfCurrent = function () {
return _this.getMapVelocity();
};
}
if (props.initialSubscription)
_this.subscribe(props.initialSubscription);
return _this;
}
ValueReaction.prototype.create = function (props) {
return new ValueReaction(props);
};
ValueReaction.prototype.get = function () {
return this.current;
};
ValueReaction.prototype.getVelocity = function () {
return this.getVelocityOfCurrent();
};
ValueReaction.prototype.update = function (v) {
_super.prototype.update.call(this, v);
this.prev = this.current;
this.updateCurrent(v);
var _a = framesync_1.getFrameData(), delta = _a.delta, timestamp = _a.timestamp;
this.timeDelta = delta;
this.lastUpdated = timestamp;
framesync_1.default.postRender(this.scheduleVelocityCheck);
};
ValueReaction.prototype.subscribe = function (observerCandidate) {
var sub = _super.prototype.subscribe.call(this, observerCandidate);
this.subscribers[this.subscribers.length - 1].update(this.current);
return sub;
};
ValueReaction.prototype.getSingleVelocity = function (current, prev) {
return typeof current === 'number' && typeof prev === 'number' ? popcorn_1.velocityPerSecond(current - prev, this.timeDelta) : popcorn_1.velocityPerSecond(parseFloat(current) - parseFloat(prev), this.timeDelta) || 0;
};
ValueReaction.prototype.getListVelocity = function () {
var _this = this;
return this.current.map(function (c, i) {
return _this.getSingleVelocity(c, _this.prev[i]);
});
};
ValueReaction.prototype.getMapVelocity = function () {
var velocity = {};
for (var key in this.current) {
if (this.current.hasOwnProperty(key)) {
velocity[key] = this.getSingleVelocity(this.current[key], this.prev[key]);
}
}
return velocity;
};
return ValueReaction;
}(BaseMulticast); exports.ValueReaction = ValueReaction; var value = function (value, initialSubscription) {
return new ValueReaction({ value: value, initialSubscription: initialSubscription });
}; exports.value = value; var multi = function (_a) {
var getCount = _a.getCount, getFirst = _a.getFirst, getOutput = _a.getOutput, mapApi = _a.mapApi, setProp = _a.setProp, startActions = _a.startActions;
return function (actions) {
return action(function (_a) {
var update = _a.update, complete = _a.complete, error = _a.error;
var numActions = getCount(actions);
var output = getOutput();
var updateOutput = function () {
return update(output);
};
var numCompletedActions = 0;
var subs = startActions(actions, function (a, name) {
var hasCompleted = false;
return a.start({
complete: function () {
if (!hasCompleted) {
hasCompleted = true;
numCompletedActions++;
if (numCompletedActions === numActions)
framesync_1.default.update(complete);
}
},
error: error,
update: function (v) {
setProp(output, name, v);
framesync_1.default.update(updateOutput, false, true);
}
});
});
return Object.keys(getFirst(subs)).reduce(function (api, methodName) {
api[methodName] = mapApi(subs, methodName);
return api;
}, {});
});
};
}; var composite = multi({
getOutput: function () {
return {};
},
getCount: function (subs) {
return Object.keys(subs).length;
},
getFirst: function (subs) {
return subs[Object.keys(subs)[0]];
},
mapApi: function (subs, methodName) {
return function () {
var args = [];
for (var _i = 0; _i < arguments.length; _i++) {
args[_i] = arguments[_i];
}
return Object.keys(subs).reduce(function (output, propKey) {
var _a;
if (subs[propKey][methodName]) {
args[0] && args[0][propKey] !== undefined ? output[propKey] = subs[propKey][methodName](args[0][propKey]) : output[propKey] = (_a = subs[propKey])[methodName].apply(_a, args);
}
return output;
}, {});
};
},
setProp: function (output, name, v) {
return output[name] = v;
},
startActions: function (actions, starter) {
return Object.keys(actions).reduce(function (subs, key) {
subs[key] = starter(actions[key], key);
return subs;
}, {});
}
}); exports.composite = composite; var parallel = multi({
getOutput: function () {
return [];
},
getCount: function (subs) {
return subs.length;
},
getFirst: function (subs) {
return subs[0];
},
mapApi: function (subs, methodName) {
return function () {
var args = [];
for (var _i = 0; _i < arguments.length; _i++) {
args[_i] = arguments[_i];
}
return subs.map(function (sub, i) {
if (sub[methodName]) {
return Array.isArray(args[0]) ? sub[methodName](args[0][i]) : sub[methodName].apply(sub, args);
}
});
};
},
setProp: function (output, name, v) {
return output[name] = v;
},
startActions: function (actions, starter) {
return actions.map(function (action, i) {
return starter(action, i);
});
}
}); var parallel$1 = function () {
var actions = [];
for (var _i = 0; _i < arguments.length; _i++) {
actions[_i] = arguments[_i];
}
return parallel(actions);
}; exports.parallel = parallel$1; var createVectorTests = function (typeTests) {
var testNames = Object.keys(typeTests);
var isVectorProp = function (prop, key) {
return prop !== undefined && !typeTests[key](prop);
};
var getVectorKeys = function (props) {
return testNames.reduce(function (vectorKeys, key) {
if (isVectorProp(props[key], key))
vectorKeys.push(key);
return vectorKeys;
}, []);
};
var testVectorProps = function (props) {
return props && testNames.some(function (key) {
return isVectorProp(props[key], key);
});
};
return { getVectorKeys: getVectorKeys, testVectorProps: testVectorProps };
}; var unitTypes = [style_value_types_1.px, style_value_types_1.percent, style_value_types_1.degrees, style_value_types_1.vh, style_value_types_1.vw]; var findUnitType = function (prop) {
return unitTypes.find(function (type) {
return type.test(prop);
});
}; var isUnitProp = function (prop) {
return Boolean(findUnitType(prop));
}; var createAction = function (action, props) {
return action(props);
}; var reduceArrayValue = function (i) {
return function (props, key) {
props[key] = props[key][i];
return props;
};
}; var createArrayAction = function (action, props, vectorKeys) {
var firstVectorKey = vectorKeys[0];
var actionList = props[firstVectorKey].map(function (v, i) {
var childActionProps = vectorKeys.reduce(reduceArrayValue(i), tslib_1.__assign({}, props));
return getActionCreator(v)(action, childActionProps);
});
return parallel$1.apply(void 0, actionList);
}; var reduceObjectValue = function (key) {
return function (props, propKey) {
props[propKey] = props[propKey][key];
return props;
};
}; var createObjectAction = function (action, props, vectorKeys) {
var firstVectorKey = vectorKeys[0];
var actionMap = Object.keys(props[firstVectorKey]).reduce(function (map, key) {
var childActionProps = vectorKeys.reduce(reduceObjectValue(key), tslib_1.__assign({}, props));
map[key] = getActionCreator(props[firstVectorKey][key])(action, childActionProps);
return map;
}, {});
return composite(actionMap);
}; var createUnitAction = function (action, _a) {
var from = _a.from, to = _a.to, props = tslib_1.__rest(_a, ["from", "to"]);
var unitType = findUnitType(from) || findUnitType(to);
var transform = unitType.transform, parse = unitType.parse;
return action(tslib_1.__assign({}, props, { from: typeof from === 'string' ? parse(from) : from, to: typeof to === 'string' ? parse(to) : to })).pipe(transform);
}; var createMixerAction = function (mixer) {
return function (action, _a) {
var from = _a.from, to = _a.to, props = tslib_1.__rest(_a, ["from", "to"]);
return action(tslib_1.__assign({}, props, { from: 0, to: 1 })).pipe(mixer(from, to));
};
}; var createColorAction = createMixerAction(popcorn_1.mixColor); var createComplexAction = createMixerAction(popcorn_1.mixComplex); var createVectorAction = function (action, typeTests) {
var _a = createVectorTests(typeTests), testVectorProps = _a.testVectorProps, getVectorKeys = _a.getVectorKeys;
var vectorAction = function (props) {
var isVector = testVectorProps(props);
if (!isVector)
return action(props);
var vectorKeys = getVectorKeys(props);
var testKey = vectorKeys[0];
var testProp = props[testKey];
return getActionCreator(testProp)(action, props, vectorKeys);
};
return vectorAction;
}; var getActionCreator = function (prop) {
if (typeof prop === 'number') {
return createAction;
}
else if (Array.isArray(prop)) {
return createArrayAction;
}
else if (isUnitProp(prop)) {
return createUnitAction;
}
else if (style_value_types_1.color.test(prop)) {
return createColorAction;
}
else if (style_value_types_1.complex.test(prop)) {
return createComplexAction;
}
else if (typeof prop === 'object') {
return createObjectAction;
}
else {
return createAction;
}
}; var decay = function (props) {
if (props === void 0) {
props = {};
}
return action(function (_a) {
var complete = _a.complete, update = _a.update;
var _b = props.velocity, velocity = _b === void 0 ? 0 : _b, _c = props.from, from = _c === void 0 ? 0 : _c, _d = props.power, power = _d === void 0 ? 0.8 : _d, _e = props.timeConstant, timeConstant = _e === void 0 ? 350 : _e, _f = props.restDelta, restDelta = _f === void 0 ? 0.5 : _f, modifyTarget = props.modifyTarget;
var elapsed = 0;
var amplitude = power * velocity;
var idealTarget = Math.round(from + amplitude);
var target = typeof modifyTarget === 'undefined' ? idealTarget : modifyTarget(idealTarget);
var process = framesync_1.default.update(function (_a) {
var frameDelta = _a.delta;
elapsed += frameDelta;
var delta = -amplitude * Math.exp(-elapsed / timeConstant);
var isMoving = delta > restDelta || delta < -restDelta;
var current = isMoving ? target + delta : target;
update(current);
if (!isMoving) {
framesync_1.cancelSync.update(process);
complete();
}
}, true);
return {
stop: function () {
return framesync_1.cancelSync.update(process);
}
};
});
}; var vectorDecay = createVectorAction(decay, {
from: style_value_types_1.number.test,
modifyTarget: function (func) {
return typeof func === 'function';
},
velocity: style_value_types_1.number.test
}); exports.decay = vectorDecay; var spring = function (props) {
if (props === void 0) {
props = {};
}
return action(function (_a) {
var update = _a.update, complete = _a.complete;
var _b = props.velocity, velocity = _b === void 0 ? 0.0 : _b;
var _c = props.from, from = _c === void 0 ? 0.0 : _c, _d = props.to, to = _d === void 0 ? 0.0 : _d, _e = props.stiffness, stiffness = _e === void 0 ? 100 : _e, _f = props.damping, damping = _f === void 0 ? 10 : _f, _g = props.mass, mass = _g === void 0 ? 1.0 : _g, _h = props.restSpeed, restSpeed = _h === void 0 ? 0.01 : _h, _j = props.restDelta, restDelta = _j === void 0 ? 0.01 : _j;
var initialVelocity = velocity ? -(velocity / 1000) : 0.0;
var t = 0;
var delta = to - from;
var position = from;
var prevPosition = position;
var process = framesync_1.default.update(function (_a) {
var timeDelta = _a.delta;
t += timeDelta;
var dampingRatio = damping / (2 * Math.sqrt(stiffness * mass));
var angularFreq = Math.sqrt(stiffness / mass) / 1000;
prevPosition = position;
if (dampingRatio < 1) {
var envelope = Math.exp(-dampingRatio * angularFreq * t);
var expoDecay = angularFreq * Math.sqrt(1.0 - dampingRatio * dampingRatio);
position = to - envelope * ((initialVelocity + dampingRatio * angularFreq * delta) / expoDecay * Math.sin(expoDecay * t) + delta * Math.cos(expoDecay * t));
}
else {
var envelope = Math.exp(-angularFreq * t);
position = to - envelope * (delta + (initialVelocity + angularFreq * delta) * t);
}
velocity = popcorn_1.velocityPerSecond(position - prevPosition, timeDelta);
var isBelowVelocityThreshold = Math.abs(velocity) <= restSpeed;
var isBelowDisplacementThreshold = Math.abs(to - position) <= restDelta;
if (isBelowVelocityThreshold && isBelowDisplacementThreshold) {
position = to;
update(position);
framesync_1.cancelSync.update(process);
complete();
}
else {
update(position);
}
}, true);
return {
stop: function () {
return framesync_1.cancelSync.update(process);
}
};
});
}; var vectorSpring = createVectorAction(spring, {
from: style_value_types_1.number.test, to: style_value_types_1.number.test, stiffness: style_value_types_1.number.test, damping: style_value_types_1.number.test, mass: style_value_types_1.number.test, velocity: style_value_types_1.number.test
}); exports.spring = vectorSpring; var inertia = function (_a) {
var _b = _a.from, from = _b === void 0 ? 0 : _b, _c = _a.velocity, velocity = _c === void 0 ? 0 : _c, min = _a.min, max = _a.max, _d = _a.power, power = _d === void 0 ? 0.8 : _d, _e = _a.timeConstant, timeConstant = _e === void 0 ? 700 : _e, _f = _a.bounceStiffness, bounceStiffness = _f === void 0 ? 500 : _f, _g = _a.bounceDamping, bounceDamping = _g === void 0 ? 10 : _g, _h = _a.restDelta, restDelta = _h === void 0 ? 1 : _h, modifyTarget = _a.modifyTarget;
return action(function (_a) {
var update = _a.update, complete = _a.complete;
var current = value(from);
var activeAnimation;
var isSpring = false;
var isLessThanMin = function (v) {
return min !== undefined && v <= min;
};
var isMoreThanMax = function (v) {
return max !== undefined && v >= max;
};
var isOutOfBounds = function (v) {
return isLessThanMin(v) || isMoreThanMax(v);
};
var isTravellingAwayFromBounds = function (v, currentVelocity) {
return isLessThanMin(v) && currentVelocity < 0 || isMoreThanMax(v) && currentVelocity > 0;
};
var startAnimation = function (animation, next) {
activeAnimation && activeAnimation.stop();
activeAnimation = animation.start({
update: function (v) {
return current.update(v);
},
complete: function () {
if (next) {
next();
return;
}
complete();
}
});
};
var startSpring = function (props) {
isSpring = true;
startAnimation(vectorSpring(tslib_1.__assign({}, props, { to: isLessThanMin(props.from) ? min : max, stiffness: bounceStiffness, damping: bounceDamping, restDelta: restDelta })));
};
current.subscribe(function (v) {
update(v);
var currentVelocity = current.getVelocity();
if (activeAnimation && !isSpring && isTravellingAwayFromBounds(v, currentVelocity)) {
startSpring({ from: v, velocity: currentVelocity });
}
});
if (isOutOfBounds(from)) {
startSpring({ from: from, velocity: velocity });
}
else if (velocity !== 0) {
var animation = vectorDecay({
from: from,
velocity: velocity,
timeConstant: timeConstant,
power: power,
restDelta: isOutOfBounds(from) ? 20 : restDelta,
modifyTarget: modifyTarget
});
startAnimation(animation, function () {
var v = current.get();
if (isOutOfBounds(v)) {
startSpring({ from: v, velocity: current.getVelocity() });
}
else {
complete();
}
});
}
else {
complete();
}
return {
stop: function () {
return activeAnimation && activeAnimation.stop();
}
};
});
}; var index = createVectorAction(inertia, {
from: style_value_types_1.number.test,
velocity: style_value_types_1.number.test,
min: style_value_types_1.number.test,
max: style_value_types_1.number.test,
damping: style_value_types_1.number.test,
stiffness: style_value_types_1.number.test,
modifyTarget: function (func) {
return typeof func === 'function';
}
}); exports.inertia = index; var frame = function () {
return action(function (_a) {
var update = _a.update;
var initialTime = 0;
var process = framesync_1.default.update(function (_a) {
var timestamp = _a.timestamp;
if (!initialTime)
initialTime = timestamp;
update(timestamp - initialTime);
}, true, true);
return {
stop: function () {
return framesync_1.cancelSync.update(process);
}
};
});
}; exports.everyFrame = frame; var scrubber = function (_a) {
var _b = _a.from, from = _b === void 0 ? 0 : _b, _c = _a.to, to = _c === void 0 ? 1 : _c, _d = _a.ease, ease = _d === void 0 ? easing_1.linear : _d, _e = _a.reverseEase, reverseEase = _e === void 0 ? false : _e;
if (reverseEase) {
ease = easing_1.createReversedEasing(ease);
}
return action(function (_a) {
var update = _a.update;
return {
seek: function (progress$$1) {
return update(progress$$1);
}
};
}).pipe(ease, function (v) {
return popcorn_1.mix(from, to, v);
});
}; var vectorScrubber = createVectorAction(scrubber, {
ease: function (func) {
return typeof func === 'function';
},
from: style_value_types_1.number.test,
to: style_value_types_1.number.test
}); var clampProgress = popcorn_1.clamp(0, 1); var tween = function (props) {
if (props === void 0) {
props = {};
}
return action(function (_a) {
var update = _a.update, complete = _a.complete;
var _b = props.duration, duration = _b === void 0 ? 300 : _b, _c = props.ease, ease = _c === void 0 ? easing_1.easeOut : _c, _d = props.flip, flip = _d === void 0 ? 0 : _d, _e = props.loop, loop = _e === void 0 ? 0 : _e, _f = props.yoyo, yoyo = _f === void 0 ? 0 : _f, _g = props.repeatDelay, repeatDelay = _g === void 0 ? 0 : _g;
var _h = props.from, from = _h === void 0 ? 0 : _h, _j = props.to, to = _j === void 0 ? 1 : _j, _k = props.elapsed, elapsed = _k === void 0 ? 0 : _k, _l = props.flipCount, flipCount = _l === void 0 ? 0 : _l, _m = props.yoyoCount, yoyoCount = _m === void 0 ? 0 : _m, _o = props.loopCount, loopCount = _o === void 0 ? 0 : _o;
var playhead = vectorScrubber({ from: from, to: to, ease: ease }).start(update);
var currentProgress = 0;
var process;
var isActive = false;
var reverseAnimation = function (reverseEase) {
if (reverseEase === void 0) {
reverseEase = false;
}
var _a;
_a = [to, from], from = _a[0], to = _a[1];
playhead = vectorScrubber({ from: from, to: to, ease: ease, reverseEase: reverseEase }).start(update);
};
var isTweenComplete = function () {
var isComplete = isActive && elapsed > duration + repeatDelay;
if (!isComplete)
return false;
if (isComplete && !loop && !flip && !yoyo)
return true;
elapsed = duration - (elapsed - repeatDelay);
if (loop && loopCount < loop) {
loopCount++;
return false;
}
else if (flip && flipCount < flip) {
flipCount++;
reverseAnimation();
return false;
}
else if (yoyo && yoyoCount < yoyo) {
yoyoCount++;
reverseAnimation(yoyoCount % 2 !== 0);
return false;
}
return true;
};
var updateTween = function () {
currentProgress = clampProgress(popcorn_1.progress(0, duration, elapsed));
playhead.seek(currentProgress);
};
var startTimer = function () {
isActive = true;
process = framesync_1.default.update(function (_a) {
var delta = _a.delta;
elapsed += delta;
updateTween();
if (isTweenComplete()) {
framesync_1.cancelSync.update(process);
complete && framesync_1.default.update(complete, false, true);
}
}, true);
};
var stopTimer = function () {
isActive = false;
if (process)
framesync_1.cancelSync.update(process);
};
startTimer();
return {
isActive: function () {
return isActive;
},
getElapsed: function () {
return popcorn_1.clamp(0, duration, elapsed);
},
getProgress: function () {
return currentProgress;
},
stop: function () {
stopTimer();
},
pause: function () {
stopTimer();
return this;
},
resume: function () {
if (!isActive)
startTimer();
return this;
},
seek: function (newProgress) {
elapsed = popcorn_1.mix(0, duration, newProgress);
framesync_1.default.update(updateTween, false, true);
return this;
},
reverse: function () {
reverseAnimation();
return this;
}
};
});
}; exports.tween = tween; var clampProgress$1 = popcorn_1.clamp(0, 1); var defaultEasings = function (values, easing$$1) {
return values.map(function () {
return easing$$1 || easing_1.easeOut;
}).splice(0, values.length - 1);
}; var defaultTimings = function (values) {
var numValues = values.length;
return values.map(function (value, i) {
return i !== 0 ? i / (numValues - 1) : 0;
});
}; var interpolateScrubbers = function (input, scrubbers, update) {
var rangeLength = input.length;
var finalInputIndex = rangeLength - 1;
var finalScrubberIndex = finalInputIndex - 1;
var subs = scrubbers.map(function (scrub) {
return scrub.start(update);
});
return function (v) {
if (v <= input[0]) {
subs[0].seek(0);
}
if (v >= input[finalInputIndex]) {
subs[finalScrubberIndex].seek(1);
}
var i = 1;
for (; i < rangeLength; i++) {
if (input[i] > v || i === finalInputIndex)
break;
}
var progressInRange = popcorn_1.progress(input[i - 1], input[i], v);
subs[i - 1].seek(clampProgress$1(progressInRange));
};
}; var keyframes = function (_a) {
var easings = _a.easings, _b = _a.ease, ease = _b === void 0 ? easing_1.linear : _b, times = _a.times, values = _a.values, tweenProps = tslib_1.__rest(_a, ["easings", "ease", "times", "values"]);
easings = Array.isArray(easings) ? easings : defaultEasings(values, easings);
times = times || defaultTimings(values);
var scrubbers = easings.map(function (easing$$1, i) {
return vectorScrubber({
from: values[i],
to: values[i + 1],
ease: easing$$1
});
});
return tween(tslib_1.__assign({}, tweenProps, { ease: ease })).applyMiddleware(function (update) {
return interpolateScrubbers(times, scrubbers, update);
});
}; exports.keyframes = keyframes; var physics = function (props) {
if (props === void 0) {
props = {};
}
return action(function (_a) {
var complete = _a.complete, update = _a.update;
var _b = props.acceleration, acceleration = _b === void 0 ? 0 : _b, _c = props.friction, friction = _c === void 0 ? 0 : _c, _d = props.velocity, velocity = _d === void 0 ? 0 : _d, springStrength = props.springStrength, to = props.to;
var _e = props.restSpeed, restSpeed = _e === void 0 ? 0.001 : _e, _f = props.from, from = _f === void 0 ? 0 : _f;
var current = from;
var process = framesync_1.default.update(function (_a) {
var delta = _a.delta;
var elapsed = Math.max(delta, 16);
if (acceleration)
velocity += popcorn_1.velocityPerFrame(acceleration, elapsed);
if (friction)
velocity *= Math.pow(1 - friction, elapsed / 100);
if (springStrength !== undefined && to !== undefined) {
var distanceToTarget = to - current;
velocity += distanceToTarget * popcorn_1.velocityPerFrame(springStrength, elapsed);
}
current += popcorn_1.velocityPerFrame(velocity, elapsed);
update(current);
var isComplete = restSpeed !== false && (!velocity || Math.abs(velocity) <= restSpeed);
if (isComplete) {
framesync_1.cancelSync.update(process);
complete();
}
}, true);
return {
set: function (v) {
current = v;
return this;
},
setAcceleration: function (v) {
acceleration = v;
return this;
},
setFriction: function (v) {
friction = v;
return this;
},
setSpringStrength: function (v) {
springStrength = v;
return this;
},
setSpringTarget: function (v) {
to = v;
return this;
},
setVelocity: function (v) {
velocity = v;
return this;
},
stop: function () {
return framesync_1.cancelSync.update(process);
}
};
});
}; var vectorPhysics = createVectorAction(physics, {
acceleration: style_value_types_1.number.test, friction: style_value_types_1.number.test, velocity: style_value_types_1.number.test, from: style_value_types_1.number.test, to: style_value_types_1.number.test, springStrength: style_value_types_1.number.test
}); exports.physics = vectorPhysics; var DEFAULT_DURATION = 300; var flattenTimings = function (instructions) {
var flatInstructions = [];
var lastArg = instructions[instructions.length - 1];
var isStaggered = typeof lastArg === 'number';
var staggerDelay = isStaggered ? lastArg : 0;
var segments = isStaggered ? instructions.slice(0, -1) : instructions;
var numSegments = segments.length;
var offset = 0;
segments.forEach(function (item, i) {
flatInstructions.push(item);
if (i !== numSegments - 1) {
var duration = item.duration || DEFAULT_DURATION;
offset += staggerDelay;
flatInstructions.push("-" + (duration - offset));
}
});
return flatInstructions;
}; var flattenArrayInstructions = function (instructions, instruction) {
Array.isArray(instruction) ? instructions.push.apply(instructions, flattenTimings(instruction)) : instructions.push(instruction); return instructions;
}; var convertDefToProps = function (props, def, i) {
var duration = props.duration, easings = props.easings, times = props.times, values = props.values;
var numValues = values.length;
var prevTimeTo = times[numValues - 1];
var timeFrom = def.at === 0 ? 0 : def.at / duration;
var timeTo = (def.at + def.duration) / duration;
if (i === 0) {
values.push(def.from);
times.push(timeFrom);
}
else {
if (prevTimeTo !== timeFrom) {
if (def.from !== undefined) {
values.push(values[numValues - 1]);
times.push(timeFrom);
easings.push(easing_1.linear);
}
var from = def.from !== undefined ? def.from : values[numValues - 1];
values.push(from);
times.push(timeFrom);
easings.push(easing_1.linear);
}
else if (def.from !== undefined) {
values.push(def.from);
times.push(timeFrom);
easings.push(easing_1.linear);
}
}
values.push(def.to);
times.push(timeTo);
easings.push(def.ease || easing_1.easeInOut);
return props;
}; var timeline = function (instructions, _a) {
var _b = _a === void 0 ? {} : _a, duration = _b.duration, elapsed = _b.elapsed, ease = _b.ease, loop = _b.loop, flip = _b.flip, yoyo = _b.yoyo;
var playhead = 0;
var calculatedDuration = 0;
var flatInstructions = instructions.reduce(flattenArrayInstructions, []);
var animationDefs = [];
flatInstructions.forEach(function (instruction) {
if (typeof instruction === 'string') {
playhead += parseFloat(instruction);
}
else if (typeof instruction === 'number') {
playhead = instruction;
}
else {
var def = tslib_1.__assign({}, instruction, { at: playhead });
def.duration = def.duration === undefined ? DEFAULT_DURATION : def.duration;
animationDefs.push(def);
playhead += def.duration;
calculatedDuration = Math.max(calculatedDuration, def.at + def.duration);
}
});
var tracks = {};
var numDefs = animationDefs.length;
for (var i = 0; i < numDefs; i++) {
var def = animationDefs[i];
var track = def.track;
if (track === undefined) {
throw new Error('No track defined');
}
if (!tracks.hasOwnProperty(track))
tracks[track] = [];
tracks[track].push(def);
}
var trackKeyframes = {};
for (var key in tracks) {
if (tracks.hasOwnProperty(key)) {
var keyframeProps = tracks[key].reduce(convertDefToProps, {
duration: calculatedDuration,
easings: [],
times: [],
values: []
});
trackKeyframes[key] = keyframes(tslib_1.__assign({}, keyframeProps, { duration: duration || calculatedDuration, ease: ease,
elapsed: elapsed,
loop: loop,
yoyo: yoyo,
flip: flip }));
}
}
return composite(trackKeyframes);
}; exports.timeline = timeline; var listen = function (element, events, options) {
return action(function (_a) {
var update = _a.update;
var eventNames = events.split(' ').map(function (eventName) {
element.addEventListener(eventName, update, options);
return eventName;
});
return {
stop: function () {
return eventNames.forEach(function (eventName) {
return element.removeEventListener(eventName, update, options);
});
}
};
});
}; exports.listen = listen; var defaultPointerPos = function () {
return {
clientX: 0,
clientY: 0,
pageX: 0,
pageY: 0,
x: 0,
y: 0
};
}; var eventToPoint = function (e, point) {
if (point === void 0) {
point = defaultPointerPos();
}
point.clientX = point.x = e.clientX;
point.clientY = point.y = e.clientY;
point.pageX = e.pageX;
point.pageY = e.pageY;
return point;
}; var points = [defaultPointerPos()]; var isTouchDevice = false; if (typeof document !== 'undefined') {
var updatePointsLocation = function (_a) {
var touches = _a.touches;
isTouchDevice = true;
var numTouches = touches.length;
points.length = 0;
for (var i = 0; i < numTouches; i++) {
var thisTouch = touches[i];
points.push(eventToPoint(thisTouch));
}
};
listen(document, 'touchstart touchmove', {
passive: true,
capture: true
}).start(updatePointsLocation);
} var multitouch = function (_a) {
var _b = _a === void 0 ? {} : _a, _c = _b.preventDefault, preventDefault = _c === void 0 ? true : _c, _d = _b.scale, scale = _d === void 0 ? 1.0 : _d, _e = _b.rotate, rotate = _e === void 0 ? 0.0 : _e;
return action(function (_a) {
var update = _a.update;
var output = {
touches: points,
scale: scale,
rotate: rotate
};
var initialDistance = 0.0;
var initialRotation = 0.0;
var isGesture = points.length > 1;
if (isGesture) {
var firstTouch = points[0], secondTouch = points[1];
initialDistance = popcorn_1.distance(firstTouch, secondTouch);
initialRotation = popcorn_1.angle(firstTouch, secondTouch);
}
var updatePoint = function () {
if (isGesture) {
var firstTouch = points[0], secondTouch = points[1];
var newDistance = popcorn_1.distance(firstTouch, secondTouch);
var newRotation = popcorn_1.angle(firstTouch, secondTouch);
output.scale = scale * (newDistance / initialDistance);
output.rotate = rotate + (newRotation - initialRotation);
}
update(output);
};
var onMove = function (e) {
if (preventDefault || e.touches.length > 1)
e.preventDefault();
framesync_1.default.update(updatePoint);
};
var updateOnMove = listen(document, 'touchmove', {
passive: !preventDefault
}).start(onMove);
if (isTouchDevice)
framesync_1.default.update(updatePoint);
return {
stop: function () {
framesync_1.cancelSync.update(updatePoint);
updateOnMove.stop();
}
};
});
}; exports.multitouch = multitouch; var getIsTouchDevice = function () {
return isTouchDevice;
}; var point = defaultPointerPos(); var isMouseDevice = false; if (typeof document !== 'undefined') {
var updatePointLocation = function (e) {
isMouseDevice = true;
eventToPoint(e, point);
};
listen(document, 'mousedown mousemove', true).start(updatePointLocation);
} var mouse = function (_a) {
var _b = (_a === void 0 ? {} : _a).preventDefault, preventDefault = _b === void 0 ? true : _b;
return action(function (_a) {
var update = _a.update;
var updatePoint = function () {
return update(point);
};
var onMove = function (e) {
if (preventDefault)
e.preventDefault();
framesync_1.default.update(updatePoint);
};
var updateOnMove = listen(document, 'mousemove').start(onMove);
if (isMouseDevice)
framesync_1.default.update(updatePoint);
return {
stop: function () {
framesync_1.cancelSync.update(updatePoint);
updateOnMove.stop();
}
};
});
}; exports.mouse = mouse; var getFirstTouch = function (_a) {
var firstTouch = _a[0]; return firstTouch;
}; var pointer = function (props) {
if (props === void 0) {
props = {};
}
return getIsTouchDevice() ? multitouch(props).pipe(function (_a) {
var touches = _a.touches;
return touches;
}, getFirstTouch) : mouse(props);
}; var index$1 = function (_a) {
if (_a === void 0) {
_a = {};
}
var x = _a.x, y = _a.y, props = tslib_1.__rest(_a, ["x", "y"]);
if (x !== undefined || y !== undefined) {
var applyXOffset_1 = popcorn_1.applyOffset(x || 0);
var applyYOffset_1 = popcorn_1.applyOffset(y || 0);
var delta_1 = { x: 0, y: 0 };
return pointer(props).pipe(function (point) {
delta_1.x = applyXOffset_1(point.x);
delta_1.y = applyYOffset_1(point.y);
return delta_1;
});
}
else {
return pointer(props);
}
}; exports.pointer = index$1; var chain = function () {
var actions = [];
for (var _i = 0; _i < arguments.length; _i++) {
actions[_i] = arguments[_i];
}
return action(function (_a) {
var update = _a.update, complete = _a.complete;
var i = 0;
var current;
var playCurrent = function () {
current = actions[i].start({
complete: function () {
i++;
i >= actions.length ? complete() : playCurrent();
},
update: update
});
};
playCurrent();
return {
stop: function () {
return current && current.stop();
}
};
});
}; exports.chain = chain; var crossfade = function (a, b) {
return action(function (observer) {
var balance = 0;
var fadable = parallel$1(a, b).start(tslib_1.__assign({}, observer, { update: function (_a) {
var va = _a[0], vb = _a[1];
observer.update(popcorn_1.mix(va, vb, balance));
} }));
return {
setBalance: function (v) {
return balance = v;
},
stop: function () {
return fadable.stop();
}
};
});
}; exports.crossfade = crossfade; var delay = function (timeToDelay) {
return action(function (_a) {
var complete = _a.complete;
var timeout = setTimeout(complete, timeToDelay);
return {
stop: function () {
return clearTimeout(timeout);
}
};
});
}; exports.delay = delay; var merge = function () {
var actions = [];
for (var _i = 0; _i < arguments.length; _i++) {
actions[_i] = arguments[_i];
}
return action(function (observer) {
var subs = actions.map(function (thisAction) {
return thisAction.start(observer);
});
return {
stop: function () {
return subs.forEach(function (sub) {
return sub.stop();
});
}
};
});
}; exports.merge = merge; var schedule = function (scheduler, schedulee) {
return action(function (_a) {
var update = _a.update, complete = _a.complete;
var latest;
var schedulerSub = scheduler.start({
update: function () {
return latest !== undefined && update(latest);
},
complete: complete
});
var scheduleeSub = schedulee.start({
update: function (v) {
return latest = v;
},
complete: complete
});
return {
stop: function () {
schedulerSub.stop();
scheduleeSub.stop();
}
};
});
}; exports.schedule = schedule; var stagger = function (actions, interval) {
var intervalIsNumber = typeof interval === 'number';
var actionsWithDelay = actions.map(function (a, i) {
var timeToDelay = intervalIsNumber ? interval * i : interval(i);
return chain(delay(timeToDelay), a);
});
return parallel$1.apply(void 0, actionsWithDelay);
}; exports.stagger = stagger; var appendUnit = function (unit) {
return function (v) {
return "" + v + unit;
};
}; var steps = function (st, min, max) {
if (min === void 0) {
min = 0;
}
if (max === void 0) {
max = 1;
}
return function (v) {
var current = popcorn_1.progress(min, max, v);
return popcorn_1.mix(min, max, stepProgress(st, current));
};
}; var transformMap = function (childTransformers) {
return function (v) {
var output = tslib_1.__assign({}, v);
for (var key in childTransformers) {
if (childTransformers.hasOwnProperty(key)) {
var childTransformer = childTransformers[key];
output[key] = childTransformer(v[key]);
}
}
return output;
};
}; var transformers = Object.freeze({
applyOffset: popcorn_1.applyOffset, clamp: popcorn_1.clamp, conditional: popcorn_1.conditional, interpolate: popcorn_1.interpolate, blendArray: popcorn_1.mixArray, blendColor: popcorn_1.mixColor, pipe: popcorn_1.pipe, smooth: popcorn_1.smooth, snap: popcorn_1.snap, generateStaticSpring: popcorn_1.springForce, nonlinearSpring: popcorn_1.springForceExpo, linearSpring: popcorn_1.springForceLinear, wrap: popcorn_1.wrap, appendUnit: appendUnit, steps: steps, transformMap: transformMap
}); exports.transform = transformers; var css = function (element, props) {
hey_listen_1.warning(false, 'css() is deprecated, use styler instead'); return stylefire_1.default(element, props);
}; exports.css = css; var svg = function (element, props) {
hey_listen_1.warning(false, 'svg() is deprecated, use styler instead'); return stylefire_1.default(element, props);
}; exports.svg = svg;
} // @popmotion/popcorn/dist/popcorn.es.js $fsx.f[50] = (module, exports) => { "use strict"; Object.defineProperty(exports, "__esModule", { value: true }); const style_value_types_1 = $fsx.r(46); const hey_listen_1 = $fsx.r(47); const framesync_1 = $fsx.r(48); var easing_1 = $fsx.r(49); exports.createAnticipateEasing = easing_1.createAnticipateEasing; exports.createBackIn = easing_1.createBackIn; exports.createExpoIn = easing_1.createExpoIn; exports.cubicBezier = easing_1.cubicBezier; exports.linear = easing_1.linear; exports.easeIn = easing_1.easeIn; exports.easeOut = easing_1.easeOut; exports.easeInOut = easing_1.easeInOut; exports.circIn = easing_1.circIn; exports.circOut = easing_1.circOut; exports.circInOut = easing_1.circInOut; exports.backIn = easing_1.backIn; exports.backOut = easing_1.backOut; exports.backInOut = easing_1.backInOut; exports.anticipate = easing_1.anticipate; exports.reversed = easing_1.reversed; exports.mirrored = easing_1.mirrored; var zeroPoint = {
x: 0, y: 0, z: 0
}; var isNum = function (v) { return typeof v === 'number'; }; var radiansToDegrees = (function (radians) { return (radians * 180) / Math.PI; }); exports.radiansToDegrees = radiansToDegrees; var angle = (function (a, b) {
if (b === void 0) {
b = zeroPoint;
}
return radiansToDegrees(Math.atan2(b.y - a.y, b.x - a.x));
}); exports.angle = angle; var applyOffset = (function (from, to) {
var hasReceivedFrom = true;
if (to === undefined) {
to = from;
hasReceivedFrom = false;
}
return function (v) {
if (hasReceivedFrom) {
return v - from + to;
}
else {
from = v;
hasReceivedFrom = true;
return to;
}
};
}); exports.applyOffset = applyOffset; var curryRange = (function (func) { return function (min, max, v) { return (v !== undefined ? func(min, max, v) : function (cv) { return func(min, max, cv); }); }; }); var clamp = function (min, max, v) {
return Math.min(Math.max(v, min), max);
}; var clamp$1 = curryRange(clamp); exports.clamp = clamp$1; var conditional = (function (check, apply) {
return function (v) {
return check(v) ? apply(v) : v;
};
}); exports.conditional = conditional; var degreesToRadians = (function (degrees) { return (degrees * Math.PI) / 180; }); exports.degreesToRadians = degreesToRadians; var isPoint = (function (point) {
return point.hasOwnProperty('x') && point.hasOwnProperty('y');
}); exports.isPoint = isPoint; var isPoint3D = (function (point) {
return isPoint(point) && point.hasOwnProperty('z');
}); exports.isPoint3D = isPoint3D; var distance1D = function (a, b) { return Math.abs(a - b); }; var distance = (function (a, b) {
if (b === void 0) {
b = zeroPoint;
}
if (isNum(a) && isNum(b)) {
return distance1D(a, b);
}
else if (isPoint(a) && isPoint(b)) {
var xDelta = distance1D(a.x, b.x);
var yDelta = distance1D(a.y, b.y);
var zDelta = isPoint3D(a) && isPoint3D(b) ? distance1D(a.z, b.z) : 0;
return Math.sqrt(Math.pow(xDelta, 2) + Math.pow(yDelta, 2) + Math.pow(zDelta, 2));
}
return 0;
}); exports.distance = distance; var progress = (function (from, to, value) {
var toFromDifference = to - from; return toFromDifference === 0 ? 1 : (value - from) / toFromDifference;
}); exports.progress = progress; var mix = (function (from, to, progress) {
return -progress * from + progress * to + from;
}); exports.mix = mix; var __assign = function () {
__assign = Object.assign || function __assign(t) {
for (var s, i = 1, n = arguments.length; i < n; i++) {
s = arguments[i];
for (var p in s)
if (Object.prototype.hasOwnProperty.call(s, p))
t[p] = s[p];
}
return t;
};
return __assign.apply(this, arguments);
}; var mixLinearColor = function (from, to, v) {
var fromExpo = from * from; var toExpo = to * to; return Math.sqrt(Math.max(0, v * (toExpo - fromExpo) + fromExpo));
}; var colorTypes = [style_value_types_1.hex, style_value_types_1.rgba, style_value_types_1.hsla]; var getColorType = function (v) {
return colorTypes.find(function (type) { return type.test(v); });
}; var notAnimatable = function (color$$1) {
return "'" + color$$1 + "' is not an animatable color. Use the equivalent color code instead.";
}; var mixColor = (function (from, to) {
var fromColorType = getColorType(from);
var toColorType = getColorType(to);
hey_listen_1.invariant(!!fromColorType, notAnimatable(from));
hey_listen_1.invariant(!!toColorType, notAnimatable(to));
hey_listen_1.invariant(fromColorType.transform === toColorType.transform, 'Both colors must be hex/RGBA, OR both must be HSLA.');
var fromColor = fromColorType.parse(from);
var toColor = toColorType.parse(to);
var blended = __assign({}, fromColor);
var mixFunc = fromColorType === style_value_types_1.hsla ? mix : mixLinearColor;
return function (v) {
for (var key in blended) {
if (key !== 'alpha') {
blended[key] = mixFunc(fromColor[key], toColor[key], v);
}
}
blended.alpha = mix(fromColor.alpha, toColor.alpha, v);
return fromColorType.transform(blended);
};
}); exports.mixColor = mixColor; var combineFunctions = function (a, b) { return function (v) { return b(a(v)); }; }; var pipe = (function () {
var transformers = [];
for (var _i = 0; _i < arguments.length; _i++) {
transformers[_i] = arguments[_i];
}
return transformers.reduce(combineFunctions);
}); exports.pipe = pipe; function getMixer(origin, target) {
if (isNum(origin)) {
return function (v) { return mix(origin, target, v); };
}
else if (style_value_types_1.color.test(origin)) {
return mixColor(origin, target);
}
else {
return mixComplex(origin, target);
}
} var mixArray = function (from, to) {
var output = from.slice();
var numValues = output.length;
var blendValue = from.map(function (fromThis, i) { return getMixer(fromThis, to[i]); });
return function (v) {
for (var i = 0; i < numValues; i++) {
output[i] = blendValue[i](v);
}
return output;
};
}; exports.mixArray = mixArray; var mixObject = function (origin, target) {
var output = __assign({}, origin, target);
var blendValue = {};
for (var key in output) {
if (origin[key] !== undefined && target[key] !== undefined) {
blendValue[key] = getMixer(origin[key], target[key]);
}
}
return function (v) {
for (var key in blendValue) {
output[key] = blendValue[key](v);
}
return output;
};
}; exports.mixObject = mixObject; function analyse(value) {
var parsed = style_value_types_1.complex.parse(value);
var numValues = parsed.length;
var numNumbers = 0;
var numRGB = 0;
var numHSL = 0;
for (var i = 0; i < numValues; i++) {
if (numNumbers || typeof parsed[i] === 'number') {
numNumbers++;
}
else {
if (parsed[i].hue !== undefined) {
numHSL++;
}
else {
numRGB++;
}
}
}
return { parsed: parsed, numNumbers: numNumbers, numRGB: numRGB, numHSL: numHSL };
} var mixComplex = function (origin, target) {
var template = style_value_types_1.complex.createTransformer(target);
var originStats = analyse(origin);
var targetStats = analyse(target);
hey_listen_1.invariant(originStats.numHSL === targetStats.numHSL &&
originStats.numRGB === targetStats.numRGB &&
originStats.numNumbers >= targetStats.numNumbers, "Complex values '" + origin + "' and '" + target + "' too different to mix. Ensure all colors are of the same type.");
return pipe(mixArray(originStats.parsed, targetStats.parsed), template);
}; exports.mixComplex = mixComplex; var mixNumber = function (from, to) { return function (p) { return mix(from, to, p); }; }; function detectMixerFactory(v) {
if (typeof v === 'number') {
return mixNumber;
}
else if (typeof v === 'string') {
if (style_value_types_1.color.test(v)) {
return mixColor;
}
else {
return mixComplex;
}
}
else if (Array.isArray(v)) {
return mixArray;
}
else if (typeof v === 'object') {
return mixObject;
}
} function createMixers(output, ease, customMixer) {
var mixers = [];
var mixerFactory = customMixer || detectMixerFactory(output[0]);
var numMixers = output.length - 1;
for (var i = 0; i < numMixers; i++) {
var mixer = mixerFactory(output[i], output[i + 1]);
if (ease) {
var easingFunction = Array.isArray(ease) ? ease[i] : ease;
mixer = pipe(easingFunction, mixer);
}
mixers.push(mixer);
}
return mixers;
} function fastInterpolate(_a, _b) {
var from = _a[0], to = _a[1];
var mixer = _b[0];
return function (v) { return mixer(progress(from, to, v)); };
} function slowInterpolate(input, mixers) {
var inputLength = input.length;
var lastInputIndex = inputLength - 1;
return function (v) {
var mixerIndex = 0;
var foundMixerIndex = false;
if (v <= input[0]) {
foundMixerIndex = true;
}
else if (v >= input[lastInputIndex]) {
mixerIndex = lastInputIndex - 1;
foundMixerIndex = true;
}
if (!foundMixerIndex) {
var i = 1;
for (; i < inputLength; i++) {
if (input[i] > v || i === lastInputIndex) {
break;
}
}
mixerIndex = i - 1;
}
var progressInRange = progress(input[mixerIndex], input[mixerIndex + 1], v);
return mixers[mixerIndex](progressInRange);
};
} function interpolate(input, output, _a) {
var _b = _a === void 0 ? {} : _a, _c = _b.clamp, clamp = _c === void 0 ? true : _c, ease = _b.ease, mixer = _b.mixer;
var inputLength = input.length;
hey_listen_1.invariant(inputLength === output.length, 'Both input and output ranges must be the same length');
hey_listen_1.invariant(!ease || !Array.isArray(ease) || ease.length === inputLength - 1, 'Array of easing functions must be of length `input.length - 1`, as it applies to the transitions **between** the defined values.');
if (input[0] > input[inputLength - 1]) {
input = [].concat(input);
output = [].concat(output);
input.reverse();
output.reverse();
}
var mixers = createMixers(output, ease, mixer);
var interpolator = inputLength === 2
? fastInterpolate(input, mixers)
: slowInterpolate(input, mixers);
return clamp
? pipe(clamp$1(input[0], input[inputLength - 1]), interpolator)
: interpolator;
} exports.interpolate = interpolate; var pointFromVector = (function (origin, angle, distance) {
angle = degreesToRadians(angle);
return {
x: distance * Math.cos(angle) + origin.x,
y: distance * Math.sin(angle) + origin.y
};
}); exports.pointFromVector = pointFromVector; var toDecimal = (function (num, precision) {
if (precision === void 0) {
precision = 2;
}
precision = Math.pow(10, precision);
return Math.round(num * precision) / precision;
}); exports.toDecimal = toDecimal; var smoothFrame = (function (prevValue, nextValue, duration, smoothing) {
if (smoothing === void 0) {
smoothing = 0;
}
return toDecimal(prevValue +
(duration * (nextValue - prevValue)) / Math.max(smoothing, duration));
}); exports.smoothFrame = smoothFrame; var smooth = (function (strength) {
if (strength === void 0) {
strength = 50;
}
var previousValue = 0;
var lastUpdated = 0;
return function (v) {
var currentFramestamp = framesync_1.getFrameData().timestamp;
var timeDelta = currentFramestamp !== lastUpdated ? currentFramestamp - lastUpdated : 0;
var newValue = timeDelta
? smoothFrame(previousValue, v, timeDelta, strength)
: previousValue;
lastUpdated = currentFramestamp;
previousValue = newValue;
return newValue;
};
}); exports.smooth = smooth; var snap = (function (points) {
if (typeof points === 'number') {
return function (v) { return Math.round(v / points) * points; };
}
else {
var i_1 = 0;
var numPoints_1 = points.length;
return function (v) {
var lastDistance = Math.abs(points[0] - v);
for (i_1 = 1; i_1 < numPoints_1; i_1++) {
var point = points[i_1];
var distance = Math.abs(point - v);
if (distance === 0)
return point;
if (distance > lastDistance)
return points[i_1 - 1];
if (i_1 === numPoints_1 - 1)
return point;
lastDistance = distance;
}
};
}
}); exports.snap = snap; var identity = function (v) { return v; }; var springForce = function (alterDisplacement) {
if (alterDisplacement === void 0) {
alterDisplacement = identity;
}
return curryRange(function (constant, origin, v) {
var displacement = origin - v;
var springModifiedDisplacement = -(0 - constant + 1) * (0 - alterDisplacement(Math.abs(displacement)));
return displacement <= 0
? origin + springModifiedDisplacement
: origin - springModifiedDisplacement;
});
}; exports.springForce = springForce; var springForceLinear = springForce(); exports.springForceLinear = springForceLinear; var springForceExpo = springForce(Math.sqrt); exports.springForceExpo = springForceExpo; var velocityPerFrame = (function (xps, frameDuration) {
return isNum(xps) ? xps / (1000 / frameDuration) : 0;
}); exports.velocityPerFrame = velocityPerFrame; var velocityPerSecond = (function (velocity, frameDuration) {
return frameDuration ? velocity * (1000 / frameDuration) : 0;
}); exports.velocityPerSecond = velocityPerSecond; var wrap = function (min, max, v) {
var rangeSize = max - min; return ((((v - min) % rangeSize) + rangeSize) % rangeSize) + min;
}; var wrap$1 = curryRange(wrap); exports.wrap = wrap$1; var clampProgress = clamp$1(0, 1); var steps = (function (steps, direction) {
if (direction === void 0) {
direction = 'end';
}
return function (progress) {
progress =
direction === 'end' ? Math.min(progress, 0.999) : Math.max(progress, 0.001);
var expanded = progress * steps;
var rounded = direction === 'end' ? Math.floor(expanded) : Math.ceil(expanded);
return clampProgress(rounded / steps);
};
}); exports.steps = steps;
} // style-value-types/dist/style-value-types.es.js $fsx.f[46] = (module, exports) => { "use strict"; Object.defineProperty(exports, "__esModule", { value: true }); var __assign = function () {
__assign = Object.assign || function __assign(t) {
for (var s, i = 1, n = arguments.length; i < n; i++) {
s = arguments[i];
for (var p in s)
if (Object.prototype.hasOwnProperty.call(s, p))
t[p] = s[p];
}
return t;
};
return __assign.apply(this, arguments);
}; var clamp = function (min, max) {
return function (v) {
return Math.max(Math.min(v, max), min);
};
}; var sanitize = function (v) { return (v % 1 ? Number(v.toFixed(5)) : v); }; var floatRegex = /(-)?(\d[\d\.]*)/g; var colorRegex = /(#[0-9a-f]{6}|#[0-9a-f]{3}|#(?:[0-9a-f]{2}){2,4}|(rgb|hsl)a?\((-?\d+%?[,\s]+){2,3}\s*[\d\.]+%?\))/gi; var singleColorRegex = /^(#[0-9a-f]{3}|#(?:[0-9a-f]{2}){2,4}|(rgb|hsl)a?\((-?\d+%?[,\s]+){2,3}\s*[\d\.]+%?\))$/i; var number = {
test: function (v) { return typeof v === 'number'; },
parse: parseFloat,
transform: function (v) { return v; }
}; exports.number = number; var alpha = __assign({}, number, { transform: clamp(0, 1) }); exports.alpha = alpha; var scale = __assign({}, number, { default: 1 }); exports.scale = scale; var createUnitType = function (unit) {
return ({
test: function (v) {
return typeof v === 'string' && v.endsWith(unit) && v.split(' ').length === 1;
},
parse: parseFloat,
transform: function (v) { return "" + v + unit; }
});
}; var degrees = createUnitType('deg'); exports.degrees = degrees; var percent = createUnitType('%'); exports.percent = percent; var px = createUnitType('px'); exports.px = px; var vh = createUnitType('vh'); exports.vh = vh; var vw = createUnitType('vw'); exports.vw = vw; var progressPercentage = __assign({}, percent, { parse: function (v) { return percent.parse(v) / 100; }, transform: function (v) { return percent.transform(v * 100); } }); exports.progressPercentage = progressPercentage; var getValueFromFunctionString = function (value) {
return value.substring(value.indexOf('(') + 1, value.lastIndexOf(')'));
}; var clampRgbUnit = clamp(0, 255); var isRgba = function (v) { return v.red !== undefined; }; var isHsla = function (v) { return v.hue !== undefined; }; var splitColorValues = function (terms) {
return function (v) {
if (typeof v !== 'string')
return v;
var values = {};
var valuesArray = getValueFromFunctionString(v).split(/,\s*/);
for (var i = 0; i < 4; i++) {
values[terms[i]] =
valuesArray[i] !== undefined ? parseFloat(valuesArray[i]) : 1;
}
return values;
};
}; var rgbaTemplate = function (_a) {
var red = _a.red, green = _a.green, blue = _a.blue, _b = _a.alpha, alpha$$1 = _b === void 0 ? 1 : _b;
return "rgba(" + red + ", " + green + ", " + blue + ", " + alpha$$1 + ")";
}; var hslaTemplate = function (_a) {
var hue = _a.hue, saturation = _a.saturation, lightness = _a.lightness, _b = _a.alpha, alpha$$1 = _b === void 0 ? 1 : _b;
return "hsla(" + hue + ", " + saturation + ", " + lightness + ", " + alpha$$1 + ")";
}; var rgbUnit = __assign({}, number, { transform: function (v) { return Math.round(clampRgbUnit(v)); } }); exports.rgbUnit = rgbUnit; function isColorString(color, colorType) {
return color.startsWith(colorType) && singleColorRegex.test(color);
} var rgba = {
test: function (v) { return (typeof v === 'string' ? isColorString(v, 'rgb') : isRgba(v)); },
parse: splitColorValues(['red', 'green', 'blue', 'alpha']),
transform: function (_a) {
var red = _a.red, green = _a.green, blue = _a.blue, _b = _a.alpha, alpha$$1 = _b === void 0 ? 1 : _b;
return rgbaTemplate({
red: rgbUnit.transform(red),
green: rgbUnit.transform(green),
blue: rgbUnit.transform(blue),
alpha: sanitize(alpha.transform(alpha$$1))
});
}
}; exports.rgba = rgba; var hsla = {
test: function (v) { return (typeof v === 'string' ? isColorString(v, 'hsl') : isHsla(v)); },
parse: splitColorValues(['hue', 'saturation', 'lightness', 'alpha']),
transform: function (_a) {
var hue = _a.hue, saturation = _a.saturation, lightness = _a.lightness, _b = _a.alpha, alpha$$1 = _b === void 0 ? 1 : _b;
return hslaTemplate({
hue: Math.round(hue),
saturation: percent.transform(sanitize(saturation)),
lightness: percent.transform(sanitize(lightness)),
alpha: sanitize(alpha.transform(alpha$$1))
});
}
}; exports.hsla = hsla; var hex = __assign({}, rgba, { test: function (v) { return typeof v === 'string' && isColorString(v, '#'); }, parse: function (v) {
var r = ;
var g = ;
var b = ;
if (v.length > 4) {
r = v.substr(1, 2);
g = v.substr(3, 2);
b = v.substr(5, 2);
}
else {
r = v.substr(1, 1);
g = v.substr(2, 1);
b = v.substr(3, 1);
r += r;
g += g;
b += b;
}
return {
red: parseInt(r, 16),
green: parseInt(g, 16),
blue: parseInt(b, 16),
alpha: 1
};
} });
exports.hex = hex; var color = {
test: function (v) {
return (typeof v === 'string' && singleColorRegex.test(v)) ||
isRgba(v) ||
isHsla(v);
},
parse: function (v) {
if (rgba.test(v)) {
return rgba.parse(v);
}
else if (hsla.test(v)) {
return hsla.parse(v);
}
else if (hex.test(v)) {
return hex.parse(v);
}
return v;
},
transform: function (v) {
if (isRgba(v)) {
return rgba.transform(v);
}
else if (isHsla(v)) {
return hsla.transform(v);
}
return v;
}
}; exports.color = color; var COLOR_TOKEN = '${c}'; var NUMBER_TOKEN = '${n}'; var convertNumbersToZero = function (v) {
return typeof v === 'number' ? 0 : v;
}; var complex = {
test: function (v) {
if (typeof v !== 'string' || !isNaN(v))
return false;
var numValues = 0;
var foundNumbers = v.match(floatRegex);
var foundColors = v.match(colorRegex);
if (foundNumbers)
numValues += foundNumbers.length;
if (foundColors)
numValues += foundColors.length;
return numValues > 0;
},
parse: function (v) {
var input = v;
var parsed = [];
var foundColors = input.match(colorRegex);
if (foundColors) {
input = input.replace(colorRegex, COLOR_TOKEN);
parsed.push.apply(parsed, foundColors.map(color.parse));
}
var foundNumbers = input.match(floatRegex);
if (foundNumbers) {
parsed.push.apply(parsed, foundNumbers.map(number.parse));
}
return parsed;
},
createTransformer: function (prop) {
var template = prop;
var token = 0;
var foundColors = prop.match(colorRegex);
var numColors = foundColors ? foundColors.length : 0;
if (foundColors) {
for (var i = 0; i < numColors; i++) {
template = template.replace(foundColors[i], COLOR_TOKEN);
token++;
}
}
var foundNumbers = template.match(floatRegex);
var numNumbers = foundNumbers ? foundNumbers.length : 0;
if (foundNumbers) {
for (var i = 0; i < numNumbers; i++) {
template = template.replace(foundNumbers[i], NUMBER_TOKEN);
token++;
}
}
return function (v) {
var output = template;
for (var i = 0; i < token; i++) {
output = output.replace(i < numColors ? COLOR_TOKEN : NUMBER_TOKEN, i < numColors ? color.transform(v[i]) : sanitize(v[i]));
}
return output;
};
},
getAnimatableNone: function (target) {
var parsedTarget = complex.parse(target);
var targetTransformer = complex.createTransformer(target);
return targetTransformer(parsedTarget.map(convertNumbersToZero));
}
}; exports.complex = complex;
} // hey-listen/dist/hey-listen.es.js $fsx.f[47] = (module, exports) => { "use strict"; Object.defineProperty(exports, "__esModule", { value: true }); var warning = function () { }; exports.warning = warning; var invariant = function () { }; exports.invariant = invariant;
} // framesync/dist/framesync.es.js $fsx.f[48] = (module, exports) => { "use strict"; Object.defineProperty(exports, "__esModule", { value: true }); const hey_listen_1 = $fsx.r(47); var prevTime = 0; var onNextFrame = typeof window !== 'undefined' && window.requestAnimationFrame !== undefined
? function (callback) { return window.requestAnimationFrame(callback); }
: function (callback) {
var timestamp = Date.now();
var timeToCall = Math.max(0, 16.7 - (timestamp - prevTime));
prevTime = timestamp + timeToCall;
setTimeout(function () { return callback(prevTime); }, timeToCall);
};
var createStep = (function (setRunNextFrame) {
var processToRun = [];
var processToRunNextFrame = [];
var numThisFrame = 0;
var isProcessing = false;
var i = 0;
var cancelled = new WeakSet();
var toKeepAlive = new WeakSet();
var renderStep = {
cancel: function (process) {
var indexOfCallback = processToRunNextFrame.indexOf(process);
cancelled.add(process);
if (indexOfCallback !== -1) {
processToRunNextFrame.splice(indexOfCallback, 1);
}
},
process: function (frame) {
var _a;
isProcessing = true;
_a = [
processToRunNextFrame,
processToRun
], processToRun = _a[0], processToRunNextFrame = _a[1];
processToRunNextFrame.length = 0;
numThisFrame = processToRun.length;
if (numThisFrame) {
var process_1;
for (i = 0; i < numThisFrame; i++) {
process_1 = processToRun[i];
process_1(frame);
if (toKeepAlive.has(process_1) === true && !cancelled.has(process_1)) {
renderStep.schedule(process_1);
setRunNextFrame(true);
}
}
}
isProcessing = false;
},
schedule: function (process, keepAlive, immediate) {
if (keepAlive === void 0) {
keepAlive = false;
}
if (immediate === void 0) {
immediate = false;
}
hey_listen_1.invariant(typeof process === 'function', 'Argument must be a function');
var addToCurrentBuffer = immediate && isProcessing;
var buffer = addToCurrentBuffer ? processToRun : processToRunNextFrame;
cancelled.delete(process);
if (keepAlive)
toKeepAlive.add(process);
if (buffer.indexOf(process) === -1) {
buffer.push(process);
if (addToCurrentBuffer)
numThisFrame = processToRun.length;
}
}
};
return renderStep;
}); var StepId; (function (StepId) {
StepId["Read"] = "read"; StepId["Update"] = "update"; StepId["Render"] = "render"; StepId["PostRender"] = "postRender"; StepId["FixedUpdate"] = "fixedUpdate";
})(StepId || (StepId = {})); var maxElapsed = 40; var defaultElapsed = (1 / 60) * 1000; var useDefaultElapsed = true; var willRunNextFrame = false; var isProcessing = false; var frame = {
delta: 0, timestamp: 0
}; var stepsOrder = [
StepId.Read, StepId.Update, StepId.Render, StepId.PostRender
]; var setWillRunNextFrame = function (willRun) { return (willRunNextFrame = willRun); }; var _a = stepsOrder.reduce(function (acc, key) {
var step = createStep(setWillRunNextFrame);
acc.sync[key] = function (process, keepAlive, immediate) {
if (keepAlive === void 0) {
keepAlive = false;
}
if (immediate === void 0) {
immediate = false;
}
if (!willRunNextFrame)
startLoop();
step.schedule(process, keepAlive, immediate);
return process;
};
acc.cancelSync[key] = function (process) { return step.cancel(process); };
acc.steps[key] = step;
return acc;
}, {
steps: {},
sync: {},
cancelSync: {}
}), steps = _a.steps, sync = _a.sync, cancelSync = _a.cancelSync; exports.cancelSync = cancelSync; var processStep = function (stepId) { return steps[stepId].process(frame); }; var processFrame = function (timestamp) {
willRunNextFrame = false;
frame.delta = useDefaultElapsed
? defaultElapsed
: Math.max(Math.min(timestamp - frame.timestamp, maxElapsed), 1);
if (!useDefaultElapsed)
defaultElapsed = frame.delta;
frame.timestamp = timestamp;
isProcessing = true;
stepsOrder.forEach(processStep);
isProcessing = false;
if (willRunNextFrame) {
useDefaultElapsed = false;
onNextFrame(processFrame);
}
}; var startLoop = function () {
willRunNextFrame = true;
useDefaultElapsed = true;
if (!isProcessing)
onNextFrame(processFrame);
}; var getFrameData = function () { return frame; }; exports.getFrameData = getFrameData; exports.default = sync;
} // @popmotion/easing/dist/easing.es.js $fsx.f[49] = (module, exports) => { "use strict"; Object.defineProperty(exports, "__esModule", { value: true }); var DEFAULT_OVERSHOOT_STRENGTH = 1.525; var reversed = function (easing) {
return function (p) {
return 1 - easing(1 - p);
};
}; exports.reversed = reversed; var mirrored = function (easing) {
return function (p) {
return p <= 0.5 ? easing(2 * p) / 2 : (2 - easing(2 * (1 - p))) / 2;
};
}; exports.mirrored = mirrored; var createReversedEasing = reversed; exports.createReversedEasing = createReversedEasing; var createMirroredEasing = mirrored; exports.createMirroredEasing = createMirroredEasing; var createExpoIn = function (power) {
return function (p) {
return Math.pow(p, power);
};
}; exports.createExpoIn = createExpoIn; var createBackIn = function (power) {
return function (p) {
return p * p * ((power + 1) * p - power);
};
}; exports.createBackIn = createBackIn; var createAnticipateEasing = function (power) {
var backEasing = createBackIn(power);
return function (p) {
return (p *= 2) < 1 ? 0.5 * backEasing(p) : 0.5 * (2 - Math.pow(2, -10 * (p - 1)));
};
}; exports.createAnticipateEasing = createAnticipateEasing; var linear = function (p) {
return p;
}; exports.linear = linear; var easeIn = createExpoIn(2); exports.easeIn = easeIn; var easeOut = reversed(easeIn); exports.easeOut = easeOut; var easeInOut = mirrored(easeIn); exports.easeInOut = easeInOut; var circIn = function (p) {
return 1 - Math.sin(Math.acos(p));
}; exports.circIn = circIn; var circOut = reversed(circIn); exports.circOut = circOut; var circInOut = mirrored(circOut); exports.circInOut = circInOut; var backIn = createBackIn(DEFAULT_OVERSHOOT_STRENGTH); exports.backIn = backIn; var backOut = reversed(backIn); exports.backOut = backOut; var backInOut = mirrored(backIn); exports.backInOut = backInOut; var anticipate = createAnticipateEasing(DEFAULT_OVERSHOOT_STRENGTH); exports.anticipate = anticipate; var BOUNCE_FIRST_THRESHOLD = 4.0 / 11.0; var BOUNCE_SECOND_THRESHOLD = 8.0 / 11.0; var BOUNCE_THIRD_THRESHOLD = 9.0 / 10.0; var ca = 4356.0 / 361.0; var cb = 35442.0 / 1805.0; var cc = 16061.0 / 1805.0; var bounceOut = function (p) {
var p2 = p * p; return p < BOUNCE_FIRST_THRESHOLD ? 7.5625 * p2 : p < BOUNCE_SECOND_THRESHOLD ? 9.075 * p2 - 9.9 * p + 3.4 : p < BOUNCE_THIRD_THRESHOLD ? ca * p2 - cb * p + cc : 10.8 * p * p - 20.52 * p + 10.72;
}; exports.bounceOut = bounceOut; var bounceIn = function (p) {
return 1.0 - bounceOut(1.0 - p);
}; exports.bounceIn = bounceIn; var bounceInOut = function (p) {
return p < 0.5 ? 0.5 * (1.0 - bounceOut(1.0 - p * 2.0)) : 0.5 * bounceOut(p * 2.0 - 1.0) + 0.5;
}; exports.bounceInOut = bounceInOut; var NEWTON_ITERATIONS = 8; var NEWTON_MIN_SLOPE = 0.001; var SUBDIVISION_PRECISION = 0.0000001; var SUBDIVISION_MAX_ITERATIONS = 10; var K_SPLINE_TABLE_SIZE = 11; var K_SAMPLE_STEP_SIZE = 1.0 / (K_SPLINE_TABLE_SIZE - 1.0); var FLOAT_32_SUPPORTED = typeof Float32Array !== 'undefined'; var a = function (a1, a2) {
return 1.0 - 3.0 * a2 + 3.0 * a1;
}; var b = function (a1, a2) {
return 3.0 * a2 - 6.0 * a1;
}; var c = function (a1) {
return 3.0 * a1;
}; var getSlope = function (t, a1, a2) {
return 3.0 * a(a1, a2) * t * t + 2.0 * b(a1, a2) * t + c(a1);
}; var calcBezier = function (t, a1, a2) {
return ((a(a1, a2) * t + b(a1, a2)) * t + c(a1)) * t;
}; function cubicBezier(mX1, mY1, mX2, mY2) {
var sampleValues = FLOAT_32_SUPPORTED ? new Float32Array(K_SPLINE_TABLE_SIZE) : new Array(K_SPLINE_TABLE_SIZE);
var binarySubdivide = function (aX, aA, aB) {
var i = 0;
var currentX;
var currentT;
do {
currentT = aA + (aB - aA) / 2.0;
currentX = calcBezier(currentT, mX1, mX2) - aX;
if (currentX > 0.0) {
aB = currentT;
}
else {
aA = currentT;
}
} while (Math.abs(currentX) > SUBDIVISION_PRECISION && ++i < SUBDIVISION_MAX_ITERATIONS);
return currentT;
};
var newtonRaphsonIterate = function (aX, aGuessT) {
var i = 0;
var currentSlope = 0;
var currentX;
for (; i < NEWTON_ITERATIONS; ++i) {
currentSlope = getSlope(aGuessT, mX1, mX2);
if (currentSlope === 0.0) {
return aGuessT;
}
currentX = calcBezier(aGuessT, mX1, mX2) - aX;
aGuessT -= currentX / currentSlope;
}
return aGuessT;
};
var calcSampleValues = function () {
for (var i = 0; i < K_SPLINE_TABLE_SIZE; ++i) {
sampleValues[i] = calcBezier(i * K_SAMPLE_STEP_SIZE, mX1, mX2);
}
};
var getTForX = function (aX) {
var intervalStart = 0.0;
var currentSample = 1;
var lastSample = K_SPLINE_TABLE_SIZE - 1;
var dist = 0.0;
var guessForT = 0.0;
var initialSlope = 0.0;
for (; currentSample !== lastSample && sampleValues[currentSample] <= aX; ++currentSample) {
intervalStart += K_SAMPLE_STEP_SIZE;
}
--currentSample;
dist = (aX - sampleValues[currentSample]) / (sampleValues[currentSample + 1] - sampleValues[currentSample]);
guessForT = intervalStart + dist * K_SAMPLE_STEP_SIZE;
initialSlope = getSlope(guessForT, mX1, mX2);
if (initialSlope >= NEWTON_MIN_SLOPE) {
return newtonRaphsonIterate(aX, guessForT);
}
else if (initialSlope === 0.0) {
return guessForT;
}
else {
return binarySubdivide(aX, intervalStart, intervalStart + K_SAMPLE_STEP_SIZE);
}
};
calcSampleValues();
var resolver = function (aX) {
var returnValue;
if (mX1 === mY1 && mX2 === mY2) {
returnValue = aX;
}
else if (aX === 0) {
returnValue = 0;
}
else if (aX === 1) {
returnValue = 1;
}
else {
returnValue = calcBezier(getTForX(aX), mY1, mY2);
}
return returnValue;
};
return resolver;
} exports.cubicBezier = cubicBezier;
} // stylefire/dist/stylefire.es.js $fsx.f[51] = (module, exports) => { "use strict"; Object.defineProperty(exports, "__esModule", { value: true }); const framesync_1 = $fsx.r(48); const style_value_types_1 = $fsx.r(46); const hey_listen_1 = $fsx.r(47); var __assign = function () {
__assign = Object.assign || function __assign(t) {
for (var s, i = 1, n = arguments.length; i < n; i++) {
s = arguments[i];
for (var p in s)
if (Object.prototype.hasOwnProperty.call(s, p))
t[p] = s[p];
}
return t;
};
return __assign.apply(this, arguments);
}; function __rest(s, e) {
var t = {};
for (var p in s)
if (Object.prototype.hasOwnProperty.call(s, p) && e.indexOf(p) < 0)
t[p] = s[p];
if (s != null && typeof Object.getOwnPropertySymbols === "function")
for (var i = 0, p = Object.getOwnPropertySymbols(s); i < p.length; i++)
if (e.indexOf(p[i]) < 0)
t[p[i]] = s[p[i]];
return t;
} var createStyler = function (_a) {
var onRead = _a.onRead, onRender = _a.onRender, _b = _a.uncachedValues, uncachedValues = _b === void 0 ? new Set() : _b, _c = _a.useCache, useCache = _c === void 0 ? true : _c;
return function (_a) {
if (_a === void 0) {
_a = {};
}
var props = __rest(_a, []);
var state = {};
var changedValues = [];
var hasChanged = false;
function setValue(key, value) {
if (key.startsWith('--')) {
props.hasCSSVariable = true;
}
var currentValue = state[key];
state[key] = value;
if (state[key] === currentValue)
return;
if (changedValues.indexOf(key) === -1) {
changedValues.push(key);
}
if (!hasChanged) {
hasChanged = true;
framesync_1.default.render(styler.render);
}
}
var styler = {
get: function (key, forceRead) {
if (forceRead === void 0) {
forceRead = false;
}
var useCached = !forceRead && useCache && !uncachedValues.has(key) && state[key] !== undefined;
return useCached ? state[key] : onRead(key, props);
},
set: function (values, value) {
if (typeof values === 'string') {
setValue(values, value);
}
else {
for (var key in values) {
setValue(key, values[key]);
}
}
return this;
},
render: function (forceRender) {
if (forceRender === void 0) {
forceRender = false;
}
if (hasChanged || forceRender === true) {
onRender(state, props, changedValues);
hasChanged = false;
changedValues.length = 0;
}
return this;
}
};
return styler;
};
}; exports.createStylerFactory = createStyler; var CAMEL_CASE_PATTERN = /([a-z])([A-Z])/g; var REPLACE_TEMPLATE = '$1-$2'; var camelToDash = function (str) {
return str.replace(CAMEL_CASE_PATTERN, REPLACE_TEMPLATE).toLowerCase();
}; var setDomAttrs = function (element, attrs) {
for (var key in attrs) {
if (attrs.hasOwnProperty(key)) {
element.setAttribute(key, attrs[key]);
}
}
}; var camelCache = new Map(); var dashCache = new Map(); var prefixes = ['Webkit', 'Moz', 'O', 'ms', ]; var numPrefixes = prefixes.length; var isBrowser = typeof document !== 'undefined'; var testElement; var setDashPrefix = function (key, prefixed) {
return dashCache.set(key, camelToDash(prefixed));
}; var testPrefix = function (key) {
testElement = testElement || document.createElement('div');
for (var i = 0; i < numPrefixes; i++) {
var prefix = prefixes[i];
var noPrefix = prefix === ;
var prefixedPropertyName = noPrefix ? key : prefix + key.charAt(0).toUpperCase() + key.slice(1);
if (prefixedPropertyName in testElement.style || noPrefix) {
camelCache.set(key, prefixedPropertyName);
setDashPrefix(key, "" + (noPrefix ? : '-') + camelToDash(prefixedPropertyName));
}
}
}; var setServerProperty = function (key) {
return setDashPrefix(key, key);
}; var prefixer = function (key, asDashCase) {
if (asDashCase === void 0) {
asDashCase = false;
}
var cache = asDashCase ? dashCache : camelCache;
if (!cache.has(key))
isBrowser ? testPrefix(key) : setServerProperty(key);
return cache.get(key) || key;
}; var axes = [, 'X', 'Y', 'Z']; var order = ['scale', 'rotate', 'skew', 'transformPerspective']; var transformProps = order.reduce(function (acc, key) {
return axes.reduce(function (axesAcc, axesKey) {
axesAcc.push(key + axesKey);
return axesAcc;
}, acc);
}, ['x', 'y', 'z']); var transformPropDictionary = transformProps.reduce(function (dict, key) {
dict[key] = true; return dict;
}, {}); function isTransformProp(key) {
return transformPropDictionary[key] === true;
} exports.isTransformProp = isTransformProp; function sortTransformProps(a, b) {
return transformProps.indexOf(a) - transformProps.indexOf(b);
} var transformOriginProps = new Set(['originX', 'originY', 'originZ']); function isTransformOriginProp(key) {
return transformOriginProps.has(key);
} var rounded = __assign({}, style_value_types_1.number, { transform: Math.round }); var valueTypes = {
color: style_value_types_1.color, backgroundColor: style_value_types_1.color, outlineColor: style_value_types_1.color, fill: style_value_types_1.color, stroke: style_value_types_1.color, borderColor: style_value_types_1.color, borderTopColor: style_value_types_1.color, borderRightColor: style_value_types_1.color, borderBottomColor: style_value_types_1.color, borderLeftColor: style_value_types_1.color, borderWidth: style_value_types_1.px, borderTopWidth: style_value_types_1.px, borderRightWidth: style_value_types_1.px, borderBottomWidth: style_value_types_1.px, borderLeftWidth: style_value_types_1.px, borderRadius: style_value_types_1.px, radius: style_value_types_1.px, borderTopLeftRadius: style_value_types_1.px, borderTopRightRadius: style_value_types_1.px, borderBottomRightRadius: style_value_types_1.px, borderBottomLeftRadius: style_value_types_1.px, width: style_value_types_1.px, maxWidth: style_value_types_1.px, height: style_value_types_1.px, maxHeight: style_value_types_1.px, size: style_value_types_1.px, top: style_value_types_1.px, right: style_value_types_1.px, bottom: style_value_types_1.px, left: style_value_types_1.px, padding: style_value_types_1.px, paddingTop: style_value_types_1.px, paddingRight: style_value_types_1.px, paddingBottom: style_value_types_1.px, paddingLeft: style_value_types_1.px, margin: style_value_types_1.px, marginTop: style_value_types_1.px, marginRight: style_value_types_1.px, marginBottom: style_value_types_1.px, marginLeft: style_value_types_1.px, rotate: style_value_types_1.degrees, rotateX: style_value_types_1.degrees, rotateY: style_value_types_1.degrees, rotateZ: style_value_types_1.degrees, scale: style_value_types_1.scale, scaleX: style_value_types_1.scale, scaleY: style_value_types_1.scale, scaleZ: style_value_types_1.scale, skew: style_value_types_1.degrees, skewX: style_value_types_1.degrees, skewY: style_value_types_1.degrees, distance: style_value_types_1.px, x: style_value_types_1.px, y: style_value_types_1.px, z: style_value_types_1.px, perspective: style_value_types_1.px, opacity: style_value_types_1.alpha, originX: style_value_types_1.progressPercentage, originY: style_value_types_1.progressPercentage, originZ: style_value_types_1.px, zIndex: rounded
}; var getValueType = function (key) {
return valueTypes[key];
}; var getValueAsType = function (value, type) {
return type && typeof value === 'number' ? type.transform(value) : value;
}; var SCROLL_LEFT = 'scrollLeft'; var SCROLL_TOP = 'scrollTop'; var scrollKeys = new Set([SCROLL_LEFT, SCROLL_TOP]); var blacklist = new Set([SCROLL_LEFT, SCROLL_TOP, 'transform']); var translateAlias = {
x: 'translateX', y: 'translateY', z: 'translateZ'
}; function isCustomTemplate(v) {
return typeof v === 'function';
} function buildTransform(state, transform, transformKeys, transformIsDefault, enableHardwareAcceleration) {
var transformString = ;
var transformHasZ = false;
transformKeys.sort(sortTransformProps);
var numTransformKeys = transformKeys.length;
for (var i = 0; i < numTransformKeys; i++) {
var key = transformKeys[i];
transformString += (translateAlias[key] || key) + "(" + transform[key] + ") ";
transformHasZ = key === 'z' ? true : transformHasZ;
}
if (!transformHasZ && enableHardwareAcceleration) {
transformString += 'translateZ(0)';
}
else {
transformString = transformString.trim();
}
if (isCustomTemplate(state.transform)) {
transformString = state.transform(transform, transformString);
}
else if (transformIsDefault) {
transformString = 'none';
}
return transformString;
} function buildStyleProperty(state, enableHardwareAcceleration, styles, transform, transformOrigin, transformKeys, isDashCase) {
if (enableHardwareAcceleration === void 0) {
enableHardwareAcceleration = true;
}
if (styles === void 0) {
styles = {};
}
if (transform === void 0) {
transform = {};
}
if (transformOrigin === void 0) {
transformOrigin = {};
}
if (transformKeys === void 0) {
transformKeys = [];
}
if (isDashCase === void 0) {
isDashCase = false;
}
var transformIsDefault = true;
var hasTransform = false;
var hasTransformOrigin = false;
for (var key in state) {
var value = state[key];
var valueType = getValueType(key);
var valueAsType = getValueAsType(value, valueType);
if (isTransformProp(key)) {
hasTransform = true;
transform[key] = valueAsType;
transformKeys.push(key);
if (transformIsDefault) {
if (valueType.default && value !== valueType.default || !valueType.default && value !== 0) {
transformIsDefault = false;
}
}
}
else if (isTransformOriginProp(key)) {
transformOrigin[key] = valueAsType;
hasTransformOrigin = true;
}
else if (!blacklist.has(key) || !isCustomTemplate(valueAsType)) {
styles[prefixer(key, isDashCase)] = valueAsType;
}
}
if (hasTransform || typeof state.transform === 'function') {
styles.transform = buildTransform(state, transform, transformKeys, transformIsDefault, enableHardwareAcceleration);
}
if (hasTransformOrigin) {
styles.transformOrigin = (transformOrigin.originX || 0) + " " + (transformOrigin.originY || 0) + " " + (transformOrigin.originZ || 0);
}
return styles;
} exports.buildStyleProperty = buildStyleProperty; function createStyleBuilder(enableHardwareAcceleration) {
if (enableHardwareAcceleration === void 0) {
enableHardwareAcceleration = true;
}
var styles = {};
var transform = {};
var transformOrigin = {};
var transformKeys = [];
return function (state) {
transformKeys.length = 0;
buildStyleProperty(state, enableHardwareAcceleration, styles, transform, transformOrigin, transformKeys, true);
return styles;
};
} function onRead(key, options) {
var element = options.element, preparseOutput = options.preparseOutput;
var defaultValueType = getValueType(key);
if (isTransformProp(key)) {
return defaultValueType ? defaultValueType.default || 0 : 0;
}
else if (scrollKeys.has(key)) {
return element[key];
}
else {
var domValue = window.getComputedStyle(element, null).getPropertyValue(prefixer(key, true)) || 0;
return preparseOutput && defaultValueType && defaultValueType.test(domValue) && defaultValueType.parse ? defaultValueType.parse(domValue) : domValue;
}
} function onRender(state, _a, changedValues) {
var element = _a.element, buildStyles = _a.buildStyles, hasCSSVariable = _a.hasCSSVariable;
Object.assign(element.style, buildStyles(state));
if (hasCSSVariable) {
var numChangedValues = changedValues.length;
for (var i = 0; i < numChangedValues; i++) {
var key = changedValues[i];
if (key.startsWith('--')) {
element.style.setProperty(key, state[key]);
}
}
}
if (changedValues.indexOf(SCROLL_LEFT) !== -1) {
element[SCROLL_LEFT] = state[SCROLL_LEFT];
}
if (changedValues.indexOf(SCROLL_TOP) !== -1) {
element[SCROLL_TOP] = state[SCROLL_TOP];
}
} var cssStyler = createStyler({
onRead: onRead, onRender: onRender, uncachedValues: scrollKeys
}); function createCssStyler(element, _a) {
if (_a === void 0) {
_a = {};
}
var enableHardwareAcceleration = _a.enableHardwareAcceleration, props = __rest(_a, ["enableHardwareAcceleration"]);
return cssStyler(__assign({ element: element, buildStyles: createStyleBuilder(enableHardwareAcceleration), preparseOutput: true }, props));
} var camelCaseAttributes = new Set(['baseFrequency', 'diffuseConstant', 'kernelMatrix', 'kernelUnitLength', 'keySplines', 'keyTimes', 'limitingConeAngle', 'markerHeight', 'markerWidth', 'numOctaves', 'targetX', 'targetY', 'surfaceScale', 'specularConstant', 'specularExponent', 'stdDeviation', 'tableValues']); var ZERO_NOT_ZERO = 0.0000001; var progressToPixels = function (progress, length) {
return progress * length + 'px';
}; var build = function (state, dimensions, isPath, pathLength) {
var hasTransform = false;
var hasDashArray = false;
var props = {};
var dashArrayStyles = isPath ? {
pathLength: '0',
pathSpacing: "" + pathLength
} : undefined;
var scale$$1 = state.scale !== undefined ? state.scale || ZERO_NOT_ZERO : state.scaleX || 1;
var scaleY = state.scaleY !== undefined ? state.scaleY || ZERO_NOT_ZERO : scale$$1 || 1;
var transformOriginX = dimensions.width * (state.originX || 50) + dimensions.x;
var transformOriginY = dimensions.height * (state.originY || 50) + dimensions.y;
var scaleTransformX = -transformOriginX * (scale$$1 * 1);
var scaleTransformY = -transformOriginY * (scaleY * 1);
var scaleReplaceX = transformOriginX / scale$$1;
var scaleReplaceY = transformOriginY / scaleY;
var transform = {
translate: "translate(" + state.x + ", " + state.y + ") ",
scale: "translate(" + scaleTransformX + ", " + scaleTransformY + ") scale(" + scale$$1 + ", " + scaleY + ") translate(" + scaleReplaceX + ", " + scaleReplaceY + ") ",
rotate: "rotate(" + state.rotate + ", " + transformOriginX + ", " + transformOriginY + ") ",
skewX: "skewX(" + state.skewX + ") ",
skewY: "skewY(" + state.skewY + ") "
};
for (var key in state) {
if (state.hasOwnProperty(key)) {
var value = state[key];
if (isTransformProp(key)) {
hasTransform = true;
}
else if (isPath && (key === 'pathLength' || key === 'pathSpacing') && typeof value === 'number') {
hasDashArray = true;
dashArrayStyles[key] = progressToPixels(value, pathLength);
}
else if (isPath && key === 'pathOffset') {
props['stroke-dashoffset'] = progressToPixels(-value, pathLength);
}
else {
var attrKey = !camelCaseAttributes.has(key) ? camelToDash(key) : key;
props[attrKey] = value;
}
}
}
if (hasDashArray) {
props['stroke-dasharray'] = dashArrayStyles.pathLength + ' ' + dashArrayStyles.pathSpacing;
}
if (hasTransform) {
props.transform = ;
for (var key in transform) {
if (transform.hasOwnProperty(key)) {
var defaultValue = key === 'scale' ? '1' : '0';
props.transform += transform[key].replace(/undefined/g, defaultValue);
}
}
}
return props;
}; var int = __assign({}, style_value_types_1.number, { transform: Math.round }); var valueTypes$1 = {
fill: style_value_types_1.color, stroke: style_value_types_1.color, scale: style_value_types_1.scale, scaleX: style_value_types_1.scale, scaleY: style_value_types_1.scale, opacity: style_value_types_1.alpha, fillOpacity: style_value_types_1.alpha, strokeOpacity: style_value_types_1.alpha, numOctaves: int
}; var getValueType$1 = function (key) {
return valueTypes$1[key];
}; var getDimensions = function (element) {
return typeof element.getBBox === 'function' ? element.getBBox() : element.getBoundingClientRect();
}; var getSVGElementDimensions = function (element) {
try {
return getDimensions(element);
}
catch (e) {
return { x: 0, y: 0, width: 0, height: 0 };
}
}; var svgStyler = createStyler({
onRead: function (key, _a) {
var element = _a.element;
if (!isTransformProp(key)) {
return element.getAttribute(key);
}
else {
var valueType = getValueType$1(key);
return valueType ? valueType.default : 0;
}
},
onRender: function (state, _a) {
var dimensions = _a.dimensions, element = _a.element, isPath = _a.isPath, pathLength = _a.pathLength;
setDomAttrs(element, build(state, dimensions, isPath, pathLength));
}
}); var svg = function (element) {
var dimensions = getSVGElementDimensions(element);
var props = {
element: element,
dimensions: dimensions,
isPath: false
};
if (element.tagName === 'path') {
props.isPath = true;
props.pathLength = element.getTotalLength();
}
return svgStyler(props);
}; var viewport = createStyler({
useCache: false,
onRead: function (key) {
return key === 'scrollTop' ? window.pageYOffset : window.pageXOffset;
},
onRender: function (_a) {
var _b = _a.scrollTop, scrollTop = _b === void 0 ? 0 : _b, _c = _a.scrollLeft, scrollLeft = _c === void 0 ? 0 : _c;
return window.scrollTo(scrollLeft, scrollTop);
}
}); var cache = new WeakMap(); var createDOMStyler = function (node, props) {
var styler;
if (node instanceof HTMLElement) {
styler = createCssStyler(node, props);
}
else if (node instanceof SVGElement) {
styler = svg(node);
}
else if (node === window) {
styler = viewport(node);
}
hey_listen_1.invariant(styler !== undefined, 'No valid node provided. Node must be HTMLElement, SVGElement or window.');
cache.set(node, styler);
return styler;
}; var getStyler = function (node, props) {
return cache.has(node) ? cache.get(node) : createDOMStyler(node, props);
}; function index(nodeOrSelector, props) {
var node = typeof nodeOrSelector === 'string' ? document.querySelector(nodeOrSelector) : nodeOrSelector; return getStyler(node, props);
} exports.default = index;
} // pose-core/dist/pose-core.es.js $fsx.f[53] = (module, exports) => { "use strict"; Object.defineProperty(exports, "__esModule", { value: true }); const tslib_1 = $fsx.r(8); const hey_listen_1 = $fsx.r(47); var getPoseValues = function (_a) {
var transition = _a.transition, flip = _a.flip, delay = _a.delay, delayChildren = _a.delayChildren, staggerChildren = _a.staggerChildren, staggerDirection = _a.staggerDirection, afterChildren = _a.afterChildren, beforeChildren = _a.beforeChildren, preTransition = _a.preTransition, applyAtStart = _a.applyAtStart, applyAtEnd = _a.applyAtEnd, props = tslib_1.__rest(_a, ["transition", "flip", "delay", "delayChildren", "staggerChildren", "staggerDirection", "afterChildren", "beforeChildren", "preTransition", "applyAtStart", "applyAtEnd"]); return props;
}; var selectPoses = function (_a) {
var label = _a.label, props = _a.props, values = _a.values, parentValues = _a.parentValues, ancestorValues = _a.ancestorValues, onChange = _a.onChange, passive = _a.passive, initialPose = _a.initialPose, poses = tslib_1.__rest(_a, ["label", "props", "values", "parentValues", "ancestorValues", "onChange", "passive", "initialPose"]); return poses;
}; var selectAllValues = function (values, selectValue) {
var allValues = {};
values.forEach(function (value, key) {
return allValues[key] = selectValue(value);
});
return allValues;
}; var resolveProp = function (target, props) {
return typeof target === 'function' ? target(props) : target;
}; var poseDefault = function (pose, prop, defaultValue, resolveProps) {
return pose && pose[prop] !== undefined ? resolveProp(pose[prop], resolveProps) : defaultValue;
}; var startChildAnimations = function (children, next, pose, props) {
var animations = [];
var delay = poseDefault(pose, 'delayChildren', 0, props);
var stagger = poseDefault(pose, 'staggerChildren', 0, props);
var staggerDirection = poseDefault(pose, 'staggerDirection', 1, props);
var maxStaggerDuration = (children.size - 1) * stagger;
var generateStaggerDuration = staggerDirection === 1 ? function (i) {
return i * stagger;
} : function (i) {
return maxStaggerDuration - i * stagger;
};
Array.from(children).forEach(function (child, i) {
animations.push(child.set(next, {
delay: delay + generateStaggerDuration(i)
}));
});
return animations;
}; var resolveTransition = function (transition, key, value, props, convertTransitionDefinition, getInstantTransition) {
var resolvedTransition;
if (typeof transition === 'function') {
var resolvedTransitionMap = transition(props);
resolvedTransition = resolveTransition(resolvedTransitionMap, key, value, props, convertTransitionDefinition, getInstantTransition);
}
else if (transition[key] || transition.default) {
var keyTransition = transition[key] || transition.default;
if (typeof keyTransition === 'function') {
resolvedTransition = keyTransition(props);
}
else {
resolvedTransition = keyTransition;
}
}
else {
resolvedTransition = transition;
}
return resolvedTransition === false ? getInstantTransition(value, props) : convertTransitionDefinition(value, resolvedTransition, props);
}; var findInsertionIndex = function (poseList, priorityList, priorityIndex) {
var insertionIndex = 0;
for (var i = priorityIndex - 1; i >= 0; i--) {
var nextHighestPriorityIndex = poseList.indexOf(priorityList[i]);
if (nextHighestPriorityIndex !== -1) {
insertionIndex = nextHighestPriorityIndex + 1;
break;
}
}
return insertionIndex;
}; var applyValues = function (toApply, values, props, setValue, setValueNative) {
hey_listen_1.invariant(typeof toApply === 'object', 'applyAtStart and applyAtEnd must be of type object');
return Object.keys(toApply).forEach(function (key) {
var valueToSet = resolveProp(toApply[key], props);
values.has(key) ? setValue(values.get(key), valueToSet) : setValueNative(key, valueToSet, props);
});
}; var createPoseSetter = function (setterProps) {
var state = setterProps.state, poses = setterProps.poses, startAction = setterProps.startAction, stopAction = setterProps.stopAction, getInstantTransition = setterProps.getInstantTransition, addActionDelay = setterProps.addActionDelay, getTransitionProps = setterProps.getTransitionProps, resolveTarget = setterProps.resolveTarget, transformPose = setterProps.transformPose, posePriority = setterProps.posePriority, convertTransitionDefinition = setterProps.convertTransitionDefinition, setValue = setterProps.setValue, setValueNative = setterProps.setValueNative, forceRender = setterProps.forceRender;
return function (next, nextProps, propagate) {
if (nextProps === void 0) {
nextProps = {};
}
if (propagate === void 0) {
propagate = true;
}
var children = state.children, values = state.values, props = state.props, activeActions = state.activeActions, activePoses = state.activePoses;
var _a = nextProps.delay, delay = _a === void 0 ? 0 : _a;
var hasChildren = children.size;
var baseTransitionProps = tslib_1.__assign({}, props, nextProps);
var nextPose = poses[next];
var getChildAnimations = function () {
return hasChildren && propagate ? startChildAnimations(children, next, nextPose, baseTransitionProps) : [];
};
var getParentAnimations = function () {
if (!nextPose)
return [];
var applyAtStart = nextPose.applyAtStart;
if (applyAtStart) {
applyValues(applyAtStart, values, baseTransitionProps, setValue, setValueNative);
if (forceRender)
forceRender(baseTransitionProps);
}
if (transformPose)
nextPose = transformPose(nextPose, next, state);
var preTransition = nextPose.preTransition, getTransition = nextPose.transition, applyAtEnd = nextPose.applyAtEnd;
if (preTransition)
preTransition(baseTransitionProps);
var animations = Object.keys(getPoseValues(nextPose)).map(function (key) {
var valuePoses = activePoses.has(key) ? activePoses.get(key) : (activePoses.set(key, []), activePoses.get(key));
var existingIndex = valuePoses.indexOf(next);
if (existingIndex !== -1)
valuePoses.splice(existingIndex, 1);
var priority = posePriority ? posePriority.indexOf(next) : 0;
var insertionIndex = priority <= 0 ? 0 : findInsertionIndex(valuePoses, posePriority, priority);
valuePoses.splice(insertionIndex, 0, next);
return insertionIndex === 0 ? new Promise(function (complete) {
var value = values.get(key);
var transitionProps = tslib_1.__assign({}, baseTransitionProps, { key: key,
value: value });
var target = resolveTarget(value, resolveProp(nextPose[key], transitionProps));
if (activeActions.has(key))
stopAction(activeActions.get(key));
var resolveTransitionProps = tslib_1.__assign({ to: target }, transitionProps, getTransitionProps(value, target, transitionProps));
var transition = resolveTransition(getTransition, key, value, resolveTransitionProps, convertTransitionDefinition, getInstantTransition);
var poseDelay = delay || resolveProp(nextPose.delay, transitionProps);
if (poseDelay) {
transition = addActionDelay(poseDelay, transition);
}
activeActions.set(key, startAction(value, transition, complete));
}) : Promise.resolve();
});
return applyAtEnd ? [Promise.all(animations).then(function () {
applyValues(applyAtEnd, values, baseTransitionProps, setValue, setValueNative);
})] : animations;
};
if (nextPose && hasChildren) {
if (resolveProp(nextPose.beforeChildren, baseTransitionProps)) {
return Promise.all(getParentAnimations()).then(function () {
return Promise.all(getChildAnimations());
});
}
else if (resolveProp(nextPose.afterChildren, baseTransitionProps)) {
return Promise.all(getChildAnimations()).then(function () {
return Promise.all(getParentAnimations());
});
}
}
return Promise.all(getParentAnimations().concat(getChildAnimations()));
};
}; var DEFAULT_INITIAL_POSE = 'init'; var isScale = function (key) {
return key.includes('scale');
}; var defaultReadValueFromSource = function (key) {
return isScale(key) ? 1 : 0;
}; var readValueFromPose = function (pose, key, props) {
var valueToResolve = pose.applyAtEnd && pose.applyAtEnd[key] !== undefined ? pose.applyAtEnd[key] : pose[key] !== undefined ? pose[key] : pose.applyAtStart && pose.applyAtStart[key] !== undefined ? pose.applyAtStart[key] : 0; return resolveProp(valueToResolve, props);
}; var getPosesToSearch = function (pose) {
var posesToSearch = Array.isArray(pose) ? pose : [pose]; posesToSearch.push(DEFAULT_INITIAL_POSE); return posesToSearch;
}; var getInitialValue = function (poses, key, initialPose, props, readValueFromSource, activePoses) {
if (readValueFromSource === void 0) {
readValueFromSource = defaultReadValueFromSource;
}
var posesToSearch = getPosesToSearch(initialPose);
var pose = posesToSearch.filter(Boolean).find(function (name) {
var thisPose = poses[name];
return thisPose && (thisPose[key] !== undefined || thisPose.applyAtStart && thisPose.applyAtStart[key] !== undefined || thisPose.applyAtEnd && thisPose.applyAtEnd[key] !== undefined);
});
activePoses.set(key, [pose || DEFAULT_INITIAL_POSE]);
return pose ? readValueFromPose(poses[pose], key, props) : readValueFromSource(key, props);
}; var createValues = function (values, _a) {
var userSetValues = _a.userSetValues, createValue = _a.createValue, convertValue = _a.convertValue, readValueFromSource = _a.readValueFromSource, initialPose = _a.initialPose, poses = _a.poses, activePoses = _a.activePoses, props = _a.props;
return function (key) {
if (values.has(key))
return;
var value;
if (userSetValues && userSetValues[key] !== undefined) {
value = convertValue(userSetValues[key], key, props);
}
else {
var initValue = getInitialValue(poses, key, initialPose, props, readValueFromSource, activePoses);
value = createValue(initValue, key, props);
}
values.set(key, value);
};
}; var scrapeValuesFromPose = function (values, props) {
return function (key) {
var pose = props.poses[key];
Object.keys(getPoseValues(pose)).forEach(createValues(values, props));
};
}; var getAncestorValue = function (key, fromParent, ancestors) {
if (fromParent === true) {
return ancestors[0] && ancestors[0].values.get(key);
}
else {
var foundAncestor = ancestors.find(function (_a) {
var label = _a.label;
return label === fromParent;
});
return foundAncestor && foundAncestor.values.get(key);
}
}; var bindPassiveValues = function (values, _a) {
var passive = _a.passive, ancestorValues = _a.ancestorValues, createValue = _a.createValue, readValue = _a.readValue, props = _a.props;
return function (key) {
var _a = passive[key], valueKey = _a[0], passiveProps = _a[1], fromParent = _a[2];
var valueToBind = fromParent && ancestorValues.length ? getAncestorValue(valueKey, fromParent, ancestorValues) : values.has(valueKey) ? values.get(valueKey) : false;
if (!valueToBind)
return;
var newValue = createValue(readValue(valueToBind), key, props, {
passiveParentKey: valueKey,
passiveParent: valueToBind,
passiveProps: passiveProps
});
values.set(key, newValue);
};
}; var setNativeValues = function (_a) {
var setValueNative = _a.setValueNative, initialPose = _a.initialPose, props = _a.props, poses = _a.poses;
var valuesHaveSet = new Set();
var setValues = function (pose, propKey) {
if (pose[propKey]) {
for (var key in pose[propKey]) {
if (!valuesHaveSet.has(key)) {
valuesHaveSet.add(key);
setValueNative(key, resolveProp(pose[propKey][key], props), props);
}
}
}
};
getPosesToSearch(initialPose).forEach(function (poseKey) {
var pose = poses[poseKey];
if (pose) {
setValues(pose, 'applyAtEnd');
setValues(pose, 'applyAtStart');
}
});
}; var createValueMap = function (props) {
var poses = props.poses, passive = props.passive;
var values = new Map();
Object.keys(poses).forEach(scrapeValuesFromPose(values, props));
setNativeValues(props);
if (passive)
Object.keys(passive).forEach(bindPassiveValues(values, props));
return values;
}; var applyDefaultTransition = function (pose, key, defaultTransitions) {
return tslib_1.__assign({}, pose, { transition: defaultTransitions.has(key) ? defaultTransitions.get(key) : defaultTransitions.get('default') });
}; var generateTransitions = function (poses, defaultTransitions) {
Object.keys(poses).forEach(function (key) {
var pose = poses[key];
hey_listen_1.invariant(typeof pose === 'object', "Pose '" + key + "' is of invalid type. All poses should be objects.");
poses[key] = pose.transition !== undefined ? pose : applyDefaultTransition(pose, key, defaultTransitions);
});
return poses;
}; var sortByReversePriority = function (priorityOrder) {
return function (a, b) {
var aP = priorityOrder.indexOf(a);
var bP = priorityOrder.indexOf(b);
if (aP === -1 && bP !== -1)
return -1;
if (aP !== -1 && bP === -1)
return 1;
return aP - bP;
};
}; var poseFactory = function (_a) {
var getDefaultProps = _a.getDefaultProps, defaultTransitions = _a.defaultTransitions, bindOnChange = _a.bindOnChange, startAction = _a.startAction, stopAction = _a.stopAction, readValue = _a.readValue, readValueFromSource = _a.readValueFromSource, resolveTarget = _a.resolveTarget, setValue = _a.setValue, setValueNative = _a.setValueNative, createValue = _a.createValue, convertValue = _a.convertValue, getInstantTransition = _a.getInstantTransition, getTransitionProps = _a.getTransitionProps, addActionDelay = _a.addActionDelay, selectValueToRead = _a.selectValueToRead, convertTransitionDefinition = _a.convertTransitionDefinition, transformPose = _a.transformPose, posePriority = _a.posePriority, forceRender = _a.forceRender, extendAPI = _a.extendAPI;
return function (config) {
var parentValues = config.parentValues, _a = config.ancestorValues, ancestorValues = _a === void 0 ? [] : _a;
if (parentValues)
ancestorValues.unshift({ values: parentValues });
var activeActions = new Map();
var activePoses = new Map();
var children = new Set();
var poses = generateTransitions(selectPoses(config), defaultTransitions);
var _b = config.props, props = _b === void 0 ? {} : _b;
if (getDefaultProps)
props = tslib_1.__assign({}, getDefaultProps(config), props);
var passive = config.passive, userSetValues = config.values, _c = config.initialPose, initialPose = _c === void 0 ? DEFAULT_INITIAL_POSE : _c;
var values = createValueMap({
poses: poses,
passive: passive,
ancestorValues: ancestorValues,
readValue: readValue,
setValueNative: setValueNative,
createValue: createValue,
convertValue: convertValue,
readValueFromSource: readValueFromSource,
userSetValues: userSetValues,
initialPose: initialPose,
activePoses: activePoses,
props: props
});
var state = {
activeActions: activeActions,
activePoses: activePoses,
children: children,
props: props,
values: values
};
var onChange = config.onChange;
if (onChange)
Object.keys(onChange).forEach(bindOnChange(values, onChange));
var set = createPoseSetter({
state: state,
poses: poses,
getInstantTransition: getInstantTransition,
getTransitionProps: getTransitionProps,
convertTransitionDefinition: convertTransitionDefinition,
setValue: setValue,
setValueNative: setValueNative,
startAction: startAction,
stopAction: stopAction,
resolveTarget: resolveTarget,
addActionDelay: addActionDelay,
transformPose: transformPose,
posePriority: posePriority,
forceRender: forceRender
});
var has = function (poseName) {
return !!poses[poseName];
};
var api = {
set: set,
unset: function (poseName, poseProps) {
var posesToSet = [];
activePoses.forEach(function (valuePoses) {
var poseIndex = valuePoses.indexOf(poseName);
if (poseIndex === -1)
return;
var currentPose = valuePoses[0];
valuePoses.splice(poseIndex, 1);
var nextPose = valuePoses[0];
if (nextPose === currentPose)
return;
if (posesToSet.indexOf(nextPose) === -1) {
posesToSet.push(nextPose);
}
});
var animationsToResolve = posesToSet.sort(sortByReversePriority(posePriority)).map(function (poseToSet) {
return set(poseToSet, poseProps, false);
});
children.forEach(function (child) {
return animationsToResolve.push(child.unset(poseName));
});
return Promise.all(animationsToResolve);
},
get: function (valueName) {
return valueName ? selectValueToRead(values.get(valueName)) : selectAllValues(values, selectValueToRead);
},
has: has,
setProps: function (newProps) {
return state.props = tslib_1.__assign({}, state.props, newProps);
},
_addChild: function (childConfig, factory) {
var child = factory(tslib_1.__assign({ initialPose: initialPose }, childConfig, { ancestorValues: [{ label: config.label, values: values }].concat(ancestorValues) }));
children.add(child);
return child;
},
removeChild: function (child) {
return children.delete(child);
},
clearChildren: function () {
children.forEach(function (child) {
return child.destroy();
});
children.clear();
},
destroy: function () {
activeActions.forEach(stopAction);
children.forEach(function (child) {
return child.destroy();
});
}
};
return extendAPI(api, state, config);
};
}; exports.default = poseFactory;
} // @emotion/is-prop-valid/dist/is-prop-valid.browser.esm.js $fsx.f[56] = (module, exports) => { "use strict"; Object.defineProperty(exports, "__esModule", { value: true }); const memoize_1 = $fsx.r(55); var reactPropsRegex = /^((children|dangerouslySetInnerHTML|key|ref|autoFocus|defaultValue|defaultChecked|innerHTML|suppressContentEditableWarning|suppressHydrationWarning|valueLink|accept|acceptCharset|accessKey|action|allow|allowUserMedia|allowPaymentRequest|allowFullScreen|allowTransparency|alt|async|autoComplete|autoPlay|capture|cellPadding|cellSpacing|challenge|charSet|checked|cite|classID|className|cols|colSpan|content|contentEditable|contextMenu|controls|controlsList|coords|crossOrigin|data|dateTime|default|defer|dir|disabled|download|draggable|encType|form|formAction|formEncType|formMethod|formNoValidate|formTarget|frameBorder|headers|height|hidden|high|href|hrefLang|htmlFor|httpEquiv|id|inputMode|integrity|is|keyParams|keyType|kind|label|lang|list|loop|low|marginHeight|marginWidth|max|maxLength|media|mediaGroup|method|min|minLength|multiple|muted|name|nonce|noValidate|open|optimum|pattern|placeholder|playsInline|poster|preload|profile|radioGroup|readOnly|referrerPolicy|rel|required|reversed|role|rows|rowSpan|sandbox|scope|scoped|scrolling|seamless|selected|shape|size|sizes|slot|span|spellCheck|src|srcDoc|srcLang|srcSet|start|step|style|summary|tabIndex|target|title|type|useMap|value|width|wmode|wrap|about|datatype|inlist|prefix|property|resource|typeof|vocab|autoCapitalize|autoCorrect|autoSave|color|itemProp|itemScope|itemType|itemID|itemRef|results|security|unselectable|accentHeight|accumulate|additive|alignmentBaseline|allowReorder|alphabetic|amplitude|arabicForm|ascent|attributeName|attributeType|autoReverse|azimuth|baseFrequency|baselineShift|baseProfile|bbox|begin|bias|by|calcMode|capHeight|clip|clipPathUnits|clipPath|clipRule|colorInterpolation|colorInterpolationFilters|colorProfile|colorRendering|contentScriptType|contentStyleType|cursor|cx|cy|d|decelerate|descent|diffuseConstant|direction|display|divisor|dominantBaseline|dur|dx|dy|edgeMode|elevation|enableBackground|end|exponent|externalResourcesRequired|fill|fillOpacity|fillRule|filter|filterRes|filterUnits|floodColor|floodOpacity|focusable|fontFamily|fontSize|fontSizeAdjust|fontStretch|fontStyle|fontVariant|fontWeight|format|from|fr|fx|fy|g1|g2|glyphName|glyphOrientationHorizontal|glyphOrientationVertical|glyphRef|gradientTransform|gradientUnits|hanging|horizAdvX|horizOriginX|ideographic|imageRendering|in|in2|intercept|k|k1|k2|k3|k4|kernelMatrix|kernelUnitLength|kerning|keyPoints|keySplines|keyTimes|lengthAdjust|letterSpacing|lightingColor|limitingConeAngle|local|markerEnd|markerMid|markerStart|markerHeight|markerUnits|markerWidth|mask|maskContentUnits|maskUnits|mathematical|mode|numOctaves|offset|opacity|operator|order|orient|orientation|origin|overflow|overlinePosition|overlineThickness|panose1|paintOrder|pathLength|patternContentUnits|patternTransform|patternUnits|pointerEvents|points|pointsAtX|pointsAtY|pointsAtZ|preserveAlpha|preserveAspectRatio|primitiveUnits|r|radius|refX|refY|renderingIntent|repeatCount|repeatDur|requiredExtensions|requiredFeatures|restart|result|rotate|rx|ry|scale|seed|shapeRendering|slope|spacing|specularConstant|specularExponent|speed|spreadMethod|startOffset|stdDeviation|stemh|stemv|stitchTiles|stopColor|stopOpacity|strikethroughPosition|strikethroughThickness|string|stroke|strokeDasharray|strokeDashoffset|strokeLinecap|strokeLinejoin|strokeMiterlimit|strokeOpacity|strokeWidth|surfaceScale|systemLanguage|tableValues|targetX|targetY|textAnchor|textDecoration|textRendering|textLength|to|transform|u1|u2|underlinePosition|underlineThickness|unicode|unicodeBidi|unicodeRange|unitsPerEm|vAlphabetic|vHanging|vIdeographic|vMathematical|values|vectorEffect|version|vertAdvY|vertOriginX|vertOriginY|viewBox|viewTarget|visibility|widths|wordSpacing|writingMode|x|xHeight|x1|x2|xChannelSelector|xlinkActuate|xlinkArcrole|xlinkHref|xlinkRole|xlinkShow|xlinkTitle|xlinkType|xmlBase|xmlns|xmlnsXlink|xmlLang|xmlSpace|y|y1|y2|yChannelSelector|z|zoomAndPan|for|class|autofocus)|(([Dd][Aa][Tt][Aa]|[Aa][Rr][Ii][Aa]|x)-.*))$/; var index = memoize_1.default(function (prop) {
return reactPropsRegex.test(prop) || prop.charCodeAt(0) === 111
&& prop.charCodeAt(1) === 110
&& prop.charCodeAt(2) < 91;
}); exports.default = index;
} // @emotion/memoize/dist/memoize.browser.esm.js $fsx.f[55] = (module, exports) => { "use strict"; Object.defineProperty(exports, "__esModule", { value: true }); function memoize(fn) {
var cache = {};
return function (arg) {
if (cache[arg] === undefined)
cache[arg] = fn(arg);
return cache[arg];
};
} exports.default = memoize;
} // react-burger-menu/lib/BurgerMenu.js $fsx.f[76] = (module, exports) => { 'use strict'; Object.defineProperty(exports, '__esModule', {
value: true
}); exports['default'] = {
slide: $fsx.r(63), stack: $fsx.r(64), elastic: $fsx.r(68), bubble: $fsx.r(69), push: $fsx.r(70), pushRotate: $fsx.r(71), scaleDown: $fsx.r(72), scaleRotate: $fsx.r(73), fallDown: $fsx.r(74), reveal: $fsx.r(75)
}; module.exports = exports['default'];
} // react-burger-menu/lib/menus/slide.js $fsx.f[63] = (module, exports) => { 'use strict'; Object.defineProperty(exports, '__esModule', {
value: true
}); function _interopRequireDefault(obj) { return obj && obj.__esModule ? obj : { 'default': obj }; } var _menuFactory = $fsx.r(62); var _menuFactory2 = _interopRequireDefault(_menuFactory); var styles = {}; exports['default'] = (0, _menuFactory2['default'])(styles); module.exports = exports['default'];
} // react-burger-menu/lib/menuFactory.js $fsx.f[62] = (module, exports) => { 'use strict'; Object.defineProperty(exports, '__esModule', {
value: true
}); var _extends = Object.assign || function (target) { for (var i = 1; i < arguments.length; i++) {
var source = arguments[i];
for (var key in source) {
if (Object.prototype.hasOwnProperty.call(source, key)) {
target[key] = source[key];
}
}
} return target; }; var _createClass = (function () { function defineProperties(target, props) { for (var i = 0; i < props.length; i++) {
var descriptor = props[i];
descriptor.enumerable = descriptor.enumerable || false;
descriptor.configurable = true;
if ('value' in descriptor)
descriptor.writable = true;
Object.defineProperty(target, descriptor.key, descriptor);
} } return function (Constructor, protoProps, staticProps) { if (protoProps)
defineProperties(Constructor.prototype, protoProps); if (staticProps) defineProperties(Constructor, staticProps); return Constructor; }; })();
var _get = function get(_x3, _x4, _x5) { var _again = true; _function: while (_again) {
var object = _x3, property = _x4, receiver = _x5;
_again = false;
if (object === null)
object = Function.prototype;
var desc = Object.getOwnPropertyDescriptor(object, property);
if (desc === undefined) {
var parent = Object.getPrototypeOf(object);
if (parent === null) {
return undefined;
}
else {
_x3 = parent;
_x4 = property;
_x5 = receiver;
_again = true;
desc = parent = undefined;
continue _function;
}
}
else if ('value' in desc) {
return desc.value;
}
else {
var getter = desc.get;
if (getter === undefined) {
return undefined;
}
return getter.call(receiver);
}
} }; function _interopRequireDefault(obj) { return obj && obj.__esModule ? obj : { 'default': obj }; } function _classCallCheck(instance, Constructor) { if (!(instance instanceof Constructor)) {
throw new TypeError('Cannot call a class as a function');
} } function _inherits(subClass, superClass) { if (typeof superClass !== 'function' && superClass !== null) {
throw new TypeError('Super expression must either be null or a function, not ' + typeof superClass);
} subClass.prototype = Object.create(superClass && superClass.prototype, { constructor: { value: subClass, enumerable: false, writable: true, configurable: true } }); if (superClass)
Object.setPrototypeOf ? Object.setPrototypeOf(subClass, superClass) : subClass.__proto__ = superClass; }
var _react = $fsx.r(3); var _react2 = _interopRequireDefault(_react); var _reactDom = $fsx.r(7); var _reactDom2 = _interopRequireDefault(_reactDom); var _propTypes = $fsx.r(13); var _propTypes2 = _interopRequireDefault(_propTypes); var _baseStyles = $fsx.r(59); var _baseStyles2 = _interopRequireDefault(_baseStyles); var _BurgerIcon = $fsx.r(60); var _BurgerIcon2 = _interopRequireDefault(_BurgerIcon); var _CrossIcon = $fsx.r(61); var _CrossIcon2 = _interopRequireDefault(_CrossIcon); exports['default'] = function (styles) {
var Menu = (function (_Component) {
_inherits(Menu, _Component);
function Menu(props) {
_classCallCheck(this, Menu);
_get(Object.getPrototypeOf(Menu.prototype), 'constructor', this).call(this, props);
this.state = {
isOpen: false
};
if (!styles) {
throw new Error('No styles supplied');
}
}
_createClass(Menu, [{
key: 'toggleMenu',
value: function toggleMenu() {
var _this = this;
var options = arguments.length <= 0 || arguments[0] === undefined ? {} : arguments[0];
var isOpen = options.isOpen;
var noStateChange = options.noStateChange;
var newState = {
isOpen: typeof isOpen !== 'undefined' ? isOpen : !this.state.isOpen
};
this.applyWrapperStyles();
this.setState(newState, function () {
!noStateChange && _this.props.onStateChange(newState);
if (!_this.props.disableAutoFocus) {
if (newState.isOpen) {
var firstItem = document.querySelector('.bm-item');
if (firstItem) {
firstItem.focus();
}
}
else {
if (document.activeElement) {
document.activeElement.blur();
}
else {
document.body.blur();
}
}
}
_this.timeoutId && clearTimeout(_this.timeoutId);
_this.timeoutId = setTimeout(function () {
_this.timeoutId = null;
if (!newState.isOpen) {
_this.applyWrapperStyles(false);
}
}, 500);
});
}
}, {
key: 'applyWrapperStyles',
value: function applyWrapperStyles() {
var set = arguments.length <= 0 || arguments[0] === undefined ? true : arguments[0];
var applyClass = function applyClass(el, className) {
return el.classList[set ? 'add' : 'remove'](className);
};
if (this.props.htmlClassName) {
applyClass(document.querySelector('html'), this.props.htmlClassName);
}
if (this.props.bodyClassName) {
applyClass(document.querySelector('body'), this.props.bodyClassName);
}
if (styles.pageWrap && this.props.pageWrapId) {
this.handleExternalWrapper(this.props.pageWrapId, styles.pageWrap, set);
}
if (styles.outerContainer && this.props.outerContainerId) {
this.handleExternalWrapper(this.props.outerContainerId, styles.outerContainer, set);
}
}
}, {
key: 'handleExternalWrapper',
value: function handleExternalWrapper(id, wrapperStyles, set) {
var wrapper = document.getElementById(id);
if (!wrapper) {
console.error("Element with ID '" + id + "' not found");
return;
}
var builtStyles = this.getStyle(wrapperStyles);
for (var prop in builtStyles) {
if (builtStyles.hasOwnProperty(prop)) {
wrapper.style[prop] = set ? builtStyles[prop] : ;
}
}
var applyOverflow = function applyOverflow(el) {
return el.style['overflow-x'] = set ? 'hidden' : ;
};
if (!this.props.htmlClassName) {
applyOverflow(document.querySelector('html'));
}
if (!this.props.bodyClassName) {
applyOverflow(document.querySelector('body'));
}
}
}, {
key: 'getStyles',
value: function getStyles(el, index, inline) {
var propName = 'bm' + el.replace(el.charAt(0), el.charAt(0).toUpperCase());
var output = _baseStyles2['default'][el] ? this.getStyle(_baseStyles2['default'][el]) : {};
if (styles[el]) {
output = _extends({}, output, this.getStyle(styles[el], index + 1));
}
if (this.props.styles[propName]) {
output = _extends({}, output, this.props.styles[propName]);
}
if (inline) {
output = _extends({}, output, inline);
}
if (this.props.noTransition) {
delete output.transition;
}
return output;
}
}, {
key: 'getStyle',
value: function getStyle(style, index) {
var width = this.props.width;
var formattedWidth = typeof width !== 'string' ? width + 'px' : width;
return style(this.state.isOpen, formattedWidth, this.props.right, index);
}
}, {
key: 'listenForClose',
value: function listenForClose(e) {
e = e || window.event;
if (!this.props.disableCloseOnEsc && this.state.isOpen && (e.key === 'Escape' || e.keyCode === 27)) {
this.toggleMenu();
}
}
}, {
key: 'shouldDisableOverlayClick',
value: function shouldDisableOverlayClick() {
if (typeof this.props.disableOverlayClick === 'function') {
return this.props.disableOverlayClick();
}
else {
return this.props.disableOverlayClick;
}
}
}, {
key: 'componentDidMount',
value: function componentDidMount() {
if (this.props.customOnKeyDown) {
window.onkeydown = this.props.customOnKeyDown;
}
else {
window.onkeydown = this.listenForClose.bind(this);
}
if (this.props.isOpen) {
this.toggleMenu({ isOpen: true, noStateChange: true });
}
}
}, {
key: 'componentWillUnmount',
value: function componentWillUnmount() {
window.onkeydown = null;
this.applyWrapperStyles(false);
}
}, {
key: 'componentDidUpdate',
value: function componentDidUpdate(prevProps) {
var _this2 = this;
var wasToggled = typeof this.props.isOpen !== 'undefined' && this.props.isOpen !== this.state.isOpen && this.props.isOpen !== prevProps.isOpen;
if (wasToggled) {
this.toggleMenu();
return;
}
if (styles.svg) {
(function () {
var morphShape = _reactDom2['default'].findDOMNode(_this2, 'bm-morph-shape');
var path = styles.svg.lib(morphShape).select('path');
if (_this2.state.isOpen) {
styles.svg.animate(path);
}
else {
setTimeout(function () {
path.attr('d', styles.svg.pathInitial);
}, 300);
}
})();
}
}
}, {
key: 'render',
value: function render() {
var _this3 = this;
return _react2['default'].createElement('div', null, !this.props.noOverlay && _react2['default'].createElement('div', {
className: ('bm-overlay ' + this.props.overlayClassName).trim(),
onClick: function () {
return !_this3.shouldDisableOverlayClick() && _this3.toggleMenu();
},
style: this.getStyles('overlay')
}), _react2['default'].createElement('div', {
id: this.props.id,
className: ('bm-menu-wrap ' + this.props.className).trim(),
style: this.getStyles('menuWrap')
}, styles.svg && _react2['default'].createElement('div', {
className: ('bm-morph-shape ' + this.props.morphShapeClassName).trim(),
style: this.getStyles('morphShape')
}, _react2['default'].createElement('svg', {
width: '100%',
height: '100%',
viewBox: '0 0 100 800',
preserveAspectRatio: 'none'
}, _react2['default'].createElement('path', { d: styles.svg.pathInitial }))), _react2['default'].createElement('div', {
className: ('bm-menu ' + this.props.menuClassName).trim(),
style: this.getStyles('menu')
}, _react2['default'].createElement('nav', {
className: ('bm-item-list ' + this.props.itemListClassName).trim(),
style: this.getStyles('itemList')
}, _react2['default'].Children.map(this.props.children, function (item, index) {
if (item) {
var classList = ['bm-item', _this3.props.itemClassName, item.props.className].filter(function (className) {
return !!className;
}).join(' ');
var extraProps = {
key: index,
className: classList,
style: _this3.getStyles('item', index, item.props.style),
tabIndex: _this3.state.isOpen ? 0 : -1
};
return _react2['default'].cloneElement(item, extraProps);
}
}))), this.props.customCrossIcon !== false && _react2['default'].createElement('div', { style: this.getStyles('closeButton') }, _react2['default'].createElement(_CrossIcon2['default'], {
onClick: function () {
return _this3.toggleMenu();
},
styles: this.props.styles,
customIcon: this.props.customCrossIcon,
className: this.props.crossButtonClassName,
crossClassName: this.props.crossClassName,
tabIndex: this.state.isOpen ? 0 : -1
}))), this.props.customBurgerIcon !== false && _react2['default'].createElement('div', { style: this.getStyles('burgerIcon') }, _react2['default'].createElement(_BurgerIcon2['default'], {
onClick: function () {
return _this3.toggleMenu();
},
styles: this.props.styles,
customIcon: this.props.customBurgerIcon,
className: this.props.burgerButtonClassName,
barClassName: this.props.burgerBarClassName
})));
}
}]);
return Menu;
})(_react.Component);
Menu.propTypes = {
bodyClassName: _propTypes2['default'].string,
burgerBarClassName: _propTypes2['default'].string,
burgerButtonClassName: _propTypes2['default'].string,
className: _propTypes2['default'].string,
crossButtonClassName: _propTypes2['default'].string,
crossClassName: _propTypes2['default'].string,
customBurgerIcon: _propTypes2['default'].oneOfType([_propTypes2['default'].element, _propTypes2['default'].oneOf([false])]),
customCrossIcon: _propTypes2['default'].oneOfType([_propTypes2['default'].element, _propTypes2['default'].oneOf([false])]),
customOnKeyDown: _propTypes2['default'].func,
disableAutoFocus: _propTypes2['default'].bool,
disableCloseOnEsc: _propTypes2['default'].bool,
disableOverlayClick: _propTypes2['default'].oneOfType([_propTypes2['default'].bool, _propTypes2['default'].func]),
htmlClassName: _propTypes2['default'].string,
id: _propTypes2['default'].string,
isOpen: _propTypes2['default'].bool,
itemClassName: _propTypes2['default'].string,
itemListClassName: _propTypes2['default'].string,
menuClassName: _propTypes2['default'].string,
morphShapeClassName: _propTypes2['default'].string,
noOverlay: _propTypes2['default'].bool,
noTransition: _propTypes2['default'].bool,
onStateChange: _propTypes2['default'].func,
outerContainerId: styles && styles.outerContainer ? _propTypes2['default'].string.isRequired : _propTypes2['default'].string,
overlayClassName: _propTypes2['default'].string,
pageWrapId: styles && styles.pageWrap ? _propTypes2['default'].string.isRequired : _propTypes2['default'].string,
right: _propTypes2['default'].bool,
styles: _propTypes2['default'].object,
width: _propTypes2['default'].oneOfType([_propTypes2['default'].number, _propTypes2['default'].string])
};
Menu.defaultProps = {
bodyClassName: ,
burgerBarClassName: ,
burgerButtonClassName: ,
className: ,
crossButtonClassName: ,
crossClassName: ,
disableAutoFocus: false,
disableCloseOnEsc: false,
htmlClassName: ,
id: ,
itemClassName: ,
itemListClassName: ,
menuClassName: ,
morphShapeClassName: ,
noOverlay: false,
noTransition: false,
onStateChange: function onStateChange() { },
outerContainerId: ,
overlayClassName: ,
pageWrapId: ,
styles: {},
width: 300
};
return Menu;
}; module.exports = exports['default'];
} // react-burger-menu/lib/baseStyles.js $fsx.f[59] = (module, exports) => { 'use strict'; Object.defineProperty(exports, '__esModule', {
value: true
}); var styles = {
overlay: function overlay(isOpen) {
return {
position: 'fixed',
zIndex: 1000,
width: '100%',
height: '100%',
background: 'rgba(0, 0, 0, 0.3)',
opacity: isOpen ? 1 : 0,
MozTransform: isOpen ? : 'translate3d(100%, 0, 0)',
MsTransform: isOpen ? : 'translate3d(100%, 0, 0)',
OTransform: isOpen ? : 'translate3d(100%, 0, 0)',
WebkitTransform: isOpen ? : 'translate3d(100%, 0, 0)',
transform: isOpen ? : 'translate3d(100%, 0, 0)',
transition: isOpen ? 'opacity 0.3s' : 'opacity 0.3s, transform 0s 0.3s'
};
},
menuWrap: function menuWrap(isOpen, width, right) {
return {
position: 'fixed',
right: right ? 0 : 'inherit',
zIndex: 1100,
width: width,
height: '100%',
MozTransform: isOpen ? : right ? 'translate3d(100%, 0, 0)' : 'translate3d(-100%, 0, 0)',
MsTransform: isOpen ? : right ? 'translate3d(100%, 0, 0)' : 'translate3d(-100%, 0, 0)',
OTransform: isOpen ? : right ? 'translate3d(100%, 0, 0)' : 'translate3d(-100%, 0, 0)',
WebkitTransform: isOpen ? : right ? 'translate3d(100%, 0, 0)' : 'translate3d(-100%, 0, 0)',
transform: isOpen ? : right ? 'translate3d(100%, 0, 0)' : 'translate3d(-100%, 0, 0)',
transition: 'all 0.5s'
};
},
menu: function menu() {
return {
height: '100%',
boxSizing: 'border-box',
overflow: 'auto'
};
},
itemList: function itemList() {
return {
height: '100%'
};
},
item: function item() {
return {
display: 'block'
};
}
}; exports['default'] = styles; module.exports = exports['default'];
} // react-burger-menu/lib/BurgerIcon.js $fsx.f[60] = (module, exports) => { 'use strict'; Object.defineProperty(exports, '__esModule', {
value: true
}); var _extends = Object.assign || function (target) { for (var i = 1; i < arguments.length; i++) {
var source = arguments[i];
for (var key in source) {
if (Object.prototype.hasOwnProperty.call(source, key)) {
target[key] = source[key];
}
}
} return target; }; var _createClass = (function () { function defineProperties(target, props) { for (var i = 0; i < props.length; i++) {
var descriptor = props[i];
descriptor.enumerable = descriptor.enumerable || false;
descriptor.configurable = true;
if ('value' in descriptor)
descriptor.writable = true;
Object.defineProperty(target, descriptor.key, descriptor);
} } return function (Constructor, protoProps, staticProps) { if (protoProps)
defineProperties(Constructor.prototype, protoProps); if (staticProps) defineProperties(Constructor, staticProps); return Constructor; }; })();
var _get = function get(_x, _x2, _x3) { var _again = true; _function: while (_again) {
var object = _x, property = _x2, receiver = _x3;
_again = false;
if (object === null)
object = Function.prototype;
var desc = Object.getOwnPropertyDescriptor(object, property);
if (desc === undefined) {
var parent = Object.getPrototypeOf(object);
if (parent === null) {
return undefined;
}
else {
_x = parent;
_x2 = property;
_x3 = receiver;
_again = true;
desc = parent = undefined;
continue _function;
}
}
else if ('value' in desc) {
return desc.value;
}
else {
var getter = desc.get;
if (getter === undefined) {
return undefined;
}
return getter.call(receiver);
}
} }; function _interopRequireDefault(obj) { return obj && obj.__esModule ? obj : { 'default': obj }; } function _classCallCheck(instance, Constructor) { if (!(instance instanceof Constructor)) {
throw new TypeError('Cannot call a class as a function');
} } function _inherits(subClass, superClass) { if (typeof superClass !== 'function' && superClass !== null) {
throw new TypeError('Super expression must either be null or a function, not ' + typeof superClass);
} subClass.prototype = Object.create(superClass && superClass.prototype, { constructor: { value: subClass, enumerable: false, writable: true, configurable: true } }); if (superClass)
Object.setPrototypeOf ? Object.setPrototypeOf(subClass, superClass) : subClass.__proto__ = superClass; }
var _react = $fsx.r(3); var _react2 = _interopRequireDefault(_react); var _propTypes = $fsx.r(13); var _propTypes2 = _interopRequireDefault(_propTypes); var BurgerIcon = (function (_Component) {
_inherits(BurgerIcon, _Component);
function BurgerIcon(props) {
_classCallCheck(this, BurgerIcon);
_get(Object.getPrototypeOf(BurgerIcon.prototype), 'constructor', this).call(this, props);
this.state = {
hover: false
};
}
_createClass(BurgerIcon, [{
key: 'getLineStyle',
value: function getLineStyle(index) {
return _extends({
position: 'absolute',
height: '20%',
left: 0,
right: 0,
top: 20 * (index * 2) + '%',
opacity: this.state.hover ? 0.6 : 1
}, this.state.hover && this.props.styles.bmBurgerBarsHover);
}
}, {
key: 'render',
value: function render() {
var _this = this;
var icon = undefined;
var buttonStyle = {
position: 'absolute',
left: 0,
top: 0,
width: '100%',
height: '100%',
margin: 0,
padding: 0,
border: 'none',
fontSize: 0,
background: 'transparent',
cursor: 'pointer'
};
if (this.props.customIcon) {
var extraProps = {
className: ('bm-icon ' + (this.props.customIcon.props.className || )).trim(),
style: _extends({ width: '100%', height: '100%' }, this.props.styles.bmIcon)
};
icon = _react2['default'].cloneElement(this.props.customIcon, extraProps);
}
else {
icon = _react2['default'].createElement('span', null, [0, 1, 2].map(function (bar) {
return _react2['default'].createElement('span', {
key: bar,
className: ('bm-burger-bars ' + _this.props.barClassName + ' ' + (_this.state.hover ? 'bm-burger-bars-hover' : )).trim(),
style: _extends({}, _this.getLineStyle(bar), _this.props.styles.bmBurgerBars)
});
}));
}
return _react2['default'].createElement('div', {
className: ('bm-burger-button ' + this.props.className).trim(),
style: _extends({ zIndex: 1000 }, this.props.styles.bmBurgerButton)
}, icon, _react2['default'].createElement('button', {
onClick: this.props.onClick,
onMouseOver: function () {
return _this.setState({ hover: true });
},
onMouseOut: function () {
return _this.setState({ hover: false });
},
style: buttonStyle
}, 'Open Menu'));
}
}]);
return BurgerIcon;
})(_react.Component); exports['default'] = BurgerIcon; BurgerIcon.propTypes = {
barClassName: _propTypes2['default'].string, customIcon: _propTypes2['default'].element, styles: _propTypes2['default'].object
}; BurgerIcon.defaultProps = {
barClassName: ,
className: ,
styles: {}
}; module.exports = exports['default'];
} // react-burger-menu/lib/CrossIcon.js $fsx.f[61] = (module, exports) => { 'use strict'; Object.defineProperty(exports, '__esModule', {
value: true
}); var _extends = Object.assign || function (target) { for (var i = 1; i < arguments.length; i++) {
var source = arguments[i];
for (var key in source) {
if (Object.prototype.hasOwnProperty.call(source, key)) {
target[key] = source[key];
}
}
} return target; }; var _createClass = (function () { function defineProperties(target, props) { for (var i = 0; i < props.length; i++) {
var descriptor = props[i];
descriptor.enumerable = descriptor.enumerable || false;
descriptor.configurable = true;
if ('value' in descriptor)
descriptor.writable = true;
Object.defineProperty(target, descriptor.key, descriptor);
} } return function (Constructor, protoProps, staticProps) { if (protoProps)
defineProperties(Constructor.prototype, protoProps); if (staticProps) defineProperties(Constructor, staticProps); return Constructor; }; })();
var _get = function get(_x, _x2, _x3) { var _again = true; _function: while (_again) {
var object = _x, property = _x2, receiver = _x3;
_again = false;
if (object === null)
object = Function.prototype;
var desc = Object.getOwnPropertyDescriptor(object, property);
if (desc === undefined) {
var parent = Object.getPrototypeOf(object);
if (parent === null) {
return undefined;
}
else {
_x = parent;
_x2 = property;
_x3 = receiver;
_again = true;
desc = parent = undefined;
continue _function;
}
}
else if ('value' in desc) {
return desc.value;
}
else {
var getter = desc.get;
if (getter === undefined) {
return undefined;
}
return getter.call(receiver);
}
} }; function _interopRequireDefault(obj) { return obj && obj.__esModule ? obj : { 'default': obj }; } function _classCallCheck(instance, Constructor) { if (!(instance instanceof Constructor)) {
throw new TypeError('Cannot call a class as a function');
} } function _inherits(subClass, superClass) { if (typeof superClass !== 'function' && superClass !== null) {
throw new TypeError('Super expression must either be null or a function, not ' + typeof superClass);
} subClass.prototype = Object.create(superClass && superClass.prototype, { constructor: { value: subClass, enumerable: false, writable: true, configurable: true } }); if (superClass)
Object.setPrototypeOf ? Object.setPrototypeOf(subClass, superClass) : subClass.__proto__ = superClass; }
var _react = $fsx.r(3); var _react2 = _interopRequireDefault(_react); var _propTypes = $fsx.r(13); var _propTypes2 = _interopRequireDefault(_propTypes); var CrossIcon = (function (_Component) {
_inherits(CrossIcon, _Component);
function CrossIcon() {
_classCallCheck(this, CrossIcon);
_get(Object.getPrototypeOf(CrossIcon.prototype), 'constructor', this).apply(this, arguments);
}
_createClass(CrossIcon, [{
key: 'getCrossStyle',
value: function getCrossStyle(type) {
return {
position: 'absolute',
width: 3,
height: 14,
transform: type === 'before' ? 'rotate(45deg)' : 'rotate(-45deg)'
};
}
}, {
key: 'render',
value: function render() {
var _this = this;
var icon;
var buttonWrapperStyle = {
position: 'absolute',
width: 24,
height: 24,
right: 8,
top: 8
};
var buttonStyle = {
position: 'absolute',
left: 0,
top: 0,
width: '100%',
height: '100%',
margin: 0,
padding: 0,
border: 'none',
fontSize: 0,
background: 'transparent',
cursor: 'pointer'
};
if (this.props.customIcon) {
var extraProps = {
className: ('bm-cross ' + (this.props.customIcon.props.className || )).trim(),
style: _extends({ width: '100%', height: '100%' }, this.props.styles.bmCross)
};
icon = _react2['default'].cloneElement(this.props.customIcon, extraProps);
}
else {
icon = _react2['default'].createElement('span', { style: { position: 'absolute', top: '6px', right: '14px' } }, ['before', 'after'].map(function (type, i) {
return _react2['default'].createElement('span', {
key: i,
className: ('bm-cross ' + _this.props.crossClassName).trim(),
style: _extends({}, _this.getCrossStyle(type), _this.props.styles.bmCross)
});
}));
}
return _react2['default'].createElement('div', {
className: ('bm-cross-button ' + this.props.className).trim(),
style: _extends({}, buttonWrapperStyle, this.props.styles.bmCrossButton)
}, icon, _react2['default'].createElement('button', {
onClick: this.props.onClick,
style: buttonStyle,
tabIndex: this.props.tabIndex
}, 'Close Menu'));
}
}]);
return CrossIcon;
})(_react.Component); exports['default'] = CrossIcon; CrossIcon.propTypes = {
crossClassName: _propTypes2['default'].string, customIcon: _propTypes2['default'].element, styles: _propTypes2['default'].object, tabIndex: _propTypes2['default'].number
}; CrossIcon.defaultProps = {
crossClassName: ,
className: ,
styles: {},
tabIndex: 0
}; module.exports = exports['default'];
} // react-burger-menu/lib/menus/stack.js $fsx.f[64] = (module, exports) => { 'use strict'; Object.defineProperty(exports, '__esModule', {
value: true
}); function _interopRequireDefault(obj) { return obj && obj.__esModule ? obj : { 'default': obj }; } var _menuFactory = $fsx.r(62); var _menuFactory2 = _interopRequireDefault(_menuFactory); var styles = {
menuWrap: function menuWrap(isOpen, width, right) {
return {
MozTransform: isOpen ? : right ? 'translate3d(' + width + ', 0, 0)' : 'translate3d(-' + width + ', 0, 0)',
MsTransform: isOpen ? : right ? 'translate3d(' + width + ', 0, 0)' : 'translate3d(-' + width + ', 0, 0)',
OTransform: isOpen ? : right ? 'translate3d(' + width + ', 0, 0)' : 'translate3d(-' + width + ', 0, 0)',
WebkitTransform: isOpen ? : right ? 'translate3d(' + width + ', 0, 0)' : 'translate3d(-' + width + ', 0, 0)',
transform: isOpen ? : right ? 'translate3d(' + width + ', 0, 0)' : 'translate3d(-' + width + ', 0, 0)',
transition: isOpen ? 'transform 0.8s cubic-bezier(0.7, 0, 0.3, 1)' : 'transform 0.4s cubic-bezier(0.7, 0, 0.3, 1)'
};
},
item: function item(isOpen, width, right, nthChild) {
return {
MozTransform: isOpen ? : 'translate3d(0, ' + nthChild * 500 + 'px, 0)',
MsTransform: isOpen ? : 'translate3d(0, ' + nthChild * 500 + 'px, 0)',
OTransform: isOpen ? : 'translate3d(0, ' + nthChild * 500 + 'px, 0)',
WebkitTransform: isOpen ? : 'translate3d(0, ' + nthChild * 500 + 'px, 0)',
transform: isOpen ? : 'translate3d(0, ' + nthChild * 500 + 'px, 0)',
transition: isOpen ? 'transform 0.8s cubic-bezier(0.7, 0, 0.3, 1)' : 'transform 0s 0.2s cubic-bezier(0.7, 0, 0.3, 1)'
};
}
}; exports['default'] = (0, _menuFactory2['default'])(styles); module.exports = exports['default'];
} // react-burger-menu/lib/menus/elastic.js $fsx.f[68] = (module, exports) => { 'use strict'; Object.defineProperty(exports, '__esModule', {
value: true
}); function _interopRequireDefault(obj) { return obj && obj.__esModule ? obj : { 'default': obj }; } var _snapsvgImporter = $fsx.r(67); var _snapsvgImporter2 = _interopRequireDefault(_snapsvgImporter); var _menuFactory = $fsx.r(62); var _menuFactory2 = _interopRequireDefault(_menuFactory); var styles = {
svg: {
lib: _snapsvgImporter2['default'],
pathInitial: 'M-1,0h101c0,0-97.833,153.603-97.833,396.167C2.167,627.579,100,800,100,800H-1V0z',
pathOpen: 'M-1,0h101c0,0,0-1,0,395c0,404,0,405,0,405H-1V0z',
animate: function animate(path) {
path.animate({ path: this.pathOpen }, 400, window.mina.easeinout);
}
},
morphShape: function morphShape(isOpen, width, right) {
return {
position: 'absolute',
width: 120,
height: '100%',
right: right ? 'inherit' : 0,
left: right ? 0 : 'inherit',
MozTransform: right ? 'rotateY(180deg)' : ,
MsTransform: right ? 'rotateY(180deg)' : ,
OTransform: right ? 'rotateY(180deg)' : ,
WebkitTransform: right ? 'rotateY(180deg)' : ,
transform: right ? 'rotateY(180deg)' :
};
},
menuWrap: function menuWrap(isOpen, width, right) {
return {
MozTransform: isOpen ? 'translate3d(0, 0, 0)' : right ? 'translate3d(100%, 0, 0)' : 'translate3d(-100%, 0, 0)',
MsTransform: isOpen ? 'translate3d(0, 0, 0)' : right ? 'translate3d(100%, 0, 0)' : 'translate3d(-100%, 0, 0)',
OTransform: isOpen ? 'translate3d(0, 0, 0)' : right ? 'translate3d(100%, 0, 0)' : 'translate3d(-100%, 0, 0)',
WebkitTransform: isOpen ? 'translate3d(0, 0, 0)' : right ? 'translate3d(100%, 0, 0)' : 'translate3d(-100%, 0, 0)',
transform: isOpen ? 'translate3d(0, 0, 0)' : right ? 'translate3d(100%, 0, 0)' : 'translate3d(-100%, 0, 0)',
transition: 'all 0.3s'
};
},
menu: function menu(isOpen, width, right) {
return {
position: 'fixed',
right: right ? 0 : 'inherit',
width: 180,
whiteSpace: 'nowrap',
boxSizing: 'border-box',
overflow: 'visible'
};
},
itemList: function itemList(isOpen, width, right) {
if (right) {
return {
position: 'relative',
left: '-110px',
width: '170%',
overflow: 'auto'
};
}
},
pageWrap: function pageWrap(isOpen, width, right) {
return {
MozTransform: isOpen ? : right ? 'translate3d(-100px, 0, 0)' : 'translate3d(100px, 0, 0)',
MsTransform: isOpen ? : right ? 'translate3d(-100px, 0, 0)' : 'translate3d(100px, 0, 0)',
OTransform: isOpen ? : right ? 'translate3d(-100px, 0, 0)' : 'translate3d(100px, 0, 0)',
WebkitTransform: isOpen ? : right ? 'translate3d(-100px, 0, 0)' : 'translate3d(100px, 0, 0)',
transform: isOpen ? : right ? 'translate3d(-100px, 0, 0)' : 'translate3d(100px, 0, 0)',
transition: isOpen ? 'all 0.3s' : 'all 0.3s 0.1s'
};
},
outerContainer: function outerContainer(isOpen) {
return {
overflow: isOpen ? : 'hidden'
};
}
}; exports['default'] = (0, _menuFactory2['default'])(styles); module.exports = exports['default'];
} // react-burger-menu/lib/snapsvgImporter.js $fsx.f[67] = (module, exports) => { 'use strict'; Object.defineProperty(exports, '__esModule', {
value: true
}); exports['default'] = function () {
var Snap = undefined;
try {
Snap = $fsx.r(66);
}
finally {
return Snap;
}
}; module.exports = exports['default'];
} // snapsvg-cjs/dist/snap.svg-cjs.js $fsx.f[66] = (module, exports) => { window.eve = $fsx.r(65); var mina = (function (eve) {
var animations = {}, requestAnimFrame = window.requestAnimationFrame ||
window.webkitRequestAnimationFrame ||
window.mozRequestAnimationFrame ||
window.oRequestAnimationFrame ||
window.msRequestAnimationFrame ||
function (callback) {
setTimeout(callback, 16, new Date().getTime());
return true;
}, requestID, isArray = Array.isArray || function (a) {
return a instanceof Array ||
Object.prototype.toString.call(a) == "[object Array]";
}, idgen = 0, idprefix = "M" + (+new Date).toString(36), ID = function () {
return idprefix + (idgen++).toString(36);
}, diff = function (a, b, A, B) {
if (isArray(a)) {
res = [];
for (var i = 0, ii = a.length; i < ii; i++) {
res[i] = diff(a[i], b, A[i], B);
}
return res;
}
var dif = (A - a) / (B - b);
return function (bb) {
return a + dif * (bb - b);
};
}, timer = Date.now || function () {
return +new Date;
}, sta = function (val) {
var a = this;
if (val == null) {
return a.s;
}
var ds = a.s - val;
a.b += a.dur * ds;
a.B += a.dur * ds;
a.s = val;
}, speed = function (val) {
var a = this;
if (val == null) {
return a.spd;
}
a.spd = val;
}, duration = function (val) {
var a = this;
if (val == null) {
return a.dur;
}
a.s = a.s * val / a.dur;
a.dur = val;
}, stopit = function () {
var a = this;
delete animations[a.id];
a.update();
eve("mina.stop." + a.id, a);
}, pause = function () {
var a = this;
if (a.pdif) {
return;
}
delete animations[a.id];
a.update();
a.pdif = a.get() - a.b;
}, resume = function () {
var a = this;
if (!a.pdif) {
return;
}
a.b = a.get() - a.pdif;
delete a.pdif;
animations[a.id] = a;
frame();
}, update = function () {
var a = this, res;
if (isArray(a.start)) {
res = [];
for (var j = 0, jj = a.start.length; j < jj; j++) {
res[j] = +a.start[j] +
(a.end[j] - a.start[j]) * a.easing(a.s);
}
}
else {
res = +a.start + (a.end - a.start) * a.easing(a.s);
}
a.set(res);
}, frame = function (timeStamp) {
if (!timeStamp) {
if (!requestID) {
requestID = requestAnimFrame(frame);
}
return;
}
var len = 0;
for (var i in animations)
if (animations.hasOwnProperty(i)) {
var a = animations[i], b = a.get(), res;
len++;
a.s = (b - a.b) / (a.dur / a.spd);
if (a.s >= 1) {
delete animations[i];
a.s = 1;
len--;
(function (a) {
setTimeout(function () {
eve("mina.finish." + a.id, a);
});
}(a));
}
a.update();
}
requestID = len ? requestAnimFrame(frame) : false;
}, mina = function (a, A, b, B, get, set, easing) {
var anim = {
id: ID(),
start: a,
end: A,
b: b,
s: 0,
dur: B - b,
spd: 1,
get: get,
set: set,
easing: easing || mina.linear,
status: sta,
speed: speed,
duration: duration,
stop: stopit,
pause: pause,
resume: resume,
update: update
};
animations[anim.id] = anim;
var len = 0, i;
for (i in animations)
if (animations.hasOwnProperty(i)) {
len++;
if (len == 2) {
break;
}
}
len == 1 && frame();
return anim;
};
mina.time = timer;
mina.getById = function (id) {
return animations[id] || null;
};
mina.linear = function (n) {
return n;
};
mina.easeout = function (n) {
return Math.pow(n, 1.7);
};
mina.easein = function (n) {
return Math.pow(n, .48);
};
mina.easeinout = function (n) {
if (n == 1) {
return 1;
}
if (n == 0) {
return 0;
}
var q = .48 - n / 1.04, Q = Math.sqrt(.1734 + q * q), x = Q - q, X = Math.pow(Math.abs(x), 1 / 3) * (x < 0 ? -1 : 1), y = -Q - q, Y = Math.pow(Math.abs(y), 1 / 3) * (y < 0 ? -1 : 1), t = X + Y + .5;
return (1 - t) * 3 * t * t + t * t * t;
};
mina.backin = function (n) {
if (n == 1) {
return 1;
}
var s = 1.70158;
return n * n * ((s + 1) * n - s);
};
mina.backout = function (n) {
if (n == 0) {
return 0;
}
n = n - 1;
var s = 1.70158;
return n * n * ((s + 1) * n + s) + 1;
};
mina.elastic = function (n) {
if (n == !!n) {
return n;
}
return Math.pow(2, -10 * n) * Math.sin((n - .075) *
(2 * Math.PI) / .3) + 1;
};
mina.bounce = function (n) {
var s = 7.5625, p = 2.75, l;
if (n < 1 / p) {
l = s * n * n;
}
else {
if (n < 2 / p) {
n -= 1.5 / p;
l = s * n * n + .75;
}
else {
if (n < 2.5 / p) {
n -= 2.25 / p;
l = s * n * n + .9375;
}
else {
n -= 2.625 / p;
l = s * n * n + .984375;
}
}
}
return l;
};
window.mina = mina;
return mina;
})(typeof eve == "undefined" ? function () { } : eve); var Snap = (function (root) {
Snap.version = "0.5.1";
function Snap(w, h) {
if (w) {
if (w.nodeType) {
return wrap(w);
}
if (is(w, "array") && Snap.set) {
return Snap.set.apply(Snap, w);
}
if (w instanceof Element) {
return w;
}
if (h == null) {
try {
w = glob.doc.querySelector(String(w));
return wrap(w);
}
catch (e) {
return null;
}
}
}
w = w == null ? "100%" : w;
h = h == null ? "100%" : h;
return new Paper(w, h);
}
Snap.toString = function () {
return "Snap v" + this.version;
};
Snap._ = {};
var glob = {
win: root.window,
doc: root.window.document
};
Snap._.glob = glob;
var has = "hasOwnProperty", Str = String, toFloat = parseFloat, toInt = parseInt, math = Math, mmax = math.max, mmin = math.min, abs = math.abs, pow = math.pow, PI = math.PI, round = math.round, E = "", S = " ", objectToString = Object.prototype.toString, ISURL = /^url\(['"]?([^\)]+?)['"]?\)$/i, colourRegExp = /^\s*((#[a-f\d]{6})|(#[a-f\d]{3})|rgba?\(\s*([\d\.]+%?\s*,\s*[\d\.]+%?\s*,\s*[\d\.]+%?(?:\s*,\s*[\d\.]+%?)?)\s*\)|hsba?\(\s*([\d\.]+(?:deg|\xb0|%)?\s*,\s*[\d\.]+%?\s*,\s*[\d\.]+(?:%?\s*,\s*[\d\.]+)?%?)\s*\)|hsla?\(\s*([\d\.]+(?:deg|\xb0|%)?\s*,\s*[\d\.]+%?\s*,\s*[\d\.]+(?:%?\s*,\s*[\d\.]+)?%?)\s*\))\s*$/i, bezierrg = /^(?:cubic-)?bezier\(([^,]+),([^,]+),([^,]+),([^\)]+)\)/, separator = Snap._.separator = /[,\s]+/, whitespace = /[\s]/g, commaSpaces = /[\s]*,[\s]*/, hsrg = { hs: 1, rg: 1 }, pathCommand = /([a-z])[\s,]*((-?\d*\.?\d*(?:e[\-+]?\d+)?[\s]*,?[\s]*)+)/ig, tCommand = /([rstm])[\s,]*((-?\d*\.?\d*(?:e[\-+]?\d+)?[\s]*,?[\s]*)+)/ig, pathValues = /(-?\d*\.?\d*(?:e[\-+]?\d+)?)[\s]*,?[\s]*/ig, idgen = 0, idprefix = "S" + (+new Date).toString(36), ID = function (el) {
return (el && el.type ? el.type : E) + idprefix + (idgen++).toString(36);
}, xlink = "http://www.w3.org/1999/xlink", xmlns = "http://www.w3.org/2000/svg", hub = {}, URL = Snap.url = function (url) {
return "url('#" + url + "')";
};
function $(el, attr) {
if (attr) {
if (el == "#text") {
el = glob.doc.createTextNode(attr.text || attr["#text"] || "");
}
if (el == "#comment") {
el = glob.doc.createComment(attr.text || attr["#text"] || "");
}
if (typeof el == "string") {
el = $(el);
}
if (typeof attr == "string") {
if (el.nodeType == 1) {
if (attr.substring(0, 6) == "xlink:") {
return el.getAttributeNS(xlink, attr.substring(6));
}
if (attr.substring(0, 4) == "xml:") {
return el.getAttributeNS(xmlns, attr.substring(4));
}
return el.getAttribute(attr);
}
else if (attr == "text") {
return el.nodeValue;
}
else {
return null;
}
}
if (el.nodeType == 1) {
for (var key in attr)
if (attr[has](key)) {
var val = Str(attr[key]);
if (val) {
if (key.substring(0, 6) == "xlink:") {
el.setAttributeNS(xlink, key.substring(6), val);
}
else if (key.substring(0, 4) == "xml:") {
el.setAttributeNS(xmlns, key.substring(4), val);
}
else {
el.setAttribute(key, val);
}
}
else {
el.removeAttribute(key);
}
}
}
else if ("text" in attr) {
el.nodeValue = attr.text;
}
}
else {
el = glob.doc.createElementNS(xmlns, el);
}
return el;
}
Snap._.$ = $;
Snap._.id = ID;
function getAttrs(el) {
var attrs = el.attributes, name, out = {};
for (var i = 0; i < attrs.length; i++) {
if (attrs[i].namespaceURI == xlink) {
name = "xlink:";
}
else {
name = "";
}
name += attrs[i].name;
out[name] = attrs[i].textContent;
}
return out;
}
function is(o, type) {
type = Str.prototype.toLowerCase.call(type);
if (type == "finite") {
return isFinite(o);
}
if (type == "array" &&
(o instanceof Array || Array.isArray && Array.isArray(o))) {
return true;
}
return type == "null" && o === null ||
type == typeof o && o !== null ||
type == "object" && o === Object(o) ||
objectToString.call(o).slice(8, -1).toLowerCase() == type;
}
Snap.format = (function () {
var tokenRegex = /\{([^\}]+)\}/g, objNotationRegex = /(?:(?:^|\.)(.+?)(?=\[|\.|$|\()|\[('|")(.+?)\2\])(\(\))?/g, replacer = function (all, key, obj) {
var res = obj;
key.replace(objNotationRegex, function (all, name, quote, quotedName, isFunc) {
name = name || quotedName;
if (res) {
if (name in res) {
res = res[name];
}
typeof res == "function" && isFunc && (res = res());
}
});
res = (res == null || res == obj ? all : res) + "";
return res;
};
return function (str, obj) {
return Str(str).replace(tokenRegex, function (all, key) {
return replacer(all, key, obj);
});
};
})();
function clone(obj) {
if (typeof obj == "function" || Object(obj) !== obj) {
return obj;
}
var res = new obj.constructor;
for (var key in obj)
if (obj[has](key)) {
res[key] = clone(obj[key]);
}
return res;
}
Snap._.clone = clone;
function repush(array, item) {
for (var i = 0, ii = array.length; i < ii; i++)
if (array[i] === item) {
return array.push(array.splice(i, 1)[0]);
}
}
function cacher(f, scope, postprocessor) {
function newf() {
var arg = Array.prototype.slice.call(arguments, 0), args = arg.join("\u2400"), cache = newf.cache = newf.cache || {}, count = newf.count = newf.count || [];
if (cache[has](args)) {
repush(count, args);
return postprocessor ? postprocessor(cache[args]) : cache[args];
}
count.length >= 1e3 && delete cache[count.shift()];
count.push(args);
cache[args] = f.apply(scope, arg);
return postprocessor ? postprocessor(cache[args]) : cache[args];
}
return newf;
}
Snap._.cacher = cacher;
function angle(x1, y1, x2, y2, x3, y3) {
if (x3 == null) {
var x = x1 - x2, y = y1 - y2;
if (!x && !y) {
return 0;
}
return (180 + math.atan2(-y, -x) * 180 / PI + 360) % 360;
}
else {
return angle(x1, y1, x3, y3) - angle(x2, y2, x3, y3);
}
}
function rad(deg) {
return deg % 360 * PI / 180;
}
function deg(rad) {
return rad * 180 / PI % 360;
}
function x_y() {
return this.x + S + this.y;
}
function x_y_w_h() {
return this.x + S + this.y + S + this.width + " \xd7 " + this.height;
}
Snap.rad = rad;
Snap.deg = deg;
Snap.sin = function (angle) {
return math.sin(Snap.rad(angle));
};
Snap.tan = function (angle) {
return math.tan(Snap.rad(angle));
};
Snap.cos = function (angle) {
return math.cos(Snap.rad(angle));
};
Snap.asin = function (num) {
return Snap.deg(math.asin(num));
};
Snap.acos = function (num) {
return Snap.deg(math.acos(num));
};
Snap.atan = function (num) {
return Snap.deg(math.atan(num));
};
Snap.atan2 = function (num) {
return Snap.deg(math.atan2(num));
};
Snap.angle = angle;
Snap.len = function (x1, y1, x2, y2) {
return Math.sqrt(Snap.len2(x1, y1, x2, y2));
};
Snap.len2 = function (x1, y1, x2, y2) {
return (x1 - x2) * (x1 - x2) + (y1 - y2) * (y1 - y2);
};
Snap.closestPoint = function (path, x, y) {
function distance2(p) {
var dx = p.x - x, dy = p.y - y;
return dx * dx + dy * dy;
}
var pathNode = path.node, pathLength = pathNode.getTotalLength(), precision = pathLength / pathNode.pathSegList.numberOfItems * .125, best, bestLength, bestDistance = Infinity;
for (var scan, scanLength = 0, scanDistance; scanLength <= pathLength; scanLength += precision) {
if ((scanDistance = distance2(scan = pathNode.getPointAtLength(scanLength))) < bestDistance) {
best = scan;
bestLength = scanLength;
bestDistance = scanDistance;
}
}
precision *= .5;
while (precision > .5) {
var before, after, beforeLength, afterLength, beforeDistance, afterDistance;
if ((beforeLength = bestLength - precision) >= 0 && (beforeDistance = distance2(before = pathNode.getPointAtLength(beforeLength))) < bestDistance) {
best = before;
bestLength = beforeLength;
bestDistance = beforeDistance;
}
else if ((afterLength = bestLength + precision) <= pathLength && (afterDistance = distance2(after = pathNode.getPointAtLength(afterLength))) < bestDistance) {
best = after;
bestLength = afterLength;
bestDistance = afterDistance;
}
else {
precision *= .5;
}
}
best = {
x: best.x,
y: best.y,
length: bestLength,
distance: Math.sqrt(bestDistance)
};
return best;
};
Snap.is = is;
Snap.snapTo = function (values, value, tolerance) {
tolerance = is(tolerance, "finite") ? tolerance : 10;
if (is(values, "array")) {
var i = values.length;
while (i--)
if (abs(values[i] - value) <= tolerance) {
return values[i];
}
}
else {
values = +values;
var rem = value % values;
if (rem < tolerance) {
return value - rem;
}
if (rem > values - tolerance) {
return value - rem + values;
}
}
return value;
};
Snap.getRGB = cacher(function (colour) {
if (!colour || !!((colour = Str(colour)).indexOf("-") + 1)) {
return { r: -1, g: -1, b: -1, hex: "none", error: 1, toString: rgbtoString };
}
if (colour == "none") {
return { r: -1, g: -1, b: -1, hex: "none", toString: rgbtoString };
}
!(hsrg[has](colour.toLowerCase().substring(0, 2)) || colour.charAt() == "#") && (colour = toHex(colour));
if (!colour) {
return { r: -1, g: -1, b: -1, hex: "none", error: 1, toString: rgbtoString };
}
var res, red, green, blue, opacity, t, values, rgb = colour.match(colourRegExp);
if (rgb) {
if (rgb[2]) {
blue = toInt(rgb[2].substring(5), 16);
green = toInt(rgb[2].substring(3, 5), 16);
red = toInt(rgb[2].substring(1, 3), 16);
}
if (rgb[3]) {
blue = toInt((t = rgb[3].charAt(3)) + t, 16);
green = toInt((t = rgb[3].charAt(2)) + t, 16);
red = toInt((t = rgb[3].charAt(1)) + t, 16);
}
if (rgb[4]) {
values = rgb[4].split(commaSpaces);
red = toFloat(values[0]);
values[0].slice(-1) == "%" && (red *= 2.55);
green = toFloat(values[1]);
values[1].slice(-1) == "%" && (green *= 2.55);
blue = toFloat(values[2]);
values[2].slice(-1) == "%" && (blue *= 2.55);
rgb[1].toLowerCase().slice(0, 4) == "rgba" && (opacity = toFloat(values[3]));
values[3] && values[3].slice(-1) == "%" && (opacity /= 100);
}
if (rgb[5]) {
values = rgb[5].split(commaSpaces);
red = toFloat(values[0]);
values[0].slice(-1) == "%" && (red /= 100);
green = toFloat(values[1]);
values[1].slice(-1) == "%" && (green /= 100);
blue = toFloat(values[2]);
values[2].slice(-1) == "%" && (blue /= 100);
(values[0].slice(-3) == "deg" || values[0].slice(-1) == "\xb0") && (red /= 360);
rgb[1].toLowerCase().slice(0, 4) == "hsba" && (opacity = toFloat(values[3]));
values[3] && values[3].slice(-1) == "%" && (opacity /= 100);
return Snap.hsb2rgb(red, green, blue, opacity);
}
if (rgb[6]) {
values = rgb[6].split(commaSpaces);
red = toFloat(values[0]);
values[0].slice(-1) == "%" && (red /= 100);
green = toFloat(values[1]);
values[1].slice(-1) == "%" && (green /= 100);
blue = toFloat(values[2]);
values[2].slice(-1) == "%" && (blue /= 100);
(values[0].slice(-3) == "deg" || values[0].slice(-1) == "\xb0") && (red /= 360);
rgb[1].toLowerCase().slice(0, 4) == "hsla" && (opacity = toFloat(values[3]));
values[3] && values[3].slice(-1) == "%" && (opacity /= 100);
return Snap.hsl2rgb(red, green, blue, opacity);
}
red = mmin(math.round(red), 255);
green = mmin(math.round(green), 255);
blue = mmin(math.round(blue), 255);
opacity = mmin(mmax(opacity, 0), 1);
rgb = { r: red, g: green, b: blue, toString: rgbtoString };
rgb.hex = "#" + (16777216 | blue | green << 8 | red << 16).toString(16).slice(1);
rgb.opacity = is(opacity, "finite") ? opacity : 1;
return rgb;
}
return { r: -1, g: -1, b: -1, hex: "none", error: 1, toString: rgbtoString };
}, Snap);
Snap.hsb = cacher(function (h, s, b) {
return Snap.hsb2rgb(h, s, b).hex;
});
Snap.hsl = cacher(function (h, s, l) {
return Snap.hsl2rgb(h, s, l).hex;
});
Snap.rgb = cacher(function (r, g, b, o) {
if (is(o, "finite")) {
var round = math.round;
return "rgba(" + [round(r), round(g), round(b), +o.toFixed(2)] + ")";
}
return "#" + (16777216 | b | g << 8 | r << 16).toString(16).slice(1);
});
var toHex = function (color) {
var i = glob.doc.getElementsByTagName("head")[0] || glob.doc.getElementsByTagName("svg")[0], red = "rgb(255, 0, 0)";
toHex = cacher(function (color) {
if (color.toLowerCase() == "red") {
return red;
}
i.style.color = red;
i.style.color = color;
var out = glob.doc.defaultView.getComputedStyle(i, E).getPropertyValue("color");
return out == red ? null : out;
});
return toHex(color);
}, hsbtoString = function () {
return "hsb(" + [this.h, this.s, this.b] + ")";
}, hsltoString = function () {
return "hsl(" + [this.h, this.s, this.l] + ")";
}, rgbtoString = function () {
return this.opacity == 1 || this.opacity == null ?
this.hex :
"rgba(" + [this.r, this.g, this.b, this.opacity] + ")";
}, prepareRGB = function (r, g, b) {
if (g == null && is(r, "object") && "r" in r && "g" in r && "b" in r) {
b = r.b;
g = r.g;
r = r.r;
}
if (g == null && is(r, string)) {
var clr = Snap.getRGB(r);
r = clr.r;
g = clr.g;
b = clr.b;
}
if (r > 1 || g > 1 || b > 1) {
r /= 255;
g /= 255;
b /= 255;
}
return [r, g, b];
}, packageRGB = function (r, g, b, o) {
r = math.round(r * 255);
g = math.round(g * 255);
b = math.round(b * 255);
var rgb = {
r: r,
g: g,
b: b,
opacity: is(o, "finite") ? o : 1,
hex: Snap.rgb(r, g, b),
toString: rgbtoString
};
is(o, "finite") && (rgb.opacity = o);
return rgb;
};
Snap.color = function (clr) {
var rgb;
if (is(clr, "object") && "h" in clr && "s" in clr && "b" in clr) {
rgb = Snap.hsb2rgb(clr);
clr.r = rgb.r;
clr.g = rgb.g;
clr.b = rgb.b;
clr.opacity = 1;
clr.hex = rgb.hex;
}
else if (is(clr, "object") && "h" in clr && "s" in clr && "l" in clr) {
rgb = Snap.hsl2rgb(clr);
clr.r = rgb.r;
clr.g = rgb.g;
clr.b = rgb.b;
clr.opacity = 1;
clr.hex = rgb.hex;
}
else {
if (is(clr, "string")) {
clr = Snap.getRGB(clr);
}
if (is(clr, "object") && "r" in clr && "g" in clr && "b" in clr && !("error" in clr)) {
rgb = Snap.rgb2hsl(clr);
clr.h = rgb.h;
clr.s = rgb.s;
clr.l = rgb.l;
rgb = Snap.rgb2hsb(clr);
clr.v = rgb.b;
}
else {
clr = { hex: "none" };
clr.r = clr.g = clr.b = clr.h = clr.s = clr.v = clr.l = -1;
clr.error = 1;
}
}
clr.toString = rgbtoString;
return clr;
};
Snap.hsb2rgb = function (h, s, v, o) {
if (is(h, "object") && "h" in h && "s" in h && "b" in h) {
v = h.b;
s = h.s;
o = h.o;
h = h.h;
}
h *= 360;
var R, G, B, X, C;
h = h % 360 / 60;
C = v * s;
X = C * (1 - abs(h % 2 - 1));
R = G = B = v - C;
h = ~~h;
R += [C, X, 0, 0, X, C][h];
G += [X, C, C, X, 0, 0][h];
B += [0, 0, X, C, C, X][h];
return packageRGB(R, G, B, o);
};
Snap.hsl2rgb = function (h, s, l, o) {
if (is(h, "object") && "h" in h && "s" in h && "l" in h) {
l = h.l;
s = h.s;
h = h.h;
}
if (h > 1 || s > 1 || l > 1) {
h /= 360;
s /= 100;
l /= 100;
}
h *= 360;
var R, G, B, X, C;
h = h % 360 / 60;
C = 2 * s * (l < .5 ? l : 1 - l);
X = C * (1 - abs(h % 2 - 1));
R = G = B = l - C / 2;
h = ~~h;
R += [C, X, 0, 0, X, C][h];
G += [X, C, C, X, 0, 0][h];
B += [0, 0, X, C, C, X][h];
return packageRGB(R, G, B, o);
};
Snap.rgb2hsb = function (r, g, b) {
b = prepareRGB(r, g, b);
r = b[0];
g = b[1];
b = b[2];
var H, S, V, C;
V = mmax(r, g, b);
C = V - mmin(r, g, b);
H = C == 0 ? null :
V == r ? (g - b) / C :
V == g ? (b - r) / C + 2 :
(r - g) / C + 4;
H = (H + 360) % 6 * 60 / 360;
S = C == 0 ? 0 : C / V;
return { h: H, s: S, b: V, toString: hsbtoString };
};
Snap.rgb2hsl = function (r, g, b) {
b = prepareRGB(r, g, b);
r = b[0];
g = b[1];
b = b[2];
var H, S, L, M, m, C;
M = mmax(r, g, b);
m = mmin(r, g, b);
C = M - m;
H = C == 0 ? null :
M == r ? (g - b) / C :
M == g ? (b - r) / C + 2 :
(r - g) / C + 4;
H = (H + 360) % 6 * 60 / 360;
L = (M + m) / 2;
S = C == 0 ? 0 :
L < .5 ? C / (2 * L) :
C / (2 - 2 * L);
return { h: H, s: S, l: L, toString: hsltoString };
};
Snap.parsePathString = function (pathString) {
if (!pathString) {
return null;
}
var pth = Snap.path(pathString);
if (pth.arr) {
return Snap.path.clone(pth.arr);
}
var paramCounts = { a: 7, c: 6, o: 2, h: 1, l: 2, m: 2, r: 4, q: 4, s: 4, t: 2, v: 1, u: 3, z: 0 }, data = [];
if (is(pathString, "array") && is(pathString[0], "array")) {
data = Snap.path.clone(pathString);
}
if (!data.length) {
Str(pathString).replace(pathCommand, function (a, b, c) {
var params = [], name = b.toLowerCase();
c.replace(pathValues, function (a, b) {
b && params.push(+b);
});
if (name == "m" && params.length > 2) {
data.push([b].concat(params.splice(0, 2)));
name = "l";
b = b == "m" ? "l" : "L";
}
if (name == "o" && params.length == 1) {
data.push([b, params[0]]);
}
if (name == "r") {
data.push([b].concat(params));
}
else
while (params.length >= paramCounts[name]) {
data.push([b].concat(params.splice(0, paramCounts[name])));
if (!paramCounts[name]) {
break;
}
}
});
}
data.toString = Snap.path.toString;
pth.arr = Snap.path.clone(data);
return data;
};
var parseTransformString = Snap.parseTransformString = function (TString) {
if (!TString) {
return null;
}
var paramCounts = { r: 3, s: 4, t: 2, m: 6 }, data = [];
if (is(TString, "array") && is(TString[0], "array")) {
data = Snap.path.clone(TString);
}
if (!data.length) {
Str(TString).replace(tCommand, function (a, b, c) {
var params = [], name = b.toLowerCase();
c.replace(pathValues, function (a, b) {
b && params.push(+b);
});
data.push([b].concat(params));
});
}
data.toString = Snap.path.toString;
return data;
};
function svgTransform2string(tstr) {
var res = [];
tstr = tstr.replace(/(?:^|\s)(\w+)\(([^)]+)\)/g, function (all, name, params) {
params = params.split(/\s*,\s*|\s+/);
if (name == "rotate" && params.length == 1) {
params.push(0, 0);
}
if (name == "scale") {
if (params.length > 2) {
params = params.slice(0, 2);
}
else if (params.length == 2) {
params.push(0, 0);
}
if (params.length == 1) {
params.push(params[0], 0, 0);
}
}
if (name == "skewX") {
res.push(["m", 1, 0, math.tan(rad(params[0])), 1, 0, 0]);
}
else if (name == "skewY") {
res.push(["m", 1, math.tan(rad(params[0])), 0, 1, 0, 0]);
}
else {
res.push([name.charAt(0)].concat(params));
}
return all;
});
return res;
}
Snap._.svgTransform2string = svgTransform2string;
Snap._.rgTransform = /^[a-z][\s]*-?\.?\d/i;
function transform2matrix(tstr, bbox) {
var tdata = parseTransformString(tstr), m = new Snap.Matrix;
if (tdata) {
for (var i = 0, ii = tdata.length; i < ii; i++) {
var t = tdata[i], tlen = t.length, command = Str(t[0]).toLowerCase(), absolute = t[0] != command, inver = absolute ? m.invert() : 0, x1, y1, x2, y2, bb;
if (command == "t" && tlen == 2) {
m.translate(t[1], 0);
}
else if (command == "t" && tlen == 3) {
if (absolute) {
x1 = inver.x(0, 0);
y1 = inver.y(0, 0);
x2 = inver.x(t[1], t[2]);
y2 = inver.y(t[1], t[2]);
m.translate(x2 - x1, y2 - y1);
}
else {
m.translate(t[1], t[2]);
}
}
else if (command == "r") {
if (tlen == 2) {
bb = bb || bbox;
m.rotate(t[1], bb.x + bb.width / 2, bb.y + bb.height / 2);
}
else if (tlen == 4) {
if (absolute) {
x2 = inver.x(t[2], t[3]);
y2 = inver.y(t[2], t[3]);
m.rotate(t[1], x2, y2);
}
else {
m.rotate(t[1], t[2], t[3]);
}
}
}
else if (command == "s") {
if (tlen == 2 || tlen == 3) {
bb = bb || bbox;
m.scale(t[1], t[tlen - 1], bb.x + bb.width / 2, bb.y + bb.height / 2);
}
else if (tlen == 4) {
if (absolute) {
x2 = inver.x(t[2], t[3]);
y2 = inver.y(t[2], t[3]);
m.scale(t[1], t[1], x2, y2);
}
else {
m.scale(t[1], t[1], t[2], t[3]);
}
}
else if (tlen == 5) {
if (absolute) {
x2 = inver.x(t[3], t[4]);
y2 = inver.y(t[3], t[4]);
m.scale(t[1], t[2], x2, y2);
}
else {
m.scale(t[1], t[2], t[3], t[4]);
}
}
}
else if (command == "m" && tlen == 7) {
m.add(t[1], t[2], t[3], t[4], t[5], t[6]);
}
}
}
return m;
}
Snap._.transform2matrix = transform2matrix;
Snap._unit2px = unit2px;
var contains = glob.doc.contains || glob.doc.compareDocumentPosition ?
function (a, b) {
var adown = a.nodeType == 9 ? a.documentElement : a, bup = b && b.parentNode;
return a == bup || !!(bup && bup.nodeType == 1 && (adown.contains ?
adown.contains(bup) :
a.compareDocumentPosition && a.compareDocumentPosition(bup) & 16));
} :
function (a, b) {
if (b) {
while (b) {
b = b.parentNode;
if (b == a) {
return true;
}
}
}
return false;
};
function getSomeDefs(el) {
var p = el.node.ownerSVGElement && wrap(el.node.ownerSVGElement) ||
el.node.parentNode && wrap(el.node.parentNode) ||
Snap.select("svg") ||
Snap(0, 0), pdefs = p.select("defs"), defs = pdefs == null ? false : pdefs.node;
if (!defs) {
defs = make("defs", p.node).node;
}
return defs;
}
function getSomeSVG(el) {
return el.node.ownerSVGElement && wrap(el.node.ownerSVGElement) || Snap.select("svg");
}
Snap._.getSomeDefs = getSomeDefs;
Snap._.getSomeSVG = getSomeSVG;
function unit2px(el, name, value) {
var svg = getSomeSVG(el).node, out = {}, mgr = svg.querySelector(".svg---mgr");
if (!mgr) {
mgr = $("rect");
$(mgr, { x: -9e9, y: -9e9, width: 10, height: 10, "class": "svg---mgr", fill: "none" });
svg.appendChild(mgr);
}
function getW(val) {
if (val == null) {
return E;
}
if (val == +val) {
return val;
}
$(mgr, { width: val });
try {
return mgr.getBBox().width;
}
catch (e) {
return 0;
}
}
function getH(val) {
if (val == null) {
return E;
}
if (val == +val) {
return val;
}
$(mgr, { height: val });
try {
return mgr.getBBox().height;
}
catch (e) {
return 0;
}
}
function set(nam, f) {
if (name == null) {
out[nam] = f(el.attr(nam) || 0);
}
else if (nam == name) {
out = f(value == null ? el.attr(nam) || 0 : value);
}
}
switch (el.type) {
case "rect":
set("rx", getW);
set("ry", getH);
case "image":
set("width", getW);
set("height", getH);
case "text":
set("x", getW);
set("y", getH);
break;
case "circle":
set("cx", getW);
set("cy", getH);
set("r", getW);
break;
case "ellipse":
set("cx", getW);
set("cy", getH);
set("rx", getW);
set("ry", getH);
break;
case "line":
set("x1", getW);
set("x2", getW);
set("y1", getH);
set("y2", getH);
break;
case "marker":
set("refX", getW);
set("markerWidth", getW);
set("refY", getH);
set("markerHeight", getH);
break;
case "radialGradient":
set("fx", getW);
set("fy", getH);
break;
case "tspan":
set("dx", getW);
set("dy", getH);
break;
default:
set(name, getW);
}
svg.removeChild(mgr);
return out;
}
Snap.select = function (query) {
query = Str(query).replace(/([^\\]):/g, "$1\\:");
return wrap(glob.doc.querySelector(query));
};
Snap.selectAll = function (query) {
var nodelist = glob.doc.querySelectorAll(query), set = (Snap.set || Array)();
for (var i = 0; i < nodelist.length; i++) {
set.push(wrap(nodelist[i]));
}
return set;
};
function add2group(list) {
if (!is(list, "array")) {
list = Array.prototype.slice.call(arguments, 0);
}
var i = 0, j = 0, node = this.node;
while (this[i])
delete this[i++];
for (i = 0; i < list.length; i++) {
if (list[i].type == "set") {
list[i].forEach(function (el) {
node.appendChild(el.node);
});
}
else {
node.appendChild(list[i].node);
}
}
var children = node.childNodes;
for (i = 0; i < children.length; i++) {
this[j++] = wrap(children[i]);
}
return this;
}
setInterval(function () {
for (var key in hub)
if (hub[has](key)) {
var el = hub[key], node = el.node;
if (el.type != "svg" && !node.ownerSVGElement || el.type == "svg" && (!node.parentNode || "ownerSVGElement" in node.parentNode && !node.ownerSVGElement)) {
delete hub[key];
}
}
}, 1e4);
function Element(el) {
if (el.snap in hub) {
return hub[el.snap];
}
var svg;
try {
svg = el.ownerSVGElement;
}
catch (e) { }
this.node = el;
if (svg) {
this.paper = new Paper(svg);
}
this.type = el.tagName || el.nodeName;
var id = this.id = ID(this);
this.anims = {};
this._ = {
transform: []
};
el.snap = id;
hub[id] = this;
if (this.type == "g") {
this.add = add2group;
}
if (this.type in { g: 1, mask: 1, pattern: 1, symbol: 1 }) {
for (var method in Paper.prototype)
if (Paper.prototype[has](method)) {
this[method] = Paper.prototype[method];
}
}
}
Element.prototype.attr = function (params, value) {
var el = this, node = el.node;
if (!params) {
if (node.nodeType != 1) {
return {
text: node.nodeValue
};
}
var attr = node.attributes, out = {};
for (var i = 0, ii = attr.length; i < ii; i++) {
out[attr[i].nodeName] = attr[i].nodeValue;
}
return out;
}
if (is(params, "string")) {
if (arguments.length > 1) {
var json = {};
json[params] = value;
params = json;
}
else {
return eve("snap.util.getattr." + params, el).firstDefined();
}
}
for (var att in params) {
if (params[has](att)) {
eve("snap.util.attr." + att, el, params[att]);
}
}
return el;
};
Snap.parse = function (svg) {
var f = glob.doc.createDocumentFragment(), full = true, div = glob.doc.createElement("div");
svg = Str(svg);
if (!svg.match(/^\s*<\s*svg(?:\s|>)/)) {
svg = "<svg>" + svg + "</svg>";
full = false;
}
div.innerHTML = svg;
svg = div.getElementsByTagName("svg")[0];
if (svg) {
if (full) {
f = svg;
}
else {
while (svg.firstChild) {
f.appendChild(svg.firstChild);
}
}
}
return new Fragment(f);
};
function Fragment(frag) {
this.node = frag;
}
Snap.fragment = function () {
var args = Array.prototype.slice.call(arguments, 0), f = glob.doc.createDocumentFragment();
for (var i = 0, ii = args.length; i < ii; i++) {
var item = args[i];
if (item.node && item.node.nodeType) {
f.appendChild(item.node);
}
if (item.nodeType) {
f.appendChild(item);
}
if (typeof item == "string") {
f.appendChild(Snap.parse(item).node);
}
}
return new Fragment(f);
};
function make(name, parent) {
var res = $(name);
parent.appendChild(res);
var el = wrap(res);
return el;
}
function Paper(w, h) {
var res, desc, defs, proto = Paper.prototype;
if (w && w.tagName && w.tagName.toLowerCase() == "svg") {
if (w.snap in hub) {
return hub[w.snap];
}
var doc = w.ownerDocument;
res = new Element(w);
desc = w.getElementsByTagName("desc")[0];
defs = w.getElementsByTagName("defs")[0];
if (!desc) {
desc = $("desc");
desc.appendChild(doc.createTextNode("Created with Snap"));
res.node.appendChild(desc);
}
if (!defs) {
defs = $("defs");
res.node.appendChild(defs);
}
res.defs = defs;
for (var key in proto)
if (proto[has](key)) {
res[key] = proto[key];
}
res.paper = res.root = res;
}
else {
res = make("svg", glob.doc.body);
$(res.node, {
height: h,
version: 1.1,
width: w,
xmlns: xmlns
});
}
return res;
}
function wrap(dom) {
if (!dom) {
return dom;
}
if (dom instanceof Element || dom instanceof Fragment) {
return dom;
}
if (dom.tagName && dom.tagName.toLowerCase() == "svg") {
return new Paper(dom);
}
if (dom.tagName && dom.tagName.toLowerCase() == "object" && dom.type == "image/svg+xml") {
return new Paper(dom.contentDocument.getElementsByTagName("svg")[0]);
}
return new Element(dom);
}
Snap._.make = make;
Snap._.wrap = wrap;
Paper.prototype.el = function (name, attr) {
var el = make(name, this.node);
attr && el.attr(attr);
return el;
};
Element.prototype.children = function () {
var out = [], ch = this.node.childNodes;
for (var i = 0, ii = ch.length; i < ii; i++) {
out[i] = Snap(ch[i]);
}
return out;
};
function jsonFiller(root, o) {
for (var i = 0, ii = root.length; i < ii; i++) {
var item = {
type: root[i].type,
attr: root[i].attr()
}, children = root[i].children();
o.push(item);
if (children.length) {
jsonFiller(children, item.childNodes = []);
}
}
}
Element.prototype.toJSON = function () {
var out = [];
jsonFiller([this], out);
return out[0];
};
eve.on("snap.util.getattr", function () {
var att = eve.nt();
att = att.substring(att.lastIndexOf(".") + 1);
var css = att.replace(/[A-Z]/g, function (letter) {
return "-" + letter.toLowerCase();
});
if (cssAttr[has](css)) {
return this.node.ownerDocument.defaultView.getComputedStyle(this.node, null).getPropertyValue(css);
}
else {
return $(this.node, att);
}
});
var cssAttr = {
"alignment-baseline": 0,
"baseline-shift": 0,
"clip": 0,
"clip-path": 0,
"clip-rule": 0,
"color": 0,
"color-interpolation": 0,
"color-interpolation-filters": 0,
"color-profile": 0,
"color-rendering": 0,
"cursor": 0,
"direction": 0,
"display": 0,
"dominant-baseline": 0,
"enable-background": 0,
"fill": 0,
"fill-opacity": 0,
"fill-rule": 0,
"filter": 0,
"flood-color": 0,
"flood-opacity": 0,
"font": 0,
"font-family": 0,
"font-size": 0,
"font-size-adjust": 0,
"font-stretch": 0,
"font-style": 0,
"font-variant": 0,
"font-weight": 0,
"glyph-orientation-horizontal": 0,
"glyph-orientation-vertical": 0,
"image-rendering": 0,
"kerning": 0,
"letter-spacing": 0,
"lighting-color": 0,
"marker": 0,
"marker-end": 0,
"marker-mid": 0,
"marker-start": 0,
"mask": 0,
"opacity": 0,
"overflow": 0,
"pointer-events": 0,
"shape-rendering": 0,
"stop-color": 0,
"stop-opacity": 0,
"stroke": 0,
"stroke-dasharray": 0,
"stroke-dashoffset": 0,
"stroke-linecap": 0,
"stroke-linejoin": 0,
"stroke-miterlimit": 0,
"stroke-opacity": 0,
"stroke-width": 0,
"text-anchor": 0,
"text-decoration": 0,
"text-rendering": 0,
"unicode-bidi": 0,
"visibility": 0,
"word-spacing": 0,
"writing-mode": 0
};
eve.on("snap.util.attr", function (value) {
var att = eve.nt(), attr = {};
att = att.substring(att.lastIndexOf(".") + 1);
attr[att] = value;
var style = att.replace(/-(\w)/gi, function (all, letter) {
return letter.toUpperCase();
}), css = att.replace(/[A-Z]/g, function (letter) {
return "-" + letter.toLowerCase();
});
if (cssAttr[has](css)) {
this.node.style[style] = value == null ? E : value;
}
else {
$(this.node, attr);
}
});
(function (proto) { }(Paper.prototype));
Snap.ajax = function (url, postData, callback, scope) {
var req = new XMLHttpRequest, id = ID();
if (req) {
if (is(postData, "function")) {
scope = callback;
callback = postData;
postData = null;
}
else if (is(postData, "object")) {
var pd = [];
for (var key in postData)
if (postData.hasOwnProperty(key)) {
pd.push(encodeURIComponent(key) + "=" + encodeURIComponent(postData[key]));
}
postData = pd.join("&");
}
req.open(postData ? "POST" : "GET", url, true);
if (postData) {
req.setRequestHeader("X-Requested-With", "XMLHttpRequest");
req.setRequestHeader("Content-type", "application/x-www-form-urlencoded");
}
if (callback) {
eve.once("snap.ajax." + id + ".0", callback);
eve.once("snap.ajax." + id + ".200", callback);
eve.once("snap.ajax." + id + ".304", callback);
}
req.onreadystatechange = function () {
if (req.readyState != 4)
return;
eve("snap.ajax." + id + "." + req.status, scope, req);
};
if (req.readyState == 4) {
return req;
}
req.send(postData);
return req;
}
};
Snap.load = function (url, callback, scope) {
Snap.ajax(url, function (req) {
var f = Snap.parse(req.responseText);
scope ? callback.call(scope, f) : callback(f);
});
};
var getOffset = function (elem) {
var box = elem.getBoundingClientRect(), doc = elem.ownerDocument, body = doc.body, docElem = doc.documentElement, clientTop = docElem.clientTop || body.clientTop || 0, clientLeft = docElem.clientLeft || body.clientLeft || 0, top = box.top + (g.win.pageYOffset || docElem.scrollTop || body.scrollTop) - clientTop, left = box.left + (g.win.pageXOffset || docElem.scrollLeft || body.scrollLeft) - clientLeft;
return {
y: top,
x: left
};
};
Snap.getElementByPoint = function (x, y) {
var paper = this, svg = paper.canvas, target = glob.doc.elementFromPoint(x, y);
if (glob.win.opera && target.tagName == "svg") {
var so = getOffset(target), sr = target.createSVGRect();
sr.x = x - so.x;
sr.y = y - so.y;
sr.width = sr.height = 1;
var hits = target.getIntersectionList(sr, null);
if (hits.length) {
target = hits[hits.length - 1];
}
}
if (!target) {
return null;
}
return wrap(target);
};
Snap.plugin = function (f) {
f(Snap, Element, Paper, glob, Fragment);
};
glob.win.Snap = Snap;
return Snap;
}(window || this)); Snap.plugin(function (Snap, Element, Paper, glob, Fragment) {
var elproto = Element.prototype, is = Snap.is, Str = String, unit2px = Snap._unit2px, $ = Snap._.$, make = Snap._.make, getSomeDefs = Snap._.getSomeDefs, has = "hasOwnProperty", wrap = Snap._.wrap;
elproto.getBBox = function (isWithoutTransform) {
if (this.type == "tspan") {
return Snap._.box(this.node.getClientRects().item(0));
}
if (!Snap.Matrix || !Snap.path) {
return this.node.getBBox();
}
var el = this, m = new Snap.Matrix;
if (el.removed) {
return Snap._.box();
}
while (el.type == "use") {
if (!isWithoutTransform) {
m = m.add(el.transform().localMatrix.translate(el.attr("x") || 0, el.attr("y") || 0));
}
if (el.original) {
el = el.original;
}
else {
var href = el.attr("xlink:href");
el = el.original = el.node.ownerDocument.getElementById(href.substring(href.indexOf("#") + 1));
}
}
var _ = el._, pathfinder = Snap.path.get[el.type] || Snap.path.get.deflt;
try {
if (isWithoutTransform) {
_.bboxwt = pathfinder ? Snap.path.getBBox(el.realPath = pathfinder(el)) : Snap._.box(el.node.getBBox());
return Snap._.box(_.bboxwt);
}
else {
el.realPath = pathfinder(el);
el.matrix = el.transform().localMatrix;
_.bbox = Snap.path.getBBox(Snap.path.map(el.realPath, m.add(el.matrix)));
return Snap._.box(_.bbox);
}
}
catch (e) {
return Snap._.box();
}
};
var propString = function () {
return this.string;
};
function extractTransform(el, tstr) {
if (tstr == null) {
var doReturn = true;
if (el.type == "linearGradient" || el.type == "radialGradient") {
tstr = el.node.getAttribute("gradientTransform");
}
else if (el.type == "pattern") {
tstr = el.node.getAttribute("patternTransform");
}
else {
tstr = el.node.getAttribute("transform");
}
if (!tstr) {
return new Snap.Matrix;
}
tstr = Snap._.svgTransform2string(tstr);
}
else {
if (!Snap._.rgTransform.test(tstr)) {
tstr = Snap._.svgTransform2string(tstr);
}
else {
tstr = Str(tstr).replace(/\.{3}|\u2026/g, el._.transform || "");
}
if (is(tstr, "array")) {
tstr = Snap.path ? Snap.path.toString.call(tstr) : Str(tstr);
}
el._.transform = tstr;
}
var m = Snap._.transform2matrix(tstr, el.getBBox(1));
if (doReturn) {
return m;
}
else {
el.matrix = m;
}
}
elproto.transform = function (tstr) {
var _ = this._;
if (tstr == null) {
var papa = this, global = new Snap.Matrix(this.node.getCTM()), local = extractTransform(this), ms = [local], m = new Snap.Matrix, i, localString = local.toTransformString(), string = Str(local) == Str(this.matrix) ?
Str(_.transform) : localString;
while (papa.type != "svg" && (papa = papa.parent())) {
ms.push(extractTransform(papa));
}
i = ms.length;
while (i--) {
m.add(ms[i]);
}
return {
string: string,
globalMatrix: global,
totalMatrix: m,
localMatrix: local,
diffMatrix: global.clone().add(local.invert()),
global: global.toTransformString(),
total: m.toTransformString(),
local: localString,
toString: propString
};
}
if (tstr instanceof Snap.Matrix) {
this.matrix = tstr;
this._.transform = tstr.toTransformString();
}
else {
extractTransform(this, tstr);
}
if (this.node) {
if (this.type == "linearGradient" || this.type == "radialGradient") {
$(this.node, { gradientTransform: this.matrix });
}
else if (this.type == "pattern") {
$(this.node, { patternTransform: this.matrix });
}
else {
$(this.node, { transform: this.matrix });
}
}
return this;
};
elproto.parent = function () {
return wrap(this.node.parentNode);
};
elproto.append = elproto.add = function (el) {
if (el) {
if (el.type == "set") {
var it = this;
el.forEach(function (el) {
it.add(el);
});
return this;
}
el = wrap(el);
this.node.appendChild(el.node);
el.paper = this.paper;
}
return this;
};
elproto.appendTo = function (el) {
if (el) {
el = wrap(el);
el.append(this);
}
return this;
};
elproto.prepend = function (el) {
if (el) {
if (el.type == "set") {
var it = this, first;
el.forEach(function (el) {
if (first) {
first.after(el);
}
else {
it.prepend(el);
}
first = el;
});
return this;
}
el = wrap(el);
var parent = el.parent();
this.node.insertBefore(el.node, this.node.firstChild);
this.add && this.add();
el.paper = this.paper;
this.parent() && this.parent().add();
parent && parent.add();
}
return this;
};
elproto.prependTo = function (el) {
el = wrap(el);
el.prepend(this);
return this;
};
elproto.before = function (el) {
if (el.type == "set") {
var it = this;
el.forEach(function (el) {
var parent = el.parent();
it.node.parentNode.insertBefore(el.node, it.node);
parent && parent.add();
});
this.parent().add();
return this;
}
el = wrap(el);
var parent = el.parent();
this.node.parentNode.insertBefore(el.node, this.node);
this.parent() && this.parent().add();
parent && parent.add();
el.paper = this.paper;
return this;
};
elproto.after = function (el) {
el = wrap(el);
var parent = el.parent();
if (this.node.nextSibling) {
this.node.parentNode.insertBefore(el.node, this.node.nextSibling);
}
else {
this.node.parentNode.appendChild(el.node);
}
this.parent() && this.parent().add();
parent && parent.add();
el.paper = this.paper;
return this;
};
elproto.insertBefore = function (el) {
el = wrap(el);
var parent = this.parent();
el.node.parentNode.insertBefore(this.node, el.node);
this.paper = el.paper;
parent && parent.add();
el.parent() && el.parent().add();
return this;
};
elproto.insertAfter = function (el) {
el = wrap(el);
var parent = this.parent();
el.node.parentNode.insertBefore(this.node, el.node.nextSibling);
this.paper = el.paper;
parent && parent.add();
el.parent() && el.parent().add();
return this;
};
elproto.remove = function () {
var parent = this.parent();
this.node.parentNode && this.node.parentNode.removeChild(this.node);
delete this.paper;
this.removed = true;
parent && parent.add();
return this;
};
elproto.select = function (query) {
return wrap(this.node.querySelector(query));
};
elproto.selectAll = function (query) {
var nodelist = this.node.querySelectorAll(query), set = (Snap.set || Array)();
for (var i = 0; i < nodelist.length; i++) {
set.push(wrap(nodelist[i]));
}
return set;
};
elproto.asPX = function (attr, value) {
if (value == null) {
value = this.attr(attr);
}
return +unit2px(this, attr, value);
};
elproto.use = function () {
var use, id = this.node.id;
if (!id) {
id = this.id;
$(this.node, {
id: id
});
}
if (this.type == "linearGradient" || this.type == "radialGradient" ||
this.type == "pattern") {
use = make(this.type, this.node.parentNode);
}
else {
use = make("use", this.node.parentNode);
}
$(use.node, {
"xlink:href": "#" + id
});
use.original = this;
return use;
};
function fixids(el) {
var els = el.selectAll("*"), it, url = /^\s*url\(("|'|)(.*)\1\)\s*$/, ids = [], uses = {};
function urltest(it, name) {
var val = $(it.node, name);
val = val && val.match(url);
val = val && val[2];
if (val && val.charAt() == "#") {
val = val.substring(1);
}
else {
return;
}
if (val) {
uses[val] = (uses[val] || []).concat(function (id) {
var attr = {};
attr[name] = Snap.url(id);
$(it.node, attr);
});
}
}
function linktest(it) {
var val = $(it.node, "xlink:href");
if (val && val.charAt() == "#") {
val = val.substring(1);
}
else {
return;
}
if (val) {
uses[val] = (uses[val] || []).concat(function (id) {
it.attr("xlink:href", "#" + id);
});
}
}
for (var i = 0, ii = els.length; i < ii; i++) {
it = els[i];
urltest(it, "fill");
urltest(it, "stroke");
urltest(it, "filter");
urltest(it, "mask");
urltest(it, "clip-path");
linktest(it);
var oldid = $(it.node, "id");
if (oldid) {
$(it.node, { id: it.id });
ids.push({
old: oldid,
id: it.id
});
}
}
for (i = 0, ii = ids.length; i < ii; i++) {
var fs = uses[ids[i].old];
if (fs) {
for (var j = 0, jj = fs.length; j < jj; j++) {
fs[j](ids[i].id);
}
}
}
}
elproto.clone = function () {
var clone = wrap(this.node.cloneNode(true));
if ($(clone.node, "id")) {
$(clone.node, { id: clone.id });
}
fixids(clone);
clone.insertAfter(this);
return clone;
};
elproto.toDefs = function () {
var defs = getSomeDefs(this);
defs.appendChild(this.node);
return this;
};
elproto.pattern = elproto.toPattern = function (x, y, width, height) {
var p = make("pattern", getSomeDefs(this));
if (x == null) {
x = this.getBBox();
}
if (is(x, "object") && "x" in x) {
y = x.y;
width = x.width;
height = x.height;
x = x.x;
}
$(p.node, {
x: x,
y: y,
width: width,
height: height,
patternUnits: "userSpaceOnUse",
id: p.id,
viewBox: [x, y, width, height].join(" ")
});
p.node.appendChild(this.node);
return p;
};
elproto.marker = function (x, y, width, height, refX, refY) {
var p = make("marker", getSomeDefs(this));
if (x == null) {
x = this.getBBox();
}
if (is(x, "object") && "x" in x) {
y = x.y;
width = x.width;
height = x.height;
refX = x.refX || x.cx;
refY = x.refY || x.cy;
x = x.x;
}
$(p.node, {
viewBox: [x, y, width, height].join(" "),
markerWidth: width,
markerHeight: height,
orient: "auto",
refX: refX || 0,
refY: refY || 0,
id: p.id
});
p.node.appendChild(this.node);
return p;
};
var eldata = {};
elproto.data = function (key, value) {
var data = eldata[this.id] = eldata[this.id] || {};
if (arguments.length == 0) {
eve("snap.data.get." + this.id, this, data, null);
return data;
}
if (arguments.length == 1) {
if (Snap.is(key, "object")) {
for (var i in key)
if (key[has](i)) {
this.data(i, key[i]);
}
return this;
}
eve("snap.data.get." + this.id, this, data[key], key);
return data[key];
}
data[key] = value;
eve("snap.data.set." + this.id, this, value, key);
return this;
};
elproto.removeData = function (key) {
if (key == null) {
eldata[this.id] = {};
}
else {
eldata[this.id] && delete eldata[this.id][key];
}
return this;
};
elproto.outerSVG = elproto.toString = toString(1);
elproto.innerSVG = toString();
function toString(type) {
return function () {
var res = type ? "<" + this.type : "", attr = this.node.attributes, chld = this.node.childNodes;
if (type) {
for (var i = 0, ii = attr.length; i < ii; i++) {
res += " " + attr[i].name + '="' +
attr[i].value.replace(/"/g, '\\"') + '"';
}
}
if (chld.length) {
type && (res += ">");
for (i = 0, ii = chld.length; i < ii; i++) {
if (chld[i].nodeType == 3) {
res += chld[i].nodeValue;
}
else if (chld[i].nodeType == 1) {
res += wrap(chld[i]).toString();
}
}
type && (res += "</" + this.type + ">");
}
else {
type && (res += "/>");
}
return res;
};
}
elproto.toDataURL = function () {
if (window && window.btoa) {
var bb = this.getBBox(), svg = Snap.format('<svg version="1.1" xmlns="http://www.w3.org/2000/svg" xmlns:xlink="http://www.w3.org/1999/xlink" width="{width}" height="{height}" viewBox="{x} {y} {width} {height}">{contents}</svg>', {
x: +bb.x.toFixed(3),
y: +bb.y.toFixed(3),
width: +bb.width.toFixed(3),
height: +bb.height.toFixed(3),
contents: this.outerSVG()
});
return "data:image/svg+xml;base64," + btoa(unescape(encodeURIComponent(svg)));
}
};
Fragment.prototype.select = elproto.select;
Fragment.prototype.selectAll = elproto.selectAll;
}); Snap.plugin(function (Snap, Element, Paper, glob, Fragment) {
var objectToString = Object.prototype.toString, Str = String, math = Math, E = "";
function Matrix(a, b, c, d, e, f) {
if (b == null && objectToString.call(a) == "[object SVGMatrix]") {
this.a = a.a;
this.b = a.b;
this.c = a.c;
this.d = a.d;
this.e = a.e;
this.f = a.f;
return;
}
if (a != null) {
this.a = +a;
this.b = +b;
this.c = +c;
this.d = +d;
this.e = +e;
this.f = +f;
}
else {
this.a = 1;
this.b = 0;
this.c = 0;
this.d = 1;
this.e = 0;
this.f = 0;
}
}
(function (matrixproto) {
matrixproto.add = function (a, b, c, d, e, f) {
if (a && a instanceof Matrix) {
return this.add(a.a, a.b, a.c, a.d, a.e, a.f);
}
var aNew = a * this.a + b * this.c, bNew = a * this.b + b * this.d;
this.e += e * this.a + f * this.c;
this.f += e * this.b + f * this.d;
this.c = c * this.a + d * this.c;
this.d = c * this.b + d * this.d;
this.a = aNew;
this.b = bNew;
return this;
};
Matrix.prototype.multLeft = function (a, b, c, d, e, f) {
if (a && a instanceof Matrix) {
return this.multLeft(a.a, a.b, a.c, a.d, a.e, a.f);
}
var aNew = a * this.a + c * this.b, cNew = a * this.c + c * this.d, eNew = a * this.e + c * this.f + e;
this.b = b * this.a + d * this.b;
this.d = b * this.c + d * this.d;
this.f = b * this.e + d * this.f + f;
this.a = aNew;
this.c = cNew;
this.e = eNew;
return this;
};
matrixproto.invert = function () {
var me = this, x = me.a * me.d - me.b * me.c;
return new Matrix(me.d / x, -me.b / x, -me.c / x, me.a / x, (me.c * me.f - me.d * me.e) / x, (me.b * me.e - me.a * me.f) / x);
};
matrixproto.clone = function () {
return new Matrix(this.a, this.b, this.c, this.d, this.e, this.f);
};
matrixproto.translate = function (x, y) {
this.e += x * this.a + y * this.c;
this.f += x * this.b + y * this.d;
return this;
};
matrixproto.scale = function (x, y, cx, cy) {
y == null && (y = x);
(cx || cy) && this.translate(cx, cy);
this.a *= x;
this.b *= x;
this.c *= y;
this.d *= y;
(cx || cy) && this.translate(-cx, -cy);
return this;
};
matrixproto.rotate = function (a, x, y) {
a = Snap.rad(a);
x = x || 0;
y = y || 0;
var cos = +math.cos(a).toFixed(9), sin = +math.sin(a).toFixed(9);
this.add(cos, sin, -sin, cos, x, y);
return this.add(1, 0, 0, 1, -x, -y);
};
matrixproto.skewX = function (x) {
return this.skew(x, 0);
};
matrixproto.skewY = function (y) {
return this.skew(0, y);
};
matrixproto.skew = function (x, y) {
x = x || 0;
y = y || 0;
x = Snap.rad(x);
y = Snap.rad(y);
var c = math.tan(x).toFixed(9);
var b = math.tan(y).toFixed(9);
return this.add(1, b, c, 1, 0, 0);
};
matrixproto.x = function (x, y) {
return x * this.a + y * this.c + this.e;
};
matrixproto.y = function (x, y) {
return x * this.b + y * this.d + this.f;
};
matrixproto.get = function (i) {
return +this[Str.fromCharCode(97 + i)].toFixed(4);
};
matrixproto.toString = function () {
return "matrix(" + [this.get(0), this.get(1), this.get(2), this.get(3), this.get(4), this.get(5)].join() + ")";
};
matrixproto.offset = function () {
return [this.e.toFixed(4), this.f.toFixed(4)];
};
function norm(a) {
return a[0] * a[0] + a[1] * a[1];
}
function normalize(a) {
var mag = math.sqrt(norm(a));
a[0] && (a[0] /= mag);
a[1] && (a[1] /= mag);
}
matrixproto.determinant = function () {
return this.a * this.d - this.b * this.c;
};
matrixproto.split = function () {
var out = {};
out.dx = this.e;
out.dy = this.f;
var row = [[this.a, this.b], [this.c, this.d]];
out.scalex = math.sqrt(norm(row[0]));
normalize(row[0]);
out.shear = row[0][0] * row[1][0] + row[0][1] * row[1][1];
row[1] = [row[1][0] - row[0][0] * out.shear, row[1][1] - row[0][1] * out.shear];
out.scaley = math.sqrt(norm(row[1]));
normalize(row[1]);
out.shear /= out.scaley;
if (this.determinant() < 0) {
out.scalex = -out.scalex;
}
var sin = row[0][1], cos = row[1][1];
if (cos < 0) {
out.rotate = Snap.deg(math.acos(cos));
if (sin < 0) {
out.rotate = 360 - out.rotate;
}
}
else {
out.rotate = Snap.deg(math.asin(sin));
}
out.isSimple = !+out.shear.toFixed(9) && (out.scalex.toFixed(9) == out.scaley.toFixed(9) || !out.rotate);
out.isSuperSimple = !+out.shear.toFixed(9) && out.scalex.toFixed(9) == out.scaley.toFixed(9) && !out.rotate;
out.noRotation = !+out.shear.toFixed(9) && !out.rotate;
return out;
};
matrixproto.toTransformString = function (shorter) {
var s = shorter || this.split();
if (!+s.shear.toFixed(9)) {
s.scalex = +s.scalex.toFixed(4);
s.scaley = +s.scaley.toFixed(4);
s.rotate = +s.rotate.toFixed(4);
return (s.dx || s.dy ? "t" + [+s.dx.toFixed(4), +s.dy.toFixed(4)] : E) +
(s.rotate ? "r" + [+s.rotate.toFixed(4), 0, 0] : E) +
(s.scalex != 1 || s.scaley != 1 ? "s" + [s.scalex, s.scaley, 0, 0] : E);
}
else {
return "m" + [this.get(0), this.get(1), this.get(2), this.get(3), this.get(4), this.get(5)];
}
};
})(Matrix.prototype);
Snap.Matrix = Matrix;
Snap.matrix = function (a, b, c, d, e, f) {
return new Matrix(a, b, c, d, e, f);
};
}); Snap.plugin(function (Snap, Element, Paper, glob, Fragment) {
var has = "hasOwnProperty", make = Snap._.make, wrap = Snap._.wrap, is = Snap.is, getSomeDefs = Snap._.getSomeDefs, reURLValue = /^url\((['"]?)([^)]+)\1\)$/, $ = Snap._.$, URL = Snap.url, Str = String, separator = Snap._.separator, E = "";
Snap.deurl = function (value) {
var res = String(value).match(reURLValue);
return res ? res[2] : value;
};
eve.on("snap.util.attr.mask", function (value) {
if (value instanceof Element || value instanceof Fragment) {
eve.stop();
if (value instanceof Fragment && value.node.childNodes.length == 1) {
value = value.node.firstChild;
getSomeDefs(this).appendChild(value);
value = wrap(value);
}
if (value.type == "mask") {
var mask = value;
}
else {
mask = make("mask", getSomeDefs(this));
mask.node.appendChild(value.node);
}
!mask.node.id && $(mask.node, {
id: mask.id
});
$(this.node, {
mask: URL(mask.id)
});
}
});
(function (clipIt) {
eve.on("snap.util.attr.clip", clipIt);
eve.on("snap.util.attr.clip-path", clipIt);
eve.on("snap.util.attr.clipPath", clipIt);
}(function (value) {
if (value instanceof Element || value instanceof Fragment) {
eve.stop();
var clip, node = value.node;
while (node) {
if (node.nodeName === "clipPath") {
clip = new Element(node);
break;
}
if (node.nodeName === "svg") {
clip = undefined;
break;
}
node = node.parentNode;
}
if (!clip) {
clip = make("clipPath", getSomeDefs(this));
clip.node.appendChild(value.node);
!clip.node.id && $(clip.node, {
id: clip.id
});
}
$(this.node, {
"clip-path": URL(clip.node.id || clip.id)
});
}
}));
function fillStroke(name) {
return function (value) {
eve.stop();
if (value instanceof Fragment && value.node.childNodes.length == 1 &&
(value.node.firstChild.tagName == "radialGradient" ||
value.node.firstChild.tagName == "linearGradient" ||
value.node.firstChild.tagName == "pattern")) {
value = value.node.firstChild;
getSomeDefs(this).appendChild(value);
value = wrap(value);
}
if (value instanceof Element) {
if (value.type == "radialGradient" || value.type == "linearGradient"
|| value.type == "pattern") {
if (!value.node.id) {
$(value.node, {
id: value.id
});
}
var fill = URL(value.node.id);
}
else {
fill = value.attr(name);
}
}
else {
fill = Snap.color(value);
if (fill.error) {
var grad = Snap(getSomeDefs(this).ownerSVGElement).gradient(value);
if (grad) {
if (!grad.node.id) {
$(grad.node, {
id: grad.id
});
}
fill = URL(grad.node.id);
}
else {
fill = value;
}
}
else {
fill = Str(fill);
}
}
var attrs = {};
attrs[name] = fill;
$(this.node, attrs);
this.node.style[name] = E;
};
}
eve.on("snap.util.attr.fill", fillStroke("fill"));
eve.on("snap.util.attr.stroke", fillStroke("stroke"));
var gradrg = /^([lr])(?:\(([^)]*)\))?(.*)$/i;
eve.on("snap.util.grad.parse", function parseGrad(string) {
string = Str(string);
var tokens = string.match(gradrg);
if (!tokens) {
return null;
}
var type = tokens[1], params = tokens[2], stops = tokens[3];
params = params.split(/\s*,\s*/).map(function (el) {
return +el == el ? +el : el;
});
if (params.length == 1 && params[0] == 0) {
params = [];
}
stops = stops.split("-");
stops = stops.map(function (el) {
el = el.split(":");
var out = {
color: el[0]
};
if (el[1]) {
out.offset = parseFloat(el[1]);
}
return out;
});
var len = stops.length, start = 0, j = 0;
function seed(i, end) {
var step = (end - start) / (i - j);
for (var k = j; k < i; k++) {
stops[k].offset = +(+start + step * (k - j)).toFixed(2);
}
j = i;
start = end;
}
len--;
for (var i = 0; i < len; i++)
if ("offset" in stops[i]) {
seed(i, stops[i].offset);
}
stops[len].offset = stops[len].offset || 100;
seed(len, stops[len].offset);
return {
type: type,
params: params,
stops: stops
};
});
eve.on("snap.util.attr.d", function (value) {
eve.stop();
if (is(value, "array") && is(value[0], "array")) {
value = Snap.path.toString.call(value);
}
value = Str(value);
if (value.match(/[ruo]/i)) {
value = Snap.path.toAbsolute(value);
}
$(this.node, { d: value });
})(-1);
eve.on("snap.util.attr.#text", function (value) {
eve.stop();
value = Str(value);
var txt = glob.doc.createTextNode(value);
while (this.node.firstChild) {
this.node.removeChild(this.node.firstChild);
}
this.node.appendChild(txt);
})(-1);
eve.on("snap.util.attr.path", function (value) {
eve.stop();
this.attr({ d: value });
})(-1);
eve.on("snap.util.attr.class", function (value) {
eve.stop();
this.node.className.baseVal = value;
})(-1);
eve.on("snap.util.attr.viewBox", function (value) {
var vb;
if (is(value, "object") && "x" in value) {
vb = [value.x, value.y, value.width, value.height].join(" ");
}
else if (is(value, "array")) {
vb = value.join(" ");
}
else {
vb = value;
}
$(this.node, {
viewBox: vb
});
eve.stop();
})(-1);
eve.on("snap.util.attr.transform", function (value) {
this.transform(value);
eve.stop();
})(-1);
eve.on("snap.util.attr.r", function (value) {
if (this.type == "rect") {
eve.stop();
$(this.node, {
rx: value,
ry: value
});
}
})(-1);
eve.on("snap.util.attr.textpath", function (value) {
eve.stop();
if (this.type == "text") {
var id, tp, node;
if (!value && this.textPath) {
tp = this.textPath;
while (tp.node.firstChild) {
this.node.appendChild(tp.node.firstChild);
}
tp.remove();
delete this.textPath;
return;
}
if (is(value, "string")) {
var defs = getSomeDefs(this), path = wrap(defs.parentNode).path(value);
defs.appendChild(path.node);
id = path.id;
path.attr({ id: id });
}
else {
value = wrap(value);
if (value instanceof Element) {
id = value.attr("id");
if (!id) {
id = value.id;
value.attr({ id: id });
}
}
}
if (id) {
tp = this.textPath;
node = this.node;
if (tp) {
tp.attr({ "xlink:href": "#" + id });
}
else {
tp = $("textPath", {
"xlink:href": "#" + id
});
while (node.firstChild) {
tp.appendChild(node.firstChild);
}
node.appendChild(tp);
this.textPath = wrap(tp);
}
}
}
})(-1);
eve.on("snap.util.attr.text", function (value) {
if (this.type == "text") {
var i = 0, node = this.node, tuner = function (chunk) {
var out = $("tspan");
if (is(chunk, "array")) {
for (var i = 0; i < chunk.length; i++) {
out.appendChild(tuner(chunk[i]));
}
}
else {
out.appendChild(glob.doc.createTextNode(chunk));
}
out.normalize && out.normalize();
return out;
};
while (node.firstChild) {
node.removeChild(node.firstChild);
}
var tuned = tuner(value);
while (tuned.firstChild) {
node.appendChild(tuned.firstChild);
}
}
eve.stop();
})(-1);
function setFontSize(value) {
eve.stop();
if (value == +value) {
value += "px";
}
this.node.style.fontSize = value;
}
eve.on("snap.util.attr.fontSize", setFontSize)(-1);
eve.on("snap.util.attr.font-size", setFontSize)(-1);
eve.on("snap.util.getattr.transform", function () {
eve.stop();
return this.transform();
})(-1);
eve.on("snap.util.getattr.textpath", function () {
eve.stop();
return this.textPath;
})(-1);
(function () {
function getter(end) {
return function () {
eve.stop();
var style = glob.doc.defaultView.getComputedStyle(this.node, null).getPropertyValue("marker-" + end);
if (style == "none") {
return style;
}
else {
return Snap(glob.doc.getElementById(style.match(reURLValue)[1]));
}
};
}
function setter(end) {
return function (value) {
eve.stop();
var name = "marker" + end.charAt(0).toUpperCase() + end.substring(1);
if (value == "" || !value) {
this.node.style[name] = "none";
return;
}
if (value.type == "marker") {
var id = value.node.id;
if (!id) {
$(value.node, { id: value.id });
}
this.node.style[name] = URL(id);
return;
}
};
}
eve.on("snap.util.getattr.marker-end", getter("end"))(-1);
eve.on("snap.util.getattr.markerEnd", getter("end"))(-1);
eve.on("snap.util.getattr.marker-start", getter("start"))(-1);
eve.on("snap.util.getattr.markerStart", getter("start"))(-1);
eve.on("snap.util.getattr.marker-mid", getter("mid"))(-1);
eve.on("snap.util.getattr.markerMid", getter("mid"))(-1);
eve.on("snap.util.attr.marker-end", setter("end"))(-1);
eve.on("snap.util.attr.markerEnd", setter("end"))(-1);
eve.on("snap.util.attr.marker-start", setter("start"))(-1);
eve.on("snap.util.attr.markerStart", setter("start"))(-1);
eve.on("snap.util.attr.marker-mid", setter("mid"))(-1);
eve.on("snap.util.attr.markerMid", setter("mid"))(-1);
}());
eve.on("snap.util.getattr.r", function () {
if (this.type == "rect" && $(this.node, "rx") == $(this.node, "ry")) {
eve.stop();
return $(this.node, "rx");
}
})(-1);
function textExtract(node) {
var out = [];
var children = node.childNodes;
for (var i = 0, ii = children.length; i < ii; i++) {
var chi = children[i];
if (chi.nodeType == 3) {
out.push(chi.nodeValue);
}
if (chi.tagName == "tspan") {
if (chi.childNodes.length == 1 && chi.firstChild.nodeType == 3) {
out.push(chi.firstChild.nodeValue);
}
else {
out.push(textExtract(chi));
}
}
}
return out;
}
eve.on("snap.util.getattr.text", function () {
if (this.type == "text" || this.type == "tspan") {
eve.stop();
var out = textExtract(this.node);
return out.length == 1 ? out[0] : out;
}
})(-1);
eve.on("snap.util.getattr.#text", function () {
return this.node.textContent;
})(-1);
eve.on("snap.util.getattr.fill", function (internal) {
if (internal) {
return;
}
eve.stop();
var value = eve("snap.util.getattr.fill", this, true).firstDefined();
return Snap(Snap.deurl(value)) || value;
})(-1);
eve.on("snap.util.getattr.stroke", function (internal) {
if (internal) {
return;
}
eve.stop();
var value = eve("snap.util.getattr.stroke", this, true).firstDefined();
return Snap(Snap.deurl(value)) || value;
})(-1);
eve.on("snap.util.getattr.viewBox", function () {
eve.stop();
var vb = $(this.node, "viewBox");
if (vb) {
vb = vb.split(separator);
return Snap._.box(+vb[0], +vb[1], +vb[2], +vb[3]);
}
else {
return;
}
})(-1);
eve.on("snap.util.getattr.points", function () {
var p = $(this.node, "points");
eve.stop();
if (p) {
return p.split(separator);
}
else {
return;
}
})(-1);
eve.on("snap.util.getattr.path", function () {
var p = $(this.node, "d");
eve.stop();
return p;
})(-1);
eve.on("snap.util.getattr.class", function () {
return this.node.className.baseVal;
})(-1);
function getFontSize() {
eve.stop();
return this.node.style.fontSize;
}
eve.on("snap.util.getattr.fontSize", getFontSize)(-1);
eve.on("snap.util.getattr.font-size", getFontSize)(-1);
}); Snap.plugin(function (Snap, Element, Paper, glob, Fragment) {
var rgNotSpace = /\S+/g, rgBadSpace = /[\t\r\n\f]/g, rgTrim = /(^\s+|\s+$)/g, Str = String, elproto = Element.prototype;
elproto.addClass = function (value) {
var classes = Str(value || "").match(rgNotSpace) || [], elem = this.node, className = elem.className.baseVal, curClasses = className.match(rgNotSpace) || [], j, pos, clazz, finalValue;
if (classes.length) {
j = 0;
while (clazz = classes[j++]) {
pos = curClasses.indexOf(clazz);
if (!~pos) {
curClasses.push(clazz);
}
}
finalValue = curClasses.join(" ");
if (className != finalValue) {
elem.className.baseVal = finalValue;
}
}
return this;
};
elproto.removeClass = function (value) {
var classes = Str(value || "").match(rgNotSpace) || [], elem = this.node, className = elem.className.baseVal, curClasses = className.match(rgNotSpace) || [], j, pos, clazz, finalValue;
if (curClasses.length) {
j = 0;
while (clazz = classes[j++]) {
pos = curClasses.indexOf(clazz);
if (~pos) {
curClasses.splice(pos, 1);
}
}
finalValue = curClasses.join(" ");
if (className != finalValue) {
elem.className.baseVal = finalValue;
}
}
return this;
};
elproto.hasClass = function (value) {
var elem = this.node, className = elem.className.baseVal, curClasses = className.match(rgNotSpace) || [];
return !!~curClasses.indexOf(value);
};
elproto.toggleClass = function (value, flag) {
if (flag != null) {
if (flag) {
return this.addClass(value);
}
else {
return this.removeClass(value);
}
}
var classes = (value || "").match(rgNotSpace) || [], elem = this.node, className = elem.className.baseVal, curClasses = className.match(rgNotSpace) || [], j, pos, clazz, finalValue;
j = 0;
while (clazz = classes[j++]) {
pos = curClasses.indexOf(clazz);
if (~pos) {
curClasses.splice(pos, 1);
}
else {
curClasses.push(clazz);
}
}
finalValue = curClasses.join(" ");
if (className != finalValue) {
elem.className.baseVal = finalValue;
}
return this;
};
}); Snap.plugin(function (Snap, Element, Paper, glob, Fragment) {
var operators = {
"+": function (x, y) {
return x + y;
},
"-": function (x, y) {
return x - y;
},
"/": function (x, y) {
return x / y;
},
"*": function (x, y) {
return x * y;
}
}, Str = String, reUnit = /[a-z]+$/i, reAddon = /^\s*([+\-\/*])\s*=\s*([\d.eE+\-]+)\s*([^\d\s]+)?\s*$/;
function getNumber(val) {
return val;
}
function getUnit(unit) {
return function (val) {
return +val.toFixed(3) + unit;
};
}
eve.on("snap.util.attr", function (val) {
var plus = Str(val).match(reAddon);
if (plus) {
var evnt = eve.nt(), name = evnt.substring(evnt.lastIndexOf(".") + 1), a = this.attr(name), atr = {};
eve.stop();
var unit = plus[3] || "", aUnit = a.match(reUnit), op = operators[plus[1]];
if (aUnit && aUnit == unit) {
val = op(parseFloat(a), +plus[2]);
}
else {
a = this.asPX(name);
val = op(this.asPX(name), this.asPX(name, plus[2] + unit));
}
if (isNaN(a) || isNaN(val)) {
return;
}
atr[name] = val;
this.attr(atr);
}
})(-10);
eve.on("snap.util.equal", function (name, b) {
var A, B, a = Str(this.attr(name) || ""), el = this, bplus = Str(b).match(reAddon);
if (bplus) {
eve.stop();
var unit = bplus[3] || "", aUnit = a.match(reUnit), op = operators[bplus[1]];
if (aUnit && aUnit == unit) {
return {
from: parseFloat(a),
to: op(parseFloat(a), +bplus[2]),
f: getUnit(aUnit)
};
}
else {
a = this.asPX(name);
return {
from: a,
to: op(a, this.asPX(name, bplus[2] + unit)),
f: getNumber
};
}
}
})(-10);
}); Snap.plugin(function (Snap, Element, Paper, glob, Fragment) {
var proto = Paper.prototype, is = Snap.is;
proto.rect = function (x, y, w, h, rx, ry) {
var attr;
if (ry == null) {
ry = rx;
}
if (is(x, "object") && x == "[object Object]") {
attr = x;
}
else if (x != null) {
attr = {
x: x,
y: y,
width: w,
height: h
};
if (rx != null) {
attr.rx = rx;
attr.ry = ry;
}
}
return this.el("rect", attr);
};
proto.circle = function (cx, cy, r) {
var attr;
if (is(cx, "object") && cx == "[object Object]") {
attr = cx;
}
else if (cx != null) {
attr = {
cx: cx,
cy: cy,
r: r
};
}
return this.el("circle", attr);
};
var preload = (function () {
function onerror() {
this.parentNode.removeChild(this);
}
return function (src, f) {
var img = glob.doc.createElement("img"), body = glob.doc.body;
img.style.cssText = "position:absolute;left:-9999em;top:-9999em";
img.onload = function () {
f.call(img);
img.onload = img.onerror = null;
body.removeChild(img);
};
img.onerror = onerror;
body.appendChild(img);
img.src = src;
};
}());
proto.image = function (src, x, y, width, height) {
var el = this.el("image");
if (is(src, "object") && "src" in src) {
el.attr(src);
}
else if (src != null) {
var set = {
"xlink:href": src,
preserveAspectRatio: "none"
};
if (x != null && y != null) {
set.x = x;
set.y = y;
}
if (width != null && height != null) {
set.width = width;
set.height = height;
}
else {
preload(src, function () {
Snap._.$(el.node, {
width: this.offsetWidth,
height: this.offsetHeight
});
});
}
Snap._.$(el.node, set);
}
return el;
};
proto.ellipse = function (cx, cy, rx, ry) {
var attr;
if (is(cx, "object") && cx == "[object Object]") {
attr = cx;
}
else if (cx != null) {
attr = {
cx: cx,
cy: cy,
rx: rx,
ry: ry
};
}
return this.el("ellipse", attr);
};
proto.path = function (d) {
var attr;
if (is(d, "object") && !is(d, "array")) {
attr = d;
}
else if (d) {
attr = { d: d };
}
return this.el("path", attr);
};
proto.group = proto.g = function (first) {
var attr, el = this.el("g");
if (arguments.length == 1 && first && !first.type) {
el.attr(first);
}
else if (arguments.length) {
el.add(Array.prototype.slice.call(arguments, 0));
}
return el;
};
proto.svg = function (x, y, width, height, vbx, vby, vbw, vbh) {
var attrs = {};
if (is(x, "object") && y == null) {
attrs = x;
}
else {
if (x != null) {
attrs.x = x;
}
if (y != null) {
attrs.y = y;
}
if (width != null) {
attrs.width = width;
}
if (height != null) {
attrs.height = height;
}
if (vbx != null && vby != null && vbw != null && vbh != null) {
attrs.viewBox = [vbx, vby, vbw, vbh];
}
}
return this.el("svg", attrs);
};
proto.mask = function (first) {
var attr, el = this.el("mask");
if (arguments.length == 1 && first && !first.type) {
el.attr(first);
}
else if (arguments.length) {
el.add(Array.prototype.slice.call(arguments, 0));
}
return el;
};
proto.ptrn = function (x, y, width, height, vx, vy, vw, vh) {
if (is(x, "object")) {
var attr = x;
}
else {
attr = { patternUnits: "userSpaceOnUse" };
if (x) {
attr.x = x;
}
if (y) {
attr.y = y;
}
if (width != null) {
attr.width = width;
}
if (height != null) {
attr.height = height;
}
if (vx != null && vy != null && vw != null && vh != null) {
attr.viewBox = [vx, vy, vw, vh];
}
else {
attr.viewBox = [x || 0, y || 0, width || 0, height || 0];
}
}
return this.el("pattern", attr);
};
proto.use = function (id) {
if (id != null) {
if (id instanceof Element) {
if (!id.attr("id")) {
id.attr({ id: Snap._.id(id) });
}
id = id.attr("id");
}
if (String(id).charAt() == "#") {
id = id.substring(1);
}
return this.el("use", { "xlink:href": "#" + id });
}
else {
return Element.prototype.use.call(this);
}
};
proto.symbol = function (vx, vy, vw, vh) {
var attr = {};
if (vx != null && vy != null && vw != null && vh != null) {
attr.viewBox = [vx, vy, vw, vh];
}
return this.el("symbol", attr);
};
proto.text = function (x, y, text) {
var attr = {};
if (is(x, "object")) {
attr = x;
}
else if (x != null) {
attr = {
x: x,
y: y,
text: text || ""
};
}
return this.el("text", attr);
};
proto.line = function (x1, y1, x2, y2) {
var attr = {};
if (is(x1, "object")) {
attr = x1;
}
else if (x1 != null) {
attr = {
x1: x1,
x2: x2,
y1: y1,
y2: y2
};
}
return this.el("line", attr);
};
proto.polyline = function (points) {
if (arguments.length > 1) {
points = Array.prototype.slice.call(arguments, 0);
}
var attr = {};
if (is(points, "object") && !is(points, "array")) {
attr = points;
}
else if (points != null) {
attr = { points: points };
}
return this.el("polyline", attr);
};
proto.polygon = function (points) {
if (arguments.length > 1) {
points = Array.prototype.slice.call(arguments, 0);
}
var attr = {};
if (is(points, "object") && !is(points, "array")) {
attr = points;
}
else if (points != null) {
attr = { points: points };
}
return this.el("polygon", attr);
};
(function () {
var $ = Snap._.$;
function Gstops() {
return this.selectAll("stop");
}
function GaddStop(color, offset) {
var stop = $("stop"), attr = {
offset: +offset + "%"
};
color = Snap.color(color);
attr["stop-color"] = color.hex;
if (color.opacity < 1) {
attr["stop-opacity"] = color.opacity;
}
$(stop, attr);
var stops = this.stops(), inserted;
for (var i = 0; i < stops.length; i++) {
var stopOffset = parseFloat(stops[i].attr("offset"));
if (stopOffset > offset) {
this.node.insertBefore(stop, stops[i].node);
inserted = true;
break;
}
}
if (!inserted) {
this.node.appendChild(stop);
}
return this;
}
function GgetBBox() {
if (this.type == "linearGradient") {
var x1 = $(this.node, "x1") || 0, x2 = $(this.node, "x2") || 1, y1 = $(this.node, "y1") || 0, y2 = $(this.node, "y2") || 0;
return Snap._.box(x1, y1, math.abs(x2 - x1), math.abs(y2 - y1));
}
else {
var cx = this.node.cx || .5, cy = this.node.cy || .5, r = this.node.r || 0;
return Snap._.box(cx - r, cy - r, r * 2, r * 2);
}
}
function GsetStops(str) {
var grad = str, stops = this.stops();
if (typeof str == "string") {
grad = eve("snap.util.grad.parse", null, "l(0,0,0,1)" + str).firstDefined().stops;
}
if (!Snap.is(grad, "array")) {
return;
}
for (var i = 0; i < stops.length; i++) {
if (grad[i]) {
var color = Snap.color(grad[i].color), attr = { "offset": grad[i].offset + "%" };
attr["stop-color"] = color.hex;
if (color.opacity < 1) {
attr["stop-opacity"] = color.opacity;
}
stops[i].attr(attr);
}
else {
stops[i].remove();
}
}
for (i = stops.length; i < grad.length; i++) {
this.addStop(grad[i].color, grad[i].offset);
}
return this;
}
function gradient(defs, str) {
var grad = eve("snap.util.grad.parse", null, str).firstDefined(), el;
if (!grad) {
return null;
}
grad.params.unshift(defs);
if (grad.type.toLowerCase() == "l") {
el = gradientLinear.apply(0, grad.params);
}
else {
el = gradientRadial.apply(0, grad.params);
}
if (grad.type != grad.type.toLowerCase()) {
$(el.node, {
gradientUnits: "userSpaceOnUse"
});
}
var stops = grad.stops, len = stops.length;
for (var i = 0; i < len; i++) {
var stop = stops[i];
el.addStop(stop.color, stop.offset);
}
return el;
}
function gradientLinear(defs, x1, y1, x2, y2) {
var el = Snap._.make("linearGradient", defs);
el.stops = Gstops;
el.addStop = GaddStop;
el.getBBox = GgetBBox;
el.setStops = GsetStops;
if (x1 != null) {
$(el.node, {
x1: x1,
y1: y1,
x2: x2,
y2: y2
});
}
return el;
}
function gradientRadial(defs, cx, cy, r, fx, fy) {
var el = Snap._.make("radialGradient", defs);
el.stops = Gstops;
el.addStop = GaddStop;
el.getBBox = GgetBBox;
if (cx != null) {
$(el.node, {
cx: cx,
cy: cy,
r: r
});
}
if (fx != null && fy != null) {
$(el.node, {
fx: fx,
fy: fy
});
}
return el;
}
proto.gradient = function (str) {
return gradient(this.defs, str);
};
proto.gradientLinear = function (x1, y1, x2, y2) {
return gradientLinear(this.defs, x1, y1, x2, y2);
};
proto.gradientRadial = function (cx, cy, r, fx, fy) {
return gradientRadial(this.defs, cx, cy, r, fx, fy);
};
proto.toString = function () {
var doc = this.node.ownerDocument, f = doc.createDocumentFragment(), d = doc.createElement("div"), svg = this.node.cloneNode(true), res;
f.appendChild(d);
d.appendChild(svg);
Snap._.$(svg, { xmlns: "http://www.w3.org/2000/svg" });
res = d.innerHTML;
f.removeChild(f.firstChild);
return res;
};
proto.toDataURL = function () {
if (window && window.btoa) {
return "data:image/svg+xml;base64," + btoa(unescape(encodeURIComponent(this)));
}
};
proto.clear = function () {
var node = this.node.firstChild, next;
while (node) {
next = node.nextSibling;
if (node.tagName != "defs") {
node.parentNode.removeChild(node);
}
else {
proto.clear.call({ node: node });
}
node = next;
}
};
}());
}); Snap.plugin(function (Snap, Element, Paper, glob) {
var elproto = Element.prototype, is = Snap.is, clone = Snap._.clone, has = "hasOwnProperty", p2s = /,?([a-z]),?/gi, toFloat = parseFloat, math = Math, PI = math.PI, mmin = math.min, mmax = math.max, pow = math.pow, abs = math.abs;
function paths(ps) {
var p = paths.ps = paths.ps || {};
if (p[ps]) {
p[ps].sleep = 100;
}
else {
p[ps] = {
sleep: 100
};
}
setTimeout(function () {
for (var key in p)
if (p[has](key) && key != ps) {
p[key].sleep--;
!p[key].sleep && delete p[key];
}
});
return p[ps];
}
function box(x, y, width, height) {
if (x == null) {
x = y = width = height = 0;
}
if (y == null) {
y = x.y;
width = x.width;
height = x.height;
x = x.x;
}
return {
x: x,
y: y,
width: width,
w: width,
height: height,
h: height,
x2: x + width,
y2: y + height,
cx: x + width / 2,
cy: y + height / 2,
r1: math.min(width, height) / 2,
r2: math.max(width, height) / 2,
r0: math.sqrt(width * width + height * height) / 2,
path: rectPath(x, y, width, height),
vb: [x, y, width, height].join(" ")
};
}
function toString() {
return this.join(",").replace(p2s, "$1");
}
function pathClone(pathArray) {
var res = clone(pathArray);
res.toString = toString;
return res;
}
function getPointAtSegmentLength(p1x, p1y, c1x, c1y, c2x, c2y, p2x, p2y, length) {
if (length == null) {
return bezlen(p1x, p1y, c1x, c1y, c2x, c2y, p2x, p2y);
}
else {
return findDotsAtSegment(p1x, p1y, c1x, c1y, c2x, c2y, p2x, p2y, getTotLen(p1x, p1y, c1x, c1y, c2x, c2y, p2x, p2y, length));
}
}
function getLengthFactory(istotal, subpath) {
function O(val) {
return +(+val).toFixed(3);
}
return Snap._.cacher(function (path, length, onlystart) {
if (path instanceof Element) {
path = path.attr("d");
}
path = path2curve(path);
var x, y, p, l, sp = "", subpaths = {}, point, len = 0;
for (var i = 0, ii = path.length; i < ii; i++) {
p = path[i];
if (p[0] == "M") {
x = +p[1];
y = +p[2];
}
else {
l = getPointAtSegmentLength(x, y, p[1], p[2], p[3], p[4], p[5], p[6]);
if (len + l > length) {
if (subpath && !subpaths.start) {
point = getPointAtSegmentLength(x, y, p[1], p[2], p[3], p[4], p[5], p[6], length - len);
sp += [
"C" + O(point.start.x),
O(point.start.y),
O(point.m.x),
O(point.m.y),
O(point.x),
O(point.y)
];
if (onlystart) {
return sp;
}
subpaths.start = sp;
sp = [
"M" + O(point.x),
O(point.y) + "C" + O(point.n.x),
O(point.n.y),
O(point.end.x),
O(point.end.y),
O(p[5]),
O(p[6])
].join();
len += l;
x = +p[5];
y = +p[6];
continue;
}
if (!istotal && !subpath) {
point = getPointAtSegmentLength(x, y, p[1], p[2], p[3], p[4], p[5], p[6], length - len);
return point;
}
}
len += l;
x = +p[5];
y = +p[6];
}
sp += p.shift() + p;
}
subpaths.end = sp;
point = istotal ? len : subpath ? subpaths : findDotsAtSegment(x, y, p[0], p[1], p[2], p[3], p[4], p[5], 1);
return point;
}, null, Snap._.clone);
}
var getTotalLength = getLengthFactory(1), getPointAtLength = getLengthFactory(), getSubpathsAtLength = getLengthFactory(0, 1);
function findDotsAtSegment(p1x, p1y, c1x, c1y, c2x, c2y, p2x, p2y, t) {
var t1 = 1 - t, t13 = pow(t1, 3), t12 = pow(t1, 2), t2 = t * t, t3 = t2 * t, x = t13 * p1x + t12 * 3 * t * c1x + t1 * 3 * t * t * c2x + t3 * p2x, y = t13 * p1y + t12 * 3 * t * c1y + t1 * 3 * t * t * c2y + t3 * p2y, mx = p1x + 2 * t * (c1x - p1x) + t2 * (c2x - 2 * c1x + p1x), my = p1y + 2 * t * (c1y - p1y) + t2 * (c2y - 2 * c1y + p1y), nx = c1x + 2 * t * (c2x - c1x) + t2 * (p2x - 2 * c2x + c1x), ny = c1y + 2 * t * (c2y - c1y) + t2 * (p2y - 2 * c2y + c1y), ax = t1 * p1x + t * c1x, ay = t1 * p1y + t * c1y, cx = t1 * c2x + t * p2x, cy = t1 * c2y + t * p2y, alpha = 90 - math.atan2(mx - nx, my - ny) * 180 / PI;
return {
x: x,
y: y,
m: { x: mx, y: my },
n: { x: nx, y: ny },
start: { x: ax, y: ay },
end: { x: cx, y: cy },
alpha: alpha
};
}
function bezierBBox(p1x, p1y, c1x, c1y, c2x, c2y, p2x, p2y) {
if (!Snap.is(p1x, "array")) {
p1x = [p1x, p1y, c1x, c1y, c2x, c2y, p2x, p2y];
}
var bbox = curveDim.apply(null, p1x);
return box(bbox.min.x, bbox.min.y, bbox.max.x - bbox.min.x, bbox.max.y - bbox.min.y);
}
function isPointInsideBBox(bbox, x, y) {
return x >= bbox.x &&
x <= bbox.x + bbox.width &&
y >= bbox.y &&
y <= bbox.y + bbox.height;
}
function isBBoxIntersect(bbox1, bbox2) {
bbox1 = box(bbox1);
bbox2 = box(bbox2);
return isPointInsideBBox(bbox2, bbox1.x, bbox1.y)
|| isPointInsideBBox(bbox2, bbox1.x2, bbox1.y)
|| isPointInsideBBox(bbox2, bbox1.x, bbox1.y2)
|| isPointInsideBBox(bbox2, bbox1.x2, bbox1.y2)
|| isPointInsideBBox(bbox1, bbox2.x, bbox2.y)
|| isPointInsideBBox(bbox1, bbox2.x2, bbox2.y)
|| isPointInsideBBox(bbox1, bbox2.x, bbox2.y2)
|| isPointInsideBBox(bbox1, bbox2.x2, bbox2.y2)
|| (bbox1.x < bbox2.x2 && bbox1.x > bbox2.x
|| bbox2.x < bbox1.x2 && bbox2.x > bbox1.x)
&& (bbox1.y < bbox2.y2 && bbox1.y > bbox2.y
|| bbox2.y < bbox1.y2 && bbox2.y > bbox1.y);
}
function base3(t, p1, p2, p3, p4) {
var t1 = -3 * p1 + 9 * p2 - 9 * p3 + 3 * p4, t2 = t * t1 + 6 * p1 - 12 * p2 + 6 * p3;
return t * t2 - 3 * p1 + 3 * p2;
}
function bezlen(x1, y1, x2, y2, x3, y3, x4, y4, z) {
if (z == null) {
z = 1;
}
z = z > 1 ? 1 : z < 0 ? 0 : z;
var z2 = z / 2, n = 12, Tvalues = [-.1252, .1252, -.3678, .3678, -.5873, .5873, -.7699, .7699, -.9041, .9041, -.9816, .9816], Cvalues = [0.2491, 0.2491, 0.2335, 0.2335, 0.2032, 0.2032, 0.1601, 0.1601, 0.1069, 0.1069, 0.0472, 0.0472], sum = 0;
for (var i = 0; i < n; i++) {
var ct = z2 * Tvalues[i] + z2, xbase = base3(ct, x1, x2, x3, x4), ybase = base3(ct, y1, y2, y3, y4), comb = xbase * xbase + ybase * ybase;
sum += Cvalues[i] * math.sqrt(comb);
}
return z2 * sum;
}
function getTotLen(x1, y1, x2, y2, x3, y3, x4, y4, ll) {
if (ll < 0 || bezlen(x1, y1, x2, y2, x3, y3, x4, y4) < ll) {
return;
}
var t = 1, step = t / 2, t2 = t - step, l, e = .01;
l = bezlen(x1, y1, x2, y2, x3, y3, x4, y4, t2);
while (abs(l - ll) > e) {
step /= 2;
t2 += (l < ll ? 1 : -1) * step;
l = bezlen(x1, y1, x2, y2, x3, y3, x4, y4, t2);
}
return t2;
}
function intersect(x1, y1, x2, y2, x3, y3, x4, y4) {
if (mmax(x1, x2) < mmin(x3, x4) ||
mmin(x1, x2) > mmax(x3, x4) ||
mmax(y1, y2) < mmin(y3, y4) ||
mmin(y1, y2) > mmax(y3, y4)) {
return;
}
var nx = (x1 * y2 - y1 * x2) * (x3 - x4) - (x1 - x2) * (x3 * y4 - y3 * x4), ny = (x1 * y2 - y1 * x2) * (y3 - y4) - (y1 - y2) * (x3 * y4 - y3 * x4), denominator = (x1 - x2) * (y3 - y4) - (y1 - y2) * (x3 - x4);
if (!denominator) {
return;
}
var px = nx / denominator, py = ny / denominator, px2 = +px.toFixed(2), py2 = +py.toFixed(2);
if (px2 < +mmin(x1, x2).toFixed(2) ||
px2 > +mmax(x1, x2).toFixed(2) ||
px2 < +mmin(x3, x4).toFixed(2) ||
px2 > +mmax(x3, x4).toFixed(2) ||
py2 < +mmin(y1, y2).toFixed(2) ||
py2 > +mmax(y1, y2).toFixed(2) ||
py2 < +mmin(y3, y4).toFixed(2) ||
py2 > +mmax(y3, y4).toFixed(2)) {
return;
}
return { x: px, y: py };
}
function inter(bez1, bez2) {
return interHelper(bez1, bez2);
}
function interCount(bez1, bez2) {
return interHelper(bez1, bez2, 1);
}
function interHelper(bez1, bez2, justCount) {
var bbox1 = bezierBBox(bez1), bbox2 = bezierBBox(bez2);
if (!isBBoxIntersect(bbox1, bbox2)) {
return justCount ? 0 : [];
}
var l1 = bezlen.apply(0, bez1), l2 = bezlen.apply(0, bez2), n1 = ~~(l1 / 8), n2 = ~~(l2 / 8), dots1 = [], dots2 = [], xy = {}, res = justCount ? 0 : [];
for (var i = 0; i < n1 + 1; i++) {
var p = findDotsAtSegment.apply(0, bez1.concat(i / n1));
dots1.push({ x: p.x, y: p.y, t: i / n1 });
}
for (i = 0; i < n2 + 1; i++) {
p = findDotsAtSegment.apply(0, bez2.concat(i / n2));
dots2.push({ x: p.x, y: p.y, t: i / n2 });
}
for (i = 0; i < n1; i++) {
for (var j = 0; j < n2; j++) {
var di = dots1[i], di1 = dots1[i + 1], dj = dots2[j], dj1 = dots2[j + 1], ci = abs(di1.x - di.x) < .001 ? "y" : "x", cj = abs(dj1.x - dj.x) < .001 ? "y" : "x", is = intersect(di.x, di.y, di1.x, di1.y, dj.x, dj.y, dj1.x, dj1.y);
if (is) {
if (xy[is.x.toFixed(4)] == is.y.toFixed(4)) {
continue;
}
xy[is.x.toFixed(4)] = is.y.toFixed(4);
var t1 = di.t + abs((is[ci] - di[ci]) / (di1[ci] - di[ci])) * (di1.t - di.t), t2 = dj.t + abs((is[cj] - dj[cj]) / (dj1[cj] - dj[cj])) * (dj1.t - dj.t);
if (t1 >= 0 && t1 <= 1 && t2 >= 0 && t2 <= 1) {
if (justCount) {
res++;
}
else {
res.push({
x: is.x,
y: is.y,
t1: t1,
t2: t2
});
}
}
}
}
}
return res;
}
function pathIntersection(path1, path2) {
return interPathHelper(path1, path2);
}
function pathIntersectionNumber(path1, path2) {
return interPathHelper(path1, path2, 1);
}
function interPathHelper(path1, path2, justCount) {
path1 = path2curve(path1);
path2 = path2curve(path2);
var x1, y1, x2, y2, x1m, y1m, x2m, y2m, bez1, bez2, res = justCount ? 0 : [];
for (var i = 0, ii = path1.length; i < ii; i++) {
var pi = path1[i];
if (pi[0] == "M") {
x1 = x1m = pi[1];
y1 = y1m = pi[2];
}
else {
if (pi[0] == "C") {
bez1 = [x1, y1].concat(pi.slice(1));
x1 = bez1[6];
y1 = bez1[7];
}
else {
bez1 = [x1, y1, x1, y1, x1m, y1m, x1m, y1m];
x1 = x1m;
y1 = y1m;
}
for (var j = 0, jj = path2.length; j < jj; j++) {
var pj = path2[j];
if (pj[0] == "M") {
x2 = x2m = pj[1];
y2 = y2m = pj[2];
}
else {
if (pj[0] == "C") {
bez2 = [x2, y2].concat(pj.slice(1));
x2 = bez2[6];
y2 = bez2[7];
}
else {
bez2 = [x2, y2, x2, y2, x2m, y2m, x2m, y2m];
x2 = x2m;
y2 = y2m;
}
var intr = interHelper(bez1, bez2, justCount);
if (justCount) {
res += intr;
}
else {
for (var k = 0, kk = intr.length; k < kk; k++) {
intr[k].segment1 = i;
intr[k].segment2 = j;
intr[k].bez1 = bez1;
intr[k].bez2 = bez2;
}
res = res.concat(intr);
}
}
}
}
}
return res;
}
function isPointInsidePath(path, x, y) {
var bbox = pathBBox(path);
return isPointInsideBBox(bbox, x, y) &&
interPathHelper(path, [["M", x, y], ["H", bbox.x2 + 10]], 1) % 2 == 1;
}
function pathBBox(path) {
var pth = paths(path);
if (pth.bbox) {
return clone(pth.bbox);
}
if (!path) {
return box();
}
path = path2curve(path);
var x = 0, y = 0, X = [], Y = [], p;
for (var i = 0, ii = path.length; i < ii; i++) {
p = path[i];
if (p[0] == "M") {
x = p[1];
y = p[2];
X.push(x);
Y.push(y);
}
else {
var dim = curveDim(x, y, p[1], p[2], p[3], p[4], p[5], p[6]);
X = X.concat(dim.min.x, dim.max.x);
Y = Y.concat(dim.min.y, dim.max.y);
x = p[5];
y = p[6];
}
}
var xmin = mmin.apply(0, X), ymin = mmin.apply(0, Y), xmax = mmax.apply(0, X), ymax = mmax.apply(0, Y), bb = box(xmin, ymin, xmax - xmin, ymax - ymin);
pth.bbox = clone(bb);
return bb;
}
function rectPath(x, y, w, h, r) {
if (r) {
return [
["M", +x + +r, y],
["l", w - r * 2, 0],
["a", r, r, 0, 0, 1, r, r],
["l", 0, h - r * 2],
["a", r, r, 0, 0, 1, -r, r],
["l", r * 2 - w, 0],
["a", r, r, 0, 0, 1, -r, -r],
["l", 0, r * 2 - h],
["a", r, r, 0, 0, 1, r, -r],
["z"]
];
}
var res = [["M", x, y], ["l", w, 0], ["l", 0, h], ["l", -w, 0], ["z"]];
res.toString = toString;
return res;
}
function ellipsePath(x, y, rx, ry, a) {
if (a == null && ry == null) {
ry = rx;
}
x = +x;
y = +y;
rx = +rx;
ry = +ry;
if (a != null) {
var rad = Math.PI / 180, x1 = x + rx * Math.cos(-ry * rad), x2 = x + rx * Math.cos(-a * rad), y1 = y + rx * Math.sin(-ry * rad), y2 = y + rx * Math.sin(-a * rad), res = [["M", x1, y1], ["A", rx, rx, 0, +(a - ry > 180), 0, x2, y2]];
}
else {
res = [
["M", x, y],
["m", 0, -ry],
["a", rx, ry, 0, 1, 1, 0, 2 * ry],
["a", rx, ry, 0, 1, 1, 0, -2 * ry],
["z"]
];
}
res.toString = toString;
return res;
}
var unit2px = Snap._unit2px, getPath = {
path: function (el) {
return el.attr("path");
},
circle: function (el) {
var attr = unit2px(el);
return ellipsePath(attr.cx, attr.cy, attr.r);
},
ellipse: function (el) {
var attr = unit2px(el);
return ellipsePath(attr.cx || 0, attr.cy || 0, attr.rx, attr.ry);
},
rect: function (el) {
var attr = unit2px(el);
return rectPath(attr.x || 0, attr.y || 0, attr.width, attr.height, attr.rx, attr.ry);
},
image: function (el) {
var attr = unit2px(el);
return rectPath(attr.x || 0, attr.y || 0, attr.width, attr.height);
},
line: function (el) {
return "M" + [el.attr("x1") || 0, el.attr("y1") || 0, el.attr("x2"), el.attr("y2")];
},
polyline: function (el) {
return "M" + el.attr("points");
},
polygon: function (el) {
return "M" + el.attr("points") + "z";
},
deflt: function (el) {
var bbox = el.node.getBBox();
return rectPath(bbox.x, bbox.y, bbox.width, bbox.height);
}
};
function pathToRelative(pathArray) {
var pth = paths(pathArray), lowerCase = String.prototype.toLowerCase;
if (pth.rel) {
return pathClone(pth.rel);
}
if (!Snap.is(pathArray, "array") || !Snap.is(pathArray && pathArray[0], "array")) {
pathArray = Snap.parsePathString(pathArray);
}
var res = [], x = 0, y = 0, mx = 0, my = 0, start = 0;
if (pathArray[0][0] == "M") {
x = pathArray[0][1];
y = pathArray[0][2];
mx = x;
my = y;
start++;
res.push(["M", x, y]);
}
for (var i = start, ii = pathArray.length; i < ii; i++) {
var r = res[i] = [], pa = pathArray[i];
if (pa[0] != lowerCase.call(pa[0])) {
r[0] = lowerCase.call(pa[0]);
switch (r[0]) {
case "a":
r[1] = pa[1];
r[2] = pa[2];
r[3] = pa[3];
r[4] = pa[4];
r[5] = pa[5];
r[6] = +(pa[6] - x).toFixed(3);
r[7] = +(pa[7] - y).toFixed(3);
break;
case "v":
r[1] = +(pa[1] - y).toFixed(3);
break;
case "m":
mx = pa[1];
my = pa[2];
default:
for (var j = 1, jj = pa.length; j < jj; j++) {
r[j] = +(pa[j] - (j % 2 ? x : y)).toFixed(3);
}
}
}
else {
r = res[i] = [];
if (pa[0] == "m") {
mx = pa[1] + x;
my = pa[2] + y;
}
for (var k = 0, kk = pa.length; k < kk; k++) {
res[i][k] = pa[k];
}
}
var len = res[i].length;
switch (res[i][0]) {
case "z":
x = mx;
y = my;
break;
case "h":
x += +res[i][len - 1];
break;
case "v":
y += +res[i][len - 1];
break;
default:
x += +res[i][len - 2];
y += +res[i][len - 1];
}
}
res.toString = toString;
pth.rel = pathClone(res);
return res;
}
function pathToAbsolute(pathArray) {
var pth = paths(pathArray);
if (pth.abs) {
return pathClone(pth.abs);
}
if (!is(pathArray, "array") || !is(pathArray && pathArray[0], "array")) {
pathArray = Snap.parsePathString(pathArray);
}
if (!pathArray || !pathArray.length) {
return "M", 0, 0;
}
var res = [], x = 0, y = 0, mx = 0, my = 0, start = 0, pa0;
if (pathArray[0][0] == "M") {
x = +pathArray[0][1];
y = +pathArray[0][2];
mx = x;
my = y;
start++;
res[0] = ["M", x, y];
}
var crz = pathArray.length == 3 &&
pathArray[0][0] == "M" &&
pathArray[1][0].toUpperCase() == "R" &&
pathArray[2][0].toUpperCase() == "Z";
for (var r, pa, i = start, ii = pathArray.length; i < ii; i++) {
res.push(r = []);
pa = pathArray[i];
pa0 = pa[0];
if (pa0 != pa0.toUpperCase()) {
r[0] = pa0.toUpperCase();
switch (r[0]) {
case "A":
r[1] = pa[1];
r[2] = pa[2];
r[3] = pa[3];
r[4] = pa[4];
r[5] = pa[5];
r[6] = +pa[6] + x;
r[7] = +pa[7] + y;
break;
case "V":
r[1] = +pa[1] + y;
break;
case "H":
r[1] = +pa[1] + x;
break;
case "R":
var dots = [x, y].concat(pa.slice(1));
for (var j = 2, jj = dots.length; j < jj; j++) {
dots[j] = +dots[j] + x;
dots[++j] = +dots[j] + y;
}
res.pop();
res = res.concat(catmullRom2bezier(dots, crz));
break;
case "O":
res.pop();
dots = ellipsePath(x, y, pa[1], pa[2]);
dots.push(dots[0]);
res = res.concat(dots);
break;
case "U":
res.pop();
res = res.concat(ellipsePath(x, y, pa[1], pa[2], pa[3]));
r = ["U"].concat(res[res.length - 1].slice(-2));
break;
case "M":
mx = +pa[1] + x;
my = +pa[2] + y;
default:
for (j = 1, jj = pa.length; j < jj; j++) {
r[j] = +pa[j] + (j % 2 ? x : y);
}
}
}
else if (pa0 == "R") {
dots = [x, y].concat(pa.slice(1));
res.pop();
res = res.concat(catmullRom2bezier(dots, crz));
r = ["R"].concat(pa.slice(-2));
}
else if (pa0 == "O") {
res.pop();
dots = ellipsePath(x, y, pa[1], pa[2]);
dots.push(dots[0]);
res = res.concat(dots);
}
else if (pa0 == "U") {
res.pop();
res = res.concat(ellipsePath(x, y, pa[1], pa[2], pa[3]));
r = ["U"].concat(res[res.length - 1].slice(-2));
}
else {
for (var k = 0, kk = pa.length; k < kk; k++) {
r[k] = pa[k];
}
}
pa0 = pa0.toUpperCase();
if (pa0 != "O") {
switch (r[0]) {
case "Z":
x = +mx;
y = +my;
break;
case "H":
x = r[1];
break;
case "V":
y = r[1];
break;
case "M":
mx = r[r.length - 2];
my = r[r.length - 1];
default:
x = r[r.length - 2];
y = r[r.length - 1];
}
}
}
res.toString = toString;
pth.abs = pathClone(res);
return res;
}
function l2c(x1, y1, x2, y2) {
return [x1, y1, x2, y2, x2, y2];
}
function q2c(x1, y1, ax, ay, x2, y2) {
var _13 = 1 / 3, _23 = 2 / 3;
return [
_13 * x1 + _23 * ax,
_13 * y1 + _23 * ay,
_13 * x2 + _23 * ax,
_13 * y2 + _23 * ay,
x2,
y2
];
}
function a2c(x1, y1, rx, ry, angle, large_arc_flag, sweep_flag, x2, y2, recursive) {
var _120 = PI * 120 / 180, rad = PI / 180 * (+angle || 0), res = [], xy, rotate = Snap._.cacher(function (x, y, rad) {
var X = x * math.cos(rad) - y * math.sin(rad), Y = x * math.sin(rad) + y * math.cos(rad);
return { x: X, y: Y };
});
if (!rx || !ry) {
return [x1, y1, x2, y2, x2, y2];
}
if (!recursive) {
xy = rotate(x1, y1, -rad);
x1 = xy.x;
y1 = xy.y;
xy = rotate(x2, y2, -rad);
x2 = xy.x;
y2 = xy.y;
var cos = math.cos(PI / 180 * angle), sin = math.sin(PI / 180 * angle), x = (x1 - x2) / 2, y = (y1 - y2) / 2;
var h = x * x / (rx * rx) + y * y / (ry * ry);
if (h > 1) {
h = math.sqrt(h);
rx = h * rx;
ry = h * ry;
}
var rx2 = rx * rx, ry2 = ry * ry, k = (large_arc_flag == sweep_flag ? -1 : 1) *
math.sqrt(abs((rx2 * ry2 - rx2 * y * y - ry2 * x * x) / (rx2 * y * y + ry2 * x * x))), cx = k * rx * y / ry + (x1 + x2) / 2, cy = k * -ry * x / rx + (y1 + y2) / 2, f1 = math.asin(((y1 - cy) / ry).toFixed(9)), f2 = math.asin(((y2 - cy) / ry).toFixed(9));
f1 = x1 < cx ? PI - f1 : f1;
f2 = x2 < cx ? PI - f2 : f2;
f1 < 0 && (f1 = PI * 2 + f1);
f2 < 0 && (f2 = PI * 2 + f2);
if (sweep_flag && f1 > f2) {
f1 = f1 - PI * 2;
}
if (!sweep_flag && f2 > f1) {
f2 = f2 - PI * 2;
}
}
else {
f1 = recursive[0];
f2 = recursive[1];
cx = recursive[2];
cy = recursive[3];
}
var df = f2 - f1;
if (abs(df) > _120) {
var f2old = f2, x2old = x2, y2old = y2;
f2 = f1 + _120 * (sweep_flag && f2 > f1 ? 1 : -1);
x2 = cx + rx * math.cos(f2);
y2 = cy + ry * math.sin(f2);
res = a2c(x2, y2, rx, ry, angle, 0, sweep_flag, x2old, y2old, [f2, f2old, cx, cy]);
}
df = f2 - f1;
var c1 = math.cos(f1), s1 = math.sin(f1), c2 = math.cos(f2), s2 = math.sin(f2), t = math.tan(df / 4), hx = 4 / 3 * rx * t, hy = 4 / 3 * ry * t, m1 = [x1, y1], m2 = [x1 + hx * s1, y1 - hy * c1], m3 = [x2 + hx * s2, y2 - hy * c2], m4 = [x2, y2];
m2[0] = 2 * m1[0] - m2[0];
m2[1] = 2 * m1[1] - m2[1];
if (recursive) {
return [m2, m3, m4].concat(res);
}
else {
res = [m2, m3, m4].concat(res).join().split(",");
var newres = [];
for (var i = 0, ii = res.length; i < ii; i++) {
newres[i] = i % 2 ? rotate(res[i - 1], res[i], rad).y : rotate(res[i], res[i + 1], rad).x;
}
return newres;
}
}
function findDotAtSegment(p1x, p1y, c1x, c1y, c2x, c2y, p2x, p2y, t) {
var t1 = 1 - t;
return {
x: pow(t1, 3) * p1x + pow(t1, 2) * 3 * t * c1x + t1 * 3 * t * t * c2x + pow(t, 3) * p2x,
y: pow(t1, 3) * p1y + pow(t1, 2) * 3 * t * c1y + t1 * 3 * t * t * c2y + pow(t, 3) * p2y
};
}
function curveDim(x0, y0, x1, y1, x2, y2, x3, y3) {
var tvalues = [], bounds = [[], []], a, b, c, t, t1, t2, b2ac, sqrtb2ac;
for (var i = 0; i < 2; ++i) {
if (i == 0) {
b = 6 * x0 - 12 * x1 + 6 * x2;
a = -3 * x0 + 9 * x1 - 9 * x2 + 3 * x3;
c = 3 * x1 - 3 * x0;
}
else {
b = 6 * y0 - 12 * y1 + 6 * y2;
a = -3 * y0 + 9 * y1 - 9 * y2 + 3 * y3;
c = 3 * y1 - 3 * y0;
}
if (abs(a) < 1e-12) {
if (abs(b) < 1e-12) {
continue;
}
t = -c / b;
if (0 < t && t < 1) {
tvalues.push(t);
}
continue;
}
b2ac = b * b - 4 * c * a;
sqrtb2ac = math.sqrt(b2ac);
if (b2ac < 0) {
continue;
}
t1 = (-b + sqrtb2ac) / (2 * a);
if (0 < t1 && t1 < 1) {
tvalues.push(t1);
}
t2 = (-b - sqrtb2ac) / (2 * a);
if (0 < t2 && t2 < 1) {
tvalues.push(t2);
}
}
var x, y, j = tvalues.length, jlen = j, mt;
while (j--) {
t = tvalues[j];
mt = 1 - t;
bounds[0][j] = mt * mt * mt * x0 + 3 * mt * mt * t * x1 + 3 * mt * t * t * x2 + t * t * t * x3;
bounds[1][j] = mt * mt * mt * y0 + 3 * mt * mt * t * y1 + 3 * mt * t * t * y2 + t * t * t * y3;
}
bounds[0][jlen] = x0;
bounds[1][jlen] = y0;
bounds[0][jlen + 1] = x3;
bounds[1][jlen + 1] = y3;
bounds[0].length = bounds[1].length = jlen + 2;
return {
min: { x: mmin.apply(0, bounds[0]), y: mmin.apply(0, bounds[1]) },
max: { x: mmax.apply(0, bounds[0]), y: mmax.apply(0, bounds[1]) }
};
}
function path2curve(path, path2) {
var pth = !path2 && paths(path);
if (!path2 && pth.curve) {
return pathClone(pth.curve);
}
var p = pathToAbsolute(path), p2 = path2 && pathToAbsolute(path2), attrs = { x: 0, y: 0, bx: 0, by: 0, X: 0, Y: 0, qx: null, qy: null }, attrs2 = { x: 0, y: 0, bx: 0, by: 0, X: 0, Y: 0, qx: null, qy: null }, processPath = function (path, d, pcom) {
var nx, ny;
if (!path) {
return ["C", d.x, d.y, d.x, d.y, d.x, d.y];
}
!(path[0] in { T: 1, Q: 1 }) && (d.qx = d.qy = null);
switch (path[0]) {
case "M":
d.X = path[1];
d.Y = path[2];
break;
case "A":
path = ["C"].concat(a2c.apply(0, [d.x, d.y].concat(path.slice(1))));
break;
case "S":
if (pcom == "C" || pcom == "S") {
nx = d.x * 2 - d.bx;
ny = d.y * 2 - d.by;
}
else {
nx = d.x;
ny = d.y;
}
path = ["C", nx, ny].concat(path.slice(1));
break;
case "T":
if (pcom == "Q" || pcom == "T") {
d.qx = d.x * 2 - d.qx;
d.qy = d.y * 2 - d.qy;
}
else {
d.qx = d.x;
d.qy = d.y;
}
path = ["C"].concat(q2c(d.x, d.y, d.qx, d.qy, path[1], path[2]));
break;
case "Q":
d.qx = path[1];
d.qy = path[2];
path = ["C"].concat(q2c(d.x, d.y, path[1], path[2], path[3], path[4]));
break;
case "L":
path = ["C"].concat(l2c(d.x, d.y, path[1], path[2]));
break;
case "H":
path = ["C"].concat(l2c(d.x, d.y, path[1], d.y));
break;
case "V":
path = ["C"].concat(l2c(d.x, d.y, d.x, path[1]));
break;
case "Z":
path = ["C"].concat(l2c(d.x, d.y, d.X, d.Y));
break;
}
return path;
}, fixArc = function (pp, i) {
if (pp[i].length > 7) {
pp[i].shift();
var pi = pp[i];
while (pi.length) {
pcoms1[i] = "A";
p2 && (pcoms2[i] = "A");
pp.splice(i++, 0, ["C"].concat(pi.splice(0, 6)));
}
pp.splice(i, 1);
ii = mmax(p.length, p2 && p2.length || 0);
}
}, fixM = function (path1, path2, a1, a2, i) {
if (path1 && path2 && path1[i][0] == "M" && path2[i][0] != "M") {
path2.splice(i, 0, ["M", a2.x, a2.y]);
a1.bx = 0;
a1.by = 0;
a1.x = path1[i][1];
a1.y = path1[i][2];
ii = mmax(p.length, p2 && p2.length || 0);
}
}, pcoms1 = [], pcoms2 = [], pfirst = "", pcom = "";
for (var i = 0, ii = mmax(p.length, p2 && p2.length || 0); i < ii; i++) {
p[i] && (pfirst = p[i][0]);
if (pfirst != "C") {
pcoms1[i] = pfirst;
i && (pcom = pcoms1[i - 1]);
}
p[i] = processPath(p[i], attrs, pcom);
if (pcoms1[i] != "A" && pfirst == "C")
pcoms1[i] = "C";
fixArc(p, i);
if (p2) {
p2[i] && (pfirst = p2[i][0]);
if (pfirst != "C") {
pcoms2[i] = pfirst;
i && (pcom = pcoms2[i - 1]);
}
p2[i] = processPath(p2[i], attrs2, pcom);
if (pcoms2[i] != "A" && pfirst == "C") {
pcoms2[i] = "C";
}
fixArc(p2, i);
}
fixM(p, p2, attrs, attrs2, i);
fixM(p2, p, attrs2, attrs, i);
var seg = p[i], seg2 = p2 && p2[i], seglen = seg.length, seg2len = p2 && seg2.length;
attrs.x = seg[seglen - 2];
attrs.y = seg[seglen - 1];
attrs.bx = toFloat(seg[seglen - 4]) || attrs.x;
attrs.by = toFloat(seg[seglen - 3]) || attrs.y;
attrs2.bx = p2 && (toFloat(seg2[seg2len - 4]) || attrs2.x);
attrs2.by = p2 && (toFloat(seg2[seg2len - 3]) || attrs2.y);
attrs2.x = p2 && seg2[seg2len - 2];
attrs2.y = p2 && seg2[seg2len - 1];
}
if (!p2) {
pth.curve = pathClone(p);
}
return p2 ? [p, p2] : p;
}
function mapPath(path, matrix) {
if (!matrix) {
return path;
}
var x, y, i, j, ii, jj, pathi;
path = path2curve(path);
for (i = 0, ii = path.length; i < ii; i++) {
pathi = path[i];
for (j = 1, jj = pathi.length; j < jj; j += 2) {
x = matrix.x(pathi[j], pathi[j + 1]);
y = matrix.y(pathi[j], pathi[j + 1]);
pathi[j] = x;
pathi[j + 1] = y;
}
}
return path;
}
function catmullRom2bezier(crp, z) {
var d = [];
for (var i = 0, iLen = crp.length; iLen - 2 * !z > i; i += 2) {
var p = [
{ x: +crp[i - 2], y: +crp[i - 1] },
{ x: +crp[i], y: +crp[i + 1] },
{ x: +crp[i + 2], y: +crp[i + 3] },
{ x: +crp[i + 4], y: +crp[i + 5] }
];
if (z) {
if (!i) {
p[0] = { x: +crp[iLen - 2], y: +crp[iLen - 1] };
}
else if (iLen - 4 == i) {
p[3] = { x: +crp[0], y: +crp[1] };
}
else if (iLen - 2 == i) {
p[2] = { x: +crp[0], y: +crp[1] };
p[3] = { x: +crp[2], y: +crp[3] };
}
}
else {
if (iLen - 4 == i) {
p[3] = p[2];
}
else if (!i) {
p[0] = { x: +crp[i], y: +crp[i + 1] };
}
}
d.push(["C",
(-p[0].x + 6 * p[1].x + p[2].x) / 6,
(-p[0].y + 6 * p[1].y + p[2].y) / 6,
(p[1].x + 6 * p[2].x - p[3].x) / 6,
(p[1].y + 6 * p[2].y - p[3].y) / 6,
p[2].x,
p[2].y
]);
}
return d;
}
Snap.path = paths;
Snap.path.getTotalLength = getTotalLength;
Snap.path.getPointAtLength = getPointAtLength;
Snap.path.getSubpath = function (path, from, to) {
if (this.getTotalLength(path) - to < 1e-6) {
return getSubpathsAtLength(path, from).end;
}
var a = getSubpathsAtLength(path, to, 1);
return from ? getSubpathsAtLength(a, from).end : a;
};
elproto.getTotalLength = function () {
if (this.node.getTotalLength) {
return this.node.getTotalLength();
}
};
elproto.getPointAtLength = function (length) {
return getPointAtLength(this.attr("d"), length);
};
elproto.getSubpath = function (from, to) {
return Snap.path.getSubpath(this.attr("d"), from, to);
};
Snap._.box = box;
Snap.path.findDotsAtSegment = findDotsAtSegment;
Snap.path.bezierBBox = bezierBBox;
Snap.path.isPointInsideBBox = isPointInsideBBox;
Snap.closest = function (x, y, X, Y) {
var r = 100, b = box(x - r / 2, y - r / 2, r, r), inside = [], getter = X[0].hasOwnProperty("x") ? function (i) {
return {
x: X[i].x,
y: X[i].y
};
} : function (i) {
return {
x: X[i],
y: Y[i]
};
}, found = 0;
while (r <= 1e6 && !found) {
for (var i = 0, ii = X.length; i < ii; i++) {
var xy = getter(i);
if (isPointInsideBBox(b, xy.x, xy.y)) {
found++;
inside.push(xy);
break;
}
}
if (!found) {
r *= 2;
b = box(x - r / 2, y - r / 2, r, r);
}
}
if (r == 1e6) {
return;
}
var len = Infinity, res;
for (i = 0, ii = inside.length; i < ii; i++) {
var l = Snap.len(x, y, inside[i].x, inside[i].y);
if (len > l) {
len = l;
inside[i].len = l;
res = inside[i];
}
}
return res;
};
Snap.path.isBBoxIntersect = isBBoxIntersect;
Snap.path.intersection = pathIntersection;
Snap.path.intersectionNumber = pathIntersectionNumber;
Snap.path.isPointInside = isPointInsidePath;
Snap.path.getBBox = pathBBox;
Snap.path.get = getPath;
Snap.path.toRelative = pathToRelative;
Snap.path.toAbsolute = pathToAbsolute;
Snap.path.toCubic = path2curve;
Snap.path.map = mapPath;
Snap.path.toString = toString;
Snap.path.clone = pathClone;
}); Snap.plugin(function (Snap, Element, Paper, glob) {
var mmax = Math.max, mmin = Math.min;
var Set = function (items) {
this.items = [];
this.bindings = {};
this.length = 0;
this.type = "set";
if (items) {
for (var i = 0, ii = items.length; i < ii; i++) {
if (items[i]) {
this[this.items.length] = this.items[this.items.length] = items[i];
this.length++;
}
}
}
}, setproto = Set.prototype;
setproto.push = function () {
var item, len;
for (var i = 0, ii = arguments.length; i < ii; i++) {
item = arguments[i];
if (item) {
len = this.items.length;
this[len] = this.items[len] = item;
this.length++;
}
}
return this;
};
setproto.pop = function () {
this.length && delete this[this.length--];
return this.items.pop();
};
setproto.forEach = function (callback, thisArg) {
for (var i = 0, ii = this.items.length; i < ii; i++) {
if (callback.call(thisArg, this.items[i], i) === false) {
return this;
}
}
return this;
};
setproto.animate = function (attrs, ms, easing, callback) {
if (typeof easing == "function" && !easing.length) {
callback = easing;
easing = mina.linear;
}
if (attrs instanceof Snap._.Animation) {
callback = attrs.callback;
easing = attrs.easing;
ms = easing.dur;
attrs = attrs.attr;
}
var args = arguments;
if (Snap.is(attrs, "array") && Snap.is(args[args.length - 1], "array")) {
var each = true;
}
var begin, handler = function () {
if (begin) {
this.b = begin;
}
else {
begin = this.b;
}
}, cb = 0, set = this, callbacker = callback && function () {
if (++cb == set.length) {
callback.call(this);
}
};
return this.forEach(function (el, i) {
eve.once("snap.animcreated." + el.id, handler);
if (each) {
args[i] && el.animate.apply(el, args[i]);
}
else {
el.animate(attrs, ms, easing, callbacker);
}
});
};
setproto.remove = function () {
while (this.length) {
this.pop().remove();
}
return this;
};
setproto.bind = function (attr, a, b) {
var data = {};
if (typeof a == "function") {
this.bindings[attr] = a;
}
else {
var aname = b || attr;
this.bindings[attr] = function (v) {
data[aname] = v;
a.attr(data);
};
}
return this;
};
setproto.attr = function (value) {
var unbound = {};
for (var k in value) {
if (this.bindings[k]) {
this.bindings[k](value[k]);
}
else {
unbound[k] = value[k];
}
}
for (var i = 0, ii = this.items.length; i < ii; i++) {
this.items[i].attr(unbound);
}
return this;
};
setproto.clear = function () {
while (this.length) {
this.pop();
}
};
setproto.splice = function (index, count, insertion) {
index = index < 0 ? mmax(this.length + index, 0) : index;
count = mmax(0, mmin(this.length - index, count));
var tail = [], todel = [], args = [], i;
for (i = 2; i < arguments.length; i++) {
args.push(arguments[i]);
}
for (i = 0; i < count; i++) {
todel.push(this[index + i]);
}
for (; i < this.length - index; i++) {
tail.push(this[index + i]);
}
var arglen = args.length;
for (i = 0; i < arglen + tail.length; i++) {
this.items[index + i] = this[index + i] = i < arglen ? args[i] : tail[i - arglen];
}
i = this.items.length = this.length -= count - arglen;
while (this[i]) {
delete this[i++];
}
return new Set(todel);
};
setproto.exclude = function (el) {
for (var i = 0, ii = this.length; i < ii; i++)
if (this[i] == el) {
this.splice(i, 1);
return true;
}
return false;
};
setproto.insertAfter = function (el) {
var i = this.items.length;
while (i--) {
this.items[i].insertAfter(el);
}
return this;
};
setproto.getBBox = function () {
var x = [], y = [], x2 = [], y2 = [];
for (var i = this.items.length; i--;)
if (!this.items[i].removed) {
var box = this.items[i].getBBox();
x.push(box.x);
y.push(box.y);
x2.push(box.x + box.width);
y2.push(box.y + box.height);
}
x = mmin.apply(0, x);
y = mmin.apply(0, y);
x2 = mmax.apply(0, x2);
y2 = mmax.apply(0, y2);
return {
x: x,
y: y,
x2: x2,
y2: y2,
width: x2 - x,
height: y2 - y,
cx: x + (x2 - x) / 2,
cy: y + (y2 - y) / 2
};
};
setproto.clone = function (s) {
s = new Set;
for (var i = 0, ii = this.items.length; i < ii; i++) {
s.push(this.items[i].clone());
}
return s;
};
setproto.toString = function () {
return "Snap\u2018s set";
};
setproto.type = "set";
Snap.Set = Set;
Snap.set = function () {
var set = new Set;
if (arguments.length) {
set.push.apply(set, Array.prototype.slice.call(arguments, 0));
}
return set;
};
}); Snap.plugin(function (Snap, Element, Paper, glob) {
var names = {}, reUnit = /[%a-z]+$/i, Str = String;
names.stroke = names.fill = "colour";
function getEmpty(item) {
var l = item[0];
switch (l.toLowerCase()) {
case "t": return [l, 0, 0];
case "m": return [l, 1, 0, 0, 1, 0, 0];
case "r": if (item.length == 4) {
return [l, 0, item[2], item[3]];
}
else {
return [l, 0];
}
case "s": if (item.length == 5) {
return [l, 1, 1, item[3], item[4]];
}
else if (item.length == 3) {
return [l, 1, 1];
}
else {
return [l, 1];
}
}
}
function equaliseTransform(t1, t2, getBBox) {
t1 = t1 || new Snap.Matrix;
t2 = t2 || new Snap.Matrix;
t1 = Snap.parseTransformString(t1.toTransformString()) || [];
t2 = Snap.parseTransformString(t2.toTransformString()) || [];
var maxlength = Math.max(t1.length, t2.length), from = [], to = [], i = 0, j, jj, tt1, tt2;
for (; i < maxlength; i++) {
tt1 = t1[i] || getEmpty(t2[i]);
tt2 = t2[i] || getEmpty(tt1);
if (tt1[0] != tt2[0] ||
tt1[0].toLowerCase() == "r" && (tt1[2] != tt2[2] || tt1[3] != tt2[3]) ||
tt1[0].toLowerCase() == "s" && (tt1[3] != tt2[3] || tt1[4] != tt2[4])) {
t1 = Snap._.transform2matrix(t1, getBBox());
t2 = Snap._.transform2matrix(t2, getBBox());
from = "m", t1.a, t1.b, t1.c, t1.d, t1.e, t1.f;
to = "m", t2.a, t2.b, t2.c, t2.d, t2.e, t2.f;
break;
}
from[i] = [];
to[i] = [];
for (j = 0, jj = Math.max(tt1.length, tt2.length); j < jj; j++) {
j in tt1 && (from[i][j] = tt1[j]);
j in tt2 && (to[i][j] = tt2[j]);
}
}
return {
from: path2array(from),
to: path2array(to),
f: getPath(from)
};
}
function getNumber(val) {
return val;
}
function getUnit(unit) {
return function (val) {
return +val.toFixed(3) + unit;
};
}
function getViewBox(val) {
return val.join(" ");
}
function getColour(clr) {
return Snap.rgb(clr[0], clr[1], clr[2], clr[3]);
}
function getPath(path) {
var k = 0, i, ii, j, jj, out, a, b = [];
for (i = 0, ii = path.length; i < ii; i++) {
out = "[";
a = ['"' + path[i][0] + '"'];
for (j = 1, jj = path[i].length; j < jj; j++) {
a[j] = "val[" + k++ + "]";
}
out += a + "]";
b[i] = out;
}
return Function("val", "return Snap.path.toString.call([" + b + "])");
}
function path2array(path) {
var out = [];
for (var i = 0, ii = path.length; i < ii; i++) {
for (var j = 1, jj = path[i].length; j < jj; j++) {
out.push(path[i][j]);
}
}
return out;
}
function isNumeric(obj) {
return isFinite(obj);
}
function arrayEqual(arr1, arr2) {
if (!Snap.is(arr1, "array") || !Snap.is(arr2, "array")) {
return false;
}
return arr1.toString() == arr2.toString();
}
Element.prototype.equal = function (name, b) {
return eve("snap.util.equal", this, name, b).firstDefined();
};
eve.on("snap.util.equal", function (name, b) {
var A, B, a = Str(this.attr(name) || ""), el = this;
if (names[name] == "colour") {
A = Snap.color(a);
B = Snap.color(b);
return {
from: [A.r, A.g, A.b, A.opacity],
to: [B.r, B.g, B.b, B.opacity],
f: getColour
};
}
if (name == "viewBox") {
A = this.attr(name).vb.split(" ").map(Number);
B = b.split(" ").map(Number);
return {
from: A,
to: B,
f: getViewBox
};
}
if (name == "transform" || name == "gradientTransform" || name == "patternTransform") {
if (typeof b == "string") {
b = Str(b).replace(/\.{3}|\u2026/g, a);
}
a = this.matrix;
if (!Snap._.rgTransform.test(b)) {
b = Snap._.transform2matrix(Snap._.svgTransform2string(b), this.getBBox());
}
else {
b = Snap._.transform2matrix(b, this.getBBox());
}
return equaliseTransform(a, b, function () {
return el.getBBox(1);
});
}
if (name == "d" || name == "path") {
A = Snap.path.toCubic(a, b);
return {
from: path2array(A[0]),
to: path2array(A[1]),
f: getPath(A[0])
};
}
if (name == "points") {
A = Str(a).split(Snap._.separator);
B = Str(b).split(Snap._.separator);
return {
from: A,
to: B,
f: function (val) { return val; }
};
}
if (isNumeric(a) && isNumeric(b)) {
return {
from: parseFloat(a),
to: parseFloat(b),
f: getNumber
};
}
var aUnit = a.match(reUnit), bUnit = Str(b).match(reUnit);
if (aUnit && arrayEqual(aUnit, bUnit)) {
return {
from: parseFloat(a),
to: parseFloat(b),
f: getUnit(aUnit)
};
}
else {
return {
from: this.asPX(name),
to: this.asPX(name, b),
f: getNumber
};
}
});
}); Snap.plugin(function (Snap, Element, Paper, glob) {
var elproto = Element.prototype, has = "hasOwnProperty", supportsTouch = "createTouch" in glob.doc, events = [
"click", "dblclick", "mousedown", "mousemove", "mouseout",
"mouseover", "mouseup", "touchstart", "touchmove", "touchend",
"touchcancel"
], touchMap = {
mousedown: "touchstart",
mousemove: "touchmove",
mouseup: "touchend"
}, getScroll = function (xy, el) {
var name = xy == "y" ? "scrollTop" : "scrollLeft", doc = el && el.node ? el.node.ownerDocument : glob.doc;
return doc[name in doc.documentElement ? "documentElement" : "body"][name];
}, preventDefault = function () {
this.returnValue = false;
}, preventTouch = function () {
return this.originalEvent.preventDefault();
}, stopPropagation = function () {
this.cancelBubble = true;
}, stopTouch = function () {
return this.originalEvent.stopPropagation();
}, addEvent = function (obj, type, fn, element) {
var realName = supportsTouch && touchMap[type] ? touchMap[type] : type, f = function (e) {
var scrollY = getScroll("y", element), scrollX = getScroll("x", element);
if (supportsTouch && touchMap[has](type)) {
for (var i = 0, ii = e.targetTouches && e.targetTouches.length; i < ii; i++) {
if (e.targetTouches[i].target == obj || obj.contains(e.targetTouches[i].target)) {
var olde = e;
e = e.targetTouches[i];
e.originalEvent = olde;
e.preventDefault = preventTouch;
e.stopPropagation = stopTouch;
break;
}
}
}
var x = e.clientX + scrollX, y = e.clientY + scrollY;
return fn.call(element, e, x, y);
};
if (type !== realName) {
obj.addEventListener(type, f, false);
}
obj.addEventListener(realName, f, false);
return function () {
if (type !== realName) {
obj.removeEventListener(type, f, false);
}
obj.removeEventListener(realName, f, false);
return true;
};
}, drag = [], dragMove = function (e) {
var x = e.clientX, y = e.clientY, scrollY = getScroll("y"), scrollX = getScroll("x"), dragi, j = drag.length;
while (j--) {
dragi = drag[j];
if (supportsTouch) {
var i = e.touches && e.touches.length, touch;
while (i--) {
touch = e.touches[i];
if (touch.identifier == dragi.el._drag.id || dragi.el.node.contains(touch.target)) {
x = touch.clientX;
y = touch.clientY;
(e.originalEvent ? e.originalEvent : e).preventDefault();
break;
}
}
}
else {
e.preventDefault();
}
var node = dragi.el.node, o, next = node.nextSibling, parent = node.parentNode, display = node.style.display;
x += scrollX;
y += scrollY;
eve("snap.drag.move." + dragi.el.id, dragi.move_scope || dragi.el, x - dragi.el._drag.x, y - dragi.el._drag.y, x, y, e);
}
}, dragUp = function (e) {
Snap.unmousemove(dragMove).unmouseup(dragUp);
var i = drag.length, dragi;
while (i--) {
dragi = drag[i];
dragi.el._drag = {};
eve("snap.drag.end." + dragi.el.id, dragi.end_scope || dragi.start_scope || dragi.move_scope || dragi.el, e);
eve.off("snap.drag.*." + dragi.el.id);
}
drag = [];
};
for (var i = events.length; i--;) {
(function (eventName) {
Snap[eventName] = elproto[eventName] = function (fn, scope) {
if (Snap.is(fn, "function")) {
this.events = this.events || [];
this.events.push({
name: eventName,
f: fn,
unbind: addEvent(this.node || document, eventName, fn, scope || this)
});
}
else {
for (var i = 0, ii = this.events.length; i < ii; i++)
if (this.events[i].name == eventName) {
try {
this.events[i].f.call(this);
}
catch (e) { }
}
}
return this;
};
Snap["un" + eventName] =
elproto["un" + eventName] = function (fn) {
var events = this.events || [], l = events.length;
while (l--)
if (events[l].name == eventName &&
(events[l].f == fn || !fn)) {
events[l].unbind();
events.splice(l, 1);
!events.length && delete this.events;
return this;
}
return this;
};
})(events[i]);
}
elproto.hover = function (f_in, f_out, scope_in, scope_out) {
return this.mouseover(f_in, scope_in).mouseout(f_out, scope_out || scope_in);
};
elproto.unhover = function (f_in, f_out) {
return this.unmouseover(f_in).unmouseout(f_out);
};
var draggable = [];
elproto.drag = function (onmove, onstart, onend, move_scope, start_scope, end_scope) {
var el = this;
if (!arguments.length) {
var origTransform;
return el.drag(function (dx, dy) {
this.attr({
transform: origTransform + (origTransform ? "T" : "t") + [dx, dy]
});
}, function () {
origTransform = this.transform().local;
});
}
function start(e, x, y) {
(e.originalEvent || e).preventDefault();
el._drag.x = x;
el._drag.y = y;
el._drag.id = e.identifier;
!drag.length && Snap.mousemove(dragMove).mouseup(dragUp);
drag.push({ el: el, move_scope: move_scope, start_scope: start_scope, end_scope: end_scope });
onstart && eve.on("snap.drag.start." + el.id, onstart);
onmove && eve.on("snap.drag.move." + el.id, onmove);
onend && eve.on("snap.drag.end." + el.id, onend);
eve("snap.drag.start." + el.id, start_scope || move_scope || el, x, y, e);
}
function init(e, x, y) {
eve("snap.draginit." + el.id, el, e, x, y);
}
eve.on("snap.draginit." + el.id, start);
el._drag = {};
draggable.push({ el: el, start: start, init: init });
el.mousedown(init);
return el;
};
elproto.undrag = function () {
var i = draggable.length;
while (i--)
if (draggable[i].el == this) {
this.unmousedown(draggable[i].init);
draggable.splice(i, 1);
eve.unbind("snap.drag.*." + this.id);
eve.unbind("snap.draginit." + this.id);
}
!draggable.length && Snap.unmousemove(dragMove).unmouseup(dragUp);
return this;
};
}); Snap.plugin(function (Snap, Element, Paper, glob) {
var elproto = Element.prototype, pproto = Paper.prototype, rgurl = /^\s*url\((.+)\)/, Str = String, $ = Snap._.$;
Snap.filter = {};
pproto.filter = function (filstr) {
var paper = this;
if (paper.type != "svg") {
paper = paper.paper;
}
var f = Snap.parse(Str(filstr)), id = Snap._.id(), width = paper.node.offsetWidth, height = paper.node.offsetHeight, filter = $("filter");
$(filter, {
id: id,
filterUnits: "userSpaceOnUse"
});
filter.appendChild(f.node);
paper.defs.appendChild(filter);
return new Element(filter);
};
eve.on("snap.util.getattr.filter", function () {
eve.stop();
var p = $(this.node, "filter");
if (p) {
var match = Str(p).match(rgurl);
return match && Snap.select(match[1]);
}
});
eve.on("snap.util.attr.filter", function (value) {
if (value instanceof Element && value.type == "filter") {
eve.stop();
var id = value.node.id;
if (!id) {
$(value.node, { id: value.id });
id = value.id;
}
$(this.node, {
filter: Snap.url(id)
});
}
if (!value || value == "none") {
eve.stop();
this.node.removeAttribute("filter");
}
});
Snap.filter.blur = function (x, y) {
if (x == null) {
x = 2;
}
var def = y == null ? x : [x, y];
return Snap.format('\<feGaussianBlur stdDeviation="{def}"/>', {
def: def
});
};
Snap.filter.blur.toString = function () {
return this();
};
Snap.filter.shadow = function (dx, dy, blur, color, opacity) {
if (opacity == null) {
if (color == null) {
opacity = blur;
blur = 4;
color = "#000";
}
else {
opacity = color;
color = blur;
blur = 4;
}
}
if (blur == null) {
blur = 4;
}
if (opacity == null) {
opacity = 1;
}
if (dx == null) {
dx = 0;
dy = 2;
}
if (dy == null) {
dy = dx;
}
color = Snap.color(color);
return Snap.format('<feGaussianBlur in="SourceAlpha" stdDeviation="{blur}"/><feOffset dx="{dx}" dy="{dy}" result="offsetblur"/><feFlood flood-color="{color}"/><feComposite in2="offsetblur" operator="in"/><feComponentTransfer><feFuncA type="linear" slope="{opacity}"/></feComponentTransfer><feMerge><feMergeNode/><feMergeNode in="SourceGraphic"/></feMerge>', {
color: color,
dx: dx,
dy: dy,
blur: blur,
opacity: opacity
});
};
Snap.filter.shadow.toString = function () {
return this();
};
Snap.filter.grayscale = function (amount) {
if (amount == null) {
amount = 1;
}
return Snap.format('<feColorMatrix type="matrix" values="{a} {b} {c} 0 0 {d} {e} {f} 0 0 {g} {b} {h} 0 0 0 0 0 1 0"/>', {
a: 0.2126 + 0.7874 * (1 - amount),
b: 0.7152 - 0.7152 * (1 - amount),
c: 0.0722 - 0.0722 * (1 - amount),
d: 0.2126 - 0.2126 * (1 - amount),
e: 0.7152 + 0.2848 * (1 - amount),
f: 0.0722 - 0.0722 * (1 - amount),
g: 0.2126 - 0.2126 * (1 - amount),
h: 0.0722 + 0.9278 * (1 - amount)
});
};
Snap.filter.grayscale.toString = function () {
return this();
};
Snap.filter.sepia = function (amount) {
if (amount == null) {
amount = 1;
}
return Snap.format('<feColorMatrix type="matrix" values="{a} {b} {c} 0 0 {d} {e} {f} 0 0 {g} {h} {i} 0 0 0 0 0 1 0"/>', {
a: 0.393 + 0.607 * (1 - amount),
b: 0.769 - 0.769 * (1 - amount),
c: 0.189 - 0.189 * (1 - amount),
d: 0.349 - 0.349 * (1 - amount),
e: 0.686 + 0.314 * (1 - amount),
f: 0.168 - 0.168 * (1 - amount),
g: 0.272 - 0.272 * (1 - amount),
h: 0.534 - 0.534 * (1 - amount),
i: 0.131 + 0.869 * (1 - amount)
});
};
Snap.filter.sepia.toString = function () {
return this();
};
Snap.filter.saturate = function (amount) {
if (amount == null) {
amount = 1;
}
return Snap.format('<feColorMatrix type="saturate" values="{amount}"/>', {
amount: 1 - amount
});
};
Snap.filter.saturate.toString = function () {
return this();
};
Snap.filter.hueRotate = function (angle) {
angle = angle || 0;
return Snap.format('<feColorMatrix type="hueRotate" values="{angle}"/>', {
angle: angle
});
};
Snap.filter.hueRotate.toString = function () {
return this();
};
Snap.filter.invert = function (amount) {
if (amount == null) {
amount = 1;
}
return Snap.format('<feComponentTransfer><feFuncR type="table" tableValues="{amount} {amount2}"/><feFuncG type="table" tableValues="{amount} {amount2}"/><feFuncB type="table" tableValues="{amount} {amount2}"/></feComponentTransfer>', {
amount: amount,
amount2: 1 - amount
});
};
Snap.filter.invert.toString = function () {
return this();
};
Snap.filter.brightness = function (amount) {
if (amount == null) {
amount = 1;
}
return Snap.format('<feComponentTransfer><feFuncR type="linear" slope="{amount}"/><feFuncG type="linear" slope="{amount}"/><feFuncB type="linear" slope="{amount}"/></feComponentTransfer>', {
amount: amount
});
};
Snap.filter.brightness.toString = function () {
return this();
};
Snap.filter.contrast = function (amount) {
if (amount == null) {
amount = 1;
}
return Snap.format('<feComponentTransfer><feFuncR type="linear" slope="{amount}" intercept="{amount2}"/><feFuncG type="linear" slope="{amount}" intercept="{amount2}"/><feFuncB type="linear" slope="{amount}" intercept="{amount2}"/></feComponentTransfer>', {
amount: amount,
amount2: .5 - amount / 2
});
};
Snap.filter.contrast.toString = function () {
return this();
};
}); Snap.plugin(function (Snap, Element, Paper, glob, Fragment) {
var box = Snap._.box, is = Snap.is, firstLetter = /^[^a-z]*([tbmlrc])/i, toString = function () {
return "T" + this.dx + "," + this.dy;
};
Element.prototype.getAlign = function (el, way) {
if (way == null && is(el, "string")) {
way = el;
el = null;
}
el = el || this.paper;
var bx = el.getBBox ? el.getBBox() : box(el), bb = this.getBBox(), out = {};
way = way && way.match(firstLetter);
way = way ? way[1].toLowerCase() : "c";
switch (way) {
case "t":
out.dx = 0;
out.dy = bx.y - bb.y;
break;
case "b":
out.dx = 0;
out.dy = bx.y2 - bb.y2;
break;
case "m":
out.dx = 0;
out.dy = bx.cy - bb.cy;
break;
case "l":
out.dx = bx.x - bb.x;
out.dy = 0;
break;
case "r":
out.dx = bx.x2 - bb.x2;
out.dy = 0;
break;
default:
out.dx = bx.cx - bb.cx;
out.dy = 0;
break;
}
out.toString = toString;
return out;
};
Element.prototype.align = function (el, way) {
return this.transform("..." + this.getAlign(el, way));
};
}); Snap.plugin(function (Snap, Element, Paper, glob, Fragment) {
var elproto = Element.prototype, is = Snap.is, Str = String, has = "hasOwnProperty";
function slice(from, to, f) {
return function (arr) {
var res = arr.slice(from, to);
if (res.length == 1) {
res = res[0];
}
return f ? f(res) : res;
};
}
var Animation = function (attr, ms, easing, callback) {
if (typeof easing == "function" && !easing.length) {
callback = easing;
easing = mina.linear;
}
this.attr = attr;
this.dur = ms;
easing && (this.easing = easing);
callback && (this.callback = callback);
};
Snap._.Animation = Animation;
Snap.animation = function (attr, ms, easing, callback) {
return new Animation(attr, ms, easing, callback);
};
elproto.inAnim = function () {
var el = this, res = [];
for (var id in el.anims)
if (el.anims[has](id)) {
(function (a) {
res.push({
anim: new Animation(a._attrs, a.dur, a.easing, a._callback),
mina: a,
curStatus: a.status(),
status: function (val) {
return a.status(val);
},
stop: function () {
a.stop();
}
});
}(el.anims[id]));
}
return res;
};
Snap.animate = function (from, to, setter, ms, easing, callback) {
if (typeof easing == "function" && !easing.length) {
callback = easing;
easing = mina.linear;
}
var now = mina.time(), anim = mina(from, to, now, now + ms, mina.time, setter, easing);
callback && eve.once("mina.finish." + anim.id, callback);
return anim;
};
elproto.stop = function () {
var anims = this.inAnim();
for (var i = 0, ii = anims.length; i < ii; i++) {
anims[i].stop();
}
return this;
};
elproto.animate = function (attrs, ms, easing, callback) {
if (typeof easing == "function" && !easing.length) {
callback = easing;
easing = mina.linear;
}
if (attrs instanceof Animation) {
callback = attrs.callback;
easing = attrs.easing;
ms = attrs.dur;
attrs = attrs.attr;
}
var fkeys = [], tkeys = [], keys = {}, from, to, f, eq, el = this;
for (var key in attrs)
if (attrs[has](key)) {
if (el.equal) {
eq = el.equal(key, Str(attrs[key]));
from = eq.from;
to = eq.to;
f = eq.f;
}
else {
from = +el.attr(key);
to = +attrs[key];
}
var len = is(from, "array") ? from.length : 1;
keys[key] = slice(fkeys.length, fkeys.length + len, f);
fkeys = fkeys.concat(from);
tkeys = tkeys.concat(to);
}
var now = mina.time(), anim = mina(fkeys, tkeys, now, now + ms, mina.time, function (val) {
var attr = {};
for (var key in keys)
if (keys[has](key)) {
attr[key] = keys[key](val);
}
el.attr(attr);
}, easing);
el.anims[anim.id] = anim;
anim._attrs = attrs;
anim._callback = callback;
eve("snap.animcreated." + el.id, anim);
eve.once("mina.finish." + anim.id, function () {
eve.off("mina.*." + anim.id);
delete el.anims[anim.id];
callback && callback.call(el);
});
eve.once("mina.stop." + anim.id, function () {
eve.off("mina.*." + anim.id);
delete el.anims[anim.id];
});
return el;
};
}); Snap.plugin(function (Snap, Element, Paper, glob) {
var red = "#ffebee#ffcdd2#ef9a9a#e57373#ef5350#f44336#e53935#d32f2f#c62828#b71c1c#ff8a80#ff5252#ff1744#d50000", pink = "#FCE4EC#F8BBD0#F48FB1#F06292#EC407A#E91E63#D81B60#C2185B#AD1457#880E4F#FF80AB#FF4081#F50057#C51162", purple = "#F3E5F5#E1BEE7#CE93D8#BA68C8#AB47BC#9C27B0#8E24AA#7B1FA2#6A1B9A#4A148C#EA80FC#E040FB#D500F9#AA00FF", deeppurple = "#EDE7F6#D1C4E9#B39DDB#9575CD#7E57C2#673AB7#5E35B1#512DA8#4527A0#311B92#B388FF#7C4DFF#651FFF#6200EA", indigo = "#E8EAF6#C5CAE9#9FA8DA#7986CB#5C6BC0#3F51B5#3949AB#303F9F#283593#1A237E#8C9EFF#536DFE#3D5AFE#304FFE", blue = "#E3F2FD#BBDEFB#90CAF9#64B5F6#64B5F6#2196F3#1E88E5#1976D2#1565C0#0D47A1#82B1FF#448AFF#2979FF#2962FF", lightblue = "#E1F5FE#B3E5FC#81D4FA#4FC3F7#29B6F6#03A9F4#039BE5#0288D1#0277BD#01579B#80D8FF#40C4FF#00B0FF#0091EA", cyan = "#E0F7FA#B2EBF2#80DEEA#4DD0E1#26C6DA#00BCD4#00ACC1#0097A7#00838F#006064#84FFFF#18FFFF#00E5FF#00B8D4", teal = "#E0F2F1#B2DFDB#80CBC4#4DB6AC#26A69A#009688#00897B#00796B#00695C#004D40#A7FFEB#64FFDA#1DE9B6#00BFA5", green = "#E8F5E9#C8E6C9#A5D6A7#81C784#66BB6A#4CAF50#43A047#388E3C#2E7D32#1B5E20#B9F6CA#69F0AE#00E676#00C853", lightgreen = "#F1F8E9#DCEDC8#C5E1A5#AED581#9CCC65#8BC34A#7CB342#689F38#558B2F#33691E#CCFF90#B2FF59#76FF03#64DD17", lime = "#F9FBE7#F0F4C3#E6EE9C#DCE775#D4E157#CDDC39#C0CA33#AFB42B#9E9D24#827717#F4FF81#EEFF41#C6FF00#AEEA00", yellow = "#FFFDE7#FFF9C4#FFF59D#FFF176#FFEE58#FFEB3B#FDD835#FBC02D#F9A825#F57F17#FFFF8D#FFFF00#FFEA00#FFD600", amber = "#FFF8E1#FFECB3#FFE082#FFD54F#FFCA28#FFC107#FFB300#FFA000#FF8F00#FF6F00#FFE57F#FFD740#FFC400#FFAB00", orange = "#FFF3E0#FFE0B2#FFCC80#FFB74D#FFA726#FF9800#FB8C00#F57C00#EF6C00#E65100#FFD180#FFAB40#FF9100#FF6D00", deeporange = "#FBE9E7#FFCCBC#FFAB91#FF8A65#FF7043#FF5722#F4511E#E64A19#D84315#BF360C#FF9E80#FF6E40#FF3D00#DD2C00", brown = "#EFEBE9#D7CCC8#BCAAA4#A1887F#8D6E63#795548#6D4C41#5D4037#4E342E#3E2723", grey = "#FAFAFA#F5F5F5#EEEEEE#E0E0E0#BDBDBD#9E9E9E#757575#616161#424242#212121", bluegrey = "#ECEFF1#CFD8DC#B0BEC5#90A4AE#78909C#607D8B#546E7A#455A64#37474F#263238";
Snap.mui = {};
Snap.flat = {};
function saveColor(colors) {
colors = colors.split(/(?=#)/);
var color = new String(colors[5]);
color[50] = colors[0];
color[100] = colors[1];
color[200] = colors[2];
color[300] = colors[3];
color[400] = colors[4];
color[500] = colors[5];
color[600] = colors[6];
color[700] = colors[7];
color[800] = colors[8];
color[900] = colors[9];
if (colors[10]) {
color.A100 = colors[10];
color.A200 = colors[11];
color.A400 = colors[12];
color.A700 = colors[13];
}
return color;
}
Snap.mui.red = saveColor(red);
Snap.mui.pink = saveColor(pink);
Snap.mui.purple = saveColor(purple);
Snap.mui.deeppurple = saveColor(deeppurple);
Snap.mui.indigo = saveColor(indigo);
Snap.mui.blue = saveColor(blue);
Snap.mui.lightblue = saveColor(lightblue);
Snap.mui.cyan = saveColor(cyan);
Snap.mui.teal = saveColor(teal);
Snap.mui.green = saveColor(green);
Snap.mui.lightgreen = saveColor(lightgreen);
Snap.mui.lime = saveColor(lime);
Snap.mui.yellow = saveColor(yellow);
Snap.mui.amber = saveColor(amber);
Snap.mui.orange = saveColor(orange);
Snap.mui.deeporange = saveColor(deeporange);
Snap.mui.brown = saveColor(brown);
Snap.mui.grey = saveColor(grey);
Snap.mui.bluegrey = saveColor(bluegrey);
Snap.flat.turquoise = "#1abc9c";
Snap.flat.greensea = "#16a085";
Snap.flat.sunflower = "#f1c40f";
Snap.flat.orange = "#f39c12";
Snap.flat.emerland = "#2ecc71";
Snap.flat.nephritis = "#27ae60";
Snap.flat.carrot = "#e67e22";
Snap.flat.pumpkin = "#d35400";
Snap.flat.peterriver = "#3498db";
Snap.flat.belizehole = "#2980b9";
Snap.flat.alizarin = "#e74c3c";
Snap.flat.pomegranate = "#c0392b";
Snap.flat.amethyst = "#9b59b6";
Snap.flat.wisteria = "#8e44ad";
Snap.flat.clouds = "#ecf0f1";
Snap.flat.silver = "#bdc3c7";
Snap.flat.wetasphalt = "#34495e";
Snap.flat.midnightblue = "#2c3e50";
Snap.flat.concrete = "#95a5a6";
Snap.flat.asbestos = "#7f8c8d";
Snap.importMUIColors = function () {
for (var color in Snap.mui) {
if (Snap.mui.hasOwnProperty(color)) {
window[color] = Snap.mui[color];
}
}
};
}); module.exports = Snap;
} // eve/eve.js $fsx.f[65] = (module, exports) => { (function (glob) {
var version = "0.5.4", has = "hasOwnProperty", separator = /[\.\/]/, comaseparator = /\s*,\s*/, wildcard = "*", numsort = function (a, b) {
return a - b;
}, current_event, stop, events = { n: {} }, firstDefined = function () {
for (var i = 0, ii = this.length; i < ii; i++) {
if (typeof this[i] != "undefined") {
return this[i];
}
}
}, lastDefined = function () {
var i = this.length;
while (--i) {
if (typeof this[i] != "undefined") {
return this[i];
}
}
}, objtos = Object.prototype.toString, Str = String, isArray = Array.isArray || function (ar) {
return ar instanceof Array || objtos.call(ar) == "[object Array]";
}, eve = function (name, scope) {
var oldstop = stop, args = Array.prototype.slice.call(arguments, 2), listeners = eve.listeners(name), z = 0, l, indexed = [], queue = {}, out = [], ce = current_event;
out.firstDefined = firstDefined;
out.lastDefined = lastDefined;
current_event = name;
stop = 0;
for (var i = 0, ii = listeners.length; i < ii; i++)
if ("zIndex" in listeners[i]) {
indexed.push(listeners[i].zIndex);
if (listeners[i].zIndex < 0) {
queue[listeners[i].zIndex] = listeners[i];
}
}
indexed.sort(numsort);
while (indexed[z] < 0) {
l = queue[indexed[z++]];
out.push(l.apply(scope, args));
if (stop) {
stop = oldstop;
return out;
}
}
for (i = 0; i < ii; i++) {
l = listeners[i];
if ("zIndex" in l) {
if (l.zIndex == indexed[z]) {
out.push(l.apply(scope, args));
if (stop) {
break;
}
do {
z++;
l = queue[indexed[z]];
l && out.push(l.apply(scope, args));
if (stop) {
break;
}
} while (l);
}
else {
queue[l.zIndex] = l;
}
}
else {
out.push(l.apply(scope, args));
if (stop) {
break;
}
}
}
stop = oldstop;
current_event = ce;
return out;
};
eve._events = events;
eve.listeners = function (name) {
var names = isArray(name) ? name : name.split(separator), e = events, item, items, k, i, ii, j, jj, nes, es = [e], out = [];
for (i = 0, ii = names.length; i < ii; i++) {
nes = [];
for (j = 0, jj = es.length; j < jj; j++) {
e = es[j].n;
items = [e[names[i]], e[wildcard]];
k = 2;
while (k--) {
item = items[k];
if (item) {
nes.push(item);
out = out.concat(item.f || []);
}
}
}
es = nes;
}
return out;
};
eve.separator = function (sep) {
if (sep) {
sep = Str(sep).replace(/(?=[\.\^\]\[\-])/g, "\\");
sep = "[" + sep + "]";
separator = new RegExp(sep);
}
else {
separator = /[\.\/]/;
}
};
eve.on = function (name, f) {
if (typeof f != "function") {
return function () { };
}
var names = isArray(name) ? isArray(name[0]) ? name : [name] : Str(name).split(comaseparator);
for (var i = 0, ii = names.length; i < ii; i++) {
(function (name) {
var names = isArray(name) ? name : Str(name).split(separator), e = events, exist;
for (var i = 0, ii = names.length; i < ii; i++) {
e = e.n;
e = e.hasOwnProperty(names[i]) && e[names[i]] || (e[names[i]] = { n: {} });
}
e.f = e.f || [];
for (i = 0, ii = e.f.length; i < ii; i++)
if (e.f[i] == f) {
exist = true;
break;
}
!exist && e.f.push(f);
}(names[i]));
}
return function (zIndex) {
if (+zIndex == +zIndex) {
f.zIndex = +zIndex;
}
};
};
eve.f = function (event) {
var attrs = [].slice.call(arguments, 1);
return function () {
eve.apply(null, [event, null].concat(attrs).concat([].slice.call(arguments, 0)));
};
};
eve.stop = function () {
stop = 1;
};
eve.nt = function (subname) {
var cur = isArray(current_event) ? current_event.join(".") : current_event;
if (subname) {
return new RegExp("(?:\\.|\\/|^)" + subname + "(?:\\.|\\/|$)").test(cur);
}
return cur;
};
eve.nts = function () {
return isArray(current_event) ? current_event : current_event.split(separator);
};
eve.off = eve.unbind = function (name, f) {
if (!name) {
eve._events = events = { n: {} };
return;
}
var names = isArray(name) ? isArray(name[0]) ? name : [name] : Str(name).split(comaseparator);
if (names.length > 1) {
for (var i = 0, ii = names.length; i < ii; i++) {
eve.off(names[i], f);
}
return;
}
names = isArray(name) ? name : Str(name).split(separator);
var e, key, splice, i, ii, j, jj, cur = [events], inodes = [];
for (i = 0, ii = names.length; i < ii; i++) {
for (j = 0; j < cur.length; j += splice.length - 2) {
splice = [j, 1];
e = cur[j].n;
if (names[i] != wildcard) {
if (e[names[i]]) {
splice.push(e[names[i]]);
inodes.unshift({
n: e,
name: names[i]
});
}
}
else {
for (key in e)
if (e[has](key)) {
splice.push(e[key]);
inodes.unshift({
n: e,
name: key
});
}
}
cur.splice.apply(cur, splice);
}
}
for (i = 0, ii = cur.length; i < ii; i++) {
e = cur[i];
while (e.n) {
if (f) {
if (e.f) {
for (j = 0, jj = e.f.length; j < jj; j++)
if (e.f[j] == f) {
e.f.splice(j, 1);
break;
}
!e.f.length && delete e.f;
}
for (key in e.n)
if (e.n[has](key) && e.n[key].f) {
var funcs = e.n[key].f;
for (j = 0, jj = funcs.length; j < jj; j++)
if (funcs[j] == f) {
funcs.splice(j, 1);
break;
}
!funcs.length && delete e.n[key].f;
}
}
else {
delete e.f;
for (key in e.n)
if (e.n[has](key) && e.n[key].f) {
delete e.n[key].f;
}
}
e = e.n;
}
}
prune: for (i = 0, ii = inodes.length; i < ii; i++) {
e = inodes[i];
for (key in e.n[e.name].f) {
continue prune;
}
for (key in e.n[e.name].n) {
continue prune;
}
delete e.n[e.name];
}
};
eve.once = function (name, f) {
var f2 = function () {
eve.off(name, f2);
return f.apply(this, arguments);
};
return eve.on(name, f2);
};
eve.version = version;
eve.toString = function () {
return "You are running Eve " + version;
};
glob.eve = eve;
typeof module != "undefined" && module.exports ? module.exports = eve : typeof define === "function" && define.amd ? define("eve", [], function () { return eve; }) : glob.eve = eve;
})(typeof window != "undefined" ? window : this);
} // react-burger-menu/lib/menus/bubble.js $fsx.f[69] = (module, exports) => { 'use strict'; Object.defineProperty(exports, '__esModule', {
value: true
}); function _interopRequireDefault(obj) { return obj && obj.__esModule ? obj : { 'default': obj }; } var _snapsvgImporter = $fsx.r(67); var _snapsvgImporter2 = _interopRequireDefault(_snapsvgImporter); var _menuFactory = $fsx.r(62); var _menuFactory2 = _interopRequireDefault(_menuFactory); var styles = {
svg: {
lib: _snapsvgImporter2['default'],
pathInitial: 'M-7.312,0H0c0,0,0,113.839,0,400c0,264.506,0,400,0,400h-7.312V0z',
pathOpen: 'M-7.312,0H15c0,0,66,113.339,66,399.5C81,664.006,15,800,15,800H-7.312V0z;M-7.312,0H100c0,0,0,113.839,0,400c0,264.506,0,400,0,400H-7.312V0z',
animate: function animate(path) {
var pos = 0;
var steps = this.pathOpen.split(';');
var stepsTotal = steps.length;
var mina = window.mina;
var nextStep = function nextStep() {
if (pos > stepsTotal - 1)
return;
path.animate({ path: steps[pos] }, pos === 0 ? 400 : 500, pos === 0 ? mina.easein : mina.elastic, function () {
nextStep();
});
pos++;
};
nextStep();
}
},
morphShape: function morphShape(isOpen, width, right) {
return {
position: 'absolute',
width: '100%',
height: '100%',
right: right ? 'inherit' : 0,
left: right ? 0 : 'inherit',
MozTransform: right ? 'rotateY(180deg)' : 'rotateY(0deg)',
MsTransform: right ? 'rotateY(180deg)' : 'rotateY(0deg)',
OTransform: right ? 'rotateY(180deg)' : 'rotateY(0deg)',
WebkitTransform: right ? 'rotateY(180deg)' : 'rotateY(0deg)',
transform: right ? 'rotateY(180deg)' : 'rotateY(0deg)'
};
},
menuWrap: function menuWrap(isOpen, width, right) {
return {
MozTransform: isOpen ? 'translate3d(0, 0, 0)' : right ? 'translate3d(100%, 0, 0)' : 'translate3d(-100%, 0, 0)',
MsTransform: isOpen ? 'translate3d(0, 0, 0)' : right ? 'translate3d(100%, 0, 0)' : 'translate3d(-100%, 0, 0)',
OTransform: isOpen ? 'translate3d(0, 0, 0)' : right ? 'translate3d(100%, 0, 0)' : 'translate3d(-100%, 0, 0)',
WebkitTransform: isOpen ? 'translate3d(0, 0, 0)' : right ? 'translate3d(100%, 0, 0)' : 'translate3d(-100%, 0, 0)',
transform: isOpen ? 'translate3d(0, 0, 0)' : right ? 'translate3d(100%, 0, 0)' : 'translate3d(-100%, 0, 0)',
transition: isOpen ? 'transform 0.4s 0s' : 'transform 0.4s'
};
},
menu: function menu(isOpen, width, right) {
width -= 140;
return {
position: 'fixed',
MozTransform: isOpen ? : right ? 'translate3d(' + width + ', 0, 0)' : 'translate3d(-' + width + ', 0, 0)',
MsTransform: isOpen ? : right ? 'translate3d(' + width + ', 0, 0)' : 'translate3d(-' + width + ', 0, 0)',
OTransform: isOpen ? : right ? 'translate3d(' + width + ', 0, 0)' : 'translate3d(-' + width + ', 0, 0)',
WebkitTransform: isOpen ? : right ? 'translate3d(' + width + ', 0, 0)' : 'translate3d(-' + width + ', 0, 0)',
transform: isOpen ? : right ? 'translate3d(' + width + ', 0, 0)' : 'translate3d(-' + width + ', 0, 0)',
transition: isOpen ? 'opacity 0.1s 0.4s cubic-bezier(.17, .67, .1, 1.27), transform 0.1s 0.4s cubic-bezier(.17, .67, .1, 1.27)' : 'opacity 0s 0.3s cubic-bezier(.17, .67, .1, 1.27), transform 0s 0.3s cubic-bezier(.17, .67, .1, 1.27)',
opacity: isOpen ? 1 : 0
};
},
item: function item(isOpen, width, right, nthChild) {
width -= 140;
return {
MozTransform: isOpen ? 'translate3d(0, 0, 0)' : right ? 'translate3d(' + width + ', 0, 0)' : 'translate3d(-' + width + ', 0, 0)',
MsTransform: isOpen ? 'translate3d(0, 0, 0)' : right ? 'translate3d(' + width + ', 0, 0)' : 'translate3d(-' + width + ', 0, 0)',
OTransform: isOpen ? 'translate3d(0, 0, 0)' : right ? 'translate3d(' + width + ', 0, 0)' : 'translate3d(-' + width + ', 0, 0)',
WebkitTransform: isOpen ? 'translate3d(0, 0, 0)' : right ? 'translate3d(' + width + ', 0, 0)' : 'translate3d(-' + width + ', 0, 0)',
transform: isOpen ? 'translate3d(0, 0, 0)' : right ? 'translate3d(' + width + ', 0, 0)' : 'translate3d(-' + width + ', 0, 0)',
transition: isOpen ? 'opacity 0.3s 0.4s, transform 0.3s 0.4s' : 'opacity 0s 0.3s cubic-bezier(.17, .67, .1, 1.27), transform 0s 0.3s cubic-bezier(.17, .67, .1, 1.27)',
opacity: isOpen ? 1 : 0
};
},
closeButton: function closeButton(isOpen, width, right) {
width -= 140;
return {
MozTransform: isOpen ? 'translate3d(0, 0, 0)' : right ? 'translate3d(' + width + ', 0, 0)' : 'translate3d(-' + width + ', 0, 0)',
MsTransform: isOpen ? 'translate3d(0, 0, 0)' : right ? 'translate3d(' + width + ', 0, 0)' : 'translate3d(-' + width + ', 0, 0)',
OTransform: isOpen ? 'translate3d(0, 0, 0)' : right ? 'translate3d(' + width + ', 0, 0)' : 'translate3d(-' + width + ', 0, 0)',
WebkitTransform: isOpen ? 'translate3d(0, 0, 0)' : right ? 'translate3d(' + width + ', 0, 0)' : 'translate3d(-' + width + ', 0, 0)',
transform: isOpen ? 'translate3d(0, 0, 0)' : right ? 'translate3d(' + width + ', 0, 0)' : 'translate3d(-' + width + ', 0, 0)',
transition: isOpen ? 'opacity 0.3s 0.4s cubic-bezier(.17, .67, .1, 1.27), transform 0.3s 0.4s cubic-bezier(.17, .67, .1, 1.27)' : 'opacity 0s 0.3s cubic-bezier(.17, .67, .1, 1.27), transform 0s 0.3s cubic-bezier(.17, .67, .1, 1.27)',
opacity: isOpen ? 1 : 0
};
}
}; exports['default'] = (0, _menuFactory2['default'])(styles); module.exports = exports['default'];
} // react-burger-menu/lib/menus/push.js $fsx.f[70] = (module, exports) => { 'use strict'; Object.defineProperty(exports, '__esModule', {
value: true
}); function _interopRequireDefault(obj) { return obj && obj.__esModule ? obj : { 'default': obj }; } var _menuFactory = $fsx.r(62); var _menuFactory2 = _interopRequireDefault(_menuFactory); var styles = {
pageWrap: function pageWrap(isOpen, width, right) {
return {
MozTransform: isOpen ? : right ? 'translate3d(-' + width + ', 0, 0)' : 'translate3d(' + width + ', 0, 0)',
MsTransform: isOpen ? : right ? 'translate3d(-' + width + ', 0, 0)' : 'translate3d(' + width + ', 0, 0)',
OTransform: isOpen ? : right ? 'translate3d(-' + width + ', 0, 0)' : 'translate3d(' + width + ', 0, 0)',
WebkitTransform: isOpen ? : right ? 'translate3d(-' + width + ', 0, 0)' : 'translate3d(' + width + ', 0, 0)',
transform: isOpen ? : right ? 'translate3d(-' + width + ', 0, 0)' : 'translate3d(' + width + ', 0, 0)',
transition: 'all 0.5s'
};
},
outerContainer: function outerContainer(isOpen) {
return {
overflow: isOpen ? : 'hidden'
};
}
}; exports['default'] = (0, _menuFactory2['default'])(styles); module.exports = exports['default'];
} // react-burger-menu/lib/menus/pushRotate.js $fsx.f[71] = (module, exports) => { 'use strict'; Object.defineProperty(exports, '__esModule', {
value: true
}); function _interopRequireDefault(obj) { return obj && obj.__esModule ? obj : { 'default': obj }; } var _menuFactory = $fsx.r(62); var _menuFactory2 = _interopRequireDefault(_menuFactory); var styles = {
pageWrap: function pageWrap(isOpen, width, right) {
return {
MozTransform: isOpen ? : right ? 'translate3d(-' + width + ', 0, 0) rotateY(15deg)' : 'translate3d(' + width + ', 0, 0) rotateY(-15deg)',
MsTransform: isOpen ? : right ? 'translate3d(-' + width + ', 0, 0) rotateY(15deg)' : 'translate3d(' + width + ', 0, 0) rotateY(-15deg)',
OTransform: isOpen ? : right ? 'translate3d(-' + width + ', 0, 0) rotateY(15deg)' : 'translate3d(' + width + ', 0, 0) rotateY(-15deg)',
WebkitTransform: isOpen ? : right ? 'translate3d(-' + width + ', 0, 0) rotateY(15deg)' : 'translate3d(' + width + ', 0, 0) rotateY(-15deg)',
transform: isOpen ? : right ? 'translate3d(-' + width + ', 0, 0) rotateY(15deg)' : 'translate3d(' + width + ', 0, 0) rotateY(-15deg)',
transformOrigin: right ? '100% 50%' : '0% 50%',
transformStyle: 'preserve-3d',
transition: 'all 0.5s'
};
},
outerContainer: function outerContainer(isOpen) {
return {
perspective: '1500px',
overflow: isOpen ? : 'hidden'
};
}
}; exports['default'] = (0, _menuFactory2['default'])(styles); module.exports = exports['default'];
} // react-burger-menu/lib/menus/scaleDown.js $fsx.f[72] = (module, exports) => { 'use strict'; Object.defineProperty(exports, '__esModule', {
value: true
}); function _interopRequireDefault(obj) { return obj && obj.__esModule ? obj : { 'default': obj }; } var _menuFactory = $fsx.r(62); var _menuFactory2 = _interopRequireDefault(_menuFactory); var styles = {
pageWrap: function pageWrap(isOpen, width) {
return {
MozTransform: isOpen ? : 'translate3d(0, 0, -' + width + ')',
MsTransform: isOpen ? : 'translate3d(0, 0, -' + width + ')',
OTransform: isOpen ? : 'translate3d(0, 0, -' + width + ')',
WebkitTransform: isOpen ? : 'translate3d(0, 0, -' + width + ')',
transform: isOpen ? : 'translate3d(0, 0, -' + width + ')',
transformOrigin: '100%',
transformStyle: 'preserve-3d',
transition: 'all 0.5s'
};
},
outerContainer: function outerContainer() {
return {
perspective: '1500px'
};
}
}; exports['default'] = (0, _menuFactory2['default'])(styles); module.exports = exports['default'];
} // react-burger-menu/lib/menus/scaleRotate.js $fsx.f[73] = (module, exports) => { 'use strict'; Object.defineProperty(exports, '__esModule', {
value: true
}); function _interopRequireDefault(obj) { return obj && obj.__esModule ? obj : { 'default': obj }; } var _menuFactory = $fsx.r(62); var _menuFactory2 = _interopRequireDefault(_menuFactory); var styles = {
pageWrap: function pageWrap(isOpen, width, right) {
return {
MozTransform: isOpen ? : right ? 'translate3d(-100px, 0, -600px) rotateY(20deg)' : 'translate3d(100px, 0, -600px) rotateY(-20deg)',
MsTransform: isOpen ? : right ? 'translate3d(-100px, 0, -600px) rotateY(20deg)' : 'translate3d(100px, 0, -600px) rotateY(-20deg)',
OTransform: isOpen ? : right ? 'translate3d(-100px, 0, -600px) rotateY(20deg)' : 'translate3d(100px, 0, -600px) rotateY(-20deg)',
WebkitTransform: isOpen ? : right ? 'translate3d(-100px, 0, -600px) rotateY(20deg)' : 'translate3d(100px, 0, -600px) rotateY(-20deg)',
transform: isOpen ? : right ? 'translate3d(-100px, 0, -600px) rotateY(20deg)' : 'translate3d(100px, 0, -600px) rotateY(-20deg)',
transformStyle: 'preserve-3d',
transition: 'all 0.5s',
overflow: isOpen ? : 'hidden'
};
},
outerContainer: function outerContainer(isOpen) {
return {
perspective: '1500px',
overflow: isOpen ? : 'hidden'
};
}
}; exports['default'] = (0, _menuFactory2['default'])(styles); module.exports = exports['default'];
} // react-burger-menu/lib/menus/fallDown.js $fsx.f[74] = (module, exports) => { 'use strict'; Object.defineProperty(exports, '__esModule', {
value: true
}); function _interopRequireDefault(obj) { return obj && obj.__esModule ? obj : { 'default': obj }; } var _menuFactory = $fsx.r(62); var _menuFactory2 = _interopRequireDefault(_menuFactory); var styles = {
menuWrap: function menuWrap(isOpen) {
return {
MozTransform: isOpen ? : 'translate3d(0, -100%, 0)',
MsTransform: isOpen ? : 'translate3d(0, -100%, 0)',
OTransform: isOpen ? : 'translate3d(0, -100%, 0)',
WebkitTransform: isOpen ? : 'translate3d(0, -100%, 0)',
transform: isOpen ? : 'translate3d(0, -100%, 0)',
transition: 'all 0.5s ease-in-out'
};
},
pageWrap: function pageWrap(isOpen, width, right) {
return {
MozTransform: isOpen ? : right ? 'translate3d(-' + width + ', 0, 0)' : 'translate3d(' + width + ', 0, 0)',
MsTransform: isOpen ? : right ? 'translate3d(-' + width + ', 0, 0)' : 'translate3d(' + width + ', 0, 0)',
OTransform: isOpen ? : right ? 'translate3d(-' + width + ', 0, 0)' : 'translate3d(' + width + ', 0, 0)',
WebkitTransform: isOpen ? : right ? 'translate3d(-' + width + ', 0, 0)' : 'translate3d(' + width + ', 0, 0)',
transform: isOpen ? : right ? 'translate3d(-' + width + ', 0, 0)' : 'translate3d(' + width + ', 0, 0)',
transition: 'all 0.5s'
};
},
outerContainer: function outerContainer(isOpen) {
return {
perspective: '1500px',
perspectiveOrigin: '0% 50%',
overflow: isOpen ? : 'hidden'
};
}
}; exports['default'] = (0, _menuFactory2['default'])(styles); module.exports = exports['default'];
} // react-burger-menu/lib/menus/reveal.js $fsx.f[75] = (module, exports) => { 'use strict'; Object.defineProperty(exports, '__esModule', {
value: true
}); function _interopRequireDefault(obj) { return obj && obj.__esModule ? obj : { 'default': obj }; } var _menuFactory = $fsx.r(62); var _menuFactory2 = _interopRequireDefault(_menuFactory); var styles = {
menuWrap: function menuWrap(isOpen, width, right) {
return {
visibility: isOpen ? 'visible' : 'hidden',
MozTransform: 'translate3d(0, 0, 0)',
MsTransform: 'translate3d(0, 0, 0)',
OTransform: 'translate3d(0, 0, 0)',
WebkitTransform: 'translate3d(0, 0, 0)',
transform: 'translate3d(0, 0, 0)',
zIndex: 1000
};
},
overlay: function overlay(isOpen, width, right) {
return {
zIndex: 1400,
MozTransform: isOpen ? right ? 'translate3d(-' + width + ', 0, 0)' : 'translate3d(' + width + ', 0, 0)' : 'translate3d(0, 0, 0)',
MsTransform: isOpen ? right ? 'translate3d(-' + width + ', 0, 0)' : 'translate3d(' + width + ', 0, 0)' : 'translate3d(0, 0, 0)',
OTransform: isOpen ? right ? 'translate3d(-' + width + ', 0, 0)' : 'translate3d(' + width + ', 0, 0)' : 'translate3d(0, 0, 0)',
WebkitTransform: isOpen ? right ? 'translate3d(-' + width + ', 0, 0)' : 'translate3d(' + width + ', 0, 0)' : 'translate3d(0, 0, 0)',
transform: isOpen ? right ? 'translate3d(-' + width + ', 0, 0)' : 'translate3d(' + width + ', 0, 0)' : 'translate3d(0, 0, 0)',
transition: 'all 0.5s',
visibility: isOpen ? 'visible' : 'hidden'
};
},
pageWrap: function pageWrap(isOpen, width, right) {
return {
MozTransform: isOpen ? : right ? 'translate3d(-' + width + ', 0, 0)' : 'translate3d(' + width + ', 0, 0)',
MsTransform: isOpen ? : right ? 'translate3d(-' + width + ', 0, 0)' : 'translate3d(' + width + ', 0, 0)',
OTransform: isOpen ? : right ? 'translate3d(-' + width + ', 0, 0)' : 'translate3d(' + width + ', 0, 0)',
WebkitTransform: isOpen ? : right ? 'translate3d(-' + width + ', 0, 0)' : 'translate3d(' + width + ', 0, 0)',
transform: isOpen ? : right ? 'translate3d(-' + width + ', 0, 0)' : 'translate3d(' + width + ', 0, 0)',
transition: 'all 0.5s',
zIndex: 1200,
position: 'relative'
};
},
burgerIcon: function burgerIcon(isOpen, width, right) {
return {
MozTransform: isOpen ? right ? 'translate3d(' + width + ', 0, 0)' : 'translate3d(-' + width + ', 0, 0)' : 'translate3d(0, 0, 0)',
MsTransform: isOpen ? right ? 'translate3d(' + width + ', 0, 0)' : 'translate3d(-' + width + ', 0, 0)' : 'translate3d(0, 0, 0)',
OTransform: isOpen ? right ? 'translate3d(' + width + ', 0, 0)' : 'translate3d(-' + width + ', 0, 0)' : 'translate3d(0, 0, 0)',
WebkitTransform: isOpen ? right ? 'translate3d(' + width + ', 0, 0)' : 'translate3d(-' + width + ', 0, 0)' : 'translate3d(0, 0, 0)',
transform: isOpen ? right ? 'translate3d(' + width + ', 0, 0)' : 'translate3d(-' + width + ', 0, 0)' : 'translate3d(0, 0, 0)',
transition: 'all 0.1s',
position: 'relative',
zIndex: 1300
};
},
outerContainer: function outerContainer(isOpen) {
return {
overflow: isOpen ? : 'hidden'
};
}
}; exports['default'] = (0, _menuFactory2['default'])(styles); module.exports = exports['default'];
} // react-scroll-progress-bar/build/index.js $fsx.f[79] = (module, exports) => { module.exports = function (t) { var e = {}; function n(o) { if (e[o])
return e[o].exports; var r = e[o] = { i: o, l: !1, exports: {} }; return t[o].call(r.exports, r, r.exports, n), r.l = !0, r.exports; } return n.m = t, n.c = e, n.d = function (t, e, o) { n.o(t, e) || Object.defineProperty(t, e, { configurable: !1, enumerable: !0, get: o }); }, n.r = function (t) { Object.defineProperty(t, "__esModule", { value: !0 }); }, n.n = function (t) { var e = t && t.__esModule ? function () { return t.default; } : function () { return t; }; return n.d(e, "a", e), e; }, n.o = function (t, e) { return Object.prototype.hasOwnProperty.call(t, e); }, n.p = "", n(n.s = 4); }([function (t, e) { t.exports = $fsx.r(3); }, function (t, e, n) { t.exports = n(3)(); }, function (t, e, n) {
"use strict";
t.exports = "SECRET_DO_NOT_PASS_THIS_OR_YOU_WILL_BE_FIRED";
}, function (t, e, n) {
"use strict";
var o = n(2);
function r() { }
t.exports = function () { function t(t, e, n, r, c, i) { if (i !== o) {
var u = new Error("Calling PropTypes validators directly is not supported by the `prop-types` package. Use PropTypes.checkPropTypes() to call them. Read more at http://fb.me/use-check-prop-types");
throw u.name = "Invariant Violation", u;
} } function e() { return t; } t.isRequired = t; var n = { array: t, bool: t, func: t, number: t, object: t, string: t, symbol: t, any: t, arrayOf: e, element: t, instanceOf: e, node: t, objectOf: e, oneOf: e, oneOfType: e, shape: e, exact: e }; return n.checkPropTypes = r, n.PropTypes = n, n; };
}, function (t, e, n) {
"use strict";
n.r(e);
var o = n(1), r = n.n(o), c = n(0), i = n.n(c);
function u(t) { return (u = "function" == typeof Symbol && "symbol" == typeof Symbol.iterator ? function (t) { return typeof t; } : function (t) { return t && "function" == typeof Symbol && t.constructor === Symbol && t !== Symbol.prototype ? "symbol" : typeof t; })(t); }
function l(t, e) { for (var n = 0; n < e.length; n++) {
var o = e[n];
o.enumerable = o.enumerable || !1, o.configurable = !0, "value" in o && (o.writable = !0), Object.defineProperty(t, o.key, o);
} }
function a(t) { return (a = Object.setPrototypeOf ? Object.getPrototypeOf : function (t) { return t.__proto__ || Object.getPrototypeOf(t); })(t); }
function s(t, e) { return (s = Object.setPrototypeOf || function (t, e) { return t.__proto__ = e, t; })(t, e); }
function p(t) { if (void 0 === t)
throw new ReferenceError("this hasn't been initialised - super() hasn't been called"); return t; }
var f = function (t) { function e(t) { var n; return function (t, e) { if (!(t instanceof e))
throw new TypeError("Cannot call a class as a function"); }(this, e), (n = function (t, e) { return !e || "object" !== u(e) && "function" != typeof e ? p(t) : e; }(this, a(e).call(this, t))).state = { width: null }, n.Scrolling = n.Scrolling.bind(p(p(n))), n; } return function (t, e) { if ("function" != typeof e && null !== e)
throw new TypeError("Super expression must either be null or a function"); t.prototype = Object.create(e && e.prototype, { constructor: { value: t, writable: !0, configurable: !0 } }), e && s(t, e); }(e, c["Component"]), function (t, e, n) { e && l(t.prototype, e), n && l(t, n); }(e, [{ key: "Scrolling", value: function () { var t = document.body.scrollTop || document.documentElement.scrollTop, e = document.documentElement.scrollHeight - document.documentElement.clientHeight, n = t / e * 100; e > 0 ? this.setState({ width: "".concat(n, "%") }) : this.setState({ width: null }); } }, { key: "componentDidMount", value: function () { try {
window.addEventListener("scroll", this.Scrolling);
}
catch (t) {
console.log(t);
} } }, { key: "componentWillUnmount", value: function () { try {
window.removeEventListener("scroll", this.Scrolling);
}
catch (t) {
console.log(t);
} } }, { key: "render", value: function () { var t = this.state.width, e = this.props, n = e.height, o = e.bgcolor; return i.a.createElement("div", { style: function (t) { var e = arguments.length > 1 && void 0 !== arguments[1] ? arguments[1] : "4px", n = arguments.length > 2 && void 0 !== arguments[2] ? arguments[2] : "#F43059"; return { margin: 0, padding: 0, position: "fixed", top: 0, zIndex: "99", backgroundColor: "".concat(n), height: "".concat(e), width: "".concat(t), transition: "".concat(t, " 0.2s ease-out") }; }(t, n, o) }); } }]), e; }();
f.propTypes = { height: r.a.number, color: r.a.string.isRequired }, e.default = f;
}]);
} // gsap/index.js $fsx.f[91] = (module, exports) => { "use strict"; Object.defineProperty(exports, "__esModule", { value: true }); const TweenLite_js_1 = $fsx.r(80); exports.TweenLite = TweenLite_js_1.default; exports._gsScope = TweenLite_js_1._gsScope; exports.TweenPlugin = TweenLite_js_1.TweenPlugin; exports.Ease = TweenLite_js_1.Ease; exports.Power0 = TweenLite_js_1.Power0; exports.Power1 = TweenLite_js_1.Power1; exports.Power2 = TweenLite_js_1.Power2; exports.Power3 = TweenLite_js_1.Power3; exports.Power4 = TweenLite_js_1.Power4; exports.Linear = TweenLite_js_1.Linear; const TimelineLite_js_1 = $fsx.r(81); exports.TimelineLite = TimelineLite_js_1.default; const TimelineMax_js_1 = $fsx.r(82); exports.TimelineMax = TimelineMax_js_1.default; const TweenMax_js_1 = $fsx.r(90); exports.default = TweenMax_js_1.default; exports.TweenMax = TweenMax_js_1.default; const CSSPlugin_js_1 = $fsx.r(84); exports.CSSPlugin = CSSPlugin_js_1.default; const AttrPlugin_js_1 = $fsx.r(85); exports.AttrPlugin = AttrPlugin_js_1.default; const RoundPropsPlugin_js_1 = $fsx.r(86); exports.RoundPropsPlugin = RoundPropsPlugin_js_1.default; const DirectionalRotationPlugin_js_1 = $fsx.r(87); exports.DirectionalRotationPlugin = DirectionalRotationPlugin_js_1.default; const BezierPlugin_js_1 = $fsx.r(88); exports.BezierPlugin = BezierPlugin_js_1.default; const EasePack_js_1 = $fsx.r(89); exports.Back = EasePack_js_1.Back; exports.Elastic = EasePack_js_1.Elastic; exports.Bounce = EasePack_js_1.Bounce; exports.RoughEase = EasePack_js_1.RoughEase; exports.SlowMo = EasePack_js_1.SlowMo; exports.SteppedEase = EasePack_js_1.SteppedEase; exports.Circ = EasePack_js_1.Circ; exports.Expo = EasePack_js_1.Expo; exports.Sine = EasePack_js_1.Sine; exports.ExpoScaleEase = EasePack_js_1.ExpoScaleEase;
} // gsap/TweenLite.js $fsx.f[80] = (module, exports) => { "use strict"; Object.defineProperty(exports, "__esModule", { value: true }); exports._gsScope = (typeof (window) !== "undefined") ? window : (typeof (module) !== "undefined" && module.exports && typeof (global) !== "undefined") ? global : this || {}; exports.TweenLite = (function (window) {
"use strict";
var _exports = {}, _doc = window.document, _globals = window.GreenSockGlobals = window.GreenSockGlobals || window;
if (_globals.TweenLite) {
return _globals.TweenLite;
}
var _namespace = function (ns) {
var a = ns.split("."), p = _globals, i;
for (i = 0; i < a.length; i++) {
p[a[i]] = p = p[a[i]] || {};
}
return p;
}, gs = _namespace("com.greensock"), _tinyNum = 0.00000001, _slice = function (a) {
var b = [], l = a.length, i;
for (i = 0; i !== l; b.push(a[i++])) { }
return b;
}, _emptyFunc = function () { }, _isArray = (function () {
var toString = Object.prototype.toString, array = toString.call([]);
return function (obj) {
return obj != null && (obj instanceof Array || (typeof (obj) === "object" && !!obj.push && toString.call(obj) === array));
};
}()), a, i, p, _ticker, _tickerActive, _defLookup = {}, Definition = function (ns, dependencies, func, global) {
this.sc = (_defLookup[ns]) ? _defLookup[ns].sc : [];
_defLookup[ns] = this;
this.gsClass = null;
this.func = func;
var _classes = [];
this.check = function (init) {
var i = dependencies.length, missing = i, cur, a, n, cl;
while (--i > -1) {
if ((cur = _defLookup[dependencies[i]] || new Definition(dependencies[i], [])).gsClass) {
_classes[i] = cur.gsClass;
missing--;
}
else if (init) {
cur.sc.push(this);
}
}
if (missing === 0 && func) {
a = ("com.greensock." + ns).split(".");
n = a.pop();
cl = _namespace(a.join("."))[n] = this.gsClass = func.apply(func, _classes);
if (global) {
_globals[n] = _exports[n] = cl;
}
for (i = 0; i < this.sc.length; i++) {
this.sc[i].check();
}
}
};
this.check(true);
}, _gsDefine = window._gsDefine = function (ns, dependencies, func, global) {
return new Definition(ns, dependencies, func, global);
}, _class = gs._class = function (ns, func, global) {
func = func || function () { };
_gsDefine(ns, [], function () { return func; }, global);
return func;
};
_gsDefine.globals = _globals;
var _baseParams = [0, 0, 1, 1], Ease = _class("easing.Ease", function (func, extraParams, type, power) {
this._func = func;
this._type = type || 0;
this._power = power || 0;
this._params = extraParams ? _baseParams.concat(extraParams) : _baseParams;
}, true), _easeMap = Ease.map = {}, _easeReg = Ease.register = function (ease, names, types, create) {
var na = names.split(","), i = na.length, ta = (types || "easeIn,easeOut,easeInOut").split(","), e, name, j, type;
while (--i > -1) {
name = na[i];
e = create ? _class("easing." + name, null, true) : gs.easing[name] || {};
j = ta.length;
while (--j > -1) {
type = ta[j];
_easeMap[name + "." + type] = _easeMap[type + name] = e[type] = ease.getRatio ? ease : ease[type] || new ease();
}
}
};
p = Ease.prototype;
p._calcEnd = false;
p.getRatio = function (p) {
if (this._func) {
this._params[0] = p;
return this._func.apply(null, this._params);
}
var t = this._type, pw = this._power, r = (t === 1) ? 1 - p : (t === 2) ? p : (p < 0.5) ? p * 2 : (1 - p) * 2;
if (pw === 1) {
r *= r;
}
else if (pw === 2) {
r *= r * r;
}
else if (pw === 3) {
r *= r * r * r;
}
else if (pw === 4) {
r *= r * r * r * r;
}
return (t === 1) ? 1 - r : (t === 2) ? r : (p < 0.5) ? r / 2 : 1 - (r / 2);
};
a = ["Linear", "Quad", "Cubic", "Quart", "Quint,Strong"];
i = a.length;
while (--i > -1) {
p = a[i] + ",Power" + i;
_easeReg(new Ease(null, null, 1, i), p, "easeOut", true);
_easeReg(new Ease(null, null, 2, i), p, "easeIn" + ((i === 0) ? ",easeNone" : ""));
_easeReg(new Ease(null, null, 3, i), p, "easeInOut");
}
_easeMap.linear = gs.easing.Linear.easeIn;
_easeMap.swing = gs.easing.Quad.easeInOut;
var EventDispatcher = _class("events.EventDispatcher", function (target) {
this._listeners = {};
this._eventTarget = target || this;
});
p = EventDispatcher.prototype;
p.addEventListener = function (type, callback, scope, useParam, priority) {
priority = priority || 0;
var list = this._listeners[type], index = 0, listener, i;
if (this === _ticker && !_tickerActive) {
_ticker.wake();
}
if (list == null) {
this._listeners[type] = list = [];
}
i = list.length;
while (--i > -1) {
listener = list[i];
if (listener.c === callback && listener.s === scope) {
list.splice(i, 1);
}
else if (index === 0 && listener.pr < priority) {
index = i + 1;
}
}
list.splice(index, 0, { c: callback, s: scope, up: useParam, pr: priority });
};
p.removeEventListener = function (type, callback) {
var list = this._listeners[type], i;
if (list) {
i = list.length;
while (--i > -1) {
if (list[i].c === callback) {
list.splice(i, 1);
return;
}
}
}
};
p.dispatchEvent = function (type) {
var list = this._listeners[type], i, t, listener;
if (list) {
i = list.length;
if (i > 1) {
list = list.slice(0);
}
t = this._eventTarget;
while (--i > -1) {
listener = list[i];
if (listener) {
if (listener.up) {
listener.c.call(listener.s || t, { type: type, target: t });
}
else {
listener.c.call(listener.s || t);
}
}
}
}
};
var _reqAnimFrame = window.requestAnimationFrame, _cancelAnimFrame = window.cancelAnimationFrame, _getTime = Date.now || function () { return new Date().getTime(); }, _lastUpdate = _getTime();
a = ["ms", "moz", "webkit", "o"];
i = a.length;
while (--i > -1 && !_reqAnimFrame) {
_reqAnimFrame = window[a[i] + "RequestAnimationFrame"];
_cancelAnimFrame = window[a[i] + "CancelAnimationFrame"] || window[a[i] + "CancelRequestAnimationFrame"];
}
_class("Ticker", function (fps, useRAF) {
var _self = this, _startTime = _getTime(), _useRAF = (useRAF !== false && _reqAnimFrame) ? "auto" : false, _lagThreshold = 500, _adjustedLag = 33, _tickWord = "tick", _fps, _req, _id, _gap, _nextTime, _tick = function (manual) {
var elapsed = _getTime() - _lastUpdate, overlap, dispatch;
if (elapsed > _lagThreshold) {
_startTime += elapsed - _adjustedLag;
}
_lastUpdate += elapsed;
_self.time = (_lastUpdate - _startTime) / 1000;
overlap = _self.time - _nextTime;
if (!_fps || overlap > 0 || manual === true) {
_self.frame++;
_nextTime += overlap + (overlap >= _gap ? 0.004 : _gap - overlap);
dispatch = true;
}
if (manual !== true) {
_id = _req(_tick);
}
if (dispatch) {
_self.dispatchEvent(_tickWord);
}
};
EventDispatcher.call(_self);
_self.time = _self.frame = 0;
_self.tick = function () {
_tick(true);
};
_self.lagSmoothing = function (threshold, adjustedLag) {
if (!arguments.length) {
return (_lagThreshold < 1 / _tinyNum);
}
_lagThreshold = threshold || (1 / _tinyNum);
_adjustedLag = Math.min(adjustedLag, _lagThreshold, 0);
};
_self.sleep = function () {
if (_id == null) {
return;
}
if (!_useRAF || !_cancelAnimFrame) {
clearTimeout(_id);
}
else {
_cancelAnimFrame(_id);
}
_req = _emptyFunc;
_id = null;
if (_self === _ticker) {
_tickerActive = false;
}
};
_self.wake = function (seamless) {
if (_id !== null) {
_self.sleep();
}
else if (seamless) {
_startTime += -_lastUpdate + (_lastUpdate = _getTime());
}
else if (_self.frame > 10) {
_lastUpdate = _getTime() - _lagThreshold + 5;
}
_req = (_fps === 0) ? _emptyFunc : (!_useRAF || !_reqAnimFrame) ? function (f) { return setTimeout(f, ((_nextTime - _self.time) * 1000 + 1) | 0); } : _reqAnimFrame;
if (_self === _ticker) {
_tickerActive = true;
}
_tick(2);
};
_self.fps = function (value) {
if (!arguments.length) {
return _fps;
}
_fps = value;
_gap = 1 / (_fps || 60);
_nextTime = this.time + _gap;
_self.wake();
};
_self.useRAF = function (value) {
if (!arguments.length) {
return _useRAF;
}
_self.sleep();
_useRAF = value;
_self.fps(_fps);
};
_self.fps(fps);
setTimeout(function () {
if (_useRAF === "auto" && _self.frame < 5 && (_doc || {}).visibilityState !== "hidden") {
_self.useRAF(false);
}
}, 1500);
});
p = gs.Ticker.prototype = new gs.events.EventDispatcher();
p.constructor = gs.Ticker;
var Animation = _class("core.Animation", function (duration, vars) {
this.vars = vars = vars || {};
this._duration = this._totalDuration = duration || 0;
this._delay = Number(vars.delay) || 0;
this._timeScale = 1;
this._active = !!vars.immediateRender;
this.data = vars.data;
this._reversed = !!vars.reversed;
if (!_rootTimeline) {
return;
}
if (!_tickerActive) {
_ticker.wake();
}
var tl = this.vars.useFrames ? _rootFramesTimeline : _rootTimeline;
tl.add(this, tl._time);
if (this.vars.paused) {
this.paused(true);
}
});
_ticker = Animation.ticker = new gs.Ticker();
p = Animation.prototype;
p._dirty = p._gc = p._initted = p._paused = false;
p._totalTime = p._time = 0;
p._rawPrevTime = -1;
p._next = p._last = p._onUpdate = p._timeline = p.timeline = null;
p._paused = false;
var _checkTimeout = function () {
if (_tickerActive && _getTime() - _lastUpdate > 2000 && ((_doc || {}).visibilityState !== "hidden" || !_ticker.lagSmoothing())) {
_ticker.wake();
}
var t = setTimeout(_checkTimeout, 2000);
if (t.unref) {
t.unref();
}
};
_checkTimeout();
p.play = function (from, suppressEvents) {
if (from != null) {
this.seek(from, suppressEvents);
}
return this.reversed(false).paused(false);
};
p.pause = function (atTime, suppressEvents) {
if (atTime != null) {
this.seek(atTime, suppressEvents);
}
return this.paused(true);
};
p.resume = function (from, suppressEvents) {
if (from != null) {
this.seek(from, suppressEvents);
}
return this.paused(false);
};
p.seek = function (time, suppressEvents) {
return this.totalTime(Number(time), suppressEvents !== false);
};
p.restart = function (includeDelay, suppressEvents) {
return this.reversed(false).paused(false).totalTime(includeDelay ? -this._delay : 0, (suppressEvents !== false), true);
};
p.reverse = function (from, suppressEvents) {
if (from != null) {
this.seek((from || this.totalDuration()), suppressEvents);
}
return this.reversed(true).paused(false);
};
p.render = function (time, suppressEvents, force) {
};
p.invalidate = function () {
this._time = this._totalTime = 0;
this._initted = this._gc = false;
this._rawPrevTime = -1;
if (this._gc || !this.timeline) {
this._enabled(true);
}
return this;
};
p.isActive = function () {
var tl = this._timeline, startTime = this._startTime, rawTime;
return (!tl || (!this._gc && !this._paused && tl.isActive() && (rawTime = tl.rawTime(true)) >= startTime && rawTime < startTime + this.totalDuration() / this._timeScale - _tinyNum));
};
p._enabled = function (enabled, ignoreTimeline) {
if (!_tickerActive) {
_ticker.wake();
}
this._gc = !enabled;
this._active = this.isActive();
if (ignoreTimeline !== true) {
if (enabled && !this.timeline) {
this._timeline.add(this, this._startTime - this._delay);
}
else if (!enabled && this.timeline) {
this._timeline._remove(this, true);
}
}
return false;
};
p._kill = function (vars, target) {
return this._enabled(false, false);
};
p.kill = function (vars, target) {
this._kill(vars, target);
return this;
};
p._uncache = function (includeSelf) {
var tween = includeSelf ? this : this.timeline;
while (tween) {
tween._dirty = true;
tween = tween.timeline;
}
return this;
};
p._swapSelfInParams = function (params) {
var i = params.length, copy = params.concat();
while (--i > -1) {
if (params[i] === "{self}") {
copy[i] = this;
}
}
return copy;
};
p._callback = function (type) {
var v = this.vars, callback = v[type], params = v[type + "Params"], scope = v[type + "Scope"] || v.callbackScope || this, l = params ? params.length : 0;
switch (l) {
case 0:
callback.call(scope);
break;
case 1:
callback.call(scope, params[0]);
break;
case 2:
callback.call(scope, params[0], params[1]);
break;
default: callback.apply(scope, params);
}
};
p.eventCallback = function (type, callback, params, scope) {
if ((type || "").substr(0, 2) === "on") {
var v = this.vars;
if (arguments.length === 1) {
return v[type];
}
if (callback == null) {
delete v[type];
}
else {
v[type] = callback;
v[type + "Params"] = (_isArray(params) && params.join("").indexOf("{self}") !== -1) ? this._swapSelfInParams(params) : params;
v[type + "Scope"] = scope;
}
if (type === "onUpdate") {
this._onUpdate = callback;
}
}
return this;
};
p.delay = function (value) {
if (!arguments.length) {
return this._delay;
}
if (this._timeline.smoothChildTiming) {
this.startTime(this._startTime + value - this._delay);
}
this._delay = value;
return this;
};
p.duration = function (value) {
if (!arguments.length) {
this._dirty = false;
return this._duration;
}
this._duration = this._totalDuration = value;
this._uncache(true);
if (this._timeline.smoothChildTiming)
if (this._time > 0)
if (this._time < this._duration)
if (value !== 0) {
this.totalTime(this._totalTime * (value / this._duration), true);
}
return this;
};
p.totalDuration = function (value) {
this._dirty = false;
return (!arguments.length) ? this._totalDuration : this.duration(value);
};
p.time = function (value, suppressEvents) {
if (!arguments.length) {
return this._time;
}
if (this._dirty) {
this.totalDuration();
}
return this.totalTime((value > this._duration) ? this._duration : value, suppressEvents);
};
p.totalTime = function (time, suppressEvents, uncapped) {
if (!_tickerActive) {
_ticker.wake();
}
if (!arguments.length) {
return this._totalTime;
}
if (this._timeline) {
if (time < 0 && !uncapped) {
time += this.totalDuration();
}
if (this._timeline.smoothChildTiming) {
if (this._dirty) {
this.totalDuration();
}
var totalDuration = this._totalDuration, tl = this._timeline;
if (time > totalDuration && !uncapped) {
time = totalDuration;
}
this._startTime = (this._paused ? this._pauseTime : tl._time) - ((!this._reversed ? time : totalDuration - time) / this._timeScale);
if (!tl._dirty) {
this._uncache(false);
}
if (tl._timeline) {
while (tl._timeline) {
if (tl._timeline._time !== (tl._startTime + tl._totalTime) / tl._timeScale) {
tl.totalTime(tl._totalTime, true);
}
tl = tl._timeline;
}
}
}
if (this._gc) {
this._enabled(true, false);
}
if (this._totalTime !== time || this._duration === 0) {
if (_lazyTweens.length) {
_lazyRender();
}
this.render(time, suppressEvents, false);
if (_lazyTweens.length) {
_lazyRender();
}
}
}
return this;
};
p.progress = p.totalProgress = function (value, suppressEvents) {
var duration = this.duration();
return (!arguments.length) ? (duration ? this._time / duration : this.ratio) : this.totalTime(duration * value, suppressEvents);
};
p.startTime = function (value) {
if (!arguments.length) {
return this._startTime;
}
if (value !== this._startTime) {
this._startTime = value;
if (this.timeline)
if (this.timeline._sortChildren) {
this.timeline.add(this, value - this._delay);
}
}
return this;
};
p.endTime = function (includeRepeats) {
return this._startTime + ((includeRepeats != false) ? this.totalDuration() : this.duration()) / this._timeScale;
};
p.timeScale = function (value) {
if (!arguments.length) {
return this._timeScale;
}
var pauseTime, t;
value = value || _tinyNum;
if (this._timeline && this._timeline.smoothChildTiming) {
pauseTime = this._pauseTime;
t = (pauseTime || pauseTime === 0) ? pauseTime : this._timeline.totalTime();
this._startTime = t - ((t - this._startTime) * this._timeScale / value);
}
this._timeScale = value;
t = this.timeline;
while (t && t.timeline) {
t._dirty = true;
t.totalDuration();
t = t.timeline;
}
return this;
};
p.reversed = function (value) {
if (!arguments.length) {
return this._reversed;
}
if (value != this._reversed) {
this._reversed = value;
this.totalTime(((this._timeline && !this._timeline.smoothChildTiming) ? this.totalDuration() - this._totalTime : this._totalTime), true);
}
return this;
};
p.paused = function (value) {
if (!arguments.length) {
return this._paused;
}
var tl = this._timeline, raw, elapsed;
if (value != this._paused)
if (tl) {
if (!_tickerActive && !value) {
_ticker.wake();
}
raw = tl.rawTime();
elapsed = raw - this._pauseTime;
if (!value && tl.smoothChildTiming) {
this._startTime += elapsed;
this._uncache(false);
}
this._pauseTime = value ? raw : null;
this._paused = value;
this._active = this.isActive();
if (!value && elapsed !== 0 && this._initted && this.duration()) {
raw = tl.smoothChildTiming ? this._totalTime : (raw - this._startTime) / this._timeScale;
this.render(raw, (raw === this._totalTime), true);
}
}
if (this._gc && !value) {
this._enabled(true, false);
}
return this;
};
var SimpleTimeline = _class("core.SimpleTimeline", function (vars) {
Animation.call(this, 0, vars);
this.autoRemoveChildren = this.smoothChildTiming = true;
});
p = SimpleTimeline.prototype = new Animation();
p.constructor = SimpleTimeline;
p.kill()._gc = false;
p._first = p._last = p._recent = null;
p._sortChildren = false;
p.add = p.insert = function (child, position, align, stagger) {
var prevTween, st;
child._startTime = Number(position || 0) + child._delay;
if (child._paused)
if (this !== child._timeline) {
child._pauseTime = this.rawTime() - (child._timeline.rawTime() - child._pauseTime);
}
if (child.timeline) {
child.timeline._remove(child, true);
}
child.timeline = child._timeline = this;
if (child._gc) {
child._enabled(true, true);
}
prevTween = this._last;
if (this._sortChildren) {
st = child._startTime;
while (prevTween && prevTween._startTime > st) {
prevTween = prevTween._prev;
}
}
if (prevTween) {
child._next = prevTween._next;
prevTween._next = child;
}
else {
child._next = this._first;
this._first = child;
}
if (child._next) {
child._next._prev = child;
}
else {
this._last = child;
}
child._prev = prevTween;
this._recent = child;
if (this._timeline) {
this._uncache(true);
}
return this;
};
p._remove = function (tween, skipDisable) {
if (tween.timeline === this) {
if (!skipDisable) {
tween._enabled(false, true);
}
if (tween._prev) {
tween._prev._next = tween._next;
}
else if (this._first === tween) {
this._first = tween._next;
}
if (tween._next) {
tween._next._prev = tween._prev;
}
else if (this._last === tween) {
this._last = tween._prev;
}
tween._next = tween._prev = tween.timeline = null;
if (tween === this._recent) {
this._recent = this._last;
}
if (this._timeline) {
this._uncache(true);
}
}
return this;
};
p.render = function (time, suppressEvents, force) {
var tween = this._first, next;
this._totalTime = this._time = this._rawPrevTime = time;
while (tween) {
next = tween._next;
if (tween._active || (time >= tween._startTime && !tween._paused && !tween._gc)) {
if (!tween._reversed) {
tween.render((time - tween._startTime) * tween._timeScale, suppressEvents, force);
}
else {
tween.render(((!tween._dirty) ? tween._totalDuration : tween.totalDuration()) - ((time - tween._startTime) * tween._timeScale), suppressEvents, force);
}
}
tween = next;
}
};
p.rawTime = function () {
if (!_tickerActive) {
_ticker.wake();
}
return this._totalTime;
};
var TweenLite = _class("TweenLite", function (target, duration, vars) {
Animation.call(this, duration, vars);
this.render = TweenLite.prototype.render;
if (target == null) {
throw "Cannot tween a null target.";
}
this.target = target = (typeof (target) !== "string") ? target : TweenLite.selector(target) || target;
var isSelector = (target.jquery || (target.length && target !== window && target[0] && (target[0] === window || (target[0].nodeType && target[0].style && !target.nodeType)))), overwrite = this.vars.overwrite, i, targ, targets;
this._overwrite = overwrite = (overwrite == null) ? _overwriteLookup[TweenLite.defaultOverwrite] : (typeof (overwrite) === "number") ? overwrite >> 0 : _overwriteLookup[overwrite];
if ((isSelector || target instanceof Array || (target.push && _isArray(target))) && typeof (target[0]) !== "number") {
this._targets = targets = _slice(target);
this._propLookup = [];
this._siblings = [];
for (i = 0; i < targets.length; i++) {
targ = targets[i];
if (!targ) {
targets.splice(i--, 1);
continue;
}
else if (typeof (targ) === "string") {
targ = targets[i--] = TweenLite.selector(targ);
if (typeof (targ) === "string") {
targets.splice(i + 1, 1);
}
continue;
}
else if (targ.length && targ !== window && targ[0] && (targ[0] === window || (targ[0].nodeType && targ[0].style && !targ.nodeType))) {
targets.splice(i--, 1);
this._targets = targets = targets.concat(_slice(targ));
continue;
}
this._siblings[i] = _register(targ, this, false);
if (overwrite === 1)
if (this._siblings[i].length > 1) {
_applyOverwrite(targ, this, null, 1, this._siblings[i]);
}
}
}
else {
this._propLookup = {};
this._siblings = _register(target, this, false);
if (overwrite === 1)
if (this._siblings.length > 1) {
_applyOverwrite(target, this, null, 1, this._siblings);
}
}
if (this.vars.immediateRender || (duration === 0 && this._delay === 0 && this.vars.immediateRender !== false)) {
this._time = -_tinyNum;
this.render(Math.min(0, -this._delay));
}
}, true), _isSelector = function (v) {
return (v && v.length && v !== window && v[0] && (v[0] === window || (v[0].nodeType && v[0].style && !v.nodeType)));
}, _autoCSS = function (vars, target) {
var css = {}, p;
for (p in vars) {
if (!_reservedProps[p] && (!(p in target) || p === "transform" || p === "x" || p === "y" || p === "width" || p === "height" || p === "className" || p === "border") && (!_plugins[p] || (_plugins[p] && _plugins[p]._autoCSS))) {
css[p] = vars[p];
delete vars[p];
}
}
vars.css = css;
};
p = TweenLite.prototype = new Animation();
p.constructor = TweenLite;
p.kill()._gc = false;
p.ratio = 0;
p._firstPT = p._targets = p._overwrittenProps = p._startAt = null;
p._notifyPluginsOfEnabled = p._lazy = false;
TweenLite.version = "2.1.3";
TweenLite.defaultEase = p._ease = new Ease(null, null, 1, 1);
TweenLite.defaultOverwrite = "auto";
TweenLite.ticker = _ticker;
TweenLite.autoSleep = 120;
TweenLite.lagSmoothing = function (threshold, adjustedLag) {
_ticker.lagSmoothing(threshold, adjustedLag);
};
TweenLite.selector = window.$ || window.jQuery || function (e) {
var selector = window.$ || window.jQuery;
if (selector) {
TweenLite.selector = selector;
return selector(e);
}
if (!_doc) {
_doc = window.document;
}
return (!_doc) ? e : (_doc.querySelectorAll ? _doc.querySelectorAll(e) : _doc.getElementById((e.charAt(0) === "#") ? e.substr(1) : e));
};
var _lazyTweens = [], _lazyLookup = {}, _numbersExp = /(?:(-|-=|\+=)?\d*\.?\d*(?:e[\-+]?\d+)?)[0-9]/ig, _relExp = /[\+-]=-?[\.\d]/, _setRatio = function (v) {
var pt = this._firstPT, min = 0.000001, val;
while (pt) {
val = !pt.blob ? pt.c * v + pt.s : (v === 1 && this.end != null) ? this.end : v ? this.join("") : this.start;
if (pt.m) {
val = pt.m.call(this._tween, val, this._target || pt.t, this._tween);
}
else if (val < min)
if (val > -min && !pt.blob) {
val = 0;
}
if (!pt.f) {
pt.t[pt.p] = val;
}
else if (pt.fp) {
pt.t[pt.p](pt.fp, val);
}
else {
pt.t[pt.p](val);
}
pt = pt._next;
}
}, _blobRound = function (v) {
return (((v * 1000) | 0) / 1000) + "";
}, _blobDif = function (start, end, filter, pt) {
var a = [], charIndex = 0, s = "", color = 0, startNums, endNums, num, i, l, nonNumbers, currentNum;
a.start = start;
a.end = end;
start = a[0] = start + "";
end = a[1] = end + "";
if (filter) {
filter(a);
start = a[0];
end = a[1];
}
a.length = 0;
startNums = start.match(_numbersExp) || [];
endNums = end.match(_numbersExp) || [];
if (pt) {
pt._next = null;
pt.blob = 1;
a._firstPT = a._applyPT = pt;
}
l = endNums.length;
for (i = 0; i < l; i++) {
currentNum = endNums[i];
nonNumbers = end.substr(charIndex, end.indexOf(currentNum, charIndex) - charIndex);
s += (nonNumbers || !i) ? nonNumbers : ",";
charIndex += nonNumbers.length;
if (color) {
color = (color + 1) % 5;
}
else if (nonNumbers.substr(-5) === "rgba(") {
color = 1;
}
if (currentNum === startNums[i] || startNums.length <= i) {
s += currentNum;
}
else {
if (s) {
a.push(s);
s = "";
}
num = parseFloat(startNums[i]);
a.push(num);
a._firstPT = { _next: a._firstPT, t: a, p: a.length - 1, s: num, c: ((currentNum.charAt(1) === "=") ? parseInt(currentNum.charAt(0) + "1", 10) * parseFloat(currentNum.substr(2)) : (parseFloat(currentNum) - num)) || 0, f: 0, m: (color && color < 4) ? Math.round : _blobRound };
}
charIndex += currentNum.length;
}
s += end.substr(charIndex);
if (s) {
a.push(s);
}
a.setRatio = _setRatio;
if (_relExp.test(end)) {
a.end = null;
}
return a;
}, _addPropTween = function (target, prop, start, end, overwriteProp, mod, funcParam, stringFilter, index) {
if (typeof (end) === "function") {
end = end(index || 0, target);
}
var type = typeof (target[prop]), getterName = (type !== "function") ? "" : ((prop.indexOf("set") || typeof (target["get" + prop.substr(3)]) !== "function") ? prop : "get" + prop.substr(3)), s = (start !== "get") ? start : !getterName ? target[prop] : funcParam ? target[getterName](funcParam) : target[getterName](), isRelative = (typeof (end) === "string" && end.charAt(1) === "="), pt = { t: target, p: prop, s: s, f: (type === "function"), pg: 0, n: overwriteProp || prop, m: (!mod ? 0 : (typeof (mod) === "function") ? mod : Math.round), pr: 0, c: isRelative ? parseInt(end.charAt(0) + "1", 10) * parseFloat(end.substr(2)) : (parseFloat(end) - s) || 0 }, blob;
if (typeof (s) !== "number" || (typeof (end) !== "number" && !isRelative)) {
if (funcParam || isNaN(s) || (!isRelative && isNaN(end)) || typeof (s) === "boolean" || typeof (end) === "boolean") {
pt.fp = funcParam;
blob = _blobDif(s, (isRelative ? (parseFloat(pt.s) + pt.c) + (pt.s + "").replace(/[0-9\-\.]/g, "") : end), stringFilter || TweenLite.defaultStringFilter, pt);
pt = { t: blob, p: "setRatio", s: 0, c: 1, f: 2, pg: 0, n: overwriteProp || prop, pr: 0, m: 0 };
}
else {
pt.s = parseFloat(s);
if (!isRelative) {
pt.c = (parseFloat(end) - pt.s) || 0;
}
}
}
if (pt.c) {
if ((pt._next = this._firstPT)) {
pt._next._prev = pt;
}
this._firstPT = pt;
return pt;
}
}, _internals = TweenLite._internals = { isArray: _isArray, isSelector: _isSelector, lazyTweens: _lazyTweens, blobDif: _blobDif }, _plugins = TweenLite._plugins = {}, _tweenLookup = _internals.tweenLookup = {}, _tweenLookupNum = 0, _reservedProps = _internals.reservedProps = { ease: 1, delay: 1, overwrite: 1, onComplete: 1, onCompleteParams: 1, onCompleteScope: 1, useFrames: 1, runBackwards: 1, startAt: 1, onUpdate: 1, onUpdateParams: 1, onUpdateScope: 1, onStart: 1, onStartParams: 1, onStartScope: 1, onReverseComplete: 1, onReverseCompleteParams: 1, onReverseCompleteScope: 1, onRepeat: 1, onRepeatParams: 1, onRepeatScope: 1, easeParams: 1, yoyo: 1, immediateRender: 1, repeat: 1, repeatDelay: 1, data: 1, paused: 1, reversed: 1, autoCSS: 1, lazy: 1, onOverwrite: 1, callbackScope: 1, stringFilter: 1, id: 1, yoyoEase: 1, stagger: 1 }, _overwriteLookup = { none: 0, all: 1, auto: 2, concurrent: 3, allOnStart: 4, preexisting: 5, "true": 1, "false": 0 }, _rootFramesTimeline = Animation._rootFramesTimeline = new SimpleTimeline(), _rootTimeline = Animation._rootTimeline = new SimpleTimeline(), _nextGCFrame = 30, _lazyRender = _internals.lazyRender = function () {
var l = _lazyTweens.length, i, tween;
_lazyLookup = {};
for (i = 0; i < l; i++) {
tween = _lazyTweens[i];
if (tween && tween._lazy !== false) {
tween.render(tween._lazy[0], tween._lazy[1], true);
tween._lazy = false;
}
}
_lazyTweens.length = 0;
};
_rootTimeline._startTime = _ticker.time;
_rootFramesTimeline._startTime = _ticker.frame;
_rootTimeline._active = _rootFramesTimeline._active = true;
setTimeout(_lazyRender, 1);
Animation._updateRoot = TweenLite.render = function () {
var i, a, p;
if (_lazyTweens.length) {
_lazyRender();
}
_rootTimeline.render((_ticker.time - _rootTimeline._startTime) * _rootTimeline._timeScale, false, false);
_rootFramesTimeline.render((_ticker.frame - _rootFramesTimeline._startTime) * _rootFramesTimeline._timeScale, false, false);
if (_lazyTweens.length) {
_lazyRender();
}
if (_ticker.frame >= _nextGCFrame) {
_nextGCFrame = _ticker.frame + (parseInt(TweenLite.autoSleep, 10) || 120);
for (p in _tweenLookup) {
a = _tweenLookup[p].tweens;
i = a.length;
while (--i > -1) {
if (a[i]._gc) {
a.splice(i, 1);
}
}
if (a.length === 0) {
delete _tweenLookup[p];
}
}
p = _rootTimeline._first;
if (!p || p._paused)
if (TweenLite.autoSleep && !_rootFramesTimeline._first && _ticker._listeners.tick.length === 1) {
while (p && p._paused) {
p = p._next;
}
if (!p) {
_ticker.sleep();
}
}
}
};
_ticker.addEventListener("tick", Animation._updateRoot);
var _register = function (target, tween, scrub) {
var id = target._gsTweenID, a, i;
if (!_tweenLookup[id || (target._gsTweenID = id = "t" + (_tweenLookupNum++))]) {
_tweenLookup[id] = { target: target, tweens: [] };
}
if (tween) {
a = _tweenLookup[id].tweens;
a[(i = a.length)] = tween;
if (scrub) {
while (--i > -1) {
if (a[i] === tween) {
a.splice(i, 1);
}
}
}
}
return _tweenLookup[id].tweens;
}, _onOverwrite = function (overwrittenTween, overwritingTween, target, killedProps) {
var func = overwrittenTween.vars.onOverwrite, r1, r2;
if (func) {
r1 = func(overwrittenTween, overwritingTween, target, killedProps);
}
func = TweenLite.onOverwrite;
if (func) {
r2 = func(overwrittenTween, overwritingTween, target, killedProps);
}
return (r1 !== false && r2 !== false);
}, _applyOverwrite = function (target, tween, props, mode, siblings) {
var i, changed, curTween, l;
if (mode === 1 || mode >= 4) {
l = siblings.length;
for (i = 0; i < l; i++) {
if ((curTween = siblings[i]) !== tween) {
if (!curTween._gc) {
if (curTween._kill(null, target, tween)) {
changed = true;
}
}
}
else if (mode === 5) {
break;
}
}
return changed;
}
var startTime = tween._startTime + _tinyNum, overlaps = [], oCount = 0, zeroDur = (tween._duration === 0), globalStart;
i = siblings.length;
while (--i > -1) {
if ((curTween = siblings[i]) === tween || curTween._gc || curTween._paused) {
}
else if (curTween._timeline !== tween._timeline) {
globalStart = globalStart || _checkOverlap(tween, 0, zeroDur);
if (_checkOverlap(curTween, globalStart, zeroDur) === 0) {
overlaps[oCount++] = curTween;
}
}
else if (curTween._startTime <= startTime)
if (curTween._startTime + curTween.totalDuration() / curTween._timeScale > startTime)
if (!((zeroDur || !curTween._initted) && startTime - curTween._startTime <= _tinyNum * 2)) {
overlaps[oCount++] = curTween;
}
}
i = oCount;
while (--i > -1) {
curTween = overlaps[i];
l = curTween._firstPT;
if (mode === 2)
if (curTween._kill(props, target, tween)) {
changed = true;
}
if (mode !== 2 || (!curTween._firstPT && curTween._initted && l)) {
if (mode !== 2 && !_onOverwrite(curTween, tween)) {
continue;
}
if (curTween._enabled(false, false)) {
changed = true;
}
}
}
return changed;
}, _checkOverlap = function (tween, reference, zeroDur) {
var tl = tween._timeline, ts = tl._timeScale, t = tween._startTime;
while (tl._timeline) {
t += tl._startTime;
ts *= tl._timeScale;
if (tl._paused) {
return -100;
}
tl = tl._timeline;
}
t /= ts;
return (t > reference) ? t - reference : ((zeroDur && t === reference) || (!tween._initted && t - reference < 2 * _tinyNum)) ? _tinyNum : ((t += tween.totalDuration() / tween._timeScale / ts) > reference + _tinyNum) ? 0 : t - reference - _tinyNum;
};
p._init = function () {
var v = this.vars, op = this._overwrittenProps, dur = this._duration, immediate = !!v.immediateRender, ease = v.ease, startAt = this._startAt, i, initPlugins, pt, p, startVars, l;
if (v.startAt) {
if (startAt) {
startAt.render(-1, true);
startAt.kill();
}
startVars = {};
for (p in v.startAt) {
startVars[p] = v.startAt[p];
}
startVars.data = "isStart";
startVars.overwrite = false;
startVars.immediateRender = true;
startVars.lazy = (immediate && v.lazy !== false);
startVars.startAt = startVars.delay = null;
startVars.onUpdate = v.onUpdate;
startVars.onUpdateParams = v.onUpdateParams;
startVars.onUpdateScope = v.onUpdateScope || v.callbackScope || this;
this._startAt = TweenLite.to(this.target || {}, 0, startVars);
if (immediate) {
if (this._time > 0) {
this._startAt = null;
}
else if (dur !== 0) {
return;
}
}
}
else if (v.runBackwards && dur !== 0) {
if (startAt) {
startAt.render(-1, true);
startAt.kill();
this._startAt = null;
}
else {
if (this._time !== 0) {
immediate = false;
}
pt = {};
for (p in v) {
if (!_reservedProps[p] || p === "autoCSS") {
pt[p] = v[p];
}
}
pt.overwrite = 0;
pt.data = "isFromStart";
pt.lazy = (immediate && v.lazy !== false);
pt.immediateRender = immediate;
this._startAt = TweenLite.to(this.target, 0, pt);
if (!immediate) {
this._startAt._init();
this._startAt._enabled(false);
if (this.vars.immediateRender) {
this._startAt = null;
}
}
else if (this._time === 0) {
return;
}
}
}
this._ease = ease = (!ease) ? TweenLite.defaultEase : (ease instanceof Ease) ? ease : (typeof (ease) === "function") ? new Ease(ease, v.easeParams) : _easeMap[ease] || TweenLite.defaultEase;
if (v.easeParams instanceof Array && ease.config) {
this._ease = ease.config.apply(ease, v.easeParams);
}
this._easeType = this._ease._type;
this._easePower = this._ease._power;
this._firstPT = null;
if (this._targets) {
l = this._targets.length;
for (i = 0; i < l; i++) {
if (this._initProps(this._targets[i], (this._propLookup[i] = {}), this._siblings[i], (op ? op[i] : null), i)) {
initPlugins = true;
}
}
}
else {
initPlugins = this._initProps(this.target, this._propLookup, this._siblings, op, 0);
}
if (initPlugins) {
TweenLite._onPluginEvent("_onInitAllProps", this);
}
if (op)
if (!this._firstPT)
if (typeof (this.target) !== "function") {
this._enabled(false, false);
}
if (v.runBackwards) {
pt = this._firstPT;
while (pt) {
pt.s += pt.c;
pt.c = -pt.c;
pt = pt._next;
}
}
this._onUpdate = v.onUpdate;
this._initted = true;
};
p._initProps = function (target, propLookup, siblings, overwrittenProps, index) {
var p, i, initPlugins, plugin, pt, v;
if (target == null) {
return false;
}
if (_lazyLookup[target._gsTweenID]) {
_lazyRender();
}
if (!this.vars.css)
if (target.style)
if (target !== window && target.nodeType)
if (_plugins.css)
if (this.vars.autoCSS !== false) {
_autoCSS(this.vars, target);
}
for (p in this.vars) {
v = this.vars[p];
if (_reservedProps[p]) {
if (v)
if ((v instanceof Array) || (v.push && _isArray(v)))
if (v.join("").indexOf("{self}") !== -1) {
this.vars[p] = v = this._swapSelfInParams(v, this);
}
}
else if (_plugins[p] && (plugin = new _plugins[p]())._onInitTween(target, this.vars[p], this, index)) {
this._firstPT = pt = { _next: this._firstPT, t: plugin, p: "setRatio", s: 0, c: 1, f: 1, n: p, pg: 1, pr: plugin._priority, m: 0 };
i = plugin._overwriteProps.length;
while (--i > -1) {
propLookup[plugin._overwriteProps[i]] = this._firstPT;
}
if (plugin._priority || plugin._onInitAllProps) {
initPlugins = true;
}
if (plugin._onDisable || plugin._onEnable) {
this._notifyPluginsOfEnabled = true;
}
if (pt._next) {
pt._next._prev = pt;
}
}
else {
propLookup[p] = _addPropTween.call(this, target, p, "get", v, p, 0, null, this.vars.stringFilter, index);
}
}
if (overwrittenProps)
if (this._kill(overwrittenProps, target)) {
return this._initProps(target, propLookup, siblings, overwrittenProps, index);
}
if (this._overwrite > 1)
if (this._firstPT)
if (siblings.length > 1)
if (_applyOverwrite(target, this, propLookup, this._overwrite, siblings)) {
this._kill(propLookup, target);
return this._initProps(target, propLookup, siblings, overwrittenProps, index);
}
if (this._firstPT)
if ((this.vars.lazy !== false && this._duration) || (this.vars.lazy && !this._duration)) {
_lazyLookup[target._gsTweenID] = true;
}
return initPlugins;
};
p.render = function (time, suppressEvents, force) {
var self = this, prevTime = self._time, duration = self._duration, prevRawPrevTime = self._rawPrevTime, isComplete, callback, pt, rawPrevTime;
if (time >= duration - _tinyNum && time >= 0) {
self._totalTime = self._time = duration;
self.ratio = self._ease._calcEnd ? self._ease.getRatio(1) : 1;
if (!self._reversed) {
isComplete = true;
callback = "onComplete";
force = (force || self._timeline.autoRemoveChildren);
}
if (duration === 0)
if (self._initted || !self.vars.lazy || force) {
if (self._startTime === self._timeline._duration) {
time = 0;
}
if (prevRawPrevTime < 0 || (time <= 0 && time >= -_tinyNum) || (prevRawPrevTime === _tinyNum && self.data !== "isPause"))
if (prevRawPrevTime !== time) {
force = true;
if (prevRawPrevTime > _tinyNum) {
callback = "onReverseComplete";
}
}
self._rawPrevTime = rawPrevTime = (!suppressEvents || time || prevRawPrevTime === time) ? time : _tinyNum;
}
}
else if (time < _tinyNum) {
self._totalTime = self._time = 0;
self.ratio = self._ease._calcEnd ? self._ease.getRatio(0) : 0;
if (prevTime !== 0 || (duration === 0 && prevRawPrevTime > 0)) {
callback = "onReverseComplete";
isComplete = self._reversed;
}
if (time > -_tinyNum) {
time = 0;
}
else if (time < 0) {
self._active = false;
if (duration === 0)
if (self._initted || !self.vars.lazy || force) {
if (prevRawPrevTime >= 0 && !(prevRawPrevTime === _tinyNum && self.data === "isPause")) {
force = true;
}
self._rawPrevTime = rawPrevTime = (!suppressEvents || time || prevRawPrevTime === time) ? time : _tinyNum;
}
}
if (!self._initted || (self._startAt && self._startAt.progress())) {
force = true;
}
}
else {
self._totalTime = self._time = time;
if (self._easeType) {
var r = time / duration, type = self._easeType, pow = self._easePower;
if (type === 1 || (type === 3 && r >= 0.5)) {
r = 1 - r;
}
if (type === 3) {
r *= 2;
}
if (pow === 1) {
r *= r;
}
else if (pow === 2) {
r *= r * r;
}
else if (pow === 3) {
r *= r * r * r;
}
else if (pow === 4) {
r *= r * r * r * r;
}
self.ratio = (type === 1) ? 1 - r : (type === 2) ? r : (time / duration < 0.5) ? r / 2 : 1 - (r / 2);
}
else {
self.ratio = self._ease.getRatio(time / duration);
}
}
if (self._time === prevTime && !force) {
return;
}
else if (!self._initted) {
self._init();
if (!self._initted || self._gc) {
return;
}
else if (!force && self._firstPT && ((self.vars.lazy !== false && self._duration) || (self.vars.lazy && !self._duration))) {
self._time = self._totalTime = prevTime;
self._rawPrevTime = prevRawPrevTime;
_lazyTweens.push(self);
self._lazy = [time, suppressEvents];
return;
}
if (self._time && !isComplete) {
self.ratio = self._ease.getRatio(self._time / duration);
}
else if (isComplete && self._ease._calcEnd) {
self.ratio = self._ease.getRatio((self._time === 0) ? 0 : 1);
}
}
if (self._lazy !== false) {
self._lazy = false;
}
if (!self._active)
if (!self._paused && self._time !== prevTime && time >= 0) {
self._active = true;
}
if (prevTime === 0) {
if (self._startAt) {
if (time >= 0) {
self._startAt.render(time, true, force);
}
else if (!callback) {
callback = "_dummyGS";
}
}
if (self.vars.onStart)
if (self._time !== 0 || duration === 0)
if (!suppressEvents) {
self._callback("onStart");
}
}
pt = self._firstPT;
while (pt) {
if (pt.f) {
pt.t[pt.p](pt.c * self.ratio + pt.s);
}
else {
pt.t[pt.p] = pt.c * self.ratio + pt.s;
}
pt = pt._next;
}
if (self._onUpdate) {
if (time < 0)
if (self._startAt && time !== -0.0001) {
self._startAt.render(time, true, force);
}
if (!suppressEvents)
if (self._time !== prevTime || isComplete || force) {
self._callback("onUpdate");
}
}
if (callback)
if (!self._gc || force) {
if (time < 0 && self._startAt && !self._onUpdate && time !== -0.0001) {
self._startAt.render(time, true, force);
}
if (isComplete) {
if (self._timeline.autoRemoveChildren) {
self._enabled(false, false);
}
self._active = false;
}
if (!suppressEvents && self.vars[callback]) {
self._callback(callback);
}
if (duration === 0 && self._rawPrevTime === _tinyNum && rawPrevTime !== _tinyNum) {
self._rawPrevTime = 0;
}
}
};
p._kill = function (vars, target, overwritingTween) {
if (vars === "all") {
vars = null;
}
if (vars == null)
if (target == null || target === this.target) {
this._lazy = false;
return this._enabled(false, false);
}
target = (typeof (target) !== "string") ? (target || this._targets || this.target) : TweenLite.selector(target) || target;
var simultaneousOverwrite = (overwritingTween && this._time && overwritingTween._startTime === this._startTime && this._timeline === overwritingTween._timeline), firstPT = this._firstPT, i, overwrittenProps, p, pt, propLookup, changed, killProps, record, killed;
if ((_isArray(target) || _isSelector(target)) && typeof (target[0]) !== "number") {
i = target.length;
while (--i > -1) {
if (this._kill(vars, target[i], overwritingTween)) {
changed = true;
}
}
}
else {
if (this._targets) {
i = this._targets.length;
while (--i > -1) {
if (target === this._targets[i]) {
propLookup = this._propLookup[i] || {};
this._overwrittenProps = this._overwrittenProps || [];
overwrittenProps = this._overwrittenProps[i] = vars ? this._overwrittenProps[i] || {} : "all";
break;
}
}
}
else if (target !== this.target) {
return false;
}
else {
propLookup = this._propLookup;
overwrittenProps = this._overwrittenProps = vars ? this._overwrittenProps || {} : "all";
}
if (propLookup) {
killProps = vars || propLookup;
record = (vars !== overwrittenProps && overwrittenProps !== "all" && vars !== propLookup && (typeof (vars) !== "object" || !vars._tempKill));
if (overwritingTween && (TweenLite.onOverwrite || this.vars.onOverwrite)) {
for (p in killProps) {
if (propLookup[p]) {
if (!killed) {
killed = [];
}
killed.push(p);
}
}
if ((killed || !vars) && !_onOverwrite(this, overwritingTween, target, killed)) {
return false;
}
}
for (p in killProps) {
if ((pt = propLookup[p])) {
if (simultaneousOverwrite) {
if (pt.f) {
pt.t[pt.p](pt.s);
}
else {
pt.t[pt.p] = pt.s;
}
changed = true;
}
if (pt.pg && pt.t._kill(killProps)) {
changed = true;
}
if (!pt.pg || pt.t._overwriteProps.length === 0) {
if (pt._prev) {
pt._prev._next = pt._next;
}
else if (pt === this._firstPT) {
this._firstPT = pt._next;
}
if (pt._next) {
pt._next._prev = pt._prev;
}
pt._next = pt._prev = null;
}
delete propLookup[p];
}
if (record) {
overwrittenProps[p] = 1;
}
}
if (!this._firstPT && this._initted && firstPT) {
this._enabled(false, false);
}
}
}
return changed;
};
p.invalidate = function () {
if (this._notifyPluginsOfEnabled) {
TweenLite._onPluginEvent("_onDisable", this);
}
var t = this._time;
this._firstPT = this._overwrittenProps = this._startAt = this._onUpdate = null;
this._notifyPluginsOfEnabled = this._active = this._lazy = false;
this._propLookup = (this._targets) ? {} : [];
Animation.prototype.invalidate.call(this);
if (this.vars.immediateRender) {
this._time = -_tinyNum;
this.render(t, false, this.vars.lazy !== false);
}
return this;
};
p._enabled = function (enabled, ignoreTimeline) {
if (!_tickerActive) {
_ticker.wake();
}
if (enabled && this._gc) {
var targets = this._targets, i;
if (targets) {
i = targets.length;
while (--i > -1) {
this._siblings[i] = _register(targets[i], this, true);
}
}
else {
this._siblings = _register(this.target, this, true);
}
}
Animation.prototype._enabled.call(this, enabled, ignoreTimeline);
if (this._notifyPluginsOfEnabled)
if (this._firstPT) {
return TweenLite._onPluginEvent((enabled ? "_onEnable" : "_onDisable"), this);
}
return false;
};
TweenLite.to = function (target, duration, vars) {
return new TweenLite(target, duration, vars);
};
TweenLite.from = function (target, duration, vars) {
vars.runBackwards = true;
vars.immediateRender = (vars.immediateRender != false);
return new TweenLite(target, duration, vars);
};
TweenLite.fromTo = function (target, duration, fromVars, toVars) {
toVars.startAt = fromVars;
toVars.immediateRender = (toVars.immediateRender != false && fromVars.immediateRender != false);
return new TweenLite(target, duration, toVars);
};
TweenLite.delayedCall = function (delay, callback, params, scope, useFrames) {
return new TweenLite(callback, 0, { delay: delay, onComplete: callback, onCompleteParams: params, callbackScope: scope, onReverseComplete: callback, onReverseCompleteParams: params, immediateRender: false, lazy: false, useFrames: useFrames, overwrite: 0 });
};
TweenLite.set = function (target, vars) {
return new TweenLite(target, 0, vars);
};
TweenLite.getTweensOf = function (target, onlyActive) {
if (target == null) {
return [];
}
target = (typeof (target) !== "string") ? target : TweenLite.selector(target) || target;
var i, a, j, t;
if ((_isArray(target) || _isSelector(target)) && typeof (target[0]) !== "number") {
i = target.length;
a = [];
while (--i > -1) {
a = a.concat(TweenLite.getTweensOf(target[i], onlyActive));
}
i = a.length;
while (--i > -1) {
t = a[i];
j = i;
while (--j > -1) {
if (t === a[j]) {
a.splice(i, 1);
}
}
}
}
else if (target._gsTweenID) {
a = _register(target).concat();
i = a.length;
while (--i > -1) {
if (a[i]._gc || (onlyActive && !a[i].isActive())) {
a.splice(i, 1);
}
}
}
return a || [];
};
TweenLite.killTweensOf = TweenLite.killDelayedCallsTo = function (target, onlyActive, vars) {
if (typeof (onlyActive) === "object") {
vars = onlyActive;
onlyActive = false;
}
var a = TweenLite.getTweensOf(target, onlyActive), i = a.length;
while (--i > -1) {
a[i]._kill(vars, target);
}
};
var TweenPlugin = _class("plugins.TweenPlugin", function (props, priority) {
this._overwriteProps = (props || "").split(",");
this._propName = this._overwriteProps[0];
this._priority = priority || 0;
this._super = TweenPlugin.prototype;
}, true);
p = TweenPlugin.prototype;
TweenPlugin.version = "1.19.0";
TweenPlugin.API = 2;
p._firstPT = null;
p._addTween = _addPropTween;
p.setRatio = _setRatio;
p._kill = function (lookup) {
var a = this._overwriteProps, pt = this._firstPT, i;
if (lookup[this._propName] != null) {
this._overwriteProps = [];
}
else {
i = a.length;
while (--i > -1) {
if (lookup[a[i]] != null) {
a.splice(i, 1);
}
}
}
while (pt) {
if (lookup[pt.n] != null) {
if (pt._next) {
pt._next._prev = pt._prev;
}
if (pt._prev) {
pt._prev._next = pt._next;
pt._prev = null;
}
else if (this._firstPT === pt) {
this._firstPT = pt._next;
}
}
pt = pt._next;
}
return false;
};
p._mod = p._roundProps = function (lookup) {
var pt = this._firstPT, val;
while (pt) {
val = lookup[this._propName] || (pt.n != null && lookup[pt.n.split(this._propName + "_").join("")]);
if (val && typeof (val) === "function") {
if (pt.f === 2) {
pt.t._applyPT.m = val;
}
else {
pt.m = val;
}
}
pt = pt._next;
}
};
TweenLite._onPluginEvent = function (type, tween) {
var pt = tween._firstPT, changed, pt2, first, last, next;
if (type === "_onInitAllProps") {
while (pt) {
next = pt._next;
pt2 = first;
while (pt2 && pt2.pr > pt.pr) {
pt2 = pt2._next;
}
if ((pt._prev = pt2 ? pt2._prev : last)) {
pt._prev._next = pt;
}
else {
first = pt;
}
if ((pt._next = pt2)) {
pt2._prev = pt;
}
else {
last = pt;
}
pt = next;
}
pt = tween._firstPT = first;
}
while (pt) {
if (pt.pg)
if (typeof (pt.t[type]) === "function")
if (pt.t[type]()) {
changed = true;
}
pt = pt._next;
}
return changed;
};
TweenPlugin.activate = function (plugins) {
var i = plugins.length;
while (--i > -1) {
if (plugins[i].API === TweenPlugin.API) {
_plugins[(new plugins[i]())._propName] = plugins[i];
}
}
return true;
};
_gsDefine.plugin = function (config) {
if (!config || !config.propName || !config.init || !config.API) {
throw "illegal plugin definition.";
}
var propName = config.propName, priority = config.priority || 0, overwriteProps = config.overwriteProps, map = { init: "_onInitTween", set: "setRatio", kill: "_kill", round: "_mod", mod: "_mod", initAll: "_onInitAllProps" }, Plugin = _class("plugins." + propName.charAt(0).toUpperCase() + propName.substr(1) + "Plugin", function () {
TweenPlugin.call(this, propName, priority);
this._overwriteProps = overwriteProps || [];
}, (config.global === true)), p = Plugin.prototype = new TweenPlugin(propName), prop;
p.constructor = Plugin;
Plugin.API = config.API;
for (prop in map) {
if (typeof (config[prop]) === "function") {
p[map[prop]] = config[prop];
}
}
Plugin.version = config.version;
TweenPlugin.activate([Plugin]);
return Plugin;
};
a = window._gsQueue;
if (a) {
for (i = 0; i < a.length; i++) {
a[i]();
}
for (p in _defLookup) {
if (!_defLookup[p].func) {
window.console.log("GSAP encountered missing dependency: " + p);
}
}
}
_tickerActive = false;
return TweenLite;
})(exports._gsScope, "TweenLite"); exports.default = exports.TweenLite; exports.globals = exports._gsScope.GreenSockGlobals; var nonGlobals = exports.globals.com.greensock; exports.SimpleTimeline = nonGlobals.core.SimpleTimeline; exports.Animation = nonGlobals.core.Animation; exports.Ease = exports.globals.Ease; exports.Linear = exports.globals.Linear; exports.Power0 = exports.Linear; exports.Power1 = exports.globals.Power1; exports.Power2 = exports.globals.Power2; exports.Power3 = exports.globals.Power3; exports.Power4 = exports.globals.Power4; exports.TweenPlugin = exports.globals.TweenPlugin; exports.EventDispatcher = nonGlobals.events.EventDispatcher;
} // gsap/TimelineLite.js $fsx.f[81] = (module, exports) => { "use strict"; Object.defineProperty(exports, "__esModule", { value: true }); const TweenLite_js_1 = $fsx.r(80); TweenLite_js_1._gsScope._gsDefine("TimelineLite", ["core.Animation", "core.SimpleTimeline", "TweenLite"], function () {
var TimelineLite = function (vars) {
TweenLite_js_1.SimpleTimeline.call(this, vars);
var self = this, v = self.vars, val, p;
self._labels = {};
self.autoRemoveChildren = !!v.autoRemoveChildren;
self.smoothChildTiming = !!v.smoothChildTiming;
self._sortChildren = true;
self._onUpdate = v.onUpdate;
for (p in v) {
val = v[p];
if (_isArray(val))
if (val.join("").indexOf("{self}") !== -1) {
v[p] = self._swapSelfInParams(val);
}
}
if (_isArray(v.tweens)) {
self.add(v.tweens, 0, v.align, v.stagger);
}
}, _tinyNum = 0.00000001, TweenLiteInternals = TweenLite_js_1.default._internals, _internals = TimelineLite._internals = {}, _isSelector = TweenLiteInternals.isSelector, _isArray = TweenLiteInternals.isArray, _lazyTweens = TweenLiteInternals.lazyTweens, _lazyRender = TweenLiteInternals.lazyRender, _globals = TweenLite_js_1._gsScope._gsDefine.globals, _copy = function (vars) {
var copy = {}, p;
for (p in vars) {
copy[p] = vars[p];
}
return copy;
}, _applyCycle = function (vars, targets, i) {
var alt = vars.cycle, p, val;
for (p in alt) {
val = alt[p];
vars[p] = (typeof (val) === "function") ? val(i, targets[i], targets) : val[i % val.length];
}
delete vars.cycle;
}, _pauseCallback = _internals.pauseCallback = function () { }, _slice = function (a) {
var b = [], l = a.length, i;
for (i = 0; i !== l; b.push(a[i++]))
;
return b;
}, _defaultImmediateRender = function (tl, toVars, fromVars, defaultFalse) {
var ir = "immediateRender";
if (!(ir in toVars)) {
toVars[ir] = !((fromVars && fromVars[ir] === false) || defaultFalse);
}
return toVars;
}, _distribute = function (v) {
if (typeof (v) === "function") {
return v;
}
var vars = (typeof (v) === "object") ? v : { each: v }, ease = vars.ease, from = vars.from || 0, base = vars.base || 0, cache = {}, isFromKeyword = isNaN(from), axis = vars.axis, ratio = { center: 0.5, end: 1 }[from] || 0;
return function (i, target, a) {
var l = (a || vars).length, distances = cache[l], originX, originY, x, y, d, j, max, min, wrap;
if (!distances) {
wrap = (vars.grid === "auto") ? 0 : (vars.grid || [Infinity])[0];
if (!wrap) {
max = -Infinity;
while (max < (max = a[wrap++].getBoundingClientRect().left) && wrap < l) { }
wrap--;
}
distances = cache[l] = [];
originX = isFromKeyword ? (Math.min(wrap, l) * ratio) - 0.5 : from % wrap;
originY = isFromKeyword ? l * ratio / wrap - 0.5 : (from / wrap) | 0;
max = 0;
min = Infinity;
for (j = 0; j < l; j++) {
x = (j % wrap) - originX;
y = originY - ((j / wrap) | 0);
distances[j] = d = !axis ? Math.sqrt(x * x + y * y) : Math.abs((axis === "y") ? y : x);
if (d > max) {
max = d;
}
if (d < min) {
min = d;
}
}
distances.max = max - min;
distances.min = min;
distances.v = l = vars.amount || (vars.each * (wrap > l ? l - 1 : !axis ? Math.max(wrap, l / wrap) : axis === "y" ? l / wrap : wrap)) || 0;
distances.b = (l < 0) ? base - l : base;
}
l = (distances[i] - distances.min) / distances.max;
return distances.b + (ease ? ease.getRatio(l) : l) * distances.v;
};
}, p = TimelineLite.prototype = new TweenLite_js_1.SimpleTimeline();
TimelineLite.version = "2.1.3";
TimelineLite.distribute = _distribute;
p.constructor = TimelineLite;
p.kill()._gc = p._forcingPlayhead = p._hasPause = false;
p.to = function (target, duration, vars, position) {
var Engine = (vars.repeat && _globals.TweenMax) || TweenLite_js_1.default;
return duration ? this.add(new Engine(target, duration, vars), position) : this.set(target, vars, position);
};
p.from = function (target, duration, vars, position) {
return this.add(((vars.repeat && _globals.TweenMax) || TweenLite_js_1.default).from(target, duration, _defaultImmediateRender(this, vars)), position);
};
p.fromTo = function (target, duration, fromVars, toVars, position) {
var Engine = (toVars.repeat && _globals.TweenMax) || TweenLite_js_1.default;
toVars = _defaultImmediateRender(this, toVars, fromVars);
return duration ? this.add(Engine.fromTo(target, duration, fromVars, toVars), position) : this.set(target, toVars, position);
};
p.staggerTo = function (targets, duration, vars, stagger, position, onCompleteAll, onCompleteAllParams, onCompleteAllScope) {
var tl = new TimelineLite({ onComplete: onCompleteAll, onCompleteParams: onCompleteAllParams, callbackScope: onCompleteAllScope, smoothChildTiming: this.smoothChildTiming }), staggerFunc = _distribute(vars.stagger || stagger), startAt = vars.startAt, cycle = vars.cycle, copy, i;
if (typeof (targets) === "string") {
targets = TweenLite_js_1.default.selector(targets) || targets;
}
targets = targets || [];
if (_isSelector(targets)) {
targets = _slice(targets);
}
for (i = 0; i < targets.length; i++) {
copy = _copy(vars);
if (startAt) {
copy.startAt = _copy(startAt);
if (startAt.cycle) {
_applyCycle(copy.startAt, targets, i);
}
}
if (cycle) {
_applyCycle(copy, targets, i);
if (copy.duration != null) {
duration = copy.duration;
delete copy.duration;
}
}
tl.to(targets[i], duration, copy, staggerFunc(i, targets[i], targets));
}
return this.add(tl, position);
};
p.staggerFrom = function (targets, duration, vars, stagger, position, onCompleteAll, onCompleteAllParams, onCompleteAllScope) {
vars.runBackwards = true;
return this.staggerTo(targets, duration, _defaultImmediateRender(this, vars), stagger, position, onCompleteAll, onCompleteAllParams, onCompleteAllScope);
};
p.staggerFromTo = function (targets, duration, fromVars, toVars, stagger, position, onCompleteAll, onCompleteAllParams, onCompleteAllScope) {
toVars.startAt = fromVars;
return this.staggerTo(targets, duration, _defaultImmediateRender(this, toVars, fromVars), stagger, position, onCompleteAll, onCompleteAllParams, onCompleteAllScope);
};
p.call = function (callback, params, scope, position) {
return this.add(TweenLite_js_1.default.delayedCall(0, callback, params, scope), position);
};
p.set = function (target, vars, position) {
return this.add(new TweenLite_js_1.default(target, 0, _defaultImmediateRender(this, vars, null, true)), position);
};
TimelineLite.exportRoot = function (vars, ignoreDelayedCalls) {
vars = vars || {};
if (vars.smoothChildTiming == null) {
vars.smoothChildTiming = true;
}
var tl = new TimelineLite(vars), root = tl._timeline, hasNegativeStart, time, tween, next;
if (ignoreDelayedCalls == null) {
ignoreDelayedCalls = true;
}
root._remove(tl, true);
tl._startTime = 0;
tl._rawPrevTime = tl._time = tl._totalTime = root._time;
tween = root._first;
while (tween) {
next = tween._next;
if (!ignoreDelayedCalls || !(tween instanceof TweenLite_js_1.default && tween.target === tween.vars.onComplete)) {
time = tween._startTime - tween._delay;
if (time < 0) {
hasNegativeStart = 1;
}
tl.add(tween, time);
}
tween = next;
}
root.add(tl, 0);
if (hasNegativeStart) {
tl.totalDuration();
}
return tl;
};
p.add = function (value, position, align, stagger) {
var self = this, curTime, l, i, child, tl, beforeRawTime;
if (typeof (position) !== "number") {
position = self._parseTimeOrLabel(position, 0, true, value);
}
if (!(value instanceof TweenLite_js_1.Animation)) {
if ((value instanceof Array) || (value && value.push && _isArray(value))) {
align = align || "normal";
stagger = stagger || 0;
curTime = position;
l = value.length;
for (i = 0; i < l; i++) {
if (_isArray(child = value[i])) {
child = new TimelineLite({ tweens: child });
}
self.add(child, curTime);
if (typeof (child) !== "string" && typeof (child) !== "function") {
if (align === "sequence") {
curTime = child._startTime + (child.totalDuration() / child._timeScale);
}
else if (align === "start") {
child._startTime -= child.delay();
}
}
curTime += stagger;
}
return self._uncache(true);
}
else if (typeof (value) === "string") {
return self.addLabel(value, position);
}
else if (typeof (value) === "function") {
value = TweenLite_js_1.default.delayedCall(0, value);
}
else {
throw ("Cannot add " + value + " into the timeline; it is not a tween, timeline, function, or string.");
}
}
TweenLite_js_1.SimpleTimeline.prototype.add.call(self, value, position);
if (value._time || (!value._duration && value._initted)) {
curTime = (self.rawTime() - value._startTime) * value._timeScale;
if (!value._duration || Math.abs(Math.max(0, Math.min(value.totalDuration(), curTime))) - value._totalTime > 0.00001) {
value.render(curTime, false, false);
}
}
if (self._gc || self._time === self._duration)
if (!self._paused)
if (self._duration < self.duration()) {
tl = self;
beforeRawTime = (tl.rawTime() > value._startTime);
while (tl._timeline) {
if (beforeRawTime && tl._timeline.smoothChildTiming) {
tl.totalTime(tl._totalTime, true);
}
else if (tl._gc) {
tl._enabled(true, false);
}
tl = tl._timeline;
}
}
return self;
};
p.remove = function (value) {
if (value instanceof TweenLite_js_1.Animation) {
this._remove(value, false);
var tl = value._timeline = value.vars.useFrames ? TweenLite_js_1.Animation._rootFramesTimeline : TweenLite_js_1.Animation._rootTimeline;
value._startTime = (value._paused ? value._pauseTime : tl._time) - ((!value._reversed ? value._totalTime : value.totalDuration() - value._totalTime) / value._timeScale);
return this;
}
else if (value instanceof Array || (value && value.push && _isArray(value))) {
var i = value.length;
while (--i > -1) {
this.remove(value[i]);
}
return this;
}
else if (typeof (value) === "string") {
return this.removeLabel(value);
}
return this.kill(null, value);
};
p._remove = function (tween, skipDisable) {
TweenLite_js_1.SimpleTimeline.prototype._remove.call(this, tween, skipDisable);
var last = this._last;
if (!last) {
this._time = this._totalTime = this._duration = this._totalDuration = 0;
}
else if (this._time > this.duration()) {
this._time = this._duration;
this._totalTime = this._totalDuration;
}
return this;
};
p.append = function (value, offsetOrLabel) {
return this.add(value, this._parseTimeOrLabel(null, offsetOrLabel, true, value));
};
p.insert = p.insertMultiple = function (value, position, align, stagger) {
return this.add(value, position || 0, align, stagger);
};
p.appendMultiple = function (tweens, offsetOrLabel, align, stagger) {
return this.add(tweens, this._parseTimeOrLabel(null, offsetOrLabel, true, tweens), align, stagger);
};
p.addLabel = function (label, position) {
this._labels[label] = this._parseTimeOrLabel(position);
return this;
};
p.addPause = function (position, callback, params, scope) {
var t = TweenLite_js_1.default.delayedCall(0, _pauseCallback, params, scope || this);
t.vars.onComplete = t.vars.onReverseComplete = callback;
t.data = "isPause";
this._hasPause = true;
return this.add(t, position);
};
p.removeLabel = function (label) {
delete this._labels[label];
return this;
};
p.getLabelTime = function (label) {
return (this._labels[label] != null) ? this._labels[label] : -1;
};
p._parseTimeOrLabel = function (timeOrLabel, offsetOrLabel, appendIfAbsent, ignore) {
var clippedDuration, i;
if (ignore instanceof TweenLite_js_1.Animation && ignore.timeline === this) {
this.remove(ignore);
}
else if (ignore && ((ignore instanceof Array) || (ignore.push && _isArray(ignore)))) {
i = ignore.length;
while (--i > -1) {
if (ignore[i] instanceof TweenLite_js_1.Animation && ignore[i].timeline === this) {
this.remove(ignore[i]);
}
}
}
clippedDuration = (typeof (timeOrLabel) === "number" && !offsetOrLabel) ? 0 : (this.duration() > 99999999999) ? this.recent().endTime(false) : this._duration;
if (typeof (offsetOrLabel) === "string") {
return this._parseTimeOrLabel(offsetOrLabel, (appendIfAbsent && typeof (timeOrLabel) === "number" && this._labels[offsetOrLabel] == null) ? timeOrLabel - clippedDuration : 0, appendIfAbsent);
}
offsetOrLabel = offsetOrLabel || 0;
if (typeof (timeOrLabel) === "string" && (isNaN(timeOrLabel) || this._labels[timeOrLabel] != null)) {
i = timeOrLabel.indexOf("=");
if (i === -1) {
if (this._labels[timeOrLabel] == null) {
return appendIfAbsent ? (this._labels[timeOrLabel] = clippedDuration + offsetOrLabel) : offsetOrLabel;
}
return this._labels[timeOrLabel] + offsetOrLabel;
}
offsetOrLabel = parseInt(timeOrLabel.charAt(i - 1) + "1", 10) * Number(timeOrLabel.substr(i + 1));
timeOrLabel = (i > 1) ? this._parseTimeOrLabel(timeOrLabel.substr(0, i - 1), 0, appendIfAbsent) : clippedDuration;
}
else if (timeOrLabel == null) {
timeOrLabel = clippedDuration;
}
return Number(timeOrLabel) + offsetOrLabel;
};
p.seek = function (position, suppressEvents) {
return this.totalTime((typeof (position) === "number") ? position : this._parseTimeOrLabel(position), (suppressEvents !== false));
};
p.stop = function () {
return this.paused(true);
};
p.gotoAndPlay = function (position, suppressEvents) {
return this.play(position, suppressEvents);
};
p.gotoAndStop = function (position, suppressEvents) {
return this.pause(position, suppressEvents);
};
p.render = function (time, suppressEvents, force) {
if (this._gc) {
this._enabled(true, false);
}
var self = this, prevTime = self._time, totalDur = (!self._dirty) ? self._totalDuration : self.totalDuration(), prevStart = self._startTime, prevTimeScale = self._timeScale, prevPaused = self._paused, tween, isComplete, next, callback, internalForce, pauseTween, curTime, pauseTime;
if (prevTime !== self._time) {
time += self._time - prevTime;
}
if (self._hasPause && !self._forcingPlayhead && !suppressEvents) {
if (time > prevTime) {
tween = self._first;
while (tween && tween._startTime <= time && !pauseTween) {
if (!tween._duration)
if (tween.data === "isPause" && !tween.ratio && !(tween._startTime === 0 && self._rawPrevTime === 0)) {
pauseTween = tween;
}
tween = tween._next;
}
}
else {
tween = self._last;
while (tween && tween._startTime >= time && !pauseTween) {
if (!tween._duration)
if (tween.data === "isPause" && tween._rawPrevTime > 0) {
pauseTween = tween;
}
tween = tween._prev;
}
}
if (pauseTween) {
self._time = self._totalTime = time = pauseTween._startTime;
pauseTime = self._startTime + (self._reversed ? self._duration - time : time) / self._timeScale;
}
}
if (time >= totalDur - _tinyNum && time >= 0) {
self._totalTime = self._time = totalDur;
if (!self._reversed)
if (!self._hasPausedChild()) {
isComplete = true;
callback = "onComplete";
internalForce = !!self._timeline.autoRemoveChildren;
if (self._duration === 0)
if ((time <= 0 && time >= -_tinyNum) || self._rawPrevTime < 0 || self._rawPrevTime === _tinyNum)
if (self._rawPrevTime !== time && self._first) {
internalForce = true;
if (self._rawPrevTime > _tinyNum) {
callback = "onReverseComplete";
}
}
}
self._rawPrevTime = (self._duration || !suppressEvents || time || self._rawPrevTime === time) ? time : _tinyNum;
time = totalDur + 0.0001;
}
else if (time < _tinyNum) {
self._totalTime = self._time = 0;
if (time > -_tinyNum) {
time = 0;
}
if (prevTime !== 0 || (self._duration === 0 && self._rawPrevTime !== _tinyNum && (self._rawPrevTime > 0 || (time < 0 && self._rawPrevTime >= 0)))) {
callback = "onReverseComplete";
isComplete = self._reversed;
}
if (time < 0) {
self._active = false;
if (self._timeline.autoRemoveChildren && self._reversed) {
internalForce = isComplete = true;
callback = "onReverseComplete";
}
else if (self._rawPrevTime >= 0 && self._first) {
internalForce = true;
}
self._rawPrevTime = time;
}
else {
self._rawPrevTime = (self._duration || !suppressEvents || time || self._rawPrevTime === time) ? time : _tinyNum;
if (time === 0 && isComplete) {
tween = self._first;
while (tween && tween._startTime === 0) {
if (!tween._duration) {
isComplete = false;
}
tween = tween._next;
}
}
time = 0;
if (!self._initted) {
internalForce = true;
}
}
}
else {
self._totalTime = self._time = self._rawPrevTime = time;
}
if ((self._time === prevTime || !self._first) && !force && !internalForce && !pauseTween) {
return;
}
else if (!self._initted) {
self._initted = true;
}
if (!self._active)
if (!self._paused && self._time !== prevTime && time > 0) {
self._active = true;
}
if (prevTime === 0)
if (self.vars.onStart)
if (self._time !== 0 || !self._duration)
if (!suppressEvents) {
self._callback("onStart");
}
curTime = self._time;
if (curTime >= prevTime) {
tween = self._first;
while (tween) {
next = tween._next;
if (curTime !== self._time || (self._paused && !prevPaused)) {
break;
}
else if (tween._active || (tween._startTime <= curTime && !tween._paused && !tween._gc)) {
if (pauseTween === tween) {
self.pause();
self._pauseTime = pauseTime;
}
if (!tween._reversed) {
tween.render((time - tween._startTime) * tween._timeScale, suppressEvents, force);
}
else {
tween.render(((!tween._dirty) ? tween._totalDuration : tween.totalDuration()) - ((time - tween._startTime) * tween._timeScale), suppressEvents, force);
}
}
tween = next;
}
}
else {
tween = self._last;
while (tween) {
next = tween._prev;
if (curTime !== self._time || (self._paused && !prevPaused)) {
break;
}
else if (tween._active || (tween._startTime <= prevTime && !tween._paused && !tween._gc)) {
if (pauseTween === tween) {
pauseTween = tween._prev;
while (pauseTween && pauseTween.endTime() > self._time) {
pauseTween.render((pauseTween._reversed ? pauseTween.totalDuration() - ((time - pauseTween._startTime) * pauseTween._timeScale) : (time - pauseTween._startTime) * pauseTween._timeScale), suppressEvents, force);
pauseTween = pauseTween._prev;
}
pauseTween = null;
self.pause();
self._pauseTime = pauseTime;
}
if (!tween._reversed) {
tween.render((time - tween._startTime) * tween._timeScale, suppressEvents, force);
}
else {
tween.render(((!tween._dirty) ? tween._totalDuration : tween.totalDuration()) - ((time - tween._startTime) * tween._timeScale), suppressEvents, force);
}
}
tween = next;
}
}
if (self._onUpdate)
if (!suppressEvents) {
if (_lazyTweens.length) {
_lazyRender();
}
self._callback("onUpdate");
}
if (callback)
if (!self._gc)
if (prevStart === self._startTime || prevTimeScale !== self._timeScale)
if (self._time === 0 || totalDur >= self.totalDuration()) {
if (isComplete) {
if (_lazyTweens.length) {
_lazyRender();
}
if (self._timeline.autoRemoveChildren) {
self._enabled(false, false);
}
self._active = false;
}
if (!suppressEvents && self.vars[callback]) {
self._callback(callback);
}
}
};
p._hasPausedChild = function () {
var tween = this._first;
while (tween) {
if (tween._paused || ((tween instanceof TimelineLite) && tween._hasPausedChild())) {
return true;
}
tween = tween._next;
}
return false;
};
p.getChildren = function (nested, tweens, timelines, ignoreBeforeTime) {
ignoreBeforeTime = ignoreBeforeTime || -9999999999;
var a = [], tween = this._first, cnt = 0;
while (tween) {
if (tween._startTime < ignoreBeforeTime) {
}
else if (tween instanceof TweenLite_js_1.default) {
if (tweens !== false) {
a[cnt++] = tween;
}
}
else {
if (timelines !== false) {
a[cnt++] = tween;
}
if (nested !== false) {
a = a.concat(tween.getChildren(true, tweens, timelines));
cnt = a.length;
}
}
tween = tween._next;
}
return a;
};
p.getTweensOf = function (target, nested) {
var disabled = this._gc, a = [], cnt = 0, tweens, i;
if (disabled) {
this._enabled(true, true);
}
tweens = TweenLite_js_1.default.getTweensOf(target);
i = tweens.length;
while (--i > -1) {
if (tweens[i].timeline === this || (nested && this._contains(tweens[i]))) {
a[cnt++] = tweens[i];
}
}
if (disabled) {
this._enabled(false, true);
}
return a;
};
p.recent = function () {
return this._recent;
};
p._contains = function (tween) {
var tl = tween.timeline;
while (tl) {
if (tl === this) {
return true;
}
tl = tl.timeline;
}
return false;
};
p.shiftChildren = function (amount, adjustLabels, ignoreBeforeTime) {
ignoreBeforeTime = ignoreBeforeTime || 0;
var tween = this._first, labels = this._labels, p;
while (tween) {
if (tween._startTime >= ignoreBeforeTime) {
tween._startTime += amount;
}
tween = tween._next;
}
if (adjustLabels) {
for (p in labels) {
if (labels[p] >= ignoreBeforeTime) {
labels[p] += amount;
}
}
}
return this._uncache(true);
};
p._kill = function (vars, target) {
if (!vars && !target) {
return this._enabled(false, false);
}
var tweens = (!target) ? this.getChildren(true, true, false) : this.getTweensOf(target), i = tweens.length, changed = false;
while (--i > -1) {
if (tweens[i]._kill(vars, target)) {
changed = true;
}
}
return changed;
};
p.clear = function (labels) {
var tweens = this.getChildren(false, true, true), i = tweens.length;
this._time = this._totalTime = 0;
while (--i > -1) {
tweens[i]._enabled(false, false);
}
if (labels !== false) {
this._labels = {};
}
return this._uncache(true);
};
p.invalidate = function () {
var tween = this._first;
while (tween) {
tween.invalidate();
tween = tween._next;
}
return TweenLite_js_1.Animation.prototype.invalidate.call(this);
;
};
p._enabled = function (enabled, ignoreTimeline) {
if (enabled === this._gc) {
var tween = this._first;
while (tween) {
tween._enabled(enabled, true);
tween = tween._next;
}
}
return TweenLite_js_1.SimpleTimeline.prototype._enabled.call(this, enabled, ignoreTimeline);
};
p.totalTime = function (time, suppressEvents, uncapped) {
this._forcingPlayhead = true;
var val = TweenLite_js_1.Animation.prototype.totalTime.apply(this, arguments);
this._forcingPlayhead = false;
return val;
};
p.duration = function (value) {
if (!arguments.length) {
if (this._dirty) {
this.totalDuration();
}
return this._duration;
}
if (this.duration() !== 0 && value !== 0) {
this.timeScale(this._duration / value);
}
return this;
};
p.totalDuration = function (value) {
if (!arguments.length) {
if (this._dirty) {
var max = 0, self = this, tween = self._last, prevStart = 999999999999, prev, end;
while (tween) {
prev = tween._prev;
if (tween._dirty) {
tween.totalDuration();
}
if (tween._startTime > prevStart && self._sortChildren && !tween._paused && !self._calculatingDuration) {
self._calculatingDuration = 1;
self.add(tween, tween._startTime - tween._delay);
self._calculatingDuration = 0;
}
else {
prevStart = tween._startTime;
}
if (tween._startTime < 0 && !tween._paused) {
max -= tween._startTime;
if (self._timeline.smoothChildTiming) {
self._startTime += tween._startTime / self._timeScale;
self._time -= tween._startTime;
self._totalTime -= tween._startTime;
self._rawPrevTime -= tween._startTime;
}
self.shiftChildren(-tween._startTime, false, -9999999999);
prevStart = 0;
}
end = tween._startTime + (tween._totalDuration / tween._timeScale);
if (end > max) {
max = end;
}
tween = prev;
}
self._duration = self._totalDuration = max;
self._dirty = false;
}
return this._totalDuration;
}
return (value && this.totalDuration()) ? this.timeScale(this._totalDuration / value) : this;
};
p.paused = function (value) {
if (value === false && this._paused) {
var tween = this._first;
while (tween) {
if (tween._startTime === this._time && tween.data === "isPause") {
tween._rawPrevTime = 0;
}
tween = tween._next;
}
}
return TweenLite_js_1.Animation.prototype.paused.apply(this, arguments);
};
p.usesFrames = function () {
var tl = this._timeline;
while (tl._timeline) {
tl = tl._timeline;
}
return (tl === TweenLite_js_1.Animation._rootFramesTimeline);
};
p.rawTime = function (wrapRepeats) {
return (wrapRepeats && (this._paused || (this._repeat && this.time() > 0 && this.totalProgress() < 1))) ? this._totalTime % (this._duration + this._repeatDelay) : this._paused ? this._totalTime : (this._timeline.rawTime(wrapRepeats) - this._startTime) * this._timeScale;
};
return TimelineLite;
}, true); exports.TimelineLite = TweenLite_js_1.globals.TimelineLite; exports.default = exports.TimelineLite;
} // gsap/TimelineMax.js $fsx.f[82] = (module, exports) => { "use strict"; Object.defineProperty(exports, "__esModule", { value: true }); const TweenLite_js_1 = $fsx.r(80); const TimelineLite_js_1 = $fsx.r(81); exports.TimelineLite = TimelineLite_js_1.default; TweenLite_js_1._gsScope._gsDefine("TimelineMax", ["TimelineLite", "TweenLite", "easing.Ease"], function () {
var TimelineMax = function (vars) {
TimelineLite_js_1.default.call(this, vars);
this._repeat = this.vars.repeat || 0;
this._repeatDelay = this.vars.repeatDelay || 0;
this._cycle = 0;
this._yoyo = !!this.vars.yoyo;
this._dirty = true;
}, _tinyNum = 0.00000001, TweenLiteInternals = TweenLite_js_1.default._internals, _lazyTweens = TweenLiteInternals.lazyTweens, _lazyRender = TweenLiteInternals.lazyRender, _globals = TweenLite_js_1._gsScope._gsDefine.globals, _easeNone = new TweenLite_js_1.Ease(null, null, 1, 0), p = TimelineMax.prototype = new TimelineLite_js_1.default();
p.constructor = TimelineMax;
p.kill()._gc = false;
TimelineMax.version = "2.1.3";
p.invalidate = function () {
this._yoyo = !!this.vars.yoyo;
this._repeat = this.vars.repeat || 0;
this._repeatDelay = this.vars.repeatDelay || 0;
this._uncache(true);
return TimelineLite_js_1.default.prototype.invalidate.call(this);
};
p.addCallback = function (callback, position, params, scope) {
return this.add(TweenLite_js_1.default.delayedCall(0, callback, params, scope), position);
};
p.removeCallback = function (callback, position) {
if (callback) {
if (position == null) {
this._kill(null, callback);
}
else {
var a = this.getTweensOf(callback, false), i = a.length, time = this._parseTimeOrLabel(position);
while (--i > -1) {
if (a[i]._startTime === time) {
a[i]._enabled(false, false);
}
}
}
}
return this;
};
p.removePause = function (position) {
return this.removeCallback(TimelineLite_js_1.default._internals.pauseCallback, position);
};
p.tweenTo = function (position, vars) {
vars = vars || {};
var copy = { ease: _easeNone, useFrames: this.usesFrames(), immediateRender: false, lazy: false }, Engine = (vars.repeat && _globals.TweenMax) || TweenLite_js_1.default, duration, p, t;
for (p in vars) {
copy[p] = vars[p];
}
copy.time = this._parseTimeOrLabel(position);
duration = (Math.abs(Number(copy.time) - this._time) / this._timeScale) || 0.001;
t = new Engine(this, duration, copy);
copy.onStart = function () {
t.target.paused(true);
if (t.vars.time !== t.target.time() && duration === t.duration() && !t.isFromTo) {
t.duration(Math.abs(t.vars.time - t.target.time()) / t.target._timeScale).render(t.time(), true, true);
}
if (vars.onStart) {
vars.onStart.apply(vars.onStartScope || vars.callbackScope || t, vars.onStartParams || []);
}
};
return t;
};
p.tweenFromTo = function (fromPosition, toPosition, vars) {
vars = vars || {};
fromPosition = this._parseTimeOrLabel(fromPosition);
vars.startAt = { onComplete: this.seek, onCompleteParams: [fromPosition], callbackScope: this };
vars.immediateRender = (vars.immediateRender !== false);
var t = this.tweenTo(toPosition, vars);
t.isFromTo = 1;
return t.duration((Math.abs(t.vars.time - fromPosition) / this._timeScale) || 0.001);
};
p.render = function (time, suppressEvents, force) {
if (this._gc) {
this._enabled(true, false);
}
var self = this, prevTime = self._time, totalDur = (!self._dirty) ? self._totalDuration : self.totalDuration(), dur = self._duration, prevTotalTime = self._totalTime, prevStart = self._startTime, prevTimeScale = self._timeScale, prevRawPrevTime = self._rawPrevTime, prevPaused = self._paused, prevCycle = self._cycle, tween, isComplete, next, callback, internalForce, cycleDuration, pauseTween, curTime, pauseTime;
if (prevTime !== self._time) {
time += self._time - prevTime;
}
if (time >= totalDur - _tinyNum && time >= 0) {
if (!self._locked) {
self._totalTime = totalDur;
self._cycle = self._repeat;
}
if (!self._reversed)
if (!self._hasPausedChild()) {
isComplete = true;
callback = "onComplete";
internalForce = !!self._timeline.autoRemoveChildren;
if (self._duration === 0)
if ((time <= 0 && time >= -_tinyNum) || prevRawPrevTime < 0 || prevRawPrevTime === _tinyNum)
if (prevRawPrevTime !== time && self._first) {
internalForce = true;
if (prevRawPrevTime > _tinyNum) {
callback = "onReverseComplete";
}
}
}
self._rawPrevTime = (self._duration || !suppressEvents || time || self._rawPrevTime === time) ? time : _tinyNum;
if (self._yoyo && (self._cycle & 1)) {
self._time = time = 0;
}
else {
self._time = dur;
time = dur + 0.0001;
}
}
else if (time < _tinyNum) {
if (!self._locked) {
self._totalTime = self._cycle = 0;
}
self._time = 0;
if (time > -_tinyNum) {
time = 0;
}
if (prevTime !== 0 || (dur === 0 && prevRawPrevTime !== _tinyNum && (prevRawPrevTime > 0 || (time < 0 && prevRawPrevTime >= 0)) && !self._locked)) {
callback = "onReverseComplete";
isComplete = self._reversed;
}
if (time < 0) {
self._active = false;
if (self._timeline.autoRemoveChildren && self._reversed) {
internalForce = isComplete = true;
callback = "onReverseComplete";
}
else if (prevRawPrevTime >= 0 && self._first) {
internalForce = true;
}
self._rawPrevTime = time;
}
else {
self._rawPrevTime = (dur || !suppressEvents || time || self._rawPrevTime === time) ? time : _tinyNum;
if (time === 0 && isComplete) {
tween = self._first;
while (tween && tween._startTime === 0) {
if (!tween._duration) {
isComplete = false;
}
tween = tween._next;
}
}
time = 0;
if (!self._initted) {
internalForce = true;
}
}
}
else {
if (dur === 0 && prevRawPrevTime < 0) {
internalForce = true;
}
self._time = self._rawPrevTime = time;
if (!self._locked) {
self._totalTime = time;
if (self._repeat !== 0) {
cycleDuration = dur + self._repeatDelay;
self._cycle = (self._totalTime / cycleDuration) >> 0;
if (self._cycle)
if (self._cycle === self._totalTime / cycleDuration && prevTotalTime <= time) {
self._cycle--;
}
self._time = self._totalTime - (self._cycle * cycleDuration);
if (self._yoyo)
if (self._cycle & 1) {
self._time = dur - self._time;
}
if (self._time > dur) {
self._time = dur;
time = dur + 0.0001;
}
else if (self._time < 0) {
self._time = time = 0;
}
else {
time = self._time;
}
}
}
}
if (self._hasPause && !self._forcingPlayhead && !suppressEvents) {
time = self._time;
if (time > prevTime || (self._repeat && prevCycle !== self._cycle)) {
tween = self._first;
while (tween && tween._startTime <= time && !pauseTween) {
if (!tween._duration)
if (tween.data === "isPause" && !tween.ratio && !(tween._startTime === 0 && self._rawPrevTime === 0)) {
pauseTween = tween;
}
tween = tween._next;
}
}
else {
tween = self._last;
while (tween && tween._startTime >= time && !pauseTween) {
if (!tween._duration)
if (tween.data === "isPause" && tween._rawPrevTime > 0) {
pauseTween = tween;
}
tween = tween._prev;
}
}
if (pauseTween) {
pauseTime = self._startTime + (self._reversed ? self._duration - pauseTween._startTime : pauseTween._startTime) / self._timeScale;
if (pauseTween._startTime < dur) {
self._time = self._rawPrevTime = time = pauseTween._startTime;
self._totalTime = time + (self._cycle * (self._totalDuration + self._repeatDelay));
}
}
}
if (self._cycle !== prevCycle)
if (!self._locked) {
var backwards = (self._yoyo && (prevCycle & 1) !== 0), wrap = (backwards === (self._yoyo && (self._cycle & 1) !== 0)), recTotalTime = self._totalTime, recCycle = self._cycle, recRawPrevTime = self._rawPrevTime, recTime = self._time;
self._totalTime = prevCycle * dur;
if (self._cycle < prevCycle) {
backwards = !backwards;
}
else {
self._totalTime += dur;
}
self._time = prevTime;
self._rawPrevTime = (dur === 0) ? prevRawPrevTime - 0.0001 : prevRawPrevTime;
self._cycle = prevCycle;
self._locked = true;
prevTime = (backwards) ? 0 : dur;
self.render(prevTime, suppressEvents, (dur === 0));
if (!suppressEvents)
if (!self._gc) {
if (self.vars.onRepeat) {
self._cycle = recCycle;
self._locked = false;
self._callback("onRepeat");
}
}
if (prevTime !== self._time) {
return;
}
if (wrap) {
self._cycle = prevCycle;
self._locked = true;
prevTime = (backwards) ? dur + 0.0001 : -0.0001;
self.render(prevTime, true, false);
}
self._locked = false;
if (self._paused && !prevPaused) {
return;
}
self._time = recTime;
self._totalTime = recTotalTime;
self._cycle = recCycle;
self._rawPrevTime = recRawPrevTime;
}
if ((self._time === prevTime || !self._first) && !force && !internalForce && !pauseTween) {
if (prevTotalTime !== self._totalTime)
if (self._onUpdate)
if (!suppressEvents) {
self._callback("onUpdate");
}
return;
}
else if (!self._initted) {
self._initted = true;
}
if (!self._active)
if (!self._paused && self._totalTime !== prevTotalTime && time > 0) {
self._active = true;
}
if (prevTotalTime === 0)
if (self.vars.onStart)
if (self._totalTime !== 0 || !self._totalDuration)
if (!suppressEvents) {
self._callback("onStart");
}
curTime = self._time;
if (curTime >= prevTime) {
tween = self._first;
while (tween) {
next = tween._next;
if (curTime !== self._time || (self._paused && !prevPaused)) {
break;
}
else if (tween._active || (tween._startTime <= self._time && !tween._paused && !tween._gc)) {
if (pauseTween === tween) {
self.pause();
self._pauseTime = pauseTime;
}
if (!tween._reversed) {
tween.render((time - tween._startTime) * tween._timeScale, suppressEvents, force);
}
else {
tween.render(((!tween._dirty) ? tween._totalDuration : tween.totalDuration()) - ((time - tween._startTime) * tween._timeScale), suppressEvents, force);
}
}
tween = next;
}
}
else {
tween = self._last;
while (tween) {
next = tween._prev;
if (curTime !== self._time || (self._paused && !prevPaused)) {
break;
}
else if (tween._active || (tween._startTime <= prevTime && !tween._paused && !tween._gc)) {
if (pauseTween === tween) {
pauseTween = tween._prev;
while (pauseTween && pauseTween.endTime() > self._time) {
pauseTween.render((pauseTween._reversed ? pauseTween.totalDuration() - ((time - pauseTween._startTime) * pauseTween._timeScale) : (time - pauseTween._startTime) * pauseTween._timeScale), suppressEvents, force);
pauseTween = pauseTween._prev;
}
pauseTween = null;
self.pause();
self._pauseTime = pauseTime;
}
if (!tween._reversed) {
tween.render((time - tween._startTime) * tween._timeScale, suppressEvents, force);
}
else {
tween.render(((!tween._dirty) ? tween._totalDuration : tween.totalDuration()) - ((time - tween._startTime) * tween._timeScale), suppressEvents, force);
}
}
tween = next;
}
}
if (self._onUpdate)
if (!suppressEvents) {
if (_lazyTweens.length) {
_lazyRender();
}
self._callback("onUpdate");
}
if (callback)
if (!self._locked)
if (!self._gc)
if (prevStart === self._startTime || prevTimeScale !== self._timeScale)
if (self._time === 0 || totalDur >= self.totalDuration()) {
if (isComplete) {
if (_lazyTweens.length) {
_lazyRender();
}
if (self._timeline.autoRemoveChildren) {
self._enabled(false, false);
}
self._active = false;
}
if (!suppressEvents && self.vars[callback]) {
self._callback(callback);
}
}
};
p.getActive = function (nested, tweens, timelines) {
var a = [], all = this.getChildren(nested || (nested == null), tweens || (nested == null), !!timelines), cnt = 0, l = all.length, i, tween;
for (i = 0; i < l; i++) {
tween = all[i];
if (tween.isActive()) {
a[cnt++] = tween;
}
}
return a;
};
p.getLabelAfter = function (time) {
if (!time)
if (time !== 0) {
time = this._time;
}
var labels = this.getLabelsArray(), l = labels.length, i;
for (i = 0; i < l; i++) {
if (labels[i].time > time) {
return labels[i].name;
}
}
return null;
};
p.getLabelBefore = function (time) {
if (time == null) {
time = this._time;
}
var labels = this.getLabelsArray(), i = labels.length;
while (--i > -1) {
if (labels[i].time < time) {
return labels[i].name;
}
}
return null;
};
p.getLabelsArray = function () {
var a = [], cnt = 0, p;
for (p in this._labels) {
a[cnt++] = { time: this._labels[p], name: p };
}
a.sort(function (a, b) {
return a.time - b.time;
});
return a;
};
p.invalidate = function () {
this._locked = false;
return TimelineLite_js_1.default.prototype.invalidate.call(this);
};
p.progress = function (value, suppressEvents) {
return (!arguments.length) ? (this._time / this.duration()) || 0 : this.totalTime(this.duration() * ((this._yoyo && (this._cycle & 1) !== 0) ? 1 - value : value) + (this._cycle * (this._duration + this._repeatDelay)), suppressEvents);
};
p.totalProgress = function (value, suppressEvents) {
return (!arguments.length) ? (this._totalTime / this.totalDuration()) || 0 : this.totalTime(this.totalDuration() * value, suppressEvents);
};
p.totalDuration = function (value) {
if (!arguments.length) {
if (this._dirty) {
TimelineLite_js_1.default.prototype.totalDuration.call(this);
this._totalDuration = (this._repeat === -1) ? 999999999999 : this._duration * (this._repeat + 1) + (this._repeatDelay * this._repeat);
}
return this._totalDuration;
}
return (this._repeat === -1 || !value) ? this : this.timeScale(this.totalDuration() / value);
};
p.time = function (value, suppressEvents) {
if (!arguments.length) {
return this._time;
}
if (this._dirty) {
this.totalDuration();
}
var duration = this._duration, cycle = this._cycle, cycleDur = cycle * (duration + this._repeatDelay);
if (value > duration) {
value = duration;
}
return this.totalTime((this._yoyo && (cycle & 1)) ? duration - value + cycleDur : this._repeat ? value + cycleDur : value, suppressEvents);
};
p.repeat = function (value) {
if (!arguments.length) {
return this._repeat;
}
this._repeat = value;
return this._uncache(true);
};
p.repeatDelay = function (value) {
if (!arguments.length) {
return this._repeatDelay;
}
this._repeatDelay = value;
return this._uncache(true);
};
p.yoyo = function (value) {
if (!arguments.length) {
return this._yoyo;
}
this._yoyo = value;
return this;
};
p.currentLabel = function (value) {
if (!arguments.length) {
return this.getLabelBefore(this._time + _tinyNum);
}
return this.seek(value, true);
};
return TimelineMax;
}, true); exports.TimelineMax = TweenLite_js_1.globals.TimelineMax; exports.default = exports.TimelineMax;
} // gsap/TweenMax.js $fsx.f[90] = (module, exports) => { "use strict"; Object.defineProperty(exports, "__esModule", { value: true }); const TweenLite_js_1 = $fsx.r(80); exports.TweenLite = TweenLite_js_1.default; exports.TweenPlugin = TweenLite_js_1.TweenPlugin; exports.Ease = TweenLite_js_1.Ease; exports.Power0 = TweenLite_js_1.Power0; exports.Power1 = TweenLite_js_1.Power1; exports.Power2 = TweenLite_js_1.Power2; exports.Power3 = TweenLite_js_1.Power3; exports.Power4 = TweenLite_js_1.Power4; exports.Linear = TweenLite_js_1.Linear; const TweenMaxBase_js_1 = $fsx.r(83); const CSSPlugin_js_1 = $fsx.r(84); exports.CSSPlugin = CSSPlugin_js_1.default; const AttrPlugin_js_1 = $fsx.r(85); exports.AttrPlugin = AttrPlugin_js_1.default; const RoundPropsPlugin_js_1 = $fsx.r(86); exports.RoundPropsPlugin = RoundPropsPlugin_js_1.default; const DirectionalRotationPlugin_js_1 = $fsx.r(87); exports.DirectionalRotationPlugin = DirectionalRotationPlugin_js_1.default; const TimelineLite_js_1 = $fsx.r(81); exports.TimelineLite = TimelineLite_js_1.default; const TimelineMax_js_1 = $fsx.r(82); exports.TimelineMax = TimelineMax_js_1.default; const BezierPlugin_js_1 = $fsx.r(88); exports.BezierPlugin = BezierPlugin_js_1.default; const EasePack_js_1 = $fsx.r(89); exports.Back = EasePack_js_1.Back; exports.Elastic = EasePack_js_1.Elastic; exports.Bounce = EasePack_js_1.Bounce; exports.RoughEase = EasePack_js_1.RoughEase; exports.SlowMo = EasePack_js_1.SlowMo; exports.SteppedEase = EasePack_js_1.SteppedEase; exports.Circ = EasePack_js_1.Circ; exports.Expo = EasePack_js_1.Expo; exports.Sine = EasePack_js_1.Sine; exports.ExpoScaleEase = EasePack_js_1.ExpoScaleEase; exports.TweenMax = TweenMaxBase_js_1.default; exports.default = exports.TweenMax; exports.TweenMax._autoActivated = [TimelineLite_js_1.default, TimelineMax_js_1.default, CSSPlugin_js_1.default, AttrPlugin_js_1.default, BezierPlugin_js_1.default, RoundPropsPlugin_js_1.default, DirectionalRotationPlugin_js_1.default, EasePack_js_1.Back, EasePack_js_1.Elastic, EasePack_js_1.Bounce, EasePack_js_1.RoughEase, EasePack_js_1.SlowMo, EasePack_js_1.SteppedEase, EasePack_js_1.Circ, EasePack_js_1.Expo, EasePack_js_1.Sine, EasePack_js_1.ExpoScaleEase];
} // gsap/TweenMaxBase.js $fsx.f[83] = (module, exports) => { "use strict"; Object.defineProperty(exports, "__esModule", { value: true }); const TweenLite_js_1 = $fsx.r(80); exports.TweenLite = TweenLite_js_1.default; exports.Ease = TweenLite_js_1.Ease; exports.Power0 = TweenLite_js_1.Power0; exports.Power1 = TweenLite_js_1.Power1; exports.Power2 = TweenLite_js_1.Power2; exports.Power3 = TweenLite_js_1.Power3; exports.Power4 = TweenLite_js_1.Power4; exports.Linear = TweenLite_js_1.Linear; TweenLite_js_1._gsScope._gsDefine("TweenMax", ["core.Animation", "core.SimpleTimeline", "TweenLite"], function () {
var _slice = function (a) {
var b = [], l = a.length, i;
for (i = 0; i !== l; b.push(a[i++]))
;
return b;
}, _applyCycle = function (vars, targets, i) {
var alt = vars.cycle, p, val;
for (p in alt) {
val = alt[p];
vars[p] = (typeof (val) === "function") ? val(i, targets[i], targets) : val[i % val.length];
}
delete vars.cycle;
}, _distribute = function (v) {
if (typeof (v) === "function") {
return v;
}
var vars = (typeof (v) === "object") ? v : { each: v }, ease = vars.ease, from = vars.from || 0, base = vars.base || 0, cache = {}, isFromKeyword = isNaN(from), axis = vars.axis, ratio = { center: 0.5, end: 1 }[from] || 0;
return function (i, target, a) {
var l = (a || vars).length, distances = cache[l], originX, originY, x, y, d, j, max, min, wrap;
if (!distances) {
wrap = (vars.grid === "auto") ? 0 : (vars.grid || [Infinity])[0];
if (!wrap) {
max = -Infinity;
while (max < (max = a[wrap++].getBoundingClientRect().left) && wrap < l) { }
wrap--;
}
distances = cache[l] = [];
originX = isFromKeyword ? (Math.min(wrap, l) * ratio) - 0.5 : from % wrap;
originY = isFromKeyword ? l * ratio / wrap - 0.5 : (from / wrap) | 0;
max = 0;
min = Infinity;
for (j = 0; j < l; j++) {
x = (j % wrap) - originX;
y = originY - ((j / wrap) | 0);
distances[j] = d = !axis ? Math.sqrt(x * x + y * y) : Math.abs((axis === "y") ? y : x);
if (d > max) {
max = d;
}
if (d < min) {
min = d;
}
}
distances.max = max - min;
distances.min = min;
distances.v = l = vars.amount || (vars.each * (wrap > l ? l - 1 : !axis ? Math.max(wrap, l / wrap) : axis === "y" ? l / wrap : wrap)) || 0;
distances.b = (l < 0) ? base - l : base;
}
l = (distances[i] - distances.min) / distances.max;
return distances.b + (ease ? ease.getRatio(l) : l) * distances.v;
};
}, TweenMax = function (target, duration, vars) {
TweenLite_js_1.default.call(this, target, duration, vars);
this._cycle = 0;
this._yoyo = (this.vars.yoyo === true || !!this.vars.yoyoEase);
this._repeat = this.vars.repeat || 0;
this._repeatDelay = this.vars.repeatDelay || 0;
if (this._repeat) {
this._uncache(true);
}
this.render = TweenMax.prototype.render;
}, _tinyNum = 0.00000001, TweenLiteInternals = TweenLite_js_1.default._internals, _isSelector = TweenLiteInternals.isSelector, _isArray = TweenLiteInternals.isArray, p = TweenMax.prototype = TweenLite_js_1.default.to({}, 0.1, {}), _blankArray = [];
TweenMax.version = "2.1.3";
p.constructor = TweenMax;
p.kill()._gc = false;
TweenMax.killTweensOf = TweenMax.killDelayedCallsTo = TweenLite_js_1.default.killTweensOf;
TweenMax.getTweensOf = TweenLite_js_1.default.getTweensOf;
TweenMax.lagSmoothing = TweenLite_js_1.default.lagSmoothing;
TweenMax.ticker = TweenLite_js_1.default.ticker;
TweenMax.render = TweenLite_js_1.default.render;
TweenMax.distribute = _distribute;
p.invalidate = function () {
this._yoyo = (this.vars.yoyo === true || !!this.vars.yoyoEase);
this._repeat = this.vars.repeat || 0;
this._repeatDelay = this.vars.repeatDelay || 0;
this._yoyoEase = null;
this._uncache(true);
return TweenLite_js_1.default.prototype.invalidate.call(this);
};
p.updateTo = function (vars, resetDuration) {
var self = this, curRatio = self.ratio, immediate = self.vars.immediateRender || vars.immediateRender, p;
if (resetDuration && self._startTime < self._timeline._time) {
self._startTime = self._timeline._time;
self._uncache(false);
if (self._gc) {
self._enabled(true, false);
}
else {
self._timeline.insert(self, self._startTime - self._delay);
}
}
for (p in vars) {
self.vars[p] = vars[p];
}
if (self._initted || immediate) {
if (resetDuration) {
self._initted = false;
if (immediate) {
self.render(0, true, true);
}
}
else {
if (self._gc) {
self._enabled(true, false);
}
if (self._notifyPluginsOfEnabled && self._firstPT) {
TweenLite_js_1.default._onPluginEvent("_onDisable", self);
}
if (self._time / self._duration > 0.998) {
var prevTime = self._totalTime;
self.render(0, true, false);
self._initted = false;
self.render(prevTime, true, false);
}
else {
self._initted = false;
self._init();
if (self._time > 0 || immediate) {
var inv = 1 / (1 - curRatio), pt = self._firstPT, endValue;
while (pt) {
endValue = pt.s + pt.c;
pt.c *= inv;
pt.s = endValue - pt.c;
pt = pt._next;
}
}
}
}
}
return self;
};
p.render = function (time, suppressEvents, force) {
if (!this._initted)
if (this._duration === 0 && this.vars.repeat) {
this.invalidate();
}
var self = this, totalDur = (!self._dirty) ? self._totalDuration : self.totalDuration(), prevTime = self._time, prevTotalTime = self._totalTime, prevCycle = self._cycle, duration = self._duration, prevRawPrevTime = self._rawPrevTime, isComplete, callback, pt, cycleDuration, r, type, pow, rawPrevTime, yoyoEase;
if (time >= totalDur - _tinyNum && time >= 0) {
self._totalTime = totalDur;
self._cycle = self._repeat;
if (self._yoyo && (self._cycle & 1) !== 0) {
self._time = 0;
self.ratio = self._ease._calcEnd ? self._ease.getRatio(0) : 0;
}
else {
self._time = duration;
self.ratio = self._ease._calcEnd ? self._ease.getRatio(1) : 1;
}
if (!self._reversed) {
isComplete = true;
callback = "onComplete";
force = (force || self._timeline.autoRemoveChildren);
}
if (duration === 0)
if (self._initted || !self.vars.lazy || force) {
if (self._startTime === self._timeline._duration) {
time = 0;
}
if (prevRawPrevTime < 0 || (time <= 0 && time >= -_tinyNum) || (prevRawPrevTime === _tinyNum && self.data !== "isPause"))
if (prevRawPrevTime !== time) {
force = true;
if (prevRawPrevTime > _tinyNum) {
callback = "onReverseComplete";
}
}
self._rawPrevTime = rawPrevTime = (!suppressEvents || time || prevRawPrevTime === time) ? time : _tinyNum;
}
}
else if (time < _tinyNum) {
self._totalTime = self._time = self._cycle = 0;
self.ratio = self._ease._calcEnd ? self._ease.getRatio(0) : 0;
if (prevTotalTime !== 0 || (duration === 0 && prevRawPrevTime > 0)) {
callback = "onReverseComplete";
isComplete = self._reversed;
}
if (time > -_tinyNum) {
time = 0;
}
else if (time < 0) {
self._active = false;
if (duration === 0)
if (self._initted || !self.vars.lazy || force) {
if (prevRawPrevTime >= 0) {
force = true;
}
self._rawPrevTime = rawPrevTime = (!suppressEvents || time || prevRawPrevTime === time) ? time : _tinyNum;
}
}
if (!self._initted) {
force = true;
}
}
else {
self._totalTime = self._time = time;
if (self._repeat !== 0) {
cycleDuration = duration + self._repeatDelay;
self._cycle = (self._totalTime / cycleDuration) >> 0;
if (self._cycle !== 0)
if (self._cycle === self._totalTime / cycleDuration && prevTotalTime <= time) {
self._cycle--;
}
self._time = self._totalTime - (self._cycle * cycleDuration);
if (self._yoyo)
if ((self._cycle & 1) !== 0) {
self._time = duration - self._time;
yoyoEase = self._yoyoEase || self.vars.yoyoEase;
if (yoyoEase) {
if (!self._yoyoEase) {
if (yoyoEase === true && !self._initted) {
yoyoEase = self.vars.ease;
self._yoyoEase = yoyoEase = !yoyoEase ? TweenLite_js_1.default.defaultEase : (yoyoEase instanceof TweenLite_js_1.Ease) ? yoyoEase : (typeof (yoyoEase) === "function") ? new TweenLite_js_1.Ease(yoyoEase, self.vars.easeParams) : TweenLite_js_1.Ease.map[yoyoEase] || TweenLite_js_1.default.defaultEase;
}
else {
self._yoyoEase = yoyoEase = (yoyoEase === true) ? self._ease : (yoyoEase instanceof TweenLite_js_1.Ease) ? yoyoEase : TweenLite_js_1.Ease.map[yoyoEase];
}
}
self.ratio = yoyoEase ? 1 - yoyoEase.getRatio((duration - self._time) / duration) : 0;
}
}
if (self._time > duration) {
self._time = duration;
}
else if (self._time < 0) {
self._time = 0;
}
}
if (self._easeType && !yoyoEase) {
r = self._time / duration;
type = self._easeType;
pow = self._easePower;
if (type === 1 || (type === 3 && r >= 0.5)) {
r = 1 - r;
}
if (type === 3) {
r *= 2;
}
if (pow === 1) {
r *= r;
}
else if (pow === 2) {
r *= r * r;
}
else if (pow === 3) {
r *= r * r * r;
}
else if (pow === 4) {
r *= r * r * r * r;
}
self.ratio = (type === 1) ? 1 - r : (type === 2) ? r : (self._time / duration < 0.5) ? r / 2 : 1 - (r / 2);
}
else if (!yoyoEase) {
self.ratio = self._ease.getRatio(self._time / duration);
}
}
if (prevTime === self._time && !force && prevCycle === self._cycle) {
if (prevTotalTime !== self._totalTime)
if (self._onUpdate)
if (!suppressEvents) {
self._callback("onUpdate");
}
return;
}
else if (!self._initted) {
self._init();
if (!self._initted || self._gc) {
return;
}
else if (!force && self._firstPT && ((self.vars.lazy !== false && self._duration) || (self.vars.lazy && !self._duration))) {
self._time = prevTime;
self._totalTime = prevTotalTime;
self._rawPrevTime = prevRawPrevTime;
self._cycle = prevCycle;
TweenLiteInternals.lazyTweens.push(self);
self._lazy = [time, suppressEvents];
return;
}
if (self._time && !isComplete && !yoyoEase) {
self.ratio = self._ease.getRatio(self._time / duration);
}
else if (isComplete && this._ease._calcEnd && !yoyoEase) {
self.ratio = self._ease.getRatio((self._time === 0) ? 0 : 1);
}
}
if (self._lazy !== false) {
self._lazy = false;
}
if (!self._active)
if (!self._paused && self._time !== prevTime && time >= 0) {
self._active = true;
}
if (prevTotalTime === 0) {
if (self._initted === 2 && time > 0) {
self._init();
}
if (self._startAt) {
if (time >= 0) {
self._startAt.render(time, true, force);
}
else if (!callback) {
callback = "_dummyGS";
}
}
if (self.vars.onStart)
if (self._totalTime !== 0 || duration === 0)
if (!suppressEvents) {
self._callback("onStart");
}
}
pt = self._firstPT;
while (pt) {
if (pt.f) {
pt.t[pt.p](pt.c * self.ratio + pt.s);
}
else {
pt.t[pt.p] = pt.c * self.ratio + pt.s;
}
pt = pt._next;
}
if (self._onUpdate) {
if (time < 0)
if (self._startAt && self._startTime) {
self._startAt.render(time, true, force);
}
if (!suppressEvents)
if (self._totalTime !== prevTotalTime || callback) {
self._callback("onUpdate");
}
}
if (self._cycle !== prevCycle)
if (!suppressEvents)
if (!self._gc)
if (self.vars.onRepeat) {
self._callback("onRepeat");
}
if (callback)
if (!self._gc || force) {
if (time < 0 && self._startAt && !self._onUpdate && self._startTime) {
self._startAt.render(time, true, force);
}
if (isComplete) {
if (self._timeline.autoRemoveChildren) {
self._enabled(false, false);
}
self._active = false;
}
if (!suppressEvents && self.vars[callback]) {
self._callback(callback);
}
if (duration === 0 && self._rawPrevTime === _tinyNum && rawPrevTime !== _tinyNum) {
self._rawPrevTime = 0;
}
}
};
TweenMax.to = function (target, duration, vars) {
return new TweenMax(target, duration, vars);
};
TweenMax.from = function (target, duration, vars) {
vars.runBackwards = true;
vars.immediateRender = (vars.immediateRender != false);
return new TweenMax(target, duration, vars);
};
TweenMax.fromTo = function (target, duration, fromVars, toVars) {
toVars.startAt = fromVars;
toVars.immediateRender = (toVars.immediateRender != false && fromVars.immediateRender != false);
return new TweenMax(target, duration, toVars);
};
TweenMax.staggerTo = TweenMax.allTo = function (targets, duration, vars, stagger, onCompleteAll, onCompleteAllParams, onCompleteAllScope) {
var a = [], staggerFunc = _distribute(vars.stagger || stagger), cycle = vars.cycle, fromCycle = (vars.startAt || _blankArray).cycle, l, copy, i, p;
if (!_isArray(targets)) {
if (typeof (targets) === "string") {
targets = TweenLite_js_1.default.selector(targets) || targets;
}
if (_isSelector(targets)) {
targets = _slice(targets);
}
}
targets = targets || [];
l = targets.length - 1;
for (i = 0; i <= l; i++) {
copy = {};
for (p in vars) {
copy[p] = vars[p];
}
if (cycle) {
_applyCycle(copy, targets, i);
if (copy.duration != null) {
duration = copy.duration;
delete copy.duration;
}
}
if (fromCycle) {
fromCycle = copy.startAt = {};
for (p in vars.startAt) {
fromCycle[p] = vars.startAt[p];
}
_applyCycle(copy.startAt, targets, i);
}
copy.delay = staggerFunc(i, targets[i], targets) + (copy.delay || 0);
if (i === l && onCompleteAll) {
copy.onComplete = function () {
if (vars.onComplete) {
vars.onComplete.apply(vars.onCompleteScope || this, arguments);
}
onCompleteAll.apply(onCompleteAllScope || vars.callbackScope || this, onCompleteAllParams || _blankArray);
};
}
a[i] = new TweenMax(targets[i], duration, copy);
}
return a;
};
TweenMax.staggerFrom = TweenMax.allFrom = function (targets, duration, vars, stagger, onCompleteAll, onCompleteAllParams, onCompleteAllScope) {
vars.runBackwards = true;
vars.immediateRender = (vars.immediateRender != false);
return TweenMax.staggerTo(targets, duration, vars, stagger, onCompleteAll, onCompleteAllParams, onCompleteAllScope);
};
TweenMax.staggerFromTo = TweenMax.allFromTo = function (targets, duration, fromVars, toVars, stagger, onCompleteAll, onCompleteAllParams, onCompleteAllScope) {
toVars.startAt = fromVars;
toVars.immediateRender = (toVars.immediateRender != false && fromVars.immediateRender != false);
return TweenMax.staggerTo(targets, duration, toVars, stagger, onCompleteAll, onCompleteAllParams, onCompleteAllScope);
};
TweenMax.delayedCall = function (delay, callback, params, scope, useFrames) {
return new TweenMax(callback, 0, { delay: delay, onComplete: callback, onCompleteParams: params, callbackScope: scope, onReverseComplete: callback, onReverseCompleteParams: params, immediateRender: false, useFrames: useFrames, overwrite: 0 });
};
TweenMax.set = function (target, vars) {
return new TweenMax(target, 0, vars);
};
TweenMax.isTweening = function (target) {
return (TweenLite_js_1.default.getTweensOf(target, true).length > 0);
};
var _getChildrenOf = function (timeline, includeTimelines) {
var a = [], cnt = 0, tween = timeline._first;
while (tween) {
if (tween instanceof TweenLite_js_1.default) {
a[cnt++] = tween;
}
else {
if (includeTimelines) {
a[cnt++] = tween;
}
a = a.concat(_getChildrenOf(tween, includeTimelines));
cnt = a.length;
}
tween = tween._next;
}
return a;
}, getAllTweens = TweenMax.getAllTweens = function (includeTimelines) {
return _getChildrenOf(TweenLite_js_1.Animation._rootTimeline, includeTimelines).concat(_getChildrenOf(TweenLite_js_1.Animation._rootFramesTimeline, includeTimelines));
};
TweenMax.killAll = function (complete, tweens, delayedCalls, timelines) {
if (tweens == null) {
tweens = true;
}
if (delayedCalls == null) {
delayedCalls = true;
}
var a = getAllTweens((timelines != false)), l = a.length, allTrue = (tweens && delayedCalls && timelines), isDC, tween, i;
for (i = 0; i < l; i++) {
tween = a[i];
if (allTrue || (tween instanceof TweenLite_js_1.SimpleTimeline) || ((isDC = (tween.target === tween.vars.onComplete)) && delayedCalls) || (tweens && !isDC)) {
if (complete) {
tween.totalTime(tween._reversed ? 0 : tween.totalDuration());
}
else {
tween._enabled(false, false);
}
}
}
};
TweenMax.killChildTweensOf = function (parent, complete) {
if (parent == null) {
return;
}
var tl = TweenLiteInternals.tweenLookup, a, curParent, p, i, l;
if (typeof (parent) === "string") {
parent = TweenLite_js_1.default.selector(parent) || parent;
}
if (_isSelector(parent)) {
parent = _slice(parent);
}
if (_isArray(parent)) {
i = parent.length;
while (--i > -1) {
TweenMax.killChildTweensOf(parent[i], complete);
}
return;
}
a = [];
for (p in tl) {
curParent = tl[p].target.parentNode;
while (curParent) {
if (curParent === parent) {
a = a.concat(tl[p].tweens);
}
curParent = curParent.parentNode;
}
}
l = a.length;
for (i = 0; i < l; i++) {
if (complete) {
a[i].totalTime(a[i].totalDuration());
}
a[i]._enabled(false, false);
}
};
var _changePause = function (pause, tweens, delayedCalls, timelines) {
tweens = (tweens !== false);
delayedCalls = (delayedCalls !== false);
timelines = (timelines !== false);
var a = getAllTweens(timelines), allTrue = (tweens && delayedCalls && timelines), i = a.length, isDC, tween;
while (--i > -1) {
tween = a[i];
if (allTrue || (tween instanceof TweenLite_js_1.SimpleTimeline) || ((isDC = (tween.target === tween.vars.onComplete)) && delayedCalls) || (tweens && !isDC)) {
tween.paused(pause);
}
}
};
TweenMax.pauseAll = function (tweens, delayedCalls, timelines) {
_changePause(true, tweens, delayedCalls, timelines);
};
TweenMax.resumeAll = function (tweens, delayedCalls, timelines) {
_changePause(false, tweens, delayedCalls, timelines);
};
TweenMax.globalTimeScale = function (value) {
var tl = TweenLite_js_1.Animation._rootTimeline, t = TweenLite_js_1.default.ticker.time;
if (!arguments.length) {
return tl._timeScale;
}
value = value || _tinyNum;
tl._startTime = t - ((t - tl._startTime) * tl._timeScale / value);
tl = TweenLite_js_1.Animation._rootFramesTimeline;
t = TweenLite_js_1.default.ticker.frame;
tl._startTime = t - ((t - tl._startTime) * tl._timeScale / value);
tl._timeScale = TweenLite_js_1.Animation._rootTimeline._timeScale = value;
return value;
};
p.progress = function (value, suppressEvents) {
return (!arguments.length) ? (this.duration() ? this._time / this._duration : this.ratio) : this.totalTime(this.duration() * ((this._yoyo && (this._cycle & 1) !== 0) ? 1 - value : value) + (this._cycle * (this._duration + this._repeatDelay)), suppressEvents);
};
p.totalProgress = function (value, suppressEvents) {
return (!arguments.length) ? this._totalTime / this.totalDuration() : this.totalTime(this.totalDuration() * value, suppressEvents);
};
p.time = function (value, suppressEvents) {
if (!arguments.length) {
return this._time;
}
if (this._dirty) {
this.totalDuration();
}
var duration = this._duration, cycle = this._cycle, cycleDur = cycle * (duration + this._repeatDelay);
if (value > duration) {
value = duration;
}
return this.totalTime((this._yoyo && (cycle & 1)) ? duration - value + cycleDur : this._repeat ? value + cycleDur : value, suppressEvents);
};
p.duration = function (value) {
if (!arguments.length) {
return this._duration;
}
return TweenLite_js_1.Animation.prototype.duration.call(this, value);
};
p.totalDuration = function (value) {
if (!arguments.length) {
if (this._dirty) {
this._totalDuration = (this._repeat === -1) ? 999999999999 : this._duration * (this._repeat + 1) + (this._repeatDelay * this._repeat);
this._dirty = false;
}
return this._totalDuration;
}
return (this._repeat === -1) ? this : this.duration((value - (this._repeat * this._repeatDelay)) / (this._repeat + 1));
};
p.repeat = function (value) {
if (!arguments.length) {
return this._repeat;
}
this._repeat = value;
return this._uncache(true);
};
p.repeatDelay = function (value) {
if (!arguments.length) {
return this._repeatDelay;
}
this._repeatDelay = value;
return this._uncache(true);
};
p.yoyo = function (value) {
if (!arguments.length) {
return this._yoyo;
}
this._yoyo = value;
return this;
};
return TweenMax;
}, true); exports.TweenMax = TweenLite_js_1.globals.TweenMax; exports.default = exports.TweenMax; exports.TweenMaxBase = exports.TweenMax;
} // gsap/CSSPlugin.js $fsx.f[84] = (module, exports) => { "use strict"; Object.defineProperty(exports, "__esModule", { value: true }); const TweenLite_js_1 = $fsx.r(80); TweenLite_js_1._gsScope._gsDefine("plugins.CSSPlugin", ["plugins.TweenPlugin", "TweenLite"], function () {
var CSSPlugin = function () {
TweenLite_js_1.TweenPlugin.call(this, "css");
this._overwriteProps.length = 0;
this.setRatio = CSSPlugin.prototype.setRatio;
}, _globals = TweenLite_js_1._gsScope._gsDefine.globals, _hasPriority, _suffixMap, _cs, _overwriteProps, _specialProps = {}, p = CSSPlugin.prototype = new TweenLite_js_1.TweenPlugin("css");
p.constructor = CSSPlugin;
CSSPlugin.version = "2.1.3";
CSSPlugin.API = 2;
CSSPlugin.defaultTransformPerspective = 0;
CSSPlugin.defaultSkewType = "compensated";
CSSPlugin.defaultSmoothOrigin = true;
p = "px";
CSSPlugin.suffixMap = { top: p, right: p, bottom: p, left: p, width: p, height: p, fontSize: p, padding: p, margin: p, perspective: p, lineHeight: "" };
var _numExp = /(?:\-|\.|\b)(\d|\.|e\-)+/g, _relNumExp = /(?:\d|\-\d|\.\d|\-\.\d|\+=\d|\-=\d|\+=.\d|\-=\.\d)+/g, _valuesExp = /(?:\+=|\-=|\-|\b)[\d\-\.]+[a-zA-Z0-9]*(?:%|\b)/gi, _valuesExpWithCommas = /(?:\+=|\-=|\-|\b)[\d\-\.]+[a-zA-Z0-9]*(?:%|\b),?/gi, _NaNExp = /(?![+-]?\d*\.?\d+|[+-]|e[+-]\d+)[^0-9]/g, _suffixExp = /(?:\d|\-|\+|=|#|\.)*/g, _opacityExp = /opacity *= *([^)]*)/i, _opacityValExp = /opacity:([^;]*)/i, _alphaFilterExp = /alpha\(opacity *=.+?\)/i, _rgbhslExp = /^(rgb|hsl)/, _capsExp = /([A-Z])/g, _camelExp = /-([a-z])/gi, _urlExp = /(^(?:url\(\"|url\())|(?:(\"\))$|\)$)/gi, _camelFunc = function (s, g) { return g.toUpperCase(); }, _horizExp = /(?:Left|Right|Width)/i, _ieGetMatrixExp = /(M11|M12|M21|M22)=[\d\-\.e]+/gi, _ieSetMatrixExp = /progid\:DXImageTransform\.Microsoft\.Matrix\(.+?\)/i, _commasOutsideParenExp = /,(?=[^\)]*(?:\(|$))/gi, _complexExp = /[\s,\(]/i, _DEG2RAD = Math.PI / 180, _RAD2DEG = 180 / Math.PI, _forcePT = {}, _dummyElement = { style: {} }, _doc = TweenLite_js_1._gsScope.document || { createElement: function () { return _dummyElement; } }, _createElement = function (type, ns) {
var e = _doc.createElementNS ? _doc.createElementNS(ns || "http://www.w3.org/1999/xhtml", type) : _doc.createElement(type);
return e.style ? e : _doc.createElement(type);
}, _tempDiv = _createElement("div"), _tempImg = _createElement("img"), _internals = CSSPlugin._internals = { _specialProps: _specialProps }, _agent = (TweenLite_js_1._gsScope.navigator || {}).userAgent || "", _autoRound, _reqSafariFix, _isSafari, _isFirefox, _isSafariLT6, _ieVers, _supportsOpacity = (function () {
var i = _agent.indexOf("Android"), a = _createElement("a");
_isSafari = (_agent.indexOf("Safari") !== -1 && _agent.indexOf("Chrome") === -1 && (i === -1 || parseFloat(_agent.substr(i + 8, 2)) > 3));
_isSafariLT6 = (_isSafari && (parseFloat(_agent.substr(_agent.indexOf("Version/") + 8, 2)) < 6));
_isFirefox = (_agent.indexOf("Firefox") !== -1);
if ((/MSIE ([0-9]{1,}[\.0-9]{0,})/).exec(_agent) || (/Trident\/.*rv:([0-9]{1,}[\.0-9]{0,})/).exec(_agent)) {
_ieVers = parseFloat(RegExp.$1);
}
if (!a) {
return false;
}
a.style.cssText = "top:1px;opacity:.55;";
return /^0.55/.test(a.style.opacity);
}()), _getIEOpacity = function (v) {
return (_opacityExp.test(((typeof (v) === "string") ? v : (v.currentStyle ? v.currentStyle.filter : v.style.filter) || "")) ? (parseFloat(RegExp.$1) / 100) : 1);
}, _log = function (s) {
if (TweenLite_js_1._gsScope.console) {
console.log(s);
}
}, _target, _index, _prefixCSS = "", _prefix = "", _checkPropPrefix = function (p, e) {
e = e || _tempDiv;
var s = e.style, a, i;
if (s[p] !== undefined) {
return p;
}
p = p.charAt(0).toUpperCase() + p.substr(1);
a = ["O", "Moz", "ms", "Ms", "Webkit"];
i = 5;
while (--i > -1 && s[a[i] + p] === undefined) { }
if (i >= 0) {
_prefix = (i === 3) ? "ms" : a[i];
_prefixCSS = "-" + _prefix.toLowerCase() + "-";
return _prefix + p;
}
return null;
}, _computedStyleScope = (typeof (window) !== "undefined" ? window : _doc.defaultView || { getComputedStyle: function () { } }), _getComputedStyle = function (e) {
return _computedStyleScope.getComputedStyle(e);
}, _getStyle = CSSPlugin.getStyle = function (t, p, cs, calc, dflt) {
var rv;
if (!_supportsOpacity)
if (p === "opacity") {
return _getIEOpacity(t);
}
if (!calc && t.style[p]) {
rv = t.style[p];
}
else if ((cs = cs || _getComputedStyle(t))) {
rv = cs[p] || cs.getPropertyValue(p) || cs.getPropertyValue(p.replace(_capsExp, "-$1").toLowerCase());
}
else if (t.currentStyle) {
rv = t.currentStyle[p];
}
return (dflt != null && (!rv || rv === "none" || rv === "auto" || rv === "auto auto")) ? dflt : rv;
}, _convertToPixels = _internals.convertToPixels = function (t, p, v, sfx, recurse) {
if (sfx === "px" || (!sfx && p !== "lineHeight")) {
return v;
}
if (sfx === "auto" || !v) {
return 0;
}
var horiz = _horizExp.test(p), node = t, style = _tempDiv.style, neg = (v < 0), precise = (v === 1), pix, cache, time;
if (neg) {
v = -v;
}
if (precise) {
v *= 100;
}
if (p === "lineHeight" && !sfx) {
cache = _getComputedStyle(t).lineHeight;
t.style.lineHeight = v;
pix = parseFloat(_getComputedStyle(t).lineHeight);
t.style.lineHeight = cache;
}
else if (sfx === "%" && p.indexOf("border") !== -1) {
pix = (v / 100) * (horiz ? t.clientWidth : t.clientHeight);
}
else {
style.cssText = "border:0 solid red;position:" + _getStyle(t, "position") + ";line-height:0;";
if (sfx === "%" || !node.appendChild || sfx.charAt(0) === "v" || sfx === "rem") {
node = t.parentNode || _doc.body;
if (_getStyle(node, "display").indexOf("flex") !== -1) {
style.position = "absolute";
}
cache = node._gsCache;
time = TweenLite_js_1.default.ticker.frame;
if (cache && horiz && cache.time === time) {
return cache.width * v / 100;
}
style[(horiz ? "width" : "height")] = v + sfx;
}
else {
style[(horiz ? "borderLeftWidth" : "borderTopWidth")] = v + sfx;
}
node.appendChild(_tempDiv);
pix = parseFloat(_tempDiv[(horiz ? "offsetWidth" : "offsetHeight")]);
node.removeChild(_tempDiv);
if (horiz && sfx === "%" && CSSPlugin.cacheWidths !== false) {
cache = node._gsCache = node._gsCache || {};
cache.time = time;
cache.width = pix / v * 100;
}
if (pix === 0 && !recurse) {
pix = _convertToPixels(t, p, v, sfx, true);
}
}
if (precise) {
pix /= 100;
}
return neg ? -pix : pix;
}, _calculateOffset = _internals.calculateOffset = function (t, p, cs) {
if (_getStyle(t, "position", cs) !== "absolute") {
return 0;
}
var dim = ((p === "left") ? "Left" : "Top"), v = _getStyle(t, "margin" + dim, cs);
return t["offset" + dim] - (_convertToPixels(t, p, parseFloat(v), v.replace(_suffixExp, "")) || 0);
}, _getAllStyles = function (t, cs) {
var s = {}, i, tr, p;
if ((cs = cs || _getComputedStyle(t, null))) {
if ((i = cs.length)) {
while (--i > -1) {
p = cs[i];
if (p.indexOf("-transform") === -1 || _transformPropCSS === p) {
s[p.replace(_camelExp, _camelFunc)] = cs.getPropertyValue(p);
}
}
}
else {
for (i in cs) {
if (i.indexOf("Transform") === -1 || _transformProp === i) {
s[i] = cs[i];
}
}
}
}
else if ((cs = t.currentStyle || t.style)) {
for (i in cs) {
if (typeof (i) === "string" && s[i] === undefined) {
s[i.replace(_camelExp, _camelFunc)] = cs[i];
}
}
}
if (!_supportsOpacity) {
s.opacity = _getIEOpacity(t);
}
tr = _getTransform(t, cs, false);
s.rotation = tr.rotation;
s.skewX = tr.skewX;
s.scaleX = tr.scaleX;
s.scaleY = tr.scaleY;
s.x = tr.x;
s.y = tr.y;
if (_supports3D) {
s.z = tr.z;
s.rotationX = tr.rotationX;
s.rotationY = tr.rotationY;
s.scaleZ = tr.scaleZ;
}
if (s.filters) {
delete s.filters;
}
return s;
}, _cssDif = function (t, s1, s2, vars, forceLookup) {
var difs = {}, style = t.style, val, p, mpt;
for (p in s2) {
if (p !== "cssText")
if (p !== "length")
if (isNaN(p))
if (s1[p] !== (val = s2[p]) || (forceLookup && forceLookup[p]))
if (p.indexOf("Origin") === -1)
if (typeof (val) === "number" || typeof (val) === "string") {
difs[p] = (val === "auto" && (p === "left" || p === "top")) ? _calculateOffset(t, p) : ((val === "" || val === "auto" || val === "none") && typeof (s1[p]) === "string" && s1[p].replace(_NaNExp, "") !== "") ? 0 : val;
if (style[p] !== undefined) {
mpt = new MiniPropTween(style, p, style[p], mpt);
}
}
}
if (vars) {
for (p in vars) {
if (p !== "className") {
difs[p] = vars[p];
}
}
}
return { difs: difs, firstMPT: mpt };
}, _dimensions = { width: ["Left", "Right"], height: ["Top", "Bottom"] }, _margins = ["marginLeft", "marginRight", "marginTop", "marginBottom"], _getDimension = function (t, p, cs) {
if ((t.nodeName + "").toLowerCase() === "svg") {
return (cs || _getComputedStyle(t))[p] || 0;
}
else if (t.getCTM && _isSVG(t)) {
return t.getBBox()[p] || 0;
}
var v = parseFloat((p === "width") ? t.offsetWidth : t.offsetHeight), a = _dimensions[p], i = a.length;
cs = cs || _getComputedStyle(t, null);
while (--i > -1) {
v -= parseFloat(_getStyle(t, "padding" + a[i], cs, true)) || 0;
v -= parseFloat(_getStyle(t, "border" + a[i] + "Width", cs, true)) || 0;
}
return v;
}, _parsePosition = function (v, recObj) {
if (v === "contain" || v === "auto" || v === "auto auto") {
return v + " ";
}
if (v == null || v === "") {
v = "0 0";
}
var a = v.split(" "), x = (v.indexOf("left") !== -1) ? "0%" : (v.indexOf("right") !== -1) ? "100%" : a[0], y = (v.indexOf("top") !== -1) ? "0%" : (v.indexOf("bottom") !== -1) ? "100%" : a[1], i;
if (a.length > 3 && !recObj) {
a = v.split(", ").join(",").split(",");
v = [];
for (i = 0; i < a.length; i++) {
v.push(_parsePosition(a[i]));
}
return v.join(",");
}
if (y == null) {
y = (x === "center") ? "50%" : "0";
}
else if (y === "center") {
y = "50%";
}
if (x === "center" || (isNaN(parseFloat(x)) && (x + "").indexOf("=") === -1)) {
x = "50%";
}
v = x + " " + y + ((a.length > 2) ? " " + a[2] : "");
if (recObj) {
recObj.oxp = (x.indexOf("%") !== -1);
recObj.oyp = (y.indexOf("%") !== -1);
recObj.oxr = (x.charAt(1) === "=");
recObj.oyr = (y.charAt(1) === "=");
recObj.ox = parseFloat(x.replace(_NaNExp, ""));
recObj.oy = parseFloat(y.replace(_NaNExp, ""));
recObj.v = v;
}
return recObj || v;
}, _parseChange = function (e, b) {
if (typeof (e) === "function") {
e = e(_index, _target);
}
return (typeof (e) === "string" && e.charAt(1) === "=") ? parseInt(e.charAt(0) + "1", 10) * parseFloat(e.substr(2)) : (parseFloat(e) - parseFloat(b)) || 0;
}, _parseVal = function (v, d) {
if (typeof (v) === "function") {
v = v(_index, _target);
}
var isRelative = (typeof (v) === "string" && v.charAt(1) === "=");
if (typeof (v) === "string" && v.charAt(v.length - 2) === "v") {
v = (isRelative ? v.substr(0, 2) : 0) + (window["inner" + ((v.substr(-2) === "vh") ? "Height" : "Width")] * (parseFloat(isRelative ? v.substr(2) : v) / 100));
}
return (v == null) ? d : isRelative ? parseInt(v.charAt(0) + "1", 10) * parseFloat(v.substr(2)) + d : parseFloat(v) || 0;
}, _parseAngle = function (v, d, p, directionalEnd) {
var min = 0.000001, cap, split, dif, result, isRelative;
if (typeof (v) === "function") {
v = v(_index, _target);
}
if (v == null) {
result = d;
}
else if (typeof (v) === "number") {
result = v;
}
else {
cap = 360;
split = v.split("_");
isRelative = (v.charAt(1) === "=");
dif = (isRelative ? parseInt(v.charAt(0) + "1", 10) * parseFloat(split[0].substr(2)) : parseFloat(split[0])) * ((v.indexOf("rad") === -1) ? 1 : _RAD2DEG) - (isRelative ? 0 : d);
if (split.length) {
if (directionalEnd) {
directionalEnd[p] = d + dif;
}
if (v.indexOf("short") !== -1) {
dif = dif % cap;
if (dif !== dif % (cap / 2)) {
dif = (dif < 0) ? dif + cap : dif - cap;
}
}
if (v.indexOf("_cw") !== -1 && dif < 0) {
dif = ((dif + cap * 9999999999) % cap) - ((dif / cap) | 0) * cap;
}
else if (v.indexOf("ccw") !== -1 && dif > 0) {
dif = ((dif - cap * 9999999999) % cap) - ((dif / cap) | 0) * cap;
}
}
result = d + dif;
}
if (result < min && result > -min) {
result = 0;
}
return result;
}, _colorLookup = { aqua: [0, 255, 255],
lime: [0, 255, 0],
silver: [192, 192, 192],
black: [0, 0, 0],
maroon: [128, 0, 0],
teal: [0, 128, 128],
blue: [0, 0, 255],
navy: [0, 0, 128],
white: [255, 255, 255],
fuchsia: [255, 0, 255],
olive: [128, 128, 0],
yellow: [255, 255, 0],
orange: [255, 165, 0],
gray: [128, 128, 128],
purple: [128, 0, 128],
green: [0, 128, 0],
red: [255, 0, 0],
pink: [255, 192, 203],
cyan: [0, 255, 255],
transparent: [255, 255, 255, 0] }, _hue = function (h, m1, m2) {
h = (h < 0) ? h + 1 : (h > 1) ? h - 1 : h;
return ((((h * 6 < 1) ? m1 + (m2 - m1) * h * 6 : (h < 0.5) ? m2 : (h * 3 < 2) ? m1 + (m2 - m1) * (2 / 3 - h) * 6 : m1) * 255) + 0.5) | 0;
}, _parseColor = CSSPlugin.parseColor = function (v, toHSL) {
var a, r, g, b, h, s, l, max, min, d, wasHSL;
if (!v) {
a = _colorLookup.black;
}
else if (typeof (v) === "number") {
a = [v >> 16, (v >> 8) & 255, v & 255];
}
else {
if (v.charAt(v.length - 1) === ",") {
v = v.substr(0, v.length - 1);
}
if (_colorLookup[v]) {
a = _colorLookup[v];
}
else if (v.charAt(0) === "#") {
if (v.length === 4) {
r = v.charAt(1);
g = v.charAt(2);
b = v.charAt(3);
v = "#" + r + r + g + g + b + b;
}
v = parseInt(v.substr(1), 16);
a = [v >> 16, (v >> 8) & 255, v & 255];
}
else if (v.substr(0, 3) === "hsl") {
a = wasHSL = v.match(_numExp);
if (!toHSL) {
h = (Number(a[0]) % 360) / 360;
s = Number(a[1]) / 100;
l = Number(a[2]) / 100;
g = (l <= 0.5) ? l * (s + 1) : l + s - l * s;
r = l * 2 - g;
if (a.length > 3) {
a[3] = Number(a[3]);
}
a[0] = _hue(h + 1 / 3, r, g);
a[1] = _hue(h, r, g);
a[2] = _hue(h - 1 / 3, r, g);
}
else if (v.indexOf("=") !== -1) {
return v.match(_relNumExp);
}
}
else {
a = v.match(_numExp) || _colorLookup.transparent;
}
a[0] = Number(a[0]);
a[1] = Number(a[1]);
a[2] = Number(a[2]);
if (a.length > 3) {
a[3] = Number(a[3]);
}
}
if (toHSL && !wasHSL) {
r = a[0] / 255;
g = a[1] / 255;
b = a[2] / 255;
max = Math.max(r, g, b);
min = Math.min(r, g, b);
l = (max + min) / 2;
if (max === min) {
h = s = 0;
}
else {
d = max - min;
s = l > 0.5 ? d / (2 - max - min) : d / (max + min);
h = (max === r) ? (g - b) / d + (g < b ? 6 : 0) : (max === g) ? (b - r) / d + 2 : (r - g) / d + 4;
h *= 60;
}
a[0] = (h + 0.5) | 0;
a[1] = (s * 100 + 0.5) | 0;
a[2] = (l * 100 + 0.5) | 0;
}
return a;
}, _formatColors = function (s, toHSL) {
var colors = s.match(_colorExp) || [], charIndex = 0, parsed = "", i, color, temp;
if (!colors.length) {
return s;
}
for (i = 0; i < colors.length; i++) {
color = colors[i];
temp = s.substr(charIndex, s.indexOf(color, charIndex) - charIndex);
charIndex += temp.length + color.length;
color = _parseColor(color, toHSL);
if (color.length === 3) {
color.push(1);
}
parsed += temp + (toHSL ? "hsla(" + color[0] + "," + color[1] + "%," + color[2] + "%," + color[3] : "rgba(" + color.join(",")) + ")";
}
return parsed + s.substr(charIndex);
}, _colorExp = "(?:\\b(?:(?:rgb|rgba|hsl|hsla)\\(.+?\\))|\\B#(?:[0-9a-f]{3}){1,2}\\b";
for (p in _colorLookup) {
_colorExp += "|" + p + "\\b";
}
_colorExp = new RegExp(_colorExp + ")", "gi");
CSSPlugin.colorStringFilter = function (a) {
var combined = a[0] + " " + a[1], toHSL;
if (_colorExp.test(combined)) {
toHSL = (combined.indexOf("hsl(") !== -1 || combined.indexOf("hsla(") !== -1);
a[0] = _formatColors(a[0], toHSL);
a[1] = _formatColors(a[1], toHSL);
}
_colorExp.lastIndex = 0;
};
if (!TweenLite_js_1.default.defaultStringFilter) {
TweenLite_js_1.default.defaultStringFilter = CSSPlugin.colorStringFilter;
}
var _getFormatter = function (dflt, clr, collapsible, multi) {
if (dflt == null) {
return function (v) { return v; };
}
var dColor = clr ? (dflt.match(_colorExp) || [""])[0] : "", dVals = dflt.split(dColor).join("").match(_valuesExp) || [], pfx = dflt.substr(0, dflt.indexOf(dVals[0])), sfx = (dflt.charAt(dflt.length - 1) === ")") ? ")" : "", delim = (dflt.indexOf(" ") !== -1) ? " " : ",", numVals = dVals.length, dSfx = (numVals > 0) ? dVals[0].replace(_numExp, "") : "", formatter;
if (!numVals) {
return function (v) { return v; };
}
if (clr) {
formatter = function (v) {
var color, vals, i, a;
if (typeof (v) === "number") {
v += dSfx;
}
else if (multi && _commasOutsideParenExp.test(v)) {
a = v.replace(_commasOutsideParenExp, "|").split("|");
for (i = 0; i < a.length; i++) {
a[i] = formatter(a[i]);
}
return a.join(",");
}
color = (v.match(_colorExp) || [dColor])[0];
vals = v.split(color).join("").match(_valuesExp) || [];
i = vals.length;
if (numVals > i--) {
while (++i < numVals) {
vals[i] = collapsible ? vals[(((i - 1) / 2) | 0)] : dVals[i];
}
}
return pfx + vals.join(delim) + delim + color + sfx + (v.indexOf("inset") !== -1 ? " inset" : "");
};
return formatter;
}
formatter = function (v) {
var vals, a, i;
if (typeof (v) === "number") {
v += dSfx;
}
else if (multi && _commasOutsideParenExp.test(v)) {
a = v.replace(_commasOutsideParenExp, "|").split("|");
for (i = 0; i < a.length; i++) {
a[i] = formatter(a[i]);
}
return a.join(",");
}
vals = v.match(delim === "," ? _valuesExp : _valuesExpWithCommas) || [];
i = vals.length;
if (numVals > i--) {
while (++i < numVals) {
vals[i] = collapsible ? vals[(((i - 1) / 2) | 0)] : dVals[i];
}
}
return ((pfx && v !== "none") ? v.substr(0, v.indexOf(vals[0])) || pfx : pfx) + vals.join(delim) + sfx;
};
return formatter;
}, _getEdgeParser = function (props) {
props = props.split(",");
return function (t, e, p, cssp, pt, plugin, vars) {
var a = (e + "").split(" "), i;
vars = {};
for (i = 0; i < 4; i++) {
vars[props[i]] = a[i] = a[i] || a[(((i - 1) / 2) >> 0)];
}
return cssp.parse(t, vars, pt, plugin);
};
}, _setPluginRatio = _internals._setPluginRatio = function (v) {
this.plugin.setRatio(v);
var d = this.data, proxy = d.proxy, mpt = d.firstMPT, min = 0.000001, val, pt, i, str, p;
while (mpt) {
val = proxy[mpt.v];
if (mpt.r) {
val = mpt.r(val);
}
else if (val < min && val > -min) {
val = 0;
}
mpt.t[mpt.p] = val;
mpt = mpt._next;
}
if (d.autoRotate) {
d.autoRotate.rotation = d.mod ? d.mod.call(this._tween, proxy.rotation, this.t, this._tween) : proxy.rotation;
}
if (v === 1 || v === 0) {
mpt = d.firstMPT;
p = (v === 1) ? "e" : "b";
while (mpt) {
pt = mpt.t;
if (!pt.type) {
pt[p] = pt.s + pt.xs0;
}
else if (pt.type === 1) {
str = pt.xs0 + pt.s + pt.xs1;
for (i = 1; i < pt.l; i++) {
str += pt["xn" + i] + pt["xs" + (i + 1)];
}
pt[p] = str;
}
mpt = mpt._next;
}
}
}, MiniPropTween = function (t, p, v, next, r) {
this.t = t;
this.p = p;
this.v = v;
this.r = r;
if (next) {
next._prev = this;
this._next = next;
}
}, _parseToProxy = _internals._parseToProxy = function (t, vars, cssp, pt, plugin, shallow) {
var bpt = pt, start = {}, end = {}, transform = cssp._transform, oldForce = _forcePT, i, p, xp, mpt, firstPT;
cssp._transform = null;
_forcePT = vars;
pt = firstPT = cssp.parse(t, vars, pt, plugin);
_forcePT = oldForce;
if (shallow) {
cssp._transform = transform;
if (bpt) {
bpt._prev = null;
if (bpt._prev) {
bpt._prev._next = null;
}
}
}
while (pt && pt !== bpt) {
if (pt.type <= 1) {
p = pt.p;
end[p] = pt.s + pt.c;
start[p] = pt.s;
if (!shallow) {
mpt = new MiniPropTween(pt, "s", p, mpt, pt.r);
pt.c = 0;
}
if (pt.type === 1) {
i = pt.l;
while (--i > 0) {
xp = "xn" + i;
p = pt.p + "_" + xp;
end[p] = pt.data[xp];
start[p] = pt[xp];
if (!shallow) {
mpt = new MiniPropTween(pt, xp, p, mpt, pt.rxp[xp]);
}
}
}
}
pt = pt._next;
}
return { proxy: start, end: end, firstMPT: mpt, pt: firstPT };
}, CSSPropTween = _internals.CSSPropTween = function (t, p, s, c, next, type, n, r, pr, b, e) {
this.t = t;
this.p = p;
this.s = s;
this.c = c;
this.n = n || p;
if (!(t instanceof CSSPropTween)) {
_overwriteProps.push(this.n);
}
this.r = !r ? r : (typeof (r) === "function") ? r : Math.round;
this.type = type || 0;
if (pr) {
this.pr = pr;
_hasPriority = true;
}
this.b = (b === undefined) ? s : b;
this.e = (e === undefined) ? s + c : e;
if (next) {
this._next = next;
next._prev = this;
}
}, _addNonTweeningNumericPT = function (target, prop, start, end, next, overwriteProp) {
var pt = new CSSPropTween(target, prop, start, end - start, next, -1, overwriteProp);
pt.b = start;
pt.e = pt.xs0 = end;
return pt;
}, _parseComplex = CSSPlugin.parseComplex = function (t, p, b, e, clrs, dflt, pt, pr, plugin, setRatio) {
b = b || dflt || "";
if (typeof (e) === "function") {
e = e(_index, _target);
}
pt = new CSSPropTween(t, p, 0, 0, pt, (setRatio ? 2 : 1), null, false, pr, b, e);
e += "";
if (clrs && _colorExp.test(e + b)) {
e = [b, e];
CSSPlugin.colorStringFilter(e);
b = e[0];
e = e[1];
}
var ba = b.split(", ").join(",").split(" "), ea = e.split(", ").join(",").split(" "), l = ba.length, autoRound = (_autoRound !== false), i, xi, ni, bv, ev, bnums, enums, bn, hasAlpha, temp, cv, str, useHSL;
if (e.indexOf(",") !== -1 || b.indexOf(",") !== -1) {
if ((e + b).indexOf("rgb") !== -1 || (e + b).indexOf("hsl") !== -1) {
ba = ba.join(" ").replace(_commasOutsideParenExp, ", ").split(" ");
ea = ea.join(" ").replace(_commasOutsideParenExp, ", ").split(" ");
}
else {
ba = ba.join(" ").split(",").join(", ").split(" ");
ea = ea.join(" ").split(",").join(", ").split(" ");
}
l = ba.length;
}
if (l !== ea.length) {
ba = (dflt || "").split(" ");
l = ba.length;
}
pt.plugin = plugin;
pt.setRatio = setRatio;
_colorExp.lastIndex = 0;
for (i = 0; i < l; i++) {
bv = ba[i];
ev = ea[i] + "";
bn = parseFloat(bv);
if (bn || bn === 0) {
pt.appendXtra("", bn, _parseChange(ev, bn), ev.replace(_relNumExp, ""), (autoRound && ev.indexOf("px") !== -1) ? Math.round : false, true);
}
else if (clrs && _colorExp.test(bv)) {
str = ev.indexOf(")") + 1;
str = ")" + (str ? ev.substr(str) : "");
useHSL = (ev.indexOf("hsl") !== -1 && _supportsOpacity);
temp = ev;
bv = _parseColor(bv, useHSL);
ev = _parseColor(ev, useHSL);
hasAlpha = (bv.length + ev.length > 6);
if (hasAlpha && !_supportsOpacity && ev[3] === 0) {
pt["xs" + pt.l] += pt.l ? " transparent" : "transparent";
pt.e = pt.e.split(ea[i]).join("transparent");
}
else {
if (!_supportsOpacity) {
hasAlpha = false;
}
if (useHSL) {
pt.appendXtra(temp.substr(0, temp.indexOf("hsl")) + (hasAlpha ? "hsla(" : "hsl("), bv[0], _parseChange(ev[0], bv[0]), ",", false, true)
.appendXtra("", bv[1], _parseChange(ev[1], bv[1]), "%,", false)
.appendXtra("", bv[2], _parseChange(ev[2], bv[2]), (hasAlpha ? "%," : "%" + str), false);
}
else {
pt.appendXtra(temp.substr(0, temp.indexOf("rgb")) + (hasAlpha ? "rgba(" : "rgb("), bv[0], ev[0] - bv[0], ",", Math.round, true)
.appendXtra("", bv[1], ev[1] - bv[1], ",", Math.round)
.appendXtra("", bv[2], ev[2] - bv[2], (hasAlpha ? "," : str), Math.round);
}
if (hasAlpha) {
bv = (bv.length < 4) ? 1 : bv[3];
pt.appendXtra("", bv, ((ev.length < 4) ? 1 : ev[3]) - bv, str, false);
}
}
_colorExp.lastIndex = 0;
}
else {
bnums = bv.match(_numExp);
if (!bnums) {
pt["xs" + pt.l] += (pt.l || pt["xs" + pt.l]) ? " " + ev : ev;
}
else {
enums = ev.match(_relNumExp);
if (!enums || enums.length !== bnums.length) {
return pt;
}
ni = 0;
for (xi = 0; xi < bnums.length; xi++) {
cv = bnums[xi];
temp = bv.indexOf(cv, ni);
pt.appendXtra(bv.substr(ni, temp - ni), Number(cv), _parseChange(enums[xi], cv), "", (autoRound && bv.substr(temp + cv.length, 2) === "px") ? Math.round : false, (xi === 0));
ni = temp + cv.length;
}
pt["xs" + pt.l] += bv.substr(ni);
}
}
}
if (e.indexOf("=") !== -1)
if (pt.data) {
str = pt.xs0 + pt.data.s;
for (i = 1; i < pt.l; i++) {
str += pt["xs" + i] + pt.data["xn" + i];
}
pt.e = str + pt["xs" + i];
}
if (!pt.l) {
pt.type = -1;
pt.xs0 = pt.e;
}
return pt.xfirst || pt;
}, i = 9;
p = CSSPropTween.prototype;
p.l = p.pr = 0;
while (--i > 0) {
p["xn" + i] = 0;
p["xs" + i] = "";
}
p.xs0 = "";
p._next = p._prev = p.xfirst = p.data = p.plugin = p.setRatio = p.rxp = null;
p.appendXtra = function (pfx, s, c, sfx, r, pad) {
var pt = this, l = pt.l;
pt["xs" + l] += (pad && (l || pt["xs" + l])) ? " " + pfx : pfx || "";
if (!c)
if (l !== 0 && !pt.plugin) {
pt["xs" + l] += s + (sfx || "");
return pt;
}
pt.l++;
pt.type = pt.setRatio ? 2 : 1;
pt["xs" + pt.l] = sfx || "";
if (l > 0) {
pt.data["xn" + l] = s + c;
pt.rxp["xn" + l] = r;
pt["xn" + l] = s;
if (!pt.plugin) {
pt.xfirst = new CSSPropTween(pt, "xn" + l, s, c, pt.xfirst || pt, 0, pt.n, r, pt.pr);
pt.xfirst.xs0 = 0;
}
return pt;
}
pt.data = { s: s + c };
pt.rxp = {};
pt.s = s;
pt.c = c;
pt.r = r;
return pt;
};
var SpecialProp = function (p, options) {
options = options || {};
this.p = options.prefix ? _checkPropPrefix(p) || p : p;
_specialProps[p] = _specialProps[this.p] = this;
this.format = options.formatter || _getFormatter(options.defaultValue, options.color, options.collapsible, options.multi);
if (options.parser) {
this.parse = options.parser;
}
this.clrs = options.color;
this.multi = options.multi;
this.keyword = options.keyword;
this.dflt = options.defaultValue;
this.allowFunc = options.allowFunc;
this.pr = options.priority || 0;
}, _registerComplexSpecialProp = _internals._registerComplexSpecialProp = function (p, options, defaults) {
if (typeof (options) !== "object") {
options = { parser: defaults };
}
var a = p.split(","), d = options.defaultValue, i, temp;
defaults = defaults || [d];
for (i = 0; i < a.length; i++) {
options.prefix = (i === 0 && options.prefix);
options.defaultValue = defaults[i] || d;
temp = new SpecialProp(a[i], options);
}
}, _registerPluginProp = _internals._registerPluginProp = function (p) {
if (!_specialProps[p]) {
var pluginName = p.charAt(0).toUpperCase() + p.substr(1) + "Plugin";
_registerComplexSpecialProp(p, { parser: function (t, e, p, cssp, pt, plugin, vars) {
var pluginClass = _globals.com.greensock.plugins[pluginName];
if (!pluginClass) {
_log("Error: " + pluginName + " js file not loaded.");
return pt;
}
pluginClass._cssRegister();
return _specialProps[p].parse(t, e, p, cssp, pt, plugin, vars);
} });
}
};
p = SpecialProp.prototype;
p.parseComplex = function (t, b, e, pt, plugin, setRatio) {
var kwd = this.keyword, i, ba, ea, l, bi, ei;
if (this.multi)
if (_commasOutsideParenExp.test(e) || _commasOutsideParenExp.test(b)) {
ba = b.replace(_commasOutsideParenExp, "|").split("|");
ea = e.replace(_commasOutsideParenExp, "|").split("|");
}
else if (kwd) {
ba = [b];
ea = [e];
}
if (ea) {
l = (ea.length > ba.length) ? ea.length : ba.length;
for (i = 0; i < l; i++) {
b = ba[i] = ba[i] || this.dflt;
e = ea[i] = ea[i] || this.dflt;
if (kwd) {
bi = b.indexOf(kwd);
ei = e.indexOf(kwd);
if (bi !== ei) {
if (ei === -1) {
ba[i] = ba[i].split(kwd).join("");
}
else if (bi === -1) {
ba[i] += " " + kwd;
}
}
}
}
b = ba.join(", ");
e = ea.join(", ");
}
return _parseComplex(t, this.p, b, e, this.clrs, this.dflt, pt, this.pr, plugin, setRatio);
};
p.parse = function (t, e, p, cssp, pt, plugin, vars) {
return this.parseComplex(t.style, this.format(_getStyle(t, this.p, _cs, false, this.dflt)), this.format(e), pt, plugin);
};
CSSPlugin.registerSpecialProp = function (name, onInitTween, priority) {
_registerComplexSpecialProp(name, { parser: function (t, e, p, cssp, pt, plugin, vars) {
var rv = new CSSPropTween(t, p, 0, 0, pt, 2, p, false, priority);
rv.plugin = plugin;
rv.setRatio = onInitTween(t, e, cssp._tween, p);
return rv;
}, priority: priority });
};
CSSPlugin.useSVGTransformAttr = true;
var _transformProps = ("scaleX,scaleY,scaleZ,x,y,z,skewX,skewY,rotation,rotationX,rotationY,perspective,xPercent,yPercent").split(","), _transformProp = _checkPropPrefix("transform"), _transformPropCSS = _prefixCSS + "transform", _transformOriginProp = _checkPropPrefix("transformOrigin"), _supports3D = (_checkPropPrefix("perspective") !== null), Transform = _internals.Transform = function () {
this.perspective = parseFloat(CSSPlugin.defaultTransformPerspective) || 0;
this.force3D = (CSSPlugin.defaultForce3D === false || !_supports3D) ? false : CSSPlugin.defaultForce3D || "auto";
}, _SVGElement = TweenLite_js_1._gsScope.SVGElement, _useSVGTransformAttr, _createSVG = function (type, container, attributes) {
var element = _doc.createElementNS("http://www.w3.org/2000/svg", type), reg = /([a-z])([A-Z])/g, p;
for (p in attributes) {
element.setAttributeNS(null, p.replace(reg, "$1-$2").toLowerCase(), attributes[p]);
}
container.appendChild(element);
return element;
}, _docElement = _doc.documentElement || {}, _forceSVGTransformAttr = (function () {
var force = _ieVers || (/Android/i.test(_agent) && !TweenLite_js_1._gsScope.chrome), svg, rect, width;
if (_doc.createElementNS && _docElement.appendChild && !force) {
svg = _createSVG("svg", _docElement);
rect = _createSVG("rect", svg, { width: 100, height: 50, x: 100 });
width = rect.getBoundingClientRect().width;
rect.style[_transformOriginProp] = "50% 50%";
rect.style[_transformProp] = "scaleX(0.5)";
force = (width === rect.getBoundingClientRect().width && !(_isFirefox && _supports3D));
_docElement.removeChild(svg);
}
return force;
})(), _parseSVGOrigin = function (e, local, decoratee, absolute, smoothOrigin, skipRecord) {
var tm = e._gsTransform, m = _getMatrix(e, true), v, x, y, xOrigin, yOrigin, a, b, c, d, tx, ty, determinant, xOriginOld, yOriginOld;
if (tm) {
xOriginOld = tm.xOrigin;
yOriginOld = tm.yOrigin;
}
if (!absolute || (v = absolute.split(" ")).length < 2) {
b = e.getBBox();
if (b.x === 0 && b.y === 0 && b.width + b.height === 0) {
b = { x: parseFloat(e.hasAttribute("x") ? e.getAttribute("x") : e.hasAttribute("cx") ? e.getAttribute("cx") : 0) || 0, y: parseFloat(e.hasAttribute("y") ? e.getAttribute("y") : e.hasAttribute("cy") ? e.getAttribute("cy") : 0) || 0, width: 0, height: 0 };
}
local = _parsePosition(local).split(" ");
v = [(local[0].indexOf("%") !== -1 ? parseFloat(local[0]) / 100 * b.width : parseFloat(local[0])) + b.x,
(local[1].indexOf("%") !== -1 ? parseFloat(local[1]) / 100 * b.height : parseFloat(local[1])) + b.y];
}
decoratee.xOrigin = xOrigin = parseFloat(v[0]);
decoratee.yOrigin = yOrigin = parseFloat(v[1]);
if (absolute && m !== _identity2DMatrix) {
a = m[0];
b = m[1];
c = m[2];
d = m[3];
tx = m[4];
ty = m[5];
determinant = (a * d - b * c);
if (determinant) {
x = xOrigin * (d / determinant) + yOrigin * (-c / determinant) + ((c * ty - d * tx) / determinant);
y = xOrigin * (-b / determinant) + yOrigin * (a / determinant) - ((a * ty - b * tx) / determinant);
xOrigin = decoratee.xOrigin = v[0] = x;
yOrigin = decoratee.yOrigin = v[1] = y;
}
}
if (tm) {
if (skipRecord) {
decoratee.xOffset = tm.xOffset;
decoratee.yOffset = tm.yOffset;
tm = decoratee;
}
if (smoothOrigin || (smoothOrigin !== false && CSSPlugin.defaultSmoothOrigin !== false)) {
x = xOrigin - xOriginOld;
y = yOrigin - yOriginOld;
tm.xOffset += (x * m[0] + y * m[2]) - x;
tm.yOffset += (x * m[1] + y * m[3]) - y;
}
else {
tm.xOffset = tm.yOffset = 0;
}
}
if (!skipRecord) {
e.setAttribute("data-svg-origin", v.join(" "));
}
}, _getBBoxHack = function (swapIfPossible) {
var svg = _createElement("svg", (this.ownerSVGElement && this.ownerSVGElement.getAttribute("xmlns")) || "http://www.w3.org/2000/svg"), oldParent = this.parentNode, oldSibling = this.nextSibling, oldCSS = this.style.cssText, bbox;
_docElement.appendChild(svg);
svg.appendChild(this);
this.style.display = "block";
if (swapIfPossible) {
try {
bbox = this.getBBox();
this._originalGetBBox = this.getBBox;
this.getBBox = _getBBoxHack;
}
catch (e) { }
}
else if (this._originalGetBBox) {
bbox = this._originalGetBBox();
}
if (oldSibling) {
oldParent.insertBefore(this, oldSibling);
}
else {
oldParent.appendChild(this);
}
_docElement.removeChild(svg);
this.style.cssText = oldCSS;
return bbox;
}, _getBBox = function (e) {
try {
return e.getBBox();
}
catch (error) {
return _getBBoxHack.call(e, true);
}
}, _isSVG = function (e) {
return !!(_SVGElement && e.getCTM && (!e.parentNode || e.ownerSVGElement) && _getBBox(e));
}, _identity2DMatrix = [1, 0, 0, 1, 0, 0], _getMatrix = function (e, force2D) {
var tm = e._gsTransform || new Transform(), rnd = 100000, style = e.style, isDefault, s, m, n, dec, nextSibling, parent;
if (_transformProp) {
s = _getStyle(e, _transformPropCSS, null, true);
}
else if (e.currentStyle) {
s = e.currentStyle.filter.match(_ieGetMatrixExp);
s = (s && s.length === 4) ? [s[0].substr(4), Number(s[2].substr(4)), Number(s[1].substr(4)), s[3].substr(4), (tm.x || 0), (tm.y || 0)].join(",") : "";
}
isDefault = (!s || s === "none" || s === "matrix(1, 0, 0, 1, 0, 0)");
if (_transformProp && isDefault && !e.offsetParent && e !== _docElement) {
n = style.display;
style.display = "block";
parent = e.parentNode;
if (!parent || !e.offsetParent) {
dec = 1;
nextSibling = e.nextSibling;
_docElement.appendChild(e);
}
s = _getStyle(e, _transformPropCSS, null, true);
isDefault = (!s || s === "none" || s === "matrix(1, 0, 0, 1, 0, 0)");
if (n) {
style.display = n;
}
else {
_removeProp(style, "display");
}
if (dec) {
if (nextSibling) {
parent.insertBefore(e, nextSibling);
}
else if (parent) {
parent.appendChild(e);
}
else {
_docElement.removeChild(e);
}
}
}
if (tm.svg || (e.getCTM && _isSVG(e))) {
if (isDefault && (style[_transformProp] + "").indexOf("matrix") !== -1) {
s = style[_transformProp];
isDefault = 0;
}
m = e.getAttribute("transform");
if (isDefault && m) {
m = e.transform.baseVal.consolidate().matrix;
s = "matrix(" + m.a + "," + m.b + "," + m.c + "," + m.d + "," + m.e + "," + m.f + ")";
isDefault = 0;
}
}
if (isDefault) {
return _identity2DMatrix;
}
m = (s || "").match(_numExp) || [];
i = m.length;
while (--i > -1) {
n = Number(m[i]);
m[i] = (dec = n - (n |= 0)) ? ((dec * rnd + (dec < 0 ? -0.5 : 0.5)) | 0) / rnd + n : n;
}
return (force2D && m.length > 6) ? [m[0], m[1], m[4], m[5], m[12], m[13]] : m;
}, _getTransform = _internals.getTransform = function (t, cs, rec, parse) {
if (t._gsTransform && rec && !parse) {
return t._gsTransform;
}
var tm = rec ? t._gsTransform || new Transform() : new Transform(), invX = (tm.scaleX < 0), min = 0.00002, rnd = 100000, zOrigin = _supports3D ? parseFloat(_getStyle(t, _transformOriginProp, cs, false, "0 0 0").split(" ")[2]) || tm.zOrigin || 0 : 0, defaultTransformPerspective = parseFloat(CSSPlugin.defaultTransformPerspective) || 0, m, i, scaleX, scaleY, rotation, skewX;
tm.svg = !!(t.getCTM && _isSVG(t));
if (tm.svg) {
_parseSVGOrigin(t, _getStyle(t, _transformOriginProp, cs, false, "50% 50%") + "", tm, t.getAttribute("data-svg-origin"));
_useSVGTransformAttr = CSSPlugin.useSVGTransformAttr || _forceSVGTransformAttr;
}
m = _getMatrix(t);
if (m !== _identity2DMatrix) {
if (m.length === 16) {
var a11 = m[0], a21 = m[1], a31 = m[2], a41 = m[3], a12 = m[4], a22 = m[5], a32 = m[6], a42 = m[7], a13 = m[8], a23 = m[9], a33 = m[10], a14 = m[12], a24 = m[13], a34 = m[14], a43 = m[11], angle = Math.atan2(a32, a33), t1, t2, t3, t4, cos, sin;
if (tm.zOrigin) {
a34 = -tm.zOrigin;
a14 = a13 * a34 - m[12];
a24 = a23 * a34 - m[13];
a34 = a33 * a34 + tm.zOrigin - m[14];
}
tm.rotationX = angle * _RAD2DEG;
if (angle) {
cos = Math.cos(-angle);
sin = Math.sin(-angle);
t1 = a12 * cos + a13 * sin;
t2 = a22 * cos + a23 * sin;
t3 = a32 * cos + a33 * sin;
a13 = a12 * -sin + a13 * cos;
a23 = a22 * -sin + a23 * cos;
a33 = a32 * -sin + a33 * cos;
a43 = a42 * -sin + a43 * cos;
a12 = t1;
a22 = t2;
a32 = t3;
}
angle = Math.atan2(-a31, a33);
tm.rotationY = angle * _RAD2DEG;
if (angle) {
cos = Math.cos(-angle);
sin = Math.sin(-angle);
t1 = a11 * cos - a13 * sin;
t2 = a21 * cos - a23 * sin;
t3 = a31 * cos - a33 * sin;
a23 = a21 * sin + a23 * cos;
a33 = a31 * sin + a33 * cos;
a43 = a41 * sin + a43 * cos;
a11 = t1;
a21 = t2;
a31 = t3;
}
angle = Math.atan2(a21, a11);
tm.rotation = angle * _RAD2DEG;
if (angle) {
cos = Math.cos(angle);
sin = Math.sin(angle);
t1 = a11 * cos + a21 * sin;
t2 = a12 * cos + a22 * sin;
t3 = a13 * cos + a23 * sin;
a21 = a21 * cos - a11 * sin;
a22 = a22 * cos - a12 * sin;
a23 = a23 * cos - a13 * sin;
a11 = t1;
a12 = t2;
a13 = t3;
}
if (tm.rotationX && Math.abs(tm.rotationX) + Math.abs(tm.rotation) > 359.9) {
tm.rotationX = tm.rotation = 0;
tm.rotationY = 180 - tm.rotationY;
}
angle = Math.atan2(a12, a22);
tm.scaleX = ((Math.sqrt(a11 * a11 + a21 * a21 + a31 * a31) * rnd + 0.5) | 0) / rnd;
tm.scaleY = ((Math.sqrt(a22 * a22 + a32 * a32) * rnd + 0.5) | 0) / rnd;
tm.scaleZ = ((Math.sqrt(a13 * a13 + a23 * a23 + a33 * a33) * rnd + 0.5) | 0) / rnd;
a11 /= tm.scaleX;
a12 /= tm.scaleY;
a21 /= tm.scaleX;
a22 /= tm.scaleY;
if (Math.abs(angle) > min) {
tm.skewX = angle * _RAD2DEG;
a12 = 0;
if (tm.skewType !== "simple") {
tm.scaleY *= 1 / Math.cos(angle);
}
}
else {
tm.skewX = 0;
}
tm.perspective = a43 ? 1 / ((a43 < 0) ? -a43 : a43) : 0;
tm.x = a14;
tm.y = a24;
tm.z = a34;
if (tm.svg) {
tm.x -= tm.xOrigin - (tm.xOrigin * a11 - tm.yOrigin * a12);
tm.y -= tm.yOrigin - (tm.yOrigin * a21 - tm.xOrigin * a22);
}
}
else if ((!_supports3D || parse || !m.length || tm.x !== m[4] || tm.y !== m[5] || (!tm.rotationX && !tm.rotationY))) {
var k = (m.length >= 6), a = k ? m[0] : 1, b = m[1] || 0, c = m[2] || 0, d = k ? m[3] : 1;
tm.x = m[4] || 0;
tm.y = m[5] || 0;
scaleX = Math.sqrt(a * a + b * b);
scaleY = Math.sqrt(d * d + c * c);
rotation = (a || b) ? Math.atan2(b, a) * _RAD2DEG : tm.rotation || 0;
skewX = (c || d) ? Math.atan2(c, d) * _RAD2DEG + rotation : tm.skewX || 0;
tm.scaleX = scaleX;
tm.scaleY = scaleY;
tm.rotation = rotation;
tm.skewX = skewX;
if (_supports3D) {
tm.rotationX = tm.rotationY = tm.z = 0;
tm.perspective = defaultTransformPerspective;
tm.scaleZ = 1;
}
if (tm.svg) {
tm.x -= tm.xOrigin - (tm.xOrigin * a + tm.yOrigin * c);
tm.y -= tm.yOrigin - (tm.xOrigin * b + tm.yOrigin * d);
}
}
if (Math.abs(tm.skewX) > 90 && Math.abs(tm.skewX) < 270) {
if (invX) {
tm.scaleX *= -1;
tm.skewX += (tm.rotation <= 0) ? 180 : -180;
tm.rotation += (tm.rotation <= 0) ? 180 : -180;
}
else {
tm.scaleY *= -1;
tm.skewX += (tm.skewX <= 0) ? 180 : -180;
}
}
tm.zOrigin = zOrigin;
for (i in tm) {
if (tm[i] < min)
if (tm[i] > -min) {
tm[i] = 0;
}
}
}
if (rec) {
t._gsTransform = tm;
if (tm.svg) {
if (_useSVGTransformAttr && t.style[_transformProp]) {
TweenLite_js_1.default.delayedCall(0.001, function () {
_removeProp(t.style, _transformProp);
});
}
else if (!_useSVGTransformAttr && t.getAttribute("transform")) {
TweenLite_js_1.default.delayedCall(0.001, function () {
t.removeAttribute("transform");
});
}
}
}
return tm;
}, _setIETransformRatio = function (v) {
var t = this.data, ang = -t.rotation * _DEG2RAD, skew = ang + t.skewX * _DEG2RAD, rnd = 100000, a = ((Math.cos(ang) * t.scaleX * rnd) | 0) / rnd, b = ((Math.sin(ang) * t.scaleX * rnd) | 0) / rnd, c = ((Math.sin(skew) * -t.scaleY * rnd) | 0) / rnd, d = ((Math.cos(skew) * t.scaleY * rnd) | 0) / rnd, style = this.t.style, cs = this.t.currentStyle, filters, val;
if (!cs) {
return;
}
val = b;
b = -c;
c = -val;
filters = cs.filter;
style.filter = "";
var w = this.t.offsetWidth, h = this.t.offsetHeight, clip = (cs.position !== "absolute"), m = "progid:DXImageTransform.Microsoft.Matrix(M11=" + a + ", M12=" + b + ", M21=" + c + ", M22=" + d, ox = t.x + (w * t.xPercent / 100), oy = t.y + (h * t.yPercent / 100), dx, dy;
if (t.ox != null) {
dx = ((t.oxp) ? w * t.ox * 0.01 : t.ox) - w / 2;
dy = ((t.oyp) ? h * t.oy * 0.01 : t.oy) - h / 2;
ox += dx - (dx * a + dy * b);
oy += dy - (dx * c + dy * d);
}
if (!clip) {
m += ", sizingMethod='auto expand')";
}
else {
dx = (w / 2);
dy = (h / 2);
m += ", Dx=" + (dx - (dx * a + dy * b) + ox) + ", Dy=" + (dy - (dx * c + dy * d) + oy) + ")";
}
if (filters.indexOf("DXImageTransform.Microsoft.Matrix(") !== -1) {
style.filter = filters.replace(_ieSetMatrixExp, m);
}
else {
style.filter = m + " " + filters;
}
if (v === 0 || v === 1)
if (a === 1)
if (b === 0)
if (c === 0)
if (d === 1)
if (!clip || m.indexOf("Dx=0, Dy=0") !== -1)
if (!_opacityExp.test(filters) || parseFloat(RegExp.$1) === 100)
if (filters.indexOf("gradient(" && filters.indexOf("Alpha")) === -1) {
style.removeAttribute("filter");
}
if (!clip) {
var mult = (_ieVers < 8) ? 1 : -1, marg, prop, dif;
dx = t.ieOffsetX || 0;
dy = t.ieOffsetY || 0;
t.ieOffsetX = Math.round((w - ((a < 0 ? -a : a) * w + (b < 0 ? -b : b) * h)) / 2 + ox);
t.ieOffsetY = Math.round((h - ((d < 0 ? -d : d) * h + (c < 0 ? -c : c) * w)) / 2 + oy);
for (i = 0; i < 4; i++) {
prop = _margins[i];
marg = cs[prop];
val = (marg.indexOf("px") !== -1) ? parseFloat(marg) : _convertToPixels(this.t, prop, parseFloat(marg), marg.replace(_suffixExp, "")) || 0;
if (val !== t[prop]) {
dif = (i < 2) ? -t.ieOffsetX : -t.ieOffsetY;
}
else {
dif = (i < 2) ? dx - t.ieOffsetX : dy - t.ieOffsetY;
}
style[prop] = (t[prop] = Math.round(val - dif * ((i === 0 || i === 2) ? 1 : mult))) + "px";
}
}
}, _setTransformRatio = _internals.set3DTransformRatio = _internals.setTransformRatio = function (v) {
var t = this.data, style = this.t.style, angle = t.rotation, rotationX = t.rotationX, rotationY = t.rotationY, sx = t.scaleX, sy = t.scaleY, sz = t.scaleZ, x = t.x, y = t.y, z = t.z, isSVG = t.svg, perspective = t.perspective, force3D = t.force3D, skewY = t.skewY, skewX = t.skewX, t1, a11, a12, a13, a21, a22, a23, a31, a32, a33, a41, a42, a43, zOrigin, min, cos, sin, t2, transform, comma, zero, skew, rnd;
if (skewY) {
skewX += skewY;
angle += skewY;
}
if (((((v === 1 || v === 0) && force3D === "auto" && (this.tween._totalTime === this.tween._totalDuration || !this.tween._totalTime)) || !force3D) && !z && !perspective && !rotationY && !rotationX && sz === 1) || (_useSVGTransformAttr && isSVG) || !_supports3D) {
if (angle || skewX || isSVG) {
angle *= _DEG2RAD;
skew = skewX * _DEG2RAD;
rnd = 100000;
a11 = Math.cos(angle) * sx;
a21 = Math.sin(angle) * sx;
a12 = Math.sin(angle - skew) * -sy;
a22 = Math.cos(angle - skew) * sy;
if (skew && t.skewType === "simple") {
t1 = Math.tan(skew - skewY * _DEG2RAD);
t1 = Math.sqrt(1 + t1 * t1);
a12 *= t1;
a22 *= t1;
if (skewY) {
t1 = Math.tan(skewY * _DEG2RAD);
t1 = Math.sqrt(1 + t1 * t1);
a11 *= t1;
a21 *= t1;
}
}
if (isSVG) {
x += t.xOrigin - (t.xOrigin * a11 + t.yOrigin * a12) + t.xOffset;
y += t.yOrigin - (t.xOrigin * a21 + t.yOrigin * a22) + t.yOffset;
if (_useSVGTransformAttr && (t.xPercent || t.yPercent)) {
min = this.t.getBBox();
x += t.xPercent * 0.01 * min.width;
y += t.yPercent * 0.01 * min.height;
}
min = 0.000001;
if (x < min)
if (x > -min) {
x = 0;
}
if (y < min)
if (y > -min) {
y = 0;
}
}
transform = (((a11 * rnd) | 0) / rnd) + "," + (((a21 * rnd) | 0) / rnd) + "," + (((a12 * rnd) | 0) / rnd) + "," + (((a22 * rnd) | 0) / rnd) + "," + x + "," + y + ")";
if (isSVG && _useSVGTransformAttr) {
this.t.setAttribute("transform", "matrix(" + transform);
}
else {
style[_transformProp] = ((t.xPercent || t.yPercent) ? "translate(" + t.xPercent + "%," + t.yPercent + "%) matrix(" : "matrix(") + transform;
}
}
else {
style[_transformProp] = ((t.xPercent || t.yPercent) ? "translate(" + t.xPercent + "%," + t.yPercent + "%) matrix(" : "matrix(") + sx + ",0,0," + sy + "," + x + "," + y + ")";
}
return;
}
if (_isFirefox) {
min = 0.0001;
if (sx < min && sx > -min) {
sx = sz = 0.00002;
}
if (sy < min && sy > -min) {
sy = sz = 0.00002;
}
if (perspective && !t.z && !t.rotationX && !t.rotationY) {
perspective = 0;
}
}
if (angle || skewX) {
angle *= _DEG2RAD;
cos = a11 = Math.cos(angle);
sin = a21 = Math.sin(angle);
if (skewX) {
angle -= skewX * _DEG2RAD;
cos = Math.cos(angle);
sin = Math.sin(angle);
if (t.skewType === "simple") {
t1 = Math.tan((skewX - skewY) * _DEG2RAD);
t1 = Math.sqrt(1 + t1 * t1);
cos *= t1;
sin *= t1;
if (t.skewY) {
t1 = Math.tan(skewY * _DEG2RAD);
t1 = Math.sqrt(1 + t1 * t1);
a11 *= t1;
a21 *= t1;
}
}
}
a12 = -sin;
a22 = cos;
}
else if (!rotationY && !rotationX && sz === 1 && !perspective && !isSVG) {
style[_transformProp] = ((t.xPercent || t.yPercent) ? "translate(" + t.xPercent + "%," + t.yPercent + "%) translate3d(" : "translate3d(") + x + "px," + y + "px," + z + "px)" + ((sx !== 1 || sy !== 1) ? " scale(" + sx + "," + sy + ")" : "");
return;
}
else {
a11 = a22 = 1;
a12 = a21 = 0;
}
a33 = 1;
a13 = a23 = a31 = a32 = a41 = a42 = 0;
a43 = (perspective) ? -1 / perspective : 0;
zOrigin = t.zOrigin;
min = 0.000001;
comma = ",";
zero = "0";
angle = rotationY * _DEG2RAD;
if (angle) {
cos = Math.cos(angle);
sin = Math.sin(angle);
a31 = -sin;
a41 = a43 * -sin;
a13 = a11 * sin;
a23 = a21 * sin;
a33 = cos;
a43 *= cos;
a11 *= cos;
a21 *= cos;
}
angle = rotationX * _DEG2RAD;
if (angle) {
cos = Math.cos(angle);
sin = Math.sin(angle);
t1 = a12 * cos + a13 * sin;
t2 = a22 * cos + a23 * sin;
a32 = a33 * sin;
a42 = a43 * sin;
a13 = a12 * -sin + a13 * cos;
a23 = a22 * -sin + a23 * cos;
a33 = a33 * cos;
a43 = a43 * cos;
a12 = t1;
a22 = t2;
}
if (sz !== 1) {
a13 *= sz;
a23 *= sz;
a33 *= sz;
a43 *= sz;
}
if (sy !== 1) {
a12 *= sy;
a22 *= sy;
a32 *= sy;
a42 *= sy;
}
if (sx !== 1) {
a11 *= sx;
a21 *= sx;
a31 *= sx;
a41 *= sx;
}
if (zOrigin || isSVG) {
if (zOrigin) {
x += a13 * -zOrigin;
y += a23 * -zOrigin;
z += a33 * -zOrigin + zOrigin;
}
if (isSVG) {
x += t.xOrigin - (t.xOrigin * a11 + t.yOrigin * a12) + t.xOffset;
y += t.yOrigin - (t.xOrigin * a21 + t.yOrigin * a22) + t.yOffset;
}
if (x < min && x > -min) {
x = zero;
}
if (y < min && y > -min) {
y = zero;
}
if (z < min && z > -min) {
z = 0;
}
}
transform = ((t.xPercent || t.yPercent) ? "translate(" + t.xPercent + "%," + t.yPercent + "%) matrix3d(" : "matrix3d(");
transform += ((a11 < min && a11 > -min) ? zero : a11) + comma + ((a21 < min && a21 > -min) ? zero : a21) + comma + ((a31 < min && a31 > -min) ? zero : a31);
transform += comma + ((a41 < min && a41 > -min) ? zero : a41) + comma + ((a12 < min && a12 > -min) ? zero : a12) + comma + ((a22 < min && a22 > -min) ? zero : a22);
if (rotationX || rotationY || sz !== 1) {
transform += comma + ((a32 < min && a32 > -min) ? zero : a32) + comma + ((a42 < min && a42 > -min) ? zero : a42) + comma + ((a13 < min && a13 > -min) ? zero : a13);
transform += comma + ((a23 < min && a23 > -min) ? zero : a23) + comma + ((a33 < min && a33 > -min) ? zero : a33) + comma + ((a43 < min && a43 > -min) ? zero : a43) + comma;
}
else {
transform += ",0,0,0,0,1,0,";
}
transform += x + comma + y + comma + z + comma + (perspective ? (1 + (-z / perspective)) : 1) + ")";
style[_transformProp] = transform;
};
p = Transform.prototype;
p.x = p.y = p.z = p.skewX = p.skewY = p.rotation = p.rotationX = p.rotationY = p.zOrigin = p.xPercent = p.yPercent = p.xOffset = p.yOffset = 0;
p.scaleX = p.scaleY = p.scaleZ = 1;
_registerComplexSpecialProp("transform,scale,scaleX,scaleY,scaleZ,x,y,z,rotation,rotationX,rotationY,rotationZ,skewX,skewY,shortRotation,shortRotationX,shortRotationY,shortRotationZ,transformOrigin,svgOrigin,transformPerspective,directionalRotation,parseTransform,force3D,skewType,xPercent,yPercent,smoothOrigin", { parser: function (t, e, parsingProp, cssp, pt, plugin, vars) {
if (cssp._lastParsedTransform === vars) {
return pt;
}
cssp._lastParsedTransform = vars;
var scaleFunc = (vars.scale && typeof (vars.scale) === "function") ? vars.scale : 0;
if (scaleFunc) {
vars.scale = scaleFunc(_index, t);
}
var originalGSTransform = t._gsTransform, style = t.style, min = 0.000001, i = _transformProps.length, v = vars, endRotations = {}, transformOriginString = "transformOrigin", m1 = _getTransform(t, _cs, true, v.parseTransform), orig = v.transform && ((typeof (v.transform) === "function") ? v.transform(_index, _target) : v.transform), m2, copy, has3D, hasChange, dr, x, y, matrix, p;
m1.skewType = v.skewType || m1.skewType || CSSPlugin.defaultSkewType;
cssp._transform = m1;
if ("rotationZ" in v) {
v.rotation = v.rotationZ;
}
if (orig && typeof (orig) === "string" && _transformProp) {
copy = _tempDiv.style;
copy[_transformProp] = orig;
copy.display = "block";
copy.position = "absolute";
if (orig.indexOf("%") !== -1) {
copy.width = _getStyle(t, "width");
copy.height = _getStyle(t, "height");
}
_doc.body.appendChild(_tempDiv);
m2 = _getTransform(_tempDiv, null, false);
if (m1.skewType === "simple") {
m2.scaleY *= Math.cos(m2.skewX * _DEG2RAD);
}
if (m1.svg) {
x = m1.xOrigin;
y = m1.yOrigin;
m2.x -= m1.xOffset;
m2.y -= m1.yOffset;
if (v.transformOrigin || v.svgOrigin) {
orig = {};
_parseSVGOrigin(t, _parsePosition(v.transformOrigin), orig, v.svgOrigin, v.smoothOrigin, true);
x = orig.xOrigin;
y = orig.yOrigin;
m2.x -= orig.xOffset - m1.xOffset;
m2.y -= orig.yOffset - m1.yOffset;
}
if (x || y) {
matrix = _getMatrix(_tempDiv, true);
m2.x -= x - (x * matrix[0] + y * matrix[2]);
m2.y -= y - (x * matrix[1] + y * matrix[3]);
}
}
_doc.body.removeChild(_tempDiv);
if (!m2.perspective) {
m2.perspective = m1.perspective;
}
if (v.xPercent != null) {
m2.xPercent = _parseVal(v.xPercent, m1.xPercent);
}
if (v.yPercent != null) {
m2.yPercent = _parseVal(v.yPercent, m1.yPercent);
}
}
else if (typeof (v) === "object") {
m2 = { scaleX: _parseVal((v.scaleX != null) ? v.scaleX : v.scale, m1.scaleX),
scaleY: _parseVal((v.scaleY != null) ? v.scaleY : v.scale, m1.scaleY),
scaleZ: _parseVal(v.scaleZ, m1.scaleZ),
x: _parseVal(v.x, m1.x),
y: _parseVal(v.y, m1.y),
z: _parseVal(v.z, m1.z),
xPercent: _parseVal(v.xPercent, m1.xPercent),
yPercent: _parseVal(v.yPercent, m1.yPercent),
perspective: _parseVal(v.transformPerspective, m1.perspective) };
dr = v.directionalRotation;
if (dr != null) {
if (typeof (dr) === "object") {
for (copy in dr) {
v[copy] = dr[copy];
}
}
else {
v.rotation = dr;
}
}
if (typeof (v.x) === "string" && v.x.indexOf("%") !== -1) {
m2.x = 0;
m2.xPercent = _parseVal(v.x, m1.xPercent);
}
if (typeof (v.y) === "string" && v.y.indexOf("%") !== -1) {
m2.y = 0;
m2.yPercent = _parseVal(v.y, m1.yPercent);
}
m2.rotation = _parseAngle(("rotation" in v) ? v.rotation : ("shortRotation" in v) ? v.shortRotation + "_short" : m1.rotation, m1.rotation, "rotation", endRotations);
if (_supports3D) {
m2.rotationX = _parseAngle(("rotationX" in v) ? v.rotationX : ("shortRotationX" in v) ? v.shortRotationX + "_short" : m1.rotationX || 0, m1.rotationX, "rotationX", endRotations);
m2.rotationY = _parseAngle(("rotationY" in v) ? v.rotationY : ("shortRotationY" in v) ? v.shortRotationY + "_short" : m1.rotationY || 0, m1.rotationY, "rotationY", endRotations);
}
m2.skewX = _parseAngle(v.skewX, m1.skewX);
m2.skewY = _parseAngle(v.skewY, m1.skewY);
}
if (_supports3D && v.force3D != null) {
m1.force3D = v.force3D;
hasChange = true;
}
has3D = (m1.force3D || m1.z || m1.rotationX || m1.rotationY || m2.z || m2.rotationX || m2.rotationY || m2.perspective);
if (!has3D && v.scale != null) {
m2.scaleZ = 1;
}
while (--i > -1) {
p = _transformProps[i];
orig = m2[p] - m1[p];
if (orig > min || orig < -min || v[p] != null || _forcePT[p] != null) {
hasChange = true;
pt = new CSSPropTween(m1, p, m1[p], orig, pt);
if (p in endRotations) {
pt.e = endRotations[p];
}
pt.xs0 = 0;
pt.plugin = plugin;
cssp._overwriteProps.push(pt.n);
}
}
orig = (typeof (v.transformOrigin) === "function") ? v.transformOrigin(_index, _target) : v.transformOrigin;
if (m1.svg && (orig || v.svgOrigin)) {
x = m1.xOffset;
y = m1.yOffset;
_parseSVGOrigin(t, _parsePosition(orig), m2, v.svgOrigin, v.smoothOrigin);
pt = _addNonTweeningNumericPT(m1, "xOrigin", (originalGSTransform ? m1 : m2).xOrigin, m2.xOrigin, pt, transformOriginString);
pt = _addNonTweeningNumericPT(m1, "yOrigin", (originalGSTransform ? m1 : m2).yOrigin, m2.yOrigin, pt, transformOriginString);
if (x !== m1.xOffset || y !== m1.yOffset) {
pt = _addNonTweeningNumericPT(m1, "xOffset", (originalGSTransform ? x : m1.xOffset), m1.xOffset, pt, transformOriginString);
pt = _addNonTweeningNumericPT(m1, "yOffset", (originalGSTransform ? y : m1.yOffset), m1.yOffset, pt, transformOriginString);
}
orig = "0px 0px";
}
if (orig || (_supports3D && has3D && m1.zOrigin)) {
if (_transformProp) {
hasChange = true;
p = _transformOriginProp;
if (!orig) {
orig = (_getStyle(t, p, _cs, false, "50% 50%") + "").split(" ");
orig = orig[0] + " " + orig[1] + " " + m1.zOrigin + "px";
}
orig += "";
pt = new CSSPropTween(style, p, 0, 0, pt, -1, transformOriginString);
pt.b = style[p];
pt.plugin = plugin;
if (_supports3D) {
copy = m1.zOrigin;
orig = orig.split(" ");
m1.zOrigin = ((orig.length > 2) ? parseFloat(orig[2]) : copy) || 0;
pt.xs0 = pt.e = orig[0] + " " + (orig[1] || "50%") + " 0px";
pt = new CSSPropTween(m1, "zOrigin", 0, 0, pt, -1, pt.n);
pt.b = copy;
pt.xs0 = pt.e = m1.zOrigin;
}
else {
pt.xs0 = pt.e = orig;
}
}
else {
_parsePosition(orig + "", m1);
}
}
if (hasChange) {
cssp._transformType = (!(m1.svg && _useSVGTransformAttr) && (has3D || this._transformType === 3)) ? 3 : 2;
}
if (scaleFunc) {
vars.scale = scaleFunc;
}
return pt;
}, allowFunc: true, prefix: true });
_registerComplexSpecialProp("boxShadow", { defaultValue: "0px 0px 0px 0px #999", prefix: true, color: true, multi: true, keyword: "inset" });
_registerComplexSpecialProp("clipPath", { defaultValue: "inset(0%)", prefix: true, multi: true, formatter: _getFormatter("inset(0% 0% 0% 0%)", false, true) });
_registerComplexSpecialProp("borderRadius", { defaultValue: "0px", parser: function (t, e, p, cssp, pt, plugin) {
e = this.format(e);
var props = ["borderTopLeftRadius", "borderTopRightRadius", "borderBottomRightRadius", "borderBottomLeftRadius"], style = t.style, ea1, i, es2, bs2, bs, es, bn, en, w, h, esfx, bsfx, rel, hn, vn, em;
w = parseFloat(t.offsetWidth);
h = parseFloat(t.offsetHeight);
ea1 = e.split(" ");
for (i = 0; i < props.length; i++) {
if (this.p.indexOf("border")) {
props[i] = _checkPropPrefix(props[i]);
}
bs = bs2 = _getStyle(t, props[i], _cs, false, "0px");
if (bs.indexOf(" ") !== -1) {
bs2 = bs.split(" ");
bs = bs2[0];
bs2 = bs2[1];
}
es = es2 = ea1[i];
bn = parseFloat(bs);
bsfx = bs.substr((bn + "").length);
rel = (es.charAt(1) === "=");
if (rel) {
en = parseInt(es.charAt(0) + "1", 10);
es = es.substr(2);
en *= parseFloat(es);
esfx = es.substr((en + "").length - (en < 0 ? 1 : 0)) || "";
}
else {
en = parseFloat(es);
esfx = es.substr((en + "").length);
}
if (esfx === "") {
esfx = _suffixMap[p] || bsfx;
}
if (esfx !== bsfx) {
hn = _convertToPixels(t, "borderLeft", bn, bsfx);
vn = _convertToPixels(t, "borderTop", bn, bsfx);
if (esfx === "%") {
bs = (hn / w * 100) + "%";
bs2 = (vn / h * 100) + "%";
}
else if (esfx === "em") {
em = _convertToPixels(t, "borderLeft", 1, "em");
bs = (hn / em) + "em";
bs2 = (vn / em) + "em";
}
else {
bs = hn + "px";
bs2 = vn + "px";
}
if (rel) {
es = (parseFloat(bs) + en) + esfx;
es2 = (parseFloat(bs2) + en) + esfx;
}
}
pt = _parseComplex(style, props[i], bs + " " + bs2, es + " " + es2, false, "0px", pt);
}
return pt;
}, prefix: true, formatter: _getFormatter("0px 0px 0px 0px", false, true) });
_registerComplexSpecialProp("borderBottomLeftRadius,borderBottomRightRadius,borderTopLeftRadius,borderTopRightRadius", { defaultValue: "0px", parser: function (t, e, p, cssp, pt, plugin) {
return _parseComplex(t.style, p, this.format(_getStyle(t, p, _cs, false, "0px 0px")), this.format(e), false, "0px", pt);
}, prefix: true, formatter: _getFormatter("0px 0px", false, true) });
_registerComplexSpecialProp("backgroundPosition", { defaultValue: "0 0", parser: function (t, e, p, cssp, pt, plugin) {
var bp = "background-position", cs = (_cs || _getComputedStyle(t, null)), bs = this.format(((cs) ? _ieVers ? cs.getPropertyValue(bp + "-x") + " " + cs.getPropertyValue(bp + "-y") : cs.getPropertyValue(bp) : t.currentStyle.backgroundPositionX + " " + t.currentStyle.backgroundPositionY) || "0 0"), es = this.format(e), ba, ea, i, pct, overlap, src;
if ((bs.indexOf("%") !== -1) !== (es.indexOf("%") !== -1) && es.split(",").length < 2) {
src = _getStyle(t, "backgroundImage").replace(_urlExp, "");
if (src && src !== "none") {
ba = bs.split(" ");
ea = es.split(" ");
_tempImg.setAttribute("src", src);
i = 2;
while (--i > -1) {
bs = ba[i];
pct = (bs.indexOf("%") !== -1);
if (pct !== (ea[i].indexOf("%") !== -1)) {
overlap = (i === 0) ? t.offsetWidth - _tempImg.width : t.offsetHeight - _tempImg.height;
ba[i] = pct ? (parseFloat(bs) / 100 * overlap) + "px" : (parseFloat(bs) / overlap * 100) + "%";
}
}
bs = ba.join(" ");
}
}
return this.parseComplex(t.style, bs, es, pt, plugin);
}, formatter: _parsePosition });
_registerComplexSpecialProp("backgroundSize", { defaultValue: "0 0", formatter: function (v) {
v += "";
return (v.substr(0, 2) === "co") ? v : _parsePosition(v.indexOf(" ") === -1 ? v + " " + v : v);
} });
_registerComplexSpecialProp("perspective", { defaultValue: "0px", prefix: true });
_registerComplexSpecialProp("perspectiveOrigin", { defaultValue: "50% 50%", prefix: true });
_registerComplexSpecialProp("transformStyle", { prefix: true });
_registerComplexSpecialProp("backfaceVisibility", { prefix: true });
_registerComplexSpecialProp("userSelect", { prefix: true });
_registerComplexSpecialProp("margin", { parser: _getEdgeParser("marginTop,marginRight,marginBottom,marginLeft") });
_registerComplexSpecialProp("padding", { parser: _getEdgeParser("paddingTop,paddingRight,paddingBottom,paddingLeft") });
_registerComplexSpecialProp("clip", { defaultValue: "rect(0px,0px,0px,0px)", parser: function (t, e, p, cssp, pt, plugin) {
var b, cs, delim;
if (_ieVers < 9) {
cs = t.currentStyle;
delim = _ieVers < 8 ? " " : ",";
b = "rect(" + cs.clipTop + delim + cs.clipRight + delim + cs.clipBottom + delim + cs.clipLeft + ")";
e = this.format(e).split(",").join(delim);
}
else {
b = this.format(_getStyle(t, this.p, _cs, false, this.dflt));
e = this.format(e);
}
return this.parseComplex(t.style, b, e, pt, plugin);
} });
_registerComplexSpecialProp("textShadow", { defaultValue: "0px 0px 0px #999", color: true, multi: true });
_registerComplexSpecialProp("autoRound,strictUnits", { parser: function (t, e, p, cssp, pt) { return pt; } });
_registerComplexSpecialProp("border", { defaultValue: "0px solid #000", parser: function (t, e, p, cssp, pt, plugin) {
var bw = _getStyle(t, "borderTopWidth", _cs, false, "0px"), end = this.format(e).split(" "), esfx = end[0].replace(_suffixExp, "");
if (esfx !== "px") {
bw = (parseFloat(bw) / _convertToPixels(t, "borderTopWidth", 1, esfx)) + esfx;
}
return this.parseComplex(t.style, this.format(bw + " " + _getStyle(t, "borderTopStyle", _cs, false, "solid") + " " + _getStyle(t, "borderTopColor", _cs, false, "#000")), end.join(" "), pt, plugin);
}, color: true, formatter: function (v) {
var a = v.split(" ");
return a[0] + " " + (a[1] || "solid") + " " + (v.match(_colorExp) || ["#000"])[0];
} });
_registerComplexSpecialProp("borderWidth", { parser: _getEdgeParser("borderTopWidth,borderRightWidth,borderBottomWidth,borderLeftWidth") });
_registerComplexSpecialProp("float,cssFloat,styleFloat", { parser: function (t, e, p, cssp, pt, plugin) {
var s = t.style, prop = ("cssFloat" in s) ? "cssFloat" : "styleFloat";
return new CSSPropTween(s, prop, 0, 0, pt, -1, p, false, 0, s[prop], e);
} });
var _setIEOpacityRatio = function (v) {
var t = this.t, filters = t.filter || _getStyle(this.data, "filter") || "", val = (this.s + this.c * v) | 0, skip;
if (val === 100) {
if (filters.indexOf("atrix(") === -1 && filters.indexOf("radient(") === -1 && filters.indexOf("oader(") === -1) {
t.removeAttribute("filter");
skip = (!_getStyle(this.data, "filter"));
}
else {
t.filter = filters.replace(_alphaFilterExp, "");
skip = true;
}
}
if (!skip) {
if (this.xn1) {
t.filter = filters = filters || ("alpha(opacity=" + val + ")");
}
if (filters.indexOf("pacity") === -1) {
if (val !== 0 || !this.xn1) {
t.filter = filters + " alpha(opacity=" + val + ")";
}
}
else {
t.filter = filters.replace(_opacityExp, "opacity=" + val);
}
}
};
_registerComplexSpecialProp("opacity,alpha,autoAlpha", { defaultValue: "1", parser: function (t, e, p, cssp, pt, plugin) {
var b = parseFloat(_getStyle(t, "opacity", _cs, false, "1")), style = t.style, isAutoAlpha = (p === "autoAlpha");
if (typeof (e) === "string" && e.charAt(1) === "=") {
e = ((e.charAt(0) === "-") ? -1 : 1) * parseFloat(e.substr(2)) + b;
}
if (isAutoAlpha && b === 1 && _getStyle(t, "visibility", _cs) === "hidden" && e !== 0) {
b = 0;
}
if (_supportsOpacity) {
pt = new CSSPropTween(style, "opacity", b, e - b, pt);
}
else {
pt = new CSSPropTween(style, "opacity", b * 100, (e - b) * 100, pt);
pt.xn1 = isAutoAlpha ? 1 : 0;
style.zoom = 1;
pt.type = 2;
pt.b = "alpha(opacity=" + pt.s + ")";
pt.e = "alpha(opacity=" + (pt.s + pt.c) + ")";
pt.data = t;
pt.plugin = plugin;
pt.setRatio = _setIEOpacityRatio;
}
if (isAutoAlpha) {
pt = new CSSPropTween(style, "visibility", 0, 0, pt, -1, null, false, 0, ((b !== 0) ? "inherit" : "hidden"), ((e === 0) ? "hidden" : "inherit"));
pt.xs0 = "inherit";
cssp._overwriteProps.push(pt.n);
cssp._overwriteProps.push(p);
}
return pt;
} });
var _removeProp = function (s, p) {
if (p) {
if (s.removeProperty) {
if (p.substr(0, 2) === "ms" || p.substr(0, 6) === "webkit") {
p = "-" + p;
}
s.removeProperty(p.replace(_capsExp, "-$1").toLowerCase());
}
else {
s.removeAttribute(p);
}
}
}, _setClassNameRatio = function (v) {
this.t._gsClassPT = this;
if (v === 1 || v === 0) {
this.t.setAttribute("class", (v === 0) ? this.b : this.e);
var mpt = this.data, s = this.t.style;
while (mpt) {
if (!mpt.v) {
_removeProp(s, mpt.p);
}
else {
s[mpt.p] = mpt.v;
}
mpt = mpt._next;
}
if (v === 1 && this.t._gsClassPT === this) {
this.t._gsClassPT = null;
}
}
else if (this.t.getAttribute("class") !== this.e) {
this.t.setAttribute("class", this.e);
}
};
_registerComplexSpecialProp("className", { parser: function (t, e, p, cssp, pt, plugin, vars) {
var b = t.getAttribute("class") || "", cssText = t.style.cssText, difData, bs, cnpt, cnptLookup, mpt;
pt = cssp._classNamePT = new CSSPropTween(t, p, 0, 0, pt, 2);
pt.setRatio = _setClassNameRatio;
pt.pr = -11;
_hasPriority = true;
pt.b = b;
bs = _getAllStyles(t, _cs);
cnpt = t._gsClassPT;
if (cnpt) {
cnptLookup = {};
mpt = cnpt.data;
while (mpt) {
cnptLookup[mpt.p] = 1;
mpt = mpt._next;
}
cnpt.setRatio(1);
}
t._gsClassPT = pt;
pt.e = (e.charAt(1) !== "=") ? e : b.replace(new RegExp("(?:\\s|^)" + e.substr(2) + "(?![\\w-])"), "") + ((e.charAt(0) === "+") ? " " + e.substr(2) : "");
t.setAttribute("class", pt.e);
difData = _cssDif(t, bs, _getAllStyles(t), vars, cnptLookup);
t.setAttribute("class", b);
pt.data = difData.firstMPT;
if (t.style.cssText !== cssText) {
t.style.cssText = cssText;
}
pt = pt.xfirst = cssp.parse(t, difData.difs, pt, plugin);
return pt;
} });
var _setClearPropsRatio = function (v) {
if (v === 1 || v === 0)
if (this.data._totalTime === this.data._totalDuration && this.data.data !== "isFromStart") {
var s = this.t.style, transformParse = _specialProps.transform.parse, a, p, i, clearTransform, transform;
if (this.e === "all") {
s.cssText = "";
clearTransform = true;
}
else {
a = this.e.split(" ").join("").split(",");
i = a.length;
while (--i > -1) {
p = a[i];
if (_specialProps[p]) {
if (_specialProps[p].parse === transformParse) {
clearTransform = true;
}
else {
p = (p === "transformOrigin") ? _transformOriginProp : _specialProps[p].p;
}
}
_removeProp(s, p);
}
}
if (clearTransform) {
_removeProp(s, _transformProp);
transform = this.t._gsTransform;
if (transform) {
if (transform.svg) {
this.t.removeAttribute("data-svg-origin");
this.t.removeAttribute("transform");
}
delete this.t._gsTransform;
}
}
}
};
_registerComplexSpecialProp("clearProps", { parser: function (t, e, p, cssp, pt) {
pt = new CSSPropTween(t, p, 0, 0, pt, 2);
pt.setRatio = _setClearPropsRatio;
pt.e = e;
pt.pr = -10;
pt.data = cssp._tween;
_hasPriority = true;
return pt;
} });
p = "bezier,throwProps,physicsProps,physics2D".split(",");
i = p.length;
while (i--) {
_registerPluginProp(p[i]);
}
p = CSSPlugin.prototype;
p._firstPT = p._lastParsedTransform = p._transform = null;
p._onInitTween = function (target, vars, tween, index) {
if (!target.nodeType) {
return false;
}
this._target = _target = target;
this._tween = tween;
this._vars = vars;
_index = index;
_autoRound = vars.autoRound;
_hasPriority = false;
_suffixMap = vars.suffixMap || CSSPlugin.suffixMap;
_cs = _getComputedStyle(target, "");
_overwriteProps = this._overwriteProps;
var style = target.style, v, pt, pt2, first, last, next, zIndex, tpt, threeD;
if (_reqSafariFix)
if (style.zIndex === "") {
v = _getStyle(target, "zIndex", _cs);
if (v === "auto" || v === "") {
this._addLazySet(style, "zIndex", 0);
}
}
if (typeof (vars) === "string") {
first = style.cssText;
v = _getAllStyles(target, _cs);
style.cssText = first + ";" + vars;
v = _cssDif(target, v, _getAllStyles(target)).difs;
if (!_supportsOpacity && _opacityValExp.test(vars)) {
v.opacity = parseFloat(RegExp.$1);
}
vars = v;
style.cssText = first;
}
if (vars.className) {
this._firstPT = pt = _specialProps.className.parse(target, vars.className, "className", this, null, null, vars);
}
else {
this._firstPT = pt = this.parse(target, vars, null);
}
if (this._transformType) {
threeD = (this._transformType === 3);
if (!_transformProp) {
style.zoom = 1;
}
else if (_isSafari) {
_reqSafariFix = true;
if (style.zIndex === "") {
zIndex = _getStyle(target, "zIndex", _cs);
if (zIndex === "auto" || zIndex === "") {
this._addLazySet(style, "zIndex", 0);
}
}
if (_isSafariLT6) {
this._addLazySet(style, "WebkitBackfaceVisibility", this._vars.WebkitBackfaceVisibility || (threeD ? "visible" : "hidden"));
}
}
pt2 = pt;
while (pt2 && pt2._next) {
pt2 = pt2._next;
}
tpt = new CSSPropTween(target, "transform", 0, 0, null, 2);
this._linkCSSP(tpt, null, pt2);
tpt.setRatio = _transformProp ? _setTransformRatio : _setIETransformRatio;
tpt.data = this._transform || _getTransform(target, _cs, true);
tpt.tween = tween;
tpt.pr = -1;
_overwriteProps.pop();
}
if (_hasPriority) {
while (pt) {
next = pt._next;
pt2 = first;
while (pt2 && pt2.pr > pt.pr) {
pt2 = pt2._next;
}
if ((pt._prev = pt2 ? pt2._prev : last)) {
pt._prev._next = pt;
}
else {
first = pt;
}
if ((pt._next = pt2)) {
pt2._prev = pt;
}
else {
last = pt;
}
pt = next;
}
this._firstPT = first;
}
return true;
};
p.parse = function (target, vars, pt, plugin) {
var style = target.style, p, sp, bn, en, bs, es, bsfx, esfx, isStr, rel;
for (p in vars) {
es = vars[p];
sp = _specialProps[p];
if (typeof (es) === "function" && !(sp && sp.allowFunc)) {
es = es(_index, _target);
}
if (sp) {
pt = sp.parse(target, es, p, this, pt, plugin, vars);
}
else if (p.substr(0, 2) === "--") {
this._tween._propLookup[p] = this._addTween.call(this._tween, target.style, "setProperty", _getComputedStyle(target).getPropertyValue(p) + "", es + "", p, false, p);
continue;
}
else {
bs = _getStyle(target, p, _cs) + "";
isStr = (typeof (es) === "string");
if (p === "color" || p === "fill" || p === "stroke" || p.indexOf("Color") !== -1 || (isStr && _rgbhslExp.test(es))) {
if (!isStr) {
es = _parseColor(es);
es = ((es.length > 3) ? "rgba(" : "rgb(") + es.join(",") + ")";
}
pt = _parseComplex(style, p, bs, es, true, "transparent", pt, 0, plugin);
}
else if (isStr && _complexExp.test(es)) {
pt = _parseComplex(style, p, bs, es, true, null, pt, 0, plugin);
}
else {
bn = parseFloat(bs);
bsfx = (bn || bn === 0) ? bs.substr((bn + "").length) : "";
if (bs === "" || bs === "auto") {
if (p === "width" || p === "height") {
bn = _getDimension(target, p, _cs);
bsfx = "px";
}
else if (p === "left" || p === "top") {
bn = _calculateOffset(target, p, _cs);
bsfx = "px";
}
else {
bn = (p !== "opacity") ? 0 : 1;
bsfx = "";
}
}
rel = (isStr && es.charAt(1) === "=");
if (rel) {
en = parseInt(es.charAt(0) + "1", 10);
es = es.substr(2);
en *= parseFloat(es);
esfx = es.replace(_suffixExp, "");
}
else {
en = parseFloat(es);
esfx = isStr ? es.replace(_suffixExp, "") : "";
}
if (esfx === "") {
esfx = (p in _suffixMap) ? _suffixMap[p] : bsfx;
}
es = (en || en === 0) ? (rel ? en + bn : en) + esfx : vars[p];
if (bsfx !== esfx)
if (esfx !== "" || p === "lineHeight")
if (en || en === 0)
if (bn) {
bn = _convertToPixels(target, p, bn, bsfx);
if (esfx === "%") {
bn /= _convertToPixels(target, p, 100, "%") / 100;
if (vars.strictUnits !== true) {
bs = bn + "%";
}
}
else if (esfx === "em" || esfx === "rem" || esfx === "vw" || esfx === "vh") {
bn /= _convertToPixels(target, p, 1, esfx);
}
else if (esfx !== "px") {
en = _convertToPixels(target, p, en, esfx);
esfx = "px";
}
if (rel)
if (en || en === 0) {
es = (en + bn) + esfx;
}
}
if (rel) {
en += bn;
}
if ((bn || bn === 0) && (en || en === 0)) {
pt = new CSSPropTween(style, p, bn, en - bn, pt, 0, p, (_autoRound !== false && (esfx === "px" || p === "zIndex")), 0, bs, es);
pt.xs0 = esfx;
}
else if (style[p] === undefined || !es && (es + "" === "NaN" || es == null)) {
_log("invalid " + p + " tween value: " + vars[p]);
}
else {
pt = new CSSPropTween(style, p, en || bn || 0, 0, pt, -1, p, false, 0, bs, es);
pt.xs0 = (es === "none" && (p === "display" || p.indexOf("Style") !== -1)) ? bs : es;
}
}
}
if (plugin)
if (pt && !pt.plugin) {
pt.plugin = plugin;
}
}
return pt;
};
p.setRatio = function (v) {
var pt = this._firstPT, min = 0.000001, val, str, i;
if (v === 1 && (this._tween._time === this._tween._duration || this._tween._time === 0)) {
while (pt) {
if (pt.type !== 2) {
if (pt.r && pt.type !== -1) {
val = pt.r(pt.s + pt.c);
if (!pt.type) {
pt.t[pt.p] = val + pt.xs0;
}
else if (pt.type === 1) {
i = pt.l;
str = pt.xs0 + val + pt.xs1;
for (i = 1; i < pt.l; i++) {
str += pt["xn" + i] + pt["xs" + (i + 1)];
}
pt.t[pt.p] = str;
}
}
else {
pt.t[pt.p] = pt.e;
}
}
else {
pt.setRatio(v);
}
pt = pt._next;
}
}
else if (v || !(this._tween._time === this._tween._duration || this._tween._time === 0) || this._tween._rawPrevTime === -0.000001) {
while (pt) {
val = pt.c * v + pt.s;
if (pt.r) {
val = pt.r(val);
}
else if (val < min)
if (val > -min) {
val = 0;
}
if (!pt.type) {
pt.t[pt.p] = val + pt.xs0;
}
else if (pt.type === 1) {
i = pt.l;
if (i === 2) {
pt.t[pt.p] = pt.xs0 + val + pt.xs1 + pt.xn1 + pt.xs2;
}
else if (i === 3) {
pt.t[pt.p] = pt.xs0 + val + pt.xs1 + pt.xn1 + pt.xs2 + pt.xn2 + pt.xs3;
}
else if (i === 4) {
pt.t[pt.p] = pt.xs0 + val + pt.xs1 + pt.xn1 + pt.xs2 + pt.xn2 + pt.xs3 + pt.xn3 + pt.xs4;
}
else if (i === 5) {
pt.t[pt.p] = pt.xs0 + val + pt.xs1 + pt.xn1 + pt.xs2 + pt.xn2 + pt.xs3 + pt.xn3 + pt.xs4 + pt.xn4 + pt.xs5;
}
else {
str = pt.xs0 + val + pt.xs1;
for (i = 1; i < pt.l; i++) {
str += pt["xn" + i] + pt["xs" + (i + 1)];
}
pt.t[pt.p] = str;
}
}
else if (pt.type === -1) {
pt.t[pt.p] = pt.xs0;
}
else if (pt.setRatio) {
pt.setRatio(v);
}
pt = pt._next;
}
}
else {
while (pt) {
if (pt.type !== 2) {
pt.t[pt.p] = pt.b;
}
else {
pt.setRatio(v);
}
pt = pt._next;
}
}
};
p._enableTransforms = function (threeD) {
this._transform = this._transform || _getTransform(this._target, _cs, true);
this._transformType = (!(this._transform.svg && _useSVGTransformAttr) && (threeD || this._transformType === 3)) ? 3 : 2;
};
var lazySet = function (v) {
this.t[this.p] = this.e;
this.data._linkCSSP(this, this._next, null, true);
};
p._addLazySet = function (t, p, v) {
var pt = this._firstPT = new CSSPropTween(t, p, 0, 0, this._firstPT, 2);
pt.e = v;
pt.setRatio = lazySet;
pt.data = this;
};
p._linkCSSP = function (pt, next, prev, remove) {
if (pt) {
if (next) {
next._prev = pt;
}
if (pt._next) {
pt._next._prev = pt._prev;
}
if (pt._prev) {
pt._prev._next = pt._next;
}
else if (this._firstPT === pt) {
this._firstPT = pt._next;
remove = true;
}
if (prev) {
prev._next = pt;
}
else if (!remove && this._firstPT === null) {
this._firstPT = pt;
}
pt._next = next;
pt._prev = prev;
}
return pt;
};
p._mod = function (lookup) {
var pt = this._firstPT;
while (pt) {
if (typeof (lookup[pt.p]) === "function") {
pt.r = lookup[pt.p];
}
pt = pt._next;
}
};
p._kill = function (lookup) {
var copy = lookup, pt, p, xfirst;
if (lookup.autoAlpha || lookup.alpha) {
copy = {};
for (p in lookup) {
copy[p] = lookup[p];
}
copy.opacity = 1;
if (copy.autoAlpha) {
copy.visibility = 1;
}
}
if (lookup.className && (pt = this._classNamePT)) {
xfirst = pt.xfirst;
if (xfirst && xfirst._prev) {
this._linkCSSP(xfirst._prev, pt._next, xfirst._prev._prev);
}
else if (xfirst === this._firstPT) {
this._firstPT = pt._next;
}
if (pt._next) {
this._linkCSSP(pt._next, pt._next._next, xfirst._prev);
}
this._classNamePT = null;
}
pt = this._firstPT;
while (pt) {
if (pt.plugin && pt.plugin !== p && pt.plugin._kill) {
pt.plugin._kill(lookup);
p = pt.plugin;
}
pt = pt._next;
}
return TweenLite_js_1.TweenPlugin.prototype._kill.call(this, copy);
};
var _getChildStyles = function (e, props, targets) {
var children, i, child, type;
if (e.slice) {
i = e.length;
while (--i > -1) {
_getChildStyles(e[i], props, targets);
}
return;
}
children = e.childNodes;
i = children.length;
while (--i > -1) {
child = children[i];
type = child.type;
if (child.style) {
props.push(_getAllStyles(child));
if (targets) {
targets.push(child);
}
}
if ((type === 1 || type === 9 || type === 11) && child.childNodes.length) {
_getChildStyles(child, props, targets);
}
}
};
CSSPlugin.cascadeTo = function (target, duration, vars) {
var tween = TweenLite_js_1.default.to(target, duration, vars), results = [tween], b = [], e = [], targets = [], _reservedProps = TweenLite_js_1.default._internals.reservedProps, i, difs, p, from;
target = tween._targets || tween.target;
_getChildStyles(target, b, targets);
tween.render(duration, true, true);
_getChildStyles(target, e);
tween.render(0, true, true);
tween._enabled(true);
i = targets.length;
while (--i > -1) {
difs = _cssDif(targets[i], b[i], e[i]);
if (difs.firstMPT) {
difs = difs.difs;
for (p in vars) {
if (_reservedProps[p]) {
difs[p] = vars[p];
}
}
from = {};
for (p in difs) {
from[p] = b[i][p];
}
results.push(TweenLite_js_1.default.fromTo(targets[i], duration, from, difs));
}
}
return results;
};
TweenLite_js_1.TweenPlugin.activate([CSSPlugin]);
return CSSPlugin;
}, true); exports.CSSPlugin = TweenLite_js_1.globals.CSSPlugin; exports.default = exports.CSSPlugin;
} // gsap/AttrPlugin.js $fsx.f[85] = (module, exports) => { "use strict"; Object.defineProperty(exports, "__esModule", { value: true }); const TweenLite_js_1 = $fsx.r(80); exports.AttrPlugin = TweenLite_js_1._gsScope._gsDefine.plugin({
propName: "attr",
API: 2,
version: "0.6.1",
init: function (target, value, tween, index) {
var p, end;
if (typeof (target.setAttribute) !== "function") {
return false;
}
for (p in value) {
end = value[p];
if (typeof (end) === "function") {
end = end(index, target);
}
this._addTween(target, "setAttribute", target.getAttribute(p) + "", end + "", p, false, p);
this._overwriteProps.push(p);
}
return true;
}
}); exports.default = exports.AttrPlugin;
} // gsap/RoundPropsPlugin.js $fsx.f[86] = (module, exports) => { "use strict"; Object.defineProperty(exports, "__esModule", { value: true }); const TweenLite_js_1 = $fsx.r(80); exports.RoundPropsPlugin = TweenLite_js_1._gsScope._gsDefine.plugin({
propName: "roundProps",
version: "1.7.0",
priority: -1,
API: 2,
init: function (target, value, tween) {
this._tween = tween;
return true;
}
}), exports._getRoundFunc = function (v) {
var p = v < 1 ? Math.pow(10, (v + "").length - 2) : 1;
return function (n) {
return ((Math.round(n / v) * v * p) | 0) / p;
};
}, exports._roundLinkedList = function (node, mod) {
while (node) {
if (!node.f && !node.blob) {
node.m = mod || Math.round;
}
node = node._next;
}
}, exports.p = exports.RoundPropsPlugin.prototype; exports.default = exports.RoundPropsPlugin; exports.p._onInitAllProps = function () {
var tween = this._tween, rp = tween.vars.roundProps, lookup = {}, rpt = tween._propLookup.roundProps, pt, next, i, p;
if (typeof (rp) === "object" && !rp.push) {
for (p in rp) {
lookup[p] = exports._getRoundFunc(rp[p]);
}
}
else {
if (typeof (rp) === "string") {
rp = rp.split(",");
}
i = rp.length;
while (--i > -1) {
lookup[rp[i]] = Math.round;
}
}
for (p in lookup) {
pt = tween._firstPT;
while (pt) {
next = pt._next;
if (pt.pg) {
pt.t._mod(lookup);
}
else if (pt.n === p) {
if (pt.f === 2 && pt.t) {
exports._roundLinkedList(pt.t._firstPT, lookup[p]);
}
else {
this._add(pt.t, p, pt.s, pt.c, lookup[p]);
if (next) {
next._prev = pt._prev;
}
if (pt._prev) {
pt._prev._next = next;
}
else if (tween._firstPT === pt) {
tween._firstPT = next;
}
pt._next = pt._prev = null;
tween._propLookup[p] = rpt;
}
}
pt = next;
}
}
return false;
}; exports.p._add = function (target, p, s, c, mod) {
this._addTween(target, p, s, s + c, p, mod || Math.round); this._overwriteProps.push(p);
};
} // gsap/DirectionalRotationPlugin.js $fsx.f[87] = (module, exports) => { "use strict"; Object.defineProperty(exports, "__esModule", { value: true }); const TweenLite_js_1 = $fsx.r(80); exports.DirectionalRotationPlugin = TweenLite_js_1._gsScope._gsDefine.plugin({
propName: "directionalRotation",
version: "0.3.1",
API: 2,
init: function (target, value, tween, index) {
if (typeof (value) !== "object") {
value = { rotation: value };
}
this.finals = {};
var cap = (value.useRadians === true) ? Math.PI * 2 : 360, min = 0.000001, p, v, start, end, dif, split;
for (p in value) {
if (p !== "useRadians") {
end = value[p];
if (typeof (end) === "function") {
end = end(index, target);
}
split = (end + "").split("_");
v = split[0];
start = parseFloat((typeof (target[p]) !== "function") ? target[p] : target[((p.indexOf("set") || typeof (target["get" + p.substr(3)]) !== "function") ? p : "get" + p.substr(3))]());
end = this.finals[p] = (typeof (v) === "string" && v.charAt(1) === "=") ? start + parseInt(v.charAt(0) + "1", 10) * Number(v.substr(2)) : Number(v) || 0;
dif = end - start;
if (split.length) {
v = split.join("_");
if (v.indexOf("short") !== -1) {
dif = dif % cap;
if (dif !== dif % (cap / 2)) {
dif = (dif < 0) ? dif + cap : dif - cap;
}
}
if (v.indexOf("_cw") !== -1 && dif < 0) {
dif = ((dif + cap * 9999999999) % cap) - ((dif / cap) | 0) * cap;
}
else if (v.indexOf("ccw") !== -1 && dif > 0) {
dif = ((dif - cap * 9999999999) % cap) - ((dif / cap) | 0) * cap;
}
}
if (dif > min || dif < -min) {
this._addTween(target, p, start, start + dif, p);
this._overwriteProps.push(p);
}
}
}
return true;
},
set: function (ratio) {
var pt;
if (ratio !== 1) {
this._super.setRatio.call(this, ratio);
}
else {
pt = this._firstPT;
while (pt) {
if (pt.f) {
pt.t[pt.p](this.finals[pt.p]);
}
else {
pt.t[pt.p] = this.finals[pt.p];
}
pt = pt._next;
}
}
}
}); exports.default = exports.DirectionalRotationPlugin; exports.DirectionalRotationPlugin._autoCSS = true;
} // gsap/BezierPlugin.js $fsx.f[88] = (module, exports) => { "use strict"; Object.defineProperty(exports, "__esModule", { value: true }); const TweenLite_js_1 = $fsx.r(80); var _RAD2DEG = 180 / Math.PI, _r1 = [], _r2 = [], _r3 = [], _corProps = {}, _globals = TweenLite_js_1._gsScope._gsDefine.globals, Segment = function (a, b, c, d) {
if (c === d) {
c = d - (d - b) / 1000000;
}
if (a === b) {
b = a + (c - a) / 1000000;
}
this.a = a;
this.b = b;
this.c = c;
this.d = d;
this.da = d - a;
this.ca = c - a;
this.ba = b - a;
}, _correlate = ",x,y,z,left,top,right,bottom,marginTop,marginLeft,marginRight,marginBottom,paddingLeft,paddingTop,paddingRight,paddingBottom,backgroundPosition,backgroundPosition_y,", cubicToQuadratic = function (a, b, c, d) {
var q1 = { a: a }, q2 = {}, q3 = {}, q4 = { c: d }, mab = (a + b) / 2, mbc = (b + c) / 2, mcd = (c + d) / 2, mabc = (mab + mbc) / 2, mbcd = (mbc + mcd) / 2, m8 = (mbcd - mabc) / 8;
q1.b = mab + (a - mab) / 4;
q2.b = mabc + m8;
q1.c = q2.a = (q1.b + q2.b) / 2;
q2.c = q3.a = (mabc + mbcd) / 2;
q3.b = mbcd - m8;
q4.b = mcd + (d - mcd) / 4;
q3.c = q4.a = (q3.b + q4.b) / 2;
return [q1, q2, q3, q4];
}, _calculateControlPoints = function (a, curviness, quad, basic, correlate) {
var l = a.length - 1, ii = 0, cp1 = a[0].a, i, p1, p2, p3, seg, m1, m2, mm, cp2, qb, r1, r2, tl;
for (i = 0; i < l; i++) {
seg = a[ii];
p1 = seg.a;
p2 = seg.d;
p3 = a[ii + 1].d;
if (correlate) {
r1 = _r1[i];
r2 = _r2[i];
tl = ((r2 + r1) * curviness * 0.25) / (basic ? 0.5 : _r3[i] || 0.5);
m1 = p2 - (p2 - p1) * (basic ? curviness * 0.5 : (r1 !== 0 ? tl / r1 : 0));
m2 = p2 + (p3 - p2) * (basic ? curviness * 0.5 : (r2 !== 0 ? tl / r2 : 0));
mm = p2 - (m1 + (((m2 - m1) * ((r1 * 3 / (r1 + r2)) + 0.5) / 4) || 0));
}
else {
m1 = p2 - (p2 - p1) * curviness * 0.5;
m2 = p2 + (p3 - p2) * curviness * 0.5;
mm = p2 - (m1 + m2) / 2;
}
m1 += mm;
m2 += mm;
seg.c = cp2 = m1;
if (i !== 0) {
seg.b = cp1;
}
else {
seg.b = cp1 = seg.a + (seg.c - seg.a) * 0.6;
}
seg.da = p2 - p1;
seg.ca = cp2 - p1;
seg.ba = cp1 - p1;
if (quad) {
qb = cubicToQuadratic(p1, cp1, cp2, p2);
a.splice(ii, 1, qb[0], qb[1], qb[2], qb[3]);
ii += 4;
}
else {
ii++;
}
cp1 = m2;
}
seg = a[ii];
seg.b = cp1;
seg.c = cp1 + (seg.d - cp1) * 0.4;
seg.da = seg.d - seg.a;
seg.ca = seg.c - seg.a;
seg.ba = cp1 - seg.a;
if (quad) {
qb = cubicToQuadratic(seg.a, cp1, seg.c, seg.d);
a.splice(ii, 1, qb[0], qb[1], qb[2], qb[3]);
}
}, _parseAnchors = function (values, p, correlate, prepend) {
var a = [], l, i, p1, p2, p3, tmp;
if (prepend) {
values = [prepend].concat(values);
i = values.length;
while (--i > -1) {
if (typeof ((tmp = values[i][p])) === "string")
if (tmp.charAt(1) === "=") {
values[i][p] = prepend[p] + Number(tmp.charAt(0) + tmp.substr(2));
}
}
}
l = values.length - 2;
if (l < 0) {
a[0] = new Segment(values[0][p], 0, 0, values[0][p]);
return a;
}
for (i = 0; i < l; i++) {
p1 = values[i][p];
p2 = values[i + 1][p];
a[i] = new Segment(p1, 0, 0, p2);
if (correlate) {
p3 = values[i + 2][p];
_r1[i] = (_r1[i] || 0) + (p2 - p1) * (p2 - p1);
_r2[i] = (_r2[i] || 0) + (p3 - p2) * (p3 - p2);
}
}
a[i] = new Segment(values[i][p], 0, 0, values[i + 1][p]);
return a;
}, bezierThrough = function (values, curviness, quadratic, basic, correlate, prepend) {
var obj = {}, props = [], first = prepend || values[0], i, p, a, j, r, l, seamless, last;
correlate = (typeof (correlate) === "string") ? "," + correlate + "," : _correlate;
if (curviness == null) {
curviness = 1;
}
for (p in values[0]) {
props.push(p);
}
if (values.length > 1) {
last = values[values.length - 1];
seamless = true;
i = props.length;
while (--i > -1) {
p = props[i];
if (Math.abs(first[p] - last[p]) > 0.05) {
seamless = false;
break;
}
}
if (seamless) {
values = values.concat();
if (prepend) {
values.unshift(prepend);
}
values.push(values[1]);
prepend = values[values.length - 3];
}
}
_r1.length = _r2.length = _r3.length = 0;
i = props.length;
while (--i > -1) {
p = props[i];
_corProps[p] = (correlate.indexOf("," + p + ",") !== -1);
obj[p] = _parseAnchors(values, p, _corProps[p], prepend);
}
i = _r1.length;
while (--i > -1) {
_r1[i] = Math.sqrt(_r1[i]);
_r2[i] = Math.sqrt(_r2[i]);
}
if (!basic) {
i = props.length;
while (--i > -1) {
if (_corProps[p]) {
a = obj[props[i]];
l = a.length - 1;
for (j = 0; j < l; j++) {
r = (a[j + 1].da / _r2[j] + a[j].da / _r1[j]) || 0;
_r3[j] = (_r3[j] || 0) + r * r;
}
}
}
i = _r3.length;
while (--i > -1) {
_r3[i] = Math.sqrt(_r3[i]);
}
}
i = props.length;
j = quadratic ? 4 : 1;
while (--i > -1) {
p = props[i];
a = obj[p];
_calculateControlPoints(a, curviness, quadratic, basic, _corProps[p]);
if (seamless) {
a.splice(0, j);
a.splice(a.length - j, j);
}
}
return obj;
}, _parseBezierData = function (values, type, prepend) {
type = type || "soft";
var obj = {}, inc = (type === "cubic") ? 3 : 2, soft = (type === "soft"), props = [], a, b, c, d, cur, i, j, l, p, cnt, tmp;
if (soft && prepend) {
values = [prepend].concat(values);
}
if (values == null || values.length < inc + 1) {
throw "invalid Bezier data";
}
for (p in values[0]) {
props.push(p);
}
i = props.length;
while (--i > -1) {
p = props[i];
obj[p] = cur = [];
cnt = 0;
l = values.length;
for (j = 0; j < l; j++) {
a = (prepend == null) ? values[j][p] : (typeof ((tmp = values[j][p])) === "string" && tmp.charAt(1) === "=") ? prepend[p] + Number(tmp.charAt(0) + tmp.substr(2)) : Number(tmp);
if (soft)
if (j > 1)
if (j < l - 1) {
cur[cnt++] = (a + cur[cnt - 2]) / 2;
}
cur[cnt++] = a;
}
l = cnt - inc + 1;
cnt = 0;
for (j = 0; j < l; j += inc) {
a = cur[j];
b = cur[j + 1];
c = cur[j + 2];
d = (inc === 2) ? 0 : cur[j + 3];
cur[cnt++] = tmp = (inc === 3) ? new Segment(a, b, c, d) : new Segment(a, (2 * b + a) / 3, (2 * b + c) / 3, c);
}
cur.length = cnt;
}
return obj;
}, _addCubicLengths = function (a, steps, resolution) {
var inc = 1 / resolution, j = a.length, d, d1, s, da, ca, ba, p, i, inv, bez, index;
while (--j > -1) {
bez = a[j];
s = bez.a;
da = bez.d - s;
ca = bez.c - s;
ba = bez.b - s;
d = d1 = 0;
for (i = 1; i <= resolution; i++) {
p = inc * i;
inv = 1 - p;
d = d1 - (d1 = (p * p * da + 3 * inv * (p * ca + inv * ba)) * p);
index = j * resolution + i - 1;
steps[index] = (steps[index] || 0) + d * d;
}
}
}, _parseLengthData = function (obj, resolution) {
resolution = resolution >> 0 || 6;
var a = [], lengths = [], d = 0, total = 0, threshold = resolution - 1, segments = [], curLS = [], p, i, l, index;
for (p in obj) {
_addCubicLengths(obj[p], a, resolution);
}
l = a.length;
for (i = 0; i < l; i++) {
d += Math.sqrt(a[i]);
index = i % resolution;
curLS[index] = d;
if (index === threshold) {
total += d;
index = (i / resolution) >> 0;
segments[index] = curLS;
lengths[index] = total;
d = 0;
curLS = [];
}
}
return { length: total, lengths: lengths, segments: segments };
}, BezierPlugin = TweenLite_js_1._gsScope._gsDefine.plugin({
propName: "bezier",
priority: -1,
version: "1.3.9",
API: 2,
global: true,
init: function (target, vars, tween) {
this._target = target;
if (vars instanceof Array) {
vars = { values: vars };
}
this._func = {};
this._mod = {};
this._props = [];
this._timeRes = (vars.timeResolution == null) ? 6 : parseInt(vars.timeResolution, 10);
var values = vars.values || [], first = {}, second = values[0], autoRotate = vars.autoRotate || tween.vars.orientToBezier, p, isFunc, i, j, prepend;
this._autoRotate = autoRotate ? (autoRotate instanceof Array) ? autoRotate : | 0) : null;
for (p in second) {
this._props.push(p);
}
i = this._props.length;
while (--i > -1) {
p = this._props[i];
this._overwriteProps.push(p);
isFunc = this._func[p] = (typeof (target[p]) === "function");
first[p] = (!isFunc) ? parseFloat(target[p]) : target[((p.indexOf("set") || typeof (target["get" + p.substr(3)]) !== "function") ? p : "get" + p.substr(3))]();
if (!prepend)
if (first[p] !== values[0][p]) {
prepend = first;
}
}
this._beziers = (vars.type !== "cubic" && vars.type !== "quadratic" && vars.type !== "soft") ? bezierThrough(values, isNaN(vars.curviness) ? 1 : vars.curviness, false, (vars.type === "thruBasic"), vars.correlate, prepend) : _parseBezierData(values, vars.type, first);
this._segCount = this._beziers[p].length;
if (this._timeRes) {
var ld = _parseLengthData(this._beziers, this._timeRes);
this._length = ld.length;
this._lengths = ld.lengths;
this._segments = ld.segments;
this._l1 = this._li = this._s1 = this._si = 0;
this._l2 = this._lengths[0];
this._curSeg = this._segments[0];
this._s2 = this._curSeg[0];
this._prec = 1 / this._curSeg.length;
}
if ((autoRotate = this._autoRotate)) {
this._initialRotations = [];
if (!(autoRotate[0] instanceof Array)) {
this._autoRotate = autoRotate = [autoRotate];
}
i = autoRotate.length;
while (--i > -1) {
for (j = 0; j < 3; j++) {
p = autoRotate[i][j];
this._func[p] = (typeof (target[p]) === "function") ? target[((p.indexOf("set") || typeof (target["get" + p.substr(3)]) !== "function") ? p : "get" + p.substr(3))] : false;
}
p = autoRotate[i][2];
this._initialRotations[i] = (this._func[p] ? this._func[p].call(this._target) : this._target[p]) || 0;
this._overwriteProps.push(p);
}
}
this._startRatio = tween.vars.runBackwards ? 1 : 0;
return true;
},
set: function (v) {
var segments = this._segCount, func = this._func, target = this._target, notStart = (v !== this._startRatio), curIndex, inv, i, p, b, t, val, l, lengths, curSeg, v1;
if (!this._timeRes) {
curIndex = (v < 0) ? 0 : (v >= 1) ? segments - 1 : (segments * v) >> 0;
t = (v - (curIndex * (1 / segments))) * segments;
}
else {
lengths = this._lengths;
curSeg = this._curSeg;
v1 = v * this._length;
i = this._li;
if (v1 > this._l2 && i < segments - 1) {
l = segments - 1;
while (i < l && (this._l2 = lengths[++i]) <= v1) { }
this._l1 = lengths[i - 1];
this._li = i;
this._curSeg = curSeg = this._segments[i];
this._s2 = curSeg[(this._s1 = this._si = 0)];
}
else if (v1 < this._l1 && i > 0) {
while (i > 0 && (this._l1 = lengths[--i]) >= v1) { }
if (i === 0 && v1 < this._l1) {
this._l1 = 0;
}
else {
i++;
}
this._l2 = lengths[i];
this._li = i;
this._curSeg = curSeg = this._segments[i];
this._s1 = curSeg[(this._si = curSeg.length - 1) - 1] || 0;
this._s2 = curSeg[this._si];
}
curIndex = i;
v1 -= this._l1;
i = this._si;
if (v1 > this._s2 && i < curSeg.length - 1) {
l = curSeg.length - 1;
while (i < l && (this._s2 = curSeg[++i]) <= v1) { }
this._s1 = curSeg[i - 1];
this._si = i;
}
else if (v1 < this._s1 && i > 0) {
while (i > 0 && (this._s1 = curSeg[--i]) >= v1) { }
if (i === 0 && v1 < this._s1) {
this._s1 = 0;
}
else {
i++;
}
this._s2 = curSeg[i];
this._si = i;
}
t = (v === 1) ? 1 : ((i + (v1 - this._s1) / (this._s2 - this._s1)) * this._prec) || 0;
}
inv = 1 - t;
i = this._props.length;
while (--i > -1) {
p = this._props[i];
b = this._beziers[p][curIndex];
val = (t * t * b.da + 3 * inv * (t * b.ca + inv * b.ba)) * t + b.a;
if (this._mod[p]) {
val = this._mod[p](val, target);
}
if (func[p]) {
target[p](val);
}
else {
target[p] = val;
}
}
if (this._autoRotate) {
var ar = this._autoRotate, b2, x1, y1, x2, y2, add, conv;
i = ar.length;
while (--i > -1) {
p = ar[i][2];
add = ar[i][3] || 0;
conv = (ar[i][4] === true) ? 1 : _RAD2DEG;
b = this._beziers[ar[i][0]];
b2 = this._beziers[ar[i][1]];
if (b && b2) {
b = b[curIndex];
b2 = b2[curIndex];
x1 = b.a + (b.b - b.a) * t;
x2 = b.b + (b.c - b.b) * t;
x1 += (x2 - x1) * t;
x2 += ((b.c + (b.d - b.c) * t) - x2) * t;
y1 = b2.a + (b2.b - b2.a) * t;
y2 = b2.b + (b2.c - b2.b) * t;
y1 += (y2 - y1) * t;
y2 += ((b2.c + (b2.d - b2.c) * t) - y2) * t;
val = notStart ? Math.atan2(y2 - y1, x2 - x1) * conv + add : this._initialRotations[i];
if (this._mod[p]) {
val = this._mod[p](val, target);
}
if (func[p]) {
target[p](val);
}
else {
target[p] = val;
}
}
}
}
}
}), p = BezierPlugin.prototype; exports.BezierPlugin = BezierPlugin; exports.default = BezierPlugin; BezierPlugin.bezierThrough = bezierThrough; BezierPlugin.cubicToQuadratic = cubicToQuadratic; BezierPlugin._autoCSS = true; BezierPlugin.quadraticToCubic = function (a, b, c) {
return new Segment(a, (2 * b + a) / 3, (2 * b + c) / 3, c);
}; BezierPlugin._cssRegister = function () {
var CSSPlugin = _globals.CSSPlugin;
if (!CSSPlugin) {
return;
}
var _internals = CSSPlugin._internals, _parseToProxy = _internals._parseToProxy, _setPluginRatio = _internals._setPluginRatio, CSSPropTween = _internals.CSSPropTween;
_internals._registerComplexSpecialProp("bezier", { parser: function (t, e, prop, cssp, pt, plugin) {
if (e instanceof Array) {
e = { values: e };
}
plugin = new BezierPlugin();
var values = e.values, l = values.length - 1, pluginValues = [], v = {}, i, p, data;
if (l < 0) {
return pt;
}
for (i = 0; i <= l; i++) {
data = _parseToProxy(t, values[i], cssp, pt, plugin, (l !== i));
pluginValues[i] = data.end;
}
for (p in e) {
v[p] = e[p];
}
v.values = pluginValues;
pt = new CSSPropTween(t, "bezier", 0, 0, data.pt, 2);
pt.data = data;
pt.plugin = plugin;
pt.setRatio = _setPluginRatio;
if (v.autoRotate === 0) {
v.autoRotate = true;
}
if (v.autoRotate && !(v.autoRotate instanceof Array)) {
i = (v.autoRotate === true) ? 0 : Number(v.autoRotate);
v.autoRotate = (data.end.left != null) ? "left", "top", "rotation", i, false : (data.end.x != null) ? "x", "y", "rotation", i, false : false;
}
if (v.autoRotate) {
if (!cssp._transform) {
cssp._enableTransforms(false);
}
data.autoRotate = cssp._target._gsTransform;
data.proxy.rotation = data.autoRotate.rotation || 0;
cssp._overwriteProps.push("rotation");
}
plugin._onInitTween(data.proxy, v, cssp._tween);
return pt;
} });
}; p._mod = function (lookup) {
var op = this._overwriteProps, i = op.length, val;
while (--i > -1) {
val = lookup[op[i]];
if (val && typeof (val) === "function") {
this._mod[op[i]] = val;
}
}
}; p._kill = function (lookup) {
var a = this._props, p, i;
for (p in this._beziers) {
if (p in lookup) {
delete this._beziers[p];
delete this._func[p];
i = a.length;
while (--i > -1) {
if (a[i] === p) {
a.splice(i, 1);
}
}
}
}
a = this._autoRotate;
if (a) {
i = a.length;
while (--i > -1) {
if (lookup[a[i][2]]) {
a.splice(i, 1);
}
}
}
return this._super._kill.call(this, lookup);
};
} // gsap/EasePack.js $fsx.f[89] = (module, exports) => { "use strict"; Object.defineProperty(exports, "__esModule", { value: true }); const TweenLite_js_1 = $fsx.r(80); exports.Linear = TweenLite_js_1.Linear; exports.Power0 = TweenLite_js_1.Power0; exports.Power1 = TweenLite_js_1.Power1; exports.Power2 = TweenLite_js_1.Power2; exports.Power3 = TweenLite_js_1.Power3; exports.Power4 = TweenLite_js_1.Power4; TweenLite_js_1._gsScope._gsDefine("easing.Back", ["easing.Ease"], function () {
var w = (TweenLite_js_1._gsScope.GreenSockGlobals || TweenLite_js_1._gsScope), gs = w.com.greensock, _2PI = Math.PI * 2, _HALF_PI = Math.PI / 2, _class = gs._class, _create = function (n, f) {
var C = _class("easing." + n, function () { }, true), p = C.prototype = new TweenLite_js_1.Ease();
p.constructor = C;
p.getRatio = f;
return C;
}, _easeReg = TweenLite_js_1.Ease.register || function () { }, _wrap = function (name, EaseOut, EaseIn, EaseInOut, aliases) {
var C = _class("easing." + name, {
easeOut: new EaseOut(),
easeIn: new EaseIn(),
easeInOut: new EaseInOut()
}, true);
_easeReg(C, name);
return C;
}, EasePoint = function (time, value, next) {
this.t = time;
this.v = value;
if (next) {
this.next = next;
next.prev = this;
this.c = next.v - value;
this.gap = next.t - time;
}
}, _createBack = function (n, f) {
var C = _class("easing." + n, function (overshoot) {
this._p1 = (overshoot || overshoot === 0) ? overshoot : 1.70158;
this._p2 = this._p1 * 1.525;
}, true), p = C.prototype = new TweenLite_js_1.Ease();
p.constructor = C;
p.getRatio = f;
p.config = function (overshoot) {
return new C(overshoot);
};
return C;
}, Back = _wrap("Back", _createBack("BackOut", function (p) {
return ((p = p - 1) * p * ((this._p1 + 1) * p + this._p1) + 1);
}), _createBack("BackIn", function (p) {
return p * p * ((this._p1 + 1) * p - this._p1);
}), _createBack("BackInOut", function (p) {
return ((p *= 2) < 1) ? 0.5 * p * p * ((this._p2 + 1) * p - this._p2) : 0.5 * ((p -= 2) * p * ((this._p2 + 1) * p + this._p2) + 2);
})), SlowMo = _class("easing.SlowMo", function (linearRatio, power, yoyoMode) {
power = (power || power === 0) ? power : 0.7;
if (linearRatio == null) {
linearRatio = 0.7;
}
else if (linearRatio > 1) {
linearRatio = 1;
}
this._p = (linearRatio !== 1) ? power : 0;
this._p1 = (1 - linearRatio) / 2;
this._p2 = linearRatio;
this._p3 = this._p1 + this._p2;
this._calcEnd = (yoyoMode === true);
}, true), p = SlowMo.prototype = new TweenLite_js_1.Ease(), SteppedEase, ExpoScaleEase, RoughEase, _createElastic;
p.constructor = SlowMo;
p.getRatio = function (p) {
var r = p + (0.5 - p) * this._p;
if (p < this._p1) {
return this._calcEnd ? 1 - ((p = 1 - (p / this._p1)) * p) : r - ((p = 1 - (p / this._p1)) * p * p * p * r);
}
else if (p > this._p3) {
return this._calcEnd ? (p === 1 ? 0 : 1 - (p = (p - this._p3) / this._p1) * p) : r + ((p - r) * (p = (p - this._p3) / this._p1) * p * p * p);
}
return this._calcEnd ? 1 : r;
};
SlowMo.ease = new SlowMo(0.7, 0.7);
p.config = SlowMo.config = function (linearRatio, power, yoyoMode) {
return new SlowMo(linearRatio, power, yoyoMode);
};
SteppedEase = _class("easing.SteppedEase", function (steps, immediateStart) {
steps = steps || 1;
this._p1 = 1 / steps;
this._p2 = steps + (immediateStart ? 0 : 1);
this._p3 = immediateStart ? 1 : 0;
}, true);
p = SteppedEase.prototype = new TweenLite_js_1.Ease();
p.constructor = SteppedEase;
p.getRatio = function (p) {
if (p < 0) {
p = 0;
}
else if (p >= 1) {
p = 0.999999999;
}
return (((this._p2 * p) | 0) + this._p3) * this._p1;
};
p.config = SteppedEase.config = function (steps, immediateStart) {
return new SteppedEase(steps, immediateStart);
};
ExpoScaleEase = _class("easing.ExpoScaleEase", function (start, end, ease) {
this._p1 = Math.log(end / start);
this._p2 = end - start;
this._p3 = start;
this._ease = ease;
}, true);
p = ExpoScaleEase.prototype = new TweenLite_js_1.Ease();
p.constructor = ExpoScaleEase;
p.getRatio = function (p) {
if (this._ease) {
p = this._ease.getRatio(p);
}
return (this._p3 * Math.exp(this._p1 * p) - this._p3) / this._p2;
};
p.config = ExpoScaleEase.config = function (start, end, ease) {
return new ExpoScaleEase(start, end, ease);
};
RoughEase = _class("easing.RoughEase", function (vars) {
vars = vars || {};
var taper = vars.taper || "none", a = [], cnt = 0, points = (vars.points || 20) | 0, i = points, randomize = (vars.randomize !== false), clamp = (vars.clamp === true), template = (vars.template instanceof TweenLite_js_1.Ease) ? vars.template : null, strength = (typeof (vars.strength) === "number") ? vars.strength * 0.4 : 0.4, x, y, bump, invX, obj, pnt;
while (--i > -1) {
x = randomize ? Math.random() : (1 / points) * i;
y = template ? template.getRatio(x) : x;
if (taper === "none") {
bump = strength;
}
else if (taper === "out") {
invX = 1 - x;
bump = invX * invX * strength;
}
else if (taper === "in") {
bump = x * x * strength;
}
else if (x < 0.5) {
invX = x * 2;
bump = invX * invX * 0.5 * strength;
}
else {
invX = (1 - x) * 2;
bump = invX * invX * 0.5 * strength;
}
if (randomize) {
y += (Math.random() * bump) - (bump * 0.5);
}
else if (i % 2) {
y += bump * 0.5;
}
else {
y -= bump * 0.5;
}
if (clamp) {
if (y > 1) {
y = 1;
}
else if (y < 0) {
y = 0;
}
}
a[cnt++] = { x: x, y: y };
}
a.sort(function (a, b) {
return a.x - b.x;
});
pnt = new EasePoint(1, 1, null);
i = points;
while (--i > -1) {
obj = a[i];
pnt = new EasePoint(obj.x, obj.y, pnt);
}
this._prev = new EasePoint(0, 0, (pnt.t !== 0) ? pnt : pnt.next);
}, true);
p = RoughEase.prototype = new TweenLite_js_1.Ease();
p.constructor = RoughEase;
p.getRatio = function (p) {
var pnt = this._prev;
if (p > pnt.t) {
while (pnt.next && p >= pnt.t) {
pnt = pnt.next;
}
pnt = pnt.prev;
}
else {
while (pnt.prev && p <= pnt.t) {
pnt = pnt.prev;
}
}
this._prev = pnt;
return (pnt.v + ((p - pnt.t) / pnt.gap) * pnt.c);
};
p.config = function (vars) {
return new RoughEase(vars);
};
RoughEase.ease = new RoughEase();
_wrap("Bounce", _create("BounceOut", function (p) {
if (p < 1 / 2.75) {
return 7.5625 * p * p;
}
else if (p < 2 / 2.75) {
return 7.5625 * (p -= 1.5 / 2.75) * p + 0.75;
}
else if (p < 2.5 / 2.75) {
return 7.5625 * (p -= 2.25 / 2.75) * p + 0.9375;
}
return 7.5625 * (p -= 2.625 / 2.75) * p + 0.984375;
}), _create("BounceIn", function (p) {
if ((p = 1 - p) < 1 / 2.75) {
return 1 - (7.5625 * p * p);
}
else if (p < 2 / 2.75) {
return 1 - (7.5625 * (p -= 1.5 / 2.75) * p + 0.75);
}
else if (p < 2.5 / 2.75) {
return 1 - (7.5625 * (p -= 2.25 / 2.75) * p + 0.9375);
}
return 1 - (7.5625 * (p -= 2.625 / 2.75) * p + 0.984375);
}), _create("BounceInOut", function (p) {
var invert = (p < 0.5);
if (invert) {
p = 1 - (p * 2);
}
else {
p = (p * 2) - 1;
}
if (p < 1 / 2.75) {
p = 7.5625 * p * p;
}
else if (p < 2 / 2.75) {
p = 7.5625 * (p -= 1.5 / 2.75) * p + 0.75;
}
else if (p < 2.5 / 2.75) {
p = 7.5625 * (p -= 2.25 / 2.75) * p + 0.9375;
}
else {
p = 7.5625 * (p -= 2.625 / 2.75) * p + 0.984375;
}
return invert ? (1 - p) * 0.5 : p * 0.5 + 0.5;
}));
_wrap("Circ", _create("CircOut", function (p) {
return Math.sqrt(1 - (p = p - 1) * p);
}), _create("CircIn", function (p) {
return -(Math.sqrt(1 - (p * p)) - 1);
}), _create("CircInOut", function (p) {
return ((p *= 2) < 1) ? -0.5 * (Math.sqrt(1 - p * p) - 1) : 0.5 * (Math.sqrt(1 - (p -= 2) * p) + 1);
}));
_createElastic = function (n, f, def) {
var C = _class("easing." + n, function (amplitude, period) {
this._p1 = (amplitude >= 1) ? amplitude : 1;
this._p2 = (period || def) / (amplitude < 1 ? amplitude : 1);
this._p3 = this._p2 / _2PI * (Math.asin(1 / this._p1) || 0);
this._p2 = _2PI / this._p2;
}, true), p = C.prototype = new TweenLite_js_1.Ease();
p.constructor = C;
p.getRatio = f;
p.config = function (amplitude, period) {
return new C(amplitude, period);
};
return C;
};
_wrap("Elastic", _createElastic("ElasticOut", function (p) {
return this._p1 * Math.pow(2, -10 * p) * Math.sin((p - this._p3) * this._p2) + 1;
}, 0.3), _createElastic("ElasticIn", function (p) {
return -(this._p1 * Math.pow(2, 10 * (p -= 1)) * Math.sin((p - this._p3) * this._p2));
}, 0.3), _createElastic("ElasticInOut", function (p) {
return ((p *= 2) < 1) ? -0.5 * (this._p1 * Math.pow(2, 10 * (p -= 1)) * Math.sin((p - this._p3) * this._p2)) : this._p1 * Math.pow(2, -10 * (p -= 1)) * Math.sin((p - this._p3) * this._p2) * 0.5 + 1;
}, 0.45));
_wrap("Expo", _create("ExpoOut", function (p) {
return 1 - Math.pow(2, -10 * p);
}), _create("ExpoIn", function (p) {
return Math.pow(2, 10 * (p - 1)) - 0.001;
}), _create("ExpoInOut", function (p) {
return ((p *= 2) < 1) ? 0.5 * Math.pow(2, 10 * (p - 1)) : 0.5 * (2 - Math.pow(2, -10 * (p - 1)));
}));
_wrap("Sine", _create("SineOut", function (p) {
return Math.sin(p * _HALF_PI);
}), _create("SineIn", function (p) {
return -Math.cos(p * _HALF_PI) + 1;
}), _create("SineInOut", function (p) {
return -0.5 * (Math.cos(Math.PI * p) - 1);
}));
_class("easing.EaseLookup", {
find: function (s) {
return TweenLite_js_1.Ease.map[s];
}
}, true);
_easeReg(w.SlowMo, "SlowMo", "ease,");
_easeReg(RoughEase, "RoughEase", "ease,");
_easeReg(SteppedEase, "SteppedEase", "ease,");
return Back;
}, true); exports.Back = TweenLite_js_1.globals.Back; exports.Elastic = TweenLite_js_1.globals.Elastic; exports.Bounce = TweenLite_js_1.globals.Bounce; exports.RoughEase = TweenLite_js_1.globals.RoughEase; exports.SlowMo = TweenLite_js_1.globals.SlowMo; exports.SteppedEase = TweenLite_js_1.globals.SteppedEase; exports.Circ = TweenLite_js_1.globals.Circ; exports.Expo = TweenLite_js_1.globals.Expo; exports.Sine = TweenLite_js_1.globals.Sine; exports.ExpoScaleEase = TweenLite_js_1.globals.ExpoScaleEase;
} // react-blob/dist/index.es.js $fsx.f[101] = (module, exports) => { "use strict"; Object.defineProperty(exports, "__esModule", { value: true }); function __$styleInject(css, ref) {
if (ref === void 0)
ref = {};
var insertAt = ref.insertAt;
if (!css || typeof document === 'undefined') {
return;
}
var head = document.head || document.getElementsByTagName('head')[0];
var style = document.createElement('style');
style.type = 'text/css';
if (insertAt === 'top') {
if (head.firstChild) {
head.insertBefore(style, head.firstChild);
}
else {
head.appendChild(style);
}
}
else {
head.appendChild(style);
}
if (style.styleSheet) {
style.styleSheet.cssText = css;
}
else {
style.appendChild(document.createTextNode(css));
}
} const react_1 = $fsx.r(3); const styled_components_1 = $fsx.r(100); var extendStatics = function (d, b) {
extendStatics = Object.setPrototypeOf ||
({ __proto__: [] } instanceof Array && function (d, b) { d.__proto__ = b; }) ||
function (d, b) { for (var p in b)
if (b.hasOwnProperty(p))
d[p] = b[p]; };
return extendStatics(d, b);
}; function __extends(d, b) {
extendStatics(d, b);
function __() { this.constructor = d; }
d.prototype = b === null ? Object.create(b) : (__.prototype = b.prototype, new __());
} var __assign = function () {
__assign = Object.assign || function __assign(t) {
for (var s, i = 1, n = arguments.length; i < n; i++) {
s = arguments[i];
for (var p in s)
if (Object.prototype.hasOwnProperty.call(s, p))
t[p] = s[p];
}
return t;
};
return __assign.apply(this, arguments);
}; function __rest(s, e) {
var t = {};
for (var p in s)
if (Object.prototype.hasOwnProperty.call(s, p) && e.indexOf(p) < 0)
t[p] = s[p];
if (s != null && typeof Object.getOwnPropertySymbols === "function")
for (var i = 0, p = Object.getOwnPropertySymbols(s); i < p.length; i++)
if (e.indexOf(p[i]) < 0)
t[p[i]] = s[p[i]];
return t;
} function __makeTemplateObject(cooked, raw) {
if (Object.defineProperty) {
Object.defineProperty(cooked, "raw", { value: raw });
}
else {
cooked.raw = raw;
}
return cooked;
} var spin = styled_components_1.keyframes(templateObject_1 || (templateObject_1 = __makeTemplateObject(["\n to {\n transform: rotate(1turn);\n }\n"], ["\n to {\n transform: rotate(1turn);\n }\n"]))); var spinParams = '22s linear infinite'; var Shape = styled_components_1.default.div(templateObject_5 || (templateObject_5 = __makeTemplateObject(["\n transition: border-radius 1s ease-out;\n transform-origin: center;\n overflow: hidden;\n ", "\n ", "\n"], ["\n transition: border-radius 1s ease-out;\n transform-origin: center;\n overflow: hidden;\n ",
"\n ",
"\n"])), function (props) { return props.size && styled_components_1.css(templateObject_2 || (templateObject_2 = __makeTemplateObject(["\n width: ", ";\n height: ", ";\n "], ["\n width: ", ";\n height: ", ";\n "])), props.size, props.size); }, function (props) {
return styled_components_1.css(templateObject_4 || (templateObject_4 = __makeTemplateObject(["\n border-radius: ", ";\n animation: ", " ", "s ease-in-out infinite both alternate,\n ", " ", ";\n "], ["\n border-radius: ", ";\n animation: ",
" ", "s ease-in-out infinite both alternate,\n ", " ", ";\n "])), props.radius1, styled_components_1.keyframes(templateObject_3 || (templateObject_3 = __makeTemplateObject(["\n 0% {\n border-radius: ", ";\n }\n 100% {\n border-radius: ", ";\n }\n "], ["\n 0% {\n border-radius: ", ";\n }\n 100% {\n border-radius: ", ";\n }\n "])), props.radius1, props.radius2), Math.random() * 10 | 0 + 10, spin, spinParams);
}); var ShapeContent = styled_components_1.default.div(templateObject_6 || (templateObject_6 = __makeTemplateObject(["\n animation: ", " ", " reverse;\n transform-origin: center;\n height: 100%;\n width: 100%;\n display: flex;\n align-items: center;\n justify-content: center;\n"], ["\n animation: ", " ", " reverse;\n transform-origin: center;\n height: 100%;\n width: 100%;\n display: flex;\n align-items: center;\n justify-content: center;\n"])), spin, spinParams); var Image = styled_components_1.default.img(templateObject_7 || (templateObject_7 = __makeTemplateObject(["\n transform: scale(1.25);\n width: 100%;\n height: 100%;\n object-fit: cover;\n"], ["\n transform: scale(1.25);\n width: 100%;\n height: 100%;\n object-fit: cover;\n"]))); var randomRadiuses = function (x) { return new Array(x).fill(1).map(function () { return radiuses[Math.random() * radiuses.length | 0]; }).join(' '); }; var radiuses = ['70%', '60%', '50%', '40%', '55%', '45%']; var makeRadius1 = function () { return randomRadiuses(4) + ' / ' + randomRadiuses(4); }; var makeRadius2 = function () { return randomRadiuses(2); }; var Blob = (function (_super) {
__extends(Blob, _super);
function Blob() {
return _super !== null && _super.apply(this, arguments) || this;
}
Blob.prototype.render = function () {
var _a = this.props, src = _a.src, children = _a.children, size = _a.size, props = __rest(_a, ["src", "children", "size"]);
var radius1 = makeRadius1();
var radius2 = makeRadius2();
return (react_1.createElement(Shape, __assign({ size: size, radius1: radius1, radius2: radius2 }, props), react_1.createElement(ShapeContent, null, src ? react_1.createElement(Image, { src: src }) : children)));
};
return Blob;
}(react_1.PureComponent)); exports.Blob = Blob; var templateObject_1, templateObject_2, templateObject_3, templateObject_4, templateObject_5, templateObject_6, templateObject_7;
} // styled-components/dist/styled-components.browser.esm.js $fsx.f[100] = (module, exports) => { "use strict"; Object.defineProperty(exports, "__esModule", { value: true }); const stylis_min_1 = $fsx.r(92); const stylis_rule_sheet_1 = $fsx.r(93); const react_1 = $fsx.r(3); const unitless_1 = $fsx.r(94); const react_is_1 = $fsx.r(26); const memoize_one_1 = $fsx.r(95); const prop_types_1 = $fsx.r(13); const is_prop_valid_1 = $fsx.r(97); const merge_anything_1 = $fsx.r(99); var interleave = (function (strings, interpolations) {
var result = [strings[0]];
for (var i = 0, len = interpolations.length; i < len; i += 1) {
result.push(interpolations[i], strings[i + 1]);
}
return result;
}); var _typeof = typeof Symbol === "function" && typeof Symbol.iterator === "symbol" ? function (obj) {
return typeof obj;
} : function (obj) {
return obj && typeof Symbol === "function" && obj.constructor === Symbol && obj !== Symbol.prototype ? "symbol" : typeof obj;
}; var classCallCheck = function (instance, Constructor) {
if (!(instance instanceof Constructor)) {
throw new TypeError("Cannot call a class as a function");
}
}; var createClass = function () {
function defineProperties(target, props) {
for (var i = 0; i < props.length; i++) {
var descriptor = props[i];
descriptor.enumerable = descriptor.enumerable || false;
descriptor.configurable = true;
if ("value" in descriptor)
descriptor.writable = true;
Object.defineProperty(target, descriptor.key, descriptor);
}
}
return function (Constructor, protoProps, staticProps) {
if (protoProps)
defineProperties(Constructor.prototype, protoProps);
if (staticProps)
defineProperties(Constructor, staticProps);
return Constructor;
};
}(); var _extends = Object.assign || function (target) {
for (var i = 1; i < arguments.length; i++) {
var source = arguments[i];
for (var key in source) {
if (Object.prototype.hasOwnProperty.call(source, key)) {
target[key] = source[key];
}
}
}
return target;
}; var inherits = function (subClass, superClass) {
if (typeof superClass !== "function" && superClass !== null) {
throw new TypeError("Super expression must either be null or a function, not " + typeof superClass);
}
subClass.prototype = Object.create(superClass && superClass.prototype, {
constructor: {
value: subClass,
enumerable: false,
writable: true,
configurable: true
}
});
if (superClass)
Object.setPrototypeOf ? Object.setPrototypeOf(subClass, superClass) : subClass.__proto__ = superClass;
}; var objectWithoutProperties = function (obj, keys) {
var target = {};
for (var i in obj) {
if (keys.indexOf(i) >= 0)
continue;
if (!Object.prototype.hasOwnProperty.call(obj, i))
continue;
target[i] = obj[i];
}
return target;
}; var possibleConstructorReturn = function (self, call) {
if (!self) {
throw new ReferenceError("this hasn't been initialised - super() hasn't been called");
}
return call && (typeof call === "object" || typeof call === "function") ? call : self;
}; var isPlainObject = (function (x) {
return (typeof x === 'undefined' ? 'undefined' : _typeof(x)) === 'object' && x.constructor === Object;
}); var EMPTY_ARRAY = Object.freeze([]); var EMPTY_OBJECT = Object.freeze({}); function isFunction(test) {
return typeof test === 'function';
} function getComponentName(target) {
return ("production" !== 'production' ? typeof target === 'string' && target : false) || target.displayName || target.name || 'Component';
} function isStatelessFunction(test) {
return typeof test === 'function' && !(test.prototype && test.prototype.isReactComponent);
} function isStyledComponent(target) {
return target && typeof target.styledComponentId === 'string';
} exports.isStyledComponent = isStyledComponent; var SC_ATTR = typeof process !== 'undefined' && (undefined || undefined) || 'data-styled'; var SC_VERSION_ATTR = 'data-styled-version'; var SC_STREAM_ATTR = 'data-styled-streamed'; var IS_BROWSER = typeof window !== 'undefined' && 'HTMLElement' in window; var DISABLE_SPEEDY = typeof SC_DISABLE_SPEEDY === 'boolean' && SC_DISABLE_SPEEDY || typeof process !== 'undefined' && (undefined || undefined) || "production" !== 'production'; var STATIC_EXECUTION_CONTEXT = {}; var ERRORS = "production" !== 'production' ? {
"1": "Cannot create styled-component for component: %s.\n\n",
"2": "Can't collect styles once you've consumed a `ServerStyleSheet`'s styles! `ServerStyleSheet` is a one off instance for each server-side render cycle.\n\n- Are you trying to reuse it across renders?\n- Are you accidentally calling collectStyles twice?\n\n",
"3": "Streaming SSR is only supported in a Node.js environment; Please do not try to call this method in the browser.\n\n",
"4": "The `StyleSheetManager` expects a valid target or sheet prop!\n\n- Does this error occur on the client and is your target falsy?\n- Does this error occur on the server and is the sheet falsy?\n\n",
"5": "The clone method cannot be used on the client!\n\n- Are you running in a client-like environment on the server?\n- Are you trying to run SSR on the client?\n\n",
"6": "Trying to insert a new style tag, but the given Node is unmounted!\n\n- Are you using a custom target that isn't mounted?\n- Does your document not have a valid head element?\n- Have you accidentally removed a style tag manually?\n\n",
"7": "ThemeProvider: Please return an object from your \"theme\" prop function, e.g.\n\n```js\ntheme={() => ({})}\n```\n\n",
"8": "ThemeProvider: Please make your \"theme\" prop an object.\n\n",
"9": "Missing document `<head>`\n\n",
"10": "Cannot find a StyleSheet instance. Usually this happens if there are multiple copies of styled-components loaded at once. Check out this issue for how to troubleshoot and fix the common cases where this situation can happen: https://github.com/styled-components/styled-components/issues/1941#issuecomment-417862021\n\n",
"11": "_This error was replaced with a dev-time warning, it will be deleted for v4 final._ [createGlobalStyle] received children which will not be rendered. Please use the component without passing children elements.\n\n",
"12": "It seems you are interpolating a keyframe declaration (%s) into an untagged string. This was supported in styled-components v3, but is not longer supported in v4 as keyframes are now injected on-demand. Please wrap your string in the css\\`\\` helper which ensures the styles are injected correctly. See https://www.styled-components.com/docs/api#css\n\n",
"13": "%s is not a styled component and cannot be referred to via component selector. See https://www.styled-components.com/docs/advanced#referring-to-other-components for more details.\n"
} : {}; function format() {
var a = arguments.length <= 0 ? undefined : arguments[0];
var b = [];
for (var c = 1, len = arguments.length; c < len; c += 1) {
b.push(arguments.length <= c ? undefined : arguments[c]);
}
b.forEach(function (d) {
a = a.replace(/%[a-z]/, d);
});
return a;
} var StyledComponentsError = function (_Error) {
inherits(StyledComponentsError, _Error);
function StyledComponentsError(code) {
classCallCheck(this, StyledComponentsError);
for (var _len = arguments.length, interpolations = Array(_len > 1 ? _len - 1 : 0), _key = 1; _key < _len; _key++) {
interpolations[_key - 1] = arguments[_key];
}
var _this = possibleConstructorReturn(this, _Error.call(this, 'An error occurred. See https://github.com/styled-components/styled-components/blob/master/packages/styled-components/src/utils/errors.md#' + code + ' for more information.' + (interpolations.length > 0 ? ' Additional arguments: ' + interpolations.join(', ') : )));
return possibleConstructorReturn(_this);
}
return StyledComponentsError;
}(Error); var SC_COMPONENT_ID = /^[^\S\n]*?\/\* sc-component-id:\s*(\S+)\s+\*\//gm; var extractComps = (function (maybeCSS) {
var css = + (maybeCSS || );
var existingComponents = [];
css.replace(SC_COMPONENT_ID, function (match, componentId, matchIndex) {
existingComponents.push({ componentId: componentId, matchIndex: matchIndex });
return match;
});
return existingComponents.map(function (_ref, i) {
var componentId = _ref.componentId, matchIndex = _ref.matchIndex;
var nextComp = existingComponents[i + 1];
var cssFromDOM = nextComp ? css.slice(matchIndex, nextComp.matchIndex) : css.slice(matchIndex);
return { componentId: componentId, cssFromDOM: cssFromDOM };
});
}); var COMMENT_REGEX = /^\s*\/\/.*$/gm; var stylisSplitter = new stylis_min_1.default({
global: false, cascade: true, keyframe: false, prefix: false, compress: false, semicolon: true
}); var stylis = new stylis_min_1.default({
global: false, cascade: true, keyframe: false, prefix: true, compress: false, semicolon: false
}); var parsingRules = []; var returnRulesPlugin = function returnRulesPlugin(context) {
if (context === -2) {
var parsedRules = parsingRules;
parsingRules = [];
return parsedRules;
}
}; var parseRulesPlugin = stylis_rule_sheet_1.default(function (rule) {
parsingRules.push(rule);
}); var _componentId = void 0; var _selector = void 0; var _selectorRegexp = void 0; var selfReferenceReplacer = function selfReferenceReplacer(match, offset, string) {
if (offset > 0 &&
string.slice(0, offset).indexOf(_selector) !== -1 &&
string.slice(offset - _selector.length, offset) !== _selector) {
return '.' + _componentId;
}
return match;
}; var selfReferenceReplacementPlugin = function selfReferenceReplacementPlugin(context, _, selectors) {
if (context === 2 && selectors.length && selectors[0].lastIndexOf(_selector) > 0) {
selectors[0] = selectors[0].replace(_selectorRegexp, selfReferenceReplacer);
}
}; stylis.use([selfReferenceReplacementPlugin, parseRulesPlugin, returnRulesPlugin]); stylisSplitter.use([parseRulesPlugin, returnRulesPlugin]); var splitByRules = function splitByRules(css) {
return stylisSplitter(, css);
}; function stringifyRules(rules, selector, prefix) {
var componentId = arguments.length > 3 && arguments[3] !== undefined ? arguments[3] : '&';
var flatCSS = rules.join().replace(COMMENT_REGEX, );
var cssStr = selector && prefix ? prefix + ' ' + selector + ' { ' + flatCSS + ' }' : flatCSS;
_componentId = componentId;
_selector = selector;
_selectorRegexp = new RegExp('\\' + _selector + '\\b', 'g');
return stylis(prefix || !selector ? : selector, cssStr);
} var getNonce = (function () {
return typeof __webpack_nonce__ !== 'undefined' ? __webpack_nonce__ : null;
}); var addNameForId = function addNameForId(names, id, name) {
if (name) {
var namesForId = names[id] || (names[id] = Object.create(null));
namesForId[name] = true;
}
}; var resetIdNames = function resetIdNames(names, id) {
names[id] = Object.create(null);
}; var hasNameForId = function hasNameForId(names) {
return function (id, name) {
return names[id] !== undefined && names[id][name];
};
}; var stringifyNames = function stringifyNames(names) {
var str = ;
for (var id in names) {
str += Object.keys(names[id]).join(' ') + ' ';
}
return str.trim();
}; var cloneNames = function cloneNames(names) {
var clone = Object.create(null);
for (var id in names) {
clone[id] = _extends({}, names[id]);
}
return clone;
}; var sheetForTag = function sheetForTag(tag) {
if (tag.sheet)
return tag.sheet;
var size = tag.ownerDocument.styleSheets.length;
for (var i = 0; i < size; i += 1) {
var sheet = tag.ownerDocument.styleSheets[i];
if (sheet.ownerNode === tag)
return sheet;
}
throw new StyledComponentsError(10);
}; var safeInsertRule = function safeInsertRule(sheet, cssRule, index) {
if (!cssRule)
return false;
var maxIndex = sheet.cssRules.length;
try {
sheet.insertRule(cssRule, index <= maxIndex ? index : maxIndex);
}
catch (err) {
return false;
}
return true;
}; var deleteRules = function deleteRules(sheet, removalIndex, size) {
var lowerBound = removalIndex - size;
for (var i = removalIndex; i > lowerBound; i -= 1) {
sheet.deleteRule(i);
}
}; var makeTextMarker = function makeTextMarker(id) {
return '\n/* sc-component-id: ' + id + ' */\n';
}; var addUpUntilIndex = function addUpUntilIndex(sizes, index) {
var totalUpToIndex = 0;
for (var i = 0; i <= index; i += 1) {
totalUpToIndex += sizes[i];
}
return totalUpToIndex;
}; var makeStyleTag = function makeStyleTag(target, tagEl, insertBefore) {
var targetDocument = document;
if (target)
targetDocument = target.ownerDocument;
else if (tagEl)
targetDocument = tagEl.ownerDocument;
var el = targetDocument.createElement('style');
el.setAttribute(SC_ATTR, );
el.setAttribute(SC_VERSION_ATTR, "4.4.0");
var nonce = getNonce();
if (nonce) {
el.setAttribute('nonce', nonce);
}
el.appendChild(targetDocument.createTextNode());
if (target && !tagEl) {
target.appendChild(el);
}
else {
if (!tagEl || !target || !tagEl.parentNode) {
throw new StyledComponentsError(6);
}
tagEl.parentNode.insertBefore(el, insertBefore ? tagEl : tagEl.nextSibling);
}
return el;
}; var wrapAsHtmlTag = function wrapAsHtmlTag(css, names) {
return function (additionalAttrs) {
var nonce = getNonce();
var attrs = [nonce && 'nonce="' + nonce + '"', SC_ATTR + '="' + stringifyNames(names) + '"', SC_VERSION_ATTR + '="' + "4.4.0" + '"', additionalAttrs];
var htmlAttr = attrs.filter(Boolean).join(' ');
return '<style ' + htmlAttr + '>' + css() + '</style>';
};
}; var wrapAsElement = function wrapAsElement(css, names) {
return function () {
var _props;
var props = (_props = {}, _props[SC_ATTR] = stringifyNames(names), _props[SC_VERSION_ATTR] = "4.4.0", _props);
var nonce = getNonce();
if (nonce) {
props.nonce = nonce;
}
return react_1.default.createElement('style', _extends({}, props, { dangerouslySetInnerHTML: { __html: css() } }));
};
}; var getIdsFromMarkersFactory = function getIdsFromMarkersFactory(markers) {
return function () {
return Object.keys(markers);
};
}; var makeSpeedyTag = function makeSpeedyTag(el, getImportRuleTag) {
var names = Object.create(null);
var markers = Object.create(null);
var sizes = [];
var extractImport = getImportRuleTag !== undefined;
var usedImportRuleTag = false;
var insertMarker = function insertMarker(id) {
var prev = markers[id];
if (prev !== undefined) {
return prev;
}
markers[id] = sizes.length;
sizes.push(0);
resetIdNames(names, id);
return markers[id];
};
var insertRules = function insertRules(id, cssRules, name) {
var marker = insertMarker(id);
var sheet = sheetForTag(el);
var insertIndex = addUpUntilIndex(sizes, marker);
var injectedRules = 0;
var importRules = [];
var cssRulesSize = cssRules.length;
for (var i = 0; i < cssRulesSize; i += 1) {
var cssRule = cssRules[i];
var mayHaveImport = extractImport;
if (mayHaveImport && cssRule.indexOf('@import') !== -1) {
importRules.push(cssRule);
}
else if (safeInsertRule(sheet, cssRule, insertIndex + injectedRules)) {
mayHaveImport = false;
injectedRules += 1;
}
}
if (extractImport && importRules.length > 0) {
usedImportRuleTag = true;
getImportRuleTag().insertRules(id + '-import', importRules);
}
sizes[marker] += injectedRules;
addNameForId(names, id, name);
};
var removeRules = function removeRules(id) {
var marker = markers[id];
if (marker === undefined)
return;
if (el.isConnected === false)
return;
var size = sizes[marker];
var sheet = sheetForTag(el);
var removalIndex = addUpUntilIndex(sizes, marker) - 1;
deleteRules(sheet, removalIndex, size);
sizes[marker] = 0;
resetIdNames(names, id);
if (extractImport && usedImportRuleTag) {
getImportRuleTag().removeRules(id + '-import');
}
};
var css = function css() {
var _sheetForTag = sheetForTag(el), cssRules = _sheetForTag.cssRules;
var str = ;
for (var id in markers) {
str += makeTextMarker(id);
var marker = markers[id];
var end = addUpUntilIndex(sizes, marker);
var size = sizes[marker];
for (var i = end - size; i < end; i += 1) {
var rule = cssRules[i];
if (rule !== undefined) {
str += rule.cssText;
}
}
}
return str;
};
return {
clone: function clone() {
throw new StyledComponentsError(5);
},
css: css,
getIds: getIdsFromMarkersFactory(markers),
hasNameForId: hasNameForId(names),
insertMarker: insertMarker,
insertRules: insertRules,
removeRules: removeRules,
sealed: false,
styleTag: el,
toElement: wrapAsElement(css, names),
toHTML: wrapAsHtmlTag(css, names)
};
}; var makeTextNode = function makeTextNode(targetDocument, id) {
return targetDocument.createTextNode(makeTextMarker(id));
}; var makeBrowserTag = function makeBrowserTag(el, getImportRuleTag) {
var names = Object.create(null);
var markers = Object.create(null);
var extractImport = getImportRuleTag !== undefined;
var usedImportRuleTag = false;
var insertMarker = function insertMarker(id) {
var prev = markers[id];
if (prev !== undefined) {
return prev;
}
markers[id] = makeTextNode(el.ownerDocument, id);
el.appendChild(markers[id]);
names[id] = Object.create(null);
return markers[id];
};
var insertRules = function insertRules(id, cssRules, name) {
var marker = insertMarker(id);
var importRules = [];
var cssRulesSize = cssRules.length;
for (var i = 0; i < cssRulesSize; i += 1) {
var rule = cssRules[i];
var mayHaveImport = extractImport;
if (mayHaveImport && rule.indexOf('@import') !== -1) {
importRules.push(rule);
}
else {
mayHaveImport = false;
var separator = i === cssRulesSize - 1 ? : ' ';
marker.appendData( + rule + separator);
}
}
addNameForId(names, id, name);
if (extractImport && importRules.length > 0) {
usedImportRuleTag = true;
getImportRuleTag().insertRules(id + '-import', importRules);
}
};
var removeRules = function removeRules(id) {
var marker = markers[id];
if (marker === undefined)
return;
var newMarker = makeTextNode(el.ownerDocument, id);
el.replaceChild(newMarker, marker);
markers[id] = newMarker;
resetIdNames(names, id);
if (extractImport && usedImportRuleTag) {
getImportRuleTag().removeRules(id + '-import');
}
};
var css = function css() {
var str = ;
for (var id in markers) {
str += markers[id].data;
}
return str;
};
return {
clone: function clone() {
throw new StyledComponentsError(5);
},
css: css,
getIds: getIdsFromMarkersFactory(markers),
hasNameForId: hasNameForId(names),
insertMarker: insertMarker,
insertRules: insertRules,
removeRules: removeRules,
sealed: false,
styleTag: el,
toElement: wrapAsElement(css, names),
toHTML: wrapAsHtmlTag(css, names)
};
}; var makeServerTag = function makeServerTag(namesArg, markersArg) {
var names = namesArg === undefined ? Object.create(null) : namesArg;
var markers = markersArg === undefined ? Object.create(null) : markersArg;
var insertMarker = function insertMarker(id) {
var prev = markers[id];
if (prev !== undefined) {
return prev;
}
return markers[id] = [];
};
var insertRules = function insertRules(id, cssRules, name) {
var marker = insertMarker(id);
marker[0] += cssRules.join(' ');
addNameForId(names, id, name);
};
var removeRules = function removeRules(id) {
var marker = markers[id];
if (marker === undefined)
return;
marker[0] = ;
resetIdNames(names, id);
};
var css = function css() {
var str = ;
for (var id in markers) {
var cssForId = markers[id][0];
if (cssForId) {
str += makeTextMarker(id) + cssForId;
}
}
return str;
};
var clone = function clone() {
var namesClone = cloneNames(names);
var markersClone = Object.create(null);
for (var id in markers) {
markersClone[id] = [markers[id][0]];
}
return makeServerTag(namesClone, markersClone);
};
var tag = {
clone: clone,
css: css,
getIds: getIdsFromMarkersFactory(markers),
hasNameForId: hasNameForId(names),
insertMarker: insertMarker,
insertRules: insertRules,
removeRules: removeRules,
sealed: false,
styleTag: null,
toElement: wrapAsElement(css, names),
toHTML: wrapAsHtmlTag(css, names)
};
return tag;
}; var makeTag = function makeTag(target, tagEl, forceServer, insertBefore, getImportRuleTag) {
if (IS_BROWSER && !forceServer) {
var el = makeStyleTag(target, tagEl, insertBefore);
if (DISABLE_SPEEDY) {
return makeBrowserTag(el, getImportRuleTag);
}
else {
return makeSpeedyTag(el, getImportRuleTag);
}
}
return makeServerTag();
}; var rehydrate = function rehydrate(tag, els, extracted) {
for (var i = 0, len = extracted.length; i < len; i += 1) {
var _extracted$i = extracted[i], componentId = _extracted$i.componentId, cssFromDOM = _extracted$i.cssFromDOM;
var cssRules = splitByRules(cssFromDOM);
tag.insertRules(componentId, cssRules);
}
for (var _i = 0, _len = els.length; _i < _len; _i += 1) {
var el = els[_i];
if (el.parentNode) {
el.parentNode.removeChild(el);
}
}
}; var SPLIT_REGEX = /\s+/; var MAX_SIZE = void 0; if (IS_BROWSER) {
MAX_SIZE = DISABLE_SPEEDY ? 40 : 1000;
} else {
MAX_SIZE = -1;
} var sheetRunningId = 0; var master = void 0; var StyleSheet = function () {
function StyleSheet() {
var _this = this;
var target = arguments.length > 0 && arguments[0] !== undefined ? arguments[0] : IS_BROWSER ? document.head : null;
var forceServer = arguments.length > 1 && arguments[1] !== undefined ? arguments[1] : false;
classCallCheck(this, StyleSheet);
this.getImportRuleTag = function () {
var importRuleTag = _this.importRuleTag;
if (importRuleTag !== undefined) {
return importRuleTag;
}
var firstTag = _this.tags[0];
var insertBefore = true;
return _this.importRuleTag = makeTag(_this.target, firstTag ? firstTag.styleTag : null, _this.forceServer, insertBefore);
};
sheetRunningId += 1;
this.id = sheetRunningId;
this.forceServer = forceServer;
this.target = forceServer ? null : target;
this.tagMap = {};
this.deferred = {};
this.rehydratedNames = {};
this.ignoreRehydratedNames = {};
this.tags = [];
this.capacity = 1;
this.clones = [];
}
StyleSheet.prototype.rehydrate = function rehydrate$$1() {
if (!IS_BROWSER || this.forceServer)
return this;
var els = [];
var extracted = [];
var isStreamed = false;
var nodes = document.querySelectorAll('style[' + SC_ATTR + '][' + SC_VERSION_ATTR + '="' + "4.4.0" + '"]');
var nodesSize = nodes.length;
if (!nodesSize)
return this;
for (var i = 0; i < nodesSize; i += 1) {
var el = nodes[i];
if (!isStreamed)
isStreamed = !!el.getAttribute(SC_STREAM_ATTR);
var elNames = (el.getAttribute(SC_ATTR) || ).trim().split(SPLIT_REGEX);
var elNamesSize = elNames.length;
for (var j = 0, name; j < elNamesSize; j += 1) {
name = elNames[j];
this.rehydratedNames[name] = true;
}
extracted.push.apply(extracted, extractComps(el.textContent));
els.push(el);
}
var extractedSize = extracted.length;
if (!extractedSize)
return this;
var tag = this.makeTag(null);
rehydrate(tag, els, extracted);
this.capacity = Math.max(1, MAX_SIZE - extractedSize);
this.tags.push(tag);
for (var _j = 0; _j < extractedSize; _j += 1) {
this.tagMap[extracted[_j].componentId] = tag;
}
return this;
};
StyleSheet.reset = function reset() {
var forceServer = arguments.length > 0 && arguments[0] !== undefined ? arguments[0] : false;
master = new StyleSheet(undefined, forceServer).rehydrate();
};
StyleSheet.prototype.clone = function clone() {
var sheet = new StyleSheet(this.target, this.forceServer);
this.clones.push(sheet);
sheet.tags = this.tags.map(function (tag) {
var ids = tag.getIds();
var newTag = tag.clone();
for (var i = 0; i < ids.length; i += 1) {
sheet.tagMap[ids[i]] = newTag;
}
return newTag;
});
sheet.rehydratedNames = _extends({}, this.rehydratedNames);
sheet.deferred = _extends({}, this.deferred);
return sheet;
};
StyleSheet.prototype.sealAllTags = function sealAllTags() {
this.capacity = 1;
this.tags.forEach(function (tag) {
tag.sealed = true;
});
};
StyleSheet.prototype.makeTag = function makeTag$$1(tag) {
var lastEl = tag ? tag.styleTag : null;
var insertBefore = false;
return makeTag(this.target, lastEl, this.forceServer, insertBefore, this.getImportRuleTag);
};
StyleSheet.prototype.getTagForId = function getTagForId(id) {
var prev = this.tagMap[id];
if (prev !== undefined && !prev.sealed) {
return prev;
}
var tag = this.tags[this.tags.length - 1];
this.capacity -= 1;
if (this.capacity === 0) {
this.capacity = MAX_SIZE;
tag = this.makeTag(tag);
this.tags.push(tag);
}
return this.tagMap[id] = tag;
};
StyleSheet.prototype.hasId = function hasId(id) {
return this.tagMap[id] !== undefined;
};
StyleSheet.prototype.hasNameForId = function hasNameForId(id, name) {
if (this.ignoreRehydratedNames[id] === undefined && this.rehydratedNames[name]) {
return true;
}
var tag = this.tagMap[id];
return tag !== undefined && tag.hasNameForId(id, name);
};
StyleSheet.prototype.deferredInject = function deferredInject(id, cssRules) {
if (this.tagMap[id] !== undefined)
return;
var clones = this.clones;
for (var i = 0; i < clones.length; i += 1) {
clones[i].deferredInject(id, cssRules);
}
this.getTagForId(id).insertMarker(id);
this.deferred[id] = cssRules;
};
StyleSheet.prototype.inject = function inject(id, cssRules, name) {
var clones = this.clones;
for (var i = 0; i < clones.length; i += 1) {
clones[i].inject(id, cssRules, name);
}
var tag = this.getTagForId(id);
if (this.deferred[id] !== undefined) {
var rules = this.deferred[id].concat(cssRules);
tag.insertRules(id, rules, name);
this.deferred[id] = undefined;
}
else {
tag.insertRules(id, cssRules, name);
}
};
StyleSheet.prototype.remove = function remove(id) {
var tag = this.tagMap[id];
if (tag === undefined)
return;
var clones = this.clones;
for (var i = 0; i < clones.length; i += 1) {
clones[i].remove(id);
}
tag.removeRules(id);
this.ignoreRehydratedNames[id] = true;
this.deferred[id] = undefined;
};
StyleSheet.prototype.toHTML = function toHTML() {
return this.tags.map(function (tag) {
return tag.toHTML();
}).join();
};
StyleSheet.prototype.toReactElements = function toReactElements() {
var id = this.id;
return this.tags.map(function (tag, i) {
var key = 'sc-' + id + '-' + i;
return react_1.cloneElement(tag.toElement(), { key: key });
});
};
createClass(StyleSheet, null, [{
key: 'master',
get: function get$$1() {
return master || (master = new StyleSheet().rehydrate());
}
}, {
key: 'instance',
get: function get$$1() {
return StyleSheet.master;
}
}]);
return StyleSheet;
}(); var Keyframes = function () {
function Keyframes(name, rules) {
var _this = this;
classCallCheck(this, Keyframes);
this.inject = function (styleSheet) {
if (!styleSheet.hasNameForId(_this.id, _this.name)) {
styleSheet.inject(_this.id, _this.rules, _this.name);
}
};
this.toString = function () {
throw new StyledComponentsError(12, String(_this.name));
};
this.name = name;
this.rules = rules;
this.id = 'sc-keyframes-' + name;
}
Keyframes.prototype.getName = function getName() {
return this.name;
};
return Keyframes;
}(); var uppercasePattern = /([A-Z])/g; var msPattern = /^ms-/; function hyphenateStyleName(string) {
return string.replace(uppercasePattern, '-$1').toLowerCase().replace(msPattern, '-ms-');
} function addUnitIfNeeded(name, value) {
if (value == null || typeof value === 'boolean' || value === ) {
return ;
}
if (typeof value === 'number' && value !== 0 && !(name in unitless_1.default)) {
return value + 'px';
}
return String(value).trim();
} var isFalsish = function isFalsish(chunk) {
return chunk === undefined || chunk === null || chunk === false || chunk === ;
}; var objToCssArray = function objToCssArray(obj, prevKey) {
var rules = [];
var keys = Object.keys(obj);
keys.forEach(function (key) {
if (!isFalsish(obj[key])) {
if (isPlainObject(obj[key])) {
rules.push.apply(rules, objToCssArray(obj[key], key));
return rules;
}
else if (isFunction(obj[key])) {
rules.push(hyphenateStyleName(key) + ':', obj[key], ';');
return rules;
}
rules.push(hyphenateStyleName(key) + ': ' + addUnitIfNeeded(key, obj[key]) + ';');
}
return rules;
});
return prevKey ? [prevKey + ' {'].concat(rules, ['}']) : rules;
}; function flatten(chunk, executionContext, styleSheet) {
if (Array.isArray(chunk)) {
var ruleSet = [];
for (var i = 0, len = chunk.length, result; i < len; i += 1) {
result = flatten(chunk[i], executionContext, styleSheet);
if (result === null)
continue;
else if (Array.isArray(result))
ruleSet.push.apply(ruleSet, result);
else
ruleSet.push(result);
}
return ruleSet;
}
if (isFalsish(chunk)) {
return null;
}
if (isStyledComponent(chunk)) {
return '.' + chunk.styledComponentId;
}
if (isFunction(chunk)) {
if (isStatelessFunction(chunk) && executionContext) {
var _result = chunk(executionContext);
if ("production" !== 'production' && react_is_1.isElement(_result)) {
console.warn(getComponentName(chunk) + ' is not a styled component and cannot be referred to via component selector. See https://www.styled-components.com/docs/advanced#referring-to-other-components for more details.');
}
return flatten(_result, executionContext, styleSheet);
}
else
return chunk;
}
if (chunk instanceof Keyframes) {
if (styleSheet) {
chunk.inject(styleSheet);
return chunk.getName();
}
else
return chunk;
}
return isPlainObject(chunk) ? objToCssArray(chunk) : chunk.toString();
} function css(styles) {
for (var _len = arguments.length, interpolations = Array(_len > 1 ? _len - 1 : 0), _key = 1; _key < _len; _key++) {
interpolations[_key - 1] = arguments[_key];
}
if (isFunction(styles) || isPlainObject(styles)) {
return flatten(interleave(EMPTY_ARRAY, [styles].concat(interpolations)));
}
return flatten(interleave(styles, interpolations));
} exports.css = css; function constructWithOptions(componentConstructor, tag) {
var options = arguments.length > 2 && arguments[2] !== undefined ? arguments[2] : EMPTY_OBJECT;
if (!react_is_1.isValidElementType(tag)) {
throw new StyledComponentsError(1, String(tag));
}
var templateFunction = function templateFunction() {
return componentConstructor(tag, options, css.apply(undefined, arguments));
};
templateFunction.withConfig = function (config) {
return constructWithOptions(componentConstructor, tag, _extends({}, options, config));
};
templateFunction.attrs = function (attrs) {
return constructWithOptions(componentConstructor, tag, _extends({}, options, {
attrs: Array.prototype.concat(options.attrs, attrs).filter(Boolean)
}));
};
return templateFunction;
} function murmurhash(c) {
for (var e = c.length | 0, a = e | 0, d = 0, b; e >= 4;) {
b = c.charCodeAt(d) & 255 | (c.charCodeAt(++d) & 255) << 8 | (c.charCodeAt(++d) & 255) << 16 | (c.charCodeAt(++d) & 255) << 24, b = 1540483477 * (b & 65535) + ((1540483477 * (b >>> 16) & 65535) << 16), b ^= b >>> 24, b = 1540483477 * (b & 65535) + ((1540483477 * (b >>> 16) & 65535) << 16), a = 1540483477 * (a & 65535) + ((1540483477 * (a >>> 16) & 65535) << 16) ^ b, e -= 4, ++d;
}
switch (e) {
case 3:
a ^= (c.charCodeAt(d + 2) & 255) << 16;
case 2:
a ^= (c.charCodeAt(d + 1) & 255) << 8;
case 1:
a ^= c.charCodeAt(d) & 255, a = 1540483477 * (a & 65535) + ((1540483477 * (a >>> 16) & 65535) << 16);
}
a ^= a >>> 13;
a = 1540483477 * (a & 65535) + ((1540483477 * (a >>> 16) & 65535) << 16);
return (a ^ a >>> 15) >>> 0;
} var charsLength = 52; var getAlphabeticChar = function getAlphabeticChar(code) {
return String.fromCharCode(code + (code > 25 ? 39 : 97));
}; function generateAlphabeticName(code) {
var name = ;
var x = void 0;
for (x = code; x > charsLength; x = Math.floor(x / charsLength)) {
name = getAlphabeticChar(x % charsLength) + name;
}
return getAlphabeticChar(x % charsLength) + name;
} function hasFunctionObjectKey(obj) {
for (var key in obj) {
if (isFunction(obj[key])) {
return true;
}
}
return false;
} function isStaticRules(rules, attrs) {
for (var i = 0; i < rules.length; i += 1) {
var rule = rules[i];
if (Array.isArray(rule) && !isStaticRules(rule, attrs)) {
return false;
}
else if (isFunction(rule) && !isStyledComponent(rule)) {
return false;
}
}
if (attrs.some(function (x) {
return isFunction(x) || hasFunctionObjectKey(x);
}))
return false;
return true;
} var hasher = function hasher(str) {
return generateAlphabeticName(murmurhash(str));
}; var ComponentStyle = function () {
function ComponentStyle(rules, attrs, componentId) {
classCallCheck(this, ComponentStyle);
this.rules = rules;
this.isStatic = "production" === 'production' && isStaticRules(rules, attrs);
this.componentId = componentId;
if (!StyleSheet.master.hasId(componentId)) {
StyleSheet.master.deferredInject(componentId, []);
}
}
ComponentStyle.prototype.generateAndInjectStyles = function generateAndInjectStyles(executionContext, styleSheet) {
var isStatic = this.isStatic, componentId = this.componentId, lastClassName = this.lastClassName;
if (IS_BROWSER && isStatic && typeof lastClassName === 'string' && styleSheet.hasNameForId(componentId, lastClassName)) {
return lastClassName;
}
var flatCSS = flatten(this.rules, executionContext, styleSheet);
var name = hasher(this.componentId + flatCSS.join());
if (!styleSheet.hasNameForId(componentId, name)) {
styleSheet.inject(this.componentId, stringifyRules(flatCSS, '.' + name, undefined, componentId), name);
}
this.lastClassName = name;
return name;
};
ComponentStyle.generateName = function generateName(str) {
return hasher(str);
};
return ComponentStyle;
}(); var LIMIT = 200; var createWarnTooManyClasses = (function (displayName) {
var generatedClasses = {};
var warningSeen = false;
return function (className) {
if (!warningSeen) {
generatedClasses[className] = true;
if (Object.keys(generatedClasses).length >= LIMIT) {
console.warn('Over ' + LIMIT + ' classes were generated for component ' + displayName + '. \n' + 'Consider using the attrs method, together with a style object for frequently changed styles.\n' + 'Example:\n' + ' const Component = styled.div.attrs(props => ({\n' + ' style: {\n' + ' background: props.background,\n' + ' },\n' + ' }))`width: 100%;`\n\n' + ' <Component />');
warningSeen = true;
generatedClasses = {};
}
}
};
}); var determineTheme = (function (props, fallbackTheme) {
var defaultProps = arguments.length > 2 && arguments[2] !== undefined ? arguments[2] : EMPTY_OBJECT; var isDefaultTheme = defaultProps ? props.theme === defaultProps.theme : false; var theme = props.theme && !isDefaultTheme ? props.theme : fallbackTheme || defaultProps.theme; return theme;
}); var escapeRegex = /[[\].#*$><+~=|^:(),"'`-]+/g; var dashesAtEnds = /(^-|-$)/g; function escape(str) {
return str
.replace(escapeRegex, '-')
.replace(dashesAtEnds, );
} function isTag(target) {
return typeof target === 'string' && ("production" !== 'production' ? target.charAt(0) === target.charAt(0).toLowerCase() : true);
} function generateDisplayName(target) {
return isTag(target) ? 'styled.' + target : 'Styled(' + getComponentName(target) + ')';
} var _TYPE_STATICS; var REACT_STATICS = {
childContextTypes: true, contextTypes: true, defaultProps: true, displayName: true, getDerivedStateFromProps: true, propTypes: true, type: true
}; var KNOWN_STATICS = {
name: true, length: true, prototype: true, caller: true, callee: true, arguments: true, arity: true
}; var TYPE_STATICS = (_TYPE_STATICS = {}, _TYPE_STATICS[react_is_1.ForwardRef] = {
$$typeof: true, render: true
}, _TYPE_STATICS); var defineProperty$1 = Object.defineProperty, getOwnPropertyNames = Object.getOwnPropertyNames, _Object$getOwnPropert = Object.getOwnPropertySymbols, getOwnPropertySymbols = _Object$getOwnPropert === undefined ? function () {
return [];
} : _Object$getOwnPropert, getOwnPropertyDescriptor = Object.getOwnPropertyDescriptor, getPrototypeOf = Object.getPrototypeOf, objectPrototype = Object.prototype; var arrayPrototype = Array.prototype; function hoistNonReactStatics(targetComponent, sourceComponent, blacklist) {
if (typeof sourceComponent !== 'string') {
var inheritedComponent = getPrototypeOf(sourceComponent);
if (inheritedComponent && inheritedComponent !== objectPrototype) {
hoistNonReactStatics(targetComponent, inheritedComponent, blacklist);
}
var keys = arrayPrototype.concat(getOwnPropertyNames(sourceComponent), getOwnPropertySymbols(sourceComponent));
var targetStatics = TYPE_STATICS[targetComponent.$$typeof] || REACT_STATICS;
var sourceStatics = TYPE_STATICS[sourceComponent.$$typeof] || REACT_STATICS;
var i = keys.length;
var descriptor = void 0;
var key = void 0;
while (i--) {
key = keys[i];
if (!KNOWN_STATICS[key] && !(blacklist && blacklist[key]) && !(sourceStatics && sourceStatics[key]) &&
!(targetStatics && targetStatics[key])) {
descriptor = getOwnPropertyDescriptor(sourceComponent, key);
if (descriptor) {
try {
defineProperty$1(targetComponent, key, descriptor);
}
catch (e) {
}
}
}
}
return targetComponent;
}
return targetComponent;
} function isDerivedReactComponent(fn) {
return !!(fn && fn.prototype && fn.prototype.isReactComponent);
} var once = (function (cb) {
var called = false;
return function () {
if (!called) {
called = true;
cb.apply(undefined, arguments);
}
};
}); var ThemeContext = react_1.createContext(); exports.ThemeContext = ThemeContext; var ThemeConsumer = ThemeContext.Consumer; exports.ThemeConsumer = ThemeConsumer; var ThemeProvider = function (_Component) {
inherits(ThemeProvider, _Component);
function ThemeProvider(props) {
classCallCheck(this, ThemeProvider);
var _this = possibleConstructorReturn(this, _Component.call(this, props));
_this.getContext = memoize_one_1.default(_this.getContext.bind(_this));
_this.renderInner = _this.renderInner.bind(_this);
return _this;
}
ThemeProvider.prototype.render = function render() {
if (!this.props.children)
return null;
return react_1.default.createElement(ThemeContext.Consumer, null, this.renderInner);
};
ThemeProvider.prototype.renderInner = function renderInner(outerTheme) {
var context = this.getContext(this.props.theme, outerTheme);
return react_1.default.createElement(ThemeContext.Provider, { value: context }, this.props.children);
};
ThemeProvider.prototype.getTheme = function getTheme(theme, outerTheme) {
if (isFunction(theme)) {
var mergedTheme = theme(outerTheme);
if ("production" !== 'production' && (mergedTheme === null || Array.isArray(mergedTheme) || (typeof mergedTheme === 'undefined' ? 'undefined' : _typeof(mergedTheme)) !== 'object')) {
throw new StyledComponentsError(7);
}
return mergedTheme;
}
if (theme === null || Array.isArray(theme) || (typeof theme === 'undefined' ? 'undefined' : _typeof(theme)) !== 'object') {
throw new StyledComponentsError(8);
}
return _extends({}, outerTheme, theme);
};
ThemeProvider.prototype.getContext = function getContext(theme, outerTheme) {
return this.getTheme(theme, outerTheme);
};
return ThemeProvider;
}(react_1.Component); exports.ThemeProvider = ThemeProvider; var CLOSING_TAG_R = /^\s*<\/[a-z]/i; var ServerStyleSheet = function () {
function ServerStyleSheet() {
classCallCheck(this, ServerStyleSheet);
this.masterSheet = StyleSheet.master;
this.instance = this.masterSheet.clone();
this.sealed = false;
}
ServerStyleSheet.prototype.seal = function seal() {
if (!this.sealed) {
var index = this.masterSheet.clones.indexOf(this.instance);
this.masterSheet.clones.splice(index, 1);
this.sealed = true;
}
};
ServerStyleSheet.prototype.collectStyles = function collectStyles(children) {
if (this.sealed) {
throw new StyledComponentsError(2);
}
return react_1.default.createElement(StyleSheetManager, { sheet: this.instance }, children);
};
ServerStyleSheet.prototype.getStyleTags = function getStyleTags() {
this.seal();
return this.instance.toHTML();
};
ServerStyleSheet.prototype.getStyleElement = function getStyleElement() {
this.seal();
return this.instance.toReactElements();
};
ServerStyleSheet.prototype.interleaveWithNodeStream = function interleaveWithNodeStream(readableStream) {
var _this = this;
{
throw new StyledComponentsError(3);
}
var instance = this.instance;
var instanceTagIndex = 0;
var streamAttr = SC_STREAM_ATTR + '="true"';
var transformer = new stream.Transform({
transform: function appendStyleChunks(chunk, _, callback) {
var tags = instance.tags;
var html = ;
for (; instanceTagIndex < tags.length; instanceTagIndex += 1) {
var tag = tags[instanceTagIndex];
html += tag.toHTML(streamAttr);
}
instance.sealAllTags();
var renderedHtml = chunk.toString();
if (CLOSING_TAG_R.test(renderedHtml)) {
var endOfClosingTag = renderedHtml.indexOf('>');
this.push(renderedHtml.slice(0, endOfClosingTag + 1) + html + renderedHtml.slice(endOfClosingTag + 1));
}
else
this.push(html + renderedHtml);
callback();
}
});
readableStream.on('end', function () {
return _this.seal();
});
readableStream.on('error', function (err) {
_this.seal();
transformer.emit('error', err);
});
return readableStream.pipe(transformer);
};
return ServerStyleSheet;
}(); exports.ServerStyleSheet = ServerStyleSheet; var StyleSheetContext = react_1.createContext(); exports.StyleSheetContext = StyleSheetContext; var StyleSheetConsumer = StyleSheetContext.Consumer; exports.StyleSheetConsumer = StyleSheetConsumer; var StyleSheetManager = function (_Component) {
inherits(StyleSheetManager, _Component);
function StyleSheetManager(props) {
classCallCheck(this, StyleSheetManager);
var _this = possibleConstructorReturn(this, _Component.call(this, props));
_this.getContext = memoize_one_1.default(_this.getContext);
return _this;
}
StyleSheetManager.prototype.getContext = function getContext(sheet, target) {
if (sheet) {
return sheet;
}
else if (target) {
return new StyleSheet(target);
}
else {
throw new StyledComponentsError(4);
}
};
StyleSheetManager.prototype.render = function render() {
var _props = this.props, children = _props.children, sheet = _props.sheet, target = _props.target;
return react_1.default.createElement(StyleSheetContext.Provider, { value: this.getContext(sheet, target) }, "production" !== 'production' ? react_1.default.Children.only(children) : children);
};
return StyleSheetManager;
}(react_1.Component); exports.StyleSheetManager = StyleSheetManager; "production" !== "production" ? StyleSheetManager.propTypes = {
sheet: prop_types_1.default.oneOfType([prop_types_1.default.instanceOf(StyleSheet), prop_types_1.default.instanceOf(ServerStyleSheet)]),
target: prop_types_1.default.shape({
appendChild: prop_types_1.default.func.isRequired
})
} : void 0; var THEME_PROP_REGEX = /\.theme[.[]/; var identifiers = {}; function generateId(_ComponentStyle, _displayName, parentComponentId) {
var displayName = typeof _displayName !== 'string' ? 'sc' : escape(_displayName); var nr = (identifiers[displayName] || 0) + 1; identifiers[displayName] = nr; var componentId = displayName + '-' + _ComponentStyle.generateName(displayName + nr); return parentComponentId ? parentComponentId + '-' + componentId : componentId;
} var StyledComponent = function (_Component) {
inherits(StyledComponent, _Component);
function StyledComponent() {
classCallCheck(this, StyledComponent);
var _this = possibleConstructorReturn(this, _Component.call(this));
_this.attrs = {};
_this.renderOuter = _this.renderOuter.bind(_this);
_this.renderInner = _this.renderInner.bind(_this);
return _this;
}
StyledComponent.prototype.render = function render() {
return react_1.default.createElement(StyleSheetConsumer, null, this.renderOuter);
};
StyledComponent.prototype.renderOuter = function renderOuter() {
var styleSheet = arguments.length > 0 && arguments[0] !== undefined ? arguments[0] : StyleSheet.master;
this.styleSheet = styleSheet;
if (this.props.forwardedComponent.componentStyle.isStatic)
return this.renderInner();
return react_1.default.createElement(ThemeConsumer, null, this.renderInner);
};
StyledComponent.prototype.renderInner = function renderInner(theme) {
var _props$forwardedCompo = this.props.forwardedComponent, componentStyle = _props$forwardedCompo.componentStyle, defaultProps = _props$forwardedCompo.defaultProps, displayName = _props$forwardedCompo.displayName, foldedComponentIds = _props$forwardedCompo.foldedComponentIds, styledComponentId = _props$forwardedCompo.styledComponentId, target = _props$forwardedCompo.target, usesTheme = _props$forwardedCompo.usesTheme;
var generatedClassName = void 0;
var rawTheme = void 0;
if (componentStyle.isStatic) {
generatedClassName = this.generateAndInjectStyles(EMPTY_OBJECT, this.props);
}
else {
rawTheme = determineTheme(this.props, theme, defaultProps);
generatedClassName = this.generateAndInjectStyles(rawTheme || EMPTY_OBJECT, this.props);
if ("production" !== 'production' && usesTheme && !rawTheme) {
console.error('Component \ +
displayName + '\' (.' + styledComponentId + ') references the \'theme\' prop in its styles but no theme was provided via prop or <ThemeProvider>.');
}
}
var elementToBeCreated = this.props.as || this.attrs.as || target;
var isTargetTag = isTag(elementToBeCreated);
var propsForElement = {};
var computedProps = _extends({}, this.props, this.attrs);
var key = void 0;
for (key in computedProps) {
if ("production" !== 'production' && key === 'innerRef' && isTargetTag) {
this.warnInnerRef(displayName);
}
if (key === 'forwardedComponent' || key === 'as') {
continue;
}
else if (key === 'forwardedRef')
propsForElement.ref = computedProps[key];
else if (key === 'forwardedAs')
propsForElement.as = computedProps[key];
else if (!isTargetTag || is_prop_valid_1.default(key)) {
propsForElement[key] = computedProps[key];
}
}
if (this.props.style && this.attrs.style) {
propsForElement.style = _extends({}, this.attrs.style, this.props.style);
}
propsForElement.className = Array.prototype.concat(foldedComponentIds, styledComponentId, generatedClassName !== styledComponentId ? generatedClassName : null, this.props.className, this.attrs.className).filter(Boolean).join(' ');
return react_1.createElement(elementToBeCreated, propsForElement);
};
StyledComponent.prototype.buildExecutionContext = function buildExecutionContext(theme, props, attrs) {
var _this2 = this;
var context = _extends({}, props, { theme: theme });
if (!attrs.length)
return context;
this.attrs = {};
attrs.forEach(function (attrDef) {
var resolvedAttrDef = attrDef;
var attrDefWasFn = false;
var attr = void 0;
var key = void 0;
if (isFunction(resolvedAttrDef)) {
resolvedAttrDef = resolvedAttrDef(context);
attrDefWasFn = true;
}
for (key in resolvedAttrDef) {
attr = resolvedAttrDef[key];
if (!attrDefWasFn) {
if (isFunction(attr) && !isDerivedReactComponent(attr) && !isStyledComponent(attr)) {
attr = attr(context);
if ("production" !== 'production' && react_1.default.isValidElement(attr)) {
_this2.warnNonStyledComponentAttrsObjectKey(key, props.forwardedComponent.displayName);
}
}
}
_this2.attrs[key] = attr;
context[key] = attr;
}
});
return context;
};
StyledComponent.prototype.generateAndInjectStyles = function generateAndInjectStyles(theme, props) {
var _props$forwardedCompo2 = props.forwardedComponent, attrs = _props$forwardedCompo2.attrs, componentStyle = _props$forwardedCompo2.componentStyle, warnTooManyClasses = _props$forwardedCompo2.warnTooManyClasses;
if (componentStyle.isStatic && !attrs.length) {
return componentStyle.generateAndInjectStyles(EMPTY_OBJECT, this.styleSheet);
}
var className = componentStyle.generateAndInjectStyles(this.buildExecutionContext(theme, props, attrs), this.styleSheet);
if ("production" !== 'production' && warnTooManyClasses)
warnTooManyClasses(className);
return className;
};
return StyledComponent;
}(react_1.Component); function createStyledComponent(target, options, rules) {
var isTargetStyledComp = isStyledComponent(target);
var isClass = !isTag(target);
var _options$displayName = options.displayName, displayName = _options$displayName === undefined ? generateDisplayName(target) : _options$displayName, _options$componentId = options.componentId, componentId = _options$componentId === undefined ? generateId(ComponentStyle, options.displayName, options.parentComponentId) : _options$componentId, _options$ParentCompon = options.ParentComponent, ParentComponent = _options$ParentCompon === undefined ? StyledComponent : _options$ParentCompon, _options$attrs = options.attrs, attrs = _options$attrs === undefined ? EMPTY_ARRAY : _options$attrs;
var styledComponentId = options.displayName && options.componentId ? escape(options.displayName) + '-' + options.componentId : options.componentId || componentId;
var finalAttrs = isTargetStyledComp && target.attrs ? Array.prototype.concat(target.attrs, attrs).filter(Boolean) : attrs;
var componentStyle = new ComponentStyle(isTargetStyledComp ?
target.componentStyle.rules.concat(rules) : rules, finalAttrs, styledComponentId);
var WrappedStyledComponent = void 0;
var forwardRef = function forwardRef(props, ref) {
return react_1.default.createElement(ParentComponent, _extends({}, props, { forwardedComponent: WrappedStyledComponent, forwardedRef: ref }));
};
forwardRef.displayName = displayName;
WrappedStyledComponent = react_1.default.forwardRef(forwardRef);
WrappedStyledComponent.displayName = displayName;
WrappedStyledComponent.attrs = finalAttrs;
WrappedStyledComponent.componentStyle = componentStyle;
WrappedStyledComponent.foldedComponentIds = isTargetStyledComp ?
Array.prototype.concat(target.foldedComponentIds, target.styledComponentId) : EMPTY_ARRAY;
WrappedStyledComponent.styledComponentId = styledComponentId;
WrappedStyledComponent.target = isTargetStyledComp ? target.target : target;
WrappedStyledComponent.withComponent = function withComponent(tag) {
var previousComponentId = options.componentId, optionsToCopy = objectWithoutProperties(options, ['componentId']);
var newComponentId = previousComponentId && previousComponentId + '-' + (isTag(tag) ? tag : escape(getComponentName(tag)));
var newOptions = _extends({}, optionsToCopy, {
attrs: finalAttrs,
componentId: newComponentId,
ParentComponent: ParentComponent
});
return createStyledComponent(tag, newOptions, rules);
};
Object.defineProperty(WrappedStyledComponent, 'defaultProps', {
get: function get$$1() {
return this._foldedDefaultProps;
},
set: function set$$1(obj) {
this._foldedDefaultProps = isTargetStyledComp ? merge_anything_1.default(target.defaultProps, obj) : obj;
}
});
WrappedStyledComponent.toString = function () {
return '.' + WrappedStyledComponent.styledComponentId;
};
if (isClass) {
hoistNonReactStatics(WrappedStyledComponent, target, {
attrs: true,
componentStyle: true,
displayName: true,
foldedComponentIds: true,
styledComponentId: true,
target: true,
withComponent: true
});
}
return WrappedStyledComponent;
} var domElements = ['a', 'abbr', 'address', 'area', 'article', 'aside', 'audio', 'b', 'base', 'bdi', 'bdo', 'big', 'blockquote', 'body', 'br', 'button', 'canvas', 'caption', 'cite', 'code', 'col', 'colgroup', 'data', 'datalist', 'dd', 'del', 'details', 'dfn', 'dialog', 'div', 'dl', 'dt', 'em', 'embed', 'fieldset', 'figcaption', 'figure', 'footer', 'form', 'h1', 'h2', 'h3', 'h4', 'h5', 'h6', 'head', 'header', 'hgroup', 'hr', 'html', 'i', 'iframe', 'img', 'input', 'ins', 'kbd', 'keygen', 'label', 'legend', 'li', 'link', 'main', 'map', 'mark', 'marquee', 'menu', 'menuitem', 'meta', 'meter', 'nav', 'noscript', 'object', 'ol', 'optgroup', 'option', 'output', 'p', 'param', 'picture', 'pre', 'progress', 'q', 'rp', 'rt', 'ruby', 's', 'samp', 'script', 'section', 'select', 'small', 'source', 'span', 'strong', 'style', 'sub', 'summary', 'sup', 'table', 'tbody', 'td', 'textarea', 'tfoot', 'th', 'thead', 'time', 'title', 'tr', 'track', 'u', 'ul', 'var', 'video', 'wbr',
'circle', 'clipPath', 'defs', 'ellipse', 'foreignObject', 'g', 'image', 'line', 'linearGradient', 'marker', 'mask', 'path', 'pattern', 'polygon', 'polyline', 'radialGradient', 'rect', 'stop', 'svg', 'text', 'tspan'];
var styled = function styled(tag) {
return constructWithOptions(createStyledComponent, tag);
}; domElements.forEach(function (domElement) {
styled[domElement] = styled(domElement);
}); var GlobalStyle = function () {
function GlobalStyle(rules, componentId) {
classCallCheck(this, GlobalStyle);
this.rules = rules;
this.componentId = componentId;
this.isStatic = isStaticRules(rules, EMPTY_ARRAY);
if (!StyleSheet.master.hasId(componentId)) {
StyleSheet.master.deferredInject(componentId, []);
}
}
GlobalStyle.prototype.createStyles = function createStyles(executionContext, styleSheet) {
var flatCSS = flatten(this.rules, executionContext, styleSheet);
var css = stringifyRules(flatCSS, );
styleSheet.inject(this.componentId, css);
};
GlobalStyle.prototype.removeStyles = function removeStyles(styleSheet) {
var componentId = this.componentId;
if (styleSheet.hasId(componentId)) {
styleSheet.remove(componentId);
}
};
GlobalStyle.prototype.renderStyles = function renderStyles(executionContext, styleSheet) {
this.removeStyles(styleSheet);
this.createStyles(executionContext, styleSheet);
};
return GlobalStyle;
}(); if (IS_BROWSER) {
window.scCGSHMRCache = {};
} function createGlobalStyle(strings) {
for (var _len = arguments.length, interpolations = Array(_len > 1 ? _len - 1 : 0), _key = 1; _key < _len; _key++) {
interpolations[_key - 1] = arguments[_key];
}
var rules = css.apply(undefined, [strings].concat(interpolations));
var id = 'sc-global-' + murmurhash(JSON.stringify(rules));
var style = new GlobalStyle(rules, id);
var GlobalStyleComponent = function (_React$Component) {
inherits(GlobalStyleComponent, _React$Component);
function GlobalStyleComponent(props) {
classCallCheck(this, GlobalStyleComponent);
var _this = possibleConstructorReturn(this, _React$Component.call(this, props));
var _this$constructor = _this.constructor, globalStyle = _this$constructor.globalStyle, styledComponentId = _this$constructor.styledComponentId;
if (IS_BROWSER) {
window.scCGSHMRCache[styledComponentId] = (window.scCGSHMRCache[styledComponentId] || 0) + 1;
}
_this.state = {
globalStyle: globalStyle,
styledComponentId: styledComponentId
};
return _this;
}
GlobalStyleComponent.prototype.componentWillUnmount = function componentWillUnmount() {
if (window.scCGSHMRCache[this.state.styledComponentId]) {
window.scCGSHMRCache[this.state.styledComponentId] -= 1;
}
if (window.scCGSHMRCache[this.state.styledComponentId] === 0) {
this.state.globalStyle.removeStyles(this.styleSheet);
}
};
GlobalStyleComponent.prototype.render = function render() {
var _this2 = this;
if ("production" !== 'production' && react_1.default.Children.count(this.props.children)) {
console.warn('The global style component ' + this.state.styledComponentId + ' was given child JSX. createGlobalStyle does not render children.');
}
return react_1.default.createElement(StyleSheetConsumer, null, function (styleSheet) {
_this2.styleSheet = styleSheet || StyleSheet.master;
var globalStyle = _this2.state.globalStyle;
if (globalStyle.isStatic) {
globalStyle.renderStyles(STATIC_EXECUTION_CONTEXT, _this2.styleSheet);
return null;
}
else {
return react_1.default.createElement(ThemeConsumer, null, function (theme) {
var defaultProps = _this2.constructor.defaultProps;
var context = _extends({}, _this2.props);
if (typeof theme !== 'undefined') {
context.theme = determineTheme(_this2.props, theme, defaultProps);
}
globalStyle.renderStyles(context, _this2.styleSheet);
return null;
});
}
});
};
return GlobalStyleComponent;
}(react_1.default.Component);
GlobalStyleComponent.globalStyle = style;
GlobalStyleComponent.styledComponentId = id;
return GlobalStyleComponent;
} exports.createGlobalStyle = createGlobalStyle; var replaceWhitespace = function replaceWhitespace(str) {
return str.replace(/\s|\\n/g, );
}; function keyframes(strings) {
if ("production" !== 'production' && typeof navigator !== 'undefined' && navigator.product === 'ReactNative') {
console.warn('`keyframes` cannot be used on ReactNative, only on the web. To do animation in ReactNative please use Animated.');
}
for (var _len = arguments.length, interpolations = Array(_len > 1 ? _len - 1 : 0), _key = 1; _key < _len; _key++) {
interpolations[_key - 1] = arguments[_key];
}
var rules = css.apply(undefined, [strings].concat(interpolations));
var name = generateAlphabeticName(murmurhash(replaceWhitespace(JSON.stringify(rules))));
return new Keyframes(name, stringifyRules(rules, name, '@keyframes'));
} exports.keyframes = keyframes; var withTheme = (function (Component$$1) {
var WithTheme = react_1.default.forwardRef(function (props, ref) {
return react_1.default.createElement(ThemeConsumer, null, function (theme) {
var defaultProps = Component$$1.defaultProps;
var themeProp = determineTheme(props, theme, defaultProps);
if ("production" !== 'production' && themeProp === undefined) {
console.warn('[withTheme] You are not using a ThemeProvider nor passing a theme prop or a theme in defaultProps in component class "' + getComponentName(Component$$1) + '"');
}
return react_1.default.createElement(Component$$1, _extends({}, props, { theme: themeProp, ref: ref }));
});
});
hoistNonReactStatics(WithTheme, Component$$1);
WithTheme.displayName = 'WithTheme(' + getComponentName(Component$$1) + ')';
return WithTheme;
}); exports.withTheme = withTheme; var __DO_NOT_USE_OR_YOU_WILL_BE_HAUNTED_BY_SPOOKY_GHOSTS = {
StyleSheet: StyleSheet
}; exports.__DO_NOT_USE_OR_YOU_WILL_BE_HAUNTED_BY_SPOOKY_GHOSTS = __DO_NOT_USE_OR_YOU_WILL_BE_HAUNTED_BY_SPOOKY_GHOSTS; if ("production" !== 'production' && typeof navigator !== 'undefined' && navigator.product === 'ReactNative') {
console.warn("It looks like you've imported 'styled-components' on React Native.\n" + "Perhaps you're looking to import 'styled-components/native'?\n" + 'Read more about this at https://www.styled-components.com/docs/basics#react-native');
} if ("production" !== 'production' && "production" !== 'test' && typeof window !== 'undefined' && typeof navigator !== 'undefined' && typeof navigator.userAgent === 'string' && navigator.userAgent.indexOf('Node.js') === -1 && navigator.userAgent.indexOf('jsdom') === -1) {
window['__styled-components-init__'] = window['__styled-components-init__'] || 0;
if (window['__styled-components-init__'] === 1) {
console.warn("It looks like there are several instances of 'styled-components' initialized in this application. " + 'This may cause dynamic styles not rendering properly, errors happening during rehydration process ' + 'and makes your application bigger without a good reason.\n\n' + 'See https://s-c.sh/2BAXzed for more info.');
}
window['__styled-components-init__'] += 1;
} exports.default = styled;
} // stylis/stylis.min.js $fsx.f[92] = (module, exports) => { !function (e) { "object" == typeof exports && "undefined" != typeof module ? module.exports = e(null) : "function" == typeof define && define.amd ? define(e(null)) : window.stylis = e(null); }(function e(a) {
"use strict";
var r = /^\0+/g, c = /[\0\r\f]/g, s = /: */g, t = /zoo|gra/, i = /([,: ])(transform)/g, f = /,+\s*(?![^(]*[)])/g, n = / +\s*(?![^(]*[)])/g, l = / *[\0] */g, o = /,\r+?/g, h = /([\t\r\n ])*\f?&/g, u = /:global\(((?:[^\(\)\[\]]*|\[.*\]|\([^\(\)]*\))*)\)/g, d = /\W+/g, b = /@(k\w+)\s*(\S*)\s*/, p = /::(place)/g, k = /:(read-only)/g, g = /\s+(?=[{\];=:>])/g, A = /([[}=:>])\s+/g, C = /(\{[^{]+?);(?=\})/g, w = /\s{2,}/g, v = /([^\(])(:+) */g, m = /[svh]\w+-[tblr]{2}/, x = /\(\s*(.*)\s*\)/g, $ = /([\s\S]*?);/g, y = /-self|flex-/g, O = /[^]*?(:[rp][el]a[\w-]+)[^]*/, j = /stretch|:\s*\w+\-(?:conte|avail)/, z = /([^-])(image-set\()/, N = "-webkit-", S = "-moz-", F = "-ms-", W = 59, q = 125, B = 123, D = 40, E = 41, G = 91, H = 93, I = 10, J = 13, K = 9, L = 64, M = 32, P = 38, Q = 45, R = 95, T = 42, U = 44, V = 58, X = 39, Y = 34, Z = 47, _ = 62, ee = 43, ae = 126, re = 0, ce = 12, se = 11, te = 107, ie = 109, fe = 115, ne = 112, le = 111, oe = 105, he = 99, ue = 100, de = 112, be = 1, pe = 1, ke = 0, ge = 1, Ae = 1, Ce = 1, we = 0, ve = 0, me = 0, xe = [], $e = [], ye = 0, Oe = null, je = -2, ze = -1, Ne = 0, Se = 1, Fe = 2, We = 3, qe = 0, Be = 1, De = "", Ee = "", Ge = "";
function He(e, a, s, t, i) { for (var f, n, o = 0, h = 0, u = 0, d = 0, g = 0, A = 0, C = 0, w = 0, m = 0, $ = 0, y = 0, O = 0, j = 0, z = 0, R = 0, we = 0, $e = 0, Oe = 0, je = 0, ze = s.length, Je = ze - 1, Re = "", Te = "", Ue = "", Ve = "", Xe = "", Ye = ""; R < ze;) {
if (C = s.charCodeAt(R), R === Je)
if (h + d + u + o !== 0) {
if (0 !== h)
C = h === Z ? I : Z;
d = u = o = 0, ze++, Je++;
}
if (h + d + u + o === 0) {
if (R === Je) {
if (we > 0)
Te = Te.replace(c, "");
if (Te.trim().length > 0) {
switch (C) {
case M:
case K:
case W:
case J:
case I: break;
default: Te += s.charAt(R);
}
C = W;
}
}
if (1 === $e)
switch (C) {
case B:
case q:
case W:
case Y:
case X:
case D:
case E:
case U: $e = 0;
case K:
case J:
case I:
case M: break;
default: for ($e = 0, je = R, g = C, R--, C = W; je < ze;)
switch (s.charCodeAt(je++)) {
case I:
case J:
case W:
++R, C = g, je = ze;
break;
case V: if (we > 0)
++R, C = g;
case B: je = ze;
}
}
switch (C) {
case B:
for (g = (Te = Te.trim()).charCodeAt(0), y = 1, je = ++R; R < ze;) {
switch (C = s.charCodeAt(R)) {
case B:
y++;
break;
case q:
y--;
break;
case Z:
switch (A = s.charCodeAt(R + 1)) {
case T:
case Z: R = Qe(A, R, Je, s);
}
break;
case G: C++;
case D: C++;
case Y:
case X: for (; R++ < Je && s.charCodeAt(R) !== C;)
;
}
if (0 === y)
break;
R++;
}
if (Ue = s.substring(je, R), g === re)
g = (Te = Te.replace(r, "").trim()).charCodeAt(0);
switch (g) {
case L:
if (we > 0)
Te = Te.replace(c, "");
switch (A = Te.charCodeAt(1)) {
case ue:
case ie:
case fe:
case Q:
f = a;
break;
default: f = xe;
}
if (je = (Ue = He(a, f, Ue, A, i + 1)).length, me > 0 && 0 === je)
je = Te.length;
if (ye > 0)
if (f = Ie(xe, Te, Oe), n = Pe(We, Ue, f, a, pe, be, je, A, i, t), Te = f.join(""), void 0 !== n)
if (0 === (je = (Ue = n.trim()).length))
A = 0, Ue = "";
if (je > 0)
switch (A) {
case fe: Te = Te.replace(x, Me);
case ue:
case ie:
case Q:
Ue = Te + "{" + Ue + "}";
break;
case te:
if (Ue = (Te = Te.replace(b, "$1 $2" + (Be > 0 ? De : ""))) + "{" + Ue + "}", 1 === Ae || 2 === Ae && Le("@" + Ue, 3))
Ue = "@" + N + Ue + "@" + Ue;
else
Ue = "@" + Ue;
break;
default: if (Ue = Te + Ue, t === de)
Ve += Ue, Ue = "";
}
else
Ue = "";
break;
default: Ue = He(a, Ie(a, Te, Oe), Ue, t, i + 1);
}
Xe += Ue, O = 0, $e = 0, z = 0, we = 0, Oe = 0, j = 0, Te = "", Ue = "", C = s.charCodeAt(++R);
break;
case q:
case W:
if ((je = (Te = (we > 0 ? Te.replace(c, "") : Te).trim()).length) > 1) {
if (0 === z)
if ((g = Te.charCodeAt(0)) === Q || g > 96 && g < 123)
je = (Te = Te.replace(" ", ":")).length;
if (ye > 0)
if (void 0 !== (n = Pe(Se, Te, a, e, pe, be, Ve.length, t, i, t)))
if (0 === (je = (Te = n.trim()).length))
Te = "\0\0";
switch (g = Te.charCodeAt(0), A = Te.charCodeAt(1), g) {
case re: break;
case L: if (A === oe || A === he) {
Ye += Te + s.charAt(R);
break;
}
default:
if (Te.charCodeAt(je - 1) === V)
break;
Ve += Ke(Te, g, A, Te.charCodeAt(2));
}
}
O = 0, $e = 0, z = 0, we = 0, Oe = 0, Te = "", C = s.charCodeAt(++R);
}
}
switch (C) {
case J:
case I:
if (h + d + u + o + ve === 0)
switch ($) {
case E:
case X:
case Y:
case L:
case ae:
case _:
case T:
case ee:
case Z:
case Q:
case V:
case U:
case W:
case B:
case q: break;
default: if (z > 0)
$e = 1;
}
if (h === Z)
h = 0;
else if (ge + O === 0 && t !== te && Te.length > 0)
we = 1, Te += "\0";
if (ye * qe > 0)
Pe(Ne, Te, a, e, pe, be, Ve.length, t, i, t);
be = 1, pe++;
break;
case W:
case q: if (h + d + u + o === 0) {
be++;
break;
}
default:
switch (be++, Re = s.charAt(R), C) {
case K:
case M:
if (d + o + h === 0)
switch (w) {
case U:
case V:
case K:
case M:
Re = "";
break;
default: if (C !== M)
Re = " ";
}
break;
case re:
Re = "\\0";
break;
case ce:
Re = "\\f";
break;
case se:
Re = "\\v";
break;
case P:
if (d + h + o === 0 && ge > 0)
Oe = 1, we = 1, Re = "\f" + Re;
break;
case 108:
if (d + h + o + ke === 0 && z > 0)
switch (R - z) {
case 2: if (w === ne && s.charCodeAt(R - 3) === V)
ke = w;
case 8: if (m === le)
ke = m;
}
break;
case V:
if (d + h + o === 0)
z = R;
break;
case U:
if (h + u + d + o === 0)
we = 1, Re += "\r";
break;
case Y:
case X:
if (0 === h)
d = d === C ? 0 : 0 === d ? C : d;
break;
case G:
if (d + h + u === 0)
o++;
break;
case H:
if (d + h + u === 0)
o--;
break;
case E:
if (d + h + o === 0)
u--;
break;
case D:
if (d + h + o === 0) {
if (0 === O)
switch (2 * w + 3 * m) {
case 533: break;
default: y = 0, O = 1;
}
u++;
}
break;
case L:
if (h + u + d + o + z + j === 0)
j = 1;
break;
case T:
case Z:
if (d + o + u > 0)
break;
switch (h) {
case 0:
switch (2 * C + 3 * s.charCodeAt(R + 1)) {
case 235:
h = Z;
break;
case 220: je = R, h = T;
}
break;
case T: if (C === Z && w === T && je + 2 !== R) {
if (33 === s.charCodeAt(je + 2))
Ve += s.substring(je, R + 1);
Re = "", h = 0;
}
}
}
if (0 === h) {
if (ge + d + o + j === 0 && t !== te && C !== W)
switch (C) {
case U:
case ae:
case _:
case ee:
case E:
case D:
if (0 === O) {
switch (w) {
case K:
case M:
case I:
case J:
Re += "\0";
break;
default: Re = "\0" + Re + (C === U ? "" : "\0");
}
we = 1;
}
else
switch (C) {
case D:
if (z + 7 === R && 108 === w)
z = 0;
O = ++y;
break;
case E: if (0 == (O = --y))
we = 1, Re += "\0";
}
break;
case K:
case M: switch (w) {
case re:
case B:
case q:
case W:
case U:
case ce:
case K:
case M:
case I:
case J: break;
default: if (0 === O)
we = 1, Re += "\0";
}
}
if (Te += Re, C !== M && C !== K)
$ = C;
}
}
m = w, w = C, R++;
} if (je = Ve.length, me > 0)
if (0 === je && 0 === Xe.length && 0 === a[0].length == false)
if (t !== ie || 1 === a.length && (ge > 0 ? Ee : Ge) === a[0])
je = a.join(",").length + 2; if (je > 0) {
if (f = 0 === ge && t !== te ? function (e) { for (var a, r, s = 0, t = e.length, i = Array(t); s < t; ++s) {
for (var f = e[s].split(l), n = "", o = 0, h = 0, u = 0, d = 0, b = f.length; o < b; ++o) {
if (0 === (h = (r = f[o]).length) && b > 1)
continue;
if (u = n.charCodeAt(n.length - 1), d = r.charCodeAt(0), a = "", 0 !== o)
switch (u) {
case T:
case ae:
case _:
case ee:
case M:
case D: break;
default: a = " ";
}
switch (d) {
case P: r = a + Ee;
case ae:
case _:
case ee:
case M:
case E:
case D: break;
case G:
r = a + r + Ee;
break;
case V:
switch (2 * r.charCodeAt(1) + 3 * r.charCodeAt(2)) {
case 530: if (Ce > 0) {
r = a + r.substring(8, h - 1);
break;
}
default: if (o < 1 || f[o - 1].length < 1)
r = a + Ee + r;
}
break;
case U: a = "";
default: if (h > 1 && r.indexOf(":") > 0)
r = a + r.replace(v, "$1" + Ee + "$2");
else
r = a + r + Ee;
}
n += r;
}
i[s] = n.replace(c, "").trim();
} return i; }(a) : a, ye > 0)
if (void 0 !== (n = Pe(Fe, Ve, f, e, pe, be, je, t, i, t)) && 0 === (Ve = n).length)
return Ye + Ve + Xe;
if (Ve = f.join(",") + "{" + Ve + "}", Ae * ke != 0) {
if (2 === Ae && !Le(Ve, 2))
ke = 0;
switch (ke) {
case le:
Ve = Ve.replace(k, ":" + S + "$1") + Ve;
break;
case ne: Ve = Ve.replace(p, "::" + N + "input-$1") + Ve.replace(p, "::" + S + "$1") + Ve.replace(p, ":" + F + "input-$1") + Ve;
}
ke = 0;
}
} return Ye + Ve + Xe; }
function Ie(e, a, r) { var c = a.trim().split(o), s = c, t = c.length, i = e.length; switch (i) {
case 0:
case 1:
for (var f = 0, n = 0 === i ? "" : e[0] + " "; f < t; ++f)
s[f] = Je(n, s[f], r, i).trim();
break;
default:
f = 0;
var l = 0;
for (s = []; f < t; ++f)
for (var h = 0; h < i; ++h)
s[l++] = Je(e[h] + " ", c[f], r, i).trim();
} return s; }
function Je(e, a, r, c) { var s = a, t = s.charCodeAt(0); if (t < 33)
t = (s = s.trim()).charCodeAt(0); switch (t) {
case P:
switch (ge + c) {
case 0:
case 1: if (0 === e.trim().length)
break;
default: return s.replace(h, "$1" + e.trim());
}
break;
case V: switch (s.charCodeAt(1)) {
case 103:
if (Ce > 0 && ge > 0)
return s.replace(u, "$1").replace(h, "$1" + Ge);
break;
default: return e.trim() + s.replace(h, "$1" + e.trim());
}
default: if (r * ge > 0 && s.indexOf("\f") > 0)
return s.replace(h, (e.charCodeAt(0) === V ? "" : "$1") + e.trim());
} return e + s; }
function Ke(e, a, r, c) { var l, o = 0, h = e + ";", u = 2 * a + 3 * r + 4 * c; if (944 === u)
return function (e) { var a = e.length, r = e.indexOf(":", 9) + 1, c = e.substring(0, r).trim(), s = e.substring(r, a - 1).trim(); switch (e.charCodeAt(9) * Be) {
case 0: break;
case Q: if (110 !== e.charCodeAt(10))
break;
default: for (var t = s.split((s = "", f)), i = 0, r = 0, a = t.length; i < a; r = 0, ++i) {
for (var l = t[i], o = l.split(n); l = o[r];) {
var h = l.charCodeAt(0);
if (1 === Be && (h > L && h < 90 || h > 96 && h < 123 || h === R || h === Q && l.charCodeAt(1) !== Q))
switch (isNaN(parseFloat(l)) + (-1 !== l.indexOf("("))) {
case 1: switch (l) {
case "infinite":
case "alternate":
case "backwards":
case "running":
case "normal":
case "forwards":
case "both":
case "none":
case "linear":
case "ease":
case "ease-in":
case "ease-out":
case "ease-in-out":
case "paused":
case "reverse":
case "alternate-reverse":
case "inherit":
case "initial":
case "unset":
case "step-start":
case "step-end": break;
default: l += De;
}
}
o[r++] = l;
}
s += (0 === i ? "" : ",") + o.join(" ");
}
} if (s = c + s + ";", 1 === Ae || 2 === Ae && Le(s, 1))
return N + s + s; return s; }(h);
else if (0 === Ae || 2 === Ae && !Le(h, 1))
return h; switch (u) {
case 1015: return 97 === h.charCodeAt(10) ? N + h + h : h;
case 951: return 116 === h.charCodeAt(3) ? N + h + h : h;
case 963: return 110 === h.charCodeAt(5) ? N + h + h : h;
case 1009: if (100 !== h.charCodeAt(4))
break;
case 969:
case 942: return N + h + h;
case 978: return N + h + S + h + h;
case 1019:
case 983: return N + h + S + h + F + h + h;
case 883:
if (h.charCodeAt(8) === Q)
return N + h + h;
if (h.indexOf("image-set(", 11) > 0)
return h.replace(z, "$1" + N + "$2") + h;
return h;
case 932:
if (h.charCodeAt(4) === Q)
switch (h.charCodeAt(5)) {
case 103: return N + "box-" + h.replace("-grow", "") + N + h + F + h.replace("grow", "positive") + h;
case 115: return N + h + F + h.replace("shrink", "negative") + h;
case 98: return N + h + F + h.replace("basis", "preferred-size") + h;
}
return N + h + F + h + h;
case 964: return N + h + F + "flex-" + h + h;
case 1023:
if (99 !== h.charCodeAt(8))
break;
return l = h.substring(h.indexOf(":", 15)).replace("flex-", "").replace("space-between", "justify"), N + "box-pack" + l + N + h + F + "flex-pack" + l + h;
case 1005: return t.test(h) ? h.replace(s, ":" + N) + h.replace(s, ":" + S) + h : h;
case 1e3:
switch (o = (l = h.substring(13).trim()).indexOf("-") + 1, l.charCodeAt(0) + l.charCodeAt(o)) {
case 226:
l = h.replace(m, "tb");
break;
case 232:
l = h.replace(m, "tb-rl");
break;
case 220:
l = h.replace(m, "lr");
break;
default: return h;
}
return N + h + F + l + h;
case 1017: if (-1 === h.indexOf("sticky", 9))
return h;
case 975:
switch (o = (h = e).length - 10, u = (l = (33 === h.charCodeAt(o) ? h.substring(0, o) : h).substring(e.indexOf(":", 7) + 1).trim()).charCodeAt(0) + (0 | l.charCodeAt(7))) {
case 203: if (l.charCodeAt(8) < 111)
break;
case 115:
h = h.replace(l, N + l) + ";" + h;
break;
case 207:
case 102: h = h.replace(l, N + (u > 102 ? "inline-" : "") + "box") + ";" + h.replace(l, N + l) + ";" + h.replace(l, F + l + "box") + ";" + h;
}
return h + ";";
case 938:
if (h.charCodeAt(5) === Q)
switch (h.charCodeAt(6)) {
case 105: return l = h.replace("-items", ""), N + h + N + "box-" + l + F + "flex-" + l + h;
case 115: return N + h + F + "flex-item-" + h.replace(y, "") + h;
default: return N + h + F + "flex-line-pack" + h.replace("align-content", "").replace(y, "") + h;
}
break;
case 973:
case 989: if (h.charCodeAt(3) !== Q || 122 === h.charCodeAt(4))
break;
case 931:
case 953:
if (true === j.test(e))
if (115 === (l = e.substring(e.indexOf(":") + 1)).charCodeAt(0))
return Ke(e.replace("stretch", "fill-available"), a, r, c).replace(":fill-available", ":stretch");
else
return h.replace(l, N + l) + h.replace(l, S + l.replace("fill-", "")) + h;
break;
case 962: if (h = N + h + (102 === h.charCodeAt(5) ? F + h : "") + h, r + c === 211 && 105 === h.charCodeAt(13) && h.indexOf("transform", 10) > 0)
return h.substring(0, h.indexOf(";", 27) + 1).replace(i, "$1" + N + "$2") + h;
} return h; }
function Le(e, a) { var r = e.indexOf(1 === a ? ":" : "{"), c = e.substring(0, 3 !== a ? r : 10), s = e.substring(r + 1, e.length - 1); return Oe(2 !== a ? c : c.replace(O, "$1"), s, a); }
function Me(e, a) { var r = Ke(a, a.charCodeAt(0), a.charCodeAt(1), a.charCodeAt(2)); return r !== a + ";" ? r.replace($, " or ($1)").substring(4) : "(" + a + ")"; }
function Pe(e, a, r, c, s, t, i, f, n, l) { for (var o, h = 0, u = a; h < ye; ++h)
switch (o = $e[h].call(Te, e, u, r, c, s, t, i, f, n, l)) {
case void 0:
case false:
case true:
case null: break;
default: u = o;
} if (u !== a)
return u; }
function Qe(e, a, r, c) { for (var s = a + 1; s < r; ++s)
switch (c.charCodeAt(s)) {
case Z:
if (e === T)
if (c.charCodeAt(s - 1) === T && a + 2 !== s)
return s + 1;
break;
case I: if (e === Z)
return s + 1;
} return s; }
function Re(e) { for (var a in e) {
var r = e[a];
switch (a) {
case "keyframe":
Be = 0 | r;
break;
case "global":
Ce = 0 | r;
break;
case "cascade":
ge = 0 | r;
break;
case "compress":
we = 0 | r;
break;
case "semicolon":
ve = 0 | r;
break;
case "preserve":
me = 0 | r;
break;
case "prefix": if (Oe = null, !r)
Ae = 0;
else if ("function" != typeof r)
Ae = 1;
else
Ae = 2, Oe = r;
}
} return Re; }
function Te(a, r) { if (void 0 !== this && this.constructor === Te)
return e(a); var s = a, t = s.charCodeAt(0); if (t < 33)
t = (s = s.trim()).charCodeAt(0); if (Be > 0)
De = s.replace(d, t === G ? "" : "-"); if (t = 1, 1 === ge)
Ge = s;
else
Ee = s; var i, f = [Ge]; if (ye > 0)
if (void 0 !== (i = Pe(ze, r, f, f, pe, be, 0, 0, 0, 0)) && "string" == typeof i)
r = i; var n = He(xe, f, r, 0, 0); if (ye > 0)
if (void 0 !== (i = Pe(je, n, f, f, pe, be, n.length, 0, 0, 0)) && "string" != typeof (n = i))
t = 0; return De = "", Ge = "", Ee = "", ke = 0, pe = 1, be = 1, we * t == 0 ? n : n.replace(c, "").replace(g, "").replace(A, "$1").replace(C, "$1").replace(w, " "); }
if (Te.use = function e(a) { switch (a) {
case void 0:
case null:
ye = $e.length = 0;
break;
default: if ("function" == typeof a)
$e[ye++] = a;
else if ("object" == typeof a)
for (var r = 0, c = a.length; r < c; ++r)
e(a[r]);
else
qe = 0 | !!a;
} return e; }, Te.set = Re, void 0 !== a)
Re(a);
return Te;
});
} // stylis-rule-sheet/index.js $fsx.f[93] = (module, exports) => { (function (factory) {
typeof exports === 'object' && typeof module !== 'undefined' ? (module['exports'] = factory()) :
typeof define === 'function' && define['amd'] ? define(factory()) :
(window['stylisRuleSheet'] = factory());
}(function () {
'use strict';
return function (insertRule) {
var delimiter = '/*|*/';
var needle = delimiter + '}';
function toSheet(block) {
if (block)
try {
insertRule(block + '}');
}
catch (e) { }
}
return function ruleSheet(context, content, selectors, parents, line, column, length, ns, depth, at) {
switch (context) {
case 1:
if (depth === 0 && content.charCodeAt(0) === 64)
return insertRule(content + ';'), ;
break;
case 2:
if (ns === 0)
return content + delimiter;
break;
case 3:
switch (ns) {
case 102:
case 112:
return insertRule(selectors[0] + content), ;
default:
return content + (at === 0 ? delimiter : );
}
case -2:
content.split(needle).forEach(toSheet);
}
};
};
}));
} // @emotion/unitless/dist/unitless.browser.esm.js $fsx.f[94] = (module, exports) => { "use strict"; Object.defineProperty(exports, "__esModule", { value: true }); var unitlessKeys = {
animationIterationCount: 1, borderImageOutset: 1, borderImageSlice: 1, borderImageWidth: 1, boxFlex: 1, boxFlexGroup: 1, boxOrdinalGroup: 1, columnCount: 1, columns: 1, flex: 1, flexGrow: 1, flexPositive: 1, flexShrink: 1, flexNegative: 1, flexOrder: 1, gridRow: 1, gridRowEnd: 1, gridRowSpan: 1, gridRowStart: 1, gridColumn: 1, gridColumnEnd: 1, gridColumnSpan: 1, gridColumnStart: 1, msGridRow: 1, msGridRowSpan: 1, msGridColumn: 1, msGridColumnSpan: 1, fontWeight: 1, lineHeight: 1, opacity: 1, order: 1, orphans: 1, tabSize: 1, widows: 1, zIndex: 1, zoom: 1, WebkitLineClamp: 1, fillOpacity: 1, floodOpacity: 1, stopOpacity: 1, strokeDasharray: 1, strokeDashoffset: 1, strokeMiterlimit: 1, strokeOpacity: 1, strokeWidth: 1
}; exports.default = unitlessKeys;
} // memoize-one/dist/memoize-one.esm.js $fsx.f[95] = (module, exports) => { "use strict"; Object.defineProperty(exports, "__esModule", { value: true }); function areInputsEqual(newInputs, lastInputs) {
if (newInputs.length !== lastInputs.length) {
return false;
}
for (var i = 0; i < newInputs.length; i++) {
if (newInputs[i] !== lastInputs[i]) {
return false;
}
}
return true;
} function memoizeOne(resultFn, isEqual) {
if (isEqual === void 0) {
isEqual = areInputsEqual;
}
var lastThis;
var lastArgs = [];
var lastResult;
var calledOnce = false;
function memoized() {
var newArgs = [];
for (var _i = 0; _i < arguments.length; _i++) {
newArgs[_i] = arguments[_i];
}
if (calledOnce && lastThis === this && isEqual(newArgs, lastArgs)) {
return lastResult;
}
lastResult = resultFn.apply(this, newArgs);
calledOnce = true;
lastThis = this;
lastArgs = newArgs;
return lastResult;
}
return memoized;
} exports.default = memoizeOne;
} // @emotion/is-prop-valid@0.8.3/dist/is-prop-valid.browser.esm.js $fsx.f[97] = (module, exports) => { "use strict"; Object.defineProperty(exports, "__esModule", { value: true }); const memoize_1 = $fsx.r(96); var reactPropsRegex = /^((children|dangerouslySetInnerHTML|key|ref|autoFocus|defaultValue|defaultChecked|innerHTML|suppressContentEditableWarning|suppressHydrationWarning|valueLink|accept|acceptCharset|accessKey|action|allow|allowUserMedia|allowPaymentRequest|allowFullScreen|allowTransparency|alt|async|autoComplete|autoPlay|capture|cellPadding|cellSpacing|challenge|charSet|checked|cite|classID|className|cols|colSpan|content|contentEditable|contextMenu|controls|controlsList|coords|crossOrigin|data|dateTime|decoding|default|defer|dir|disabled|download|draggable|encType|form|formAction|formEncType|formMethod|formNoValidate|formTarget|frameBorder|headers|height|hidden|high|href|hrefLang|htmlFor|httpEquiv|id|inputMode|integrity|is|keyParams|keyType|kind|label|lang|list|loading|loop|low|marginHeight|marginWidth|max|maxLength|media|mediaGroup|method|min|minLength|multiple|muted|name|nonce|noValidate|open|optimum|pattern|placeholder|playsInline|poster|preload|profile|radioGroup|readOnly|referrerPolicy|rel|required|reversed|role|rows|rowSpan|sandbox|scope|scoped|scrolling|seamless|selected|shape|size|sizes|slot|span|spellCheck|src|srcDoc|srcLang|srcSet|start|step|style|summary|tabIndex|target|title|type|useMap|value|width|wmode|wrap|about|datatype|inlist|prefix|property|resource|typeof|vocab|autoCapitalize|autoCorrect|autoSave|color|itemProp|itemScope|itemType|itemID|itemRef|results|security|unselectable|accentHeight|accumulate|additive|alignmentBaseline|allowReorder|alphabetic|amplitude|arabicForm|ascent|attributeName|attributeType|autoReverse|azimuth|baseFrequency|baselineShift|baseProfile|bbox|begin|bias|by|calcMode|capHeight|clip|clipPathUnits|clipPath|clipRule|colorInterpolation|colorInterpolationFilters|colorProfile|colorRendering|contentScriptType|contentStyleType|cursor|cx|cy|d|decelerate|descent|diffuseConstant|direction|display|divisor|dominantBaseline|dur|dx|dy|edgeMode|elevation|enableBackground|end|exponent|externalResourcesRequired|fill|fillOpacity|fillRule|filter|filterRes|filterUnits|floodColor|floodOpacity|focusable|fontFamily|fontSize|fontSizeAdjust|fontStretch|fontStyle|fontVariant|fontWeight|format|from|fr|fx|fy|g1|g2|glyphName|glyphOrientationHorizontal|glyphOrientationVertical|glyphRef|gradientTransform|gradientUnits|hanging|horizAdvX|horizOriginX|ideographic|imageRendering|in|in2|intercept|k|k1|k2|k3|k4|kernelMatrix|kernelUnitLength|kerning|keyPoints|keySplines|keyTimes|lengthAdjust|letterSpacing|lightingColor|limitingConeAngle|local|markerEnd|markerMid|markerStart|markerHeight|markerUnits|markerWidth|mask|maskContentUnits|maskUnits|mathematical|mode|numOctaves|offset|opacity|operator|order|orient|orientation|origin|overflow|overlinePosition|overlineThickness|panose1|paintOrder|pathLength|patternContentUnits|patternTransform|patternUnits|pointerEvents|points|pointsAtX|pointsAtY|pointsAtZ|preserveAlpha|preserveAspectRatio|primitiveUnits|r|radius|refX|refY|renderingIntent|repeatCount|repeatDur|requiredExtensions|requiredFeatures|restart|result|rotate|rx|ry|scale|seed|shapeRendering|slope|spacing|specularConstant|specularExponent|speed|spreadMethod|startOffset|stdDeviation|stemh|stemv|stitchTiles|stopColor|stopOpacity|strikethroughPosition|strikethroughThickness|string|stroke|strokeDasharray|strokeDashoffset|strokeLinecap|strokeLinejoin|strokeMiterlimit|strokeOpacity|strokeWidth|surfaceScale|systemLanguage|tableValues|targetX|targetY|textAnchor|textDecoration|textRendering|textLength|to|transform|u1|u2|underlinePosition|underlineThickness|unicode|unicodeBidi|unicodeRange|unitsPerEm|vAlphabetic|vHanging|vIdeographic|vMathematical|values|vectorEffect|version|vertAdvY|vertOriginX|vertOriginY|viewBox|viewTarget|visibility|widths|wordSpacing|writingMode|x|xHeight|x1|x2|xChannelSelector|xlinkActuate|xlinkArcrole|xlinkHref|xlinkRole|xlinkShow|xlinkTitle|xlinkType|xmlBase|xmlns|xmlnsXlink|xmlLang|xmlSpace|y|y1|y2|yChannelSelector|z|zoomAndPan|for|class|autofocus)|(([Dd][Aa][Tt][Aa]|[Aa][Rr][Ii][Aa]|x)-.*))$/; var index = memoize_1.default(function (prop) {
return reactPropsRegex.test(prop) || prop.charCodeAt(0) === 111
&& prop.charCodeAt(1) === 110
&& prop.charCodeAt(2) < 91;
}); exports.default = index;
} // @emotion/memoize@0.7.3/dist/memoize.browser.esm.js $fsx.f[96] = (module, exports) => { "use strict"; Object.defineProperty(exports, "__esModule", { value: true }); function memoize(fn) {
var cache = {};
return function (arg) {
if (cache[arg] === undefined)
cache[arg] = fn(arg);
return cache[arg];
};
} exports.default = memoize;
} // merge-anything/dist/index.esm.js $fsx.f[99] = (module, exports) => { "use strict"; Object.defineProperty(exports, "__esModule", { value: true }); const is_what_1 = $fsx.r(98); function assignProp(carry, key, newVal, originalObject) {
var propType = originalObject.propertyIsEnumerable(key)
? 'enumerable'
: 'nonenumerable';
if (propType === 'enumerable')
carry[key] = newVal;
if (propType === 'nonenumerable') {
Object.defineProperty(carry, key, {
value: newVal,
enumerable: false,
writable: true,
configurable: true
});
}
} function mergeRecursively(origin, newComer, extensions) {
if (!is_what_1.isPlainObject(newComer)) {
if (extensions && is_what_1.isArray(extensions)) {
extensions.forEach(function (extend) {
newComer = extend(origin, newComer);
});
}
return newComer;
}
var newObject = {};
if (is_what_1.isPlainObject(origin)) {
var props_1 = Object.getOwnPropertyNames(origin);
var symbols_1 = Object.getOwnPropertySymbols(origin);
newObject = props_1.concat(symbols_1).reduce(function (carry, key) {
var targetVal = origin[key];
if ((!is_what_1.isSymbol(key) && !Object.getOwnPropertyNames(newComer).includes(key)) ||
(is_what_1.isSymbol(key) && !Object.getOwnPropertySymbols(newComer).includes(key))) {
assignProp(carry, key, targetVal, origin);
}
return carry;
}, {});
}
var props = Object.getOwnPropertyNames(newComer);
var symbols = Object.getOwnPropertySymbols(newComer);
var result = props.concat(symbols).reduce(function (carry, key) {
var newVal = newComer[key];
var targetVal = (is_what_1.isPlainObject(origin))
? origin[key]
: undefined;
if (extensions && is_what_1.isArray(extensions)) {
extensions.forEach(function (extend) {
newVal = extend(targetVal, newVal);
});
}
if (targetVal !== undefined && is_what_1.isPlainObject(newVal)) {
newVal = mergeRecursively(targetVal, newVal, extensions);
}
assignProp(carry, key, newVal, newComer);
return carry;
}, newObject);
return result;
} function merge(origin) {
var newComers = [];
for (var _i = 1; _i < arguments.length; _i++) {
newComers[_i - 1] = arguments[_i];
}
var extensions = null;
var base = origin;
if (is_what_1.isPlainObject(origin) && origin.extensions && Object.keys(origin).length === 1) {
base = {};
extensions = origin.extensions;
}
return newComers.reduce(function (result, newComer) {
return mergeRecursively(result, newComer, extensions);
}, base);
} exports.merge = merge; function concatArrays(originVal, newVal) {
if (is_what_1.isArray(originVal) && is_what_1.isArray(newVal)) {
return originVal.concat(newVal);
}
return newVal;
} exports.concatArrays = concatArrays; exports.default = merge;
} // is-what/dist/index.esm.js $fsx.f[98] = (module, exports) => { "use strict"; Object.defineProperty(exports, "__esModule", { value: true }); function getType(payload) {
return Object.prototype.toString.call(payload).slice(8, -1);
} exports.getType = getType; function isUndefined(payload) {
return getType(payload) === 'Undefined';
} exports.isUndefined = isUndefined; function isNull(payload) {
return getType(payload) === 'Null';
} exports.isNull = isNull; function isPlainObject(payload) {
if (getType(payload) !== 'Object')
return false;
return (payload.constructor === Object && Object.getPrototypeOf(payload) === Object.prototype);
} exports.isPlainObject = isPlainObject; function isObject(payload) {
return isPlainObject(payload);
} exports.isObject = isObject; function isAnyObject(payload) {
return getType(payload) === 'Object';
} exports.isAnyObject = isAnyObject; function isObjectLike(payload) {
return isAnyObject(payload);
} exports.isObjectLike = isObjectLike; function isFunction(payload) {
return getType(payload) === 'Function';
} exports.isFunction = isFunction; function isArray(payload) {
return getType(payload) === 'Array';
} exports.isArray = isArray; function isString(payload) {
return getType(payload) === 'String';
} exports.isString = isString; function isFullString(payload) {
return isString(payload) && payload !== ;
} exports.isFullString = isFullString; function isEmptyString(payload) {
return payload === ;
} exports.isEmptyString = isEmptyString; function isNumber(payload) {
return (getType(payload) === 'Number' && !isNaN(payload));
} exports.isNumber = isNumber; function isBoolean(payload) {
return getType(payload) === 'Boolean';
} exports.isBoolean = isBoolean; function isRegExp(payload) {
return getType(payload) === 'RegExp';
} exports.isRegExp = isRegExp; function isDate(payload) {
return (getType(payload) === 'Date' && !isNaN(payload));
} exports.isDate = isDate; function isSymbol(payload) {
return (getType(payload) === 'Symbol');
} exports.isSymbol = isSymbol; function isPrimitive(payload) {
return (isBoolean(payload) ||
isNull(payload) ||
isUndefined(payload) ||
isNumber(payload) ||
isString(payload) ||
isSymbol(payload));
} exports.isPrimitive = isPrimitive; function isType(payload, type) {
if (!(type instanceof Function)) {
throw new TypeError('Type must be a function');
}
if (!type.hasOwnProperty('prototype')) {
throw new TypeError('Type is not a class');
}
var name = type.name;
return (getType(payload) === name) || Boolean(payload && (payload.constructor === type));
} exports.isType = isType;
} // jquery/dist/jquery.js $fsx.f[102] = (module, exports) => { (function (global, factory) {
if (typeof module === "object" && typeof module.exports === "object") {
module.exports = global.document ?
factory(global, true) :
function (w) {
if (!w.document) {
throw new Error("jQuery requires a window with a document");
}
return factory(w);
};
}
else {
factory(global);
}
}(typeof window !== "undefined" ? window : this, function (window, noGlobal) {
var deletedIds = [];
var slice = deletedIds.slice;
var concat = deletedIds.concat;
var push = deletedIds.push;
var indexOf = deletedIds.indexOf;
var class2type = {};
var toString = class2type.toString;
var hasOwn = class2type.hasOwnProperty;
var support = {};
var version = "1.11.1", jQuery = function (selector, context) {
return new jQuery.fn.init(selector, context);
}, rtrim = /^[\s\uFEFF\xA0]+|[\s\uFEFF\xA0]+$/g, rmsPrefix = /^-ms-/, rdashAlpha = /-([\da-z])/gi, fcamelCase = function (all, letter) {
return letter.toUpperCase();
};
jQuery.fn = jQuery.prototype = {
jquery: version,
constructor: jQuery,
selector: "",
length: 0,
toArray: function () {
return slice.call(this);
},
get: function (num) {
return num != null ?
(num < 0 ? this[num + this.length] : this[num]) :
slice.call(this);
},
pushStack: function (elems) {
var ret = jQuery.merge(this.constructor(), elems);
ret.prevObject = this;
ret.context = this.context;
return ret;
},
each: function (callback, args) {
return jQuery.each(this, callback, args);
},
map: function (callback) {
return this.pushStack(jQuery.map(this, function (elem, i) {
return callback.call(elem, i, elem);
}));
},
slice: function () {
return this.pushStack(slice.apply(this, arguments));
},
first: function () {
return this.eq(0);
},
last: function () {
return this.eq(-1);
},
eq: function (i) {
var len = this.length, j = +i + (i < 0 ? len : 0);
return this.pushStack(j >= 0 && j < len ? [this[j]] : []);
},
end: function () {
return this.prevObject || this.constructor(null);
},
push: push,
sort: deletedIds.sort,
splice: deletedIds.splice
};
jQuery.extend = jQuery.fn.extend = function () {
var src, copyIsArray, copy, name, options, clone, target = arguments[0] || {}, i = 1, length = arguments.length, deep = false;
if (typeof target === "boolean") {
deep = target;
target = arguments[i] || {};
i++;
}
if (typeof target !== "object" && !jQuery.isFunction(target)) {
target = {};
}
if (i === length) {
target = this;
i--;
}
for (; i < length; i++) {
if ((options = arguments[i]) != null) {
for (name in options) {
src = target[name];
copy = options[name];
if (target === copy) {
continue;
}
if (deep && copy && (jQuery.isPlainObject(copy) || (copyIsArray = jQuery.isArray(copy)))) {
if (copyIsArray) {
copyIsArray = false;
clone = src && jQuery.isArray(src) ? src : [];
}
else {
clone = src && jQuery.isPlainObject(src) ? src : {};
}
target[name] = jQuery.extend(deep, clone, copy);
}
else if (copy !== undefined) {
target[name] = copy;
}
}
}
}
return target;
};
jQuery.extend({
expando: "jQuery" + (version + Math.random()).replace(/\D/g, ""),
isReady: true,
error: function (msg) {
throw new Error(msg);
},
noop: function () { },
isFunction: function (obj) {
return jQuery.type(obj) === "function";
},
isArray: Array.isArray || function (obj) {
return jQuery.type(obj) === "array";
},
isWindow: function (obj) {
return obj != null && obj == obj.window;
},
isNumeric: function (obj) {
return !jQuery.isArray(obj) && obj - parseFloat(obj) >= 0;
},
isEmptyObject: function (obj) {
var name;
for (name in obj) {
return false;
}
return true;
},
isPlainObject: function (obj) {
var key;
if (!obj || jQuery.type(obj) !== "object" || obj.nodeType || jQuery.isWindow(obj)) {
return false;
}
try {
if (obj.constructor &&
!hasOwn.call(obj, "constructor") &&
!hasOwn.call(obj.constructor.prototype, "isPrototypeOf")) {
return false;
}
}
catch (e) {
return false;
}
if (support.ownLast) {
for (key in obj) {
return hasOwn.call(obj, key);
}
}
for (key in obj) { }
return key === undefined || hasOwn.call(obj, key);
},
type: function (obj) {
if (obj == null) {
return obj + "";
}
return typeof obj === "object" || typeof obj === "function" ?
class2type[toString.call(obj)] || "object" :
typeof obj;
},
globalEval: function (data) {
if (data && jQuery.trim(data)) {
(window.execScript || function (data) {
window["eval"].call(window, data);
})(data);
}
},
camelCase: function (string) {
return string.replace(rmsPrefix, "ms-").replace(rdashAlpha, fcamelCase);
},
nodeName: function (elem, name) {
return elem.nodeName && elem.nodeName.toLowerCase() === name.toLowerCase();
},
each: function (obj, callback, args) {
var value, i = 0, length = obj.length, isArray = isArraylike(obj);
if (args) {
if (isArray) {
for (; i < length; i++) {
value = callback.apply(obj[i], args);
if (value === false) {
break;
}
}
}
else {
for (i in obj) {
value = callback.apply(obj[i], args);
if (value === false) {
break;
}
}
}
}
else {
if (isArray) {
for (; i < length; i++) {
value = callback.call(obj[i], i, obj[i]);
if (value === false) {
break;
}
}
}
else {
for (i in obj) {
value = callback.call(obj[i], i, obj[i]);
if (value === false) {
break;
}
}
}
}
return obj;
},
trim: function (text) {
return text == null ?
"" :
(text + "").replace(rtrim, "");
},
makeArray: function (arr, results) {
var ret = results || [];
if (arr != null) {
if (isArraylike(Object(arr))) {
jQuery.merge(ret, typeof arr === "string" ?
[arr] : arr);
}
else {
push.call(ret, arr);
}
}
return ret;
},
inArray: function (elem, arr, i) {
var len;
if (arr) {
if (indexOf) {
return indexOf.call(arr, elem, i);
}
len = arr.length;
i = i ? i < 0 ? Math.max(0, len + i) : i : 0;
for (; i < len; i++) {
if (i in arr && arr[i] === elem) {
return i;
}
}
}
return -1;
},
merge: function (first, second) {
var len = +second.length, j = 0, i = first.length;
while (j < len) {
first[i++] = second[j++];
}
if (len !== len) {
while (second[j] !== undefined) {
first[i++] = second[j++];
}
}
first.length = i;
return first;
},
grep: function (elems, callback, invert) {
var callbackInverse, matches = [], i = 0, length = elems.length, callbackExpect = !invert;
for (; i < length; i++) {
callbackInverse = !callback(elems[i], i);
if (callbackInverse !== callbackExpect) {
matches.push(elems[i]);
}
}
return matches;
},
map: function (elems, callback, arg) {
var value, i = 0, length = elems.length, isArray = isArraylike(elems), ret = [];
if (isArray) {
for (; i < length; i++) {
value = callback(elems[i], i, arg);
if (value != null) {
ret.push(value);
}
}
}
else {
for (i in elems) {
value = callback(elems[i], i, arg);
if (value != null) {
ret.push(value);
}
}
}
return concat.apply([], ret);
},
guid: 1,
proxy: function (fn, context) {
var args, proxy, tmp;
if (typeof context === "string") {
tmp = fn[context];
context = fn;
fn = tmp;
}
if (!jQuery.isFunction(fn)) {
return undefined;
}
args = slice.call(arguments, 2);
proxy = function () {
return fn.apply(context || this, args.concat(slice.call(arguments)));
};
proxy.guid = fn.guid = fn.guid || jQuery.guid++;
return proxy;
},
now: function () {
return +(new Date());
},
support: support
});
jQuery.each("Boolean Number String Function Array Date RegExp Object Error".split(" "), function (i, name) {
class2type["[object " + name + "]"] = name.toLowerCase();
});
function isArraylike(obj) {
var length = obj.length, type = jQuery.type(obj);
if (type === "function" || jQuery.isWindow(obj)) {
return false;
}
if (obj.nodeType === 1 && length) {
return true;
}
return type === "array" || length === 0 ||
typeof length === "number" && length > 0 && (length - 1) in obj;
}
var Sizzle = (function (window) {
var i, support, Expr, getText, isXML, tokenize, compile, select, outermostContext, sortInput, hasDuplicate, setDocument, document, docElem, documentIsHTML, rbuggyQSA, rbuggyMatches, matches, contains, expando = "sizzle" + -(new Date()), preferredDoc = window.document, dirruns = 0, done = 0, classCache = createCache(), tokenCache = createCache(), compilerCache = createCache(), sortOrder = function (a, b) {
if (a === b) {
hasDuplicate = true;
}
return 0;
}, strundefined = typeof undefined, MAX_NEGATIVE = 1 << 31, hasOwn = ({}).hasOwnProperty, arr = [], pop = arr.pop, push_native = arr.push, push = arr.push, slice = arr.slice, indexOf = arr.indexOf || function (elem) {
var i = 0, len = this.length;
for (; i < len; i++) {
if (this[i] === elem) {
return i;
}
}
return -1;
}, booleans = "checked|selected|async|autofocus|autoplay|controls|defer|disabled|hidden|ismap|loop|multiple|open|readonly|required|scoped", whitespace = "[\\x20\\t\\r\\n\\f]", characterEncoding = "(?:\\\\.|[\\w-]|[^\\x00-\\xa0])+", identifier = characterEncoding.replace("w", "w#"), attributes = "\\[" + whitespace + "*(" + characterEncoding + ")(?:" + whitespace +
"*([*^$|!~]?=)" + whitespace +
"*(?:'((?:\\\\.|[^\\\\'])*)'|\"((?:\\\\.|[^\\\\\"])*)\"|(" + identifier + "))|)" + whitespace +
"*\\]", pseudos = ":(" + characterEncoding + ")(?:\\((" +
"('((?:\\\\.|[^\\\\'])*)'|\"((?:\\\\.|[^\\\\\"])*)\")|" +
"((?:\\\\.|[^\\\\()[\\]]|" + attributes + ")*)|" +
".*" +
")\\)|)", rtrim = new RegExp("^" + whitespace + "+|((?:^|[^\\\\])(?:\\\\.)*)" + whitespace + "+$", "g"), rcomma = new RegExp("^" + whitespace + "*," + whitespace + "*"), rcombinators = new RegExp("^" + whitespace + "*([>+~]|" + whitespace + ")" + whitespace + "*"), rattributeQuotes = new RegExp("=" + whitespace + "*([^\\]'\"]*?)" + whitespace + "*\\]", "g"), rpseudo = new RegExp(pseudos), ridentifier = new RegExp("^" + identifier + "$"), matchExpr = {
"ID": new RegExp("^#(" + characterEncoding + ")"),
"CLASS": new RegExp("^\\.(" + characterEncoding + ")"),
"TAG": new RegExp("^(" + characterEncoding.replace("w", "w*") + ")"),
"ATTR": new RegExp("^" + attributes),
"PSEUDO": new RegExp("^" + pseudos),
"CHILD": new RegExp("^:(only|first|last|nth|nth-last)-(child|of-type)(?:\\(" + whitespace +
"*(even|odd|(([+-]|)(\\d*)n|)" + whitespace + "*(?:([+-]|)" + whitespace +
"*(\\d+)|))" + whitespace + "*\\)|)", "i"),
"bool": new RegExp("^(?:" + booleans + ")$", "i"),
"needsContext": new RegExp("^" + whitespace + "*[>+~]|:(even|odd|eq|gt|lt|nth|first|last)(?:\\(" +
whitespace + "*((?:-\\d)?\\d*)" + whitespace + "*\\)|)(?=[^-]|$)", "i")
}, rinputs = /^(?:input|select|textarea|button)$/i, rheader = /^h\d$/i, rnative = /^[^{]+\{\s*\[native \w/, rquickExpr = /^(?:#([\w-]+)|(\w+)|\.([\w-]+))$/, rsibling = /[+~]/, rescape = /'|\\/g, runescape = new RegExp("\\\\([\\da-f]{1,6}" + whitespace + "?|(" + whitespace + ")|.)", "ig"), funescape = function (_, escaped, escapedWhitespace) {
var high = "0x" + escaped - 0x10000;
return high !== high || escapedWhitespace ?
escaped :
high < 0 ?
String.fromCharCode(high + 0x10000) :
String.fromCharCode(high >> 10 | 0xD800, high & 0x3FF | 0xDC00);
};
try {
push.apply((arr = slice.call(preferredDoc.childNodes)), preferredDoc.childNodes);
arr[preferredDoc.childNodes.length].nodeType;
}
catch (e) {
push = { apply: arr.length ?
function (target, els) {
push_native.apply(target, slice.call(els));
} :
function (target, els) {
var j = target.length, i = 0;
while ((target[j++] = els[i++])) { }
target.length = j - 1;
}
};
}
function Sizzle(selector, context, results, seed) {
var match, elem, m, nodeType, i, groups, old, nid, newContext, newSelector;
if ((context ? context.ownerDocument || context : preferredDoc) !== document) {
setDocument(context);
}
context = context || document;
results = results || [];
if (!selector || typeof selector !== "string") {
return results;
}
if ((nodeType = context.nodeType) !== 1 && nodeType !== 9) {
return [];
}
if (documentIsHTML && !seed) {
if ((match = rquickExpr.exec(selector))) {
if ((m = match[1])) {
if (nodeType === 9) {
elem = context.getElementById(m);
if (elem && elem.parentNode) {
if (elem.id === m) {
results.push(elem);
return results;
}
}
else {
return results;
}
}
else {
if (context.ownerDocument && (elem = context.ownerDocument.getElementById(m)) &&
contains(context, elem) && elem.id === m) {
results.push(elem);
return results;
}
}
}
else if (match[2]) {
push.apply(results, context.getElementsByTagName(selector));
return results;
}
else if ((m = match[3]) && support.getElementsByClassName && context.getElementsByClassName) {
push.apply(results, context.getElementsByClassName(m));
return results;
}
}
if (support.qsa && (!rbuggyQSA || !rbuggyQSA.test(selector))) {
nid = old = expando;
newContext = context;
newSelector = nodeType === 9 && selector;
if (nodeType === 1 && context.nodeName.toLowerCase() !== "object") {
groups = tokenize(selector);
if ((old = context.getAttribute("id"))) {
nid = old.replace(rescape, "\\$&");
}
else {
context.setAttribute("id", nid);
}
nid = "[id='" + nid + "'] ";
i = groups.length;
while (i--) {
groups[i] = nid + toSelector(groups[i]);
}
newContext = rsibling.test(selector) && testContext(context.parentNode) || context;
newSelector = groups.join(",");
}
if (newSelector) {
try {
push.apply(results, newContext.querySelectorAll(newSelector));
return results;
}
catch (qsaError) {
}
finally {
if (!old) {
context.removeAttribute("id");
}
}
}
}
}
return select(selector.replace(rtrim, "$1"), context, results, seed);
}
function createCache() {
var keys = [];
function cache(key, value) {
if (keys.push(key + " ") > Expr.cacheLength) {
delete cache[keys.shift()];
}
return (cache[key + " "] = value);
}
return cache;
}
function markFunction(fn) {
fn[expando] = true;
return fn;
}
function assert(fn) {
var div = document.createElement("div");
try {
return !!fn(div);
}
catch (e) {
return false;
}
finally {
if (div.parentNode) {
div.parentNode.removeChild(div);
}
div = null;
}
}
function addHandle(attrs, handler) {
var arr = attrs.split("|"), i = attrs.length;
while (i--) {
Expr.attrHandle[arr[i]] = handler;
}
}
function siblingCheck(a, b) {
var cur = b && a, diff = cur && a.nodeType === 1 && b.nodeType === 1 &&
(~b.sourceIndex || MAX_NEGATIVE) -
(~a.sourceIndex || MAX_NEGATIVE);
if (diff) {
return diff;
}
if (cur) {
while ((cur = cur.nextSibling)) {
if (cur === b) {
return -1;
}
}
}
return a ? 1 : -1;
}
function createInputPseudo(type) {
return function (elem) {
var name = elem.nodeName.toLowerCase();
return name === "input" && elem.type === type;
};
}
function createButtonPseudo(type) {
return function (elem) {
var name = elem.nodeName.toLowerCase();
return (name === "input" || name === "button") && elem.type === type;
};
}
function createPositionalPseudo(fn) {
return markFunction(function (argument) {
argument = +argument;
return markFunction(function (seed, matches) {
var j, matchIndexes = fn([], seed.length, argument), i = matchIndexes.length;
while (i--) {
if (seed[(j = matchIndexes[i])]) {
seed[j] = !(matches[j] = seed[j]);
}
}
});
});
}
function testContext(context) {
return context && typeof context.getElementsByTagName !== strundefined && context;
}
support = Sizzle.support = {};
isXML = Sizzle.isXML = function (elem) {
var documentElement = elem && (elem.ownerDocument || elem).documentElement;
return documentElement ? documentElement.nodeName !== "HTML" : false;
};
setDocument = Sizzle.setDocument = function (node) {
var hasCompare, doc = node ? node.ownerDocument || node : preferredDoc, parent = doc.defaultView;
if (doc === document || doc.nodeType !== 9 || !doc.documentElement) {
return document;
}
document = doc;
docElem = doc.documentElement;
documentIsHTML = !isXML(doc);
if (parent && parent !== parent.top) {
if (parent.addEventListener) {
parent.addEventListener("unload", function () {
setDocument();
}, false);
}
else if (parent.attachEvent) {
parent.attachEvent("onunload", function () {
setDocument();
});
}
}
support.attributes = assert(function (div) {
div.className = "i";
return !div.getAttribute("className");
});
support.getElementsByTagName = assert(function (div) {
div.appendChild(doc.createComment(""));
return !div.getElementsByTagName("*").length;
});
support.getElementsByClassName = rnative.test(doc.getElementsByClassName) && assert(function (div) {
div.innerHTML = "";
div.firstChild.className = "i";
return div.getElementsByClassName("i").length === 2;
});
support.getById = assert(function (div) {
docElem.appendChild(div).id = expando;
return !doc.getElementsByName || !doc.getElementsByName(expando).length;
});
if (support.getById) {
Expr.find["ID"] = function (id, context) {
if (typeof context.getElementById !== strundefined && documentIsHTML) {
var m = context.getElementById(id);
return m && m.parentNode ? [m] : [];
}
};
Expr.filter["ID"] = function (id) {
var attrId = id.replace(runescape, funescape);
return function (elem) {
return elem.getAttribute("id") === attrId;
};
};
}
else {
delete Expr.find["ID"];
Expr.filter["ID"] = function (id) {
var attrId = id.replace(runescape, funescape);
return function (elem) {
var node = typeof elem.getAttributeNode !== strundefined && elem.getAttributeNode("id");
return node && node.value === attrId;
};
};
}
Expr.find["TAG"] = support.getElementsByTagName ?
function (tag, context) {
if (typeof context.getElementsByTagName !== strundefined) {
return context.getElementsByTagName(tag);
}
} :
function (tag, context) {
var elem, tmp = [], i = 0, results = context.getElementsByTagName(tag);
if (tag === "*") {
while ((elem = results[i++])) {
if (elem.nodeType === 1) {
tmp.push(elem);
}
}
return tmp;
}
return results;
};
Expr.find["CLASS"] = support.getElementsByClassName && function (className, context) {
if (typeof context.getElementsByClassName !== strundefined && documentIsHTML) {
return context.getElementsByClassName(className);
}
};
rbuggyMatches = [];
rbuggyQSA = [];
if ((support.qsa = rnative.test(doc.querySelectorAll))) {
assert(function (div) {
div.innerHTML = "<select msallowclip=><option selected=></option></select>";
if (div.querySelectorAll("[msallowclip^=]").length) {
rbuggyQSA.push("[*^$]=" + whitespace + "*(?:|\"\")");
}
if (!div.querySelectorAll("[selected]").length) {
rbuggyQSA.push("\\[" + whitespace + "*(?:value|" + booleans + ")");
}
if (!div.querySelectorAll(":checked").length) {
rbuggyQSA.push(":checked");
}
});
assert(function (div) {
var input = doc.createElement("input");
input.setAttribute("type", "hidden");
div.appendChild(input).setAttribute("name", "D");
if (div.querySelectorAll("[name=d]").length) {
rbuggyQSA.push("name" + whitespace + "*[*^$|!~]?=");
}
if (!div.querySelectorAll(":enabled").length) {
rbuggyQSA.push(":enabled", ":disabled");
}
div.querySelectorAll("*,:x");
rbuggyQSA.push(",.*:");
});
}
if ((support.matchesSelector = rnative.test((matches = docElem.matches ||
docElem.webkitMatchesSelector ||
docElem.mozMatchesSelector ||
docElem.oMatchesSelector ||
docElem.msMatchesSelector)))) {
assert(function (div) {
support.disconnectedMatch = matches.call(div, "div");
matches.call(div, "[s!=]:x");
rbuggyMatches.push("!=", pseudos);
});
}
rbuggyQSA = rbuggyQSA.length && new RegExp(rbuggyQSA.join("|"));
rbuggyMatches = rbuggyMatches.length && new RegExp(rbuggyMatches.join("|"));
hasCompare = rnative.test(docElem.compareDocumentPosition);
contains = hasCompare || rnative.test(docElem.contains) ?
function (a, b) {
var adown = a.nodeType === 9 ? a.documentElement : a, bup = b && b.parentNode;
return a === bup || !!(bup && bup.nodeType === 1 && (adown.contains ?
adown.contains(bup) :
a.compareDocumentPosition && a.compareDocumentPosition(bup) & 16));
} :
function (a, b) {
if (b) {
while ((b = b.parentNode)) {
if (b === a) {
return true;
}
}
}
return false;
};
sortOrder = hasCompare ?
function (a, b) {
if (a === b) {
hasDuplicate = true;
return 0;
}
var compare = !a.compareDocumentPosition - !b.compareDocumentPosition;
if (compare) {
return compare;
}
compare = (a.ownerDocument || a) === (b.ownerDocument || b) ?
a.compareDocumentPosition(b) :
1;
if (compare & 1 ||
(!support.sortDetached && b.compareDocumentPosition(a) === compare)) {
if (a === doc || a.ownerDocument === preferredDoc && contains(preferredDoc, a)) {
return -1;
}
if (b === doc || b.ownerDocument === preferredDoc && contains(preferredDoc, b)) {
return 1;
}
return sortInput ?
(indexOf.call(sortInput, a) - indexOf.call(sortInput, b)) :
0;
}
return compare & 4 ? -1 : 1;
} :
function (a, b) {
if (a === b) {
hasDuplicate = true;
return 0;
}
var cur, i = 0, aup = a.parentNode, bup = b.parentNode, ap = [a], bp = [b];
if (!aup || !bup) {
return a === doc ? -1 :
b === doc ? 1 :
aup ? -1 :
bup ? 1 :
sortInput ?
(indexOf.call(sortInput, a) - indexOf.call(sortInput, b)) :
0;
}
else if (aup === bup) {
return siblingCheck(a, b);
}
cur = a;
while ((cur = cur.parentNode)) {
ap.unshift(cur);
}
cur = b;
while ((cur = cur.parentNode)) {
bp.unshift(cur);
}
while (ap[i] === bp[i]) {
i++;
}
return i ?
siblingCheck(ap[i], bp[i]) :
ap[i] === preferredDoc ? -1 :
bp[i] === preferredDoc ? 1 :
0;
};
return doc;
};
Sizzle.matches = function (expr, elements) {
return Sizzle(expr, null, null, elements);
};
Sizzle.matchesSelector = function (elem, expr) {
if ((elem.ownerDocument || elem) !== document) {
setDocument(elem);
}
expr = expr.replace(rattributeQuotes, "='$1']");
if (support.matchesSelector && documentIsHTML &&
(!rbuggyMatches || !rbuggyMatches.test(expr)) &&
(!rbuggyQSA || !rbuggyQSA.test(expr))) {
try {
var ret = matches.call(elem, expr);
if (ret || support.disconnectedMatch ||
elem.document && elem.document.nodeType !== 11) {
return ret;
}
}
catch (e) { }
}
return Sizzle(expr, document, null, [elem]).length > 0;
};
Sizzle.contains = function (context, elem) {
if ((context.ownerDocument || context) !== document) {
setDocument(context);
}
return contains(context, elem);
};
Sizzle.attr = function (elem, name) {
if ((elem.ownerDocument || elem) !== document) {
setDocument(elem);
}
var fn = Expr.attrHandle[name.toLowerCase()], val = fn && hasOwn.call(Expr.attrHandle, name.toLowerCase()) ?
fn(elem, name, !documentIsHTML) :
undefined;
return val !== undefined ?
val :
support.attributes || !documentIsHTML ?
elem.getAttribute(name) :
(val = elem.getAttributeNode(name)) && val.specified ?
val.value :
null;
};
Sizzle.error = function (msg) {
throw new Error("Syntax error, unrecognized expression: " + msg);
};
Sizzle.uniqueSort = function (results) {
var elem, duplicates = [], j = 0, i = 0;
hasDuplicate = !support.detectDuplicates;
sortInput = !support.sortStable && results.slice(0);
results.sort(sortOrder);
if (hasDuplicate) {
while ((elem = results[i++])) {
if (elem === results[i]) {
j = duplicates.push(i);
}
}
while (j--) {
results.splice(duplicates[j], 1);
}
}
sortInput = null;
return results;
};
getText = Sizzle.getText = function (elem) {
var node, ret = "", i = 0, nodeType = elem.nodeType;
if (!nodeType) {
while ((node = elem[i++])) {
ret += getText(node);
}
}
else if (nodeType === 1 || nodeType === 9 || nodeType === 11) {
if (typeof elem.textContent === "string") {
return elem.textContent;
}
else {
for (elem = elem.firstChild; elem; elem = elem.nextSibling) {
ret += getText(elem);
}
}
}
else if (nodeType === 3 || nodeType === 4) {
return elem.nodeValue;
}
return ret;
};
Expr = Sizzle.selectors = {
cacheLength: 50,
createPseudo: markFunction,
match: matchExpr,
attrHandle: {},
find: {},
relative: {
">": { dir: "parentNode", first: true },
" ": { dir: "parentNode" },
"+": { dir: "previousSibling", first: true },
"~": { dir: "previousSibling" }
},
preFilter: {
"ATTR": function (match) {
match[1] = match[1].replace(runescape, funescape);
match[3] = (match[3] || match[4] || match[5] || "").replace(runescape, funescape);
if (match[2] === "~=") {
match[3] = " " + match[3] + " ";
}
return match.slice(0, 4);
},
"CHILD": function (match) {
match[1] = match[1].toLowerCase();
if (match[1].slice(0, 3) === "nth") {
if (!match[3]) {
Sizzle.error(match[0]);
}
match[4] = +(match[4] ? match[5] + (match[6] || 1) : 2 * (match[3] === "even" || match[3] === "odd"));
match[5] = +((match[7] + match[8]) || match[3] === "odd");
}
else if (match[3]) {
Sizzle.error(match[0]);
}
return match;
},
"PSEUDO": function (match) {
var excess, unquoted = !match[6] && match[2];
if (matchExpr["CHILD"].test(match[0])) {
return null;
}
if (match[3]) {
match[2] = match[4] || match[5] || "";
}
else if (unquoted && rpseudo.test(unquoted) &&
(excess = tokenize(unquoted, true)) &&
(excess = unquoted.indexOf(")", unquoted.length - excess) - unquoted.length)) {
match[0] = match[0].slice(0, excess);
match[2] = unquoted.slice(0, excess);
}
return match.slice(0, 3);
}
},
filter: {
"TAG": function (nodeNameSelector) {
var nodeName = nodeNameSelector.replace(runescape, funescape).toLowerCase();
return nodeNameSelector === "*" ?
function () { return true; } :
function (elem) {
return elem.nodeName && elem.nodeName.toLowerCase() === nodeName;
};
},
"CLASS": function (className) {
var pattern = classCache[className + " "];
return pattern ||
(pattern = new RegExp("(^|" + whitespace + ")" + className + "(" + whitespace + "|$)")) &&
classCache(className, function (elem) {
return pattern.test(typeof elem.className === "string" && elem.className || typeof elem.getAttribute !== strundefined && elem.getAttribute("class") || "");
});
},
"ATTR": function (name, operator, check) {
return function (elem) {
var result = Sizzle.attr(elem, name);
if (result == null) {
return operator === "!=";
}
if (!operator) {
return true;
}
result += "";
return operator === "=" ? result === check :
operator === "!=" ? result !== check :
operator === "^=" ? check && result.indexOf(check) === 0 :
operator === "*=" ? check && result.indexOf(check) > -1 :
operator === "$=" ? check && result.slice(-check.length) === check :
operator === "~=" ? (" " + result + " ").indexOf(check) > -1 :
operator === "|=" ? result === check || result.slice(0, check.length + 1) === check + "-" :
false;
};
},
"CHILD": function (type, what, argument, first, last) {
var simple = type.slice(0, 3) !== "nth", forward = type.slice(-4) !== "last", ofType = what === "of-type";
return first === 1 && last === 0 ?
function (elem) {
return !!elem.parentNode;
} :
function (elem, context, xml) {
var cache, outerCache, node, diff, nodeIndex, start, dir = simple !== forward ? "nextSibling" : "previousSibling", parent = elem.parentNode, name = ofType && elem.nodeName.toLowerCase(), useCache = !xml && !ofType;
if (parent) {
if (simple) {
while (dir) {
node = elem;
while ((node = node[dir])) {
if (ofType ? node.nodeName.toLowerCase() === name : node.nodeType === 1) {
return false;
}
}
start = dir = type === "only" && !start && "nextSibling";
}
return true;
}
start = [forward ? parent.firstChild : parent.lastChild];
if (forward && useCache) {
outerCache = parent[expando] || (parent[expando] = {});
cache = outerCache[type] || [];
nodeIndex = cache[0] === dirruns && cache[1];
diff = cache[0] === dirruns && cache[2];
node = nodeIndex && parent.childNodes[nodeIndex];
while ((node = ++nodeIndex && node && node[dir] ||
(diff = nodeIndex = 0) || start.pop())) {
if (node.nodeType === 1 && ++diff && node === elem) {
outerCache[type] = [dirruns, nodeIndex, diff];
break;
}
}
}
else if (useCache && (cache = (elem[expando] || (elem[expando] = {}))[type]) && cache[0] === dirruns) {
diff = cache[1];
}
else {
while ((node = ++nodeIndex && node && node[dir] ||
(diff = nodeIndex = 0) || start.pop())) {
if ((ofType ? node.nodeName.toLowerCase() === name : node.nodeType === 1) && ++diff) {
if (useCache) {
(node[expando] || (node[expando] = {}))[type] = [dirruns, diff];
}
if (node === elem) {
break;
}
}
}
}
diff -= last;
return diff === first || (diff % first === 0 && diff / first >= 0);
}
};
},
"PSEUDO": function (pseudo, argument) {
var args, fn = Expr.pseudos[pseudo] || Expr.setFilters[pseudo.toLowerCase()] ||
Sizzle.error("unsupported pseudo: " + pseudo);
if (fn[expando]) {
return fn(argument);
}
if (fn.length > 1) {
args = [pseudo, pseudo, "", argument];
return Expr.setFilters.hasOwnProperty(pseudo.toLowerCase()) ?
markFunction(function (seed, matches) {
var idx, matched = fn(seed, argument), i = matched.length;
while (i--) {
idx = indexOf.call(seed, matched[i]);
seed[idx] = !(matches[idx] = matched[i]);
}
}) :
function (elem) {
return fn(elem, 0, args);
};
}
return fn;
}
},
pseudos: {
"not": markFunction(function (selector) {
var input = [], results = [], matcher = compile(selector.replace(rtrim, "$1"));
return matcher[expando] ?
markFunction(function (seed, matches, context, xml) {
var elem, unmatched = matcher(seed, null, xml, []), i = seed.length;
while (i--) {
if ((elem = unmatched[i])) {
seed[i] = !(matches[i] = elem);
}
}
}) :
function (elem, context, xml) {
input[0] = elem;
matcher(input, null, xml, results);
return !results.pop();
};
}),
"has": markFunction(function (selector) {
return function (elem) {
return Sizzle(selector, elem).length > 0;
};
}),
"contains": markFunction(function (text) {
return function (elem) {
return (elem.textContent || elem.innerText || getText(elem)).indexOf(text) > -1;
};
}),
"lang": markFunction(function (lang) {
if (!ridentifier.test(lang || "")) {
Sizzle.error("unsupported lang: " + lang);
}
lang = lang.replace(runescape, funescape).toLowerCase();
return function (elem) {
var elemLang;
do {
if ((elemLang = documentIsHTML ?
elem.lang :
elem.getAttribute("xml:lang") || elem.getAttribute("lang"))) {
elemLang = elemLang.toLowerCase();
return elemLang === lang || elemLang.indexOf(lang + "-") === 0;
}
} while ((elem = elem.parentNode) && elem.nodeType === 1);
return false;
};
}),
"target": function (elem) {
var hash = window.location && window.location.hash;
return hash && hash.slice(1) === elem.id;
},
"root": function (elem) {
return elem === docElem;
},
"focus": function (elem) {
return elem === document.activeElement && (!document.hasFocus || document.hasFocus()) && !!(elem.type || elem.href || ~elem.tabIndex);
},
"enabled": function (elem) {
return elem.disabled === false;
},
"disabled": function (elem) {
return elem.disabled === true;
},
"checked": function (elem) {
var nodeName = elem.nodeName.toLowerCase();
return (nodeName === "input" && !!elem.checked) || (nodeName === "option" && !!elem.selected);
},
"selected": function (elem) {
if (elem.parentNode) {
elem.parentNode.selectedIndex;
}
return elem.selected === true;
},
"empty": function (elem) {
for (elem = elem.firstChild; elem; elem = elem.nextSibling) {
if (elem.nodeType < 6) {
return false;
}
}
return true;
},
"parent": function (elem) {
return !Expr.pseudos["empty"](elem);
},
"header": function (elem) {
return rheader.test(elem.nodeName);
},
"input": function (elem) {
return rinputs.test(elem.nodeName);
},
"button": function (elem) {
var name = elem.nodeName.toLowerCase();
return name === "input" && elem.type === "button" || name === "button";
},
"text": function (elem) {
var attr;
return elem.nodeName.toLowerCase() === "input" &&
elem.type === "text" &&
((attr = elem.getAttribute("type")) == null || attr.toLowerCase() === "text");
},
"first": createPositionalPseudo(function () {
return [0];
}),
"last": createPositionalPseudo(function (matchIndexes, length) {
return [length - 1];
}),
"eq": createPositionalPseudo(function (matchIndexes, length, argument) {
return [argument < 0 ? argument + length : argument];
}),
"even": createPositionalPseudo(function (matchIndexes, length) {
var i = 0;
for (; i < length; i += 2) {
matchIndexes.push(i);
}
return matchIndexes;
}),
"odd": createPositionalPseudo(function (matchIndexes, length) {
var i = 1;
for (; i < length; i += 2) {
matchIndexes.push(i);
}
return matchIndexes;
}),
"lt": createPositionalPseudo(function (matchIndexes, length, argument) {
var i = argument < 0 ? argument + length : argument;
for (; --i >= 0;) {
matchIndexes.push(i);
}
return matchIndexes;
}),
"gt": createPositionalPseudo(function (matchIndexes, length, argument) {
var i = argument < 0 ? argument + length : argument;
for (; ++i < length;) {
matchIndexes.push(i);
}
return matchIndexes;
})
}
};
Expr.pseudos["nth"] = Expr.pseudos["eq"];
for (i in { radio: true, checkbox: true, file: true, password: true, image: true }) {
Expr.pseudos[i] = createInputPseudo(i);
}
for (i in { submit: true, reset: true }) {
Expr.pseudos[i] = createButtonPseudo(i);
}
function setFilters() { }
setFilters.prototype = Expr.filters = Expr.pseudos;
Expr.setFilters = new setFilters();
tokenize = Sizzle.tokenize = function (selector, parseOnly) {
var matched, match, tokens, type, soFar, groups, preFilters, cached = tokenCache[selector + " "];
if (cached) {
return parseOnly ? 0 : cached.slice(0);
}
soFar = selector;
groups = [];
preFilters = Expr.preFilter;
while (soFar) {
if (!matched || (match = rcomma.exec(soFar))) {
if (match) {
soFar = soFar.slice(match[0].length) || soFar;
}
groups.push((tokens = []));
}
matched = false;
if ((match = rcombinators.exec(soFar))) {
matched = match.shift();
tokens.push({
value: matched,
type: match[0].replace(rtrim, " ")
});
soFar = soFar.slice(matched.length);
}
for (type in Expr.filter) {
if ((match = matchExpr[type].exec(soFar)) && (!preFilters[type] ||
(match = preFilters[type](match)))) {
matched = match.shift();
tokens.push({
value: matched,
type: type,
matches: match
});
soFar = soFar.slice(matched.length);
}
}
if (!matched) {
break;
}
}
return parseOnly ?
soFar.length :
soFar ?
Sizzle.error(selector) :
tokenCache(selector, groups).slice(0);
};
function toSelector(tokens) {
var i = 0, len = tokens.length, selector = "";
for (; i < len; i++) {
selector += tokens[i].value;
}
return selector;
}
function addCombinator(matcher, combinator, base) {
var dir = combinator.dir, checkNonElements = base && dir === "parentNode", doneName = done++;
return combinator.first ?
function (elem, context, xml) {
while ((elem = elem[dir])) {
if (elem.nodeType === 1 || checkNonElements) {
return matcher(elem, context, xml);
}
}
} :
function (elem, context, xml) {
var oldCache, outerCache, newCache = [dirruns, doneName];
if (xml) {
while ((elem = elem[dir])) {
if (elem.nodeType === 1 || checkNonElements) {
if (matcher(elem, context, xml)) {
return true;
}
}
}
}
else {
while ((elem = elem[dir])) {
if (elem.nodeType === 1 || checkNonElements) {
outerCache = elem[expando] || (elem[expando] = {});
if ((oldCache = outerCache[dir]) &&
oldCache[0] === dirruns && oldCache[1] === doneName) {
return (newCache[2] = oldCache[2]);
}
else {
outerCache[dir] = newCache;
if ((newCache[2] = matcher(elem, context, xml))) {
return true;
}
}
}
}
}
};
}
function elementMatcher(matchers) {
return matchers.length > 1 ?
function (elem, context, xml) {
var i = matchers.length;
while (i--) {
if (!matchers[i](elem, context, xml)) {
return false;
}
}
return true;
} :
matchers[0];
}
function multipleContexts(selector, contexts, results) {
var i = 0, len = contexts.length;
for (; i < len; i++) {
Sizzle(selector, contexts[i], results);
}
return results;
}
function condense(unmatched, map, filter, context, xml) {
var elem, newUnmatched = [], i = 0, len = unmatched.length, mapped = map != null;
for (; i < len; i++) {
if ((elem = unmatched[i])) {
if (!filter || filter(elem, context, xml)) {
newUnmatched.push(elem);
if (mapped) {
map.push(i);
}
}
}
}
return newUnmatched;
}
function setMatcher(preFilter, selector, matcher, postFilter, postFinder, postSelector) {
if (postFilter && !postFilter[expando]) {
postFilter = setMatcher(postFilter);
}
if (postFinder && !postFinder[expando]) {
postFinder = setMatcher(postFinder, postSelector);
}
return markFunction(function (seed, results, context, xml) {
var temp, i, elem, preMap = [], postMap = [], preexisting = results.length, elems = seed || multipleContexts(selector || "*", context.nodeType ? [context] : context, []), matcherIn = preFilter && (seed || !selector) ?
condense(elems, preMap, preFilter, context, xml) :
elems, matcherOut = matcher ?
postFinder || (seed ? preFilter : preexisting || postFilter) ?
[] :
results :
matcherIn;
if (matcher) {
matcher(matcherIn, matcherOut, context, xml);
}
if (postFilter) {
temp = condense(matcherOut, postMap);
postFilter(temp, [], context, xml);
i = temp.length;
while (i--) {
if ((elem = temp[i])) {
matcherOut[postMap[i]] = !(matcherIn[postMap[i]] = elem);
}
}
}
if (seed) {
if (postFinder || preFilter) {
if (postFinder) {
temp = [];
i = matcherOut.length;
while (i--) {
if ((elem = matcherOut[i])) {
temp.push((matcherIn[i] = elem));
}
}
postFinder(null, (matcherOut = []), temp, xml);
}
i = matcherOut.length;
while (i--) {
if ((elem = matcherOut[i]) &&
(temp = postFinder ? indexOf.call(seed, elem) : preMap[i]) > -1) {
seed[temp] = !(results[temp] = elem);
}
}
}
}
else {
matcherOut = condense(matcherOut === results ?
matcherOut.splice(preexisting, matcherOut.length) :
matcherOut);
if (postFinder) {
postFinder(null, results, matcherOut, xml);
}
else {
push.apply(results, matcherOut);
}
}
});
}
function matcherFromTokens(tokens) {
var checkContext, matcher, j, len = tokens.length, leadingRelative = Expr.relative[tokens[0].type], implicitRelative = leadingRelative || Expr.relative[" "], i = leadingRelative ? 1 : 0, matchContext = addCombinator(function (elem) {
return elem === checkContext;
}, implicitRelative, true), matchAnyContext = addCombinator(function (elem) {
return indexOf.call(checkContext, elem) > -1;
}, implicitRelative, true), matchers = [function (elem, context, xml) {
return (!leadingRelative && (xml || context !== outermostContext)) || ((checkContext = context).nodeType ?
matchContext(elem, context, xml) :
matchAnyContext(elem, context, xml));
}];
for (; i < len; i++) {
if ((matcher = Expr.relative[tokens[i].type])) {
matchers = [addCombinator(elementMatcher(matchers), matcher)];
}
else {
matcher = Expr.filter[tokens[i].type].apply(null, tokens[i].matches);
if (matcher[expando]) {
j = ++i;
for (; j < len; j++) {
if (Expr.relative[tokens[j].type]) {
break;
}
}
return setMatcher(i > 1 && elementMatcher(matchers), i > 1 && toSelector(tokens.slice(0, i - 1).concat({ value: tokens[i - 2].type === " " ? "*" : "" })).replace(rtrim, "$1"), matcher, i < j && matcherFromTokens(tokens.slice(i, j)), j < len && matcherFromTokens((tokens = tokens.slice(j))), j < len && toSelector(tokens));
}
matchers.push(matcher);
}
}
return elementMatcher(matchers);
}
function matcherFromGroupMatchers(elementMatchers, setMatchers) {
var bySet = setMatchers.length > 0, byElement = elementMatchers.length > 0, superMatcher = function (seed, context, xml, results, outermost) {
var elem, j, matcher, matchedCount = 0, i = "0", unmatched = seed && [], setMatched = [], contextBackup = outermostContext, elems = seed || byElement && Expr.find["TAG"]("*", outermost), dirrunsUnique = (dirruns += contextBackup == null ? 1 : Math.random() || 0.1), len = elems.length;
if (outermost) {
outermostContext = context !== document && context;
}
for (; i !== len && (elem = elems[i]) != null; i++) {
if (byElement && elem) {
j = 0;
while ((matcher = elementMatchers[j++])) {
if (matcher(elem, context, xml)) {
results.push(elem);
break;
}
}
if (outermost) {
dirruns = dirrunsUnique;
}
}
if (bySet) {
if ((elem = !matcher && elem)) {
matchedCount--;
}
if (seed) {
unmatched.push(elem);
}
}
}
matchedCount += i;
if (bySet && i !== matchedCount) {
j = 0;
while ((matcher = setMatchers[j++])) {
matcher(unmatched, setMatched, context, xml);
}
if (seed) {
if (matchedCount > 0) {
while (i--) {
if (!(unmatched[i] || setMatched[i])) {
setMatched[i] = pop.call(results);
}
}
}
setMatched = condense(setMatched);
}
push.apply(results, setMatched);
if (outermost && !seed && setMatched.length > 0 &&
(matchedCount + setMatchers.length) > 1) {
Sizzle.uniqueSort(results);
}
}
if (outermost) {
dirruns = dirrunsUnique;
outermostContext = contextBackup;
}
return unmatched;
};
return bySet ?
markFunction(superMatcher) :
superMatcher;
}
compile = Sizzle.compile = function (selector, match) {
var i, setMatchers = [], elementMatchers = [], cached = compilerCache[selector + " "];
if (!cached) {
if (!match) {
match = tokenize(selector);
}
i = match.length;
while (i--) {
cached = matcherFromTokens(match[i]);
if (cached[expando]) {
setMatchers.push(cached);
}
else {
elementMatchers.push(cached);
}
}
cached = compilerCache(selector, matcherFromGroupMatchers(elementMatchers, setMatchers));
cached.selector = selector;
}
return cached;
};
select = Sizzle.select = function (selector, context, results, seed) {
var i, tokens, token, type, find, compiled = typeof selector === "function" && selector, match = !seed && tokenize((selector = compiled.selector || selector));
results = results || [];
if (match.length === 1) {
tokens = match[0] = match[0].slice(0);
if (tokens.length > 2 && (token = tokens[0]).type === "ID" &&
support.getById && context.nodeType === 9 && documentIsHTML &&
Expr.relative[tokens[1].type]) {
context = (Expr.find["ID"](token.matches[0].replace(runescape, funescape), context) || [])[0];
if (!context) {
return results;
}
else if (compiled) {
context = context.parentNode;
}
selector = selector.slice(tokens.shift().value.length);
}
i = matchExpr["needsContext"].test(selector) ? 0 : tokens.length;
while (i--) {
token = tokens[i];
if (Expr.relative[(type = token.type)]) {
break;
}
if ((find = Expr.find[type])) {
if ((seed = find(token.matches[0].replace(runescape, funescape), rsibling.test(tokens[0].type) && testContext(context.parentNode) || context))) {
tokens.splice(i, 1);
selector = seed.length && toSelector(tokens);
if (!selector) {
push.apply(results, seed);
return results;
}
break;
}
}
}
}
(compiled || compile(selector, match))(seed, context, !documentIsHTML, results, rsibling.test(selector) && testContext(context.parentNode) || context);
return results;
};
support.sortStable = expando.split("").sort(sortOrder).join("") === expando;
support.detectDuplicates = !!hasDuplicate;
setDocument();
support.sortDetached = assert(function (div1) {
return div1.compareDocumentPosition(document.createElement("div")) & 1;
});
if (!assert(function (div) {
div.innerHTML = "<a href='#'></a>";
return div.firstChild.getAttribute("href") === "#";
})) {
addHandle("type|href|height|width", function (elem, name, isXML) {
if (!isXML) {
return elem.getAttribute(name, name.toLowerCase() === "type" ? 1 : 2);
}
});
}
if (!support.attributes || !assert(function (div) {
div.innerHTML = "<input/>";
div.firstChild.setAttribute("value", "");
return div.firstChild.getAttribute("value") === "";
})) {
addHandle("value", function (elem, name, isXML) {
if (!isXML && elem.nodeName.toLowerCase() === "input") {
return elem.defaultValue;
}
});
}
if (!assert(function (div) {
return div.getAttribute("disabled") == null;
})) {
addHandle(booleans, function (elem, name, isXML) {
var val;
if (!isXML) {
return elem[name] === true ? name.toLowerCase() :
(val = elem.getAttributeNode(name)) && val.specified ?
val.value :
null;
}
});
}
return Sizzle;
})(window);
jQuery.find = Sizzle;
jQuery.expr = Sizzle.selectors;
jQuery.expr[":"] = jQuery.expr.pseudos;
jQuery.unique = Sizzle.uniqueSort;
jQuery.text = Sizzle.getText;
jQuery.isXMLDoc = Sizzle.isXML;
jQuery.contains = Sizzle.contains;
var rneedsContext = jQuery.expr.match.needsContext;
var rsingleTag = (/^<(\w+)\s*\/?>(?:<\/\1>|)$/);
var risSimple = /^.[^:#\[\.,]*$/;
function winnow(elements, qualifier, not) {
if (jQuery.isFunction(qualifier)) {
return jQuery.grep(elements, function (elem, i) {
return !!qualifier.call(elem, i, elem) !== not;
});
}
if (qualifier.nodeType) {
return jQuery.grep(elements, function (elem) {
return (elem === qualifier) !== not;
});
}
if (typeof qualifier === "string") {
if (risSimple.test(qualifier)) {
return jQuery.filter(qualifier, elements, not);
}
qualifier = jQuery.filter(qualifier, elements);
}
return jQuery.grep(elements, function (elem) {
return (jQuery.inArray(elem, qualifier) >= 0) !== not;
});
}
jQuery.filter = function (expr, elems, not) {
var elem = elems[0];
if (not) {
expr = ":not(" + expr + ")";
}
return elems.length === 1 && elem.nodeType === 1 ?
jQuery.find.matchesSelector(elem, expr) ? [elem] : [] :
jQuery.find.matches(expr, jQuery.grep(elems, function (elem) {
return elem.nodeType === 1;
}));
};
jQuery.fn.extend({
find: function (selector) {
var i, ret = [], self = this, len = self.length;
if (typeof selector !== "string") {
return this.pushStack(jQuery(selector).filter(function () {
for (i = 0; i < len; i++) {
if (jQuery.contains(self[i], this)) {
return true;
}
}
}));
}
for (i = 0; i < len; i++) {
jQuery.find(selector, self[i], ret);
}
ret = this.pushStack(len > 1 ? jQuery.unique(ret) : ret);
ret.selector = this.selector ? this.selector + " " + selector : selector;
return ret;
},
filter: function (selector) {
return this.pushStack(winnow(this, selector || [], false));
},
not: function (selector) {
return this.pushStack(winnow(this, selector || [], true));
},
is: function (selector) {
return !!winnow(this, typeof selector === "string" && rneedsContext.test(selector) ?
jQuery(selector) :
selector || [], false).length;
}
});
var rootjQuery, document = window.document, rquickExpr = /^(?:\s*(<[\w\W]+>)[^>]*|#([\w-]*))$/, init = jQuery.fn.init = function (selector, context) {
var match, elem;
if (!selector) {
return this;
}
if (typeof selector === "string") {
if (selector.charAt(0) === "<" && selector.charAt(selector.length - 1) === ">" && selector.length >= 3) {
match = [null, selector, null];
}
else {
match = rquickExpr.exec(selector);
}
if (match && (match[1] || !context)) {
if (match[1]) {
context = context instanceof jQuery ? context[0] : context;
jQuery.merge(this, jQuery.parseHTML(match[1], context && context.nodeType ? context.ownerDocument || context : document, true));
if (rsingleTag.test(match[1]) && jQuery.isPlainObject(context)) {
for (match in context) {
if (jQuery.isFunction(this[match])) {
this[match](context[match]);
}
else {
this.attr(match, context[match]);
}
}
}
return this;
}
else {
elem = document.getElementById(match[2]);
if (elem && elem.parentNode) {
if (elem.id !== match[2]) {
return rootjQuery.find(selector);
}
this.length = 1;
this[0] = elem;
}
this.context = document;
this.selector = selector;
return this;
}
}
else if (!context || context.jquery) {
return (context || rootjQuery).find(selector);
}
else {
return this.constructor(context).find(selector);
}
}
else if (selector.nodeType) {
this.context = this[0] = selector;
this.length = 1;
return this;
}
else if (jQuery.isFunction(selector)) {
return typeof rootjQuery.ready !== "undefined" ?
rootjQuery.ready(selector) :
selector(jQuery);
}
if (selector.selector !== undefined) {
this.selector = selector.selector;
this.context = selector.context;
}
return jQuery.makeArray(selector, this);
};
init.prototype = jQuery.fn;
rootjQuery = jQuery(document);
var rparentsprev = /^(?:parents|prev(?:Until|All))/, guaranteedUnique = {
children: true,
contents: true,
next: true,
prev: true
};
jQuery.extend({
dir: function (elem, dir, until) {
var matched = [], cur = elem[dir];
while (cur && cur.nodeType !== 9 && (until === undefined || cur.nodeType !== 1 || !jQuery(cur).is(until))) {
if (cur.nodeType === 1) {
matched.push(cur);
}
cur = cur[dir];
}
return matched;
},
sibling: function (n, elem) {
var r = [];
for (; n; n = n.nextSibling) {
if (n.nodeType === 1 && n !== elem) {
r.push(n);
}
}
return r;
}
});
jQuery.fn.extend({
has: function (target) {
var i, targets = jQuery(target, this), len = targets.length;
return this.filter(function () {
for (i = 0; i < len; i++) {
if (jQuery.contains(this, targets[i])) {
return true;
}
}
});
},
closest: function (selectors, context) {
var cur, i = 0, l = this.length, matched = [], pos = rneedsContext.test(selectors) || typeof selectors !== "string" ?
jQuery(selectors, context || this.context) :
0;
for (; i < l; i++) {
for (cur = this[i]; cur && cur !== context; cur = cur.parentNode) {
if (cur.nodeType < 11 && (pos ?
pos.index(cur) > -1 :
cur.nodeType === 1 &&
jQuery.find.matchesSelector(cur, selectors))) {
matched.push(cur);
break;
}
}
}
return this.pushStack(matched.length > 1 ? jQuery.unique(matched) : matched);
},
index: function (elem) {
if (!elem) {
return (this[0] && this[0].parentNode) ? this.first().prevAll().length : -1;
}
if (typeof elem === "string") {
return jQuery.inArray(this[0], jQuery(elem));
}
return jQuery.inArray(elem.jquery ? elem[0] : elem, this);
},
add: function (selector, context) {
return this.pushStack(jQuery.unique(jQuery.merge(this.get(), jQuery(selector, context))));
},
addBack: function (selector) {
return this.add(selector == null ?
this.prevObject : this.prevObject.filter(selector));
}
});
function sibling(cur, dir) {
do {
cur = cur[dir];
} while (cur && cur.nodeType !== 1);
return cur;
}
jQuery.each({
parent: function (elem) {
var parent = elem.parentNode;
return parent && parent.nodeType !== 11 ? parent : null;
},
parents: function (elem) {
return jQuery.dir(elem, "parentNode");
},
parentsUntil: function (elem, i, until) {
return jQuery.dir(elem, "parentNode", until);
},
next: function (elem) {
return sibling(elem, "nextSibling");
},
prev: function (elem) {
return sibling(elem, "previousSibling");
},
nextAll: function (elem) {
return jQuery.dir(elem, "nextSibling");
},
prevAll: function (elem) {
return jQuery.dir(elem, "previousSibling");
},
nextUntil: function (elem, i, until) {
return jQuery.dir(elem, "nextSibling", until);
},
prevUntil: function (elem, i, until) {
return jQuery.dir(elem, "previousSibling", until);
},
siblings: function (elem) {
return jQuery.sibling((elem.parentNode || {}).firstChild, elem);
},
children: function (elem) {
return jQuery.sibling(elem.firstChild);
},
contents: function (elem) {
return jQuery.nodeName(elem, "iframe") ?
elem.contentDocument || elem.contentWindow.document :
jQuery.merge([], elem.childNodes);
}
}, function (name, fn) {
jQuery.fn[name] = function (until, selector) {
var ret = jQuery.map(this, fn, until);
if (name.slice(-5) !== "Until") {
selector = until;
}
if (selector && typeof selector === "string") {
ret = jQuery.filter(selector, ret);
}
if (this.length > 1) {
if (!guaranteedUnique[name]) {
ret = jQuery.unique(ret);
}
if (rparentsprev.test(name)) {
ret = ret.reverse();
}
}
return this.pushStack(ret);
};
});
var rnotwhite = (/\S+/g);
var optionsCache = {};
function createOptions(options) {
var object = optionsCache[options] = {};
jQuery.each(options.match(rnotwhite) || [], function (_, flag) {
object[flag] = true;
});
return object;
}
jQuery.Callbacks = function (options) {
options = typeof options === "string" ?
(optionsCache[options] || createOptions(options)) :
jQuery.extend({}, options);
var firing, memory, fired, firingLength, firingIndex, firingStart, list = [], stack = !options.once && [], fire = function (data) {
memory = options.memory && data;
fired = true;
firingIndex = firingStart || 0;
firingStart = 0;
firingLength = list.length;
firing = true;
for (; list && firingIndex < firingLength; firingIndex++) {
if (list[firingIndex].apply(data[0], data[1]) === false && options.stopOnFalse) {
memory = false;
break;
}
}
firing = false;
if (list) {
if (stack) {
if (stack.length) {
fire(stack.shift());
}
}
else if (memory) {
list = [];
}
else {
self.disable();
}
}
}, self = {
add: function () {
if (list) {
var start = list.length;
(function add(args) {
jQuery.each(args, function (_, arg) {
var type = jQuery.type(arg);
if (type === "function") {
if (!options.unique || !self.has(arg)) {
list.push(arg);
}
}
else if (arg && arg.length && type !== "string") {
add(arg);
}
});
})(arguments);
if (firing) {
firingLength = list.length;
}
else if (memory) {
firingStart = start;
fire(memory);
}
}
return this;
},
remove: function () {
if (list) {
jQuery.each(arguments, function (_, arg) {
var index;
while ((index = jQuery.inArray(arg, list, index)) > -1) {
list.splice(index, 1);
if (firing) {
if (index <= firingLength) {
firingLength--;
}
if (index <= firingIndex) {
firingIndex--;
}
}
}
});
}
return this;
},
has: function (fn) {
return fn ? jQuery.inArray(fn, list) > -1 : !!(list && list.length);
},
empty: function () {
list = [];
firingLength = 0;
return this;
},
disable: function () {
list = stack = memory = undefined;
return this;
},
disabled: function () {
return !list;
},
lock: function () {
stack = undefined;
if (!memory) {
self.disable();
}
return this;
},
locked: function () {
return !stack;
},
fireWith: function (context, args) {
if (list && (!fired || stack)) {
args = args || [];
args = [context, args.slice ? args.slice() : args];
if (firing) {
stack.push(args);
}
else {
fire(args);
}
}
return this;
},
fire: function () {
self.fireWith(this, arguments);
return this;
},
fired: function () {
return !!fired;
}
};
return self;
};
jQuery.extend({
Deferred: function (func) {
var tuples = [
["resolve", "done", jQuery.Callbacks("once memory"), "resolved"],
["reject", "fail", jQuery.Callbacks("once memory"), "rejected"],
["notify", "progress", jQuery.Callbacks("memory")]
], state = "pending", promise = {
state: function () {
return state;
},
always: function () {
deferred.done(arguments).fail(arguments);
return this;
},
then: function () {
var fns = arguments;
return jQuery.Deferred(function (newDefer) {
jQuery.each(tuples, function (i, tuple) {
var fn = jQuery.isFunction(fns[i]) && fns[i];
deferred[tuple[1]](function () {
var returned = fn && fn.apply(this, arguments);
if (returned && jQuery.isFunction(returned.promise)) {
returned.promise()
.done(newDefer.resolve)
.fail(newDefer.reject)
.progress(newDefer.notify);
}
else {
newDefer[tuple[0] + "With"](this === promise ? newDefer.promise() : this, fn ? [returned] : arguments);
}
});
});
fns = null;
}).promise();
},
promise: function (obj) {
return obj != null ? jQuery.extend(obj, promise) : promise;
}
}, deferred = {};
promise.pipe = promise.then;
jQuery.each(tuples, function (i, tuple) {
var list = tuple[2], stateString = tuple[3];
promise[tuple[1]] = list.add;
if (stateString) {
list.add(function () {
state = stateString;
}, tuples[i ^ 1][2].disable, tuples[2][2].lock);
}
deferred[tuple[0]] = function () {
deferred[tuple[0] + "With"](this === deferred ? promise : this, arguments);
return this;
};
deferred[tuple[0] + "With"] = list.fireWith;
});
promise.promise(deferred);
if (func) {
func.call(deferred, deferred);
}
return deferred;
},
when: function (subordinate) {
var i = 0, resolveValues = slice.call(arguments), length = resolveValues.length, remaining = length !== 1 || (subordinate && jQuery.isFunction(subordinate.promise)) ? length : 0, deferred = remaining === 1 ? subordinate : jQuery.Deferred(), updateFunc = function (i, contexts, values) {
return function (value) {
contexts[i] = this;
values[i] = arguments.length > 1 ? slice.call(arguments) : value;
if (values === progressValues) {
deferred.notifyWith(contexts, values);
}
else if (!(--remaining)) {
deferred.resolveWith(contexts, values);
}
};
}, progressValues, progressContexts, resolveContexts;
if (length > 1) {
progressValues = new Array(length);
progressContexts = new Array(length);
resolveContexts = new Array(length);
for (; i < length; i++) {
if (resolveValues[i] && jQuery.isFunction(resolveValues[i].promise)) {
resolveValues[i].promise()
.done(updateFunc(i, resolveContexts, resolveValues))
.fail(deferred.reject)
.progress(updateFunc(i, progressContexts, progressValues));
}
else {
--remaining;
}
}
}
if (!remaining) {
deferred.resolveWith(resolveContexts, resolveValues);
}
return deferred.promise();
}
});
var readyList;
jQuery.fn.ready = function (fn) {
jQuery.ready.promise().done(fn);
return this;
};
jQuery.extend({
isReady: false,
readyWait: 1,
holdReady: function (hold) {
if (hold) {
jQuery.readyWait++;
}
else {
jQuery.ready(true);
}
},
ready: function (wait) {
if (wait === true ? --jQuery.readyWait : jQuery.isReady) {
return;
}
if (!document.body) {
return setTimeout(jQuery.ready);
}
jQuery.isReady = true;
if (wait !== true && --jQuery.readyWait > 0) {
return;
}
readyList.resolveWith(document, [jQuery]);
if (jQuery.fn.triggerHandler) {
jQuery(document).triggerHandler("ready");
jQuery(document).off("ready");
}
}
});
function detach() {
if (document.addEventListener) {
document.removeEventListener("DOMContentLoaded", completed, false);
window.removeEventListener("load", completed, false);
}
else {
document.detachEvent("onreadystatechange", completed);
window.detachEvent("onload", completed);
}
}
function completed() {
if (document.addEventListener || event.type === "load" || document.readyState === "complete") {
detach();
jQuery.ready();
}
}
jQuery.ready.promise = function (obj) {
if (!readyList) {
readyList = jQuery.Deferred();
if (document.readyState === "complete") {
setTimeout(jQuery.ready);
}
else if (document.addEventListener) {
document.addEventListener("DOMContentLoaded", completed, false);
window.addEventListener("load", completed, false);
}
else {
document.attachEvent("onreadystatechange", completed);
window.attachEvent("onload", completed);
var top = false;
try {
top = window.frameElement == null && document.documentElement;
}
catch (e) { }
if (top && top.doScroll) {
(function doScrollCheck() {
if (!jQuery.isReady) {
try {
top.doScroll("left");
}
catch (e) {
return setTimeout(doScrollCheck, 50);
}
detach();
jQuery.ready();
}
})();
}
}
}
return readyList.promise(obj);
};
var strundefined = typeof undefined;
var i;
for (i in jQuery(support)) {
break;
}
support.ownLast = i !== "0";
support.inlineBlockNeedsLayout = false;
jQuery(function () {
var val, div, body, container;
body = document.getElementsByTagName("body")[0];
if (!body || !body.style) {
return;
}
div = document.createElement("div");
container = document.createElement("div");
container.style.cssText = "position:absolute;border:0;width:0;height:0;top:0;left:-9999px";
body.appendChild(container).appendChild(div);
if (typeof div.style.zoom !== strundefined) {
div.style.cssText = "display:inline;margin:0;border:0;padding:1px;width:1px;zoom:1";
support.inlineBlockNeedsLayout = val = div.offsetWidth === 3;
if (val) {
body.style.zoom = 1;
}
}
body.removeChild(container);
});
(function () {
var div = document.createElement("div");
if (support.deleteExpando == null) {
support.deleteExpando = true;
try {
delete div.test;
}
catch (e) {
support.deleteExpando = false;
}
}
div = null;
})();
jQuery.acceptData = function (elem) {
var noData = jQuery.noData[(elem.nodeName + " ").toLowerCase()], nodeType = +elem.nodeType || 1;
return nodeType !== 1 && nodeType !== 9 ?
false :
!noData || noData !== true && elem.getAttribute("classid") === noData;
};
var rbrace = /^(?:\{[\w\W]*\}|\[[\w\W]*\])$/, rmultiDash = /([A-Z])/g;
function dataAttr(elem, key, data) {
if (data === undefined && elem.nodeType === 1) {
var name = "data-" + key.replace(rmultiDash, "-$1").toLowerCase();
data = elem.getAttribute(name);
if (typeof data === "string") {
try {
data = data === "true" ? true :
data === "false" ? false :
data === "null" ? null :
+data + "" === data ? +data :
rbrace.test(data) ? jQuery.parseJSON(data) :
data;
}
catch (e) { }
jQuery.data(elem, key, data);
}
else {
data = undefined;
}
}
return data;
}
function isEmptyDataObject(obj) {
var name;
for (name in obj) {
if (name === "data" && jQuery.isEmptyObject(obj[name])) {
continue;
}
if (name !== "toJSON") {
return false;
}
}
return true;
}
function internalData(elem, name, data, pvt) {
if (!jQuery.acceptData(elem)) {
return;
}
var ret, thisCache, internalKey = jQuery.expando, isNode = elem.nodeType, cache = isNode ? jQuery.cache : elem, id = isNode ? elem[internalKey] : elem[internalKey] && internalKey;
if ((!id || !cache[id] || (!pvt && !cache[id].data)) && data === undefined && typeof name === "string") {
return;
}
if (!id) {
if (isNode) {
id = elem[internalKey] = deletedIds.pop() || jQuery.guid++;
}
else {
id = internalKey;
}
}
if (!cache[id]) {
cache[id] = isNode ? {} : { toJSON: jQuery.noop };
}
if (typeof name === "object" || typeof name === "function") {
if (pvt) {
cache[id] = jQuery.extend(cache[id], name);
}
else {
cache[id].data = jQuery.extend(cache[id].data, name);
}
}
thisCache = cache[id];
if (!pvt) {
if (!thisCache.data) {
thisCache.data = {};
}
thisCache = thisCache.data;
}
if (data !== undefined) {
thisCache[jQuery.camelCase(name)] = data;
}
if (typeof name === "string") {
ret = thisCache[name];
if (ret == null) {
ret = thisCache[jQuery.camelCase(name)];
}
}
else {
ret = thisCache;
}
return ret;
}
function internalRemoveData(elem, name, pvt) {
if (!jQuery.acceptData(elem)) {
return;
}
var thisCache, i, isNode = elem.nodeType, cache = isNode ? jQuery.cache : elem, id = isNode ? elem[jQuery.expando] : jQuery.expando;
if (!cache[id]) {
return;
}
if (name) {
thisCache = pvt ? cache[id] : cache[id].data;
if (thisCache) {
if (!jQuery.isArray(name)) {
if (name in thisCache) {
name = [name];
}
else {
name = jQuery.camelCase(name);
if (name in thisCache) {
name = [name];
}
else {
name = name.split(" ");
}
}
}
else {
name = name.concat(jQuery.map(name, jQuery.camelCase));
}
i = name.length;
while (i--) {
delete thisCache[name[i]];
}
if (pvt ? !isEmptyDataObject(thisCache) : !jQuery.isEmptyObject(thisCache)) {
return;
}
}
}
if (!pvt) {
delete cache[id].data;
if (!isEmptyDataObject(cache[id])) {
return;
}
}
if (isNode) {
jQuery.cleanData([elem], true);
}
else if (support.deleteExpando || cache != cache.window) {
delete cache[id];
}
else {
cache[id] = null;
}
}
jQuery.extend({
cache: {},
noData: {
"applet ": true,
"embed ": true,
"object ": "clsid:D27CDB6E-AE6D-11cf-96B8-444553540000"
},
hasData: function (elem) {
elem = elem.nodeType ? jQuery.cache[elem[jQuery.expando]] : elem[jQuery.expando];
return !!elem && !isEmptyDataObject(elem);
},
data: function (elem, name, data) {
return internalData(elem, name, data);
},
removeData: function (elem, name) {
return internalRemoveData(elem, name);
},
_data: function (elem, name, data) {
return internalData(elem, name, data, true);
},
_removeData: function (elem, name) {
return internalRemoveData(elem, name, true);
}
});
jQuery.fn.extend({
data: function (key, value) {
var i, name, data, elem = this[0], attrs = elem && elem.attributes;
if (key === undefined) {
if (this.length) {
data = jQuery.data(elem);
if (elem.nodeType === 1 && !jQuery._data(elem, "parsedAttrs")) {
i = attrs.length;
while (i--) {
if (attrs[i]) {
name = attrs[i].name;
if (name.indexOf("data-") === 0) {
name = jQuery.camelCase(name.slice(5));
dataAttr(elem, name, data[name]);
}
}
}
jQuery._data(elem, "parsedAttrs", true);
}
}
return data;
}
if (typeof key === "object") {
return this.each(function () {
jQuery.data(this, key);
});
}
return arguments.length > 1 ?
this.each(function () {
jQuery.data(this, key, value);
}) :
elem ? dataAttr(elem, key, jQuery.data(elem, key)) : undefined;
},
removeData: function (key) {
return this.each(function () {
jQuery.removeData(this, key);
});
}
});
jQuery.extend({
queue: function (elem, type, data) {
var queue;
if (elem) {
type = (type || "fx") + "queue";
queue = jQuery._data(elem, type);
if (data) {
if (!queue || jQuery.isArray(data)) {
queue = jQuery._data(elem, type, jQuery.makeArray(data));
}
else {
queue.push(data);
}
}
return queue || [];
}
},
dequeue: function (elem, type) {
type = type || "fx";
var queue = jQuery.queue(elem, type), startLength = queue.length, fn = queue.shift(), hooks = jQuery._queueHooks(elem, type), next = function () {
jQuery.dequeue(elem, type);
};
if (fn === "inprogress") {
fn = queue.shift();
startLength--;
}
if (fn) {
if (type === "fx") {
queue.unshift("inprogress");
}
delete hooks.stop;
fn.call(elem, next, hooks);
}
if (!startLength && hooks) {
hooks.empty.fire();
}
},
_queueHooks: function (elem, type) {
var key = type + "queueHooks";
return jQuery._data(elem, key) || jQuery._data(elem, key, {
empty: jQuery.Callbacks("once memory").add(function () {
jQuery._removeData(elem, type + "queue");
jQuery._removeData(elem, key);
})
});
}
});
jQuery.fn.extend({
queue: function (type, data) {
var setter = 2;
if (typeof type !== "string") {
data = type;
type = "fx";
setter--;
}
if (arguments.length < setter) {
return jQuery.queue(this[0], type);
}
return data === undefined ?
this :
this.each(function () {
var queue = jQuery.queue(this, type, data);
jQuery._queueHooks(this, type);
if (type === "fx" && queue[0] !== "inprogress") {
jQuery.dequeue(this, type);
}
});
},
dequeue: function (type) {
return this.each(function () {
jQuery.dequeue(this, type);
});
},
clearQueue: function (type) {
return this.queue(type || "fx", []);
},
promise: function (type, obj) {
var tmp, count = 1, defer = jQuery.Deferred(), elements = this, i = this.length, resolve = function () {
if (!(--count)) {
defer.resolveWith(elements, [elements]);
}
};
if (typeof type !== "string") {
obj = type;
type = undefined;
}
type = type || "fx";
while (i--) {
tmp = jQuery._data(elements[i], type + "queueHooks");
if (tmp && tmp.empty) {
count++;
tmp.empty.add(resolve);
}
}
resolve();
return defer.promise(obj);
}
});
var pnum = (/[+-]?(?:\d*\.|)\d+(?:[eE][+-]?\d+|)/).source;
var cssExpand = ["Top", "Right", "Bottom", "Left"];
var isHidden = function (elem, el) {
elem = el || elem;
return jQuery.css(elem, "display") === "none" || !jQuery.contains(elem.ownerDocument, elem);
};
var access = jQuery.access = function (elems, fn, key, value, chainable, emptyGet, raw) {
var i = 0, length = elems.length, bulk = key == null;
if (jQuery.type(key) === "object") {
chainable = true;
for (i in key) {
jQuery.access(elems, fn, i, key[i], true, emptyGet, raw);
}
}
else if (value !== undefined) {
chainable = true;
if (!jQuery.isFunction(value)) {
raw = true;
}
if (bulk) {
if (raw) {
fn.call(elems, value);
fn = null;
}
else {
bulk = fn;
fn = function (elem, key, value) {
return bulk.call(jQuery(elem), value);
};
}
}
if (fn) {
for (; i < length; i++) {
fn(elems[i], key, raw ? value : value.call(elems[i], i, fn(elems[i], key)));
}
}
}
return chainable ?
elems :
bulk ?
fn.call(elems) :
length ? fn(elems[0], key) : emptyGet;
};
var rcheckableType = (/^(?:checkbox|radio)$/i);
(function () {
var input = document.createElement("input"), div = document.createElement("div"), fragment = document.createDocumentFragment();
div.innerHTML = " <link/> support.leadingWhitespace = div.firstChild.nodeType === 3;
support.tbody = !div.getElementsByTagName("tbody").length;
support.htmlSerialize = !!div.getElementsByTagName("link").length;
support.html5Clone =
document.createElement("nav").cloneNode(true).outerHTML !== "<:nav></:nav>";
input.type = "checkbox";
input.checked = true;
fragment.appendChild(input);
support.appendChecked = input.checked;
div.innerHTML = "<textarea>x</textarea>";
support.noCloneChecked = !!div.cloneNode(true).lastChild.defaultValue;
fragment.appendChild(div);
div.innerHTML = "<input type='radio' checked='checked' name='t'/>";
support.checkClone = div.cloneNode(true).cloneNode(true).lastChild.checked;
support.noCloneEvent = true;
if (div.attachEvent) {
div.attachEvent("onclick", function () {
support.noCloneEvent = false;
});
div.cloneNode(true).click();
}
if (support.deleteExpando == null) {
support.deleteExpando = true;
try {
delete div.test;
}
catch (e) {
support.deleteExpando = false;
}
}
})();
(function () {
var i, eventName, div = document.createElement("div");
for (i in { submit: true, change: true, focusin: true }) {
eventName = "on" + i;
if (!(support[i + "Bubbles"] = eventName in window)) {
div.setAttribute(eventName, "t");
support[i + "Bubbles"] = div.attributes[eventName].expando === false;
}
}
div = null;
})();
var rformElems = /^(?:input|select|textarea)$/i, rkeyEvent = /^key/, rmouseEvent = /^(?:mouse|pointer|contextmenu)|click/, rfocusMorph = /^(?:focusinfocus|focusoutblur)$/, rtypenamespace = /^([^.]*)(?:\.(.+)|)$/;
function returnTrue() {
return true;
}
function returnFalse() {
return false;
}
function safeActiveElement() {
try {
return document.activeElement;
}
catch (err) { }
}
jQuery.event = {
global: {},
add: function (elem, types, handler, data, selector) {
var tmp, events, t, handleObjIn, special, eventHandle, handleObj, handlers, type, namespaces, origType, elemData = jQuery._data(elem);
if (!elemData) {
return;
}
if (handler.handler) {
handleObjIn = handler;
handler = handleObjIn.handler;
selector = handleObjIn.selector;
}
if (!handler.guid) {
handler.guid = jQuery.guid++;
}
if (!(events = elemData.events)) {
events = elemData.events = {};
}
if (!(eventHandle = elemData.handle)) {
eventHandle = elemData.handle = function (e) {
return typeof jQuery !== strundefined && (!e || jQuery.event.triggered !== e.type) ?
jQuery.event.dispatch.apply(eventHandle.elem, arguments) :
undefined;
};
eventHandle.elem = elem;
}
types = (types || "").match(rnotwhite) || [""];
t = types.length;
while (t--) {
tmp = rtypenamespace.exec(types[t]) || [];
type = origType = tmp[1];
namespaces = (tmp[2] || "").split(".").sort();
if (!type) {
continue;
}
special = jQuery.event.special[type] || {};
type = (selector ? special.delegateType : special.bindType) || type;
special = jQuery.event.special[type] || {};
handleObj = jQuery.extend({
type: type,
origType: origType,
data: data,
handler: handler,
guid: handler.guid,
selector: selector,
needsContext: selector && jQuery.expr.match.needsContext.test(selector),
namespace: namespaces.join(".")
}, handleObjIn);
if (!(handlers = events[type])) {
handlers = events[type] = [];
handlers.delegateCount = 0;
if (!special.setup || special.setup.call(elem, data, namespaces, eventHandle) === false) {
if (elem.addEventListener) {
elem.addEventListener(type, eventHandle, false);
}
else if (elem.attachEvent) {
elem.attachEvent("on" + type, eventHandle);
}
}
}
if (special.add) {
special.add.call(elem, handleObj);
if (!handleObj.handler.guid) {
handleObj.handler.guid = handler.guid;
}
}
if (selector) {
handlers.splice(handlers.delegateCount++, 0, handleObj);
}
else {
handlers.push(handleObj);
}
jQuery.event.global[type] = true;
}
elem = null;
},
remove: function (elem, types, handler, selector, mappedTypes) {
var j, handleObj, tmp, origCount, t, events, special, handlers, type, namespaces, origType, elemData = jQuery.hasData(elem) && jQuery._data(elem);
if (!elemData || !(events = elemData.events)) {
return;
}
types = (types || "").match(rnotwhite) || [""];
t = types.length;
while (t--) {
tmp = rtypenamespace.exec(types[t]) || [];
type = origType = tmp[1];
namespaces = (tmp[2] || "").split(".").sort();
if (!type) {
for (type in events) {
jQuery.event.remove(elem, type + types[t], handler, selector, true);
}
continue;
}
special = jQuery.event.special[type] || {};
type = (selector ? special.delegateType : special.bindType) || type;
handlers = events[type] || [];
tmp = tmp[2] && new RegExp("(^|\\.)" + namespaces.join("\\.(?:.*\\.|)") + "(\\.|$)");
origCount = j = handlers.length;
while (j--) {
handleObj = handlers[j];
if ((mappedTypes || origType === handleObj.origType) &&
(!handler || handler.guid === handleObj.guid) &&
(!tmp || tmp.test(handleObj.namespace)) &&
(!selector || selector === handleObj.selector || selector === "**" && handleObj.selector)) {
handlers.splice(j, 1);
if (handleObj.selector) {
handlers.delegateCount--;
}
if (special.remove) {
special.remove.call(elem, handleObj);
}
}
}
if (origCount && !handlers.length) {
if (!special.teardown || special.teardown.call(elem, namespaces, elemData.handle) === false) {
jQuery.removeEvent(elem, type, elemData.handle);
}
delete events[type];
}
}
if (jQuery.isEmptyObject(events)) {
delete elemData.handle;
jQuery._removeData(elem, "events");
}
},
trigger: function (event, data, elem, onlyHandlers) {
var handle, ontype, cur, bubbleType, special, tmp, i, eventPath = [elem || document], type = hasOwn.call(event, "type") ? event.type : event, namespaces = hasOwn.call(event, "namespace") ? event.namespace.split(".") : [];
cur = tmp = elem = elem || document;
if (elem.nodeType === 3 || elem.nodeType === 8) {
return;
}
if (rfocusMorph.test(type + jQuery.event.triggered)) {
return;
}
if (type.indexOf(".") >= 0) {
namespaces = type.split(".");
type = namespaces.shift();
namespaces.sort();
}
ontype = type.indexOf(":") < 0 && "on" + type;
event = event[jQuery.expando] ?
event :
new jQuery.Event(type, typeof event === "object" && event);
event.isTrigger = onlyHandlers ? 2 : 3;
event.namespace = namespaces.join(".");
event.namespace_re = event.namespace ?
new RegExp("(^|\\.)" + namespaces.join("\\.(?:.*\\.|)") + "(\\.|$)") :
null;
event.result = undefined;
if (!event.target) {
event.target = elem;
}
data = data == null ?
[event] :
jQuery.makeArray(data, [event]);
special = jQuery.event.special[type] || {};
if (!onlyHandlers && special.trigger && special.trigger.apply(elem, data) === false) {
return;
}
if (!onlyHandlers && !special.noBubble && !jQuery.isWindow(elem)) {
bubbleType = special.delegateType || type;
if (!rfocusMorph.test(bubbleType + type)) {
cur = cur.parentNode;
}
for (; cur; cur = cur.parentNode) {
eventPath.push(cur);
tmp = cur;
}
if (tmp === (elem.ownerDocument || document)) {
eventPath.push(tmp.defaultView || tmp.parentWindow || window);
}
}
i = 0;
while ((cur = eventPath[i++]) && !event.isPropagationStopped()) {
event.type = i > 1 ?
bubbleType :
special.bindType || type;
handle = (jQuery._data(cur, "events") || {})[event.type] && jQuery._data(cur, "handle");
if (handle) {
handle.apply(cur, data);
}
handle = ontype && cur[ontype];
if (handle && handle.apply && jQuery.acceptData(cur)) {
event.result = handle.apply(cur, data);
if (event.result === false) {
event.preventDefault();
}
}
}
event.type = type;
if (!onlyHandlers && !event.isDefaultPrevented()) {
if ((!special._default || special._default.apply(eventPath.pop(), data) === false) &&
jQuery.acceptData(elem)) {
if (ontype && elem[type] && !jQuery.isWindow(elem)) {
tmp = elem[ontype];
if (tmp) {
elem[ontype] = null;
}
jQuery.event.triggered = type;
try {
elem[type]();
}
catch (e) {
}
jQuery.event.triggered = undefined;
if (tmp) {
elem[ontype] = tmp;
}
}
}
}
return event.result;
},
dispatch: function (event) {
event = jQuery.event.fix(event);
var i, ret, handleObj, matched, j, handlerQueue = [], args = slice.call(arguments), handlers = (jQuery._data(this, "events") || {})[event.type] || [], special = jQuery.event.special[event.type] || {};
args[0] = event;
event.delegateTarget = this;
if (special.preDispatch && special.preDispatch.call(this, event) === false) {
return;
}
handlerQueue = jQuery.event.handlers.call(this, event, handlers);
i = 0;
while ((matched = handlerQueue[i++]) && !event.isPropagationStopped()) {
event.currentTarget = matched.elem;
j = 0;
while ((handleObj = matched.handlers[j++]) && !event.isImmediatePropagationStopped()) {
if (!event.namespace_re || event.namespace_re.test(handleObj.namespace)) {
event.handleObj = handleObj;
event.data = handleObj.data;
ret = ((jQuery.event.special[handleObj.origType] || {}).handle || handleObj.handler)
.apply(matched.elem, args);
if (ret !== undefined) {
if ((event.result = ret) === false) {
event.preventDefault();
event.stopPropagation();
}
}
}
}
}
if (special.postDispatch) {
special.postDispatch.call(this, event);
}
return event.result;
},
handlers: function (event, handlers) {
var sel, handleObj, matches, i, handlerQueue = [], delegateCount = handlers.delegateCount, cur = event.target;
if (delegateCount && cur.nodeType && (!event.button || event.type !== "click")) {
for (; cur != this; cur = cur.parentNode || this) {
if (cur.nodeType === 1 && (cur.disabled !== true || event.type !== "click")) {
matches = [];
for (i = 0; i < delegateCount; i++) {
handleObj = handlers[i];
sel = handleObj.selector + " ";
if (matches[sel] === undefined) {
matches[sel] = handleObj.needsContext ?
jQuery(sel, this).index(cur) >= 0 :
jQuery.find(sel, this, null, [cur]).length;
}
if (matches[sel]) {
matches.push(handleObj);
}
}
if (matches.length) {
handlerQueue.push({ elem: cur, handlers: matches });
}
}
}
}
if (delegateCount < handlers.length) {
handlerQueue.push({ elem: this, handlers: handlers.slice(delegateCount) });
}
return handlerQueue;
},
fix: function (event) {
if (event[jQuery.expando]) {
return event;
}
var i, prop, copy, type = event.type, originalEvent = event, fixHook = this.fixHooks[type];
if (!fixHook) {
this.fixHooks[type] = fixHook =
rmouseEvent.test(type) ? this.mouseHooks :
rkeyEvent.test(type) ? this.keyHooks :
{};
}
copy = fixHook.props ? this.props.concat(fixHook.props) : this.props;
event = new jQuery.Event(originalEvent);
i = copy.length;
while (i--) {
prop = copy[i];
event[prop] = originalEvent[prop];
}
if (!event.target) {
event.target = originalEvent.srcElement || document;
}
if (event.target.nodeType === 3) {
event.target = event.target.parentNode;
}
event.metaKey = !!event.metaKey;
return fixHook.filter ? fixHook.filter(event, originalEvent) : event;
},
props: "altKey bubbles cancelable ctrlKey currentTarget eventPhase metaKey relatedTarget shiftKey target timeStamp view which".split(" "),
fixHooks: {},
keyHooks: {
props: "char charCode key keyCode".split(" "),
filter: function (event, original) {
if (event.which == null) {
event.which = original.charCode != null ? original.charCode : original.keyCode;
}
return event;
}
},
mouseHooks: {
props: "button buttons clientX clientY fromElement offsetX offsetY pageX pageY screenX screenY toElement".split(" "),
filter: function (event, original) {
var body, eventDoc, doc, button = original.button, fromElement = original.fromElement;
if (event.pageX == null && original.clientX != null) {
eventDoc = event.target.ownerDocument || document;
doc = eventDoc.documentElement;
body = eventDoc.body;
event.pageX = original.clientX + (doc && doc.scrollLeft || body && body.scrollLeft || 0) - (doc && doc.clientLeft || body && body.clientLeft || 0);
event.pageY = original.clientY + (doc && doc.scrollTop || body && body.scrollTop || 0) - (doc && doc.clientTop || body && body.clientTop || 0);
}
if (!event.relatedTarget && fromElement) {
event.relatedTarget = fromElement === event.target ? original.toElement : fromElement;
}
if (!event.which && button !== undefined) {
event.which = (button & 1 ? 1 : (button & 2 ? 3 : (button & 4 ? 2 : 0)));
}
return event;
}
},
special: {
load: {
noBubble: true
},
focus: {
trigger: function () {
if (this !== safeActiveElement() && this.focus) {
try {
this.focus();
return false;
}
catch (e) {
}
}
},
delegateType: "focusin"
},
blur: {
trigger: function () {
if (this === safeActiveElement() && this.blur) {
this.blur();
return false;
}
},
delegateType: "focusout"
},
click: {
trigger: function () {
if (jQuery.nodeName(this, "input") && this.type === "checkbox" && this.click) {
this.click();
return false;
}
},
_default: function (event) {
return jQuery.nodeName(event.target, "a");
}
},
beforeunload: {
postDispatch: function (event) {
if (event.result !== undefined && event.originalEvent) {
event.originalEvent.returnValue = event.result;
}
}
}
},
simulate: function (type, elem, event, bubble) {
var e = jQuery.extend(new jQuery.Event(), event, {
type: type,
isSimulated: true,
originalEvent: {}
});
if (bubble) {
jQuery.event.trigger(e, null, elem);
}
else {
jQuery.event.dispatch.call(elem, e);
}
if (e.isDefaultPrevented()) {
event.preventDefault();
}
}
};
jQuery.removeEvent = document.removeEventListener ?
function (elem, type, handle) {
if (elem.removeEventListener) {
elem.removeEventListener(type, handle, false);
}
} :
function (elem, type, handle) {
var name = "on" + type;
if (elem.detachEvent) {
if (typeof elem[name] === strundefined) {
elem[name] = null;
}
elem.detachEvent(name, handle);
}
};
jQuery.Event = function (src, props) {
if (!(this instanceof jQuery.Event)) {
return new jQuery.Event(src, props);
}
if (src && src.type) {
this.originalEvent = src;
this.type = src.type;
this.isDefaultPrevented = src.defaultPrevented ||
src.defaultPrevented === undefined &&
src.returnValue === false ?
returnTrue :
returnFalse;
}
else {
this.type = src;
}
if (props) {
jQuery.extend(this, props);
}
this.timeStamp = src && src.timeStamp || jQuery.now();
this[jQuery.expando] = true;
};
jQuery.Event.prototype = {
isDefaultPrevented: returnFalse,
isPropagationStopped: returnFalse,
isImmediatePropagationStopped: returnFalse,
preventDefault: function () {
var e = this.originalEvent;
this.isDefaultPrevented = returnTrue;
if (!e) {
return;
}
if (e.preventDefault) {
e.preventDefault();
}
else {
e.returnValue = false;
}
},
stopPropagation: function () {
var e = this.originalEvent;
this.isPropagationStopped = returnTrue;
if (!e) {
return;
}
if (e.stopPropagation) {
e.stopPropagation();
}
e.cancelBubble = true;
},
stopImmediatePropagation: function () {
var e = this.originalEvent;
this.isImmediatePropagationStopped = returnTrue;
if (e && e.stopImmediatePropagation) {
e.stopImmediatePropagation();
}
this.stopPropagation();
}
};
jQuery.each({
mouseenter: "mouseover",
mouseleave: "mouseout",
pointerenter: "pointerover",
pointerleave: "pointerout"
}, function (orig, fix) {
jQuery.event.special[orig] = {
delegateType: fix,
bindType: fix,
handle: function (event) {
var ret, target = this, related = event.relatedTarget, handleObj = event.handleObj;
if (!related || (related !== target && !jQuery.contains(target, related))) {
event.type = handleObj.origType;
ret = handleObj.handler.apply(this, arguments);
event.type = fix;
}
return ret;
}
};
});
if (!support.submitBubbles) {
jQuery.event.special.submit = {
setup: function () {
if (jQuery.nodeName(this, "form")) {
return false;
}
jQuery.event.add(this, "click._submit keypress._submit", function (e) {
var elem = e.target, form = jQuery.nodeName(elem, "input") || jQuery.nodeName(elem, "button") ? elem.form : undefined;
if (form && !jQuery._data(form, "submitBubbles")) {
jQuery.event.add(form, "submit._submit", function (event) {
event._submit_bubble = true;
});
jQuery._data(form, "submitBubbles", true);
}
});
},
postDispatch: function (event) {
if (event._submit_bubble) {
delete event._submit_bubble;
if (this.parentNode && !event.isTrigger) {
jQuery.event.simulate("submit", this.parentNode, event, true);
}
}
},
teardown: function () {
if (jQuery.nodeName(this, "form")) {
return false;
}
jQuery.event.remove(this, "._submit");
}
};
}
if (!support.changeBubbles) {
jQuery.event.special.change = {
setup: function () {
if (rformElems.test(this.nodeName)) {
if (this.type === "checkbox" || this.type === "radio") {
jQuery.event.add(this, "propertychange._change", function (event) {
if (event.originalEvent.propertyName === "checked") {
this._just_changed = true;
}
});
jQuery.event.add(this, "click._change", function (event) {
if (this._just_changed && !event.isTrigger) {
this._just_changed = false;
}
jQuery.event.simulate("change", this, event, true);
});
}
return false;
}
jQuery.event.add(this, "beforeactivate._change", function (e) {
var elem = e.target;
if (rformElems.test(elem.nodeName) && !jQuery._data(elem, "changeBubbles")) {
jQuery.event.add(elem, "change._change", function (event) {
if (this.parentNode && !event.isSimulated && !event.isTrigger) {
jQuery.event.simulate("change", this.parentNode, event, true);
}
});
jQuery._data(elem, "changeBubbles", true);
}
});
},
handle: function (event) {
var elem = event.target;
if (this !== elem || event.isSimulated || event.isTrigger || (elem.type !== "radio" && elem.type !== "checkbox")) {
return event.handleObj.handler.apply(this, arguments);
}
},
teardown: function () {
jQuery.event.remove(this, "._change");
return !rformElems.test(this.nodeName);
}
};
}
if (!support.focusinBubbles) {
jQuery.each({ focus: "focusin", blur: "focusout" }, function (orig, fix) {
var handler = function (event) {
jQuery.event.simulate(fix, event.target, jQuery.event.fix(event), true);
};
jQuery.event.special[fix] = {
setup: function () {
var doc = this.ownerDocument || this, attaches = jQuery._data(doc, fix);
if (!attaches) {
doc.addEventListener(orig, handler, true);
}
jQuery._data(doc, fix, (attaches || 0) + 1);
},
teardown: function () {
var doc = this.ownerDocument || this, attaches = jQuery._data(doc, fix) - 1;
if (!attaches) {
doc.removeEventListener(orig, handler, true);
jQuery._removeData(doc, fix);
}
else {
jQuery._data(doc, fix, attaches);
}
}
};
});
}
jQuery.fn.extend({
on: function (types, selector, data, fn, one) {
var type, origFn;
if (typeof types === "object") {
if (typeof selector !== "string") {
data = data || selector;
selector = undefined;
}
for (type in types) {
this.on(type, selector, data, types[type], one);
}
return this;
}
if (data == null && fn == null) {
fn = selector;
data = selector = undefined;
}
else if (fn == null) {
if (typeof selector === "string") {
fn = data;
data = undefined;
}
else {
fn = data;
data = selector;
selector = undefined;
}
}
if (fn === false) {
fn = returnFalse;
}
else if (!fn) {
return this;
}
if (one === 1) {
origFn = fn;
fn = function (event) {
jQuery().off(event);
return origFn.apply(this, arguments);
};
fn.guid = origFn.guid || (origFn.guid = jQuery.guid++);
}
return this.each(function () {
jQuery.event.add(this, types, fn, data, selector);
});
},
one: function (types, selector, data, fn) {
return this.on(types, selector, data, fn, 1);
},
off: function (types, selector, fn) {
var handleObj, type;
if (types && types.preventDefault && types.handleObj) {
handleObj = types.handleObj;
jQuery(types.delegateTarget).off(handleObj.namespace ? handleObj.origType + "." + handleObj.namespace : handleObj.origType, handleObj.selector, handleObj.handler);
return this;
}
if (typeof types === "object") {
for (type in types) {
this.off(type, selector, types[type]);
}
return this;
}
if (selector === false || typeof selector === "function") {
fn = selector;
selector = undefined;
}
if (fn === false) {
fn = returnFalse;
}
return this.each(function () {
jQuery.event.remove(this, types, fn, selector);
});
},
trigger: function (type, data) {
return this.each(function () {
jQuery.event.trigger(type, data, this);
});
},
triggerHandler: function (type, data) {
var elem = this[0];
if (elem) {
return jQuery.event.trigger(type, data, elem, true);
}
}
});
function createSafeFragment(document) {
var list = nodeNames.split("|"), safeFrag = document.createDocumentFragment();
if (safeFrag.createElement) {
while (list.length) {
safeFrag.createElement(list.pop());
}
}
return safeFrag;
}
var nodeNames = "abbr|article|aside|audio|bdi|canvas|data|datalist|details|figcaption|figure|footer|" +
"header|hgroup|mark|meter|nav|output|progress|section|summary|time|video", rinlinejQuery = / jQuery\d+="(?:null|\d+)"/g, rnoshimcache = new RegExp("<(?:" + nodeNames + ")[\\s/>]", "i"), rleadingWhitespace = /^\s+/, rxhtmlTag = /<(?!area|br|col|embed|hr|img|input|link|meta|param)(([\w:]+)[^>]*)\/>/gi, rtagName = /<([\w:]+)/, rtbody = /<tbody/i, rhtml = /<|&#?\w+;/, rnoInnerhtml = /<(?:script|style|link)/i, rchecked = /checked\s*(?:[^=]|=\s*.checked.)/i, rscriptType = /^$|\/(?:java|ecma)script/i, rscriptTypeMasked = /^true\/(.*)/, rcleanScript = /^\s*<!(?:\[CDATA\[|--)|(?:\]\]|--)>\s*$/g, wrapMap = {
option: [1, "<select multiple='multiple'>", "</select>"],
legend: [1, "<fieldset>", "</fieldset>"],
area: [1, "<map>", "</map>"],
param: [1, "<object>", "</object>"],
thead: [1, "", "
"]
}, safeFragment = createSafeFragment(document), fragmentDiv = safeFragment.appendChild(document.createElement("div"));
wrapMap.optgroup = wrapMap.option;
wrapMap.tbody = wrapMap.tfoot = wrapMap.colgroup = wrapMap.caption = wrapMap.thead;
wrapMap.th = wrapMap.td;
function getAll(context, tag) {
var elems, elem, i = 0, found = typeof context.getElementsByTagName !== strundefined ? context.getElementsByTagName(tag || "*") :
typeof context.querySelectorAll !== strundefined ? context.querySelectorAll(tag || "*") :
undefined;
if (!found) {
for (found = [], elems = context.childNodes || context; (elem = elems[i]) != null; i++) {
if (!tag || jQuery.nodeName(elem, tag)) {
found.push(elem);
}
else {
jQuery.merge(found, getAll(elem, tag));
}
}
}
return tag === undefined || tag && jQuery.nodeName(context, tag) ?
jQuery.merge([context], found) :
found;
}
function fixDefaultChecked(elem) {
if (rcheckableType.test(elem.type)) {
elem.defaultChecked = elem.checked;
}
}
function manipulationTarget(elem, content) {
return jQuery.nodeName(elem, "table") &&
jQuery.nodeName(content.nodeType !== 11 ? content : content.firstChild, "tr") ?
elem.getElementsByTagName("tbody")[0] ||
elem.appendChild(elem.ownerDocument.createElement("tbody")) :
elem;
}
function disableScript(elem) {
elem.type = (jQuery.find.attr(elem, "type") !== null) + "/" + elem.type;
return elem;
}
function restoreScript(elem) {
var match = rscriptTypeMasked.exec(elem.type);
if (match) {
elem.type = match[1];
}
else {
elem.removeAttribute("type");
}
return elem;
}
function setGlobalEval(elems, refElements) {
var elem, i = 0;
for (; (elem = elems[i]) != null; i++) {
jQuery._data(elem, "globalEval", !refElements || jQuery._data(refElements[i], "globalEval"));
}
}
function cloneCopyEvent(src, dest) {
if (dest.nodeType !== 1 || !jQuery.hasData(src)) {
return;
}
var type, i, l, oldData = jQuery._data(src), curData = jQuery._data(dest, oldData), events = oldData.events;
if (events) {
delete curData.handle;
curData.events = {};
for (type in events) {
for (i = 0, l = events[type].length; i < l; i++) {
jQuery.event.add(dest, type, events[type][i]);
}
}
}
if (curData.data) {
curData.data = jQuery.extend({}, curData.data);
}
}
function fixCloneNodeIssues(src, dest) {
var nodeName, e, data;
if (dest.nodeType !== 1) {
return;
}
nodeName = dest.nodeName.toLowerCase();
if (!support.noCloneEvent && dest[jQuery.expando]) {
data = jQuery._data(dest);
for (e in data.events) {
jQuery.removeEvent(dest, e, data.handle);
}
dest.removeAttribute(jQuery.expando);
}
if (nodeName === "script" && dest.text !== src.text) {
disableScript(dest).text = src.text;
restoreScript(dest);
}
else if (nodeName === "object") {
if (dest.parentNode) {
dest.outerHTML = src.outerHTML;
}
if (support.html5Clone && (src.innerHTML && !jQuery.trim(dest.innerHTML))) {
dest.innerHTML = src.innerHTML;
}
}
else if (nodeName === "input" && rcheckableType.test(src.type)) {
dest.defaultChecked = dest.checked = src.checked;
if (dest.value !== src.value) {
dest.value = src.value;
}
}
else if (nodeName === "option") {
dest.defaultSelected = dest.selected = src.defaultSelected;
}
else if (nodeName === "input" || nodeName === "textarea") {
dest.defaultValue = src.defaultValue;
}
}
jQuery.extend({
clone: function (elem, dataAndEvents, deepDataAndEvents) {
var destElements, node, clone, i, srcElements, inPage = jQuery.contains(elem.ownerDocument, elem);
if (support.html5Clone || jQuery.isXMLDoc(elem) || !rnoshimcache.test("<" + elem.nodeName + ">")) {
clone = elem.cloneNode(true);
}
else {
fragmentDiv.innerHTML = elem.outerHTML;
fragmentDiv.removeChild(clone = fragmentDiv.firstChild);
}
if ((!support.noCloneEvent || !support.noCloneChecked) &&
(elem.nodeType === 1 || elem.nodeType === 11) && !jQuery.isXMLDoc(elem)) {
destElements = getAll(clone);
srcElements = getAll(elem);
for (i = 0; (node = srcElements[i]) != null; ++i) {
if (destElements[i]) {
fixCloneNodeIssues(node, destElements[i]);
}
}
}
if (dataAndEvents) {
if (deepDataAndEvents) {
srcElements = srcElements || getAll(elem);
destElements = destElements || getAll(clone);
for (i = 0; (node = srcElements[i]) != null; i++) {
cloneCopyEvent(node, destElements[i]);
}
}
else {
cloneCopyEvent(elem, clone);
}
}
destElements = getAll(clone, "script");
if (destElements.length > 0) {
setGlobalEval(destElements, !inPage && getAll(elem, "script"));
}
destElements = srcElements = node = null;
return clone;
},
buildFragment: function (elems, context, scripts, selection) {
var j, elem, contains, tmp, tag, tbody, wrap, l = elems.length, safe = createSafeFragment(context), nodes = [], i = 0;
for (; i < l; i++) {
elem = elems[i];
if (elem || elem === 0) {
if (jQuery.type(elem) === "object") {
jQuery.merge(nodes, elem.nodeType ? [elem] : elem);
}
else if (!rhtml.test(elem)) {
nodes.push(context.createTextNode(elem));
}
else {
tmp = tmp || safe.appendChild(context.createElement("div"));
tag = (rtagName.exec(elem) || ["", ""])[1].toLowerCase();
wrap = wrapMap[tag] || wrapMap._default;
tmp.innerHTML = wrap[1] + elem.replace(rxhtmlTag, "<$1></$2>") + wrap[2];
j = wrap[0];
while (j--) {
tmp = tmp.lastChild;
}
if (!support.leadingWhitespace && rleadingWhitespace.test(elem)) {
nodes.push(context.createTextNode(rleadingWhitespace.exec(elem)[0]));
}
if (!support.tbody) {
elem = tag === "table" && !rtbody.test(elem) ?
tmp.firstChild :
wrap[1] === " a = div.getElementsByTagName("a")[0];
style = a && a.style;
if (!style) {
return;
}
style.cssText = "float:left;opacity:.5";
support.opacity = style.opacity === "0.5";
support.cssFloat = !!style.cssFloat;
div.style.backgroundClip = "content-box";
div.cloneNode(true).style.backgroundClip = "";
support.clearCloneStyle = div.style.backgroundClip === "content-box";
support.boxSizing = style.boxSizing === "" || style.MozBoxSizing === "" ||
style.WebkitBoxSizing === "";
jQuery.extend(support, {
reliableHiddenOffsets: function () {
if (reliableHiddenOffsetsVal == null) {
computeStyleTests();
}
return reliableHiddenOffsetsVal;
},
boxSizingReliable: function () {
if (boxSizingReliableVal == null) {
computeStyleTests();
}
return boxSizingReliableVal;
},
pixelPosition: function () {
if (pixelPositionVal == null) {
computeStyleTests();
}
return pixelPositionVal;
},
reliableMarginRight: function () {
if (reliableMarginRightVal == null) {
computeStyleTests();
}
return reliableMarginRightVal;
}
});
function computeStyleTests() {
var div, body, container, contents;
body = document.getElementsByTagName("body")[0];
if (!body || !body.style) {
return;
}
div = document.createElement("div");
container = document.createElement("div");
container.style.cssText = "position:absolute;border:0;width:0;height:0;top:0;left:-9999px";
body.appendChild(container).appendChild(div);
div.style.cssText =
"-webkit-box-sizing:border-box;-moz-box-sizing:border-box;" +
"box-sizing:border-box;display:block;margin-top:1%;top:1%;" +
"border:1px;padding:1px;width:4px;position:absolute";
pixelPositionVal = boxSizingReliableVal = false;
reliableMarginRightVal = true;
if (window.getComputedStyle) {
pixelPositionVal = (window.getComputedStyle(div, null) || {}).top !== "1%";
boxSizingReliableVal =
(window.getComputedStyle(div, null) || { width: "4px" }).width === "4px";
contents = div.appendChild(document.createElement("div"));
contents.style.cssText = div.style.cssText =
"-webkit-box-sizing:content-box;-moz-box-sizing:content-box;" +
"box-sizing:content-box;display:block;margin:0;border:0;padding:0";
contents.style.marginRight = contents.style.width = "0";
div.style.width = "1px";
reliableMarginRightVal =
!parseFloat((window.getComputedStyle(contents, null) || {}).marginRight);
}
div.innerHTML = "| t |
contents = div.getElementsByTagName("td");
contents[0].style.cssText = "margin:0;border:0;padding:0;display:none";
reliableHiddenOffsetsVal = contents[0].offsetHeight === 0;
if (reliableHiddenOffsetsVal) {
contents[0].style.display = "";
contents[1].style.display = "none";
reliableHiddenOffsetsVal = contents[0].offsetHeight === 0;
}
body.removeChild(container);
}
})();
jQuery.swap = function (elem, options, callback, args) {
var ret, name, old = {};
for (name in options) {
old[name] = elem.style[name];
elem.style[name] = options[name];
}
ret = callback.apply(elem, args || []);
for (name in options) {
elem.style[name] = old[name];
}
return ret;
};
var ralpha = /alpha\([^)]*\)/i, ropacity = /opacity\s*=\s*([^)]*)/, rdisplayswap = /^(none|table(?!-c[ea]).+)/, rnumsplit = new RegExp("^(" + pnum + ")(.*)$", "i"), rrelNum = new RegExp("^([+-])=(" + pnum + ")", "i"), cssShow = { position: "absolute", visibility: "hidden", display: "block" }, cssNormalTransform = {
letterSpacing: "0",
fontWeight: "400"
}, cssPrefixes = ["Webkit", "O", "Moz", "ms"];
function vendorPropName(style, name) {
if (name in style) {
return name;
}
var capName = name.charAt(0).toUpperCase() + name.slice(1), origName = name, i = cssPrefixes.length;
while (i--) {
name = cssPrefixes[i] + capName;
if (name in style) {
return name;
}
}
return origName;
}
function showHide(elements, show) {
var display, elem, hidden, values = [], index = 0, length = elements.length;
for (; index < length; index++) {
elem = elements[index];
if (!elem.style) {
continue;
}
values[index] = jQuery._data(elem, "olddisplay");
display = elem.style.display;
if (show) {
if (!values[index] && display === "none") {
elem.style.display = "";
}
if (elem.style.display === "" && isHidden(elem)) {
values[index] = jQuery._data(elem, "olddisplay", defaultDisplay(elem.nodeName));
}
}
else {
hidden = isHidden(elem);
if (display && display !== "none" || !hidden) {
jQuery._data(elem, "olddisplay", hidden ? display : jQuery.css(elem, "display"));
}
}
}
for (index = 0; index < length; index++) {
elem = elements[index];
if (!elem.style) {
continue;
}
if (!show || elem.style.display === "none" || elem.style.display === "") {
elem.style.display = show ? values[index] || "" : "none";
}
}
return elements;
}
function setPositiveNumber(elem, value, subtract) {
var matches = rnumsplit.exec(value);
return matches ?
Math.max(0, matches[1] - (subtract || 0)) + (matches[2] || "px") :
value;
}
function augmentWidthOrHeight(elem, name, extra, isBorderBox, styles) {
var i = extra === (isBorderBox ? "border" : "content") ?
4 :
name === "width" ? 1 : 0, val = 0;
for (; i < 4; i += 2) {
if (extra === "margin") {
val += jQuery.css(elem, extra + cssExpand[i], true, styles);
}
if (isBorderBox) {
if (extra === "content") {
val -= jQuery.css(elem, "padding" + cssExpand[i], true, styles);
}
if (extra !== "margin") {
val -= jQuery.css(elem, "border" + cssExpand[i] + "Width", true, styles);
}
}
else {
val += jQuery.css(elem, "padding" + cssExpand[i], true, styles);
if (extra !== "padding") {
val += jQuery.css(elem, "border" + cssExpand[i] + "Width", true, styles);
}
}
}
return val;
}
function getWidthOrHeight(elem, name, extra) {
var valueIsBorderBox = true, val = name === "width" ? elem.offsetWidth : elem.offsetHeight, styles = getStyles(elem), isBorderBox = support.boxSizing && jQuery.css(elem, "boxSizing", false, styles) === "border-box";
if (val <= 0 || val == null) {
val = curCSS(elem, name, styles);
if (val < 0 || val == null) {
val = elem.style[name];
}
if (rnumnonpx.test(val)) {
return val;
}
valueIsBorderBox = isBorderBox && (support.boxSizingReliable() || val === elem.style[name]);
val = parseFloat(val) || 0;
}
return (val +
augmentWidthOrHeight(elem, name, extra || (isBorderBox ? "border" : "content"), valueIsBorderBox, styles)) + "px";
}
jQuery.extend({
cssHooks: {
opacity: {
get: function (elem, computed) {
if (computed) {
var ret = curCSS(elem, "opacity");
return ret === "" ? "1" : ret;
}
}
}
},
cssNumber: {
"columnCount": true,
"fillOpacity": true,
"flexGrow": true,
"flexShrink": true,
"fontWeight": true,
"lineHeight": true,
"opacity": true,
"order": true,
"orphans": true,
"widows": true,
"zIndex": true,
"zoom": true
},
cssProps: {
"float": support.cssFloat ? "cssFloat" : "styleFloat"
},
style: function (elem, name, value, extra) {
if (!elem || elem.nodeType === 3 || elem.nodeType === 8 || !elem.style) {
return;
}
var ret, type, hooks, origName = jQuery.camelCase(name), style = elem.style;
name = jQuery.cssProps[origName] || (jQuery.cssProps[origName] = vendorPropName(style, origName));
hooks = jQuery.cssHooks[name] || jQuery.cssHooks[origName];
if (value !== undefined) {
type = typeof value;
if (type === "string" && (ret = rrelNum.exec(value))) {
value = (ret[1] + 1) * ret[2] + parseFloat(jQuery.css(elem, name));
type = "number";
}
if (value == null || value !== value) {
return;
}
if (type === "number" && !jQuery.cssNumber[origName]) {
value += "px";
}
if (!support.clearCloneStyle && value === "" && name.indexOf("background") === 0) {
style[name] = "inherit";
}
if (!hooks || !("set" in hooks) || (value = hooks.set(elem, value, extra)) !== undefined) {
try {
style[name] = value;
}
catch (e) { }
}
}
else {
if (hooks && "get" in hooks && (ret = hooks.get(elem, false, extra)) !== undefined) {
return ret;
}
return style[name];
}
},
css: function (elem, name, extra, styles) {
var num, val, hooks, origName = jQuery.camelCase(name);
name = jQuery.cssProps[origName] || (jQuery.cssProps[origName] = vendorPropName(elem.style, origName));
hooks = jQuery.cssHooks[name] || jQuery.cssHooks[origName];
if (hooks && "get" in hooks) {
val = hooks.get(elem, true, extra);
}
if (val === undefined) {
val = curCSS(elem, name, styles);
}
if (val === "normal" && name in cssNormalTransform) {
val = cssNormalTransform[name];
}
if (extra === "" || extra) {
num = parseFloat(val);
return extra === true || jQuery.isNumeric(num) ? num || 0 : val;
}
return val;
}
});
jQuery.each(["height", "width"], function (i, name) {
jQuery.cssHooks[name] = {
get: function (elem, computed, extra) {
if (computed) {
return rdisplayswap.test(jQuery.css(elem, "display")) && elem.offsetWidth === 0 ?
jQuery.swap(elem, cssShow, function () {
return getWidthOrHeight(elem, name, extra);
}) :
getWidthOrHeight(elem, name, extra);
}
},
set: function (elem, value, extra) {
var styles = extra && getStyles(elem);
return setPositiveNumber(elem, value, extra ?
augmentWidthOrHeight(elem, name, extra, support.boxSizing && jQuery.css(elem, "boxSizing", false, styles) === "border-box", styles) : 0);
}
};
});
if (!support.opacity) {
jQuery.cssHooks.opacity = {
get: function (elem, computed) {
return ropacity.test((computed && elem.currentStyle ? elem.currentStyle.filter : elem.style.filter) || "") ?
(0.01 * parseFloat(RegExp.$1)) + "" :
computed ? "1" : "";
},
set: function (elem, value) {
var style = elem.style, currentStyle = elem.currentStyle, opacity = jQuery.isNumeric(value) ? "alpha(opacity=" + value * 100 + ")" : "", filter = currentStyle && currentStyle.filter || style.filter || "";
style.zoom = 1;
if ((value >= 1 || value === "") &&
jQuery.trim(filter.replace(ralpha, "")) === "" &&
style.removeAttribute) {
style.removeAttribute("filter");
if (value === "" || currentStyle && !currentStyle.filter) {
return;
}
}
style.filter = ralpha.test(filter) ?
filter.replace(ralpha, opacity) :
filter + " " + opacity;
}
};
}
jQuery.cssHooks.marginRight = addGetHookIf(support.reliableMarginRight, function (elem, computed) {
if (computed) {
return jQuery.swap(elem, { "display": "inline-block" }, curCSS, [elem, "marginRight"]);
}
});
jQuery.each({
margin: "",
padding: "",
border: "Width"
}, function (prefix, suffix) {
jQuery.cssHooks[prefix + suffix] = {
expand: function (value) {
var i = 0, expanded = {}, parts = typeof value === "string" ? value.split(" ") : [value];
for (; i < 4; i++) {
expanded[prefix + cssExpand[i] + suffix] =
parts[i] || parts[i - 2] || parts[0];
}
return expanded;
}
};
if (!rmargin.test(prefix)) {
jQuery.cssHooks[prefix + suffix].set = setPositiveNumber;
}
});
jQuery.fn.extend({
css: function (name, value) {
return access(this, function (elem, name, value) {
var styles, len, map = {}, i = 0;
if (jQuery.isArray(name)) {
styles = getStyles(elem);
len = name.length;
for (; i < len; i++) {
map[name[i]] = jQuery.css(elem, name[i], false, styles);
}
return map;
}
return value !== undefined ?
jQuery.style(elem, name, value) :
jQuery.css(elem, name);
}, name, value, arguments.length > 1);
},
show: function () {
return showHide(this, true);
},
hide: function () {
return showHide(this);
},
toggle: function (state) {
if (typeof state === "boolean") {
return state ? this.show() : this.hide();
}
return this.each(function () {
if (isHidden(this)) {
jQuery(this).show();
}
else {
jQuery(this).hide();
}
});
}
});
function Tween(elem, options, prop, end, easing) {
return new Tween.prototype.init(elem, options, prop, end, easing);
}
jQuery.Tween = Tween;
Tween.prototype = {
constructor: Tween,
init: function (elem, options, prop, end, easing, unit) {
this.elem = elem;
this.prop = prop;
this.easing = easing || "swing";
this.options = options;
this.start = this.now = this.cur();
this.end = end;
this.unit = unit || (jQuery.cssNumber[prop] ? "" : "px");
},
cur: function () {
var hooks = Tween.propHooks[this.prop];
return hooks && hooks.get ?
hooks.get(this) :
Tween.propHooks._default.get(this);
},
run: function (percent) {
var eased, hooks = Tween.propHooks[this.prop];
if (this.options.duration) {
this.pos = eased = jQuery.easing[this.easing](percent, this.options.duration * percent, 0, 1, this.options.duration);
}
else {
this.pos = eased = percent;
}
this.now = (this.end - this.start) * eased + this.start;
if (this.options.step) {
this.options.step.call(this.elem, this.now, this);
}
if (hooks && hooks.set) {
hooks.set(this);
}
else {
Tween.propHooks._default.set(this);
}
return this;
}
};
Tween.prototype.init.prototype = Tween.prototype;
Tween.propHooks = {
_default: {
get: function (tween) {
var result;
if (tween.elem[tween.prop] != null &&
(!tween.elem.style || tween.elem.style[tween.prop] == null)) {
return tween.elem[tween.prop];
}
result = jQuery.css(tween.elem, tween.prop, "");
return !result || result === "auto" ? 0 : result;
},
set: function (tween) {
if (jQuery.fx.step[tween.prop]) {
jQuery.fx.step[tween.prop](tween);
}
else if (tween.elem.style && (tween.elem.style[jQuery.cssProps[tween.prop]] != null || jQuery.cssHooks[tween.prop])) {
jQuery.style(tween.elem, tween.prop, tween.now + tween.unit);
}
else {
tween.elem[tween.prop] = tween.now;
}
}
}
};
Tween.propHooks.scrollTop = Tween.propHooks.scrollLeft = {
set: function (tween) {
if (tween.elem.nodeType && tween.elem.parentNode) {
tween.elem[tween.prop] = tween.now;
}
}
};
jQuery.easing = {
linear: function (p) {
return p;
},
swing: function (p) {
return 0.5 - Math.cos(p * Math.PI) / 2;
}
};
jQuery.fx = Tween.prototype.init;
jQuery.fx.step = {};
var fxNow, timerId, rfxtypes = /^(?:toggle|show|hide)$/, rfxnum = new RegExp("^(?:([+-])=|)(" + pnum + ")([a-z%]*)$", "i"), rrun = /queueHooks$/, animationPrefilters = [defaultPrefilter], tweeners = {
"*": [function (prop, value) {
var tween = this.createTween(prop, value), target = tween.cur(), parts = rfxnum.exec(value), unit = parts && parts[3] || (jQuery.cssNumber[prop] ? "" : "px"), start = (jQuery.cssNumber[prop] || unit !== "px" && +target) &&
rfxnum.exec(jQuery.css(tween.elem, prop)), scale = 1, maxIterations = 20;
if (start && start[3] !== unit) {
unit = unit || start[3];
parts = parts || [];
start = +target || 1;
do {
scale = scale || ".5";
start = start / scale;
jQuery.style(tween.elem, prop, start + unit);
} while (scale !== (scale = tween.cur() / target) && scale !== 1 && --maxIterations);
}
if (parts) {
start = tween.start = +start || +target || 0;
tween.unit = unit;
tween.end = parts[1] ?
start + (parts[1] + 1) * parts[2] :
+parts[2];
}
return tween;
}]
};
function createFxNow() {
setTimeout(function () {
fxNow = undefined;
});
return (fxNow = jQuery.now());
}
function genFx(type, includeWidth) {
var which, attrs = { height: type }, i = 0;
includeWidth = includeWidth ? 1 : 0;
for (; i < 4; i += 2 - includeWidth) {
which = cssExpand[i];
attrs["margin" + which] = attrs["padding" + which] = type;
}
if (includeWidth) {
attrs.opacity = attrs.width = type;
}
return attrs;
}
function createTween(value, prop, animation) {
var tween, collection = (tweeners[prop] || []).concat(tweeners["*"]), index = 0, length = collection.length;
for (; index < length; index++) {
if ((tween = collection[index].call(animation, prop, value))) {
return tween;
}
}
}
function defaultPrefilter(elem, props, opts) {
var prop, value, toggle, tween, hooks, oldfire, display, checkDisplay, anim = this, orig = {}, style = elem.style, hidden = elem.nodeType && isHidden(elem), dataShow = jQuery._data(elem, "fxshow");
if (!opts.queue) {
hooks = jQuery._queueHooks(elem, "fx");
if (hooks.unqueued == null) {
hooks.unqueued = 0;
oldfire = hooks.empty.fire;
hooks.empty.fire = function () {
if (!hooks.unqueued) {
oldfire();
}
};
}
hooks.unqueued++;
anim.always(function () {
anim.always(function () {
hooks.unqueued--;
if (!jQuery.queue(elem, "fx").length) {
hooks.empty.fire();
}
});
});
}
if (elem.nodeType === 1 && ("height" in props || "width" in props)) {
opts.overflow = [style.overflow, style.overflowX, style.overflowY];
display = jQuery.css(elem, "display");
checkDisplay = display === "none" ?
jQuery._data(elem, "olddisplay") || defaultDisplay(elem.nodeName) : display;
if (checkDisplay === "inline" && jQuery.css(elem, "float") === "none") {
if (!support.inlineBlockNeedsLayout || defaultDisplay(elem.nodeName) === "inline") {
style.display = "inline-block";
}
else {
style.zoom = 1;
}
}
}
if (opts.overflow) {
style.overflow = "hidden";
if (!support.shrinkWrapBlocks()) {
anim.always(function () {
style.overflow = opts.overflow[0];
style.overflowX = opts.overflow[1];
style.overflowY = opts.overflow[2];
});
}
}
for (prop in props) {
value = props[prop];
if (rfxtypes.exec(value)) {
delete props[prop];
toggle = toggle || value === "toggle";
if (value === (hidden ? "hide" : "show")) {
if (value === "show" && dataShow && dataShow[prop] !== undefined) {
hidden = true;
}
else {
continue;
}
}
orig[prop] = dataShow && dataShow[prop] || jQuery.style(elem, prop);
}
else {
display = undefined;
}
}
if (!jQuery.isEmptyObject(orig)) {
if (dataShow) {
if ("hidden" in dataShow) {
hidden = dataShow.hidden;
}
}
else {
dataShow = jQuery._data(elem, "fxshow", {});
}
if (toggle) {
dataShow.hidden = !hidden;
}
if (hidden) {
jQuery(elem).show();
}
else {
anim.done(function () {
jQuery(elem).hide();
});
}
anim.done(function () {
var prop;
jQuery._removeData(elem, "fxshow");
for (prop in orig) {
jQuery.style(elem, prop, orig[prop]);
}
});
for (prop in orig) {
tween = createTween(hidden ? dataShow[prop] : 0, prop, anim);
if (!(prop in dataShow)) {
dataShow[prop] = tween.start;
if (hidden) {
tween.end = tween.start;
tween.start = prop === "width" || prop === "height" ? 1 : 0;
}
}
}
}
else if ((display === "none" ? defaultDisplay(elem.nodeName) : display) === "inline") {
style.display = display;
}
}
function propFilter(props, specialEasing) {
var index, name, easing, value, hooks;
for (index in props) {
name = jQuery.camelCase(index);
easing = specialEasing[name];
value = props[index];
if (jQuery.isArray(value)) {
easing = value[1];
value = props[index] = value[0];
}
if (index !== name) {
props[name] = value;
delete props[index];
}
hooks = jQuery.cssHooks[name];
if (hooks && "expand" in hooks) {
value = hooks.expand(value);
delete props[name];
for (index in value) {
if (!(index in props)) {
props[index] = value[index];
specialEasing[index] = easing;
}
}
}
else {
specialEasing[name] = easing;
}
}
}
function Animation(elem, properties, options) {
var result, stopped, index = 0, length = animationPrefilters.length, deferred = jQuery.Deferred().always(function () {
delete tick.elem;
}), tick = function () {
if (stopped) {
return false;
}
var currentTime = fxNow || createFxNow(), remaining = Math.max(0, animation.startTime + animation.duration - currentTime), temp = remaining / animation.duration || 0, percent = 1 - temp, index = 0, length = animation.tweens.length;
for (; index < length; index++) {
animation.tweens[index].run(percent);
}
deferred.notifyWith(elem, [animation, percent, remaining]);
if (percent < 1 && length) {
return remaining;
}
else {
deferred.resolveWith(elem, [animation]);
return false;
}
}, animation = deferred.promise({
elem: elem,
props: jQuery.extend({}, properties),
opts: jQuery.extend(true, { specialEasing: {} }, options),
originalProperties: properties,
originalOptions: options,
startTime: fxNow || createFxNow(),
duration: options.duration,
tweens: [],
createTween: function (prop, end) {
var tween = jQuery.Tween(elem, animation.opts, prop, end, animation.opts.specialEasing[prop] || animation.opts.easing);
animation.tweens.push(tween);
return tween;
},
stop: function (gotoEnd) {
var index = 0, length = gotoEnd ? animation.tweens.length : 0;
if (stopped) {
return this;
}
stopped = true;
for (; index < length; index++) {
animation.tweens[index].run(1);
}
if (gotoEnd) {
deferred.resolveWith(elem, [animation, gotoEnd]);
}
else {
deferred.rejectWith(elem, [animation, gotoEnd]);
}
return this;
}
}), props = animation.props;
propFilter(props, animation.opts.specialEasing);
for (; index < length; index++) {
result = animationPrefilters[index].call(animation, elem, props, animation.opts);
if (result) {
return result;
}
}
jQuery.map(props, createTween, animation);
if (jQuery.isFunction(animation.opts.start)) {
animation.opts.start.call(elem, animation);
}
jQuery.fx.timer(jQuery.extend(tick, {
elem: elem,
anim: animation,
queue: animation.opts.queue
}));
return animation.progress(animation.opts.progress)
.done(animation.opts.done, animation.opts.complete)
.fail(animation.opts.fail)
.always(animation.opts.always);
}
jQuery.Animation = jQuery.extend(Animation, {
tweener: function (props, callback) {
if (jQuery.isFunction(props)) {
callback = props;
props = ["*"];
}
else {
props = props.split(" ");
}
var prop, index = 0, length = props.length;
for (; index < length; index++) {
prop = props[index];
tweeners[prop] = tweeners[prop] || [];
tweeners[prop].unshift(callback);
}
},
prefilter: function (callback, prepend) {
if (prepend) {
animationPrefilters.unshift(callback);
}
else {
animationPrefilters.push(callback);
}
}
});
jQuery.speed = function (speed, easing, fn) {
var opt = speed && typeof speed === "object" ? jQuery.extend({}, speed) : {
complete: fn || !fn && easing ||
jQuery.isFunction(speed) && speed,
duration: speed,
easing: fn && easing || easing && !jQuery.isFunction(easing) && easing
};
opt.duration = jQuery.fx.off ? 0 : typeof opt.duration === "number" ? opt.duration :
opt.duration in jQuery.fx.speeds ? jQuery.fx.speeds[opt.duration] : jQuery.fx.speeds._default;
if (opt.queue == null || opt.queue === true) {
opt.queue = "fx";
}
opt.old = opt.complete;
opt.complete = function () {
if (jQuery.isFunction(opt.old)) {
opt.old.call(this);
}
if (opt.queue) {
jQuery.dequeue(this, opt.queue);
}
};
return opt;
};
jQuery.fn.extend({
fadeTo: function (speed, to, easing, callback) {
return this.filter(isHidden).css("opacity", 0).show()
.end().animate({ opacity: to }, speed, easing, callback);
},
animate: function (prop, speed, easing, callback) {
var empty = jQuery.isEmptyObject(prop), optall = jQuery.speed(speed, easing, callback), doAnimation = function () {
var anim = Animation(this, jQuery.extend({}, prop), optall);
if (empty || jQuery._data(this, "finish")) {
anim.stop(true);
}
};
doAnimation.finish = doAnimation;
return empty || optall.queue === false ?
this.each(doAnimation) :
this.queue(optall.queue, doAnimation);
},
stop: function (type, clearQueue, gotoEnd) {
var stopQueue = function (hooks) {
var stop = hooks.stop;
delete hooks.stop;
stop(gotoEnd);
};
if (typeof type !== "string") {
gotoEnd = clearQueue;
clearQueue = type;
type = undefined;
}
if (clearQueue && type !== false) {
this.queue(type || "fx", []);
}
return this.each(function () {
var dequeue = true, index = type != null && type + "queueHooks", timers = jQuery.timers, data = jQuery._data(this);
if (index) {
if (data[index] && data[index].stop) {
stopQueue(data[index]);
}
}
else {
for (index in data) {
if (data[index] && data[index].stop && rrun.test(index)) {
stopQueue(data[index]);
}
}
}
for (index = timers.length; index--;) {
if (timers[index].elem === this && (type == null || timers[index].queue === type)) {
timers[index].anim.stop(gotoEnd);
dequeue = false;
timers.splice(index, 1);
}
}
if (dequeue || !gotoEnd) {
jQuery.dequeue(this, type);
}
});
},
finish: function (type) {
if (type !== false) {
type = type || "fx";
}
return this.each(function () {
var index, data = jQuery._data(this), queue = data[type + "queue"], hooks = data[type + "queueHooks"], timers = jQuery.timers, length = queue ? queue.length : 0;
data.finish = true;
jQuery.queue(this, type, []);
if (hooks && hooks.stop) {
hooks.stop.call(this, true);
}
for (index = timers.length; index--;) {
if (timers[index].elem === this && timers[index].queue === type) {
timers[index].anim.stop(true);
timers.splice(index, 1);
}
}
for (index = 0; index < length; index++) {
if (queue[index] && queue[index].finish) {
queue[index].finish.call(this);
}
}
delete data.finish;
});
}
});
jQuery.each(["toggle", "show", "hide"], function (i, name) {
var cssFn = jQuery.fn[name];
jQuery.fn[name] = function (speed, easing, callback) {
return speed == null || typeof speed === "boolean" ?
cssFn.apply(this, arguments) :
this.animate(genFx(name, true), speed, easing, callback);
};
});
jQuery.each({
slideDown: genFx("show"),
slideUp: genFx("hide"),
slideToggle: genFx("toggle"),
fadeIn: { opacity: "show" },
fadeOut: { opacity: "hide" },
fadeToggle: { opacity: "toggle" }
}, function (name, props) {
jQuery.fn[name] = function (speed, easing, callback) {
return this.animate(props, speed, easing, callback);
};
});
jQuery.timers = [];
jQuery.fx.tick = function () {
var timer, timers = jQuery.timers, i = 0;
fxNow = jQuery.now();
for (; i < timers.length; i++) {
timer = timers[i];
if (!timer() && timers[i] === timer) {
timers.splice(i--, 1);
}
}
if (!timers.length) {
jQuery.fx.stop();
}
fxNow = undefined;
};
jQuery.fx.timer = function (timer) {
jQuery.timers.push(timer);
if (timer()) {
jQuery.fx.start();
}
else {
jQuery.timers.pop();
}
};
jQuery.fx.interval = 13;
jQuery.fx.start = function () {
if (!timerId) {
timerId = setInterval(jQuery.fx.tick, jQuery.fx.interval);
}
};
jQuery.fx.stop = function () {
clearInterval(timerId);
timerId = null;
};
jQuery.fx.speeds = {
slow: 600,
fast: 200,
_default: 400
};
jQuery.fn.delay = function (time, type) {
time = jQuery.fx ? jQuery.fx.speeds[time] || time : time;
type = type || "fx";
return this.queue(type, function (next, hooks) {
var timeout = setTimeout(next, time);
hooks.stop = function () {
clearTimeout(timeout);
};
});
};
(function () {
var input, div, select, a, opt;
div = document.createElement("div");
div.setAttribute("className", "t");
div.innerHTML = " <link/> a = div.getElementsByTagName("a")[0];
select = document.createElement("select");
opt = select.appendChild(document.createElement("option"));
input = div.getElementsByTagName("input")[0];
a.style.cssText = "top:1px";
support.getSetAttribute = div.className !== "t";
support.style = /top/.test(a.getAttribute("style"));
support.hrefNormalized = a.getAttribute("href") === "/a";
support.checkOn = !!input.value;
support.optSelected = opt.selected;
support.enctype = !!document.createElement("form").enctype;
select.disabled = true;
support.optDisabled = !opt.disabled;
input = document.createElement("input");
input.setAttribute("value", "");
support.input = input.getAttribute("value") === "";
input.value = "t";
input.setAttribute("type", "radio");
support.radioValue = input.value === "t";
})();
var rreturn = /\r/g;
jQuery.fn.extend({
val: function (value) {
var hooks, ret, isFunction, elem = this[0];
if (!arguments.length) {
if (elem) {
hooks = jQuery.valHooks[elem.type] || jQuery.valHooks[elem.nodeName.toLowerCase()];
if (hooks && "get" in hooks && (ret = hooks.get(elem, "value")) !== undefined) {
return ret;
}
ret = elem.value;
return typeof ret === "string" ?
ret.replace(rreturn, "") :
ret == null ? "" : ret;
}
return;
}
isFunction = jQuery.isFunction(value);
return this.each(function (i) {
var val;
if (this.nodeType !== 1) {
return;
}
if (isFunction) {
val = value.call(this, i, jQuery(this).val());
}
else {
val = value;
}
if (val == null) {
val = "";
}
else if (typeof val === "number") {
val += "";
}
else if (jQuery.isArray(val)) {
val = jQuery.map(val, function (value) {
return value == null ? "" : value + "";
});
}
hooks = jQuery.valHooks[this.type] || jQuery.valHooks[this.nodeName.toLowerCase()];
if (!hooks || !("set" in hooks) || hooks.set(this, val, "value") === undefined) {
this.value = val;
}
});
}
});
jQuery.extend({
valHooks: {
option: {
get: function (elem) {
var val = jQuery.find.attr(elem, "value");
return val != null ?
val :
jQuery.trim(jQuery.text(elem));
}
},
select: {
get: function (elem) {
var value, option, options = elem.options, index = elem.selectedIndex, one = elem.type === "select-one" || index < 0, values = one ? null : [], max = one ? index + 1 : options.length, i = index < 0 ?
max :
one ? index : 0;
for (; i < max; i++) {
option = options[i];
if ((option.selected || i === index) &&
(support.optDisabled ? !option.disabled : option.getAttribute("disabled") === null) &&
(!option.parentNode.disabled || !jQuery.nodeName(option.parentNode, "optgroup"))) {
value = jQuery(option).val();
if (one) {
return value;
}
values.push(value);
}
}
return values;
},
set: function (elem, value) {
var optionSet, option, options = elem.options, values = jQuery.makeArray(value), i = options.length;
while (i--) {
option = options[i];
if (jQuery.inArray(jQuery.valHooks.option.get(option), values) >= 0) {
try {
option.selected = optionSet = true;
}
catch (_) {
option.scrollHeight;
}
}
else {
option.selected = false;
}
}
if (!optionSet) {
elem.selectedIndex = -1;
}
return options;
}
}
}
});
jQuery.each(["radio", "checkbox"], function () {
jQuery.valHooks[this] = {
set: function (elem, value) {
if (jQuery.isArray(value)) {
return (elem.checked = jQuery.inArray(jQuery(elem).val(), value) >= 0);
}
}
};
if (!support.checkOn) {
jQuery.valHooks[this].get = function (elem) {
return elem.getAttribute("value") === null ? "on" : elem.value;
};
}
});
var nodeHook, boolHook, attrHandle = jQuery.expr.attrHandle, ruseDefault = /^(?:checked|selected)$/i, getSetAttribute = support.getSetAttribute, getSetInput = support.input;
jQuery.fn.extend({
attr: function (name, value) {
return access(this, jQuery.attr, name, value, arguments.length > 1);
},
removeAttr: function (name) {
return this.each(function () {
jQuery.removeAttr(this, name);
});
}
});
jQuery.extend({
attr: function (elem, name, value) {
var hooks, ret, nType = elem.nodeType;
if (!elem || nType === 3 || nType === 8 || nType === 2) {
return;
}
if (typeof elem.getAttribute === strundefined) {
return jQuery.prop(elem, name, value);
}
if (nType !== 1 || !jQuery.isXMLDoc(elem)) {
name = name.toLowerCase();
hooks = jQuery.attrHooks[name] ||
(jQuery.expr.match.bool.test(name) ? boolHook : nodeHook);
}
if (value !== undefined) {
if (value === null) {
jQuery.removeAttr(elem, name);
}
else if (hooks && "set" in hooks && (ret = hooks.set(elem, value, name)) !== undefined) {
return ret;
}
else {
elem.setAttribute(name, value + "");
return value;
}
}
else if (hooks && "get" in hooks && (ret = hooks.get(elem, name)) !== null) {
return ret;
}
else {
ret = jQuery.find.attr(elem, name);
return ret == null ?
undefined :
ret;
}
},
removeAttr: function (elem, value) {
var name, propName, i = 0, attrNames = value && value.match(rnotwhite);
if (attrNames && elem.nodeType === 1) {
while ((name = attrNames[i++])) {
propName = jQuery.propFix[name] || name;
if (jQuery.expr.match.bool.test(name)) {
if (getSetInput && getSetAttribute || !ruseDefault.test(name)) {
elem[propName] = false;
}
else {
elem[jQuery.camelCase("default-" + name)] =
elem[propName] = false;
}
}
else {
jQuery.attr(elem, name, "");
}
elem.removeAttribute(getSetAttribute ? name : propName);
}
}
},
attrHooks: {
type: {
set: function (elem, value) {
if (!support.radioValue && value === "radio" && jQuery.nodeName(elem, "input")) {
var val = elem.value;
elem.setAttribute("type", value);
if (val) {
elem.value = val;
}
return value;
}
}
}
}
});
boolHook = {
set: function (elem, value, name) {
if (value === false) {
jQuery.removeAttr(elem, name);
}
else if (getSetInput && getSetAttribute || !ruseDefault.test(name)) {
elem.setAttribute(!getSetAttribute && jQuery.propFix[name] || name, name);
}
else {
elem[jQuery.camelCase("default-" + name)] = elem[name] = true;
}
return name;
}
};
jQuery.each(jQuery.expr.match.bool.source.match(/\w+/g), function (i, name) {
var getter = attrHandle[name] || jQuery.find.attr;
attrHandle[name] = getSetInput && getSetAttribute || !ruseDefault.test(name) ?
function (elem, name, isXML) {
var ret, handle;
if (!isXML) {
handle = attrHandle[name];
attrHandle[name] = ret;
ret = getter(elem, name, isXML) != null ?
name.toLowerCase() :
null;
attrHandle[name] = handle;
}
return ret;
} :
function (elem, name, isXML) {
if (!isXML) {
return elem[jQuery.camelCase("default-" + name)] ?
name.toLowerCase() :
null;
}
};
});
if (!getSetInput || !getSetAttribute) {
jQuery.attrHooks.value = {
set: function (elem, value, name) {
if (jQuery.nodeName(elem, "input")) {
elem.defaultValue = value;
}
else {
return nodeHook && nodeHook.set(elem, value, name);
}
}
};
}
if (!getSetAttribute) {
nodeHook = {
set: function (elem, value, name) {
var ret = elem.getAttributeNode(name);
if (!ret) {
elem.setAttributeNode((ret = elem.ownerDocument.createAttribute(name)));
}
ret.value = value += "";
if (name === "value" || value === elem.getAttribute(name)) {
return value;
}
}
};
attrHandle.id = attrHandle.name = attrHandle.coords =
function (elem, name, isXML) {
var ret;
if (!isXML) {
return (ret = elem.getAttributeNode(name)) && ret.value !== "" ?
ret.value :
null;
}
};
jQuery.valHooks.button = {
get: function (elem, name) {
var ret = elem.getAttributeNode(name);
if (ret && ret.specified) {
return ret.value;
}
},
set: nodeHook.set
};
jQuery.attrHooks.contenteditable = {
set: function (elem, value, name) {
nodeHook.set(elem, value === "" ? false : value, name);
}
};
jQuery.each(["width", "height"], function (i, name) {
jQuery.attrHooks[name] = {
set: function (elem, value) {
if (value === "") {
elem.setAttribute(name, "auto");
return value;
}
}
};
});
}
if (!support.style) {
jQuery.attrHooks.style = {
get: function (elem) {
return elem.style.cssText || undefined;
},
set: function (elem, value) {
return (elem.style.cssText = value + "");
}
};
}
var rfocusable = /^(?:input|select|textarea|button|object)$/i, rclickable = /^(?:a|area)$/i;
jQuery.fn.extend({
prop: function (name, value) {
return access(this, jQuery.prop, name, value, arguments.length > 1);
},
removeProp: function (name) {
name = jQuery.propFix[name] || name;
return this.each(function () {
try {
this[name] = undefined;
delete this[name];
}
catch (e) { }
});
}
});
jQuery.extend({
propFix: {
"for": "htmlFor",
"class": "className"
},
prop: function (elem, name, value) {
var ret, hooks, notxml, nType = elem.nodeType;
if (!elem || nType === 3 || nType === 8 || nType === 2) {
return;
}
notxml = nType !== 1 || !jQuery.isXMLDoc(elem);
if (notxml) {
name = jQuery.propFix[name] || name;
hooks = jQuery.propHooks[name];
}
if (value !== undefined) {
return hooks && "set" in hooks && (ret = hooks.set(elem, value, name)) !== undefined ?
ret :
(elem[name] = value);
}
else {
return hooks && "get" in hooks && (ret = hooks.get(elem, name)) !== null ?
ret :
elem[name];
}
},
propHooks: {
tabIndex: {
get: function (elem) {
var tabindex = jQuery.find.attr(elem, "tabindex");
return tabindex ?
parseInt(tabindex, 10) :
rfocusable.test(elem.nodeName) || rclickable.test(elem.nodeName) && elem.href ?
0 :
-1;
}
}
}
});
if (!support.hrefNormalized) {
jQuery.each(["href", "src"], function (i, name) {
jQuery.propHooks[name] = {
get: function (elem) {
return elem.getAttribute(name, 4);
}
};
});
}
if (!support.optSelected) {
jQuery.propHooks.selected = {
get: function (elem) {
var parent = elem.parentNode;
if (parent) {
parent.selectedIndex;
if (parent.parentNode) {
parent.parentNode.selectedIndex;
}
}
return null;
}
};
}
jQuery.each([
"tabIndex",
"readOnly",
"maxLength",
"cellSpacing",
"cellPadding",
"rowSpan",
"colSpan",
"useMap",
"frameBorder",
"contentEditable"
], function () {
jQuery.propFix[this.toLowerCase()] = this;
});
if (!support.enctype) {
jQuery.propFix.enctype = "encoding";
}
var rclass = /[\t\r\n\f]/g;
jQuery.fn.extend({
addClass: function (value) {
var classes, elem, cur, clazz, j, finalValue, i = 0, len = this.length, proceed = typeof value === "string" && value;
if (jQuery.isFunction(value)) {
return this.each(function (j) {
jQuery(this).addClass(value.call(this, j, this.className));
});
}
if (proceed) {
classes = (value || "").match(rnotwhite) || [];
for (; i < len; i++) {
elem = this[i];
cur = elem.nodeType === 1 && (elem.className ?
(" " + elem.className + " ").replace(rclass, " ") :
" ");
if (cur) {
j = 0;
while ((clazz = classes[j++])) {
if (cur.indexOf(" " + clazz + " ") < 0) {
cur += clazz + " ";
}
}
finalValue = jQuery.trim(cur);
if (elem.className !== finalValue) {
elem.className = finalValue;
}
}
}
}
return this;
},
removeClass: function (value) {
var classes, elem, cur, clazz, j, finalValue, i = 0, len = this.length, proceed = arguments.length === 0 || typeof value === "string" && value;
if (jQuery.isFunction(value)) {
return this.each(function (j) {
jQuery(this).removeClass(value.call(this, j, this.className));
});
}
if (proceed) {
classes = (value || "").match(rnotwhite) || [];
for (; i < len; i++) {
elem = this[i];
cur = elem.nodeType === 1 && (elem.className ?
(" " + elem.className + " ").replace(rclass, " ") :
"");
if (cur) {
j = 0;
while ((clazz = classes[j++])) {
while (cur.indexOf(" " + clazz + " ") >= 0) {
cur = cur.replace(" " + clazz + " ", " ");
}
}
finalValue = value ? jQuery.trim(cur) : "";
if (elem.className !== finalValue) {
elem.className = finalValue;
}
}
}
}
return this;
},
toggleClass: function (value, stateVal) {
var type = typeof value;
if (typeof stateVal === "boolean" && type === "string") {
return stateVal ? this.addClass(value) : this.removeClass(value);
}
if (jQuery.isFunction(value)) {
return this.each(function (i) {
jQuery(this).toggleClass(value.call(this, i, this.className, stateVal), stateVal);
});
}
return this.each(function () {
if (type === "string") {
var className, i = 0, self = jQuery(this), classNames = value.match(rnotwhite) || [];
while ((className = classNames[i++])) {
if (self.hasClass(className)) {
self.removeClass(className);
}
else {
self.addClass(className);
}
}
}
else if (type === strundefined || type === "boolean") {
if (this.className) {
jQuery._data(this, "__className__", this.className);
}
this.className = this.className || value === false ? "" : jQuery._data(this, "__className__") || "";
}
});
},
hasClass: function (selector) {
var className = " " + selector + " ", i = 0, l = this.length;
for (; i < l; i++) {
if (this[i].nodeType === 1 && (" " + this[i].className + " ").replace(rclass, " ").indexOf(className) >= 0) {
return true;
}
}
return false;
}
});
jQuery.each(("blur focus focusin focusout load resize scroll unload click dblclick " +
"mousedown mouseup mousemove mouseover mouseout mouseenter mouseleave " +
"change select submit keydown keypress keyup error contextmenu").split(" "), function (i, name) {
jQuery.fn[name] = function (data, fn) {
return arguments.length > 0 ?
this.on(name, null, data, fn) :
this.trigger(name);
};
});
jQuery.fn.extend({
hover: function (fnOver, fnOut) {
return this.mouseenter(fnOver).mouseleave(fnOut || fnOver);
},
bind: function (types, data, fn) {
return this.on(types, null, data, fn);
},
unbind: function (types, fn) {
return this.off(types, null, fn);
},
delegate: function (selector, types, data, fn) {
return this.on(types, selector, data, fn);
},
undelegate: function (selector, types, fn) {
return arguments.length === 1 ? this.off(selector, "**") : this.off(types, selector || "**", fn);
}
});
var nonce = jQuery.now();
var rquery = (/\?/);
var rvalidtokens = /(,)|(\[|{)|(}|])|"(?:[^"\\\r\n]|\\["\\\/bfnrt]|\\u[\da-fA-F]{4})*"\s*:?|true|false|null|-?(?!0\d)\d+(?:\.\d+|)(?:[eE][+-]?\d+|)/g;
jQuery.parseJSON = function (data) {
if (window.JSON && window.JSON.parse) {
return window.JSON.parse(data + "");
}
var requireNonComma, depth = null, str = jQuery.trim(data + "");
return str && !jQuery.trim(str.replace(rvalidtokens, function (token, comma, open, close) {
if (requireNonComma && comma) {
depth = 0;
}
if (depth === 0) {
return token;
}
requireNonComma = open || comma;
depth += !close - !open;
return "";
})) ?
(Function("return " + str))() :
jQuery.error("Invalid JSON: " + data);
};
jQuery.parseXML = function (data) {
var xml, tmp;
if (!data || typeof data !== "string") {
return null;
}
try {
if (window.DOMParser) {
tmp = new DOMParser();
xml = tmp.parseFromString(data, "text/xml");
}
else {
xml = new ActiveXObject("Microsoft.XMLDOM");
xml.async = "false";
xml.loadXML(data);
}
}
catch (e) {
xml = undefined;
}
if (!xml || !xml.documentElement || xml.getElementsByTagName("parsererror").length) {
jQuery.error("Invalid XML: " + data);
}
return xml;
};
var ajaxLocParts, ajaxLocation, rhash = /#.*$/, rts = /([?&])_=[^&]*/, rheaders = /^(.*?):[ \t]*([^\r\n]*)\r?$/mg, rlocalProtocol = /^(?:about|app|app-storage|.+-extension|file|res|widget):$/, rnoContent = /^(?:GET|HEAD)$/, rprotocol = /^\/\//, rurl = /^([\w.+-]+:)(?:\/\/(?:[^\/?#]*@|)([^\/?#:]*)(?::(\d+)|)|)/, prefilters = {}, transports = {}, allTypes = "*/".concat("*");
try {
ajaxLocation = location.href;
}
catch (e) {
ajaxLocation = document.createElement("a");
ajaxLocation.href = "";
ajaxLocation = ajaxLocation.href;
}
ajaxLocParts = rurl.exec(ajaxLocation.toLowerCase()) || [];
function addToPrefiltersOrTransports(structure) {
return function (dataTypeExpression, func) {
if (typeof dataTypeExpression !== "string") {
func = dataTypeExpression;
dataTypeExpression = "*";
}
var dataType, i = 0, dataTypes = dataTypeExpression.toLowerCase().match(rnotwhite) || [];
if (jQuery.isFunction(func)) {
while ((dataType = dataTypes[i++])) {
if (dataType.charAt(0) === "+") {
dataType = dataType.slice(1) || "*";
(structure[dataType] = structure[dataType] || []).unshift(func);
}
else {
(structure[dataType] = structure[dataType] || []).push(func);
}
}
}
};
}
function inspectPrefiltersOrTransports(structure, options, originalOptions, jqXHR) {
var inspected = {}, seekingTransport = (structure === transports);
function inspect(dataType) {
var selected;
inspected[dataType] = true;
jQuery.each(structure[dataType] || [], function (_, prefilterOrFactory) {
var dataTypeOrTransport = prefilterOrFactory(options, originalOptions, jqXHR);
if (typeof dataTypeOrTransport === "string" && !seekingTransport && !inspected[dataTypeOrTransport]) {
options.dataTypes.unshift(dataTypeOrTransport);
inspect(dataTypeOrTransport);
return false;
}
else if (seekingTransport) {
return !(selected = dataTypeOrTransport);
}
});
return selected;
}
return inspect(options.dataTypes[0]) || !inspected["*"] && inspect("*");
}
function ajaxExtend(target, src) {
var deep, key, flatOptions = jQuery.ajaxSettings.flatOptions || {};
for (key in src) {
if (src[key] !== undefined) {
(flatOptions[key] ? target : (deep || (deep = {})))[key] = src[key];
}
}
if (deep) {
jQuery.extend(true, target, deep);
}
return target;
}
function ajaxHandleResponses(s, jqXHR, responses) {
var firstDataType, ct, finalDataType, type, contents = s.contents, dataTypes = s.dataTypes;
while (dataTypes[0] === "*") {
dataTypes.shift();
if (ct === undefined) {
ct = s.mimeType || jqXHR.getResponseHeader("Content-Type");
}
}
if (ct) {
for (type in contents) {
if (contents[type] && contents[type].test(ct)) {
dataTypes.unshift(type);
break;
}
}
}
if (dataTypes[0] in responses) {
finalDataType = dataTypes[0];
}
else {
for (type in responses) {
if (!dataTypes[0] || s.converters[type + " " + dataTypes[0]]) {
finalDataType = type;
break;
}
if (!firstDataType) {
firstDataType = type;
}
}
finalDataType = finalDataType || firstDataType;
}
if (finalDataType) {
if (finalDataType !== dataTypes[0]) {
dataTypes.unshift(finalDataType);
}
return responses[finalDataType];
}
}
function ajaxConvert(s, response, jqXHR, isSuccess) {
var conv2, current, conv, tmp, prev, converters = {}, dataTypes = s.dataTypes.slice();
if (dataTypes[1]) {
for (conv in s.converters) {
converters[conv.toLowerCase()] = s.converters[conv];
}
}
current = dataTypes.shift();
while (current) {
if (s.responseFields[current]) {
jqXHR[s.responseFields[current]] = response;
}
if (!prev && isSuccess && s.dataFilter) {
response = s.dataFilter(response, s.dataType);
}
prev = current;
current = dataTypes.shift();
if (current) {
if (current === "*") {
current = prev;
}
else if (prev !== "*" && prev !== current) {
conv = converters[prev + " " + current] || converters["* " + current];
if (!conv) {
for (conv2 in converters) {
tmp = conv2.split(" ");
if (tmp[1] === current) {
conv = converters[prev + " " + tmp[0]] ||
converters["* " + tmp[0]];
if (conv) {
if (conv === true) {
conv = converters[conv2];
}
else if (converters[conv2] !== true) {
current = tmp[0];
dataTypes.unshift(tmp[1]);
}
break;
}
}
}
}
if (conv !== true) {
if (conv && s["throws"]) {
response = conv(response);
}
else {
try {
response = conv(response);
}
catch (e) {
return { state: "parsererror", error: conv ? e : "No conversion from " + prev + " to " + current };
}
}
}
}
}
}
return { state: "success", data: response };
}
jQuery.extend({
active: 0,
lastModified: {},
etag: {},
ajaxSettings: {
url: ajaxLocation,
type: "GET",
isLocal: rlocalProtocol.test(ajaxLocParts[1]),
global: true,
processData: true,
async: true,
contentType: "application/x-www-form-urlencoded; charset=UTF-8",
accepts: {
"*": allTypes,
text: "text/plain",
html: "text/html",
xml: "application/xml, text/xml",
json: "application/json, text/javascript"
},
contents: {
xml: /xml/,
html: /html/,
json: /json/
},
responseFields: {
xml: "responseXML",
text: "responseText",
json: "responseJSON"
},
converters: {
"* text": String,
"text html": true,
"text json": jQuery.parseJSON,
"text xml": jQuery.parseXML
},
flatOptions: {
url: true,
context: true
}
},
ajaxSetup: function (target, settings) {
return settings ?
ajaxExtend(ajaxExtend(target, jQuery.ajaxSettings), settings) :
ajaxExtend(jQuery.ajaxSettings, target);
},
ajaxPrefilter: addToPrefiltersOrTransports(prefilters),
ajaxTransport: addToPrefiltersOrTransports(transports),
ajax: function (url, options) {
if (typeof url === "object") {
options = url;
url = undefined;
}
options = options || {};
var parts, i, cacheURL, responseHeadersString, timeoutTimer, fireGlobals, transport, responseHeaders, s = jQuery.ajaxSetup({}, options), callbackContext = s.context || s, globalEventContext = s.context && (callbackContext.nodeType || callbackContext.jquery) ?
jQuery(callbackContext) :
jQuery.event, deferred = jQuery.Deferred(), completeDeferred = jQuery.Callbacks("once memory"), statusCode = s.statusCode || {}, requestHeaders = {}, requestHeadersNames = {}, state = 0, strAbort = "canceled", jqXHR = {
readyState: 0,
getResponseHeader: function (key) {
var match;
if (state === 2) {
if (!responseHeaders) {
responseHeaders = {};
while ((match = rheaders.exec(responseHeadersString))) {
responseHeaders[match[1].toLowerCase()] = match[2];
}
}
match = responseHeaders[key.toLowerCase()];
}
return match == null ? null : match;
},
getAllResponseHeaders: function () {
return state === 2 ? responseHeadersString : null;
},
setRequestHeader: function (name, value) {
var lname = name.toLowerCase();
if (!state) {
name = requestHeadersNames[lname] = requestHeadersNames[lname] || name;
requestHeaders[name] = value;
}
return this;
},
overrideMimeType: function (type) {
if (!state) {
s.mimeType = type;
}
return this;
},
statusCode: function (map) {
var code;
if (map) {
if (state < 2) {
for (code in map) {
statusCode[code] = [statusCode[code], map[code]];
}
}
else {
jqXHR.always(map[jqXHR.status]);
}
}
return this;
},
abort: function (statusText) {
var finalText = statusText || strAbort;
if (transport) {
transport.abort(finalText);
}
done(0, finalText);
return this;
}
};
deferred.promise(jqXHR).complete = completeDeferred.add;
jqXHR.success = jqXHR.done;
jqXHR.error = jqXHR.fail;
s.url = ((url || s.url || ajaxLocation) + "").replace(rhash, "").replace(rprotocol, ajaxLocParts[1] + "//");
s.type = options.method || options.type || s.method || s.type;
s.dataTypes = jQuery.trim(s.dataType || "*").toLowerCase().match(rnotwhite) || [""];
if (s.crossDomain == null) {
parts = rurl.exec(s.url.toLowerCase());
s.crossDomain = !!(parts &&
(parts[1] !== ajaxLocParts[1] || parts[2] !== ajaxLocParts[2] ||
(parts[3] || (parts[1] === "http:" ? "80" : "443")) !==
(ajaxLocParts[3] || (ajaxLocParts[1] === "http:" ? "80" : "443"))));
}
if (s.data && s.processData && typeof s.data !== "string") {
s.data = jQuery.param(s.data, s.traditional);
}
inspectPrefiltersOrTransports(prefilters, s, options, jqXHR);
if (state === 2) {
return jqXHR;
}
fireGlobals = s.global;
if (fireGlobals && jQuery.active++ === 0) {
jQuery.event.trigger("ajaxStart");
}
s.type = s.type.toUpperCase();
s.hasContent = !rnoContent.test(s.type);
cacheURL = s.url;
if (!s.hasContent) {
if (s.data) {
cacheURL = (s.url += (rquery.test(cacheURL) ? "&" : "?") + s.data);
delete s.data;
}
if (s.cache === false) {
s.url = rts.test(cacheURL) ?
cacheURL.replace(rts, "$1_=" + nonce++) :
cacheURL + (rquery.test(cacheURL) ? "&" : "?") + "_=" + nonce++;
}
}
if (s.ifModified) {
if (jQuery.lastModified[cacheURL]) {
jqXHR.setRequestHeader("If-Modified-Since", jQuery.lastModified[cacheURL]);
}
if (jQuery.etag[cacheURL]) {
jqXHR.setRequestHeader("If-None-Match", jQuery.etag[cacheURL]);
}
}
if (s.data && s.hasContent && s.contentType !== false || options.contentType) {
jqXHR.setRequestHeader("Content-Type", s.contentType);
}
jqXHR.setRequestHeader("Accept", s.dataTypes[0] && s.accepts[s.dataTypes[0]] ?
s.accepts[s.dataTypes[0]] + (s.dataTypes[0] !== "*" ? ", " + allTypes + "; q=0.01" : "") :
s.accepts["*"]);
for (i in s.headers) {
jqXHR.setRequestHeader(i, s.headers[i]);
}
if (s.beforeSend && (s.beforeSend.call(callbackContext, jqXHR, s) === false || state === 2)) {
return jqXHR.abort();
}
strAbort = "abort";
for (i in { success: 1, error: 1, complete: 1 }) {
jqXHR[i](s[i]);
}
transport = inspectPrefiltersOrTransports(transports, s, options, jqXHR);
if (!transport) {
done(-1, "No Transport");
}
else {
jqXHR.readyState = 1;
if (fireGlobals) {
globalEventContext.trigger("ajaxSend", [jqXHR, s]);
}
if (s.async && s.timeout > 0) {
timeoutTimer = setTimeout(function () {
jqXHR.abort("timeout");
}, s.timeout);
}
try {
state = 1;
transport.send(requestHeaders, done);
}
catch (e) {
if (state < 2) {
done(-1, e);
}
else {
throw e;
}
}
}
function done(status, nativeStatusText, responses, headers) {
var isSuccess, success, error, response, modified, statusText = nativeStatusText;
if (state === 2) {
return;
}
state = 2;
if (timeoutTimer) {
clearTimeout(timeoutTimer);
}
transport = undefined;
responseHeadersString = headers || "";
jqXHR.readyState = status > 0 ? 4 : 0;
isSuccess = status >= 200 && status < 300 || status === 304;
if (responses) {
response = ajaxHandleResponses(s, jqXHR, responses);
}
response = ajaxConvert(s, response, jqXHR, isSuccess);
if (isSuccess) {
if (s.ifModified) {
modified = jqXHR.getResponseHeader("Last-Modified");
if (modified) {
jQuery.lastModified[cacheURL] = modified;
}
modified = jqXHR.getResponseHeader("etag");
if (modified) {
jQuery.etag[cacheURL] = modified;
}
}
if (status === 204 || s.type === "HEAD") {
statusText = "nocontent";
}
else if (status === 304) {
statusText = "notmodified";
}
else {
statusText = response.state;
success = response.data;
error = response.error;
isSuccess = !error;
}
}
else {
error = statusText;
if (status || !statusText) {
statusText = "error";
if (status < 0) {
status = 0;
}
}
}
jqXHR.status = status;
jqXHR.statusText = (nativeStatusText || statusText) + "";
if (isSuccess) {
deferred.resolveWith(callbackContext, [success, statusText, jqXHR]);
}
else {
deferred.rejectWith(callbackContext, [jqXHR, statusText, error]);
}
jqXHR.statusCode(statusCode);
statusCode = undefined;
if (fireGlobals) {
globalEventContext.trigger(isSuccess ? "ajaxSuccess" : "ajaxError", [jqXHR, s, isSuccess ? success : error]);
}
completeDeferred.fireWith(callbackContext, [jqXHR, statusText]);
if (fireGlobals) {
globalEventContext.trigger("ajaxComplete", [jqXHR, s]);
if (!(--jQuery.active)) {
jQuery.event.trigger("ajaxStop");
}
}
}
return jqXHR;
},
getJSON: function (url, data, callback) {
return jQuery.get(url, data, callback, "json");
},
getScript: function (url, callback) {
return jQuery.get(url, undefined, callback, "script");
}
});
jQuery.each(["get", "post"], function (i, method) {
jQuery[method] = function (url, data, callback, type) {
if (jQuery.isFunction(data)) {
type = type || callback;
callback = data;
data = undefined;
}
return jQuery.ajax({
url: url,
type: method,
dataType: type,
data: data,
success: callback
});
};
});
jQuery.each(["ajaxStart", "ajaxStop", "ajaxComplete", "ajaxError", "ajaxSuccess", "ajaxSend"], function (i, type) {
jQuery.fn[type] = function (fn) {
return this.on(type, fn);
};
});
jQuery._evalUrl = function (url) {
return jQuery.ajax({
url: url,
type: "GET",
dataType: "script",
async: false,
global: false,
"throws": true
});
};
jQuery.fn.extend({
wrapAll: function (html) {
if (jQuery.isFunction(html)) {
return this.each(function (i) {
jQuery(this).wrapAll(html.call(this, i));
});
}
if (this[0]) {
var wrap = jQuery(html, this[0].ownerDocument).eq(0).clone(true);
if (this[0].parentNode) {
wrap.insertBefore(this[0]);
}
wrap.map(function () {
var elem = this;
while (elem.firstChild && elem.firstChild.nodeType === 1) {
elem = elem.firstChild;
}
return elem;
}).append(this);
}
return this;
},
wrapInner: function (html) {
if (jQuery.isFunction(html)) {
return this.each(function (i) {
jQuery(this).wrapInner(html.call(this, i));
});
}
return this.each(function () {
var self = jQuery(this), contents = self.contents();
if (contents.length) {
contents.wrapAll(html);
}
else {
self.append(html);
}
});
},
wrap: function (html) {
var isFunction = jQuery.isFunction(html);
return this.each(function (i) {
jQuery(this).wrapAll(isFunction ? html.call(this, i) : html);
});
},
unwrap: function () {
return this.parent().each(function () {
if (!jQuery.nodeName(this, "body")) {
jQuery(this).replaceWith(this.childNodes);
}
}).end();
}
});
jQuery.expr.filters.hidden = function (elem) {
return elem.offsetWidth <= 0 && elem.offsetHeight <= 0 ||
(!support.reliableHiddenOffsets() &&
((elem.style && elem.style.display) || jQuery.css(elem, "display")) === "none");
};
jQuery.expr.filters.visible = function (elem) {
return !jQuery.expr.filters.hidden(elem);
};
var r20 = /%20/g, rbracket = /\[\]$/, rCRLF = /\r?\n/g, rsubmitterTypes = /^(?:submit|button|image|reset|file)$/i, rsubmittable = /^(?:input|select|textarea|keygen)/i;
function buildParams(prefix, obj, traditional, add) {
var name;
if (jQuery.isArray(obj)) {
jQuery.each(obj, function (i, v) {
if (traditional || rbracket.test(prefix)) {
add(prefix, v);
}
else {
buildParams(prefix + "[" + (typeof v === "object" ? i : "") + "]", v, traditional, add);
}
});
}
else if (!traditional && jQuery.type(obj) === "object") {
for (name in obj) {
buildParams(prefix + "[" + name + "]", obj[name], traditional, add);
}
}
else {
add(prefix, obj);
}
}
jQuery.param = function (a, traditional) {
var prefix, s = [], add = function (key, value) {
value = jQuery.isFunction(value) ? value() : (value == null ? "" : value);
s[s.length] = encodeURIComponent(key) + "=" + encodeURIComponent(value);
};
if (traditional === undefined) {
traditional = jQuery.ajaxSettings && jQuery.ajaxSettings.traditional;
}
if (jQuery.isArray(a) || (a.jquery && !jQuery.isPlainObject(a))) {
jQuery.each(a, function () {
add(this.name, this.value);
});
}
else {
for (prefix in a) {
buildParams(prefix, a[prefix], traditional, add);
}
}
return s.join("&").replace(r20, "+");
};
jQuery.fn.extend({
serialize: function () {
return jQuery.param(this.serializeArray());
},
serializeArray: function () {
return this.map(function () {
var elements = jQuery.prop(this, "elements");
return elements ? jQuery.makeArray(elements) : this;
})
.filter(function () {
var type = this.type;
return this.name && !jQuery(this).is(":disabled") &&
rsubmittable.test(this.nodeName) && !rsubmitterTypes.test(type) &&
(this.checked || !rcheckableType.test(type));
})
.map(function (i, elem) {
var val = jQuery(this).val();
return val == null ?
null :
jQuery.isArray(val) ?
jQuery.map(val, function (val) {
return { name: elem.name, value: val.replace(rCRLF, "\r\n") };
}) :
{ name: elem.name, value: val.replace(rCRLF, "\r\n") };
}).get();
}
});
jQuery.ajaxSettings.xhr = window.ActiveXObject !== undefined ?
function () {
return !this.isLocal &&
/^(get|post|head|put|delete|options)$/i.test(this.type) &&
createStandardXHR() || createActiveXHR();
} :
createStandardXHR;
var xhrId = 0, xhrCallbacks = {}, xhrSupported = jQuery.ajaxSettings.xhr();
if (window.ActiveXObject) {
jQuery(window).on("unload", function () {
for (var key in xhrCallbacks) {
xhrCallbacks[key](undefined, true);
}
});
}
support.cors = !!xhrSupported && ("withCredentials" in xhrSupported);
xhrSupported = support.ajax = !!xhrSupported;
if (xhrSupported) {
jQuery.ajaxTransport(function (options) {
if (!options.crossDomain || support.cors) {
var callback;
return {
send: function (headers, complete) {
var i, xhr = options.xhr(), id = ++xhrId;
xhr.open(options.type, options.url, options.async, options.username, options.password);
if (options.xhrFields) {
for (i in options.xhrFields) {
xhr[i] = options.xhrFields[i];
}
}
if (options.mimeType && xhr.overrideMimeType) {
xhr.overrideMimeType(options.mimeType);
}
if (!options.crossDomain && !headers["X-Requested-With"]) {
headers["X-Requested-With"] = "XMLHttpRequest";
}
for (i in headers) {
if (headers[i] !== undefined) {
xhr.setRequestHeader(i, headers[i] + "");
}
}
xhr.send((options.hasContent && options.data) || null);
callback = function (_, isAbort) {
var status, statusText, responses;
if (callback && (isAbort || xhr.readyState === 4)) {
delete xhrCallbacks[id];
callback = undefined;
xhr.onreadystatechange = jQuery.noop;
if (isAbort) {
if (xhr.readyState !== 4) {
xhr.abort();
}
}
else {
responses = {};
status = xhr.status;
if (typeof xhr.responseText === "string") {
responses.text = xhr.responseText;
}
try {
statusText = xhr.statusText;
}
catch (e) {
statusText = "";
}
if (!status && options.isLocal && !options.crossDomain) {
status = responses.text ? 200 : 404;
}
else if (status === 1223) {
status = 204;
}
}
}
if (responses) {
complete(status, statusText, responses, xhr.getAllResponseHeaders());
}
};
if (!options.async) {
callback();
}
else if (xhr.readyState === 4) {
setTimeout(callback);
}
else {
xhr.onreadystatechange = xhrCallbacks[id] = callback;
}
},
abort: function () {
if (callback) {
callback(undefined, true);
}
}
};
}
});
}
function createStandardXHR() {
try {
return new window.XMLHttpRequest();
}
catch (e) { }
}
function createActiveXHR() {
try {
return new window.ActiveXObject("Microsoft.XMLHTTP");
}
catch (e) { }
}
jQuery.ajaxSetup({
accepts: {
script: "text/javascript, application/javascript, application/ecmascript, application/x-ecmascript"
},
contents: {
script: /(?:java|ecma)script/
},
converters: {
"text script": function (text) {
jQuery.globalEval(text);
return text;
}
}
});
jQuery.ajaxPrefilter("script", function (s) {
if (s.cache === undefined) {
s.cache = false;
}
if (s.crossDomain) {
s.type = "GET";
s.global = false;
}
});
jQuery.ajaxTransport("script", function (s) {
if (s.crossDomain) {
var script, head = document.head || jQuery("head")[0] || document.documentElement;
return {
send: function (_, callback) {
script = document.createElement("script");
script.async = true;
if (s.scriptCharset) {
script.charset = s.scriptCharset;
}
script.src = s.url;
script.onload = script.onreadystatechange = function (_, isAbort) {
if (isAbort || !script.readyState || /loaded|complete/.test(script.readyState)) {
script.onload = script.onreadystatechange = null;
if (script.parentNode) {
script.parentNode.removeChild(script);
}
script = null;
if (!isAbort) {
callback(200, "success");
}
}
};
head.insertBefore(script, head.firstChild);
},
abort: function () {
if (script) {
script.onload(undefined, true);
}
}
};
}
});
var oldCallbacks = [], rjsonp = /(=)\?(?=&|$)|\?\?/;
jQuery.ajaxSetup({
jsonp: "callback",
jsonpCallback: function () {
var callback = oldCallbacks.pop() || (jQuery.expando + "_" + (nonce++));
this[callback] = true;
return callback;
}
});
jQuery.ajaxPrefilter("json jsonp", function (s, originalSettings, jqXHR) {
var callbackName, overwritten, responseContainer, jsonProp = s.jsonp !== false && (rjsonp.test(s.url) ?
"url" :
typeof s.data === "string" && !(s.contentType || "").indexOf("application/x-www-form-urlencoded") && rjsonp.test(s.data) && "data");
if (jsonProp || s.dataTypes[0] === "jsonp") {
callbackName = s.jsonpCallback = jQuery.isFunction(s.jsonpCallback) ?
s.jsonpCallback() :
s.jsonpCallback;
if (jsonProp) {
s[jsonProp] = s[jsonProp].replace(rjsonp, "$1" + callbackName);
}
else if (s.jsonp !== false) {
s.url += (rquery.test(s.url) ? "&" : "?") + s.jsonp + "=" + callbackName;
}
s.converters["script json"] = function () {
if (!responseContainer) {
jQuery.error(callbackName + " was not called");
}
return responseContainer[0];
};
s.dataTypes[0] = "json";
overwritten = window[callbackName];
window[callbackName] = function () {
responseContainer = arguments;
};
jqXHR.always(function () {
window[callbackName] = overwritten;
if (s[callbackName]) {
s.jsonpCallback = originalSettings.jsonpCallback;
oldCallbacks.push(callbackName);
}
if (responseContainer && jQuery.isFunction(overwritten)) {
overwritten(responseContainer[0]);
}
responseContainer = overwritten = undefined;
});
return "script";
}
});
jQuery.parseHTML = function (data, context, keepScripts) {
if (!data || typeof data !== "string") {
return null;
}
if (typeof context === "boolean") {
keepScripts = context;
context = false;
}
context = context || document;
var parsed = rsingleTag.exec(data), scripts = !keepScripts && [];
if (parsed) {
return [context.createElement(parsed[1])];
}
parsed = jQuery.buildFragment([data], context, scripts);
if (scripts && scripts.length) {
jQuery(scripts).remove();
}
return jQuery.merge([], parsed.childNodes);
};
var _load = jQuery.fn.load;
jQuery.fn.load = function (url, params, callback) {
if (typeof url !== "string" && _load) {
return _load.apply(this, arguments);
}
var selector, response, type, self = this, off = url.indexOf(" ");
if (off >= 0) {
selector = jQuery.trim(url.slice(off, url.length));
url = url.slice(0, off);
}
if (jQuery.isFunction(params)) {
callback = params;
params = undefined;
}
else if (params && typeof params === "object") {
type = "POST";
}
if (self.length > 0) {
jQuery.ajax({
url: url,
type: type,
dataType: "html",
data: params
}).done(function (responseText) {
response = arguments;
self.html(selector ?
jQuery("").append(jQuery.parseHTML(responseText)).find(selector) :
responseText);
}).complete(callback && function (jqXHR, status) {
self.each(callback, response || [jqXHR.responseText, status, jqXHR]);
});
}
return this;
};
jQuery.expr.filters.animated = function (elem) {
return jQuery.grep(jQuery.timers, function (fn) {
return elem === fn.elem;
}).length;
};
var docElem = window.document.documentElement;
function getWindow(elem) {
return jQuery.isWindow(elem) ?
elem :
elem.nodeType === 9 ?
elem.defaultView || elem.parentWindow :
false;
}
jQuery.offset = {
setOffset: function (elem, options, i) {
var curPosition, curLeft, curCSSTop, curTop, curOffset, curCSSLeft, calculatePosition, position = jQuery.css(elem, "position"), curElem = jQuery(elem), props = {};
if (position === "static") {
elem.style.position = "relative";
}
curOffset = curElem.offset();
curCSSTop = jQuery.css(elem, "top");
curCSSLeft = jQuery.css(elem, "left");
calculatePosition = (position === "absolute" || position === "fixed") &&
jQuery.inArray("auto", [curCSSTop, curCSSLeft]) > -1;
if (calculatePosition) {
curPosition = curElem.position();
curTop = curPosition.top;
curLeft = curPosition.left;
}
else {
curTop = parseFloat(curCSSTop) || 0;
curLeft = parseFloat(curCSSLeft) || 0;
}
if (jQuery.isFunction(options)) {
options = options.call(elem, i, curOffset);
}
if (options.top != null) {
props.top = (options.top - curOffset.top) + curTop;
}
if (options.left != null) {
props.left = (options.left - curOffset.left) + curLeft;
}
if ("using" in options) {
options.using.call(elem, props);
}
else {
curElem.css(props);
}
}
};
jQuery.fn.extend({
offset: function (options) {
if (arguments.length) {
return options === undefined ?
this :
this.each(function (i) {
jQuery.offset.setOffset(this, options, i);
});
}
var docElem, win, box = { top: 0, left: 0 }, elem = this[0], doc = elem && elem.ownerDocument;
if (!doc) {
return;
}
docElem = doc.documentElement;
if (!jQuery.contains(docElem, elem)) {
return box;
}
if (typeof elem.getBoundingClientRect !== strundefined) {
box = elem.getBoundingClientRect();
}
win = getWindow(doc);
return {
top: box.top + (win.pageYOffset || docElem.scrollTop) - (docElem.clientTop || 0),
left: box.left + (win.pageXOffset || docElem.scrollLeft) - (docElem.clientLeft || 0)
};
},
position: function () {
if (!this[0]) {
return;
}
var offsetParent, offset, parentOffset = { top: 0, left: 0 }, elem = this[0];
if (jQuery.css(elem, "position") === "fixed") {
offset = elem.getBoundingClientRect();
}
else {
offsetParent = this.offsetParent();
offset = this.offset();
if (!jQuery.nodeName(offsetParent[0], "html")) {
parentOffset = offsetParent.offset();
}
parentOffset.top += jQuery.css(offsetParent[0], "borderTopWidth", true);
parentOffset.left += jQuery.css(offsetParent[0], "borderLeftWidth", true);
}
return {
top: offset.top - parentOffset.top - jQuery.css(elem, "marginTop", true),
left: offset.left - parentOffset.left - jQuery.css(elem, "marginLeft", true)
};
},
offsetParent: function () {
return this.map(function () {
var offsetParent = this.offsetParent || docElem;
while (offsetParent && (!jQuery.nodeName(offsetParent, "html") && jQuery.css(offsetParent, "position") === "static")) {
offsetParent = offsetParent.offsetParent;
}
return offsetParent || docElem;
});
}
});
jQuery.each({ scrollLeft: "pageXOffset", scrollTop: "pageYOffset" }, function (method, prop) {
var top = /Y/.test(prop);
jQuery.fn[method] = function (val) {
return access(this, function (elem, method, val) {
var win = getWindow(elem);
if (val === undefined) {
return win ? (prop in win) ? win[prop] :
win.document.documentElement[method] :
elem[method];
}
if (win) {
win.scrollTo(!top ? val : jQuery(win).scrollLeft(), top ? val : jQuery(win).scrollTop());
}
else {
elem[method] = val;
}
}, method, val, arguments.length, null);
};
});
jQuery.each(["top", "left"], function (i, prop) {
jQuery.cssHooks[prop] = addGetHookIf(support.pixelPosition, function (elem, computed) {
if (computed) {
computed = curCSS(elem, prop);
return rnumnonpx.test(computed) ?
jQuery(elem).position()[prop] + "px" :
computed;
}
});
});
jQuery.each({ Height: "height", Width: "width" }, function (name, type) {
jQuery.each({ padding: "inner" + name, content: type, "": "outer" + name }, function (defaultExtra, funcName) {
jQuery.fn[funcName] = function (margin, value) {
var chainable = arguments.length && (defaultExtra || typeof margin !== "boolean"), extra = defaultExtra || (margin === true || value === true ? "margin" : "border");
return access(this, function (elem, type, value) {
var doc;
if (jQuery.isWindow(elem)) {
return elem.document.documentElement["client" + name];
}
if (elem.nodeType === 9) {
doc = elem.documentElement;
return Math.max(elem.body["scroll" + name], doc["scroll" + name], elem.body["offset" + name], doc["offset" + name], doc["client" + name]);
}
return value === undefined ?
jQuery.css(elem, type, extra) :
jQuery.style(elem, type, value, extra);
}, type, chainable ? margin : undefined, chainable, null);
};
});
});
jQuery.fn.size = function () {
return this.length;
};
jQuery.fn.andSelf = jQuery.fn.addBack;
if (typeof define === "function" && define.amd) {
define("jquery", [], function () {
return jQuery;
});
}
var _jQuery = window.jQuery, _$ = window.$;
jQuery.noConflict = function (deep) {
if (window.$ === jQuery) {
window.$ = _$;
}
if (deep && window.jQuery === jQuery) {
window.jQuery = _jQuery;
}
return jQuery;
};
if (typeof noGlobal === strundefined) {
window.jQuery = window.$ = jQuery;
}
return jQuery;
}));
} // react-scroll/modules/index.js $fsx.f[128] = (module, exports) => { 'use strict'; Object.defineProperty(exports, "__esModule", {
value: true
}); exports.Helpers = exports.ScrollElement = exports.ScrollLink = exports.animateScroll = exports.scrollSpy = exports.Events = exports.scroller = exports.Element = exports.Button = exports.Link = undefined; var _Link = $fsx.r(123); var _Link2 = _interopRequireDefault(_Link); var _Button = $fsx.r(124); var _Button2 = _interopRequireDefault(_Button); var _Element = $fsx.r(126); var _Element2 = _interopRequireDefault(_Element); var _scroller = $fsx.r(120); var _scroller2 = _interopRequireDefault(_scroller); var _scrollEvents = $fsx.r(118); var _scrollEvents2 = _interopRequireDefault(_scrollEvents); var _scrollSpy = $fsx.r(114); var _scrollSpy2 = _interopRequireDefault(_scrollSpy); var _animateScroll = $fsx.r(119); var _animateScroll2 = _interopRequireDefault(_animateScroll); var _scrollLink = $fsx.r(122); var _scrollLink2 = _interopRequireDefault(_scrollLink); var _scrollElement = $fsx.r(125); var _scrollElement2 = _interopRequireDefault(_scrollElement); var _Helpers = $fsx.r(127); var _Helpers2 = _interopRequireDefault(_Helpers); function _interopRequireDefault(obj) { return obj && obj.__esModule ? obj : { default: obj }; } exports.Link = _Link2.default; exports.Button = _Button2.default; exports.Element = _Element2.default; exports.scroller = _scroller2.default; exports.Events = _scrollEvents2.default; exports.scrollSpy = _scrollSpy2.default; exports.animateScroll = _animateScroll2.default; exports.ScrollLink = _scrollLink2.default; exports.ScrollElement = _scrollElement2.default; exports.Helpers = _Helpers2.default; exports.default = { Link: _Link2.default, Button: _Button2.default, Element: _Element2.default, scroller: _scroller2.default, Events: _scrollEvents2.default, scrollSpy: _scrollSpy2.default, animateScroll: _animateScroll2.default, ScrollLink: _scrollLink2.default, ScrollElement: _scrollElement2.default, Helpers: _Helpers2.default };
} // react-scroll/modules/components/Link.js $fsx.f[123] = (module, exports) => { "use strict"; Object.defineProperty(exports, "__esModule", {
value: true
}); var _react = $fsx.r(3); var _react2 = _interopRequireDefault(_react); var _scrollLink = $fsx.r(122); var _scrollLink2 = _interopRequireDefault(_scrollLink); function _interopRequireDefault(obj) { return obj && obj.__esModule ? obj : { default: obj }; } function _classCallCheck(instance, Constructor) { if (!(instance instanceof Constructor)) {
throw new TypeError("Cannot call a class as a function");
} } function _possibleConstructorReturn(self, call) { if (!self) {
throw new ReferenceError("this hasn't been initialised - super() hasn't been called");
} return call && (typeof call === "object" || typeof call === "function") ? call : self; } function _inherits(subClass, superClass) { if (typeof superClass !== "function" && superClass !== null) {
throw new TypeError("Super expression must either be null or a function, not " + typeof superClass);
} subClass.prototype = Object.create(superClass && superClass.prototype, { constructor: { value: subClass, enumerable: false, writable: true, configurable: true } }); if (superClass)
Object.setPrototypeOf ? Object.setPrototypeOf(subClass, superClass) : subClass.__proto__ = superClass; }
var LinkElement = function (_React$Component) {
_inherits(LinkElement, _React$Component);
function LinkElement() {
var _ref;
var _temp, _this, _ret;
_classCallCheck(this, LinkElement);
for (var _len = arguments.length, args = Array(_len), _key = 0; _key < _len; _key++) {
args[_key] = arguments[_key];
}
return _ret = (_temp = (_this = _possibleConstructorReturn(this, (_ref = LinkElement.__proto__ || Object.getPrototypeOf(LinkElement)).call.apply(_ref, [this].concat(args))), _this), _this.render = function () {
return _react2.default.createElement('a', _this.props, _this.props.children);
}, _temp), _possibleConstructorReturn(_this, _ret);
}
return LinkElement;
}(_react2.default.Component);
exports.default = (0, _scrollLink2.default)(LinkElement);
} // react-scroll/modules/mixins/scroll-link.js $fsx.f[122] = (module, exports) => { 'use strict'; Object.defineProperty(exports, "__esModule", {
value: true
}); var _extends = Object.assign || function (target) { for (var i = 1; i < arguments.length; i++) {
var source = arguments[i];
for (var key in source) {
if (Object.prototype.hasOwnProperty.call(source, key)) {
target[key] = source[key];
}
}
} return target; }; var _createClass = function () { function defineProperties(target, props) { for (var i = 0; i < props.length; i++) {
var descriptor = props[i];
descriptor.enumerable = descriptor.enumerable || false;
descriptor.configurable = true;
if ("value" in descriptor)
descriptor.writable = true;
Object.defineProperty(target, descriptor.key, descriptor);
} } return function (Constructor, protoProps, staticProps) { if (protoProps)
defineProperties(Constructor.prototype, protoProps); if (staticProps) defineProperties(Constructor, staticProps); return Constructor; }; }();
var _react = $fsx.r(3); var _react2 = _interopRequireDefault(_react); var _scrollSpy = $fsx.r(114); var _scrollSpy2 = _interopRequireDefault(_scrollSpy); var _scroller = $fsx.r(120); var _scroller2 = _interopRequireDefault(_scroller); var _propTypes = $fsx.r(13); var _propTypes2 = _interopRequireDefault(_propTypes); var _scrollHash = $fsx.r(121); var _scrollHash2 = _interopRequireDefault(_scrollHash); function _interopRequireDefault(obj) { return obj && obj.__esModule ? obj : { default: obj }; } function _classCallCheck(instance, Constructor) { if (!(instance instanceof Constructor)) {
throw new TypeError("Cannot call a class as a function");
} } function _possibleConstructorReturn(self, call) { if (!self) {
throw new ReferenceError("this hasn't been initialised - super() hasn't been called");
} return call && (typeof call === "object" || typeof call === "function") ? call : self; } function _inherits(subClass, superClass) { if (typeof superClass !== "function" && superClass !== null) {
throw new TypeError("Super expression must either be null or a function, not " + typeof superClass);
} subClass.prototype = Object.create(superClass && superClass.prototype, { constructor: { value: subClass, enumerable: false, writable: true, configurable: true } }); if (superClass)
Object.setPrototypeOf ? Object.setPrototypeOf(subClass, superClass) : subClass.__proto__ = superClass; }
var protoTypes = {
to: _propTypes2.default.string.isRequired, containerId: _propTypes2.default.string, container: _propTypes2.default.object, activeClass: _propTypes2.default.string, spy: _propTypes2.default.bool, smooth: _propTypes2.default.oneOfType([_propTypes2.default.bool, _propTypes2.default.string]), offset: _propTypes2.default.number, delay: _propTypes2.default.number, isDynamic: _propTypes2.default.bool, onClick: _propTypes2.default.func, duration: _propTypes2.default.oneOfType([_propTypes2.default.number, _propTypes2.default.func]), absolute: _propTypes2.default.bool, onSetActive: _propTypes2.default.func, onSetInactive: _propTypes2.default.func, ignoreCancelEvents: _propTypes2.default.bool, hashSpy: _propTypes2.default.bool
}; exports.default = function (Component, customScroller) {
var scroller = customScroller || _scroller2.default;
var Link = function (_React$PureComponent) {
_inherits(Link, _React$PureComponent);
function Link(props) {
_classCallCheck(this, Link);
var _this = _possibleConstructorReturn(this, (Link.__proto__ || Object.getPrototypeOf(Link)).call(this, props));
_initialiseProps.call(_this);
_this.state = {
active: false
};
return _this;
}
_createClass(Link, [{
key: 'getScrollSpyContainer',
value: function getScrollSpyContainer() {
var containerId = this.props.containerId;
var container = this.props.container;
if (containerId && !container) {
return document.getElementById(containerId);
}
if (container && container.nodeType) {
return container;
}
return document;
}
}, {
key: 'componentDidMount',
value: function componentDidMount() {
if (this.props.spy || this.props.hashSpy) {
var scrollSpyContainer = this.getScrollSpyContainer();
if (!_scrollSpy2.default.isMounted(scrollSpyContainer)) {
_scrollSpy2.default.mount(scrollSpyContainer);
}
if (this.props.hashSpy) {
if (!_scrollHash2.default.isMounted()) {
_scrollHash2.default.mount(scroller);
}
_scrollHash2.default.mapContainer(this.props.to, scrollSpyContainer);
}
_scrollSpy2.default.addSpyHandler(this.spyHandler, scrollSpyContainer);
this.setState({
container: scrollSpyContainer
});
}
}
}, {
key: 'componentWillUnmount',
value: function componentWillUnmount() {
_scrollSpy2.default.unmount(this.stateHandler, this.spyHandler);
}
}, {
key: 'render',
value: function render() {
var className = "";
if (this.state && this.state.active) {
className = ((this.props.className || "") + " " + (this.props.activeClass || "active")).trim();
}
else {
className = this.props.className;
}
var props = _extends({}, this.props);
for (var prop in protoTypes) {
if (props.hasOwnProperty(prop)) {
delete props[prop];
}
}
props.className = className;
props.onClick = this.handleClick;
return _react2.default.createElement(Component, props);
}
}]);
return Link;
}(_react2.default.PureComponent);
var _initialiseProps = function _initialiseProps() {
var _this2 = this;
this.scrollTo = function (to, props) {
scroller.scrollTo(to, _extends({}, _this2.state, props));
};
this.handleClick = function (event) {
if (_this2.props.onClick) {
_this2.props.onClick(event);
}
if (event.stopPropagation)
event.stopPropagation();
if (event.preventDefault)
event.preventDefault();
_this2.scrollTo(_this2.props.to, _this2.props);
};
this.spyHandler = function (y) {
var scrollSpyContainer = _this2.getScrollSpyContainer();
if (_scrollHash2.default.isMounted() && !_scrollHash2.default.isInitialized()) {
return;
}
var to = _this2.props.to;
var element = null;
var elemTopBound = 0;
var elemBottomBound = 0;
var containerTop = 0;
if (scrollSpyContainer.getBoundingClientRect) {
var containerCords = scrollSpyContainer.getBoundingClientRect();
containerTop = containerCords.top;
}
if (!element || _this2.props.isDynamic) {
element = scroller.get(to);
if (!element) {
return;
}
var cords = element.getBoundingClientRect();
elemTopBound = cords.top - containerTop + y;
elemBottomBound = elemTopBound + cords.height;
}
var offsetY = y - _this2.props.offset;
var isInside = offsetY >= Math.floor(elemTopBound) && offsetY < Math.floor(elemBottomBound);
var isOutside = offsetY < Math.floor(elemTopBound) || offsetY >= Math.floor(elemBottomBound);
var activeLink = scroller.getActiveLink();
if (isOutside) {
if (to === activeLink) {
scroller.setActiveLink(void 0);
}
if (_this2.props.hashSpy && _scrollHash2.default.getHash() === to) {
_scrollHash2.default.changeHash();
}
if (_this2.props.spy && _this2.state.active) {
_this2.setState({ active: false });
_this2.props.onSetInactive && _this2.props.onSetInactive(to, element);
}
}
if (isInside && (activeLink !== to || _this2.state.active === false)) {
scroller.setActiveLink(to);
_this2.props.hashSpy && _scrollHash2.default.changeHash(to);
if (_this2.props.spy) {
_this2.setState({ active: true });
_this2.props.onSetActive && _this2.props.onSetActive(to, element);
}
}
};
};
;
Link.propTypes = protoTypes;
Link.defaultProps = { offset: 0 };
return Link;
};
} // react-scroll/modules/mixins/scroll-spy.js $fsx.f[114] = (module, exports) => { 'use strict'; Object.defineProperty(exports, "__esModule", {
value: true
}); var _lodash = $fsx.r(112); var _lodash2 = _interopRequireDefault(_lodash); var _passiveEventListeners = $fsx.r(113); function _interopRequireDefault(obj) { return obj && obj.__esModule ? obj : { default: obj }; } var eventThrottler = function eventThrottler(eventHandler) {
return (0, _lodash2.default)(eventHandler, 66);
}; var scrollSpy = {
spyCallbacks: [],
spySetState: [],
scrollSpyContainers: [],
mount: function mount(scrollSpyContainer) {
if (scrollSpyContainer) {
var eventHandler = eventThrottler(function (event) {
scrollSpy.scrollHandler(scrollSpyContainer);
});
scrollSpy.scrollSpyContainers.push(scrollSpyContainer);
(0, _passiveEventListeners.addPassiveEventListener)(scrollSpyContainer, 'scroll', eventHandler);
}
},
isMounted: function isMounted(scrollSpyContainer) {
return scrollSpy.scrollSpyContainers.indexOf(scrollSpyContainer) !== -1;
},
currentPositionY: function currentPositionY(scrollSpyContainer) {
if (scrollSpyContainer === document) {
var supportPageOffset = window.pageXOffset !== undefined;
var isCSS1Compat = (document.compatMode || "") === "CSS1Compat";
return supportPageOffset ? window.pageYOffset : isCSS1Compat ? document.documentElement.scrollTop : document.body.scrollTop;
}
else {
return scrollSpyContainer.scrollTop;
}
},
scrollHandler: function scrollHandler(scrollSpyContainer) {
var callbacks = scrollSpy.scrollSpyContainers[scrollSpy.scrollSpyContainers.indexOf(scrollSpyContainer)].spyCallbacks || [];
callbacks.forEach(function (c) {
return c(scrollSpy.currentPositionY(scrollSpyContainer));
});
},
addStateHandler: function addStateHandler(handler) {
scrollSpy.spySetState.push(handler);
},
addSpyHandler: function addSpyHandler(handler, scrollSpyContainer) {
var container = scrollSpy.scrollSpyContainers[scrollSpy.scrollSpyContainers.indexOf(scrollSpyContainer)];
if (!container.spyCallbacks) {
container.spyCallbacks = [];
}
container.spyCallbacks.push(handler);
handler(scrollSpy.currentPositionY(scrollSpyContainer));
},
updateStates: function updateStates() {
scrollSpy.spySetState.forEach(function (s) {
return s();
});
},
unmount: function unmount(stateHandler, spyHandler) {
scrollSpy.scrollSpyContainers.forEach(function (c) {
return c.spyCallbacks && c.spyCallbacks.length && c.spyCallbacks.splice(c.spyCallbacks.indexOf(spyHandler), 1);
});
if (scrollSpy.spySetState && scrollSpy.spySetState.length) {
scrollSpy.spySetState.splice(scrollSpy.spySetState.indexOf(stateHandler), 1);
}
document.removeEventListener('scroll', scrollSpy.scrollHandler);
},
update: function update() {
return scrollSpy.scrollSpyContainers.forEach(function (c) {
return scrollSpy.scrollHandler(c);
});
}
}; exports.default = scrollSpy;
} // lodash.throttle/index.js $fsx.f[112] = (module, exports) => { const global = {}; var FUNC_ERROR_TEXT = 'Expected a function'; var NAN = 0 / 0; var symbolTag = '[object Symbol]'; var reTrim = /^\s+|\s+$/g; var reIsBadHex = /^[-+]0x[0-9a-f]+$/i; var reIsBinary = /^0b[01]+$/i; var reIsOctal = /^0o[0-7]+$/i; var freeParseInt = parseInt; var freeGlobal = typeof global == 'object' && global && global.Object === Object && global; var freeSelf = typeof self == 'object' && self && self.Object === Object && self; var root = freeGlobal || freeSelf || Function('return this')(); var objectProto = Object.prototype; var objectToString = objectProto.toString; var nativeMax = Math.max, nativeMin = Math.min; var now = function () {
return root.Date.now();
}; function debounce(func, wait, options) {
var lastArgs, lastThis, maxWait, result, timerId, lastCallTime, lastInvokeTime = 0, leading = false, maxing = false, trailing = true;
if (typeof func != 'function') {
throw new TypeError(FUNC_ERROR_TEXT);
}
wait = toNumber(wait) || 0;
if (isObject(options)) {
leading = !!options.leading;
maxing = 'maxWait' in options;
maxWait = maxing ? nativeMax(toNumber(options.maxWait) || 0, wait) : maxWait;
trailing = 'trailing' in options ? !!options.trailing : trailing;
}
function invokeFunc(time) {
var args = lastArgs, thisArg = lastThis;
lastArgs = lastThis = undefined;
lastInvokeTime = time;
result = func.apply(thisArg, args);
return result;
}
function leadingEdge(time) {
lastInvokeTime = time;
timerId = setTimeout(timerExpired, wait);
return leading ? invokeFunc(time) : result;
}
function remainingWait(time) {
var timeSinceLastCall = time - lastCallTime, timeSinceLastInvoke = time - lastInvokeTime, result = wait - timeSinceLastCall;
return maxing ? nativeMin(result, maxWait - timeSinceLastInvoke) : result;
}
function shouldInvoke(time) {
var timeSinceLastCall = time - lastCallTime, timeSinceLastInvoke = time - lastInvokeTime;
return (lastCallTime === undefined || (timeSinceLastCall >= wait) ||
(timeSinceLastCall < 0) || (maxing && timeSinceLastInvoke >= maxWait));
}
function timerExpired() {
var time = now();
if (shouldInvoke(time)) {
return trailingEdge(time);
}
timerId = setTimeout(timerExpired, remainingWait(time));
}
function trailingEdge(time) {
timerId = undefined;
if (trailing && lastArgs) {
return invokeFunc(time);
}
lastArgs = lastThis = undefined;
return result;
}
function cancel() {
if (timerId !== undefined) {
clearTimeout(timerId);
}
lastInvokeTime = 0;
lastArgs = lastCallTime = lastThis = timerId = undefined;
}
function flush() {
return timerId === undefined ? result : trailingEdge(now());
}
function debounced() {
var time = now(), isInvoking = shouldInvoke(time);
lastArgs = arguments;
lastThis = this;
lastCallTime = time;
if (isInvoking) {
if (timerId === undefined) {
return leadingEdge(lastCallTime);
}
if (maxing) {
timerId = setTimeout(timerExpired, wait);
return invokeFunc(lastCallTime);
}
}
if (timerId === undefined) {
timerId = setTimeout(timerExpired, wait);
}
return result;
}
debounced.cancel = cancel;
debounced.flush = flush;
return debounced;
} function throttle(func, wait, options) {
var leading = true, trailing = true;
if (typeof func != 'function') {
throw new TypeError(FUNC_ERROR_TEXT);
}
if (isObject(options)) {
leading = 'leading' in options ? !!options.leading : leading;
trailing = 'trailing' in options ? !!options.trailing : trailing;
}
return debounce(func, wait, {
'leading': leading,
'maxWait': wait,
'trailing': trailing
});
} function isObject(value) {
var type = typeof value; return !!value && (type == 'object' || type == 'function');
} function isObjectLike(value) {
return !!value && typeof value == 'object';
} function isSymbol(value) {
return typeof value == 'symbol' ||
(isObjectLike(value) && objectToString.call(value) == symbolTag);
} function toNumber(value) {
if (typeof value == 'number') {
return value;
}
if (isSymbol(value)) {
return NAN;
}
if (isObject(value)) {
var other = typeof value.valueOf == 'function' ? value.valueOf() : value;
value = isObject(other) ? (other + ) : other;
}
if (typeof value != 'string') {
return value === 0 ? value : +value;
}
value = value.replace(reTrim, );
var isBinary = reIsBinary.test(value);
return (isBinary || reIsOctal.test(value))
? freeParseInt(value.slice(2), isBinary ? 2 : 8)
: (reIsBadHex.test(value) ? NAN : +value);
} module.exports = throttle;
} // react-scroll/modules/mixins/passive-event-listeners.js $fsx.f[113] = (module, exports) => { 'use strict'; Object.defineProperty(exports, "__esModule", {
value: true
}); var addPassiveEventListener = exports.addPassiveEventListener = function addPassiveEventListener(target, eventName, listener) {
var supportsPassiveOption = function () {
var supportsPassiveOption = false;
try {
var opts = Object.defineProperty({}, 'passive', {
get: function get() {
supportsPassiveOption = true;
}
});
window.addEventListener('test', null, opts);
}
catch (e) { }
return supportsPassiveOption;
}();
target.addEventListener(eventName, listener, supportsPassiveOption ? { passive: true } : false);
}; var removePassiveEventListener = exports.removePassiveEventListener = function removePassiveEventListener(target, eventName, listener) {
target.removeEventListener(eventName, listener);
};
} // react-scroll/modules/mixins/scroller.js $fsx.f[120] = (module, exports) => { 'use strict'; Object.defineProperty(exports, "__esModule", {
value: true
}); var _extends = Object.assign || function (target) { for (var i = 1; i < arguments.length; i++) {
var source = arguments[i];
for (var key in source) {
if (Object.prototype.hasOwnProperty.call(source, key)) {
target[key] = source[key];
}
}
} return target; }; var _utils = $fsx.r(115); var _utils2 = _interopRequireDefault(_utils); var _animateScroll = $fsx.r(119); var _animateScroll2 = _interopRequireDefault(_animateScroll); var _scrollEvents = $fsx.r(118); var _scrollEvents2 = _interopRequireDefault(_scrollEvents); function _interopRequireDefault(obj) { return obj && obj.__esModule ? obj : { default: obj }; } var __mapped = {}; var __activeLink = void 0; exports.default = {
unmount: function unmount() {
__mapped = {};
},
register: function register(name, element) {
__mapped[name] = element;
},
unregister: function unregister(name) {
delete __mapped[name];
},
get: function get(name) {
return __mapped[name] || document.getElementById(name) || document.getElementsByName(name)[0] || document.getElementsByClassName(name)[0];
},
setActiveLink: function setActiveLink(link) {
return __activeLink = link;
},
getActiveLink: function getActiveLink() {
return __activeLink;
},
scrollTo: function scrollTo(to, props) {
var target = this.get(to);
if (!target) {
console.warn("target Element not found");
return;
}
props = _extends({}, props, { absolute: false });
var containerId = props.containerId;
var container = props.container;
var containerElement = void 0;
if (containerId) {
containerElement = document.getElementById(containerId);
}
else if (container && container.nodeType) {
containerElement = container;
}
else {
containerElement = document;
}
props.absolute = true;
var scrollOffset = _utils2.default.scrollOffset(containerElement, target) + (props.offset || 0);
if (!props.smooth) {
if (_scrollEvents2.default.registered['begin']) {
_scrollEvents2.default.registered['begin'](to, target);
}
if (containerElement === document) {
window.scrollTo(0, scrollOffset);
}
else {
containerElement.scrollTop = scrollOffset;
}
if (_scrollEvents2.default.registered['end']) {
_scrollEvents2.default.registered['end'](to, target);
}
return;
}
_animateScroll2.default.animateTopScroll(scrollOffset, props, to, target);
}
};
} // react-scroll/modules/mixins/utils.js $fsx.f[115] = (module, exports) => { 'use strict'; Object.defineProperty(exports, "__esModule", {
value: true
}); var pushHash = function pushHash(hash) {
hash = hash ? hash.indexOf('#') === 0 ? hash : '#' + hash : ;
if (history.pushState) {
var loc = window.location;
history.pushState(null, null, hash ? loc.pathname + loc.search + hash
: loc.pathname + loc.search);
}
else {
location.hash = hash;
}
}; var getHash = function getHash() {
return window.location.hash.replace(/^#/, );
}; var filterElementInContainer = function filterElementInContainer(container) {
return function (element) {
return container.contains ? container != element && container.contains(element) : !!(container.compareDocumentPosition(element) & 16);
};
}; var scrollOffset = function scrollOffset(c, t) {
return c === document ? t.getBoundingClientRect().top + (window.scrollY || window.pageYOffset) : getComputedStyle(c).position !== "static" ? t.offsetTop : t.getBoundingClientRect().top + c.scrollTop;
}; exports.default = {
pushHash: pushHash, getHash: getHash, filterElementInContainer: filterElementInContainer, scrollOffset: scrollOffset
};
} // react-scroll/modules/mixins/animate-scroll.js $fsx.f[119] = (module, exports) => { 'use strict'; Object.defineProperty(exports, "__esModule", {
value: true
}); var _extends = Object.assign || function (target) { for (var i = 1; i < arguments.length; i++) {
var source = arguments[i];
for (var key in source) {
if (Object.prototype.hasOwnProperty.call(source, key)) {
target[key] = source[key];
}
}
} return target; }; var _utils = $fsx.r(115); var _utils2 = _interopRequireDefault(_utils); var _smooth = $fsx.r(116); var _smooth2 = _interopRequireDefault(_smooth); var _cancelEvents = $fsx.r(117); var _cancelEvents2 = _interopRequireDefault(_cancelEvents); var _scrollEvents = $fsx.r(118); var _scrollEvents2 = _interopRequireDefault(_scrollEvents); function _interopRequireDefault(obj) { return obj && obj.__esModule ? obj : { default: obj }; } var getAnimationType = function getAnimationType(options) {
return _smooth2.default[options.smooth] || _smooth2.default.defaultEasing;
}; var functionWrapper = function functionWrapper(value) {
return typeof value === 'function' ? value : function () {
return value;
};
}; var currentWindowProperties = function currentWindowProperties() {
if (typeof window !== 'undefined') {
return window.requestAnimationFrame || window.webkitRequestAnimationFrame;
}
}; var requestAnimationFrameHelper = function () {
return currentWindowProperties() || function (callback, element, delay) {
window.setTimeout(callback, delay || 1000 / 60, new Date().getTime());
};
}(); var makeData = function makeData() {
return {
currentPositionY: 0,
startPositionY: 0,
targetPositionY: 0,
progress: 0,
duration: 0,
cancel: false,
target: null,
containerElement: null,
to: null,
start: null,
deltaTop: null,
percent: null,
delayTimeout: null
};
}; var currentPositionY = function currentPositionY(options) {
var containerElement = options.data.containerElement;
if (containerElement && containerElement !== document && containerElement !== document.body) {
return containerElement.scrollTop;
}
else {
var supportPageOffset = window.pageXOffset !== undefined;
var isCSS1Compat = (document.compatMode || "") === "CSS1Compat";
return supportPageOffset ? window.pageYOffset : isCSS1Compat ? document.documentElement.scrollTop : document.body.scrollTop;
}
}; var scrollContainerHeight = function scrollContainerHeight(options) {
var containerElement = options.data.containerElement;
if (containerElement && containerElement !== document && containerElement !== document.body) {
return containerElement.scrollHeight - containerElement.offsetHeight;
}
else {
var body = document.body;
var html = document.documentElement;
return Math.max(body.scrollHeight, body.offsetHeight, html.clientHeight, html.scrollHeight, html.offsetHeight);
}
}; var animateScroll = function animateScroll(easing, options, timestamp) {
var data = options.data;
if (!options.ignoreCancelEvents && data.cancel) {
if (_scrollEvents2.default.registered['end']) {
_scrollEvents2.default.registered['end'](data.to, data.target, data.currentPositionY);
}
return;
}
;
data.deltaTop = Math.round(data.targetPositionY - data.startPositionY);
if (data.start === null) {
data.start = timestamp;
}
data.progress = timestamp - data.start;
data.percent = data.progress >= data.duration ? 1 : easing(data.progress / data.duration);
data.currentPositionY = data.startPositionY + Math.ceil(data.deltaTop * data.percent);
if (data.containerElement && data.containerElement !== document && data.containerElement !== document.body) {
data.containerElement.scrollTop = data.currentPositionY;
}
else {
window.scrollTo(0, data.currentPositionY);
}
if (data.percent < 1) {
var easedAnimate = animateScroll.bind(null, easing, options);
requestAnimationFrameHelper.call(window, easedAnimate);
return;
}
if (_scrollEvents2.default.registered['end']) {
_scrollEvents2.default.registered['end'](data.to, data.target, data.currentPositionY);
}
}; var setContainer = function setContainer(options) {
options.data.containerElement = !options ? null : options.containerId ? document.getElementById(options.containerId) : options.container && options.container.nodeType ? options.container : document;
}; var animateTopScroll = function animateTopScroll(y, options, to, target) {
options.data = options.data || makeData();
window.clearTimeout(options.data.delayTimeout);
_cancelEvents2.default.subscribe(function () {
options.data.cancel = true;
});
setContainer(options);
options.data.start = null;
options.data.cancel = false;
options.data.startPositionY = currentPositionY(options);
options.data.targetPositionY = options.absolute ? y : y + options.data.startPositionY;
if (options.data.startPositionY === options.data.targetPositionY) {
if (_scrollEvents2.default.registered['end']) {
_scrollEvents2.default.registered['end'](options.data.to, options.data.target, options.data.currentPositionY);
}
return;
}
options.data.deltaTop = Math.round(options.data.targetPositionY - options.data.startPositionY);
options.data.duration = functionWrapper(options.duration)(options.data.deltaTop);
options.data.duration = isNaN(parseFloat(options.data.duration)) ? 1000 : parseFloat(options.data.duration);
options.data.to = to;
options.data.target = target;
var easing = getAnimationType(options);
var easedAnimate = animateScroll.bind(null, easing, options);
if (options && options.delay > 0) {
options.data.delayTimeout = window.setTimeout(function () {
if (_scrollEvents2.default.registered['begin']) {
_scrollEvents2.default.registered['begin'](options.data.to, options.data.target);
}
requestAnimationFrameHelper.call(window, easedAnimate);
}, options.delay);
return;
}
if (_scrollEvents2.default.registered['begin']) {
_scrollEvents2.default.registered['begin'](options.data.to, options.data.target);
}
requestAnimationFrameHelper.call(window, easedAnimate);
}; var proceedOptions = function proceedOptions(options) {
options = _extends({}, options);
options.data = options.data || makeData();
options.absolute = true;
return options;
}; var scrollToTop = function scrollToTop(options) {
animateTopScroll(0, proceedOptions(options));
}; var scrollTo = function scrollTo(toY, options) {
animateTopScroll(toY, proceedOptions(options));
}; var scrollToBottom = function scrollToBottom(options) {
options = proceedOptions(options); setContainer(options); animateTopScroll(scrollContainerHeight(options), options);
}; var scrollMore = function scrollMore(toY, options) {
options = proceedOptions(options); setContainer(options); animateTopScroll(currentPositionY(options) + toY, options);
}; exports.default = {
animateTopScroll: animateTopScroll, getAnimationType: getAnimationType, scrollToTop: scrollToTop, scrollToBottom: scrollToBottom, scrollTo: scrollTo, scrollMore: scrollMore
};
} // react-scroll/modules/mixins/smooth.js $fsx.f[116] = (module, exports) => { "use strict"; Object.defineProperty(exports, "__esModule", {
value: true
}); exports.default = {
defaultEasing: function defaultEasing(x) {
if (x < 0.5) {
return Math.pow(x * 2, 2) / 2;
}
return 1 - Math.pow((1 - x) * 2, 2) / 2;
},
linear: function linear(x) {
return x;
},
easeInQuad: function easeInQuad(x) {
return x * x;
},
easeOutQuad: function easeOutQuad(x) {
return x * (2 - x);
},
easeInOutQuad: function easeInOutQuad(x) {
return x < .5 ? 2 * x * x : -1 + (4 - 2 * x) * x;
},
easeInCubic: function easeInCubic(x) {
return x * x * x;
},
easeOutCubic: function easeOutCubic(x) {
return --x * x * x + 1;
},
easeInOutCubic: function easeInOutCubic(x) {
return x < .5 ? 4 * x * x * x : (x - 1) * (2 * x - 2) * (2 * x - 2) + 1;
},
easeInQuart: function easeInQuart(x) {
return x * x * x * x;
},
easeOutQuart: function easeOutQuart(x) {
return 1 - --x * x * x * x;
},
easeInOutQuart: function easeInOutQuart(x) {
return x < .5 ? 8 * x * x * x * x : 1 - 8 * --x * x * x * x;
},
easeInQuint: function easeInQuint(x) {
return x * x * x * x * x;
},
easeOutQuint: function easeOutQuint(x) {
return 1 + --x * x * x * x * x;
},
easeInOutQuint: function easeInOutQuint(x) {
return x < .5 ? 16 * x * x * x * x * x : 1 + 16 * --x * x * x * x * x;
}
};
} // react-scroll/modules/mixins/cancel-events.js $fsx.f[117] = (module, exports) => { 'use strict'; Object.defineProperty(exports, "__esModule", {
value: true
}); var _passiveEventListeners = $fsx.r(113); var events = ['mousedown', 'mousewheel', 'touchmove', 'keydown']; exports.default = {
subscribe: function subscribe(cancelEvent) {
return typeof document !== 'undefined' && events.forEach(function (event) {
return (0, _passiveEventListeners.addPassiveEventListener)(document, event, cancelEvent);
});
}
};
} // react-scroll/modules/mixins/scroll-events.js $fsx.f[118] = (module, exports) => { "use strict"; Object.defineProperty(exports, "__esModule", {
value: true
}); var Events = {
registered: {},
scrollEvent: {
register: function register(evtName, callback) {
Events.registered[evtName] = callback;
},
remove: function remove(evtName) {
Events.registered[evtName] = null;
}
}
}; exports.default = Events;
} // react-scroll/modules/mixins/scroll-hash.js $fsx.f[121] = (module, exports) => { 'use strict'; Object.defineProperty(exports, "__esModule", {
value: true
}); var _passiveEventListeners = $fsx.r(113); var _utils = $fsx.r(115); var _utils2 = _interopRequireDefault(_utils); function _interopRequireDefault(obj) { return obj && obj.__esModule ? obj : { default: obj }; } var scrollHash = {
mountFlag: false,
initialized: false,
scroller: null,
containers: {},
mount: function mount(scroller) {
this.scroller = scroller;
this.handleHashChange = this.handleHashChange.bind(this);
window.addEventListener('hashchange', this.handleHashChange);
this.initStateFromHash();
this.mountFlag = true;
},
mapContainer: function mapContainer(to, container) {
this.containers[to] = container;
},
isMounted: function isMounted() {
return this.mountFlag;
},
isInitialized: function isInitialized() {
return this.initialized;
},
initStateFromHash: function initStateFromHash() {
var _this = this;
var hash = this.getHash();
if (hash) {
window.setTimeout(function () {
_this.scrollTo(hash, true);
_this.initialized = true;
}, 10);
}
else {
this.initialized = true;
}
},
scrollTo: function scrollTo(to, isInit) {
var scroller = this.scroller;
var element = scroller.get(to);
if (element && (isInit || to !== scroller.getActiveLink())) {
var container = this.containers[to] || document;
scroller.scrollTo(to, { container: container });
}
},
getHash: function getHash() {
return _utils2.default.getHash();
},
changeHash: function changeHash(to) {
if (this.isInitialized() && _utils2.default.getHash() !== to) {
_utils2.default.pushHash(to);
}
},
handleHashChange: function handleHashChange() {
this.scrollTo(this.getHash());
},
unmount: function unmount() {
this.scroller = null;
this.containers = null;
window.removeEventListener('hashchange', this.handleHashChange);
}
}; exports.default = scrollHash;
} // react-scroll/modules/components/Button.js $fsx.f[124] = (module, exports) => { "use strict"; Object.defineProperty(exports, "__esModule", {
value: true
}); var _createClass = function () { function defineProperties(target, props) { for (var i = 0; i < props.length; i++) {
var descriptor = props[i];
descriptor.enumerable = descriptor.enumerable || false;
descriptor.configurable = true;
if ("value" in descriptor)
descriptor.writable = true;
Object.defineProperty(target, descriptor.key, descriptor);
} } return function (Constructor, protoProps, staticProps) { if (protoProps)
defineProperties(Constructor.prototype, protoProps); if (staticProps) defineProperties(Constructor, staticProps); return Constructor; }; }();
var _react = $fsx.r(3); var _react2 = _interopRequireDefault(_react); var _scrollLink = $fsx.r(122); var _scrollLink2 = _interopRequireDefault(_scrollLink); function _interopRequireDefault(obj) { return obj && obj.__esModule ? obj : { default: obj }; } function _classCallCheck(instance, Constructor) { if (!(instance instanceof Constructor)) {
throw new TypeError("Cannot call a class as a function");
} } function _possibleConstructorReturn(self, call) { if (!self) {
throw new ReferenceError("this hasn't been initialised - super() hasn't been called");
} return call && (typeof call === "object" || typeof call === "function") ? call : self; } function _inherits(subClass, superClass) { if (typeof superClass !== "function" && superClass !== null) {
throw new TypeError("Super expression must either be null or a function, not " + typeof superClass);
} subClass.prototype = Object.create(superClass && superClass.prototype, { constructor: { value: subClass, enumerable: false, writable: true, configurable: true } }); if (superClass)
Object.setPrototypeOf ? Object.setPrototypeOf(subClass, superClass) : subClass.__proto__ = superClass; }
var ButtonElement = function (_React$Component) {
_inherits(ButtonElement, _React$Component);
function ButtonElement() {
_classCallCheck(this, ButtonElement);
return _possibleConstructorReturn(this, (ButtonElement.__proto__ || Object.getPrototypeOf(ButtonElement)).apply(this, arguments));
}
_createClass(ButtonElement, [{
key: 'render',
value: function render() {
return _react2.default.createElement('input', this.props, this.props.children);
}
}]);
return ButtonElement;
}(_react2.default.Component);
exports.default = (0, _scrollLink2.default)(ButtonElement);
} // react-scroll/modules/components/Element.js $fsx.f[126] = (module, exports) => { "use strict"; Object.defineProperty(exports, "__esModule", {
value: true
}); var _extends = Object.assign || function (target) { for (var i = 1; i < arguments.length; i++) {
var source = arguments[i];
for (var key in source) {
if (Object.prototype.hasOwnProperty.call(source, key)) {
target[key] = source[key];
}
}
} return target; }; var _createClass = function () { function defineProperties(target, props) { for (var i = 0; i < props.length; i++) {
var descriptor = props[i];
descriptor.enumerable = descriptor.enumerable || false;
descriptor.configurable = true;
if ("value" in descriptor)
descriptor.writable = true;
Object.defineProperty(target, descriptor.key, descriptor);
} } return function (Constructor, protoProps, staticProps) { if (protoProps)
defineProperties(Constructor.prototype, protoProps); if (staticProps) defineProperties(Constructor, staticProps); return Constructor; }; }();
var _react = $fsx.r(3); var _react2 = _interopRequireDefault(_react); var _scrollElement = $fsx.r(125); var _scrollElement2 = _interopRequireDefault(_scrollElement); var _propTypes = $fsx.r(13); var _propTypes2 = _interopRequireDefault(_propTypes); function _interopRequireDefault(obj) { return obj && obj.__esModule ? obj : { default: obj }; } function _classCallCheck(instance, Constructor) { if (!(instance instanceof Constructor)) {
throw new TypeError("Cannot call a class as a function");
} } function _possibleConstructorReturn(self, call) { if (!self) {
throw new ReferenceError("this hasn't been initialised - super() hasn't been called");
} return call && (typeof call === "object" || typeof call === "function") ? call : self; } function _inherits(subClass, superClass) { if (typeof superClass !== "function" && superClass !== null) {
throw new TypeError("Super expression must either be null or a function, not " + typeof superClass);
} subClass.prototype = Object.create(superClass && superClass.prototype, { constructor: { value: subClass, enumerable: false, writable: true, configurable: true } }); if (superClass)
Object.setPrototypeOf ? Object.setPrototypeOf(subClass, superClass) : subClass.__proto__ = superClass; }
var ElementWrapper = function (_React$Component) {
_inherits(ElementWrapper, _React$Component);
function ElementWrapper() {
_classCallCheck(this, ElementWrapper);
return _possibleConstructorReturn(this, (ElementWrapper.__proto__ || Object.getPrototypeOf(ElementWrapper)).apply(this, arguments));
}
_createClass(ElementWrapper, [{
key: 'render',
value: function render() {
var _this2 = this;
var newProps = _extends({}, this.props);
if (newProps.parentBindings) {
delete newProps.parentBindings;
}
return _react2.default.createElement('div', _extends({}, newProps, { ref: function ref(el) {
_this2.props.parentBindings.domNode = el;
} }), this.props.children);
}
}]);
return ElementWrapper;
}(_react2.default.Component);
ElementWrapper.propTypes = {
name: _propTypes2.default.string, id: _propTypes2.default.string
}; exports.default = (0, _scrollElement2.default)(ElementWrapper);
} // react-scroll/modules/mixins/scroll-element.js $fsx.f[125] = (module, exports) => { 'use strict'; Object.defineProperty(exports, "__esModule", {
value: true
}); var _extends = Object.assign || function (target) { for (var i = 1; i < arguments.length; i++) {
var source = arguments[i];
for (var key in source) {
if (Object.prototype.hasOwnProperty.call(source, key)) {
target[key] = source[key];
}
}
} return target; }; var _createClass = function () { function defineProperties(target, props) { for (var i = 0; i < props.length; i++) {
var descriptor = props[i];
descriptor.enumerable = descriptor.enumerable || false;
descriptor.configurable = true;
if ("value" in descriptor)
descriptor.writable = true;
Object.defineProperty(target, descriptor.key, descriptor);
} } return function (Constructor, protoProps, staticProps) { if (protoProps)
defineProperties(Constructor.prototype, protoProps); if (staticProps) defineProperties(Constructor, staticProps); return Constructor; }; }();
var _react = $fsx.r(3); var _react2 = _interopRequireDefault(_react); var _reactDom = $fsx.r(7); var _reactDom2 = _interopRequireDefault(_reactDom); var _scroller = $fsx.r(120); var _scroller2 = _interopRequireDefault(_scroller); var _propTypes = $fsx.r(13); var _propTypes2 = _interopRequireDefault(_propTypes); function _interopRequireDefault(obj) { return obj && obj.__esModule ? obj : { default: obj }; } function _classCallCheck(instance, Constructor) { if (!(instance instanceof Constructor)) {
throw new TypeError("Cannot call a class as a function");
} } function _possibleConstructorReturn(self, call) { if (!self) {
throw new ReferenceError("this hasn't been initialised - super() hasn't been called");
} return call && (typeof call === "object" || typeof call === "function") ? call : self; } function _inherits(subClass, superClass) { if (typeof superClass !== "function" && superClass !== null) {
throw new TypeError("Super expression must either be null or a function, not " + typeof superClass);
} subClass.prototype = Object.create(superClass && superClass.prototype, { constructor: { value: subClass, enumerable: false, writable: true, configurable: true } }); if (superClass)
Object.setPrototypeOf ? Object.setPrototypeOf(subClass, superClass) : subClass.__proto__ = superClass; }
exports.default = function (Component) {
var Element = function (_React$Component) {
_inherits(Element, _React$Component);
function Element(props) {
_classCallCheck(this, Element);
var _this = _possibleConstructorReturn(this, (Element.__proto__ || Object.getPrototypeOf(Element)).call(this, props));
_this.childBindings = {
domNode: null
};
return _this;
}
_createClass(Element, [{
key: 'componentDidMount',
value: function componentDidMount() {
if (typeof window === 'undefined') {
return false;
}
this.registerElems(this.props.name);
}
}, {
key: 'componentDidUpdate',
value: function componentDidUpdate(prevProps) {
if (this.props.name !== prevProps.name) {
this.registerElems(this.props.name);
}
}
}, {
key: 'componentWillUnmount',
value: function componentWillUnmount() {
if (typeof window === 'undefined') {
return false;
}
_scroller2.default.unregister(this.props.name);
}
}, {
key: 'registerElems',
value: function registerElems(name) {
_scroller2.default.register(name, this.childBindings.domNode);
}
}, {
key: 'render',
value: function render() {
return _react2.default.createElement(Component, _extends({}, this.props, { parentBindings: this.childBindings }));
}
}]);
return Element;
}(_react2.default.Component);
;
Element.propTypes = {
name: _propTypes2.default.string,
id: _propTypes2.default.string
};
return Element;
};
} // react-scroll/modules/mixins/Helpers.js $fsx.f[127] = (module, exports) => { "use strict"; var _extends = Object.assign || function (target) { for (var i = 1; i < arguments.length; i++) {
var source = arguments[i];
for (var key in source) {
if (Object.prototype.hasOwnProperty.call(source, key)) {
target[key] = source[key];
}
}
} return target; }; var _createClass = function () { function defineProperties(target, props) { for (var i = 0; i < props.length; i++) {
var descriptor = props[i];
descriptor.enumerable = descriptor.enumerable || false;
descriptor.configurable = true;
if ("value" in descriptor)
descriptor.writable = true;
Object.defineProperty(target, descriptor.key, descriptor);
} } return function (Constructor, protoProps, staticProps) { if (protoProps)
defineProperties(Constructor.prototype, protoProps); if (staticProps) defineProperties(Constructor, staticProps); return Constructor; }; }();
function _classCallCheck(instance, Constructor) { if (!(instance instanceof Constructor)) {
throw new TypeError("Cannot call a class as a function");
} } function _possibleConstructorReturn(self, call) { if (!self) {
throw new ReferenceError("this hasn't been initialised - super() hasn't been called");
} return call && (typeof call === "object" || typeof call === "function") ? call : self; } function _inherits(subClass, superClass) { if (typeof superClass !== "function" && superClass !== null) {
throw new TypeError("Super expression must either be null or a function, not " + typeof superClass);
} subClass.prototype = Object.create(superClass && superClass.prototype, { constructor: { value: subClass, enumerable: false, writable: true, configurable: true } }); if (superClass)
Object.setPrototypeOf ? Object.setPrototypeOf(subClass, superClass) : subClass.__proto__ = superClass; }
var React = $fsx.r(3); var ReactDOM = $fsx.r(7); var utils = $fsx.r(115); var scrollSpy = $fsx.r(114); var defaultScroller = $fsx.r(120); var PropTypes = $fsx.r(13); var scrollHash = $fsx.r(121); var protoTypes = {
to: PropTypes.string.isRequired, containerId: PropTypes.string, container: PropTypes.object, activeClass: PropTypes.string, spy: PropTypes.bool, smooth: PropTypes.oneOfType([PropTypes.bool, PropTypes.string]), offset: PropTypes.number, delay: PropTypes.number, isDynamic: PropTypes.bool, onClick: PropTypes.func, duration: PropTypes.oneOfType([PropTypes.number, PropTypes.func]), absolute: PropTypes.bool, onSetActive: PropTypes.func, onSetInactive: PropTypes.func, ignoreCancelEvents: PropTypes.bool, hashSpy: PropTypes.bool
}; var Helpers = {
Scroll: function Scroll(Component, customScroller) {
console.warn("Helpers.Scroll is deprecated since v1.7.0");
var scroller = customScroller || defaultScroller;
var Scroll = function (_React$Component) {
_inherits(Scroll, _React$Component);
function Scroll(props) {
_classCallCheck(this, Scroll);
var _this = _possibleConstructorReturn(this, (Scroll.__proto__ || Object.getPrototypeOf(Scroll)).call(this, props));
_initialiseProps.call(_this);
_this.state = {
active: false
};
return _this;
}
_createClass(Scroll, [{
key: 'getScrollSpyContainer',
value: function getScrollSpyContainer() {
var containerId = this.props.containerId;
var container = this.props.container;
if (containerId) {
return document.getElementById(containerId);
}
if (container && container.nodeType) {
return container;
}
return document;
}
}, {
key: 'componentDidMount',
value: function componentDidMount() {
if (this.props.spy || this.props.hashSpy) {
var scrollSpyContainer = this.getScrollSpyContainer();
if (!scrollSpy.isMounted(scrollSpyContainer)) {
scrollSpy.mount(scrollSpyContainer);
}
if (this.props.hashSpy) {
if (!scrollHash.isMounted()) {
scrollHash.mount(scroller);
}
scrollHash.mapContainer(this.props.to, scrollSpyContainer);
}
if (this.props.spy) {
scrollSpy.addStateHandler(this.stateHandler);
}
scrollSpy.addSpyHandler(this.spyHandler, scrollSpyContainer);
this.setState({
container: scrollSpyContainer
});
}
}
}, {
key: 'componentWillUnmount',
value: function componentWillUnmount() {
scrollSpy.unmount(this.stateHandler, this.spyHandler);
}
}, {
key: 'render',
value: function render() {
var className = "";
if (this.state && this.state.active) {
className = ((this.props.className || "") + " " + (this.props.activeClass || "active")).trim();
}
else {
className = this.props.className;
}
var props = _extends({}, this.props);
for (var prop in protoTypes) {
if (props.hasOwnProperty(prop)) {
delete props[prop];
}
}
props.className = className;
props.onClick = this.handleClick;
return React.createElement(Component, props);
}
}]);
return Scroll;
}(React.Component);
var _initialiseProps = function _initialiseProps() {
var _this2 = this;
this.scrollTo = function (to, props) {
scroller.scrollTo(to, _extends({}, _this2.state, props));
};
this.handleClick = function (event) {
if (_this2.props.onClick) {
_this2.props.onClick(event);
}
if (event.stopPropagation)
event.stopPropagation();
if (event.preventDefault)
event.preventDefault();
_this2.scrollTo(_this2.props.to, _this2.props);
};
this.stateHandler = function () {
if (scroller.getActiveLink() !== _this2.props.to) {
if (_this2.state !== null && _this2.state.active && _this2.props.onSetInactive) {
_this2.props.onSetInactive();
}
_this2.setState({ active: false });
}
};
this.spyHandler = function (y) {
var scrollSpyContainer = _this2.getScrollSpyContainer();
if (scrollHash.isMounted() && !scrollHash.isInitialized()) {
return;
}
var to = _this2.props.to;
var element = null;
var elemTopBound = 0;
var elemBottomBound = 0;
var containerTop = 0;
if (scrollSpyContainer.getBoundingClientRect) {
var containerCords = scrollSpyContainer.getBoundingClientRect();
containerTop = containerCords.top;
}
if (!element || _this2.props.isDynamic) {
element = scroller.get(to);
if (!element) {
return;
}
var cords = element.getBoundingClientRect();
elemTopBound = cords.top - containerTop + y;
elemBottomBound = elemTopBound + cords.height;
}
var offsetY = y - _this2.props.offset;
var isInside = offsetY >= Math.floor(elemTopBound) && offsetY < Math.floor(elemBottomBound);
var isOutside = offsetY < Math.floor(elemTopBound) || offsetY >= Math.floor(elemBottomBound);
var activeLink = scroller.getActiveLink();
if (isOutside) {
if (to === activeLink) {
scroller.setActiveLink(void 0);
}
if (_this2.props.hashSpy && scrollHash.getHash() === to) {
scrollHash.changeHash();
}
if (_this2.props.spy && _this2.state.active) {
_this2.setState({ active: false });
_this2.props.onSetInactive && _this2.props.onSetInactive();
}
return scrollSpy.updateStates();
}
if (isInside && activeLink !== to) {
scroller.setActiveLink(to);
_this2.props.hashSpy && scrollHash.changeHash(to);
if (_this2.props.spy) {
_this2.setState({ active: true });
_this2.props.onSetActive && _this2.props.onSetActive(to);
}
return scrollSpy.updateStates();
}
};
};
;
Scroll.propTypes = protoTypes;
Scroll.defaultProps = { offset: 0 };
return Scroll;
},
Element: function Element(Component) {
console.warn("Helpers.Element is deprecated since v1.7.0");
var Element = function (_React$Component2) {
_inherits(Element, _React$Component2);
function Element(props) {
_classCallCheck(this, Element);
var _this3 = _possibleConstructorReturn(this, (Element.__proto__ || Object.getPrototypeOf(Element)).call(this, props));
_this3.childBindings = {
domNode: null
};
return _this3;
}
_createClass(Element, [{
key: 'componentDidMount',
value: function componentDidMount() {
if (typeof window === 'undefined') {
return false;
}
this.registerElems(this.props.name);
}
}, {
key: 'componentDidUpdate',
value: function componentDidUpdate(prevProps) {
if (this.props.name !== prevProps.name) {
this.registerElems(this.props.name);
}
}
}, {
key: 'componentWillUnmount',
value: function componentWillUnmount() {
if (typeof window === 'undefined') {
return false;
}
defaultScroller.unregister(this.props.name);
}
}, {
key: 'registerElems',
value: function registerElems(name) {
defaultScroller.register(name, this.childBindings.domNode);
}
}, {
key: 'render',
value: function render() {
return React.createElement(Component, _extends({}, this.props, { parentBindings: this.childBindings }));
}
}]);
return Element;
}(React.Component);
;
Element.propTypes = {
name: PropTypes.string,
id: PropTypes.string
};
return Element;
}
}; module.exports = Helpers;
} // rodal/lib/rodal.js $fsx.f[132] = (module, exports) => { 'use strict'; Object.defineProperty(exports, "__esModule", {
value: true
}); var _createClass = function () { function defineProperties(target, props) { for (var i = 0; i < props.length; i++) {
var descriptor = props[i];
descriptor.enumerable = descriptor.enumerable || false;
descriptor.configurable = true;
if ("value" in descriptor)
descriptor.writable = true;
Object.defineProperty(target, descriptor.key, descriptor);
} } return function (Constructor, protoProps, staticProps) { if (protoProps)
defineProperties(Constructor.prototype, protoProps); if (staticProps) defineProperties(Constructor, staticProps); return Constructor; }; }();
var _extends = Object.assign || function (target) { for (var i = 1; i < arguments.length; i++) {
var source = arguments[i];
for (var key in source) {
if (Object.prototype.hasOwnProperty.call(source, key)) {
target[key] = source[key];
}
}
} return target; }; var _react = $fsx.r(3); var _react2 = _interopRequireDefault(_react); var _propTypes = $fsx.r(13); var _propTypes2 = _interopRequireDefault(_propTypes); function _interopRequireDefault(obj) { return obj && obj.__esModule ? obj : { default: obj }; } function _classCallCheck(instance, Constructor) { if (!(instance instanceof Constructor)) {
throw new TypeError("Cannot call a class as a function");
} } function _possibleConstructorReturn(self, call) { if (!self) {
throw new ReferenceError("this hasn't been initialised - super() hasn't been called");
} return call && (typeof call === "object" || typeof call === "function") ? call : self; } function _inherits(subClass, superClass) { if (typeof superClass !== "function" && superClass !== null) {
throw new TypeError("Super expression must either be null or a function, not " + typeof superClass);
} subClass.prototype = Object.create(superClass && superClass.prototype, { constructor: { value: subClass, enumerable: false, writable: true, configurable: true } }); if (superClass)
Object.setPrototypeOf ? Object.setPrototypeOf(subClass, superClass) : subClass.__proto__ = superClass; }
var inBrowser = typeof window !== 'undefined'; var UA = inBrowser && window.navigator.userAgent.toLowerCase(); var isIE9 = UA && UA.indexOf('msie 9.0') > 0; var Dialog = function Dialog(props) {
var animation = (props.animationType === 'enter' ? props.enterAnimation : props.leaveAnimation) || props.animation;
var className = 'rodal-dialog rodal-' + animation + '-' + props.animationType;
var CloseButton = props.showCloseButton ? _react2.default.createElement('span', { className: 'rodal-close', onClick: props.onClose }) : null;
var width = props.width, height = props.height, measure = props.measure, duration = props.duration, customStyles = props.customStyles;
var style = {
width: width + measure,
height: height + measure,
animationDuration: duration + 'ms',
WebkitAnimationDuration: duration + 'ms'
};
var mergedStyles = _extends({}, style, customStyles);
return _react2.default.createElement('div', { style: mergedStyles, className: className }, props.children, CloseButton);
}; var Rodal = function (_React$Component) {
_inherits(Rodal, _React$Component);
function Rodal() {
var _ref;
var _temp, _this, _ret;
_classCallCheck(this, Rodal);
for (var _len = arguments.length, args = Array(_len), _key = 0; _key < _len; _key++) {
args[_key] = arguments[_key];
}
return _ret = (_temp = (_this = _possibleConstructorReturn(this, (_ref = Rodal.__proto__ || Object.getPrototypeOf(Rodal)).call.apply(_ref, [this].concat(args))), _this), _this.state = {
isShow: false,
animationType: 'leave'
}, _this.onKeyUp = function (event) {
if (_this.props.closeOnEsc && event.keyCode === 27) {
_this.props.onClose();
}
}, _this.animationEnd = function (event) {
if (_this.state.animationType === 'leave') {
_this.setState({ isShow: false });
}
else if (_this.props.closeOnEsc) {
_this.el.focus();
}
if (event.target === _this.el) {
var onAnimationEnd = _this.props.onAnimationEnd;
onAnimationEnd && onAnimationEnd();
}
}, _temp), _possibleConstructorReturn(_this, _ret);
}
_createClass(Rodal, [{
key: 'componentDidMount',
value: function componentDidMount() {
if (this.props.visible) {
this.enter();
}
}
}, {
key: 'componentWillReceiveProps',
value: function componentWillReceiveProps(nextProps) {
if (!this.props.visible && nextProps.visible) {
this.enter();
}
else if (this.props.visible && !nextProps.visible) {
this.leave();
}
}
}, {
key: 'enter',
value: function enter() {
this.setState({
isShow: true,
animationType: 'enter'
});
}
}, {
key: 'leave',
value: function leave() {
this.setState(isIE9 ? { isShow: false } : { animationType: 'leave' });
}
}, {
key: 'render',
value: function render() {
var _this2 = this;
var props = this.props, state = this.state;
var onClick = props.closeMaskOnClick ? props.onClose : null;
var mask = props.showMask ? _react2.default.createElement('div', { className: 'rodal-mask', style: props.customMaskStyles, onClick: onClick }) : null;
var style = {
display: state.isShow ? : 'none',
animationDuration: props.duration + 'ms',
WebkitAnimationDuration: props.duration + 'ms'
};
return _react2.default.createElement('div', {
style: style,
className: "rodal rodal-fade-" + state.animationType + ' ' + props.className,
onAnimationEnd: this.animationEnd,
tabIndex: '-1',
ref: function ref(el) {
_this2.el = el;
},
onKeyUp: this.onKeyUp
}, mask, _react2.default.createElement(Dialog, _extends({}, props, { animationType: state.animationType }), props.children));
}
}]);
return Rodal;
}(_react2.default.Component); Rodal.propTypes = {
width: _propTypes2.default.number, height: _propTypes2.default.number, measure: _propTypes2.default.string, visible: _propTypes2.default.bool, showMask: _propTypes2.default.bool, closeOnEsc: _propTypes2.default.bool, closeMaskOnClick: _propTypes2.default.bool, showCloseButton: _propTypes2.default.bool, animation: _propTypes2.default.string, enterAnimation: _propTypes2.default.string, leaveAnimation: _propTypes2.default.string, duration: _propTypes2.default.number, className: _propTypes2.default.string, customStyles: _propTypes2.default.object, customMaskStyles: _propTypes2.default.object, onClose: _propTypes2.default.func.isRequired, onAnimationEnd: _propTypes2.default.func
}; Rodal.defaultProps = {
width: 400,
height: 240,
measure: 'px',
visible: false,
showMask: true,
closeOnEsc: false,
closeMaskOnClick: true,
showCloseButton: true,
animation: 'zoom',
enterAnimation: ,
leaveAnimation: ,
duration: 300,
className: ,
customStyles: {},
customMaskStyles: {}
}; exports.default = Rodal;
} // nuka-carousel/es/index.js $fsx.f[168] = (module, exports) => { "use strict"; Object.defineProperty(exports, "__esModule", { value: true }); function _typeof(obj) { if (typeof Symbol === "function" && typeof Symbol.iterator === "symbol") {
_typeof = function _typeof(obj) { return typeof obj; };
} else {
_typeof = function _typeof(obj) { return obj && typeof Symbol === "function" && obj.constructor === Symbol && obj !== Symbol.prototype ? "symbol" : typeof obj; };
} return _typeof(obj); } function _extends() { _extends = Object.assign || function (target) { for (var i = 1; i < arguments.length; i++) {
var source = arguments[i];
for (var key in source) {
if (Object.prototype.hasOwnProperty.call(source, key)) {
target[key] = source[key];
}
}
} return target; }; return _extends.apply(this, arguments); } function ownKeys(object, enumerableOnly) { var keys = Object.keys(object); if (Object.getOwnPropertySymbols) {
var symbols = Object.getOwnPropertySymbols(object);
if (enumerableOnly)
symbols = symbols.filter(function (sym) { return Object.getOwnPropertyDescriptor(object, sym).enumerable; });
keys.push.apply(keys, symbols);
} return keys; } function _objectSpread(target) { for (var i = 1; i < arguments.length; i++) {
var source = arguments[i] != null ? arguments[i] : {};
if (i % 2) {
ownKeys(source, true).forEach(function (key) { _defineProperty(target, key, source[key]); });
}
else if (Object.getOwnPropertyDescriptors) {
Object.defineProperties(target, Object.getOwnPropertyDescriptors(source));
}
else {
ownKeys(source).forEach(function (key) { Object.defineProperty(target, key, Object.getOwnPropertyDescriptor(source, key)); });
}
} return target; } function _defineProperty(obj, key, value) { if (key in obj) {
Object.defineProperty(obj, key, { value: value, enumerable: true, configurable: true, writable: true });
} else {
obj[key] = value;
} return obj; } function _classCallCheck(instance, Constructor) { if (!(instance instanceof Constructor)) {
throw new TypeError("Cannot call a class as a function");
} } function _defineProperties(target, props) { for (var i = 0; i < props.length; i++) {
var descriptor = props[i];
descriptor.enumerable = descriptor.enumerable || false;
descriptor.configurable = true;
if ("value" in descriptor)
descriptor.writable = true;
Object.defineProperty(target, descriptor.key, descriptor);
} } function _createClass(Constructor, protoProps, staticProps) { if (protoProps)
_defineProperties(Constructor.prototype, protoProps); if (staticProps) _defineProperties(Constructor, staticProps); return Constructor; }
function _possibleConstructorReturn(self, call) { if (call && (_typeof(call) === "object" || typeof call === "function")) {
return call;
} return _assertThisInitialized(self); } function _getPrototypeOf(o) { _getPrototypeOf = Object.setPrototypeOf ? Object.getPrototypeOf : function _getPrototypeOf(o) { return o.__proto__ || Object.getPrototypeOf(o); }; return _getPrototypeOf(o); } function _assertThisInitialized(self) { if (self === void 0) {
throw new ReferenceError("this hasn't been initialised - super() hasn't been called");
} return self; } function _inherits(subClass, superClass) { if (typeof superClass !== "function" && superClass !== null) {
throw new TypeError("Super expression must either be null or a function");
} subClass.prototype = Object.create(superClass && superClass.prototype, { constructor: { value: subClass, writable: true, configurable: true } }); if (superClass)
_setPrototypeOf(subClass, superClass); }
function _setPrototypeOf(o, p) { _setPrototypeOf = Object.setPrototypeOf || function _setPrototypeOf(o, p) { o.__proto__ = p; return o; }; return _setPrototypeOf(o, p); } const react_1 = $fsx.r(3); const prop_types_1 = $fsx.r(13); const exenv_1 = $fsx.r(133); const Animate_1 = $fsx.r(147); const easing = $fsx.r(158); const default_controls_1 = $fsx.r(159); exports.PagingDots = default_controls_1.PagingDots; exports.PreviousButton = default_controls_1.PreviousButton; exports.NextButton = default_controls_1.NextButton; const all_transitions_1 = $fsx.r(163); const announce_slide_1 = $fsx.r(164); const utilities_1 = $fsx.r(165); const style_utilities_1 = $fsx.r(166); const bootstrapping_utilities_1 = $fsx.r(167); var Carousel = function (_React$Component) {
_inherits(Carousel, _React$Component);
function Carousel() {
var _this;
_classCallCheck(this, Carousel);
_this = _possibleConstructorReturn(this, _getPrototypeOf(Carousel).apply(this, arguments));
_this.displayName = 'Carousel';
_this.clickDisabled = false;
_this.isTransitioning = false;
_this.timers = [];
_this.touchObject = {};
_this.controlsMap = [{
funcName: 'renderTopLeftControls',
key: 'TopLeft'
}, {
funcName: 'renderTopCenterControls',
key: 'TopCenter'
}, {
funcName: 'renderTopRightControls',
key: 'TopRight'
}, {
funcName: 'renderCenterLeftControls',
key: 'CenterLeft'
}, {
funcName: 'renderCenterCenterControls',
key: 'CenterCenter'
}, {
funcName: 'renderCenterRightControls',
key: 'CenterRight'
}, {
funcName: 'renderBottomLeftControls',
key: 'BottomLeft'
}, {
funcName: 'renderBottomCenterControls',
key: 'BottomCenter'
}, {
funcName: 'renderBottomRightControls',
key: 'BottomRight'
}];
_this.childNodesMutationObs = null;
_this.state = _objectSpread({
currentSlide: _this.props.slideIndex,
dragging: false,
easing: _this.props.disableAnimation ? : easing.easeCircleOut,
hasInteraction: false,
isWrappingAround: false,
left: 0,
resetWrapAroundPosition: false,
slideCount: bootstrapping_utilities_1.getValidChildren(_this.props.children).length,
top: 0,
wrapToIndex: null,
readyStateChanged: 0
}, utilities_1.calcSomeInitialState(_this.props));
_this.autoplayIterator = _this.autoplayIterator.bind(_assertThisInitialized(_this));
_this.calcSlideHeightAndWidth = _this.calcSlideHeightAndWidth.bind(_assertThisInitialized(_this));
_this.getChildNodes = _this.getChildNodes.bind(_assertThisInitialized(_this));
_this.getMouseEvents = _this.getMouseEvents.bind(_assertThisInitialized(_this));
_this.getOffsetDeltas = _this.getOffsetDeltas.bind(_assertThisInitialized(_this));
_this.getTargetLeft = _this.getTargetLeft.bind(_assertThisInitialized(_this));
_this.getTouchEvents = _this.getTouchEvents.bind(_assertThisInitialized(_this));
_this.goToSlide = _this.goToSlide.bind(_assertThisInitialized(_this));
_this.handleClick = _this.handleClick.bind(_assertThisInitialized(_this));
_this.handleKeyPress = _this.handleKeyPress.bind(_assertThisInitialized(_this));
_this.handleMouseOut = _this.handleMouseOut.bind(_assertThisInitialized(_this));
_this.handleMouseOver = _this.handleMouseOver.bind(_assertThisInitialized(_this));
_this.handleSwipe = _this.handleSwipe.bind(_assertThisInitialized(_this));
_this.nextSlide = _this.nextSlide.bind(_assertThisInitialized(_this));
_this.onReadyStateChange = _this.onReadyStateChange.bind(_assertThisInitialized(_this));
_this.onResize = _this.onResize.bind(_assertThisInitialized(_this));
_this.onVisibilityChange = _this.onVisibilityChange.bind(_assertThisInitialized(_this));
_this.previousSlide = _this.previousSlide.bind(_assertThisInitialized(_this));
_this.renderControls = _this.renderControls.bind(_assertThisInitialized(_this));
_this.resetAutoplay = _this.resetAutoplay.bind(_assertThisInitialized(_this));
_this.setDimensions = _this.setDimensions.bind(_assertThisInitialized(_this));
_this.setLeft = _this.setLeft.bind(_assertThisInitialized(_this));
_this.setSlideHeightAndWidth = _this.setSlideHeightAndWidth.bind(_assertThisInitialized(_this));
_this.startAutoplay = _this.startAutoplay.bind(_assertThisInitialized(_this));
_this.stopAutoplay = _this.stopAutoplay.bind(_assertThisInitialized(_this));
_this.establishChildNodesMutationObserver = _this.establishChildNodesMutationObserver.bind(_assertThisInitialized(_this));
return _this;
}
_createClass(Carousel, [{
key: "componentDidMount",
value: function componentDidMount() {
this.mounted = true;
this.setLeft();
this.setDimensions();
this.bindEvents();
this.establishChildNodesMutationObserver();
if (this.props.autoplay) {
this.startAutoplay();
}
}
}, {
key: "componentWillReceiveProps",
value: function componentWillReceiveProps(nextProps) {
var slideCount = bootstrapping_utilities_1.getValidChildren(nextProps.children).length;
var slideCountChanged = slideCount !== this.state.slideCount;
this.setState(function (prevState) {
return {
slideCount: slideCount,
currentSlide: slideCountChanged ? nextProps.slideIndex : prevState.currentSlide
};
});
if (slideCount <= this.state.currentSlide) {
this.goToSlide(Math.max(slideCount - 1, 0), nextProps);
}
var updateDimensions = slideCountChanged || utilities_1.shouldUpdate(this.props, nextProps, ['cellSpacing', 'vertical', 'slideWidth', 'slideHeight', 'heightMode', 'slidesToScroll', 'slidesToShow', 'transitionMode', 'cellAlign']);
if (updateDimensions) {
this.setDimensions(nextProps);
}
if (this.props.slideIndex !== nextProps.slideIndex && nextProps.slideIndex !== this.state.currentSlide && !this.state.isWrappingAround) {
this.goToSlide(nextProps.slideIndex, this.props);
}
if (this.props.autoplay !== nextProps.autoplay) {
if (nextProps.autoplay) {
this.startAutoplay();
}
else {
this.stopAutoplay();
}
}
}
}, {
key: "componentDidUpdate",
value: function componentDidUpdate(prevProps, prevState) {
var slideChanged = prevState.currentSlide !== this.state.currentSlide;
var heightModeChanged = prevProps.heightMode !== this.props.heightMode;
var axisChanged = prevProps.vertical !== this.props.vertical;
if (axisChanged) {
this.onResize();
}
else if (slideChanged || heightModeChanged) {
var image = this.getCurrentChildNodeImg();
if (image) {
image.addEventListener('load', this.setSlideHeightAndWidth);
image.removeEventListener('load', this.setSlideHeightAndWidth);
}
else {
this.setSlideHeightAndWidth();
}
}
var _this$calcSlideHeight = this.calcSlideHeightAndWidth(), slideHeight = _this$calcSlideHeight.slideHeight;
var heightMismatches = slideHeight !== prevState.slideHeight;
if (this.mounted && prevState.readyStateChanged > 0 && heightMismatches) {
this.setDimensions();
}
}
}, {
key: "componentWillUnmount",
value: function componentWillUnmount() {
this.unbindEvents();
this.disconnectChildNodesMutationObserver();
this.stopAutoplay();
this.mounted = false;
for (var i = 0; i < this.timers.length; i++) {
clearTimeout(this.timers[i]);
}
}
}, {
key: "establishChildNodesMutationObserver",
value: function establishChildNodesMutationObserver() {
var _this2 = this;
var childNodes = this.getChildNodes();
if (childNodes.length && 'MutationObserver' in window) {
this.childNodesMutationObs = new MutationObserver(function (mutations) {
mutations.forEach(function () {
_this2.setSlideHeightAndWidth();
});
});
var observeChildNodeMutation = function observeChildNodeMutation(node) {
_this2.childNodesMutationObs.observe(node, {
attributes: true,
attributeFilter: ['style'],
attributeOldValue: false,
characterData: false,
characterDataOldValue: false,
childList: false,
subtree: false
});
};
var childNodesArray = Array.from(childNodes);
for (var _i = 0, _childNodesArray = childNodesArray; _i < _childNodesArray.length; _i++) {
var node = _childNodesArray[_i];
observeChildNodeMutation(node);
}
}
}
}, {
key: "disconnectChildNodesMutationObserver",
value: function disconnectChildNodesMutationObserver() {
if (this.childNodesMutationObs instanceof MutationObserver) {
this.childNodesMutationObs.disconnect();
}
}
}, {
key: "getTouchEvents",
value: function getTouchEvents() {
var _this3 = this;
if (this.props.swiping === false) {
return {
onTouchStart: this.handleMouseOver,
onTouchEnd: this.handleMouseOut
};
}
return {
onTouchStart: function onTouchStart(e) {
_this3.touchObject = {
startX: e.touches[0].pageX,
startY: e.touches[0].pageY
};
_this3.handleMouseOver();
_this3.setState({
dragging: true
});
},
onTouchMove: function onTouchMove(e) {
var direction = utilities_1.swipeDirection(_this3.touchObject.startX, e.touches[0].pageX, _this3.touchObject.startY, e.touches[0].pageY, _this3.props.vertical);
if (direction !== 0) {
e.preventDefault();
}
var length = _this3.props.vertical ? Math.round(Math.sqrt(Math.pow(e.touches[0].pageY - _this3.touchObject.startY, 2))) : Math.round(Math.sqrt(Math.pow(e.touches[0].pageX - _this3.touchObject.startX, 2)));
if (length >= 10) {
if (_this3.clickDisabled === false)
_this3.props.onDragStart(e);
_this3.clickDisabled = true;
}
_this3.touchObject = {
startX: _this3.touchObject.startX,
startY: _this3.touchObject.startY,
endX: e.touches[0].pageX,
endY: e.touches[0].pageY,
length: length,
direction: direction
};
_this3.setState({
left: _this3.props.vertical ? 0 : _this3.getTargetLeft(_this3.touchObject.length * _this3.touchObject.direction),
top: _this3.props.vertical ? _this3.getTargetLeft(_this3.touchObject.length * _this3.touchObject.direction) : 0
});
},
onTouchEnd: function onTouchEnd(e) {
_this3.handleSwipe(e);
_this3.handleMouseOut();
},
onTouchCancel: function onTouchCancel(e) {
_this3.handleSwipe(e);
}
};
}
}, {
key: "getMouseEvents",
value: function getMouseEvents() {
var _this4 = this;
if (this.props.dragging === false) {
return {
onMouseOver: this.handleMouseOver,
onMouseOut: this.handleMouseOut
};
}
return {
onMouseOver: this.handleMouseOver,
onMouseOut: this.handleMouseOut,
onMouseDown: function onMouseDown(e) {
_this4.touchObject = {
startX: e.clientX,
startY: e.clientY
};
_this4.setState({
dragging: true
});
},
onMouseMove: function onMouseMove(e) {
if (!_this4.state.dragging) {
return;
}
var direction = utilities_1.swipeDirection(_this4.touchObject.startX, e.clientX, _this4.touchObject.startY, e.clientY, _this4.props.vertical);
if (direction !== 0) {
e.preventDefault();
}
var length = _this4.props.vertical ? Math.round(Math.sqrt(Math.pow(e.clientY - _this4.touchObject.startY, 2))) : Math.round(Math.sqrt(Math.pow(e.clientX - _this4.touchObject.startX, 2)));
if (length >= 10) {
if (_this4.clickDisabled === false)
_this4.props.onDragStart(e);
_this4.clickDisabled = true;
}
_this4.touchObject = {
startX: _this4.touchObject.startX,
startY: _this4.touchObject.startY,
endX: e.clientX,
endY: e.clientY,
length: length,
direction: direction
};
_this4.setState({
left: _this4.props.vertical ? 0 : _this4.getTargetLeft(_this4.touchObject.length * _this4.touchObject.direction),
top: _this4.props.vertical ? _this4.getTargetLeft(_this4.touchObject.length * _this4.touchObject.direction) : 0
});
},
onMouseUp: function onMouseUp(e) {
if (_this4.touchObject.length === 0 || _this4.touchObject.length === undefined) {
_this4.setState({
dragging: false
});
return;
}
_this4.handleSwipe(e);
},
onMouseLeave: function onMouseLeave(e) {
if (!_this4.state.dragging) {
return;
}
_this4.handleSwipe(e);
}
};
}
}, {
key: "pauseAutoplay",
value: function pauseAutoplay() {
if (this.props.autoplay) {
this.autoplayPaused = true;
this.stopAutoplay();
}
}
}, {
key: "unpauseAutoplay",
value: function unpauseAutoplay() {
if (this.props.autoplay && this.autoplayPaused) {
this.startAutoplay();
this.autoplayPaused = null;
}
}
}, {
key: "handleMouseOver",
value: function handleMouseOver() {
if (this.props.pauseOnHover) {
this.pauseAutoplay();
}
}
}, {
key: "handleMouseOut",
value: function handleMouseOut() {
if (this.autoplayPaused) {
this.unpauseAutoplay();
}
}
}, {
key: "handleClick",
value: function handleClick(event) {
if (this.clickDisabled === true) {
if (event.metaKey || event.shiftKey || event.altKey || event.ctrlKey) {
return;
}
event.preventDefault();
event.stopPropagation();
if (event.nativeEvent) {
event.nativeEvent.stopPropagation();
}
}
}
}, {
key: "handleSwipe",
value: function handleSwipe() {
var _this5 = this;
var slidesToShow = this.state.slidesToShow;
if (this.props.slidesToScroll === 'auto') {
slidesToShow = this.state.slidesToScroll;
}
if (this.touchObject.length > this.state.slideWidth / slidesToShow / 5) {
if (this.touchObject.direction === 1) {
if (this.state.currentSlide + 1 >= this.state.slideCount && !this.props.wrapAround) {
this.setState({
easing: easing[this.props.edgeEasing]
});
}
else {
this.nextSlide();
}
}
else if (this.touchObject.direction === -1) {
if (this.state.currentSlide <= 0 && !this.props.wrapAround) {
this.setState({
easing: easing[this.props.edgeEasing]
});
}
else {
this.previousSlide();
}
}
}
else {
this.goToSlide(this.state.currentSlide);
}
this.timers.push(setTimeout(function () {
_this5.clickDisabled = false;
}, 0));
this.touchObject = {};
this.setState({
dragging: false
});
}
}, {
key: "handleKeyPress",
value: function handleKeyPress(e) {
if (this.props.enableKeyboardControls) {
switch (e.keyCode) {
case 39:
case 68:
case 38:
case 87:
this.nextSlide();
break;
case 37:
case 65:
case 40:
case 83:
this.previousSlide();
break;
case 81:
this.goToSlide(0, this.props);
break;
case 69:
this.goToSlide(this.state.slideCount - 1, this.props);
break;
case 32:
if (this.state.pauseOnHover && this.props.autoplay) {
this.setState({
pauseOnHover: false
});
this.pauseAutoplay();
break;
}
else {
this.setState({
pauseOnHover: true
});
this.unpauseAutoplay();
break;
}
}
}
}
}, {
key: "autoplayIterator",
value: function autoplayIterator() {
if (this.props.wrapAround) {
if (this.props.autoplayReverse) {
this.previousSlide();
}
else {
this.nextSlide();
}
return;
}
if (this.props.autoplayReverse) {
if (this.state.currentSlide !== 0) {
this.previousSlide();
}
else {
this.stopAutoplay();
}
}
else if (this.state.currentSlide !== this.state.slideCount - this.state.slidesToShow) {
this.nextSlide();
}
else {
this.stopAutoplay();
}
}
}, {
key: "startAutoplay",
value: function startAutoplay() {
this.autoplayID = setInterval(this.autoplayIterator, this.props.autoplayInterval);
}
}, {
key: "resetAutoplay",
value: function resetAutoplay() {
if (this.props.autoplay && !this.autoplayPaused) {
this.stopAutoplay();
this.startAutoplay();
}
}
}, {
key: "stopAutoplay",
value: function stopAutoplay() {
if (this.autoplayID) {
clearInterval(this.autoplayID);
}
}
}, {
key: "getTargetLeft",
value: function getTargetLeft(touchOffset, slide) {
var offset;
var target = slide || this.state.currentSlide;
switch (this.state.cellAlign) {
case 'left':
{
offset = 0;
offset -= this.props.cellSpacing * target;
break;
}
case 'center':
{
offset = (this.state.frameWidth - this.state.slideWidth) / 2;
offset -= this.props.cellSpacing * target;
break;
}
case 'right':
{
offset = this.state.frameWidth - this.state.slideWidth;
offset -= this.props.cellSpacing * target;
break;
}
}
var left = this.state.slideWidth * target;
var lastSlide = this.state.currentSlide > 0 && target + this.state.slidesToScroll >= this.state.slideCount;
if (lastSlide && this.props.slideWidth !== 1 && !this.props.wrapAround && this.props.slidesToScroll === 'auto') {
left = this.state.slideWidth * this.state.slideCount - this.state.frameWidth;
offset = 0;
offset -= this.props.cellSpacing * (this.state.slideCount - 1);
}
offset -= touchOffset || 0;
return (left - offset) * -1;
}
}, {
key: "getOffsetDeltas",
value: function getOffsetDeltas() {
var offset = 0;
if (this.state.isWrappingAround) {
offset = this.getTargetLeft(null, this.state.wrapToIndex);
}
else {
offset = this.getTargetLeft(this.touchObject.length * this.touchObject.direction);
}
return {
tx: [this.props.vertical ? 0 : offset],
ty: [this.props.vertical ? offset : 0]
};
}
}, {
key: "isEdgeSwiping",
value: function isEdgeSwiping() {
var _this$state = this.state, slideCount = _this$state.slideCount, slideWidth = _this$state.slideWidth, slideHeight = _this$state.slideHeight, slidesToShow = _this$state.slidesToShow;
var _this$getOffsetDeltas = this.getOffsetDeltas(), tx = _this$getOffsetDeltas.tx, ty = _this$getOffsetDeltas.ty;
if (this.props.vertical) {
var rowHeight = slideHeight / slidesToShow;
var slidesLeftToShow = slideCount - slidesToShow;
var lastSlideLimit = rowHeight * slidesLeftToShow;
return ty > 0 || -ty > lastSlideLimit;
}
return tx > 0 || -tx > slideWidth * (slideCount - 1);
}
}, {
key: "goToSlide",
value: function goToSlide(index, props) {
var _this6 = this;
if (props === undefined) {
props = this.props;
}
if (this.isTransitioning) {
return;
}
this.setState({
hasInteraction: true,
easing: easing[props.easing]
});
this.isTransitioning = true;
var previousSlide = this.state.currentSlide;
if (index >= this.state.slideCount || index < 0) {
if (!props.wrapAround) {
this.isTransitioning = false;
return;
}
if (index >= this.state.slideCount) {
props.beforeSlide(this.state.currentSlide, 0);
this.setState(function (prevState) {
return {
left: props.vertical ? 0 : _this6.getTargetLeft(_this6.state.slideWidth, prevState.currentSlide),
top: props.vertical ? _this6.getTargetLeft(_this6.state.slideWidth, prevState.currentSlide) : 0,
currentSlide: 0,
isWrappingAround: true,
wrapToIndex: _this6.state.slideCount
};
}, function () {
_this6.timers.push(setTimeout(function () {
_this6.resetAutoplay();
_this6.isTransitioning = false;
if (index !== previousSlide) {
_this6.props.afterSlide(0);
}
}, props.speed));
});
return;
}
else {
var endSlide = index < 0 ? this.state.slideCount + index : this.state.slideCount - this.state.slidesToScroll;
props.beforeSlide(this.state.currentSlide, endSlide);
this.setState(function (prevState) {
return {
left: props.vertical ? 0 : _this6.getTargetLeft(0, prevState.currentSlide),
top: props.vertical ? _this6.getTargetLeft(0, prevState.currentSlide) : 0,
currentSlide: endSlide,
isWrappingAround: true,
wrapToIndex: index
};
}, function () {
_this6.timers.push(setTimeout(function () {
_this6.resetAutoplay();
_this6.isTransitioning = false;
if (index !== previousSlide) {
_this6.props.afterSlide(_this6.state.slideCount - 1);
}
}, props.speed));
});
return;
}
}
this.props.beforeSlide(this.state.currentSlide, index);
this.setState({
currentSlide: index
}, function () {
return _this6.timers.push(setTimeout(function () {
_this6.resetAutoplay();
_this6.isTransitioning = false;
if (index !== previousSlide) {
_this6.props.afterSlide(index);
}
}, props.speed));
});
}
}, {
key: "nextSlide",
value: function nextSlide() {
var childrenCount = this.state.slideCount;
var slidesToShow = this.state.slidesToShow;
if (this.props.slidesToScroll === 'auto') {
slidesToShow = this.state.slidesToScroll;
}
if (this.state.currentSlide >= childrenCount - slidesToShow && !this.props.wrapAround && this.props.cellAlign === 'left') {
return;
}
if (this.props.wrapAround) {
this.goToSlide(this.state.currentSlide + this.state.slidesToScroll);
}
else {
if (this.props.slideWidth !== 1) {
this.goToSlide(this.state.currentSlide + this.state.slidesToScroll);
return;
}
var offset = this.state.currentSlide + this.state.slidesToScroll;
var nextSlideIndex = this.props.cellAlign !== 'left' ? offset : Math.min(offset, childrenCount - slidesToShow);
this.goToSlide(nextSlideIndex);
}
}
}, {
key: "previousSlide",
value: function previousSlide() {
if (this.state.currentSlide <= 0 && !this.props.wrapAround) {
return;
}
if (this.props.wrapAround) {
this.goToSlide(this.state.currentSlide - this.state.slidesToScroll);
}
else {
this.goToSlide(Math.max(0, this.state.currentSlide - this.state.slidesToScroll));
}
}
}, {
key: "bindEvents",
value: function bindEvents() {
if (exenv_1.default.canUseDOM) {
utilities_1.addEvent(window, 'resize', this.onResize);
utilities_1.addEvent(document, 'readystatechange', this.onReadyStateChange);
utilities_1.addEvent(document, 'visibilitychange', this.onVisibilityChange);
utilities_1.addEvent(document, 'keydown', this.handleKeyPress);
}
}
}, {
key: "onResize",
value: function onResize() {
this.setDimensions(null, this.props.onResize);
}
}, {
key: "onReadyStateChange",
value: function onReadyStateChange() {
this.setState({
readyStateChanged: this.state.readyStateChanged + 1
});
this.setDimensions();
}
}, {
key: "onVisibilityChange",
value: function onVisibilityChange() {
if (document.hidden) {
this.pauseAutoplay();
}
else {
this.unpauseAutoplay();
}
}
}, {
key: "unbindEvents",
value: function unbindEvents() {
if (exenv_1.default.canUseDOM) {
utilities_1.removeEvent(window, 'resize', this.onResize);
utilities_1.removeEvent(document, 'readystatechange', this.onReadyStateChange);
utilities_1.removeEvent(document, 'visibilitychange', this.onVisibilityChange);
utilities_1.removeEvent(document, 'keydown', this.handleKeyPress);
}
}
}, {
key: "calcSlideHeightAndWidth",
value: function calcSlideHeightAndWidth(props) {
props = props || this.props;
var childNodes = this.getChildNodes();
var slideHeight = bootstrapping_utilities_1.getSlideHeight(props, this.state, childNodes);
var _getPropsByTransition = utilities_1.getPropsByTransitionMode(props, ['slidesToShow']), slidesToShow = _getPropsByTransition.slidesToShow;
var frame = this.frame;
var slideWidth;
if (this.props.animation === 'zoom') {
slideWidth = frame.offsetWidth - frame.offsetWidth * 15 / 100;
}
else if (typeof props.slideWidth !== 'number') {
slideWidth = parseInt(props.slideWidth);
}
else if (props.vertical) {
slideWidth = slideHeight / slidesToShow * props.slideWidth;
}
else {
slideWidth = frame.offsetWidth / slidesToShow * props.slideWidth;
}
if (!props.vertical) {
slideWidth -= props.cellSpacing * ((100 - 100 / slidesToShow) / 100);
}
return {
slideHeight: slideHeight,
slideWidth: slideWidth
};
}
}, {
key: "setSlideHeightAndWidth",
value: function setSlideHeightAndWidth() {
this.setState(this.calcSlideHeightAndWidth());
}
}, {
key: "setDimensions",
value: function setDimensions(props) {
var _this7 = this;
var stateCb = arguments.length > 1 && arguments[1] !== undefined ? arguments[1] : function () { };
props = props || this.props;
var _getPropsByTransition2 = utilities_1.getPropsByTransitionMode(props, ['slidesToShow', 'cellAlign']), slidesToShow = _getPropsByTransition2.slidesToShow, cellAlign = _getPropsByTransition2.cellAlign;
var frame = this.frame;
var _this$calcSlideHeight2 = this.calcSlideHeightAndWidth(props), slideHeight = _this$calcSlideHeight2.slideHeight, slideWidth = _this$calcSlideHeight2.slideWidth;
var frameHeight = slideHeight + props.cellSpacing * (slidesToShow - 1);
var frameWidth = props.vertical ? frameHeight : frame.offsetWidth;
var _getPropsByTransition3 = utilities_1.getPropsByTransitionMode(props, ['slidesToScroll']), slidesToScroll = _getPropsByTransition3.slidesToScroll;
if (slidesToScroll === 'auto') {
slidesToScroll = Math.floor(frameWidth / (slideWidth + props.cellSpacing));
}
this.setState({
frameWidth: frameWidth,
slideHeight: slideHeight,
slidesToScroll: slidesToScroll,
slidesToShow: slidesToShow,
slideWidth: slideWidth,
cellAlign: cellAlign,
left: props.vertical ? 0 : this.getTargetLeft(),
top: props.vertical ? this.getTargetLeft() : 0
}, function () {
stateCb();
_this7.setLeft();
});
}
}, {
key: "getChildNodes",
value: function getChildNodes() {
return this.frame.childNodes[0].childNodes;
}
}, {
key: "getCurrentChildNodeImg",
value: function getCurrentChildNodeImg() {
var childNodes = this.getChildNodes();
var currentChildNode = childNodes[this.props.slideIndex];
return currentChildNode ? currentChildNode.getElementsByTagName('img')[0] : null;
}
}, {
key: "setLeft",
value: function setLeft() {
var newLeft = this.props.vertical ? 0 : this.getTargetLeft();
var newTop = this.props.vertical ? this.getTargetLeft() : 0;
if (newLeft !== this.state.left || newTop !== this.state.top) {
this.setState({
left: newLeft,
top: newTop
});
}
}
}, {
key: "renderControls",
value: function renderControls() {
var _this8 = this;
if (this.props.withoutControls) {
return this.controlsMap.map(function () {
return null;
});
}
else {
return this.controlsMap.map(function (_ref) {
var funcName = _ref.funcName, key = _ref.key;
var func = _this8.props[funcName];
var controlChildren = func && typeof func === 'function' && func({
cellAlign: _this8.props.cellAlign,
cellSpacing: _this8.props.cellSpacing,
currentSlide: _this8.state.currentSlide,
frameWidth: _this8.state.frameWidth,
goToSlide: function goToSlide(index) {
return _this8.goToSlide(index);
},
nextSlide: function nextSlide() {
return _this8.nextSlide();
},
previousSlide: function previousSlide() {
return _this8.previousSlide();
},
slideCount: _this8.state.slideCount,
slidesToScroll: _this8.state.slidesToScroll,
slidesToShow: _this8.state.slidesToShow,
slideWidth: _this8.state.slideWidth,
wrapAround: _this8.props.wrapAround
});
return controlChildren && react_1.default.createElement("div", {
className: "slider-control-".concat(key.toLowerCase()),
style: style_utilities_1.getDecoratorStyles(key),
key: key
}, controlChildren);
});
}
}
}, {
key: "render",
value: function render() {
var _this9 = this;
var _this$state2 = this.state, currentSlide = _this$state2.currentSlide, slideCount = _this$state2.slideCount, frameWidth = _this$state2.frameWidth;
var _this$props = this.props, frameOverflow = _this$props.frameOverflow, vertical = _this$props.vertical, framePadding = _this$props.framePadding, slidesToShow = _this$props.slidesToShow, renderAnnounceSlideMessage = _this$props.renderAnnounceSlideMessage, disableAnimation = _this$props.disableAnimation;
var duration = this.state.dragging || !this.state.dragging && this.state.resetWrapAroundPosition && this.props.wrapAround || disableAnimation || !this.state.hasInteraction ? 0 : this.props.speed;
var frameStyles = style_utilities_1.getFrameStyles(frameOverflow, vertical, framePadding, frameWidth);
var touchEvents = this.getTouchEvents();
var mouseEvents = this.getMouseEvents();
var TransitionControl = all_transitions_1.default[this.props.transitionMode];
var validChildren = bootstrapping_utilities_1.getValidChildren(this.props.children);
return react_1.default.createElement("div", {
className: ['slider', this.props.className || ].join(' '),
style: _extends({}, style_utilities_1.getSliderStyles(this.props.width, this.props.height), this.props.style)
}, !this.props.autoplay && react_1.default.createElement(announce_slide_1.default, {
message: renderAnnounceSlideMessage({
currentSlide: currentSlide,
slideCount: slideCount
})
}), react_1.default.createElement("div", _extends({
className: "slider-frame",
ref: function ref(frame) {
return _this9.frame = frame;
},
style: frameStyles
}, touchEvents, mouseEvents, {
onClickCapture: this.handleClick
}), react_1.default.createElement(Animate_1.default, {
show: true,
start: {
tx: 0,
ty: 0
},
update: function update() {
var _this9$getOffsetDelta = _this9.getOffsetDeltas(), tx = _this9$getOffsetDelta.tx, ty = _this9$getOffsetDelta.ty;
if (_this9.props.disableEdgeSwiping && !_this9.props.wrapAround && _this9.isEdgeSwiping()) {
return {};
}
else {
return {
tx: tx,
ty: ty,
timing: {
duration: duration,
ease: _this9.state.easing
},
events: {
end: function end() {
var newLeft = _this9.props.vertical ? 0 : _this9.getTargetLeft();
var newTop = _this9.props.vertical ? _this9.getTargetLeft() : 0;
if (newLeft !== _this9.state.left || newTop !== _this9.state.top) {
_this9.setState({
left: newLeft,
top: newTop,
isWrappingAround: false,
resetWrapAroundPosition: true
}, function () {
_this9.setState({
resetWrapAroundPosition: false
});
});
}
}
}
};
}
},
children: function children(_ref2) {
var tx = _ref2.tx, ty = _ref2.ty;
return react_1.default.createElement(TransitionControl, _extends({}, style_utilities_1.getTransitionProps(_this9.props, _this9.state), {
deltaX: tx,
deltaY: ty
}), bootstrapping_utilities_1.addAccessibility(validChildren, slidesToShow, currentSlide));
}
})), this.renderControls(), this.props.autoGenerateStyleTag && react_1.default.createElement("style", {
type: "text/css",
dangerouslySetInnerHTML: {
__html: style_utilities_1.getImgTagStyles()
}
}));
}
}]);
return Carousel;
}(react_1.default.Component); exports.default = Carousel; Carousel.propTypes = {
afterSlide: prop_types_1.default.func, animation: prop_types_1.default.oneOf(['zoom']), autoGenerateStyleTag: prop_types_1.default.bool, autoplay: prop_types_1.default.bool, autoplayInterval: prop_types_1.default.number, autoplayReverse: prop_types_1.default.bool, beforeSlide: prop_types_1.default.func, cellAlign: prop_types_1.default.oneOf(['left', 'center', 'right']), cellSpacing: prop_types_1.default.number, enableKeyboardControls: prop_types_1.default.bool, disableAnimation: prop_types_1.default.bool, disableEdgeSwiping: prop_types_1.default.bool, dragging: prop_types_1.default.bool, easing: prop_types_1.default.string, edgeEasing: prop_types_1.default.string, frameOverflow: prop_types_1.default.string, framePadding: prop_types_1.default.string, height: prop_types_1.default.string, heightMode: prop_types_1.default.oneOf(['first', 'current', 'max']), initialSlideHeight: prop_types_1.default.number, initialSlideWidth: prop_types_1.default.number, onDragStart: prop_types_1.default.func, onResize: prop_types_1.default.func, pauseOnHover: prop_types_1.default.bool, renderAnnounceSlideMessage: prop_types_1.default.func, renderBottomCenterControls: prop_types_1.default.func, renderBottomLeftControls: prop_types_1.default.func, renderBottomRightControls: prop_types_1.default.func, renderCenterCenterControls: prop_types_1.default.func, renderCenterLeftControls: prop_types_1.default.func, renderCenterRightControls: prop_types_1.default.func, renderTopCenterControls: prop_types_1.default.func, renderTopLeftControls: prop_types_1.default.func, renderTopRightControls: prop_types_1.default.func, slideIndex: prop_types_1.default.number, slideOffset: prop_types_1.default.number, slidesToScroll: prop_types_1.default.oneOfType([prop_types_1.default.number, prop_types_1.default.oneOf(['auto'])]), slidesToShow: prop_types_1.default.number, slideWidth: prop_types_1.default.oneOfType([prop_types_1.default.string, prop_types_1.default.number]), speed: prop_types_1.default.number, swiping: prop_types_1.default.bool, transitionMode: prop_types_1.default.oneOf(['scroll', 'fade', 'scroll3d']), vertical: prop_types_1.default.bool, width: prop_types_1.default.string, withoutControls: prop_types_1.default.bool, wrapAround: prop_types_1.default.bool, opacityScale: prop_types_1.default.number, slideListMargin: prop_types_1.default.number
}; Carousel.defaultProps = {
afterSlide: function afterSlide() { },
autoGenerateStyleTag: true,
autoplay: false,
autoplayInterval: 3000,
autoplayReverse: false,
beforeSlide: function beforeSlide() { },
cellAlign: 'left',
cellSpacing: 0,
enableKeyboardControls: false,
disableAnimation: false,
disableEdgeSwiping: false,
dragging: true,
easing: 'easeCircleOut',
edgeEasing: 'easeElasticOut',
frameOverflow: 'hidden',
framePadding: '0px',
height: 'inherit',
heightMode: 'max',
onDragStart: function onDragStart() { },
onResize: function onResize() { },
pauseOnHover: true,
renderAnnounceSlideMessage: announce_slide_1.defaultRenderAnnounceSlideMessage,
renderBottomCenterControls: function renderBottomCenterControls(props) {
return react_1.default.createElement(default_controls_1.PagingDots, props);
},
renderCenterLeftControls: function renderCenterLeftControls(props) {
return react_1.default.createElement(default_controls_1.PreviousButton, props);
},
renderCenterRightControls: function renderCenterRightControls(props) {
return react_1.default.createElement(default_controls_1.NextButton, props);
},
slideIndex: 0,
slideOffset: 25,
slidesToScroll: 1,
slidesToShow: 1,
slideWidth: 1,
speed: 500,
style: {},
swiping: true,
transitionMode: 'scroll',
vertical: false,
width: '100%',
withoutControls: false,
wrapAround: false,
slideListMargin: 10
};
} // exenv/index.js $fsx.f[133] = (module, exports) => { (function () {
'use strict';
var canUseDOM = !!(typeof window !== 'undefined' &&
window.document &&
window.document.createElement);
var ExecutionEnvironment = {
canUseDOM: canUseDOM,
canUseWorkers: typeof Worker !== 'undefined',
canUseEventListeners: canUseDOM && !!(window.addEventListener || window.attachEvent),
canUseViewport: canUseDOM && !!window.screen
};
if (typeof define === 'function' && typeof define.amd === 'object' && define.amd) {
define(function () {
return ExecutionEnvironment;
});
}
else if (typeof module !== 'undefined' && module.exports) {
module.exports = ExecutionEnvironment;
}
else {
window.ExecutionEnvironment = ExecutionEnvironment;
}
}());
} // react-move/Animate/index.js $fsx.f[147] = (module, exports) => { "use strict"; Object.defineProperty(exports, "__esModule", {
value: true
}); exports.default = void 0; var _react = _interopRequireWildcard($fsx.r(3)); var _propTypes = _interopRequireDefault($fsx.r(13)); var _NodeGroup = _interopRequireDefault($fsx.r(146)); var _utils = $fsx.r(145); function _interopRequireDefault(obj) { return obj && obj.__esModule ? obj : { default: obj }; } function _interopRequireWildcard(obj) { if (obj && obj.__esModule) {
return obj;
} else {
var newObj = {};
if (obj != null) {
for (var key in obj) {
if (Object.prototype.hasOwnProperty.call(obj, key)) {
var desc = Object.defineProperty && Object.getOwnPropertyDescriptor ? Object.getOwnPropertyDescriptor(obj, key) : {};
if (desc.get || desc.set) {
Object.defineProperty(newObj, key, desc);
}
else {
newObj[key] = obj[key];
}
}
}
}
newObj.default = obj;
return newObj;
} } function _typeof(obj) { if (typeof Symbol === "function" && typeof Symbol.iterator === "symbol") {
_typeof = function _typeof(obj) { return typeof obj; };
} else {
_typeof = function _typeof(obj) { return obj && typeof Symbol === "function" && obj.constructor === Symbol && obj !== Symbol.prototype ? "symbol" : typeof obj; };
} return _typeof(obj); } function _classCallCheck(instance, Constructor) { if (!(instance instanceof Constructor)) {
throw new TypeError("Cannot call a class as a function");
} } function _defineProperties(target, props) { for (var i = 0; i < props.length; i++) {
var descriptor = props[i];
descriptor.enumerable = descriptor.enumerable || false;
descriptor.configurable = true;
if ("value" in descriptor)
descriptor.writable = true;
Object.defineProperty(target, descriptor.key, descriptor);
} } function _createClass(Constructor, protoProps, staticProps) { if (protoProps)
_defineProperties(Constructor.prototype, protoProps); if (staticProps) _defineProperties(Constructor, staticProps); return Constructor; }
function _possibleConstructorReturn(self, call) { if (call && (_typeof(call) === "object" || typeof call === "function")) {
return call;
} return _assertThisInitialized(self); } function _assertThisInitialized(self) { if (self === void 0) {
throw new ReferenceError("this hasn't been initialised - super() hasn't been called");
} return self; } function _getPrototypeOf(o) { _getPrototypeOf = Object.setPrototypeOf ? Object.getPrototypeOf : function _getPrototypeOf(o) { return o.__proto__ || Object.getPrototypeOf(o); }; return _getPrototypeOf(o); } function _inherits(subClass, superClass) { if (typeof superClass !== "function" && superClass !== null) {
throw new TypeError("Super expression must either be null or a function");
} subClass.prototype = Object.create(superClass && superClass.prototype, { constructor: { value: subClass, writable: true, configurable: true } }); if (superClass)
_setPrototypeOf(subClass, superClass); }
function _setPrototypeOf(o, p) { _setPrototypeOf = Object.setPrototypeOf || function _setPrototypeOf(o, p) { o.__proto__ = p; return o; }; return _setPrototypeOf(o, p); } var keyAccessor = function keyAccessor() {
return '$$key$$';
}; var Animate = function (_Component) {
_inherits(Animate, _Component);
function Animate() {
_classCallCheck(this, Animate);
return _possibleConstructorReturn(this, _getPrototypeOf(Animate).apply(this, arguments));
}
_createClass(Animate, [{
key: "render",
value: function render() {
var _this$props = this.props, show = _this$props.show, start = _this$props.start, enter = _this$props.enter, update = _this$props.update, leave = _this$props.leave, interpolation = _this$props.interpolation, children = _this$props.children;
var data = typeof start === 'function' ? start() : start;
return _react.default.createElement(_NodeGroup.default, {
data: show ? [data] : [],
start: function start() {
return data;
},
keyAccessor: keyAccessor,
interpolation: interpolation,
enter: typeof enter === 'function' ? enter : function () {
return enter;
},
update: typeof update === 'function' ? update : function () {
return update;
},
leave: typeof leave === 'function' ? leave : function () {
return leave;
}
}, function (nodes) {
if (!nodes[0]) {
return null;
}
var renderedChildren = children(nodes[0].state);
return renderedChildren && _react.default.Children.only(renderedChildren);
});
}
}]);
return Animate;
}(_react.Component); Animate.propTypes = "production" !== "production" ? {
show: _propTypes.default.bool, interpolation: _propTypes.default.func, start: _propTypes.default.oneOfType([_propTypes.default.func, _propTypes.default.object]), enter: _propTypes.default.oneOfType([_propTypes.default.func, _propTypes.default.array, _propTypes.default.object]), update: _propTypes.default.oneOfType([_propTypes.default.func, _propTypes.default.array, _propTypes.default.object]), leave: _propTypes.default.oneOfType([_propTypes.default.func, _propTypes.default.array, _propTypes.default.object]), children: _propTypes.default.func.isRequired
} : {}; Animate.defaultProps = {
show: true, interpolation: _utils.numeric
}; var _default = Animate; exports.default = _default;
} // react-move/NodeGroup/index.js $fsx.f[146] = (module, exports) => { "use strict"; Object.defineProperty(exports, "__esModule", {
value: true
}); exports.default = void 0; var _react = _interopRequireWildcard($fsx.r(3)); var _reactLifecyclesCompat = $fsx.r(134); var _propTypes = _interopRequireDefault($fsx.r(13)); var _kapellmeister = $fsx.r(142); var _mergeKeys = _interopRequireDefault($fsx.r(143)); var _types = $fsx.r(144); var _utils = $fsx.r(145); function _interopRequireDefault(obj) { return obj && obj.__esModule ? obj : { default: obj }; } function _interopRequireWildcard(obj) { if (obj && obj.__esModule) {
return obj;
} else {
var newObj = {};
if (obj != null) {
for (var key in obj) {
if (Object.prototype.hasOwnProperty.call(obj, key)) {
var desc = Object.defineProperty && Object.getOwnPropertyDescriptor ? Object.getOwnPropertyDescriptor(obj, key) : {};
if (desc.get || desc.set) {
Object.defineProperty(newObj, key, desc);
}
else {
newObj[key] = obj[key];
}
}
}
}
newObj.default = obj;
return newObj;
} } function _typeof(obj) { if (typeof Symbol === "function" && typeof Symbol.iterator === "symbol") {
_typeof = function _typeof(obj) { return typeof obj; };
} else {
_typeof = function _typeof(obj) { return obj && typeof Symbol === "function" && obj.constructor === Symbol && obj !== Symbol.prototype ? "symbol" : typeof obj; };
} return _typeof(obj); } function _classCallCheck(instance, Constructor) { if (!(instance instanceof Constructor)) {
throw new TypeError("Cannot call a class as a function");
} } function _defineProperties(target, props) { for (var i = 0; i < props.length; i++) {
var descriptor = props[i];
descriptor.enumerable = descriptor.enumerable || false;
descriptor.configurable = true;
if ("value" in descriptor)
descriptor.writable = true;
Object.defineProperty(target, descriptor.key, descriptor);
} } function _createClass(Constructor, protoProps, staticProps) { if (protoProps)
_defineProperties(Constructor.prototype, protoProps); if (staticProps) _defineProperties(Constructor, staticProps); return Constructor; }
function _possibleConstructorReturn(self, call) { if (call && (_typeof(call) === "object" || typeof call === "function")) {
return call;
} return _assertThisInitialized(self); } function _getPrototypeOf(o) { _getPrototypeOf = Object.setPrototypeOf ? Object.getPrototypeOf : function _getPrototypeOf(o) { return o.__proto__ || Object.getPrototypeOf(o); }; return _getPrototypeOf(o); } function _assertThisInitialized(self) { if (self === void 0) {
throw new ReferenceError("this hasn't been initialised - super() hasn't been called");
} return self; } function _inherits(subClass, superClass) { if (typeof superClass !== "function" && superClass !== null) {
throw new TypeError("Super expression must either be null or a function");
} subClass.prototype = Object.create(superClass && superClass.prototype, { constructor: { value: subClass, writable: true, configurable: true } }); if (superClass)
_setPrototypeOf(subClass, superClass); }
function _setPrototypeOf(o, p) { _setPrototypeOf = Object.setPrototypeOf || function _setPrototypeOf(o, p) { o.__proto__ = p; return o; }; return _setPrototypeOf(o, p); } function _defineProperty(obj, key, value) { if (key in obj) {
Object.defineProperty(obj, key, { value: value, enumerable: true, configurable: true, writable: true });
} else {
obj[key] = value;
} return obj; } var NodeGroup = function (_Component) {
_inherits(NodeGroup, _Component);
function NodeGroup(props) {
var _this;
_classCallCheck(this, NodeGroup);
_this = _possibleConstructorReturn(this, _getPrototypeOf(NodeGroup).call(this, props));
_defineProperty(_assertThisInitialized(_this), "animate", function () {
var _this$state = _this.state, nodeKeys = _this$state.nodeKeys, nodeHash = _this$state.nodeHash;
if (_this.unmounting) {
return;
}
var pending = false;
var nextNodeKeys = [];
var length = nodeKeys.length;
for (var i = 0; i < length; i++) {
var k = nodeKeys[i];
var n = nodeHash[k];
var isTransitioning = n.isTransitioning();
if (isTransitioning) {
pending = true;
}
if (n.type === _types.LEAVE && !isTransitioning) {
delete nodeHash[k];
}
else {
nextNodeKeys.push(k);
}
}
if (!pending) {
_this.interval.stop();
}
_this.setState(function () {
return {
nodeKeys: nextNodeKeys,
nodes: nextNodeKeys.map(function (key) {
return nodeHash[key];
})
};
});
});
_defineProperty(_assertThisInitialized(_this), "interval", null);
_defineProperty(_assertThisInitialized(_this), "unmounting", false);
var interpolation = props.interpolation;
var Node = function (_BaseNode) {
_inherits(Node, _BaseNode);
function Node(key, data) {
var _this2;
_classCallCheck(this, Node);
_this2 = _possibleConstructorReturn(this, _getPrototypeOf(Node).call(this));
_defineProperty(_assertThisInitialized(_this2), "getInterpolator", interpolation);
_this2.key = key;
_this2.data = data;
_this2.type = _types.ENTER;
return _this2;
}
return Node;
}(_kapellmeister.BaseNode);
_this.state = {
Node: Node,
nodeKeys: [],
nodeHash: {},
nodes: [],
data: null
};
return _this;
}
_createClass(NodeGroup, [{
key: "componentDidMount",
value: function componentDidMount() {
this.startInterval();
}
}, {
key: "componentDidUpdate",
value: function componentDidUpdate(prevProps) {
if (prevProps.data !== this.props.data && !this.unmounting) {
this.startInterval();
}
}
}, {
key: "startInterval",
value: function startInterval() {
if (!this.interval) {
this.interval = (0, _kapellmeister.interval)(this.animate);
}
else {
this.interval.restart(this.animate);
}
}
}, {
key: "componentWillUnmount",
value: function componentWillUnmount() {
var _this$state2 = this.state, nodeKeys = _this$state2.nodeKeys, nodeHash = _this$state2.nodeHash;
this.unmounting = true;
if (this.interval) {
this.interval.stop();
}
nodeKeys.forEach(function (key) {
nodeHash[key].stopTransitions();
});
}
}, {
key: "render",
value: function render() {
var renderedChildren = this.props.children(this.state.nodes);
return renderedChildren && _react.default.Children.only(renderedChildren);
}
}], [{
key: "getDerivedStateFromProps",
value: function getDerivedStateFromProps(nextProps, prevState) {
if (nextProps.data !== prevState.data) {
var data = nextProps.data, keyAccessor = nextProps.keyAccessor, start = nextProps.start, enter = nextProps.enter, update = nextProps.update, leave = nextProps.leave;
var Node = prevState.Node, nodeKeys = prevState.nodeKeys, nodeHash = prevState.nodeHash;
var keyIndex = {};
for (var i = 0; i < nodeKeys.length; i++) {
keyIndex[nodeKeys[i]] = i;
}
var nextKeyIndex = {};
var nextNodeKeys = [];
for (var _i = 0; _i < data.length; _i++) {
var d = data[_i];
var k = keyAccessor(d, _i);
nextKeyIndex[k] = _i;
nextNodeKeys.push(k);
if (keyIndex[k] === undefined) {
var node = new Node();
node.key = k;
node.data = d;
node.type = _types.ENTER;
nodeHash[k] = node;
}
}
for (var _i2 = 0; _i2 < nodeKeys.length; _i2++) {
var _k = nodeKeys[_i2];
var n = nodeHash[_k];
if (nextKeyIndex[_k] !== undefined) {
n.data = data[nextKeyIndex[_k]];
n.type = _types.UPDATE;
}
else {
n.type = _types.LEAVE;
}
}
var mergedNodeKeys = (0, _mergeKeys.default)(nodeKeys, keyIndex, nextNodeKeys, nextKeyIndex);
for (var _i3 = 0; _i3 < mergedNodeKeys.length; _i3++) {
var _k2 = mergedNodeKeys[_i3];
var _n = nodeHash[_k2];
var _d = _n.data;
if (_n.type === _types.ENTER) {
_n.setState(start(_d, nextKeyIndex[_k2]));
_n.transition(enter(_d, nextKeyIndex[_k2]));
}
else if (_n.type === _types.LEAVE) {
_n.transition(leave(_d, keyIndex[_k2]));
}
else {
_n.transition(update(_d, nextKeyIndex[_k2]));
}
}
return {
data: data,
nodes: mergedNodeKeys.map(function (key) {
return nodeHash[key];
}),
nodeHash: nodeHash,
nodeKeys: mergedNodeKeys
};
}
return null;
}
}]);
return NodeGroup;
}(_react.Component); NodeGroup.propTypes = "production" !== "production" ? {
data: _propTypes.default.array.isRequired, keyAccessor: _propTypes.default.func.isRequired, interpolation: _propTypes.default.func, start: _propTypes.default.func.isRequired, enter: _propTypes.default.func, update: _propTypes.default.func, leave: _propTypes.default.func, children: _propTypes.default.func.isRequired
} : {}; NodeGroup.defaultProps = {
enter: function enter() { },
update: function update() { },
leave: function leave() { },
interpolation: _utils.numeric
}; (0, _reactLifecyclesCompat.polyfill)(NodeGroup); var _default = NodeGroup; exports.default = _default;
} // react-lifecycles-compat/react-lifecycles-compat.es.js $fsx.f[134] = (module, exports) => { "use strict"; Object.defineProperty(exports, "__esModule", { value: true }); function componentWillMount() {
var state = this.constructor.getDerivedStateFromProps(this.props, this.state);
if (state !== null && state !== undefined) {
this.setState(state);
}
} function componentWillReceiveProps(nextProps) {
function updater(prevState) {
var state = this.constructor.getDerivedStateFromProps(nextProps, prevState);
return state !== null && state !== undefined ? state : null;
}
this.setState(updater.bind(this));
} function componentWillUpdate(nextProps, nextState) {
try {
var prevProps = this.props;
var prevState = this.state;
this.props = nextProps;
this.state = nextState;
this.__reactInternalSnapshotFlag = true;
this.__reactInternalSnapshot = this.getSnapshotBeforeUpdate(prevProps, prevState);
}
finally {
this.props = prevProps;
this.state = prevState;
}
} componentWillMount.__suppressDeprecationWarning = true; componentWillReceiveProps.__suppressDeprecationWarning = true; componentWillUpdate.__suppressDeprecationWarning = true; function polyfill(Component) {
var prototype = Component.prototype;
if (!prototype || !prototype.isReactComponent) {
throw new Error('Can only polyfill class components');
}
if (typeof Component.getDerivedStateFromProps !== 'function' &&
typeof prototype.getSnapshotBeforeUpdate !== 'function') {
return Component;
}
var foundWillMountName = null;
var foundWillReceivePropsName = null;
var foundWillUpdateName = null;
if (typeof prototype.componentWillMount === 'function') {
foundWillMountName = 'componentWillMount';
}
else if (typeof prototype.UNSAFE_componentWillMount === 'function') {
foundWillMountName = 'UNSAFE_componentWillMount';
}
if (typeof prototype.componentWillReceiveProps === 'function') {
foundWillReceivePropsName = 'componentWillReceiveProps';
}
else if (typeof prototype.UNSAFE_componentWillReceiveProps === 'function') {
foundWillReceivePropsName = 'UNSAFE_componentWillReceiveProps';
}
if (typeof prototype.componentWillUpdate === 'function') {
foundWillUpdateName = 'componentWillUpdate';
}
else if (typeof prototype.UNSAFE_componentWillUpdate === 'function') {
foundWillUpdateName = 'UNSAFE_componentWillUpdate';
}
if (foundWillMountName !== null ||
foundWillReceivePropsName !== null ||
foundWillUpdateName !== null) {
var componentName = Component.displayName || Component.name;
var newApiName = typeof Component.getDerivedStateFromProps === 'function'
? 'getDerivedStateFromProps()'
: 'getSnapshotBeforeUpdate()';
throw Error('Unsafe legacy lifecycles will not be called for components using new component APIs.\n\n' +
componentName +
' uses ' +
newApiName +
' but also contains the following legacy lifecycles:' +
(foundWillMountName !== null ? '\n ' + foundWillMountName : ) +
(foundWillReceivePropsName !== null
? '\n ' + foundWillReceivePropsName
: ) +
(foundWillUpdateName !== null ? '\n ' + foundWillUpdateName : ) +
'\n\nThe above lifecycles should be removed. Learn more about this warning here:\n' +
'https://fb.me/react-async-component-lifecycle-hooks');
}
if (typeof Component.getDerivedStateFromProps === 'function') {
prototype.componentWillMount = componentWillMount;
prototype.componentWillReceiveProps = componentWillReceiveProps;
}
if (typeof prototype.getSnapshotBeforeUpdate === 'function') {
if (typeof prototype.componentDidUpdate !== 'function') {
throw new Error('Cannot polyfill getSnapshotBeforeUpdate() for components that do not define componentDidUpdate() on the prototype');
}
prototype.componentWillUpdate = componentWillUpdate;
var componentDidUpdate = prototype.componentDidUpdate;
prototype.componentDidUpdate = function componentDidUpdatePolyfill(prevProps, prevState, maybeSnapshot) {
var snapshot = this.__reactInternalSnapshotFlag
? this.__reactInternalSnapshot
: maybeSnapshot;
componentDidUpdate.call(this, prevProps, prevState, snapshot);
};
}
return Component;
} exports.polyfill = polyfill;
} // kapellmeister/es/index.js $fsx.f[142] = (module, exports) => { "use strict"; Object.defineProperty(exports, "__esModule", { value: true }); var BaseNode_1 = $fsx.r(141); exports.BaseNode = BaseNode_1.default; var d3_timer_1 = $fsx.r(138); exports.now = d3_timer_1.now; exports.timer = d3_timer_1.timer; exports.interval = d3_timer_1.interval; exports.timeout = d3_timer_1.timeout;
} // kapellmeister/es/BaseNode.js $fsx.f[141] = (module, exports) => { "use strict"; Object.defineProperty(exports, "__esModule", { value: true }); function _objectSpread(target) { for (var i = 1; i < arguments.length; i++) {
var source = arguments[i] != null ? arguments[i] : {};
var ownKeys = Object.keys(source);
if (typeof Object.getOwnPropertySymbols === 'function') {
ownKeys = ownKeys.concat(Object.getOwnPropertySymbols(source).filter(function (sym) { return Object.getOwnPropertyDescriptor(source, sym).enumerable; }));
}
ownKeys.forEach(function (key) { _defineProperty(target, key, source[key]); });
} return target; } function _defineProperty(obj, key, value) { if (key in obj) {
Object.defineProperty(obj, key, { value: value, enumerable: true, configurable: true, writable: true });
} else {
obj[key] = value;
} return obj; } function _classCallCheck(instance, Constructor) { if (!(instance instanceof Constructor)) {
throw new TypeError("Cannot call a class as a function");
} } function _defineProperties(target, props) { for (var i = 0; i < props.length; i++) {
var descriptor = props[i];
descriptor.enumerable = descriptor.enumerable || false;
descriptor.configurable = true;
if ("value" in descriptor)
descriptor.writable = true;
Object.defineProperty(target, descriptor.key, descriptor);
} } function _createClass(Constructor, protoProps, staticProps) { if (protoProps)
_defineProperties(Constructor.prototype, protoProps); if (staticProps) _defineProperties(Constructor, staticProps); return Constructor; }
const d3_timer_1 = $fsx.r(138); const utils_1 = $fsx.r(139); const Events_1 = $fsx.r(140); var BaseNode = function () {
function BaseNode(state) {
_classCallCheck(this, BaseNode);
this.state = state || {};
}
_createClass(BaseNode, [{
key: "transition",
value: function transition(config) {
if (Array.isArray(config)) {
var _iteratorNormalCompletion = true;
var _didIteratorError = false;
var _iteratorError = undefined;
try {
for (var _iterator = config[Symbol.iterator](), _step; !(_iteratorNormalCompletion = (_step = _iterator.next()).done); _iteratorNormalCompletion = true) {
var item = _step.value;
this.parse(item);
}
}
catch (err) {
_didIteratorError = true;
_iteratorError = err;
}
finally {
try {
if (!_iteratorNormalCompletion && _iterator.return != null) {
_iterator.return();
}
}
finally {
if (_didIteratorError) {
throw _iteratorError;
}
}
}
}
else {
this.parse(config);
}
}
}, {
key: "isTransitioning",
value: function isTransitioning() {
return !!this.transitionData;
}
}, {
key: "stopTransitions",
value: function stopTransitions() {
var transitions = this.transitionData;
if (transitions) {
Object.keys(transitions).forEach(function (t) {
transitions[t].timer.stop();
});
}
}
}, {
key: "setState",
value: function setState(update) {
if (typeof update === 'function') {
utils_1.extend(this.state, update(this.state));
}
else {
utils_1.extend(this.state, update);
}
}
}, {
key: "parse",
value: function parse(config) {
var _this = this;
var clone = _objectSpread({}, config);
var events = new Events_1.default(clone);
if (clone.events) {
delete clone.events;
}
var timing = _objectSpread({}, utils_1.timingDefaults, clone.timing || {}, {
time: d3_timer_1.now()
});
if (clone.timing) {
delete clone.timing;
}
Object.keys(clone).forEach(function (stateKey) {
var tweens = [];
var next = clone[stateKey];
if (utils_1.isNamespace(next)) {
Object.keys(next).forEach(function (attr) {
var val = next[attr];
if (Array.isArray(val)) {
if (val.length === 1) {
tweens.push(_this.getTween(attr, val[0], stateKey));
}
else {
_this.setState(function (state) {
var _objectSpread2, _ref;
return _ref = {}, _ref[stateKey] = _objectSpread({}, state[stateKey], (_objectSpread2 = {}, _objectSpread2[attr] = val[0], _objectSpread2)), _ref;
});
tweens.push(_this.getTween(attr, val[1], stateKey));
}
}
else if (typeof val === 'function') {
var getNameSpacedCustomTween = function getNameSpacedCustomTween() {
var kapellmeisterNamespacedTween = function kapellmeisterNamespacedTween(t) {
_this.setState(function (state) {
var _objectSpread3, _ref2;
return _ref2 = {}, _ref2[stateKey] = _objectSpread({}, state[stateKey], (_objectSpread3 = {}, _objectSpread3[attr] = val(t), _objectSpread3)), _ref2;
});
};
return kapellmeisterNamespacedTween;
};
tweens.push(getNameSpacedCustomTween);
}
else {
_this.setState(function (state) {
var _objectSpread4, _ref3;
return _ref3 = {}, _ref3[stateKey] = _objectSpread({}, state[stateKey], (_objectSpread4 = {}, _objectSpread4[attr] = val, _objectSpread4)), _ref3;
});
tweens.push(_this.getTween(attr, val, stateKey));
}
});
}
else {
if (Array.isArray(next)) {
if (next.length === 1) {
tweens.push(_this.getTween(stateKey, next[0], null));
}
else {
var _this$setState;
_this.setState((_this$setState = {}, _this$setState[stateKey] = next[0], _this$setState));
tweens.push(_this.getTween(stateKey, next[1], null));
}
}
else if (typeof next === 'function') {
var getCustomTween = function getCustomTween() {
var kapellmeisterTween = function kapellmeisterTween(t) {
var _this$setState2;
_this.setState((_this$setState2 = {}, _this$setState2[stateKey] = next(t), _this$setState2));
};
return kapellmeisterTween;
};
tweens.push(getCustomTween);
}
else {
var _this$setState3;
_this.setState((_this$setState3 = {}, _this$setState3[stateKey] = next, _this$setState3));
tweens.push(_this.getTween(stateKey, next, null));
}
}
_this.update({
stateKey: stateKey,
timing: timing,
tweens: tweens,
events: events,
status: 0
});
});
}
}, {
key: "getTween",
value: function getTween(attr, endValue, nameSpace) {
var _this2 = this;
return function () {
var begValue = nameSpace ? _this2.state[nameSpace][attr] : _this2.state[attr];
if (begValue === endValue) {
return null;
}
var i = _this2.getInterpolator(begValue, endValue, attr, nameSpace);
var stateTween;
if (nameSpace === null) {
stateTween = function stateTween(t) {
var _this2$setState;
_this2.setState((_this2$setState = {}, _this2$setState[attr] = i(t), _this2$setState));
};
}
else {
stateTween = function stateTween(t) {
_this2.setState(function (state) {
var _objectSpread5, _ref4;
return _ref4 = {}, _ref4[nameSpace] = _objectSpread({}, state[nameSpace], (_objectSpread5 = {}, _objectSpread5[attr] = i(t), _objectSpread5)), _ref4;
});
};
}
return stateTween;
};
}
}, {
key: "update",
value: function update(transition) {
if (!this.transitionData) {
this.transitionData = {};
}
this.init(utils_1.getTransitionId(), transition);
}
}, {
key: "init",
value: function init(id, transition) {
var _this3 = this;
var n = transition.tweens.length;
var tweens = new Array(n);
var queue = function queue(elapsed) {
transition.status = 1;
transition.timer.restart(start, transition.timing.delay, transition.timing.time);
if (transition.timing.delay <= elapsed) {
start(elapsed - transition.timing.delay);
}
};
this.transitionData[id] = transition;
transition.timer = d3_timer_1.timer(queue, 0, transition.timing.time);
var start = function start(elapsed) {
if (transition.status !== 1)
return stop();
for (var tid in _this3.transitionData) {
var t = _this3.transitionData[tid];
if (t.stateKey !== transition.stateKey) {
continue;
}
if (t.status === 3) {
return d3_timer_1.timeout(start);
}
if (t.status === 4) {
t.status = 6;
t.timer.stop();
if (t.events.interrupt) {
t.events.interrupt.call(_this3);
}
delete _this3.transitionData[tid];
}
else if (+tid < id) {
t.status = 6;
t.timer.stop();
delete _this3.transitionData[tid];
}
}
d3_timer_1.timeout(function () {
if (transition.status === 3) {
transition.status = 4;
transition.timer.restart(tick, transition.timing.delay, transition.timing.time);
tick(elapsed);
}
});
transition.status = 2;
if (transition.events.start) {
transition.events.start.call(_this3);
}
if (transition.status !== 2) {
return;
}
transition.status = 3;
var j = -1;
for (var i = 0; i < n; ++i) {
var res = transition.tweens[i]();
if (res) {
tweens[++j] = res;
}
}
tweens.length = j + 1;
};
var tick = function tick(elapsed) {
var t = 1;
if (elapsed < transition.timing.duration) {
t = transition.timing.ease(elapsed / transition.timing.duration);
}
else {
transition.timer.restart(stop);
transition.status = 5;
}
var i = -1;
while (++i < tweens.length) {
tweens[i](t);
}
if (transition.status === 5) {
if (transition.events.end) {
transition.events.end.call(_this3);
}
stop();
}
};
var stop = function stop() {
transition.status = 6;
transition.timer.stop();
delete _this3.transitionData[id];
for (var _ in _this3.transitionData) {
return;
}
delete _this3.transitionData;
};
}
}]);
return BaseNode;
}(); exports.default = BaseNode;
} // d3-timer/src/index.js $fsx.f[138] = (module, exports) => { "use strict"; Object.defineProperty(exports, "__esModule", { value: true }); var timer_1 = $fsx.r(135); exports.now = timer_1.now; exports.timer = timer_1.timer; exports.timerFlush = timer_1.timerFlush; var timeout_1 = $fsx.r(136); exports.timeout = timeout_1.default; var interval_1 = $fsx.r(137); exports.interval = interval_1.default;
} // d3-timer/src/timer.js $fsx.f[135] = (module, exports) => { "use strict"; Object.defineProperty(exports, "__esModule", { value: true }); var frame = 0, timeout = 0, interval = 0, pokeDelay = 1000, taskHead, taskTail, clockLast = 0, clockNow = 0, clockSkew = 0, clock = typeof performance === "object" && performance.now ? performance : Date, setFrame = typeof window === "object" && window.requestAnimationFrame ? window.requestAnimationFrame.bind(window) : function (f) { setTimeout(f, 17); }; function now() {
return clockNow || (setFrame(clearNow), clockNow = clock.now() + clockSkew);
} exports.now = now; function clearNow() {
clockNow = 0;
} function Timer() {
this._call =
this._time =
this._next = null;
} exports.Timer = Timer; Timer.prototype = timer.prototype = {
constructor: Timer,
restart: function (callback, delay, time) {
if (typeof callback !== "function")
throw new TypeError("callback is not a function");
time = (time == null ? now() : +time) + (delay == null ? 0 : +delay);
if (!this._next && taskTail !== this) {
if (taskTail)
taskTail._next = this;
else
taskHead = this;
taskTail = this;
}
this._call = callback;
this._time = time;
sleep();
},
stop: function () {
if (this._call) {
this._call = null;
this._time = Infinity;
sleep();
}
}
}; function timer(callback, delay, time) {
var t = new Timer; t.restart(callback, delay, time); return t;
} exports.timer = timer; function timerFlush() {
now();
++frame;
var t = taskHead, e;
while (t) {
if ((e = clockNow - t._time) >= 0)
t._call.call(null, e);
t = t._next;
}
--frame;
} exports.timerFlush = timerFlush; function wake() {
clockNow = (clockLast = clock.now()) + clockSkew;
frame = timeout = 0;
try {
timerFlush();
}
finally {
frame = 0;
nap();
clockNow = 0;
}
} function poke() {
var now = clock.now(), delay = now - clockLast;
if (delay > pokeDelay)
clockSkew -= delay, clockLast = now;
} function nap() {
var t0, t1 = taskHead, t2, time = Infinity;
while (t1) {
if (t1._call) {
if (time > t1._time)
time = t1._time;
t0 = t1, t1 = t1._next;
}
else {
t2 = t1._next, t1._next = null;
t1 = t0 ? t0._next = t2 : taskHead = t2;
}
}
taskTail = t0;
sleep(time);
} function sleep(time) {
if (frame)
return;
if (timeout)
timeout = clearTimeout(timeout);
var delay = time - clockNow;
if (delay > 24) {
if (time < Infinity)
timeout = setTimeout(wake, time - clock.now() - clockSkew);
if (interval)
interval = clearInterval(interval);
}
else {
if (!interval)
clockLast = clock.now(), interval = setInterval(poke, pokeDelay);
frame = 1, setFrame(wake);
}
}
} // d3-timer/src/timeout.js $fsx.f[136] = (module, exports) => { "use strict"; Object.defineProperty(exports, "__esModule", { value: true }); const timer_1 = $fsx.r(135); function default_1(callback, delay, time) {
var t = new timer_1.Timer;
delay = delay == null ? 0 : +delay;
t.restart(function (elapsed) {
t.stop();
callback(elapsed + delay);
}, delay, time);
return t;
} exports.default = default_1;
} // d3-timer/src/interval.js $fsx.f[137] = (module, exports) => { "use strict"; Object.defineProperty(exports, "__esModule", { value: true }); const timer_1 = $fsx.r(135); function default_1(callback, delay, time) {
var t = new timer_1.Timer, total = delay;
if (delay == null)
return t.restart(callback, delay, time), t;
delay = +delay, time = time == null ? timer_1.now() : +time;
t.restart(function tick(elapsed) {
elapsed += total;
t.restart(tick, total += delay, time);
callback(elapsed);
}, delay, time);
return t;
} exports.default = default_1;
} // kapellmeister/es/utils.js $fsx.f[139] = (module, exports) => { "use strict"; Object.defineProperty(exports, "__esModule", { value: true }); function _typeof(obj) { if (typeof Symbol === "function" && typeof Symbol.iterator === "symbol") {
_typeof = function _typeof(obj) { return typeof obj; };
} else {
_typeof = function _typeof(obj) { return obj && typeof Symbol === "function" && obj.constructor === Symbol && obj !== Symbol.prototype ? "symbol" : typeof obj; };
} return _typeof(obj); } var transitionId = 0; function getTransitionId() {
return ++transitionId;
} exports.getTransitionId = getTransitionId; function extend(obj, props) {
for (var i in props) {
obj[i] = props[i];
}
} exports.extend = extend; function once(func) {
var called = false;
return function transitionEvent() {
if (!called) {
called = true;
func.call(this);
}
};
} exports.once = once; function isNamespace(prop) {
return _typeof(prop) === 'object' && Array.isArray(prop) === false;
} exports.isNamespace = isNamespace; var linear = function linear(t) {
return +t;
}; exports.timingDefaults = {
delay: 0, duration: 250, ease: linear
};
} // kapellmeister/es/Events.js $fsx.f[140] = (module, exports) => { "use strict"; Object.defineProperty(exports, "__esModule", { value: true }); function _classCallCheck(instance, Constructor) { if (!(instance instanceof Constructor)) {
throw new TypeError("Cannot call a class as a function");
} } const utils_1 = $fsx.r(139); exports.Events = function Events(config) {
var _this = this;
_classCallCheck(this, Events);
this.start = null;
this.interrupt = null;
this.end = null;
if (config.events) {
Object.keys(config.events).forEach(function (d) {
if (typeof config.events[d] !== 'function') {
throw new Error('Event handlers must be a function');
}
else {
_this[d] = utils_1.once(config.events[d]);
}
});
}
}; exports.default = exports.Events;
} // react-move/core/mergeKeys.js $fsx.f[143] = (module, exports) => { "use strict"; Object.defineProperty(exports, "__esModule", {
value: true
}); exports.default = void 0; function mergeKeys(currNodeKeys, currKeyIndex, nextNodeKeys, nextKeyIndex) {
var allKeys = [];
for (var i = 0; i < nextNodeKeys.length; i++) {
allKeys[i] = nextNodeKeys[i];
}
for (var _i = 0; _i < currNodeKeys.length; _i++) {
if (nextKeyIndex[currNodeKeys[_i]] === undefined) {
allKeys.push(currNodeKeys[_i]);
}
}
return allKeys.sort(function (a, b) {
var nextOrderA = nextKeyIndex[a];
var nextOrderB = nextKeyIndex[b];
var currOrderA = currKeyIndex[a];
var currOrderB = currKeyIndex[b];
if (nextOrderA != null && nextOrderB != null) {
return nextKeyIndex[a] - nextKeyIndex[b];
}
else if (currOrderA != null && currOrderB != null) {
return currKeyIndex[a] - currKeyIndex[b];
}
else if (nextOrderA != null) {
for (var _i2 = 0; _i2 < nextNodeKeys.length; _i2++) {
var pivot = nextNodeKeys[_i2];
if (!currKeyIndex[pivot]) {
continue;
}
if (nextOrderA < nextKeyIndex[pivot] && currOrderB > currKeyIndex[pivot]) {
return -1;
}
else if (nextOrderA > nextKeyIndex[pivot] && currOrderB < currKeyIndex[pivot]) {
return 1;
}
}
return 1;
}
for (var _i3 = 0; _i3 < nextNodeKeys.length; _i3++) {
var _pivot = nextNodeKeys[_i3];
if (!currKeyIndex[_pivot]) {
continue;
}
if (nextOrderB < nextKeyIndex[_pivot] && currOrderA > currKeyIndex[_pivot]) {
return 1;
}
else if (nextOrderB > nextKeyIndex[_pivot] && currOrderA < currKeyIndex[_pivot]) {
return -1;
}
}
return -1;
});
} var _default = mergeKeys; exports.default = _default;
} // react-move/core/types.js $fsx.f[144] = (module, exports) => { "use strict"; Object.defineProperty(exports, "__esModule", {
value: true
}); exports.LEAVE = exports.UPDATE = exports.ENTER = void 0; var ENTER = 'ENTER'; exports.ENTER = ENTER; var UPDATE = 'UPDATE'; exports.UPDATE = UPDATE; var LEAVE = 'LEAVE'; exports.LEAVE = LEAVE;
} // react-move/utils.js $fsx.f[145] = (module, exports) => { "use strict"; Object.defineProperty(exports, "__esModule", {
value: true
}); exports.numeric = numeric; function numeric(beg, end) {
var a = +beg;
var b = +end - a;
return function (t) {
return a + b * t;
};
}
} // d3-ease/src/index.js $fsx.f[158] = (module, exports) => { "use strict"; Object.defineProperty(exports, "__esModule", { value: true }); var linear_1 = $fsx.r(148); exports.easeLinear = linear_1.linear; var quad_1 = $fsx.r(149); exports.easeQuad = quad_1.quadInOut; exports.easeQuadIn = quad_1.quadIn; exports.easeQuadOut = quad_1.quadOut; exports.easeQuadInOut = quad_1.quadInOut; var cubic_1 = $fsx.r(150); exports.easeCubic = cubic_1.cubicInOut; exports.easeCubicIn = cubic_1.cubicIn; exports.easeCubicOut = cubic_1.cubicOut; exports.easeCubicInOut = cubic_1.cubicInOut; var poly_1 = $fsx.r(151); exports.easePoly = poly_1.polyInOut; exports.easePolyIn = poly_1.polyIn; exports.easePolyOut = poly_1.polyOut; exports.easePolyInOut = poly_1.polyInOut; var sin_1 = $fsx.r(152); exports.easeSin = sin_1.sinInOut; exports.easeSinIn = sin_1.sinIn; exports.easeSinOut = sin_1.sinOut; exports.easeSinInOut = sin_1.sinInOut; var exp_1 = $fsx.r(153); exports.easeExp = exp_1.expInOut; exports.easeExpIn = exp_1.expIn; exports.easeExpOut = exp_1.expOut; exports.easeExpInOut = exp_1.expInOut; var circle_1 = $fsx.r(154); exports.easeCircle = circle_1.circleInOut; exports.easeCircleIn = circle_1.circleIn; exports.easeCircleOut = circle_1.circleOut; exports.easeCircleInOut = circle_1.circleInOut; var bounce_1 = $fsx.r(155); exports.easeBounce = bounce_1.bounceOut; exports.easeBounceIn = bounce_1.bounceIn; exports.easeBounceOut = bounce_1.bounceOut; exports.easeBounceInOut = bounce_1.bounceInOut; var back_1 = $fsx.r(156); exports.easeBack = back_1.backInOut; exports.easeBackIn = back_1.backIn; exports.easeBackOut = back_1.backOut; exports.easeBackInOut = back_1.backInOut; var elastic_1 = $fsx.r(157); exports.easeElastic = elastic_1.elasticOut; exports.easeElasticIn = elastic_1.elasticIn; exports.easeElasticOut = elastic_1.elasticOut; exports.easeElasticInOut = elastic_1.elasticInOut;
} // d3-ease/src/linear.js $fsx.f[148] = (module, exports) => { "use strict"; Object.defineProperty(exports, "__esModule", { value: true }); function linear(t) {
return +t;
} exports.linear = linear;
} // d3-ease/src/quad.js $fsx.f[149] = (module, exports) => { "use strict"; Object.defineProperty(exports, "__esModule", { value: true }); function quadIn(t) {
return t * t;
} exports.quadIn = quadIn; function quadOut(t) {
return t * (2 - t);
} exports.quadOut = quadOut; function quadInOut(t) {
return ((t *= 2) <= 1 ? t * t : --t * (2 - t) + 1) / 2;
} exports.quadInOut = quadInOut;
} // d3-ease/src/cubic.js $fsx.f[150] = (module, exports) => { "use strict"; Object.defineProperty(exports, "__esModule", { value: true }); function cubicIn(t) {
return t * t * t;
} exports.cubicIn = cubicIn; function cubicOut(t) {
return --t * t * t + 1;
} exports.cubicOut = cubicOut; function cubicInOut(t) {
return ((t *= 2) <= 1 ? t * t * t : (t -= 2) * t * t + 2) / 2;
} exports.cubicInOut = cubicInOut;
} // d3-ease/src/poly.js $fsx.f[151] = (module, exports) => { "use strict"; Object.defineProperty(exports, "__esModule", { value: true }); var exponent = 3; exports.polyIn = (function custom(e) {
e = +e;
function polyIn(t) {
return Math.pow(t, e);
}
polyIn.exponent = custom;
return polyIn;
})(exponent); exports.polyOut = (function custom(e) {
e = +e;
function polyOut(t) {
return 1 - Math.pow(1 - t, e);
}
polyOut.exponent = custom;
return polyOut;
})(exponent); exports.polyInOut = (function custom(e) {
e = +e;
function polyInOut(t) {
return ((t *= 2) <= 1 ? Math.pow(t, e) : 2 - Math.pow(2 - t, e)) / 2;
}
polyInOut.exponent = custom;
return polyInOut;
})(exponent);
} // d3-ease/src/sin.js $fsx.f[152] = (module, exports) => { "use strict"; Object.defineProperty(exports, "__esModule", { value: true }); var pi = Math.PI, halfPi = pi / 2; function sinIn(t) {
return 1 - Math.cos(t * halfPi);
} exports.sinIn = sinIn; function sinOut(t) {
return Math.sin(t * halfPi);
} exports.sinOut = sinOut; function sinInOut(t) {
return (1 - Math.cos(pi * t)) / 2;
} exports.sinInOut = sinInOut;
} // d3-ease/src/exp.js $fsx.f[153] = (module, exports) => { "use strict"; Object.defineProperty(exports, "__esModule", { value: true }); function expIn(t) {
return Math.pow(2, 10 * t - 10);
} exports.expIn = expIn; function expOut(t) {
return 1 - Math.pow(2, -10 * t);
} exports.expOut = expOut; function expInOut(t) {
return ((t *= 2) <= 1 ? Math.pow(2, 10 * t - 10) : 2 - Math.pow(2, 10 - 10 * t)) / 2;
} exports.expInOut = expInOut;
} // d3-ease/src/circle.js $fsx.f[154] = (module, exports) => { "use strict"; Object.defineProperty(exports, "__esModule", { value: true }); function circleIn(t) {
return 1 - Math.sqrt(1 - t * t);
} exports.circleIn = circleIn; function circleOut(t) {
return Math.sqrt(1 - --t * t);
} exports.circleOut = circleOut; function circleInOut(t) {
return ((t *= 2) <= 1 ? 1 - Math.sqrt(1 - t * t) : Math.sqrt(1 - (t -= 2) * t) + 1) / 2;
} exports.circleInOut = circleInOut;
} // d3-ease/src/bounce.js $fsx.f[155] = (module, exports) => { "use strict"; Object.defineProperty(exports, "__esModule", { value: true }); var b1 = 4 / 11, b2 = 6 / 11, b3 = 8 / 11, b4 = 3 / 4, b5 = 9 / 11, b6 = 10 / 11, b7 = 15 / 16, b8 = 21 / 22, b9 = 63 / 64, b0 = 1 / b1 / b1; function bounceIn(t) {
return 1 - bounceOut(1 - t);
} exports.bounceIn = bounceIn; function bounceOut(t) {
return (t = +t) < b1 ? b0 * t * t : t < b3 ? b0 * (t -= b2) * t + b4 : t < b6 ? b0 * (t -= b5) * t + b7 : b0 * (t -= b8) * t + b9;
} exports.bounceOut = bounceOut; function bounceInOut(t) {
return ((t *= 2) <= 1 ? 1 - bounceOut(1 - t) : bounceOut(t - 1) + 1) / 2;
} exports.bounceInOut = bounceInOut;
} // d3-ease/src/back.js $fsx.f[156] = (module, exports) => { "use strict"; Object.defineProperty(exports, "__esModule", { value: true }); var overshoot = 1.70158; exports.backIn = (function custom(s) {
s = +s;
function backIn(t) {
return t * t * ((s + 1) * t - s);
}
backIn.overshoot = custom;
return backIn;
})(overshoot); exports.backOut = (function custom(s) {
s = +s;
function backOut(t) {
return --t * t * ((s + 1) * t + s) + 1;
}
backOut.overshoot = custom;
return backOut;
})(overshoot); exports.backInOut = (function custom(s) {
s = +s;
function backInOut(t) {
return ((t *= 2) < 1 ? t * t * ((s + 1) * t - s) : (t -= 2) * t * ((s + 1) * t + s) + 2) / 2;
}
backInOut.overshoot = custom;
return backInOut;
})(overshoot);
} // d3-ease/src/elastic.js $fsx.f[157] = (module, exports) => { "use strict"; Object.defineProperty(exports, "__esModule", { value: true }); var tau = 2 * Math.PI, amplitude = 1, period = 0.3; exports.elasticIn = (function custom(a, p) {
var s = Math.asin(1 / (a = Math.max(1, a))) * (p /= tau);
function elasticIn(t) {
return a * Math.pow(2, 10 * --t) * Math.sin((s - t) / p);
}
elasticIn.amplitude = function (a) { return custom(a, p * tau); };
elasticIn.period = function (p) { return custom(a, p); };
return elasticIn;
})(amplitude, period); exports.elasticOut = (function custom(a, p) {
var s = Math.asin(1 / (a = Math.max(1, a))) * (p /= tau);
function elasticOut(t) {
return 1 - a * Math.pow(2, -10 * (t = +t)) * Math.sin((t + s) / p);
}
elasticOut.amplitude = function (a) { return custom(a, p * tau); };
elasticOut.period = function (p) { return custom(a, p); };
return elasticOut;
})(amplitude, period); exports.elasticInOut = (function custom(a, p) {
var s = Math.asin(1 / (a = Math.max(1, a))) * (p /= tau);
function elasticInOut(t) {
return ((t = t * 2 - 1) < 0
? a * Math.pow(2, 10 * t) * Math.sin((s - t) / p)
: 2 - a * Math.pow(2, -10 * t) * Math.sin((s + t) / p)) / 2;
}
elasticInOut.amplitude = function (a) { return custom(a, p * tau); };
elasticInOut.period = function (p) { return custom(a, p); };
return elasticInOut;
})(amplitude, period);
} // nuka-carousel/es/default-controls.js $fsx.f[159] = (module, exports) => { "use strict"; Object.defineProperty(exports, "__esModule", { value: true }); function _typeof(obj) { if (typeof Symbol === "function" && typeof Symbol.iterator === "symbol") {
_typeof = function _typeof(obj) { return typeof obj; };
} else {
_typeof = function _typeof(obj) { return obj && typeof Symbol === "function" && obj.constructor === Symbol && obj !== Symbol.prototype ? "symbol" : typeof obj; };
} return _typeof(obj); } function _classCallCheck(instance, Constructor) { if (!(instance instanceof Constructor)) {
throw new TypeError("Cannot call a class as a function");
} } function _defineProperties(target, props) { for (var i = 0; i < props.length; i++) {
var descriptor = props[i];
descriptor.enumerable = descriptor.enumerable || false;
descriptor.configurable = true;
if ("value" in descriptor)
descriptor.writable = true;
Object.defineProperty(target, descriptor.key, descriptor);
} } function _createClass(Constructor, protoProps, staticProps) { if (protoProps)
_defineProperties(Constructor.prototype, protoProps); if (staticProps) _defineProperties(Constructor, staticProps); return Constructor; }
function _possibleConstructorReturn(self, call) { if (call && (_typeof(call) === "object" || typeof call === "function")) {
return call;
} return _assertThisInitialized(self); } function _getPrototypeOf(o) { _getPrototypeOf = Object.setPrototypeOf ? Object.getPrototypeOf : function _getPrototypeOf(o) { return o.__proto__ || Object.getPrototypeOf(o); }; return _getPrototypeOf(o); } function _assertThisInitialized(self) { if (self === void 0) {
throw new ReferenceError("this hasn't been initialised - super() hasn't been called");
} return self; } function _inherits(subClass, superClass) { if (typeof superClass !== "function" && superClass !== null) {
throw new TypeError("Super expression must either be null or a function");
} subClass.prototype = Object.create(superClass && superClass.prototype, { constructor: { value: subClass, writable: true, configurable: true } }); if (superClass)
_setPrototypeOf(subClass, superClass); }
function _setPrototypeOf(o, p) { _setPrototypeOf = Object.setPrototypeOf || function _setPrototypeOf(o, p) { o.__proto__ = p; return o; }; return _setPrototypeOf(o, p); } const react_1 = $fsx.r(3); var defaultButtonStyles = function defaultButtonStyles(disabled) {
return {
border: 0,
background: 'rgba(0,0,0,0.4)',
color: 'white',
padding: 10,
opacity: disabled ? 0.3 : 1,
cursor: disabled ? 'not-allowed' : 'pointer'
};
}; exports.PreviousButton = function (_React$Component) {
_inherits(PreviousButton, _React$Component);
function PreviousButton() {
var _this;
_classCallCheck(this, PreviousButton);
_this = _possibleConstructorReturn(this, _getPrototypeOf(PreviousButton).apply(this, arguments));
_this.handleClick = _this.handleClick.bind(_assertThisInitialized(_this));
return _this;
}
_createClass(PreviousButton, [{
key: "handleClick",
value: function handleClick(event) {
event.preventDefault();
this.props.previousSlide();
}
}, {
key: "render",
value: function render() {
var disabled = this.props.currentSlide === 0 && !this.props.wrapAround || this.props.slideCount === 0;
return react_1.default.createElement("button", {
style: defaultButtonStyles(disabled),
disabled: disabled,
onClick: this.handleClick,
"aria-label": "previous",
type: "button"
}, "PREV");
}
}]);
return PreviousButton;
}(react_1.default.Component); exports.NextButton = function (_React$Component2) {
_inherits(NextButton, _React$Component2);
function NextButton() {
var _this2;
_classCallCheck(this, NextButton);
_this2 = _possibleConstructorReturn(this, _getPrototypeOf(NextButton).apply(this, arguments));
_this2.handleClick = _this2.handleClick.bind(_assertThisInitialized(_this2));
_this2.nextButtonDisable = _this2.nextButtonDisabled.bind(_assertThisInitialized(_this2));
return _this2;
}
_createClass(NextButton, [{
key: "handleClick",
value: function handleClick(event) {
event.preventDefault();
this.props.nextSlide();
}
}, {
key: "nextButtonDisabled",
value: function nextButtonDisabled(params) {
var wrapAround = params.wrapAround, slidesToShow = params.slidesToShow, currentSlide = params.currentSlide, cellAlign = params.cellAlign, slideCount = params.slideCount;
var buttonDisabled = false;
if (!wrapAround) {
var lastSlideIndex = slideCount - 1;
var slidesShowing = slidesToShow;
var lastSlideOffset = 0;
switch (cellAlign) {
case 'center':
slidesShowing = (slidesToShow - 1) * 0.5;
lastSlideOffset = Math.floor(slidesToShow * 0.5) - 1;
break;
case 'right':
slidesShowing = 1;
break;
}
if (slidesToShow > 1) {
buttonDisabled = currentSlide + slidesShowing > lastSlideIndex + lastSlideOffset;
}
else {
buttonDisabled = currentSlide + 1 > lastSlideIndex;
}
}
return buttonDisabled;
}
}, {
key: "render",
value: function render() {
var _this$props = this.props, wrapAround = _this$props.wrapAround, slidesToShow = _this$props.slidesToShow, currentSlide = _this$props.currentSlide, cellAlign = _this$props.cellAlign, slideCount = _this$props.slideCount;
var disabled = this.nextButtonDisabled({
wrapAround: wrapAround,
slidesToShow: slidesToShow,
currentSlide: currentSlide,
cellAlign: cellAlign,
slideCount: slideCount
});
return react_1.default.createElement("button", {
style: defaultButtonStyles(disabled),
disabled: disabled,
onClick: this.handleClick,
"aria-label": "next",
type: "button"
}, "NEXT");
}
}]);
return NextButton;
}(react_1.default.Component); exports.PagingDots = function (_React$Component3) {
_inherits(PagingDots, _React$Component3);
function PagingDots() {
_classCallCheck(this, PagingDots);
return _possibleConstructorReturn(this, _getPrototypeOf(PagingDots).apply(this, arguments));
}
_createClass(PagingDots, [{
key: "getDotIndexes",
value: function getDotIndexes(slideCount, slidesToScroll, slidesToShow, cellAlign) {
var dotIndexes = [];
var lastDotIndex = slideCount - slidesToShow;
switch (cellAlign) {
case 'center':
case 'right':
lastDotIndex += slidesToShow - 1;
break;
}
if (lastDotIndex < 0) {
return [0];
}
for (var i = 0; i < lastDotIndex; i += slidesToScroll) {
dotIndexes.push(i);
}
dotIndexes.push(lastDotIndex);
return dotIndexes;
}
}, {
key: "getListStyles",
value: function getListStyles() {
return {
position: 'relative',
margin: 0,
top: -10,
padding: 0
};
}
}, {
key: "getListItemStyles",
value: function getListItemStyles() {
return {
listStyleType: 'none',
display: 'inline-block'
};
}
}, {
key: "getButtonStyles",
value: function getButtonStyles(active) {
return {
cursor: 'pointer',
opacity: active ? 1 : 0.5,
background: 'transparent',
border: 'none'
};
}
}, {
key: "render",
value: function render() {
var _this3 = this;
var indexes = this.getDotIndexes(this.props.slideCount, this.props.slidesToScroll, this.props.slidesToShow, this.props.cellAlign);
return react_1.default.createElement("ul", {
style: this.getListStyles()
}, indexes.map(function (index) {
return react_1.default.createElement("li", {
style: _this3.getListItemStyles(),
key: index,
className: _this3.props.currentSlide === index ? 'paging-item active' : 'paging-item'
}, react_1.default.createElement("button", {
type: "button",
style: _this3.getButtonStyles(_this3.props.currentSlide === index),
onClick: _this3.props.goToSlide.bind(null, index),
"aria-label": "slide ".concat(index + 1, " bullet")
}, react_1.default.createElement("span", {
className: "paging-dot",
style: {
display: 'inline-block',
borderRadius: '50%',
width: '6px',
height: '6px',
background: 'black'
}
})));
}));
}
}]);
return PagingDots;
}(react_1.default.Component);
} // nuka-carousel/es/all-transitions.js $fsx.f[163] = (module, exports) => { "use strict"; Object.defineProperty(exports, "__esModule", { value: true }); const scroll_transition_1 = $fsx.r(160); const fade_transition_1 = $fsx.r(161); const _3d_scroll_transition_1 = $fsx.r(162); exports.default = {
fade: fade_transition_1.default, scroll: scroll_transition_1.default, scroll3d: _3d_scroll_transition_1.default
};
} // nuka-carousel/es/transitions/scroll-transition.js $fsx.f[160] = (module, exports) => { "use strict"; Object.defineProperty(exports, "__esModule", { value: true }); function _typeof(obj) { if (typeof Symbol === "function" && typeof Symbol.iterator === "symbol") {
_typeof = function _typeof(obj) { return typeof obj; };
} else {
_typeof = function _typeof(obj) { return obj && typeof Symbol === "function" && obj.constructor === Symbol && obj !== Symbol.prototype ? "symbol" : typeof obj; };
} return _typeof(obj); } function _classCallCheck(instance, Constructor) { if (!(instance instanceof Constructor)) {
throw new TypeError("Cannot call a class as a function");
} } function _defineProperties(target, props) { for (var i = 0; i < props.length; i++) {
var descriptor = props[i];
descriptor.enumerable = descriptor.enumerable || false;
descriptor.configurable = true;
if ("value" in descriptor)
descriptor.writable = true;
Object.defineProperty(target, descriptor.key, descriptor);
} } function _createClass(Constructor, protoProps, staticProps) { if (protoProps)
_defineProperties(Constructor.prototype, protoProps); if (staticProps) _defineProperties(Constructor, staticProps); return Constructor; }
function _possibleConstructorReturn(self, call) { if (call && (_typeof(call) === "object" || typeof call === "function")) {
return call;
} return _assertThisInitialized(self); } function _getPrototypeOf(o) { _getPrototypeOf = Object.setPrototypeOf ? Object.getPrototypeOf : function _getPrototypeOf(o) { return o.__proto__ || Object.getPrototypeOf(o); }; return _getPrototypeOf(o); } function _assertThisInitialized(self) { if (self === void 0) {
throw new ReferenceError("this hasn't been initialised - super() hasn't been called");
} return self; } function _inherits(subClass, superClass) { if (typeof superClass !== "function" && superClass !== null) {
throw new TypeError("Super expression must either be null or a function");
} subClass.prototype = Object.create(superClass && superClass.prototype, { constructor: { value: subClass, writable: true, configurable: true } }); if (superClass)
_setPrototypeOf(subClass, superClass); }
function _setPrototypeOf(o, p) { _setPrototypeOf = Object.setPrototypeOf || function _setPrototypeOf(o, p) { o.__proto__ = p; return o; }; return _setPrototypeOf(o, p); } const react_1 = $fsx.r(3); const prop_types_1 = $fsx.r(13); var MIN_ZOOM_SCALE = 0; var MAX_ZOOM_SCALE = 1; var ScrollTransition = function (_React$Component) {
_inherits(ScrollTransition, _React$Component);
function ScrollTransition(props) {
var _this;
_classCallCheck(this, ScrollTransition);
_this = _possibleConstructorReturn(this, _getPrototypeOf(ScrollTransition).call(this, props));
_this.getListStyles = _this.getListStyles.bind(_assertThisInitialized(_this));
return _this;
}
_createClass(ScrollTransition, [{
key: "getSlideDirection",
value: function getSlideDirection(start, end, isWrapping) {
var direction = 0;
if (start === end)
return direction;
if (isWrapping) {
direction = start < end ? -1 : 1;
}
else {
direction = start < end ? 1 : -1;
}
return direction;
}
}, {
key: "getSlideTargetPosition",
value: function getSlideTargetPosition(index, positionValue) {
var targetPosition = (this.props.slideWidth + this.props.cellSpacing) * index;
var startSlide = Math.min(Math.abs(Math.floor(positionValue / this.props.slideWidth)), this.props.slideCount - 1);
var offset = 0;
if (this.props.animation === 'zoom' && (this.props.currentSlide === index + 1 || this.props.currentSlide === 0 && index === this.props.children.length - 1)) {
offset = this.props.slideOffset;
}
else if (this.props.animation === 'zoom' && (this.props.currentSlide === index - 1 || this.props.currentSlide === this.props.children.length - 1 && index === 0)) {
offset = -this.props.slideOffset;
}
if (this.props.wrapAround && index !== startSlide) {
var direction = this.getSlideDirection(startSlide, this.props.currentSlide, this.props.isWrappingAround);
var slidesBefore = Math.floor((this.props.slideCount - 1) / 2);
var slidesAfter = this.props.slideCount - slidesBefore - 1;
if (direction < 0) {
var temp = slidesBefore;
slidesBefore = slidesAfter;
slidesAfter = temp;
}
var distanceFromStart = Math.abs(startSlide - index);
if (index < startSlide) {
if (distanceFromStart > slidesBefore) {
targetPosition = (this.props.slideWidth + this.props.cellSpacing) * (this.props.slideCount + index);
}
}
else if (distanceFromStart > slidesAfter) {
targetPosition = (this.props.slideWidth + this.props.cellSpacing) * (this.props.slideCount - index) * -1;
}
}
return targetPosition + offset;
}
}, {
key: "formatChildren",
value: function formatChildren(children) {
var _this2 = this;
var _this$props = this.props, top = _this$props.top, left = _this$props.left, currentSlide = _this$props.currentSlide, slidesToShow = _this$props.slidesToShow;
var positionValue = this.props.vertical ? top : left;
return react_1.default.Children.map(children, function (child, index) {
var visible = index >= currentSlide && index < currentSlide + slidesToShow;
return react_1.default.createElement("li", {
className: "slider-slide".concat(visible ? ' slide-visible' : ),
style: _this2.getSlideStyles(index, positionValue),
key: index
}, child);
});
}
}, {
key: "getSlideStyles",
value: function getSlideStyles(index, positionValue) {
var targetPosition = this.getSlideTargetPosition(index, positionValue);
var transformScale = this.props.animation === 'zoom' && this.props.currentSlide !== index ? Math.max(Math.min(this.props.zoomScale, MAX_ZOOM_SCALE), MIN_ZOOM_SCALE) : 1.0;
return {
boxSizing: 'border-box',
display: this.props.vertical ? 'block' : 'inline-block',
height: 'auto',
left: this.props.vertical ? 0 : targetPosition,
listStyleType: 'none',
marginBottom: this.props.vertical ? this.props.cellSpacing / 2 : 'auto',
marginLeft: this.props.vertical ? 'auto' : this.props.cellSpacing / 2,
marginRight: this.props.vertical ? 'auto' : this.props.cellSpacing / 2,
marginTop: this.props.vertical ? this.props.cellSpacing / 2 : 'auto',
MozBoxSizing: 'border-box',
position: 'absolute',
top: this.props.vertical ? targetPosition : 0,
transform: "scale(".concat(transformScale, ")"),
transition: 'transform .4s linear',
verticalAlign: 'top',
width: this.props.vertical ? '100%' : this.props.slideWidth
};
}
}, {
key: "getListStyles",
value: function getListStyles(styles) {
var deltaX = styles.deltaX, deltaY = styles.deltaY;
var listWidth = this.props.slideWidth * react_1.default.Children.count(this.props.children);
var spacingOffset = this.props.cellSpacing * react_1.default.Children.count(this.props.children);
var transform = "translate3d(".concat(deltaX, "px, ").concat(deltaY, "px, 0)");
return {
transform: transform,
WebkitTransform: transform,
msTransform: "translate(".concat(deltaX, "px, ").concat(deltaY, "px)"),
position: 'relative',
display: 'block',
margin: this.props.vertical ? "".concat(this.props.cellSpacing / 2 * -1, "px 0px") : "0px ".concat(this.props.cellSpacing / 2 * -1, "px"),
padding: 0,
height: this.props.vertical ? listWidth + spacingOffset : this.props.slideHeight,
width: this.props.vertical ? 'auto' : listWidth + spacingOffset,
cursor: this.props.dragging === true ? 'pointer' : 'inherit',
boxSizing: 'border-box',
MozBoxSizing: 'border-box',
touchAction: "pinch-zoom ".concat(this.props.vertical ? 'pan-x' : 'pan-y')
};
}
}, {
key: "render",
value: function render() {
var children = this.formatChildren(this.props.children);
var deltaX = this.props.deltaX;
var deltaY = this.props.deltaY;
return react_1.default.createElement("ul", {
className: "slider-list",
style: this.getListStyles({
deltaX: deltaX,
deltaY: deltaY
})
}, children);
}
}]);
return ScrollTransition;
}(react_1.default.Component); exports.default = ScrollTransition; ScrollTransition.propTypes = {
animation: prop_types_1.default.oneOf(['zoom']), cellSpacing: prop_types_1.default.number, currentSlide: prop_types_1.default.number, deltaX: prop_types_1.default.number, deltaY: prop_types_1.default.number, dragging: prop_types_1.default.bool, isWrappingAround: prop_types_1.default.bool, left: prop_types_1.default.number, slideCount: prop_types_1.default.number, slideHeight: prop_types_1.default.number, slideOffset: prop_types_1.default.number, slideWidth: prop_types_1.default.number, top: prop_types_1.default.number, vertical: prop_types_1.default.bool, wrapAround: prop_types_1.default.bool, zoomScale: prop_types_1.default.number
}; ScrollTransition.defaultProps = {
cellSpacing: 0, currentSlide: 0, deltaX: 0, deltaY: 0, dragging: false, isWrappingAround: false, left: 0, slideCount: 0, slideHeight: 0, slideWidth: 0, top: 0, vertical: false, wrapAround: false, zoomScale: 0.85
};
} // nuka-carousel/es/transitions/fade-transition.js $fsx.f[161] = (module, exports) => { "use strict"; Object.defineProperty(exports, "__esModule", { value: true }); function _typeof(obj) { if (typeof Symbol === "function" && typeof Symbol.iterator === "symbol") {
_typeof = function _typeof(obj) { return typeof obj; };
} else {
_typeof = function _typeof(obj) { return obj && typeof Symbol === "function" && obj.constructor === Symbol && obj !== Symbol.prototype ? "symbol" : typeof obj; };
} return _typeof(obj); } function _classCallCheck(instance, Constructor) { if (!(instance instanceof Constructor)) {
throw new TypeError("Cannot call a class as a function");
} } function _defineProperties(target, props) { for (var i = 0; i < props.length; i++) {
var descriptor = props[i];
descriptor.enumerable = descriptor.enumerable || false;
descriptor.configurable = true;
if ("value" in descriptor)
descriptor.writable = true;
Object.defineProperty(target, descriptor.key, descriptor);
} } function _createClass(Constructor, protoProps, staticProps) { if (protoProps)
_defineProperties(Constructor.prototype, protoProps); if (staticProps) _defineProperties(Constructor, staticProps); return Constructor; }
function _possibleConstructorReturn(self, call) { if (call && (_typeof(call) === "object" || typeof call === "function")) {
return call;
} return _assertThisInitialized(self); } function _assertThisInitialized(self) { if (self === void 0) {
throw new ReferenceError("this hasn't been initialised - super() hasn't been called");
} return self; } function _getPrototypeOf(o) { _getPrototypeOf = Object.setPrototypeOf ? Object.getPrototypeOf : function _getPrototypeOf(o) { return o.__proto__ || Object.getPrototypeOf(o); }; return _getPrototypeOf(o); } function _inherits(subClass, superClass) { if (typeof superClass !== "function" && superClass !== null) {
throw new TypeError("Super expression must either be null or a function");
} subClass.prototype = Object.create(superClass && superClass.prototype, { constructor: { value: subClass, writable: true, configurable: true } }); if (superClass)
_setPrototypeOf(subClass, superClass); }
function _setPrototypeOf(o, p) { _setPrototypeOf = Object.setPrototypeOf || function _setPrototypeOf(o, p) { o.__proto__ = p; return o; }; return _setPrototypeOf(o, p); } const react_1 = $fsx.r(3); const prop_types_1 = $fsx.r(13); var FadeTransition = function (_React$Component) {
_inherits(FadeTransition, _React$Component);
function FadeTransition(props) {
var _this;
_classCallCheck(this, FadeTransition);
_this = _possibleConstructorReturn(this, _getPrototypeOf(FadeTransition).call(this, props));
_this.fadeFromSlide = props.currentSlide;
return _this;
}
_createClass(FadeTransition, [{
key: "formatChildren",
value: function formatChildren(children, opacity) {
var _this2 = this;
var _this$props = this.props, currentSlide = _this$props.currentSlide, slidesToShow = _this$props.slidesToShow;
return react_1.default.Children.map(children, function (child, index) {
var visible = index >= currentSlide && index < currentSlide + slidesToShow;
return react_1.default.createElement("li", {
className: "slider-slide".concat(visible ? ' slide-visible' : ),
style: _this2.getSlideStyles(index, opacity),
key: index
}, child);
});
}
}, {
key: "getSlideOpacityAndLeftMap",
value: function getSlideOpacityAndLeftMap(fadeFrom, fadeTo, fade) {
var fadeToPosition = fadeTo;
if (fadeFrom > fade && fadeFrom === 0) {
fadeToPosition = fadeFrom - this.props.slidesToShow;
}
else if (fadeFrom < fade && fadeFrom + this.props.slidesToShow > this.props.slideCount - 1) {
fadeToPosition = fadeFrom + this.props.slidesToShow;
}
var opacity = {};
if (fadeFrom === fadeTo) {
opacity[fadeFrom] = 1;
}
else {
var distance = fadeFrom - fadeToPosition;
opacity[fadeFrom] = (fade - fadeToPosition) / distance;
opacity[fadeTo] = (fadeFrom - fade) / distance;
}
var map = {};
for (var i = 0; i < this.props.slidesToShow; i++) {
map[fadeFrom + i] = {
opacity: opacity[fadeFrom],
left: this.props.slideWidth * i
};
map[fadeTo + i] = {
opacity: opacity[fadeTo],
left: this.props.slideWidth * i
};
}
return map;
}
}, {
key: "getSlideStyles",
value: function getSlideStyles(index, data) {
return {
boxSizing: 'border-box',
display: 'block',
height: 'auto',
left: data[index] ? data[index].left : 0,
listStyleType: 'none',
marginBottom: 'auto',
marginLeft: this.props.cellSpacing / 2,
marginRight: this.props.cellSpacing / 2,
marginTop: 'auto',
MozBoxSizing: 'border-box',
opacity: data[index] ? data[index].opacity : 0,
position: 'absolute',
top: 0,
verticalAlign: 'top',
visibility: data[index] ? 'inherit' : 'hidden',
width: this.props.slideWidth
};
}
}, {
key: "getContainerStyles",
value: function getContainerStyles() {
var width = this.props.slideWidth * this.props.slidesToShow;
return {
boxSizing: 'border-box',
cursor: this.props.dragging === true ? 'pointer' : 'inherit',
display: 'block',
height: this.props.slideHeight,
margin: this.props.vertical ? "".concat(this.props.cellSpacing / 2 * -1, "px 0px") : "0px ".concat(this.props.cellSpacing / 2 * -1, "px"),
MozBoxSizing: 'border-box',
padding: 0,
touchAction: 'none',
width: width
};
}
}, {
key: "render",
value: function render() {
var fade = -(this.props.deltaX || this.props.deltaY) / this.props.slideWidth;
if (parseInt(fade) === fade) {
this.fadeFromSlide = fade;
}
var opacityAndLeftMap = this.getSlideOpacityAndLeftMap(this.fadeFromSlide, this.props.currentSlide, fade);
var children = this.formatChildren(this.props.children, opacityAndLeftMap);
return react_1.default.createElement("ul", {
className: "slider-list",
style: this.getContainerStyles()
}, children);
}
}]);
return FadeTransition;
}(react_1.default.Component); exports.default = FadeTransition; FadeTransition.propTypes = {
cellSpacing: prop_types_1.default.number, currentSlide: prop_types_1.default.number, deltaX: prop_types_1.default.number, deltaY: prop_types_1.default.number, dragging: prop_types_1.default.bool, isWrappingAround: prop_types_1.default.bool, left: prop_types_1.default.number, slideCount: prop_types_1.default.number, slideHeight: prop_types_1.default.number, slidesToShow: prop_types_1.default.number, slideWidth: prop_types_1.default.number, top: prop_types_1.default.number, vertical: prop_types_1.default.bool, wrapAround: prop_types_1.default.bool
}; FadeTransition.defaultProps = {
cellSpacing: 0, currentSlide: 0, deltaX: 0, deltaY: 0, dragging: false, isWrappingAround: false, left: 0, slideCount: 0, slideHeight: 0, slidesToShow: 1, slideWidth: 0, top: 0, vertical: false, wrapAround: false
};
} // nuka-carousel/es/transitions/3d-scroll-transition.js $fsx.f[162] = (module, exports) => { "use strict"; Object.defineProperty(exports, "__esModule", { value: true }); function _typeof(obj) { if (typeof Symbol === "function" && typeof Symbol.iterator === "symbol") {
_typeof = function _typeof(obj) { return typeof obj; };
} else {
_typeof = function _typeof(obj) { return obj && typeof Symbol === "function" && obj.constructor === Symbol && obj !== Symbol.prototype ? "symbol" : typeof obj; };
} return _typeof(obj); } function _classCallCheck(instance, Constructor) { if (!(instance instanceof Constructor)) {
throw new TypeError("Cannot call a class as a function");
} } function _defineProperties(target, props) { for (var i = 0; i < props.length; i++) {
var descriptor = props[i];
descriptor.enumerable = descriptor.enumerable || false;
descriptor.configurable = true;
if ("value" in descriptor)
descriptor.writable = true;
Object.defineProperty(target, descriptor.key, descriptor);
} } function _createClass(Constructor, protoProps, staticProps) { if (protoProps)
_defineProperties(Constructor.prototype, protoProps); if (staticProps) _defineProperties(Constructor, staticProps); return Constructor; }
function _possibleConstructorReturn(self, call) { if (call && (_typeof(call) === "object" || typeof call === "function")) {
return call;
} return _assertThisInitialized(self); } function _getPrototypeOf(o) { _getPrototypeOf = Object.setPrototypeOf ? Object.getPrototypeOf : function _getPrototypeOf(o) { return o.__proto__ || Object.getPrototypeOf(o); }; return _getPrototypeOf(o); } function _assertThisInitialized(self) { if (self === void 0) {
throw new ReferenceError("this hasn't been initialised - super() hasn't been called");
} return self; } function _inherits(subClass, superClass) { if (typeof superClass !== "function" && superClass !== null) {
throw new TypeError("Super expression must either be null or a function");
} subClass.prototype = Object.create(superClass && superClass.prototype, { constructor: { value: subClass, writable: true, configurable: true } }); if (superClass)
_setPrototypeOf(subClass, superClass); }
function _setPrototypeOf(o, p) { _setPrototypeOf = Object.setPrototypeOf || function _setPrototypeOf(o, p) { o.__proto__ = p; return o; }; return _setPrototypeOf(o, p); } const react_1 = $fsx.r(3); const prop_types_1 = $fsx.r(13); var MIN_ZOOM_SCALE = 0; var MAX_ZOOM_SCALE = 1; var ScrollTransition3D = function (_React$Component) {
_inherits(ScrollTransition3D, _React$Component);
function ScrollTransition3D(props) {
var _this;
_classCallCheck(this, ScrollTransition3D);
_this = _possibleConstructorReturn(this, _getPrototypeOf(ScrollTransition3D).call(this, props));
_this.getListStyles = _this.getListStyles.bind(_assertThisInitialized(_this));
return _this;
}
_createClass(ScrollTransition3D, [{
key: "getSlideDirection",
value: function getSlideDirection(start, end, isWrapping) {
var direction = 0;
if (start === end)
return direction;
if (isWrapping) {
direction = start < end ? -1 : 1;
}
else {
direction = start < end ? 1 : -1;
}
return direction;
}
}, {
key: "getSlideTargetPosition",
value: function getSlideTargetPosition(index) {
var targetPosition = 0;
var offset = 0;
if (index !== this.props.currentSlide) {
var relativeDistanceToCurrentSlide = this.getRelativeDistanceToCurrentSlide(index);
targetPosition = (this.props.slideWidth + this.props.cellSpacing) * relativeDistanceToCurrentSlide - this.getZoomOffsetFor(relativeDistanceToCurrentSlide);
offset = 0;
if (this.props.animation === 'zoom' && (this.props.currentSlide === index + 1 || this.props.currentSlide === 0 && index === this.props.children.length - 1)) {
offset = this.props.slideOffset;
}
else if (this.props.animation === 'zoom' && (this.props.currentSlide === index - 1 || this.props.currentSlide === this.props.children.length - 1 && index === 0)) {
offset = -this.props.slideOffset;
}
}
return targetPosition + offset;
}
}, {
key: "formatChildren",
value: function formatChildren(children) {
var _this2 = this;
var _this$props = this.props, top = _this$props.top, left = _this$props.left, currentSlide = _this$props.currentSlide, slidesToShow = _this$props.slidesToShow;
var positionValue = this.props.vertical ? top : left;
return react_1.default.Children.map(children, function (child, index) {
var visible = _this2.getDistanceToCurrentSlide(index) <= slidesToShow / 2;
var current = currentSlide === index;
return react_1.default.createElement("li", {
className: "slider-slide".concat(visible ? ' slide-visible' : ).concat(current ? ' slide-current' : ),
style: _this2.getSlideStyles(index, positionValue),
key: index
}, child);
});
}
}, {
key: "getZoomOffsetFor",
value: function getZoomOffsetFor(relativeDistanceToCurrent) {
if (relativeDistanceToCurrent === 0) {
return 0;
}
var marginGeneratedByZoom = (1 - Math.pow(this.props.zoomScale, Math.abs(relativeDistanceToCurrent))) * this.props.slideWidth;
var direction = relativeDistanceToCurrent < 0 ? -1 : 1;
var result = marginGeneratedByZoom * direction + this.getZoomOffsetFor(relativeDistanceToCurrent < 0 ? relativeDistanceToCurrent + 1 : relativeDistanceToCurrent - 1);
return result;
}
}, {
key: "getDistance",
value: function getDistance(index, referenceIndex) {
return Math.abs(index - referenceIndex);
}
}, {
key: "getDistanceToCurrentSlide",
value: function getDistanceToCurrentSlide(index) {
return this.props.wrapAround ? Math.min(Math.min(this.getDistance(index, 0) + this.getDistance(this.props.currentSlide, this.props.slideCount), this.getDistance(index, this.props.slideCount) + this.getDistance(this.props.currentSlide, 0)), this.getDistance(index, this.props.currentSlide)) : this.getDistance(index, this.props.currentSlide);
}
}, {
key: "getRelativeDistanceToCurrentSlide",
value: function getRelativeDistanceToCurrentSlide(index) {
if (this.props.wrapAround) {
var distanceByLeftEge = this.getDistance(index, 0) + this.getDistance(this.props.currentSlide, this.props.slideCount);
var distanceByRightEdge = this.getDistance(index, this.props.slideCount) + this.getDistance(this.props.currentSlide, 0);
var absoluteDirectDistance = this.getDistance(index, this.props.currentSlide);
var minimumDistance = Math.min(Math.min(distanceByLeftEge, distanceByRightEdge), absoluteDirectDistance);
switch (minimumDistance) {
case absoluteDirectDistance:
return index - this.props.currentSlide;
case distanceByLeftEge:
return distanceByLeftEge;
case distanceByRightEdge:
return -distanceByRightEdge;
default:
return 0;
}
}
else {
return index - this.props.currentSlide;
}
}
}, {
key: "getTransformScale",
value: function getTransformScale(index) {
return this.props.currentSlide !== index ? Math.max(Math.min(Math.pow(this.props.zoomScale, this.getDistanceToCurrentSlide(index)), MAX_ZOOM_SCALE), MIN_ZOOM_SCALE) : 1.0;
}
}, {
key: "getOpacityScale",
value: function getOpacityScale(index) {
return this.props.currentSlide !== index ? Math.max(Math.min(Math.pow(this.props.opacityScale, this.getDistanceToCurrentSlide(index)), MAX_ZOOM_SCALE), MIN_ZOOM_SCALE) : 1.0;
}
}, {
key: "getSlideStyles",
value: function getSlideStyles(index, positionValue) {
var targetPosition = this.getSlideTargetPosition(index, positionValue);
var transformScale = this.getTransformScale(index);
return {
zIndex: this.props.slideCount - this.getDistanceToCurrentSlide(index),
boxSizing: 'border-box',
display: this.props.vertical ? 'block' : 'inline-block',
height: 'auto',
left: this.props.vertical ? 0 : targetPosition,
listStyleType: 'none',
marginBottom: this.props.vertical ? this.props.cellSpacing / 2 : 'auto',
marginLeft: this.props.vertical ? 'auto' : this.props.cellSpacing / 2,
marginRight: this.props.vertical ? 'auto' : this.props.cellSpacing / 2,
marginTop: this.props.vertical ? this.props.cellSpacing / 2 : 'auto',
MozBoxSizing: 'border-box',
position: 'absolute',
top: this.props.vertical ? targetPosition : 0,
transform: "scale(".concat(transformScale, ")"),
transition: 'left 0.4s ease-out, transform 0.4s ease-out, opacity 0.4s ease-out',
verticalAlign: 'top',
width: this.props.vertical ? '100%' : this.props.slideWidth,
opacity: this.getOpacityScale(index)
};
}
}, {
key: "getListStyles",
value: function getListStyles() {
var listWidth = this.props.slideWidth * react_1.default.Children.count(this.props.children);
var spacingOffset = this.props.cellSpacing * react_1.default.Children.count(this.props.children);
return {
left: "calc(50% - (".concat(this.props.slideWidth, "px / 2))"),
position: 'relative',
margin: this.props.vertical ? "".concat(this.props.cellSpacing / 2 * -1, "px 0px") : "".concat(this.props.slideListMargin, "px ").concat(this.props.cellSpacing / 2 * -1, "px"),
padding: 0,
height: this.props.vertical ? listWidth + spacingOffset : this.props.slideHeight,
width: this.props.vertical ? 'auto' : '100%',
cursor: this.props.dragging === true ? 'pointer' : 'inherit',
boxSizing: 'border-box',
MozBoxSizing: 'border-box',
touchAction: "pinch-zoom ".concat(this.props.vertical ? 'pan-x' : 'pan-y')
};
}
}, {
key: "render",
value: function render() {
var children = this.formatChildren(this.props.children);
return react_1.default.createElement("ul", {
className: "slider-list",
style: this.getListStyles()
}, children);
}
}]);
return ScrollTransition3D;
}(react_1.default.Component); exports.default = ScrollTransition3D; ScrollTransition3D.propTypes = {
cellSpacing: prop_types_1.default.number, currentSlide: prop_types_1.default.number, dragging: prop_types_1.default.bool, isWrappingAround: prop_types_1.default.bool, left: prop_types_1.default.number, slideCount: prop_types_1.default.number, slideHeight: prop_types_1.default.number, slideOffset: prop_types_1.default.number, slideWidth: prop_types_1.default.number, top: prop_types_1.default.number, vertical: prop_types_1.default.bool, wrapAround: prop_types_1.default.bool, zoomScale: prop_types_1.default.number, opacityScale: prop_types_1.default.number, slidesToShow: prop_types_1.default.number, slideListMargin: prop_types_1.default.number
}; ScrollTransition3D.defaultProps = {
cellSpacing: 0, currentSlide: 0, dragging: false, isWrappingAround: false, left: 0, slideCount: 0, slideHeight: 0, slideWidth: 0, top: 0, vertical: false, wrapAround: true, zoomScale: 0.75, opacityScale: 0.65, slidesToShow: 3, slideListMargin: 10
};
} // nuka-carousel/es/announce-slide.js $fsx.f[164] = (module, exports) => { "use strict"; Object.defineProperty(exports, "__esModule", { value: true }); const react_1 = $fsx.r(3); var AnnounceSlide = function AnnounceSlide(_ref) {
var message = _ref.message;
var styles = {
position: 'absolute',
left: '-10000px',
top: 'auto',
width: '1px',
height: '1px',
overflow: 'hidden'
};
return react_1.default.createElement("div", {
"aria-live": "polite",
"aria-atomic": "true",
style: styles,
tabIndex: -1
}, message);
}; exports.defaultRenderAnnounceSlideMessage = function defaultRenderAnnounceSlideMessage(_ref2) {
var currentSlide = _ref2.currentSlide, slideCount = _ref2.slideCount; return "Slide ".concat(currentSlide + 1, " of ").concat(slideCount);
}; exports.default = AnnounceSlide;
} // nuka-carousel/es/utilities/utilities.js $fsx.f[165] = (module, exports) => { "use strict"; Object.defineProperty(exports, "__esModule", { value: true }); function ownKeys(object, enumerableOnly) { var keys = Object.keys(object); if (Object.getOwnPropertySymbols) {
var symbols = Object.getOwnPropertySymbols(object);
if (enumerableOnly)
symbols = symbols.filter(function (sym) { return Object.getOwnPropertyDescriptor(object, sym).enumerable; });
keys.push.apply(keys, symbols);
} return keys; } function _objectSpread(target) { for (var i = 1; i < arguments.length; i++) {
var source = arguments[i] != null ? arguments[i] : {};
if (i % 2) {
ownKeys(source, true).forEach(function (key) { _defineProperty(target, key, source[key]); });
}
else if (Object.getOwnPropertyDescriptors) {
Object.defineProperties(target, Object.getOwnPropertyDescriptors(source));
}
else {
ownKeys(source).forEach(function (key) { Object.defineProperty(target, key, Object.getOwnPropertyDescriptor(source, key)); });
}
} return target; } function _defineProperty(obj, key, value) { if (key in obj) {
Object.defineProperty(obj, key, { value: value, enumerable: true, configurable: true, writable: true });
} else {
obj[key] = value;
} return obj; } const react_1 = $fsx.r(3); exports.addEvent = function addEvent(elem, type, eventHandle) {
if (elem === null || typeof elem === 'undefined') {
return;
}
if (elem.addEventListener) {
elem.addEventListener(type, eventHandle, false);
}
else if (elem.attachEvent) {
elem.attachEvent("on".concat(type), eventHandle);
}
else {
elem["on".concat(type)] = eventHandle;
}
}; exports.removeEvent = function removeEvent(elem, type, eventHandle) {
if (elem === null || typeof elem === 'undefined') {
return;
}
if (elem.removeEventListener) {
elem.removeEventListener(type, eventHandle, false);
}
else if (elem.detachEvent) {
elem.detachEvent("on".concat(type), eventHandle);
}
else {
elem["on".concat(type)] = null;
}
}; exports.addAccessibility = function addAccessibility(children, slidesToShow, currentSlide) {
var needsTabIndex;
if (slidesToShow > 1) {
return react_1.default.Children.map(children, function (child, index) {
var firstVisibleSlide = index >= currentSlide;
var lastVisibleSlide = index < slidesToShow + currentSlide;
needsTabIndex = firstVisibleSlide && lastVisibleSlide;
var ariaProps = needsTabIndex ? {
'aria-hidden': 'false',
tabIndex: 0
} : {
'aria-hidden': 'true'
};
return react_1.default.cloneElement(child, _objectSpread({}, child.props, {}, ariaProps));
});
}
else {
return react_1.default.Children.map(children, function (child, index) {
needsTabIndex = index !== currentSlide;
var ariaProps = needsTabIndex ? {
'aria-hidden': 'true'
} : {
'aria-hidden': 'false',
tabIndex: 0
};
return react_1.default.cloneElement(child, _objectSpread({}, child.props, {}, ariaProps));
});
}
}; exports.getPropsByTransitionMode = function getPropsByTransitionMode(props, keys) {
var slidesToShow = props.slidesToShow, transitionMode = props.transitionMode;
var updatedDefaults = {};
if (transitionMode === 'fade') {
keys.forEach(function (key) {
switch (key) {
case 'slidesToShow':
updatedDefaults[key] = Math.max(parseInt(slidesToShow), 1);
break;
case 'slidesToScroll':
updatedDefaults[key] = Math.max(parseInt(slidesToShow), 1);
break;
case 'cellAlign':
updatedDefaults[key] = 'left';
break;
default:
updatedDefaults[key] = props[key];
break;
}
});
}
else {
keys.forEach(function (key) {
updatedDefaults[key] = props[key];
});
}
return updatedDefaults;
}; exports.swipeDirection = function swipeDirection(x1, x2, y1, y2, vertical) {
var xDist = x1 - x2;
var yDist = y1 - y2;
var r = Math.atan2(yDist, xDist);
var swipeAngle = Math.round(r * 180 / Math.PI);
if (swipeAngle < 0) {
swipeAngle = 360 - Math.abs(swipeAngle);
}
if (swipeAngle <= 45 && swipeAngle >= 0) {
return 1;
}
if (swipeAngle <= 360 && swipeAngle >= 315) {
return 1;
}
if (swipeAngle >= 135 && swipeAngle <= 225) {
return -1;
}
if (vertical === true) {
if (swipeAngle >= 35 && swipeAngle <= 135) {
return 1;
}
else {
return -1;
}
}
return 0;
}; exports.shouldUpdate = function shouldUpdate(curr, next, keys) {
var update = false;
for (var i = 0; i < keys.length; i++) {
if (curr[keys[i]] !== next[keys[i]]) {
update = true;
break;
}
}
return update;
}; exports.calcSomeInitialState = function calcSomeInitialState(props) {
var _getPropsByTransition = exports.getPropsByTransitionMode(props, ['slidesToScroll', 'slidesToShow', 'cellAlign']), slidesToScroll = _getPropsByTransition.slidesToScroll, slidesToShow = _getPropsByTransition.slidesToShow, cellAlign = _getPropsByTransition.cellAlign;
var slideWidth = props.vertical ? props.initialSlideHeight || 0 : props.initialSlideWidth || 0;
var slideHeight = props.vertical ? (props.initialSlideHeight || 0) * props.slidesToShow : props.initialSlideHeight || 0;
var frameHeight = slideHeight + props.cellSpacing * (slidesToShow - 1);
var frameWidth = props.vertical ? frameHeight : '100%';
return {
slideWidth: slideWidth,
slideHeight: slideHeight,
frameWidth: frameWidth,
slidesToScroll: slidesToScroll,
slidesToShow: slidesToShow,
cellAlign: cellAlign
};
};
} // nuka-carousel/es/utilities/style-utilities.js $fsx.f[166] = (module, exports) => { "use strict"; Object.defineProperty(exports, "__esModule", { value: true }); exports.getImgTagStyles = function getImgTagStyles() {
return ".slider-slide > img { width: 100%; display: block; }\n .slider-slide > img:focus { margin: auto; }";
}; exports.getDecoratorStyles = function getDecoratorStyles(position) {
switch (position) {
case 'TopLeft':
{
return {
position: 'absolute',
top: 0,
left: 0
};
}
case 'TopCenter':
{
return {
position: 'absolute',
top: 0,
left: '50%',
transform: 'translateX(-50%)',
WebkitTransform: 'translateX(-50%)',
msTransform: 'translateX(-50%)'
};
}
case 'TopRight':
{
return {
position: 'absolute',
top: 0,
right: 0
};
}
case 'CenterLeft':
{
return {
position: 'absolute',
top: '50%',
left: 0,
transform: 'translateY(-50%)',
WebkitTransform: 'translateY(-50%)',
msTransform: 'translateY(-50%)'
};
}
case 'CenterCenter':
{
return {
position: 'absolute',
top: '50%',
left: '50%',
transform: 'translate(-50%,-50%)',
WebkitTransform: 'translate(-50%, -50%)',
msTransform: 'translate(-50%, -50%)'
};
}
case 'CenterRight':
{
return {
position: 'absolute',
top: '50%',
right: 0,
transform: 'translateY(-50%)',
WebkitTransform: 'translateY(-50%)',
msTransform: 'translateY(-50%)'
};
}
case 'BottomLeft':
{
return {
position: 'absolute',
bottom: 0,
left: 0
};
}
case 'BottomCenter':
{
return {
position: 'absolute',
bottom: 0,
left: '50%',
transform: 'translateX(-50%)',
WebkitTransform: 'translateX(-50%)',
msTransform: 'translateX(-50%)'
};
}
case 'BottomRight':
{
return {
position: 'absolute',
bottom: 0,
right: 0
};
}
default:
{
return {
position: 'absolute',
top: 0,
left: 0
};
}
}
}; exports.getSliderStyles = function getSliderStyles(propWidth, propHeight) {
return {
boxSizing: 'border-box',
display: 'block',
height: propHeight,
MozBoxSizing: 'border-box',
position: 'relative',
width: propWidth
};
}; exports.getFrameStyles = function getFrameStyles(propFrameOverFlow, propVertical, propFramePadding, stateFrameWidth) {
return {
boxSizing: 'border-box',
display: 'block',
height: propVertical ? stateFrameWidth || 'initial' : '100%',
margin: propFramePadding,
MozBoxSizing: 'border-box',
msTransform: 'translate(0, 0)',
overflow: propFrameOverFlow,
padding: 0,
position: 'relative',
touchAction: "pinch-zoom ".concat(propVertical ? 'pan-x' : 'pan-y'),
transform: 'translate3d(0, 0, 0)',
WebkitTransform: 'translate3d(0, 0, 0)'
};
}; exports.getTransitionProps = function getTransitionProps(props, state) {
return {
animation: props.animation,
cellSpacing: props.cellSpacing,
currentSlide: state.currentSlide,
dragging: props.dragging,
isWrappingAround: state.isWrappingAround,
left: state.left,
slideCount: state.slideCount,
slideHeight: state.slideHeight,
slideOffset: props.slideOffset,
slidesToShow: state.slidesToShow,
slideWidth: state.slideWidth,
top: state.top,
vertical: props.vertical,
wrapAround: props.wrapAround,
zoomScale: props.zoomScale,
opacityScale: props.opacityScale,
slideListMargin: props.slideListMargin
};
};
} // nuka-carousel/es/utilities/bootstrapping-utilities.js $fsx.f[167] = (module, exports) => { "use strict"; Object.defineProperty(exports, "__esModule", { value: true }); const react_1 = $fsx.r(3); exports.addAccessibility = function addAccessibility(children, slidesToShow) {
if (slidesToShow > 1) {
return react_1.default.Children.map(children, function (child) {
return react_1.default.cloneElement(child, child.props);
});
}
else {
return react_1.default.Children.map(children, function (child) {
return react_1.default.cloneElement(child, child.props);
});
}
}; exports.getValidChildren = function getValidChildren(children) {
return react_1.default.Children.toArray(children);
}; var findMaxHeightSlide = function findMaxHeightSlide(slides) {
var maxHeight = 0;
for (var i = 0; i < slides.length; i++) {
if (slides[i].offsetHeight > maxHeight) {
maxHeight = slides[i].offsetHeight;
}
}
return maxHeight;
}; exports.getSlideHeight = function getSlideHeight(props, state) {
var childNodes = arguments.length > 2 && arguments[2] !== undefined ? arguments[2] : [];
var heightMode = props.heightMode, vertical = props.vertical, initialSlideHeight = props.initialSlideHeight;
var slidesToShow = state.slidesToShow, currentSlide = state.currentSlide;
var firstSlide = childNodes[0];
if (firstSlide && heightMode === 'first') {
return vertical ? firstSlide.offsetHeight * slidesToShow : firstSlide.offsetHeight;
}
if (heightMode === 'max') {
return findMaxHeightSlide(childNodes);
}
if (heightMode === 'current') {
return childNodes[currentSlide].offsetHeight;
}
return initialSlideHeight || 100;
};
}